1848 Pages


Course Number: CS 191, Spring 2005

College/University: Berkeley

Word Count: 1463913


Document Preview

%!PS-Adobe-2.0 %%Creator: dvips(k) 5.90a Copyright 2002 Radical Eye Software %%Title: lecture9.dvi %%CreationDate: Tue Feb 15 18:25:27 2005 %%Pages: 7 %%PageOrder: Ascend %%BoundingBox: 0 0 612 792 %%DocumentFonts: CMDUNH10 Times-Roman Times-Italic Symbol CMR10 CMSY10 %%+ CMMI10 CMEX10 Times-Bold %%EndComments %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: dvips.exe -P pdf lecture9.dvi %DVIPSParameters:...

Unformatted Document Excerpt
Coursehero >> California >> Berkeley >> CS 191

Course Hero has millions of student submitted documents similar to the one
below including study guides, practice problems, reference materials, practice exams, textbook help and tutor support.

Course Hero has millions of student submitted documents similar to the one below including study guides, practice problems, reference materials, practice exams, textbook help and tutor support.

%%Creator: %!PS-Adobe-2.0 dvips(k) 5.90a Copyright 2002 Radical Eye Software %%Title: lecture9.dvi %%CreationDate: Tue Feb 15 18:25:27 2005 %%Pages: 7 %%PageOrder: Ascend %%BoundingBox: 0 0 612 792 %%DocumentFonts: CMDUNH10 Times-Roman Times-Italic Symbol CMR10 CMSY10 %%+ CMMI10 CMEX10 Times-Bold %%EndComments %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: dvips.exe -P pdf lecture9.dvi %DVIPSParameters: dpi=8000, compressed %DVIPSSource: TeX output 2005.02.15:1825 %%BeginProcSet: tex.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S /BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: alt-rule.pro %! % Patch by TVZ % Makes dvips files draw rules with stroke rather than fill. % Makes narrow rules more predictable at low resolutions % after distilling to PDF. % May have unknown consequences for very thick rules. % Tested only with dvips 5.85(k). TeXDict begin /QV { gsave newpath /ruleY X /ruleX X Rx Ry gt { ruleX ruleY Ry 2 div sub moveto Rx 0 rlineto Ry } { ruleX Rx 2 div add ruleY moveto 0 Ry neg rlineto Rx } ifelse setlinewidth 0 setlinecap stroke grestore } bind def end %%EndProcSet %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: 8r.enc % File 8r.enc TeX Base 1 Encoding Revision 2.0pre 2002-10-30 % % @@psencodingfile@{ % author = "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry, % W. Schmidt, P. Lehman", % version = "2.0pre", % date = "30 October 2002", % filename = "8r.enc", % email = "tex-fonts@@tug.org", % docstring = "This is the encoding vector for Type1 and TrueType % fonts to be used with TeX. This file is part of the % PSNFSS bundle, version 9" % @} % % The idea is to have all the characters normally included in Type 1 fonts % available for typesetting. This is effectively the characters in Adobe % Standard encoding, ISO Latin 1, Windows ANSI including the euro symbol, % MacRoman, and some extra characters from Lucida. % % Character code assignments were made as follows: % % (1) the Windows ANSI characters are almost all in their Windows ANSI % positions, because some Windows users cannot easily reencode the % fonts, and it makes no difference on other systems. The only Windows % ANSI characters not available are those that make no sense for % typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen % (173). quotesingle and grave are moved just because it's such an % irritation not having them in TeX positions. % % (2) Remaining characters are assigned arbitrarily to the lower part % of the range, avoiding 0, 10 and 13 in case we meet dumb software. % % (3) Y&Y Lucida Bright includes some extra text characters; in the % hopes that other PostScript fonts, perhaps created for public % consumption, will include them, they are included starting at 0x12. % These are /dotlessj /ff /ffi /ffl. % % (4) hyphen appears twice for compatibility with both ASCII and Windows. % % (5) /Euro was assigned to 128, as in Windows ANSI % % (6) Missing characters from MacRoman encoding incorporated as follows: % % PostScript MacRoman TeXBase1 % -------------- -------------- -------------% /notequal 173 0x16 % /infinity 176 0x17 % /lessequal 178 0x18 % /greaterequal 179 0x19 % /partialdiff 182 0x1A % /summation 183 0x1B % /product 184 0x1C % /pi 185 0x1D % /integral 186 0x81 % /Omega 189 0x8D % /radical 195 0x8E % /approxequal 197 0x8F % /Delta 198 0x9D % /lozenge 215 0x9E % /TeXBase1Encoding [ % 0x00 /.notdef /dotaccent /fi /fl /fraction /hungarumlaut /Lslash /lslash /ogonek /ring /.notdef /breve /minus /.notdef /Zcaron /zcaron % 0x10 /caron /dotlessi /dotlessj /ff /ffi /ffl /notequal /infinity /lessequal /greaterequal /partialdiff /summation /product /pi /grave /quotesingle % 0x20 /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /hyphen /period /slash % 0x30 /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question % 0x40 /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O % 0x50 /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore % 0x60 /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o % 0x70 /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef % 0x80 /Euro /integral /quotesinglbase /florin /quotedblbase /ellipsis /dagger /daggerdbl /circumflex /perthousand /Scaron /guilsinglleft /OE /Omega /radical /approxequal % 0x90 /.notdef /.notdef /.notdef /quotedblleft /quotedblright /bullet /endash /emdash /tilde /trademark /scaron /guilsinglright /oe /Delta /lozenge /Ydieresis % 0xA0 /.notdef /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron % 0xD0 /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown % 0xC0 /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis % 0xD0 /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls % 0xE0 /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis % 0xF0 /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def %%EndProcSet %%BeginProcSet: texps.pro %! TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def} ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{ dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def} if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def} def end %%EndProcSet %%BeginProcSet: special.pro %! TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N /vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N /rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N /@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ /hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B /@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ /urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known {userdict/md get type/dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale }if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState save N userdict maxlength dict begin/magscale true def normalscale currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts /psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict begin/SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N /@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X /yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet %%BeginProcSet: color.pro %! TeXDict begin/setcmykcolor where{pop}{/setcmykcolor{dup 10 eq{pop setrgbcolor}{1 sub 4 1 roll 3{3 index add neg dup 0 lt{pop 0}if 3 1 roll }repeat setrgbcolor pop}ifelse}B}ifelse/TeXcolorcmyk{setcmykcolor}def /TeXcolorrgb{setrgbcolor}def/TeXcolorgrey{setgray}def/TeXcolorgray{ setgray}def/TeXcolorhsb{sethsbcolor}def/currentcmykcolor where{pop}{ /currentcmykcolor{currentrgbcolor 10}B}ifelse/DC{exch dup userdict exch known{pop pop}{X}ifelse}B/GreenYellow{0.15 0 0.69 0 setcmykcolor}DC /Yellow{0 0 1 0 setcmykcolor}DC/Goldenrod{0 0.10 0.84 0 setcmykcolor}DC /Dandelion{0 0.29 0.84 0 setcmykcolor}DC/Apricot{0 0.32 0.52 0 setcmykcolor}DC/Peach{0 0.50 0.70 0 setcmykcolor}DC/Melon{0 0.46 0.50 0 setcmykcolor}DC/YellowOrange{0 0.42 1 0 setcmykcolor}DC/Orange{0 0.61 0.87 0 setcmykcolor}DC/BurntOrange{0 0.51 1 0 setcmykcolor}DC /Bittersweet{0 0.75 1 0.24 setcmykcolor}DC/RedOrange{0 0.77 0.87 0 setcmykcolor}DC/Mahogany{0 0.85 0.87 0.35 setcmykcolor}DC/Maroon{0 0.87 0.68 0.32 setcmykcolor}DC/BrickRed{0 0.89 0.94 0.28 setcmykcolor}DC/Red{ 0 1 1 0 setcmykcolor}DC/OrangeRed{0 1 0.50 0 setcmykcolor}DC/RubineRed{ 0 1 0.13 0 setcmykcolor}DC/WildStrawberry{0 0.96 0.39 0 setcmykcolor}DC /Salmon{0 0.53 0.38 0 setcmykcolor}DC/CarnationPink{0 0.63 0 0 setcmykcolor}DC/Magenta{0 1 0 0 setcmykcolor}DC/VioletRed{0 0.81 0 0 setcmykcolor}DC/Rhodamine{0 0.82 0 0 setcmykcolor}DC/Mulberry{0.34 0.90 0 0.02 setcmykcolor}DC/RedViolet{0.07 0.90 0 0.34 setcmykcolor}DC /Fuchsia{0.47 0.91 0 0.08 setcmykcolor}DC/Lavender{0 0.48 0 0 setcmykcolor}DC/Thistle{0.12 0.59 0 0 setcmykcolor}DC/Orchid{0.32 0.64 0 0 setcmykcolor}DC/DarkOrchid{0.40 0.80 0.20 0 setcmykcolor}DC/Purple{ 0.45 0.86 0 0 setcmykcolor}DC/Plum{0.50 1 0 0 setcmykcolor}DC/Violet{ 0.79 0.88 0 0 setcmykcolor}DC/RoyalPurple{0.75 0.90 0 0 setcmykcolor}DC /BlueViolet{0.86 0.91 0 0.04 setcmykcolor}DC/Periwinkle{0.57 0.55 0 0 setcmykcolor}DC/CadetBlue{0.62 0.57 0.23 0 setcmykcolor}DC /CornflowerBlue{0.65 0.13 0 0 setcmykcolor}DC/MidnightBlue{0.98 0.13 0 0.43 setcmykcolor}DC/NavyBlue{0.94 0.54 0 0 setcmykcolor}DC/RoyalBlue{1 0.50 0 0 setcmykcolor}DC/Blue{1 1 0 0 setcmykcolor}DC/Cerulean{0.94 0.11 0 0 setcmykcolor}DC/Cyan{1 0 0 0 setcmykcolor}DC/ProcessBlue{0.96 0 0 0 setcmykcolor}DC/SkyBlue{0.62 0 0.12 0 setcmykcolor}DC/Turquoise{0.85 0 0.20 0 setcmykcolor}DC/TealBlue{0.86 0 0.34 0.02 setcmykcolor}DC /Aquamarine{0.82 0 0.30 0 setcmykcolor}DC/BlueGreen{0.85 0 0.33 0 setcmykcolor}DC/Emerald{1 0 0.50 0 setcmykcolor}DC/JungleGreen{0.99 0 0.52 0 setcmykcolor}DC/SeaGreen{0.69 0 0.50 0 setcmykcolor}DC/Green{1 0 1 0 setcmykcolor}DC/ForestGreen{0.91 0 0.88 0.12 setcmykcolor}DC /PineGreen{0.92 0 0.59 0.25 setcmykcolor}DC/LimeGreen{0.50 0 1 0 setcmykcolor}DC/YellowGreen{0.44 0 0.74 0 setcmykcolor}DC/SpringGreen{ 0.26 0 0.76 0 setcmykcolor}DC/OliveGreen{0.64 0 0.95 0.40 setcmykcolor} DC/RawSienna{0 0.72 1 0.45 setcmykcolor}DC/Sepia{0 0.83 1 0.70 setcmykcolor}DC/Brown{0 0.81 1 0.60 setcmykcolor}DC/Tan{0.14 0.42 0.56 0 setcmykcolor}DC/Gray{0 0 0 0.50 setcmykcolor}DC/Black{0 0 0 1 setcmykcolor}DC/White{0 0 0 0 setcmykcolor}DC end %%EndProcSet TeXDict begin @defspecial /DvipsToPDF { 72.27 mul Resolution div } def /PDFToDvips { 72.27 div Resolution mul } def /HyperBorder { 1 PDFToDvips } def /H.V {pdf@hoff pdf@voff null} def /H.B {/Rect[pdf@llx pdf@lly pdf@urx pdf@ury]} def /H.S { currentpoint HyperBorder add /pdf@lly exch def dup DvipsToPDF /pdf@hoff exch def HyperBorder sub /pdf@llx exch def } def /H.L { 2 sub dup /HyperBasePt exch def PDFToDvips /HyperBaseDvips exch def currentpoint HyperBaseDvips sub /pdf@ury exch def /pdf@urx exch def } def /H.A { H.L currentpoint exch pop vsize 72 sub exch DvipsToPDF HyperBasePt sub sub /pdf@voff exch def } def /H.R { currentpoint HyperBorder sub /pdf@ury exch def HyperBorder add /pdf@urx exch def currentpoint exch pop vsize 72 sub exch DvipsToPDF sub /pdf@voff exch def } def systemdict /pdfmark known not {userdict /pdfmark systemdict /cleartomark get put} if @fedspecial end %%BeginFont: CMEX10 %!PS-AdobeFont-1.1: CMEX10 1.00 %%CreationDate: 1992 Jul 23 21:22:48 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.00) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMEX10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMEX10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 179 /parenleftBig put dup 180 /parenrightBig put dup 181 /parenleftbigg put dup 182 /parenrightbigg put dup 90 /integraldisplay put readonly def /FontBBox{-24 -2960 1454 772}readonly def /UniqueID 5000774 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF5B8CAC6A7BEB5D02276E511FFAF2AE11910 DE076F24311D94D07CACC323F360887F1EA11BDDA7927FF3325986FDB0ABDFC8 8E4B40E7988921D551EC0867EBCA44C05657F0DC913E7B3004A5F3E1337B6987 FEBC45F989C8DC6DC0AD577E903F05D0D54208A0AE7F28C734F130C133B48422 BED48639A2B74E4C08F2E710E24A99F347E0F4394CE64EACB549576E89044E52 EABE595BC964156D9D8C2BAB0F49664E951D7C1A3D1789C47F03C7051A63D5E8 DF04FAAC47351E82CAE0794AA9692C6452688A74A7A6A7AD09B8A9783C235EC1 EA2156261B8FB331827145DE315B6EC1B3D8B67B3323F761EAF4C223BB214C4C 6B062D1B281F5041D068319F4911058376D8EFBA59884BA3318C5BC95684F281 E0591BC0D1B2A4592A137FF301610019B8AC46AE6E48BC091E888E4487688350 E9AD5074EE4848271CE4ACC38D8CBC8F3DB32813DDD5B341AF9A6601281ABA38 4A978B98483A63FCC458D0E3BCE6FD830E7E09B0DB987A6B63B74638FC9F21A5 8C68479E1A85225670D79CDDE5AC0B77F5A994CA700B5F0FF1F97FC63EFDE023 8135F04A9D20C31998B12AE06676C362141AAAA395CDEF0A49E0141D335965F2 FB4198499799CECCC8AA5D255264784CD30A3E8295888EFBC2060ADDD7BAC45A EEEECDFF7A47A88E69D84C9E572616C1AC69A34B5F0D0DE8EE4EDF9F4ADE0387 680924D8D5B73EF04EAD7F45977CA8AD73D4DD45DE1966A3B8251C0386164C35 5880DD2609C80E96D1AB861C9259748E98F6711D4E241A269ED51FF328344664 3AF9F18DCE671611DB2F5D3EA77EE734D2BED623F973E6840B8DAD1E2C3C2666 DD4DD1C1CC71EF3BE29E7C9EC47F20088C52CAEC511F41B45F7509B28A1BA4CD 2A3B2616129034A81ECF7462F70D79292B195840B4023AB698DAEB85F7E5618C 1514AF8A510B42ACCE638FEF3A87966957AFFCC618B26FD51463433D11184EF5 E42B4C523D5EEE0C79A26D6F6738BE296F883DEC85C9CEC9E7DD3F6A4CF5F235 A503F9E12CAA0DBD52A67F5E2DE661988E66D6B076AB9F30653FBF4C515F2706 436D3E88B3A08381E0FC0B91B5FE8CB787F73D781069E3B1369EA76EC5D67F22 1B78B0D561B94144C06724C75D0DB16AB4446F03933394E9584987B4DB05DFC7 4432E63C5AD65B6AD4F90B7616B30FA7E5F795B3BA2400BF534F01BC70ABDD88 396805CC9F423C65676500430FEF8A0D97726801C1197615A8DFFAC4E966A523 CBED729546D91E375592B9178AC25455306BE57193D675CD92E53A652DE92F6C A2BA9C10C15FBE979C16646C30D1F54F1547493CCC47AF804747CBBCA552A0DB 8693AEB005095469BA8739FE7A7DAD5EA9B8CECA900CBE45FB75DCDAB87D7363 9EE74A873D8AF5E6E414EA87C847AF72D76D9B52D8C669BD9B2AC5AF6229AF66 33BDA62D168245A22E2AA8F348039D28206ACEF7D046640A83CE5FDAC903BBBA FA57F2ECA6A2C4780F76A27C40945DEC839E87A9E7FBB71D1BD05127F50125AA E93F647C8A28CE1CA224210309EBF55417DDB75B98D17A878D576CB49AEC58B4 6593725C780142BB3138FD48F402DD1AF208F7110125C9A42598E04BBFAB235E 2A3F89C4568C7E004A5CBC6D79FEB1E7A4841FE147620227C2467FDD655A5177 83C99B4FD2A08E50D048D62977F8D3BBF0EF3806813CEF34F05F52BF56CD55CB 208493B73BE8C3934FBC3EF35D34A39DC736BFF42078B4BDF477A03F9057C6DC 31381E639CF064EC5F2D9309CFEB2A87AF7083FE26798F241D170881F31649BC 528C3B83B433A31F26372FF0713EEF6DC1D9FCB72C77674E6081F820F4703470 B136D5096C507F045F98DE32833EE6A479E806B513F917F93DFD7D9D66314A0C 856F301A78AADB4E66F6DF24D6CDC38E37897F876598323A24BDF08B0EA34EED A5ADF5EC6F73FFD07F09D8217CFBBD43D033E77F461AC922ACF191F1516CF96A 31C24FA2891D3C62F5FD9025E80126B700E4D5AFD9A4856CD5DCA5479C333ECC 4BB97F2B77DCE448DEBE8244D015CB6E6972439C8C039D06505E5DB1F4FE42EC 53BDE7967BAB5315EA0C3F3C5766510B87870EB13B94B5FBC12BE5E24F6B2ED7 FAF9B56F4CF6AF92F398CA551A12D6F60501F2B1DE31FE450EB9C4670BFCE47B D4586C0A8F1DD81C54CDA0148246E6596434E9A055A1758DAED737539FA3AC08 9BB9BF0B60B2CE6B6D406ADB3CE1DDFB1CDC70EED3AF64ADF9E0D9666A0D4EAF 52F928751DC6A0416AA11E344E8C7D51B0FB176E6BDE628517C8014280D5CA26 45BE9F4E1568EE29C63B9E3C5FDD37E97916AD0751 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMSY10 %!PS-AdobeFont-1.1: CMSY10 1.0 %%CreationDate: 1991 Aug 15 07:20:57 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMSY10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.035 def /isFixedPitch false def end readonly def /FontName /CMSY10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 161 /minus put dup 162 /periodcentered put dup 163 /multiply put dup 164 /asteriskmath put dup 188 /approxequal put dup 191 /lessmuch put dup 34 /arrowup put dup 35 /arrowdown put dup 41 /arrowdblright put dup 48 /prime put dup 102 /braceleft put dup 103 /braceright put dup 106 /bar put dup 112 /radical put readonly def /FontBBox{-29 -960 1116 775}readonly def /UniqueID 5000820 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A 221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A 27D1663E0B62F461F6E40A5D6676D1D12B51E641C1D4E8E2771864FC104F8CBF 5B78EC1D88228725F1C453A678F58A7E1B7BD7CA700717D288EB8DA1F57C4F09 0ABF1D42C5DDD0C384C7E22F8F8047BE1D4C1CC8E33368FB1AC82B4E96146730 DE3302B2E6B819CB6AE455B1AF3187FFE8071AA57EF8A6616B9CB7941D44EC7A 71A7BB3DF755178D7D2E4BB69859EFA4BBC30BD6BB1531133FD4D9438FF99F09 4ECC068A324D75B5F696B8688EEB2F17E5ED34CCD6D047A4E3806D000C199D7C 515DB70A8D4F6146FE068DC1E5DE8BC57034F30B748EA02516C927663E107D2F D32CCA94568EB69302E2F74AA6593C8429D46F4DBC544134390BB87A58263EA1 0964FE588E1CD9E1596234BF0B69BD326EBCE2F93E19207F5ECB65C86E0131E3 D9DC9078FA5E267B004C8999067F54B67D07FDDBD1CBD824276311868CD490C5 FA019FB9AE0584A2C6A8B6BECFA3837047261E9565918367C68B0F71FB08625D FB1F45182B19DDFBCD6B33AAF2B45F517C2C70680FA90A6AEE5CFA2106ECA99F B82D6FA78009B7B8BE7FFA1FF4E6A5E7F7B7DC21FF5D85F59EEFC09117F90365 D5C8660E99FFEFCF8ACC27D0174CF9CD192D1FED0B797CCE5D01B8873C16B42C BFBDBD29EE61C513A269A4E8061D8836C338DB1F0853DCD8B1F0923D3AA54793 F513A70B73DE4537E9A1E1B57AD0B189F40E0512DD089BF7271057D37939D61A 1491A38504AC58674A314C72E38812275812EEC03F11E9137E5F82A2A852DE80 433FEADCCD36DFECCA3D62FE526DABFF3E7B8AA1D311F8A5B397285ED14C58AD 21B9B22D55839115A576D79C6B905B8322B4D195A8B57D94097BABF8D9433C79 B36CD0D910723C89C271976FD735C71FF84713D7A9A0B0FC10104C3DC3AC2BC1 78C2F2B03805E2A67B8B1D0830F51905F4BECBDE7ADB363AAAF19C0B33FFB847 1BE4D29F1BF973D8F846B7068A423D9EAD29B968A53CF5260B77D6B63767EB5C 3886C91C56FFDC1CFD30CEF82B868E7F976DDD82495F7860DBE7CB6F34D2C043 5A7738F46DF5A10A5DF5996EAAA1761B3865F2732D9B5C023BA3DE66DC4612F8 19A484464B6AE2B47F60FCFF42D271C1D0F574550A32A10BABBFBA8981958DE9 9F535DEA5384C0E9C2C5366FBD14727DD9D3459596628FCF2FE5F7BDEEB61C33 13D08CDD7AC04F97B332F55247A6A6B8F8340AD932FC6416E1E833442FB8E0C6 14EFE4FEA36056C82575C28DE5B73C9BD13BA7B295CDF62794636557D36034F7 F829952C914CA176B2E5B2ABB1B3EB30A85DB15F88BDE4113D3256648E0AB4B5 08FC8271CD17CB74E10755537D5A482FE5695E195F2E7D01A738EF710BE2CE94 090730048C47F93D62130948DCFCE54D39EFBCB61EFCB588279791B130F53910 B6BDDA0B5DB09B3FC1B77F56FC687A7EAEAEF3C50EDED060186D7FC2982A5687 48328E910560ABB09F1E665BB298E662C985CFD3F1C68D9B7CFB2E94D897A23F C68B12658DCFA5BF9EA4BB2C34488D32F003DC26B92D6195FBFA031D0ABBE847 439C683D37FA3F41A249F537FF98253E0BD6854CE00A0AED8B14D4F52B434C5B 3638C58BCFB705B463350F9787D37DD1EEAEF029113620CEAD5710062BC99326 DC8B53DC4054A9725B4F48E58F1AF52D316E4E61841D3696673F8651CE233499 BCFAFEAC521A75E9DD03F90E19BB8842070EB03E15EE0B448006F3EA6BB3F450 C7D8A1933552BF0333C238CE5F88119B74DAA4F5504E6DE1CCB5F9352A893244 1432888901A6FD83F07C03A171F0C30F96C86D27CE113C583CA2317E9C5DA341 ED197E8E067CB79D47BAC68C8C0BEA35EFB83EFA738E03C86DFB12942E2E25A5 A43B02B103F23F34254FE6B2844F3B2DBB1BCC3D56AFF1A6763F2EC8ED42D9CD 813D85D411979CA9EC722F1A84E03D05DC963CE4A219613D6FA17B4C5EA36C33 8E567CD9968D0AFC66D4061E2A84BD505FBE882D0EBC69D7CD22F8200CE230A3 6A6ECB8FEA15D0A226940325036A49FDDF26F8B660036745557DCF98F98CFB6F 0B5C0C412D52F0C547DF9ECB6943863C8767D808B3EB84009D0DC9E302445B5A B4F9BF7C52E36D32ACD68D34ABD2913D6AF39037914CF7D21E19E5BEA03EBA81 E2E102186BC1E3E1B0A0ACCAFE3C1D50D60F8685812EB96CA1CA7E4294D0BB41 324F3D10AE69362A4BD0C44232E70EA1CE01A53C099FC76B65B9098858570D45 9D4CD52581759F83DAF79365042C3DBA5F6E8C36ACC559A59D93243477157359 12B45C94076B23B147B49B6F560981FF75A3A787077C63CE289879FC1A2E5D46 0FE3724CE9CF4ADE6D16B28BEC12A19346D4A6138129F64868D0110E979C7F4B 9F3E17AAE66908351DD18E1969818402FD6E8E01DE621001A21D7943AC6AA7AC B7556CFBDF343784BAE62FEE58AA7FEE0013E172881148344557E2B4C09E3531 C0A92165096985BBDE89CED89032CC23A573FC9CBB07989E4040D897DDFDBBE0 99D7A22B9093864499F9E0BF74AB5938B88EDF438FECAF9B3BF55B2E00938F85 0AF0923DD7CC043A4F6EBF22D00CB4846E0BD41F2B1935037B3C225EEB7656F9 F8B0B4BA612F65423155867D1B57627539F9836290C95E15ECF7AD288735F053 ED23C89E3BCBE33EBA176217D710BD9AD7896893554E4A893F1EEE25309B5099 BEAD165A9B46AE8BB0A3275576A3C942D61EBAB2CBD330259015923173FB7AA3 41F6F12C4BBD0B138201AAF6014B18A05F1AAD08B3F210BB2B62F21ADC83405F 96C3E02B6BB0FC63994D5AFD6A7C5DA47E7F3F9CCBCD02DC95B936D3A2E769B2 374C30FDC2B1FFADAEC336F37EF5E4FE4758154399528BF8635CB36CF7B35995 CC9B704288C9698FD23FAD1E6A9E3A1D414BDA072D38A5CB5D8406F1C67BF076 09E97B3F4FF7CA3A0D8422DE4EED79F60E6D0F86B6EE9F874AA43DE900C4A773 371A72AED4C4F13641942C3BEC18780578B532AA3FD6DD26A0EC8B66D3FF159A D7AD01357991C7FEFB4E01DC363BAFD955B4930BAC7B9E187D3E392631EA3BAB D0370F579DF57744E0305B5641E53AF63E6BB74BD42B34C8804C483868A7CB25 3A928630D3DB484B060B4C1E17E88BE50CFDE9106FC20E129233C47789C7FF68 F474A8CB2E70C24E8CF3F3058B1A4969C5B2AE66D050B501C1720B50158C091F B974BAC67952EAC37F9ED6E164259BB4F1325E0D6ADE9FF3D200D47FCB838714 2E771F9A710065F1E04EF41D943EB758724E87D971B6C8AAE5D13D2EE6E48D65 694E85C47A5DBB89B0E1E7C1021855C7667B4856F457FBC055A2533624BCEDE0 AF9AD1D49EA5D81EC9A5F4B108F58C2FDF5C3E1871D4E390BA5E8AFDC3E925D9 A67BAA673AC210BA6614EAEA87 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMR10 %!PS-AdobeFont-1.1: CMR10 1.00B %%CreationDate: 1992 Feb 19 19:54:52 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.00B) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMR10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMR10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 40 /parenleft put dup 41 /parenright put dup 43 /plus put dup 61 /equal put dup 91 /bracketleft put dup 93 /bracketright put readonly def /FontBBox{-251 -250 1009 969}readonly def /UniqueID 5000793 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4 87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0 92A36FAC8D27F9087AFEEA2096F839A2BC4B937F24E080EF7C0F9374A18D565C 295A05210DB96A23175AC59A9BD0147A310EF49C551A417E0A22703F94FF7B75 409A5D417DA6730A69E310FA6A4229FC7E4F620B0FC4C63C50E99E179EB51E4C 4BC45217722F1E8E40F1E1428E792EAFE05C5A50D38C52114DFCD24D54027CBF 2512DD116F0463DE4052A7AD53B641A27E81E481947884CE35661B49153FA19E 0A2A860C7B61558671303DE6AE06A80E4E450E17067676E6BBB42A9A24ACBC3E B0CA7B7A3BFEA84FED39CCFB6D545BB2BCC49E5E16976407AB9D94556CD4F008 24EF579B6800B6DC3AAF840B3FC6822872368E3B4274DD06CA36AF8F6346C11B 43C772CC242F3B212C4BD7018D71A1A74C9A94ED0093A5FB6557F4E0751047AF D72098ECA301B8AE68110F983796E581F106144951DF5B750432A230FDA3B575 5A38B5E7972AABC12306A01A99FCF8189D71B8DBF49550BAEA9CF1B97CBFC7CC 96498ECC938B1A1710B670657DE923A659DB8757147B140A48067328E7E3F9C3 7D1888B284904301450CE0BC15EEEA00E48CCD6388F3FC3C8578EF9A20A0E06E 4F7ADDAF0E7D1E182D115BF1AD931977325AD391E72E2B13CC108E3726C11099 E2000623188AAAC9F3E233EB253BDD8B0A4759A66A113E066238B0086AC1B634 5ABFF90E4B5ED3FA69C22541981B2BFC9710AEF6B50A8BB53431C7B4D380D721 639E005D6B4688EE16BFF48443E7C9E5FB5BC5883E271CB03428966C96B6988B 2C9127404E8C64B122D405610B1207E61D6CB678BF414E64299C22D6B8DA233B 8E0E897EEAF81E43E962BD1DE1D8F24C8350761B0E688E433D01BCC9ADD5857E BE9564F01D501D5F99C4272CA490100395D23DEC1BE59A6DE8D20B90C61434C9 062B6856C5C61184BD58F20E01B447F6140CB149BD370D59069F121FCA8AC937 4A86AF9E00E141BE1F2B0DEF30A4AC17817E4B58B1A8921B990F237E64A938AD 284A1DAB4F3BF58231B22F57219F9BF0E38585D631CF24EB1DDCBB1EA6E3DB31 88D7C3F8D9EAF27F7239557A2D2EA7AC5AED0DC02CDB0A2C9E4D64C24C3616F3 AA98D473C46596DC975C149FD66CE806C4529D92B0173BBCDA0D18B2956E0F51 179D7861557A915D2AA59CE21800265DAF737E83C7B4E9C41F80195E51A95158 F9CEAFA5ABDEBCDF332BC7107FEA70FDE84269ACCD15BB35D961846217D54B02 88995D6A3304BF88EEA7ACB9C548195606C4E601789F3562E89A69C40BEA9167 D3F49BF39DB2D57630674554F297DA605A079220182EA752B31072D46E091410 D021BFC8B8A1E4D6E2AC110AE143BE32F407F6AAD2FEE259839BF6AEE1B7FAC4 7597F8E3347EFB48F3DDE6E9198354D1D408AD5657D41F5D11FE6B805FBFA2E2 F92F6332DDAD4AE77D30758E37B67866D6CEA29B6027812977B8D68A570904DF 47550EA6773ED0DFE830F8B80BBECAA80EC33DC5ACDD4E683E5B688F5D1F14FA A5778EE610C3FCF3429021E2A014F8B0B97BEAFFA7F3868E61B35678D54173BC 93A7BF29949C2814BB364594DA9ABAA2F2AEC654B0FB8C022B5775582D8CBA0D D1AD19333BD74415F40C24E839E48B674B003359EAB05AC8A0ABD358DA7E999D 1AFE8359E410DE798A76FBF289C701E5DC730913F6FC2FD9693C34013B47C8CF 84670F3925D2FB69CA3C2C61029C9FD1066AD2C1D640A556E226D7056118CBBB CB4C859D64B04B08751F3EFBDEF6F1F352DCBD682F73C89910D7A937D07ED50E 5DCA560DBAD3A96F708B639F62730A566E7D4D3C6C89BF3868707B721ED3ECD8 F185314C9D5B4E8456BC0B096F99F1A9AD67E40E0EBF19B06BFE1DE82BA32980 AA 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMMI10 %!PS-AdobeFont-1.1: CMMI10 1.100 %%CreationDate: 1996 Jul 23 07:53:57 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.100) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMMI10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.04 def /isFixedPitch false def end readonly def /FontName /CMMI10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 58 /period put dup 59 /comma put dup 60 /less put dup 61 /slash put dup 62 /greater put dup 126 /vector put readonly def /FontBBox{-32 -250 1048 750}readonly def /UniqueID 5087385 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 9E394A533A081C36D456A09920001A3D2199583EB9B84B4DEE08E3D12939E321 990CD249827D9648574955F61BAAA11263A91B6C3D47A5190165B0C25ABF6D3E 6EC187E4B05182126BB0D0323D943170B795255260F9FD25F2248D04F45DFBFB DEF7FF8B19BFEF637B210018AE02572B389B3F76282BEB29CC301905D388C721 59616893E774413F48DE0B408BC66DCE3FE17CB9F84D205839D58014D6A88823 D9320AE93AF96D97A02C4D5A2BB2B8C7925C4578003959C46E3CE1A2F0EAC4BF 8B9B325E46435BDE60BC54D72BC8ACB5C0A34413AC87045DC7B84646A324B808 6FD8E34217213E131C3B1510415CE45420688ED9C1D27890EC68BD7C1235FAF9 1DAB3A369DD2FC3BE5CF9655C7B7EDA7361D7E05E5831B6B8E2EEC542A7B38EE 03BE4BAC6079D038ACB3C7C916279764547C2D51976BABA94BA9866D79F13909 95AA39B0F03103A07CBDF441B8C5669F729020AF284B7FF52A29C6255FCAACF1 74109050FBA2602E72593FBCBFC26E726EE4AEF97B7632BC4F5F353B5C67FED2 3EA752A4A57B8F7FEFF1D7341D895F0A3A0BE1D8E3391970457A967EFF84F6D8 47750B1145B8CC5BD96EE7AA99DDC9E06939E383BDA41175233D58AD263EBF19 AFC0E2F840512D321166547B306C592B8A01E1FA2564B9A26DAC14256414E4C8 42616728D918C74D13C349F4186EC7B9708B86467425A6FDB3A396562F7EE4D8 40B43621744CF8A23A6E532649B66C2A0002DD04F8F39618E4F572819DD34837 B5A08E643FDCA1505AF6A1FA3DDFD1FA758013CAED8ACDDBBB334D664DFF5B53 95601766730045C2D9F29DC2BFEBDE5E7720CC7D82522859B92B2395E3305B29 73FD4E10D7424AD26B4CB3A3B63772EAC0C1D2105D9D905BDDAEAE6D1608B712 3FBE98033DCC0388B4F7C41BB62EDBB86AF2632E2DE8F7647A13F5687010ED09 4F623DB722C478C95C2876F9D36DC318015CCE51CC458196221F79BC766EC955 80E17D642DFD23D7FAC69C5536361311640EDCF70A695C64534231AA573D9DD6 D4DE612F998BA3BC526A9C8CE3B506277D99DFA253E49EBD8E8D1CAC7D29294D 73A5DBB684E0DB043188F7F4C4D7F651A9E8ABBA7CAC3F9DB366553416ED1F67 5480281C2356B3C16E14CEE1FAF70A10E28B2729372BAED967E5A5548621E00E C11A217F16D8D662FA8743FFEDED1177926DB303E939809999ED4071A8072A92 AC242B2BCA812DB939859148D52C7298F13D658FDFED1A219001450958CBAC84 DF255AA7C4C4520E518A0F742B9D4F5E60B9A17450D910FDDD3E619734FDBF86 90F1ECB58FFE06E9A9DC509ED5EB1592B621FAA0169AE91E2B8AA96783F10823 A77A12C1A41D79E367A81F2E84FCAE5C655E4FA04BE41F6B396E56BEA0FB69EE 26AE7AACE7ADAD7ED5EB4B9FDBFF84AAB444D09DFE2854E985C13642EA31A879 5EFDB4EFD8DEAC4B6D04881FBB7CD09CDDE7A9A78507ED5ECE741AE82AF43633 F8CA76079DD855F1CE7DE875DD367A06CC953CE09A9C486E4EE4F258BF38FED5 254998C5B886F77143A77B4F630D2064D85AF9C7103A4449A7AC944FBCF26C6D 3DE26D44027DF7D29BCC7D19AABC7904CBBA64A30061CCAB862207BD6D9063EF 9F51D36B5DBEA823F43F8D9F8DF31E59AB773E3F33D57E601C116F973374A5A1 B8AF87B50A33993E1A6E44FEAD627A434BC109DFB53874CCDCF04AAB18702398 3E60923C029E074B19B3316A7E7998B970A0835BFBCF1FDCADA35B10610582F1 6EBCCF07F34AAFB7C080A0537231BEA135DD942BA85D8C3AFD14B08FBC0ED3CA 5EC98929F2BB3B385F2A4A4A09264F7D929800CDD781BCBB3AF926F74C19357E 3C03A5BFFF3C3DA195E8EF6B54B7C5D98124E2D2203DC28DB79468318E 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMDUNH10 %!PS-AdobeFont-1.1: CMDUNH10 1.0 %%CreationDate: 1991 Aug 20 16:37:03 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMDUNH10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMDUNH10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 44 /comma put dup 46 /period put dup 47 /slash put dup 48 /zero put dup 49 /one put dup 50 /two put dup 51 /three put dup 53 /five put dup 57 /nine put dup 63 /question put dup 66 /B put dup 67 /C put dup 73 /I put dup 76 /L put dup 77 /M put dup 80 /P put dup 83 /S put dup 84 /T put dup 87 /W put dup 97 /a put dup 98 /b put dup 99 /c put dup 100 /d put dup 101 /e put dup 103 /g put dup 104 /h put dup 105 /i put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 113 /q put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 118 /v put dup 120 /x put dup 121 /y put readonly def /FontBBox{-40 -528 1010 1028}readonly def /UniqueID 5000773 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF7158F116CF3C2F1543E1ADB2B5504C72B6F CB64B7809598B089DF6B3960820D3C76485A0D5042470E1E73D1F6268B379894 F9302F310676063DD37D9037692AEFE7B657E22CF832F609EC6360A10E560D0F 5F74D30CE7C4DC620033D42F770F2F1871598FDD4271BDFA86BB72D0FE7E73F7 17E17AF5B9C98A3AF990A20389B7B550A29DD2A351550409A3C57080C582F563 32393FDFDB2F2BD41AA24FB33FDF2F9FEE937D3EC689F962DC4C1B472E6E245A A2F45F1FAAC5C8CD6C38BC5B2D523C9F58034F88076E3B5D136A6739AC0BD3ED 1A5D005825608FD08EB7E6BF89BB0E87CFE8A76668B54B0B1F34F6D4D12C693F 934A1668E36F026AE70A2D00EB973B0C36950A9B6F8A48B86C68AF52EE4FB2A6 302E647E793AD076EDFB119FEAE10DA4EE4704178B180AB4D38E530EC1368814 645E5E5578C4A47AEC55678D4DE1D7B65AA2F320FCCAC0857DB0455A7C2E1BF8 0492899E04EE91559E6835DEF4582AFB5EE9C62AD3CC4887D575B5E721C53907 8116ADBB5AF44B1A425581D051E01528E12720E2F6FBC8110B951250BFBE60B9 08E083123DB9FC00B5F04BDE1B1448B0386AC292122B6393FA858B8BB952B927 F6AE75FAF6478CEF3234AE02F5771D4CF5B47157045AFB822E7A983AC1011B52 8E84B20AA06DAA97CF8BF553CFD220B301D9E1A8C798B4C5B12C3AD58ED3CF07 D37C22933ADDC71EE1321641E79D09971E4E5224588B4418D83B796A23B92722 7E51E877F11C4BC76E4187217BC38D75C1C905B837E703278B20204402954579 5A4EC08092F4657051573F6332290E522C15C317932F7208571A56F47ECB6DFE AFF137C9A67377F09EE551129B45EC5CC9F6E57416A08A8BB50436FC068386C0 7DCB1D4E78585B8FBB0786054F841509A8B47F7B7F9A1A1DBD25D4E4C2163219 521FBAAE5ED8DA91542CE7AF2490DD78DFECA9EC9FDAC9347FFDC8857C1385AD 36C5F7CD8A40C02C1D115CCAF8F2FAA28BD30ACD2340DB4A015B78AC5281DB89 B1EEB4065F95C960185BFDA585AB0FDB818038F5F3FE7D1B2393058EDCE18DE5 DF060E91B16AB96A60DB22F7CB5B69FD5D709596A4146E6459DD1DAC403301D2 E66124017E421285599F96F003CAFC58D90037334347F078106D21D05A6D9221 846819014B18633A0AD879D313D1CEC4C19AF500657BD2999F04C3F09E289CCE 7D3473D36D08D7D60372F81EC252EF9C294B07333413C8456B65E114A52F3AD4 C323DAAB066284BFA6DB1BED4D7A1B8498B0DF87B4F434E1AC21E40BDF1EBD8E B07A3AB450936E749BF1034621B5A43E3B7A7330BE9E766F03A1095A62BC11BC EFED259A4042D75C6FBEBFE431732CF3234C8DEF0D90C02386298C7584DEE1B8 4D04D768EA24823883F326F54C27786EF8B13E476FF964E0F9BBFCEEC100C9C2 9E2153FC58B05FE11D33CD86BE992B9563EB8DA9EA0709213162511B19A3EE74 4DB087D6A7947422087249943C14ECC28F17581050B58C59DD361B8C4FBE6267 BEED88C4DA9898FF2A66C7D93046ECF64BA9652C55F1AA75E32FAD0033D0C141 B11E3C3AB32BB24945079DFD270D1A7072202979896FE7D42B9A3124F21B83F9 0D21AED8436303CFDAE130907B0399924B13D1FB7BD086442EAD0476D9250900 B05151DA84488CBDC82A2344A9EDD09137B8F428A9D0DB4B2CAD4078E4B6FC13 104DEED281323F5694BEF06D0F5674A611DB27E5988805A1EE18D1D0900F01E7 FC839946060704DC9E326210A80C1EB28C89B885914F6172A70CF7E386E5F977 A23E55E6F6DA3716CAF8D78C1378EBFA4336DB1ECD8A007581BDA115E2E4C04C AAA47D49099118EF0FABB43F2F246437DA2CF6580F6462982EA60F64DD6C5AEA C094C397A82E58436D40B8DA1425E513360CC45EA3BED75DF68CC8284D7D64D1 CB3E2C935D056327DF4CDE74711C0A00C72DAB9EC9E19941ACA1761BF1D4D9FB BE4C6A1006EB377787F8FCED8B73240FD8335B8E3CDEA487BDFA269060B715E0 F2E42F86D53B2FCD888EF993D595DA54F052D07BA88661E9E702B876FABB209D E58DFC4CA1FCF548BB7E4A8971180C75CA718A4F4B5E1DEBB035BF8BB728D1D7 069A2A3985E2D0C2946F3766BC5564D550625A61766FD2A7E8313CA748A2E352 29E64C067961BE0DA7AAA988DEA09161FE8156F2B47C91F9FC55759FD87B4C5E DD4A9A2BC4F25C6024046C61FACA490C5CB0D90B0A1CB64471D375CA81AD1CE5 F7C3B650889E9A3D5D782ED30D144FB99DA06CF32E31E18366AA9462BB937992 7FA55BB80AD462FB4F12ED9D8623F9185824B9B94D1EE7512F5C95356CA4B599 C490D315801F18D608B212C52AE6E0CEDB63D1E6A8FE5257C3FFE2D29D0F68BF 77666A24655D1A929D18FB67CCBB9B6EE256DAEA48A768E578E37ED8E663F942 6BCCC23A4C025DF0B2A2F7395BF2E84F7C10864E224D808FCDBB21B9D5F463BC B23DE4B10B6FD8C3D8B2D2A2971AE02C3B0806B0F1974BD035EF7552E1C1D28D 4F49767025786B70E5ABED20C615EC6C9A2090CA4A7D1E5BECF35E2C778BF71F 33C150BFD1884358DCDFEC823925C5231174287E621F84D01BA7FF13120B0046 5A4FAB3DE6D43467F084D892A1ABF34E875906A781ED7E843DCB8945FE04EC24 5FE56402CBF188E87C1EB173FBC74C9C4840560E241081675F8E8701F1E1251A 6662C4C557164CAC4E51938E60AA0B14EC9EE052429F8E8569874B5B98DDBB25 C123A733DC05D19E20F23529121E35698E0836A4D41172071A7118D25FF0B280 959D2A22CC86566D9C91451E54462BEDE88AAD1A990D18985C2FA2CB5F2489A7 D541DEA07BE93A830FD77BE39D6FA659994FAAD2AAA4599AC3C2F06397D4E952 70C666FB0DFF340F199F3A4E109BBD2C3D10E2D90F81F5FD3CE1C5CCB150A266 C178B04F461F3FB83624F79A6E7DBA07AC45CE92352993185F37E1D97E78BE8B 9037EB1E2435F10257D7C9AA51C8BD92EFA18468384D3A8616A30DC9BC2521D6 E286FF11E3AF713B656D04E56D2D476102CB8BCCD7CD87438B2110AE95CBCFF3 BD9D3D562286056C0ED55208E3659123160AC1FF9B04929E30C22BA7E4091CFF 2EABB1B1CE1C4712A3B0CB6FA13E7543E8FC0DCD7BBF48EB9C1521EEA9FCD304 A1E5D4CF249AE9C2AC1893944AB41851A7FD0F7037291F18D6DB3FA735B3F89D 897FB7E50B3BDCAC2D91841CA3A2A2C8C7B94EC4884036EB07709A149EC54694 35FB4163EF9F72AF05753E28C7DFF5043E0A63B093EC76AC6E47A09BA15D53A1 80992590938CE372F0D67A7C12A0C4DC9803E7B6F51C0996C8FC0BB228523C49 48676C3985981ACD7A4DAE4C59DA771BE9083FF764F4637EB62BBA1799B20920 34328B9F8812DFCB34172B55C73627F8C2150DD3EB866EA40AF60E5E80693DB7 C78DC5607D5EA664AD27239AED0CFFA6DB94F14DC06E8F3465A6954CE6DD8EEF 4E82E2E2B8991A3900CDF715075021D1A345C35113EAE3DBF58E20778AD93F99 36FDEEAE66AA6676EBBFBC5B4E258407F27948260126D8255DEB32930B6CE288 4F91C424B5E389C388CA58B88BFF8C76616F1279D2C209F7777273C7B1FE6959 0110D01AFE3536EC98D3982DF7BFAAE179CA013D394F86E1816E94F4C92A3D89 54BB18C97A42F9AEF2CC4DA7AA1E6DDA1301DD1F17783347210AA7A406651361 CE5BFB8BF5922CBC49E81A55978AD8EF81D9F1DDCA9D1C3A3569049EFE512B8E B7FB16EF3A9FEE338664DC68EBEC11BFA524B26ACB1FCD0C50FCD395843C12D0 CB7C577609B4A86C2AD6258E1F8D3D136548BD2F67F69B0EA5386CF9BC80A55A 8B73A3482F5880EEBABF895ADB549A134E2D716F0F4396ED9CC412D4A8987FDA 9F20AE8B791FDF54A3829D25FC96429241259F233A0AB45C2A3ED1B82E6475F7 75D707D7EED77114802D465DC93B85A5296C29EF3BA7058475C86A5502341A6D 9B056CA4C875AC99952FB664B6B0C824C5D29C938CDD18745269C0051FB6958F C737340D10F9C64E53FF866D01B3A0D651F034DB3174FE341EEF7C1B6C00EC1C D4D6F45076A7349F8BB85A4BBC82D1D1721B5EBA6159782EDE5ED330AD20570D 3062C86259182EA989535C2E41E6640D2627315CF7297587F8B1922BED25B5BC 81BA36E2E0F9CA236CF2B151ECDC3833F14F813158FE26B0035A54F6C558AF66 EE8D3F376A47B22DF8AB443598D2A8CD0AE7DF67311BFB6E3AA4E558CA9D4894 A20E2F4DF64F4C8A93BC841F85DC8550FD247CA5BE48B6BAEC4EC34996420819 75424F74C034275917043BBBBDF1963A8F0BC382D38BC20FF5955583C565E339 5A5005EB9A2587180E36DC7F50F5E3E33B9C8FF606D2DA26B8BC4163A9E87C4B DA26095199571E374D4B039EAE2AC018C6FDF5329B95BC6FA1137CFC8E4967A4 8DE082BC97B3118FA80CA8C1229A1B7D5386DD80D677E5ADCDB7D0E216CECE1F E8B17EEB25ACDC1FC5A9E4C30A5416CF100CEDB8EDC05CDA80E5E36900A31313 A3E0F021CBE7101382737F71B8409A1058224A7A6269F526F64DCEE156BCE0E0 287AD7889AE9A7951E438E29ED81A375440F00EF9CA0C8EE8CA2776C4A4F95D0 F0AC7E8C0E41A6AA7874622358C439E21FF19850B2A9DAF5763CFB9E8FE56159 B894097DF14324B776734EAB7E6855A24100C99E1427D2735C5428377E118702 648E0D2883DA14CC1E3F28882F084E9DBE94ADA48A2EA0F2BF44A65300D90FD3 9BE002C09A1E98679E0D6D61BCFBB77BA756F5D05E53B7D7531A2D6EEDEBF83D 94B25498BAF3F967FA8A16629330B76407E7944101F3B9C871BD06014058B301 9A171F76D650217429D69CCFF852CA3F64EBBA6269E0BDD2AE2714E0F50E4B18 010B5703EA8AEF22821B12C8342932D35A88F21682D595A4C97FB9B323F576AC 3ABEE13EF6D74CE46CDE3AC73F26278B79026BDB3DA3C3A6D1F79703B99E79F3 3E22AA429C4E842A21EE8C43DCCAFE48766B1F5408C04C59BB1C21896EA9D4B4 74169951A95492CD19F5DEE4086C3F60663E2D6A5FF2E420241C7B0732803EA4 EE4F2EF7EEC30CEA5502F7379E51E3F9E7161A1B337F30DA60357C1FF92DFDB7 B9583D0DE535787F882EB0F7977F83E393D4536583873B530F8DC01F33D77405 6995E93611D0FF58BEE00885D4403179DFAC7F029B27FF2F43EAE8E00BD6611C A7A9AC4F6170F7642109CD899A12EDF68B69026B823865A79A94568EEDBF3F9A B46B5EF45CF24149139E744843D5BE5451905B0EAD0F29E8C821C8099624BFE6 EEAC1BA16813E9686F6E1368B6425463FEC83FC77DC09FD7BDB1D2B2CEF3A732 3193609D28301180444CFD3FD55CB2F489CF06BA9E2026E734E03DA5C1C8F598 4D45B05BA025B04CACD5D28471963AAB0F9D8AC183DD33BDD95383C2ECCA5B41 7262F2B2A2371E9A5B4FA5B9BA9042FA27E72B3841FF8F022022069F7E3A41AE 40B756F6B19837D2F9BA7C40A99899B26CA47D60DC79B420D5897188EEED6619 883234C6C0278806B1D0EAA2A5301C58C0C1B45A37BD9E2EC69C8C86B09E0986 CFCADB4572E1C8FE3B21C8539BA3FD3E764F8B68173FEACCA9666186EC5B20F4 81E8840BE9C59E54939B35A66906EBD3776EC928FF4AA63D76069669BF912574 2AAB87A9F7D6D4130D0C0B77F9AB8D54D65665E0457BE3EF1EAA6CE532EDAEE9 6C8721E5CADA03DA1971B45FA1AED788B14ED31388DE57030B7A7E736A795335 862D9ECD704C2DBF981A00E0E6478BED237C6B1E751128294407DB15A1D63DCF C368300A4016BF5FA4604B67D7F3351A3697084A4318E90CC393A9C94A1EB29F 1CB0B7BD898A66686139D34ED0B98851549937D7F73D5DF46861E8B8F5A2368A A5384CB3135D8A9A5887BD95A7AD95D36E30FD4396939A69232D4D447587B11F 621016414B5EC98365239B24EACF02DBF9AA004A2284A221E61BBDB6E7E6F09E 8302CEB3C63286F2CE0C18E3F5C1E545D7D71D21E5DE97565841BED9C092ADBE 1872D09761D5C328EEF0B98A8E4EAC2B908C1FD18E78774374303B2D7A008234 2D33E031C7BE298DDFD4BADEB5C52770FDEF4BEB1DC70B28B1F75E7F53B0BD66 F7844A57E88030ADEF0188C26FD11D6424A1CF9C3F6B365888A07DAAB44C8BC4 70F2414C4B8C6162016101CC07FCED7EDF1617B624223CD1274219D2CE0D5AF4 7E32BBB70DEFE292871D41999263F4D1EC31DA8C4BA5CBC6BE7EE85D2638EC35 401F64F90E24D9F7E32EDBAE4B4D57DD8C628B3DA83D0B386F5144B644DD9A63 EA6A3E1B0051541A70E88B9340C5B129118BDF6B0C36E3039286B6CE387DDE15 EB78DDB4FC55F9FD92006548ABD159D28EAA6D7D5C35237016A274A2BE7D98ED 94E3F768DD83079559FE9A3674F52816C22A7B967AE6BC47BBA512C20F2C6367 791BBA92FD54AF900E369F0B4ABC13ECC991CC62227AB671039B4BA6FA6D3DCF BFBD49F50A83B2CBE1E8EA77B66D950FFADF5ECFF5651B5668288B4BCBAA202E 564F0FE8BD0B2BB296C46324491158465EBD40E0519D3C36F4D85275A3C7F2C3 97D1294078C1F2E264E8A1C0C1A5D76CBCFF67F2568F227EFC0EB9CBFA64F152 194ECD699F41D9C7D4EA65C383CEDB5EB1138E8E3BC01D6FAA0C7810EA98DDF8 15AEC7F32D145F5704A7CADE46AA3C3898B014C76CAA8F00AB2B5167EF64B85F 44FC922F48A384A85569EAEE9861523E2461063D58BD89C84A7757E3A9EB047F 4D7639B03158EEBA090E70591BF4012CBD295D7F5EE1F82A08B3E48AC2168378 18762EA0C27A504806DAA9027C6D73647F0D608C532EBB43BC7D0A3EB9897FF8 16E50C37690CC5B3A0F5CC49B17418699E002021B5B5B0CC98126CD036262C7D 71E8EAE8ACF771DAF4F2B983F0E5B97719F14F73C8766243CFFA778E3283DF9E C650124AA531054A5CF6A78699EDAC14EBAA3D7882FE1A41B5108DF3B9ED0795 F9B56C451CEB9A6BF31CEA99AC97AB5F2198CCA738DB419A5A6C1A645905C0CC B2CD1CE4956F0F71D01597BEE107CF7D083A3135BC9715D8AC2BAA9E1CDF8B66 08E694CD6ACA2CDFCD925ABE12A8BEECD74CB182380EE2B88ACDD8655B6654F2 9CB8148C8875F2EA9C9891DF957F1C8107BEFD7852B011E8694A6B7AF7F8AD08 AD6FE224F4EF3922892368140DFD7678708B848D0ADC0C429862A5D4F5A2442C 8E080C0D7BDB21FFEADBFABEB6A7DEF706F1052222DE38E256AA5E30AFF33CA9 0F8222E913D9EB9015C127FB45C415DA3E30C60F1469049D5C1664AF970CACBB C1CC7168DAD1A7A1E5D9BF60DD85612B65ABD05833AFB39352548528EF5ED98D 55F4CA8B3A8B4A314B7F21943828A20C320BE7F00DE09B95151CA5B72BFA845D F7B76FFA693760F0FEC5AA7AB96820E91BAC337A333A8E2CB85A8905A27E4CD5 8B07DFF256CBA4DB3DE45A80F6543E490176B6EA67CFC2E1F1A944CE4E0908E8 54B480C2167FB51584204697585D4DF3AC923648E84B1C3B2ED9DC75A3938972 2A4F38992B1D7F44255D1F43070A7E674D069CDC59D7334B3C03B39CBAC45AAE 9CB181EB6317EABB574433E4693E48AD7AA75D240B581DA47FB555B2067572D4 F4CD36D1792A9E78B4426B27FAED36B44A267A236F5C625AA7201F7FDC6DFEA3 86A379AE0ECCA7F5A31FB0C4BA81491AE0EFC6AC455EBB60647112BAA9A0E038 FF7BCDAB171719C123F9676767F9D9E088771DFAA46DE7F0330AF4C719DF83F7 C5006A6D170226FE6809E6ED74FC8D7EA9058F71E55B3BF6D1618D6EB2878200 4BD5EE0D882EB30D5F5EE99DCBDB6135CC19C29E8B94D93ECFC85F96109F2CF5 CB9E2D41D1A6CD76B616D820A6D75257525244B10D54DE7ABA5D166FE549C54B 9FF229B53BE768BDBDA91846810F1D1A0F6D80EDB3E7609D8026D086E4419D78 63D6013D41E3035A814732479B6B7E3E0B79A75022EF83E49CE56240FE465F21 5F2367117FDACE292E4F76133CC65BA6F60D229106F11FBC73A460F5B6A8F32D 3662A1A5506110EE6EC93F78B3E0357864C370CF6B465BD6C4FA94368FE2624C 4D6E66A790E1F4C058D36EAF3A3BC707A128BFAD6D1A48D25E838958E45F534B C8AF039B712BA3DE4CD548E99ADEAA36464AA970B6E6E057F9F1544601DF43C1 2BE0ADD588995EAD821DADB8738E739621E4E3275D49A971A5994DC4D79D3DF5 AE37A7E8F78AD5E37976220162A3AF706B7A5BB508B88F34A149C36CC33DE50F D0A6986D3D20481BB8A1E5E3DC365C7941C2D45000626317E15A3F434BAEB3D1 26E80FBAB0DC35971B9FCA405FACD77DE8C0DFEBF2DE11C91DD31B007E9E46C5 9A9CF9B53051EA71490D37C4DF273CA5BC8E6C6A05DC8B2D8A2F785BA259434C 3D0EDAFE48F2AB5B7638E925E3D4AE263850355C77AE35DFD028A611AB457DD3 9BEB326C0C74FD548C37321861CD107F407352CDD10B681630508A192CD4C859 300B1B2DCC94C32618F574856404AE6F42F6DBBFBEFB64CFDABFB40927A64699 801B4D790D0EEEA681CFEACBE59009E7DB1D9EF75E57E05E2995C7B9EE2EF62F 5B3CC9EBA43E7D57AFAF1A04E2A7244024F3C098D26A44C4B8309E2944678A03 BE367843AA3BDF8A5337067FE865D18201AF5A660FE8D2685783EF3D55975F19 F799EECB230CA0DBF50CD3A8B8AEC1391B6228B2F52CA3A0211D04210B9E7D17 35A7D12DE8559C3BBDAC1C6842A4E65612947687A938371A5F62FC587D47447D 80739751EFC3EE48B7B08D327E0AF5783AC5EBD0212DBC0B57FA5E945EC54BF0 0F54C42F22D6B37850096116FA26A271B81B38E6CBFAA5E2E8898047203C8CE4 DBA6C0937C420D0A194ED96F8D64CCA89A505DAA07F5108CFCFD08C9329D1484 6FBFE9AB21937D3712D393EE495881604F3700EFA02E61EA49D60A7E937B5B1B 39CDACABF339D6D437C2E4E261358BEB2E008F67525CAB87C079FA890BF02527 0554BF90A0F0EEF6C7B1652A9E4FE8981AC68576C82C67BA127E74A6DDFE2E26 3B392A8E7D7736F6946FE672F7894E4E52938403B7CB978C004F5C5545BDFC26 90FD32110936282BC42C7DFEF89B37829654BC44C4D29964863FF7E8EBBED03C 68F4C29D503215670BEFB47B2F39B91DC707D3085928BBBC2A7A0340B5F60A1B 16012D1DAA2E7A513B019416FFBA60DC90B2D27D29347A1BBE992657FAEE1025 193A1ADDD56EC09C0A6601873AF9B466ECCBDE8591387E77F244284CB39A8310 600E598B5999885CC5F8757B5AB8B1EEC3B48FD8F37C9496B55BC5D4BC337247 A39D56E5CC91FC158C77C9E34DD8BD4E9B9CBB301D33767DD6A2DBD9505CEBAE 0C14442CBF662921083EC383087D20F9CD78B8F5B8B3225BB770F98F69F1A4BA C201F198C217BC4380F8F9FB5533130A608774AE54030476718A1CE989B48C25 83B8E95298929C2F844FE4609FCEFDBFDC6261A6ED3B6AF1255A7BD3F3739E20 FB365F1060B810D0CE246048AD7E036728E8EFDE2610DCF7016AF692D485D8A6 6A2DAECA50E34F1CFC398E0F9B1681C91D3B0673E8520FEC8556F97FB4A600C4 BE6273C2D8C19DAEF55B925DA6E3B04FF28130D0D589F9AFDB824E60519336B5 7662C20ABC20A5A877ADD35176BA1E3DBDAD124BCCDE1B5A430785C5C6A0986B 5192F278306DEC6B8DE61C5E31227DF6569105BFB5D62D34A2810BE3BDE6F370 EF2774AE6D8EBADC13BCDF0CF4C9FDE17EB2B4116019EF4B464739B33CEB7FD7 97CB01C37F5405B592EA078BFE326EC1A577BA8410D284F6F1A52606B8FF825E 5E852C86E16F8DA7F9ED46946D1875A1B0AF72B13FD0610A1878EE49D5F7D8EC 2F36F321609B0D5919B6FCCE787D63610F91408573FF0FCDE71D9C555C41B12B BA4E68D39AA5479A7B8C0391E92CE58546B7804BA5347AC42D607C3C2FDE803F 0C1784FB9EDE8B3F54D9F0AA77149307C5A823B696C1A595AB35557BC6485CEE A57D1B454E33413DE6AAEAEB7F5DF6B8473F8F2CA25A449C39575442EE1AE4A0 6E957848D4C4DA675118AEA6F5D7A269C583F71C16A89DF3FDD840E4D4B43794 2F26BA4939596EA5B1E74CC5D7B4F1047A373E6D406D37C555E42624A0895AA6 94EE7C44AB5CF4A0D2CC68504F034E1DEBD3B40316DC36D28718FC4EAA385AB5 DA0CEA54996610864A1492E6A53BA486A42904E4D4 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont TeXDict begin 40258437 52099151 1000 8000 8000 (lecture9.dvi) @start /Fa 133[393 443 121[{ TeXBase1Encoding ReEncodeFont }2 885.568 /Times-Bold rf /Fb 103[404 15[404 28[674 404 337 21[674 6[808 3[943 21[606 606 606 48[{ TeXBase1Encoding ReEncodeFont }11 1212.12 /Times-Bold rf /Fc 165[606 90[{}1 1090.91 /CMEX10 rf /Fd 236[892 892 724 724 16[{}4 1212.12 /CMEX10 rf /Fe 139[185 1[258 1[332 332 332 1[185 2[185 3[295 1[295 99[{ TeXBase1Encoding ReEncodeFont }9 664.176 /Times-Italic rf /Fg 134[498 3[498 277 388 332 1[498 1[498 4[277 498 498 1[442 1[442 15[554 2[554 3[609 8[665 9[498 1[498 498 498 498 498 498 498 498 277 2[249 44[{ TeXBase1Encoding ReEncodeFont }27 996.264 /Times-Roman rf /Fh 207[244 44[443 2[689{}3 885.568 /CMSY10 rf /Fi 204[332 332 332 49[{ TeXBase1Encoding ReEncodeFont }3 664.176 /Times-Roman rf /Fk 214[344 344 40[{}2 885.568 /CMR10 rf /Fl 80[295 38[295 84[443 443 443 443 48[{ TeXBase1Encoding ReEncodeFont }6 885.568 /Times-Roman rf /Fm 90[631 165[{}1 885.568 /Symbol rf /Fn 143[1010 5[337 2[606 606 60[1212 5[606 606 5[1212 2[943 22[943 337 943{}12 1212.12 /CMSY10 rf /Fo 133[344 393 393 1[393 1[246 344 344 1[443 443 443 639 246 2[246 443 443 1[393 1[393 26[639 2[541 69[{ TeXBase1Encoding ReEncodeFont }19 885.568 /Times-Italic rf /Fp 194[443 61[{}1 885.568 /CMMI10 rf /Fq 142[461 486 9[461 102[{ .167 SlantFont }3 885.568 /Symbol rf /Fr 129[606 63[943 1[943 337 337 58[{}5 1212.12 /CMMI10 rf /Fs 73[599 60[832 7[632 665 2[698 6[632 3[665 765 97[{ .167 SlantFont }8 1212.12 /Symbol rf /Ft 162[337 1[337 29[943 17[943 1[471 471 40[{}6 1212.12 /CMR10 rf /Fv 134[538 538 1[538 606 337 472 472 606 606 606 606 875 337 2[337 606 606 337 538 606 538 606 606 11[875 674 606 741 875 741 1[808 1[674 1[538 404 875 2[741 2[741 741 31[404 33[{ TeXBase1Encoding ReEncodeFont }37 1212.12 /Times-Italic rf /Fw 80[404 26[538 538 10[404 13[538 606 606 875 606 606 337 472 404 606 606 606 606 943 337 606 337 337 606 606 404 538 606 538 606 538 7[875 1[1144 1[875 741 674 808 875 1[875 875 1078 741 875 1[404 875 875 674 741 875 808 808 875 1[538 1[684 2[337 606 2[606 606 606 606 606 606 606 1[303 404 303 2[404 404 404 5[404 30[674 2[{ TeXBase1Encoding ReEncodeFont }70 1212.12 /Times-Roman rf /Fx 135[841 1[841 886 620 629 624 1[886 797 886 1328 443 2[443 3[708 886 708 1[797 13[886 5[1461 996 18[797 6[797 797 49[{}22 1594.02 /CMDUNH10 rf /Fy 134[701 701 1[701 738 517 524 520 701 738 664 738 1107 369 2[369 738 664 1[590 738 590 738 664 9[1365 2[959 738 2[904 2[1218 3[480 5[959 941 2[627 5[664 3[664 1[664 664 664 664 664 369 1[369 44[{}39 1328.35 /CMDUNH10 rf end %%EndProlog %%BeginSetup %%Feature: *Resolution 8000dpi TeXDict begin end %%EndSetup %%Page: 1 1 TeXDict begin 1 0 bop 0 0 a SDict begin /product where{pop product(Distiller)search{pop pop pop version(.)search{exch pop exch pop(3011)eq{gsave newpath 0 0 moveto closepath clip/Courier findfont 10 scalefont setfont 72 72 moveto(.)show grestore}if}{pop}ifelse}{pop}ifelse}if end 0 0 a 0 0 a SDict begin [ /Title () /Subject () /Creator (LaTeX with hyperref package) /Author () /Producer (dvips + Distiller) /Keywords () /DOCINFO pdfmark end 0 0 a Black 2000 -4672 a SDict begin H.S end 2000 -4672 a Black Black 2000 -4672 a SDict begin H.R end 2000 -4672 a 2000 -4672 a SDict begin [ /View [/XYZ H.V] /Dest (page.1) cvn H.B /DEST pdfmark end 2000 -4672 a Black 2000 -1904 a SDict begin [ /Count -0 /Dest (section.1) cvn /Title (Measurement and expectation values) /OUT pdfmark end 2000 -1904 a 2000 -1904 a SDict begin [ /Count -3 /Dest (section.2) cvn /Title (Spin) /OUT pdfmark end 2000 -1904 a 2000 -1904 a SDict begin [ /Count -0 /Dest (subsection.2.1) cvn /Title (Physical qubits) /OUT pdfmark end 2000 -1904 a 2000 -1904 a SDict begin [ /Count -0 /Dest (subsection.2.2) cvn /Title (The Bloch Sphere) /OUT pdfmark end 2000 -1904 a 2000 -1904 a SDict begin [ /Count -0 /Dest (subsection.2.3) cvn /Title (What is spin?) /OUT pdfmark end 2000 -1904 a 2000 -1904 a SDict begin [ /Page 1 /View [ /Fit ] /PageMode /UseOutlines /DOCVIEW pdfmark end 2000 -1904 a 2000 -1904 a SDict begin [ {Catalog} << >> /PUT pdfmark end 2000 -1904 a 2000 -1904 a SDict 2000 SDict 2000 SDict end begin -1904 begin -1904 begin H.S end a 2000 -1904 a 13.6 H.A end a 2000 -1904 a [ /View [/XYZ H.V] /Dest (Doc-Start) cvn H.B /DEST pdfmark 2000 -1904 a 2000 -687 52000 665 v 3985 x Fy(C/CS/Ph)-37 b(ys)444 b(191)2580 b(Measuremen)-37 b(t)444 b(and)f(exp)37 b(ectation)443 b(v)-74 b(alues,)444 b(In)-37 b(tro)442 b(to)h(Spin)5721 b(2/15/05)2000 4178 y(Spring)443 b(2005)38554 b Fx(Lecture)533 b(9)p 2000 5828 V 2000 7418 a SDict begin H.S end 2000 7418 a 2000 7418 a SDict begin 13.6 H.A end 2000 7418 a 2000 7418 a SDict begin [ /View [/XYZ H.V] /Dest (section.1) cvn H.B /DEST pdfmark end 2000 7418 a 2103 x Fx(1)1594 b(Measuremen)-44 b(t)532 b(and)f(exp)44 b(ectation)532 b(v)-89 b(alues)2000 12289 y Fw(Last)257 b(time)h(we)h(discussed)e(ho) -30 b(w)258 b(useful)f(it)h(is)g(to)g(w)-12 b(ork)257 b(in)h(the)h(basis)e(of)h Fv(ener)-45 b(gy)258 b(eig)-12 b(enstates)257 b Fw(because)i(of)e(their)h(connection)2000 13794 y(with)303 b(time)g(e)-30 b(v)-24 b(olution:)5399 18054 y(\210)5030 18295 y Fv(H)85 b Fs(y)6822 18477 y Fo(E)7752 18295 y Ft(=)268 b Fv(E)88 b Fs(y)10624 18477 y Fo(E)11554 18295 y Fn(\))270 b(f)p Fs(y)14474 18477 y Fo(E)15135 18295 y Fn(g)p Fr(;)135 b Fn(f)p Fv(E)88 b Fn(g)2000 21291 y Fw(Since)5365 21049 y(\210)4996 21291 y Fv(H)388 b Fw(is)303 b(a)g(hermitian)g(operator)g(we)g(kno)-30 b(w)303 b(that)g(this)g(can)g(be)h(orthonormal.)375 b(T)-42 b(ime)302 b(e)-30 b(v)-24 b(olution)303 b(is)g(obtained)g(by:)5030 25791 y Fn(j)p Fs(y)101 b Ft(\()-30 b Fv(t)349 b Ft(=)268 b Fw(0)p Ft(\))h Fr(>)p Ft(=)e Fv(a)12743 25973 y Fl(1)13241 25791 y Fn(j)p Fs(y)14410 25973 y Fo(E)14951 26113 y Fi(1)15661 25791 y Fr(>)i Ft(+)p Fv(a)18422 25973 y Fl(2)18919 25791 y Fn(j)p Fs(y)20088 25973 y Fo(E)20629 26113 y Fi(2)21339 25791 y Fr(>)f Ft(+)p Fv(a)24099 25973 y Fl(3)24596 25791 y Fn(j)p Fs(y)25765 25973 y Fo(E)26306 26113 y Fi(3)27017 25791 y Fr(>)g Ft(+)135 b Fn(\242)g(\242)g(\242)263 b(\))270 b(j)p Fs(y)101 b Ft(\()-30 b Fv(t)82 b Ft(\))266 b Fr(>)p Ft(=)h Fv(e)37890 25291 y Fh(\241)p Fo(i)39094 25115 y Fl(\210)38825 25291 y Fo(H)39 b(t)60 b Fp(=)40306 25318 y Fl(\257)40252 25291 y Fo(h)40750 25791 y Fn(j)p Fs(y)101 b Ft(\()-30 b Fv(t)349 b Ft(=)268 b Fw(0)p Ft(\))h Fr(>)2000 28787 y Fw(So)459 b(let')-67 b(s)458 b(discuss)g (measurement.)844 b(If)458 b Fn(j)p Fs(y)d Fr(>)p Ft(=)353 b Fv(a)23524 28969 y Fl(1)24023 28787 y Fn(j)p Fs(y)25192 28969 y Fo(E)25733 29109 y Fi(1)26530 28787 y Fr(>)i Ft(+)p Fv(a)29377 28969 y Fl(2)29874 28787 y Fn(j)p Fs(y)31043 28969 y Fo(E)31584 29109 y Fi(2)32381 28787 y Fr(>)f Ft(+)p Fv(a)35227 28969 y Fl(3)35724 28787 y Fn(j)p Fs(y)36893 28969 y Fo(E)37434 29109 y Fi(3)38232 28787 y Fr(>)g Ft(+)135 b Fn(\242)g(\242)g(\242)129 b Fw(,)498 b(what)459 b(is)g(the)g(result)f(of)h(a)2000 30292 y(measurement)450 b(of)f(ener)-22 b(gy?)817 b(One)450 b(of)f(the)h(postulate)g(of)g(QM)f (is)g(that)h(the)g(result)f(of)h(the)g(measurement)f(must)h(be)g(an) 2000 31798 y(eigen)-48 b(v)-30 b(alue)273 b(of)9096 31556 y(\210)8727 31798 y Fv(H)85 b Fw(.)366 b Fs(y)372 b Fw(will)273 b(collapse)f(onto)h(one)g(of)f(these)h(eigenstates)f(with)h(some)f (probability)-79 b(.)366 b(What')-67 b(s)272 b(the)h(probability)2000 33303 y(of)315 b(obtaining)i Fv(E)8962 33485 y Fl(3)9459 33303 y Fw(?)414 b Fv(P)11000 33485 y Fl(3)11775 33303 y Ft(=)275 b Fn(j)h Fr(<)f Fs(y)15656 33485 y Fo(e)16104 33303 y Fn(j)p Fs(y)375 b Fr(>)275 b Fn(j)19203 32863 y Fl(2)19977 33303 y Ft(=)g Fv(a)21801 32863 y Fl(2)21801 33649 y(3)22615 33303 y Fw(And)316 b(what)g(is)f Fs(y)416 b Fw(after)315 b(measurement?)414 b Fs(y)i Fw(is)316 b(projected)g(to)f Fs(y)49302 33485 y Fl(3)50116 33303 y Fw(upon)h(an)2000 34808 y(observ)-30 b(ation)336 b(of)h Fv(E)10050 34990 y Fl(3)10547 34808 y Fw(.)478 b(So,)345 b(measurement)337 b(is)f(a)h(random)g(collapse)g(onto)g(one)g(of)f(the) h(eig.)478 b(states)336 b(of)g(the)h(observ)-30 b(able)337 b(you)2000 36314 y(are)303 b(measuring!)2000 38373 y Fv(The)431 b(same)g(holds)g(for)g(momentum)p Fw(:)632 b(If)431 b(we)g(are)g(discussing)f(momentum)i(then)f(it')-67 b(s)431 b(best)f(to)h(w)-12 b(ork)431 b(with)h(momentum)2000 39878 y(eigenstates.)5298 44379 y(\210)-581 b Fv(p)p Fs(y)6625 44561 y Fo(p)7393 44379 y Ft(=)359 b Fv(p)p Fs(y)10199 44561 y Fo(p)10966 44379 y Fn(\))270 b(f)p Fs(y)13952 44561 y Fo(p)14450 44379 y Fn(g)p Fr(;)135 b Fn(f)91 b Fv(p)p Fn(g)2000 47374 y Fw(Suppose)368 b Fn(j)p Fs(y)405 b Fr(>)p Ft(=)303 b Fv(b)10845 47556 y Fl(1)11343 47374 y Fn(j)p Fs(y)12578 47556 y Fo(p)13021 47696 y Fi(1)13768 47374 y Fr(>)h Ft(+)p Fv(b)16564 47556 y Fl(2)17061 47374 y Fn(j)p Fs(y)18296 47556 y Fo(p)18739 47696 y Fi(2)19486 47374 y Fr(>)g Ft(+)p Fv(b)22282 47556 y Fl(3)22779 47374 y Fn(j)p Fs(y)24014 47556 y Fo(p)24457 47696 y Fi(3)25204 47374 y Fr(>)h Ft(+)135 b Fn(\242)g(\242)g(\242)497 b Fw(What)368 b(is)g(a)g(result)g(of)g(a)g(measurement)h(of)e (momentum?)2000 48880 y(W)-97 b(e)351 b(will)g(end)h(up)f(measuring)f (an)h(eigen)-48 b(v)-30 b(alue)351 b(of)g(momentum)g(with)g(some)g (probability)-79 b(,)363 b(and)352 b(then)f(collapse)g(onto)g(that)2000 50385 y(eigenstate)303 b(\()p Fv(P)8143 50567 y Fl(2)8910 50385 y Ft(=)269 b Fn(j)p Fv(b)11065 50567 y Fl(2)11562 50385 y Fn(j)11899 49945 y Fl(2)12395 50385 y Fw(\).)2000 52444 y(The)422 b(e)-18 b(xact)423 b(same)g(thing)g(happens)f(for)g (the)h(observ)-30 b(ables)582 b(\210)-564 b Fv(x)t Fw(,)28781 52203 y(\210)28644 52444 y Fv(L)t Fw(,)452 b(etc.)735 b(The)423 b(eigenstates)f(of)g(these)h(observ)-30 b(ables)422 b(de\002ne)2000 53950 y(bases,)302 b(and)i(measurement)f(of)f(that)i (observ)-30 b(able)302 b(randomly)h(collapses)g(us)f(onto)i(one)f(of)g (those)f(eigenstates.)2000 56009 y Fv(Question)p Fw(:)344 b(What)241 b(if)f(we)g(tak)-12 b(e)241 b(an)f(ensemble)h(of)f (identically)h(prepared)f(states)f(and)i(measure)f(the)g(same)h(ph)-6 b(ysical)240 b(quantity)2000 57514 y(for)303 b(each?)379 b(Ho)-30 b(w)304 b(do)g(we)h(determine)f(\(theoretically\))f(the)h(a) -24 b(v)-18 b(erage)304 b(v)-30 b(alue)304 b(of)g(the)g(measurements?) 378 b(This)303 b(will)h(lead)g(us)g(to)2000 59020 y(the)f(de\002nition) g(of)g(an)g Fv(e)-24 b(xpectation)304 b(value)p Fw(.)2000 61079 y(Example:)379 b(ENERGY)-156 b(.)305 b(Suppose)f(we)h(kno)-30 b(w)305 b(states)f Fn(f)p Fs(y)25926 61261 y Fo(E)26587 61079 y Fn(g)p Fw(,)h Fn(f)p Fv(E)88 b Fn(g)p Fw(.)381 b(If)304 b(an)h(ensemble)g(is)f(prepared)h(in)g Fn(j)p Fs(y)369 b Fr(>)p Ft(=)268 b Fn(j)p Fs(y)49737 61261 y Fo(E)50666 61079 y Fr(>)304 b Fw(then)2000 62584 y(the)327 b(situation)f(is)g(simple:)423 b Fr(<)281 b Fv(E)370 b Fr(>)p Ft(=)281 b Fv(E)18681 62766 y Fl(0)19178 62584 y Fw(.)447 b(But)327 b(what)g(if)f(we)h(prepare)f(an)h(ensemble)g(in)g (a)f(state)h Fn(j)p Fs(y)381 b Fr(>)326 b Fw(in)g(a)h(superposition) 2000 64090 y(state)356 b(which)h(is)g(not)f(an)h(eigenstate)g(of)19409 63848 y(\210)19039 64090 y Fv(H)85 b Fw(,)371 b(e.g.)537 b Fn(j)p Fs(y)398 b Fr(>)p Ft(=)296 b Fv(a)27315 64272 y Fl(1)27814 64090 y Fn(j)p Fs(y)28983 64272 y Fo(E)29524 64412 y Fi(1)30264 64090 y Fr(>)i Ft(+)p Fv(a)33054 64272 y Fl(2)33551 64090 y Fn(j)p Fs(y)34720 64272 y Fo(E)35261 64412 y Fi(2)36001 64090 y Fr(>)g Ft(+)p Fv(a)38791 64272 y Fl(3)39288 64090 y Fn(j)p Fs(y)40457 64272 y Fo(E)40998 64412 y Fi(3)41738 64090 y Fr(>)g Ft(+)135 b Fn(\242)g(\242)g(\242)129 b Fw(?)537 b(What)357 b(is)f Fr(<)298 b Fv(E)387 b Fr(>)2000 65595 y Fw(then?)5030 70096 y Fr(<)268 b Fv(E)358 b Fr(>)p Ft(=)267 b Fv(E)10234 70278 y Fl(1)10732 70096 y Fv(Pr)-27 b(ob)p Ft([)p Fv(E)14208 70278 y Fl(1)14704 70096 y Ft(])168 b(+)g Fv(E)17061 70278 y Fl(2)17557 70096 y Fv(Pr)-27 b(ob)p Ft([)p Fv(E)21033 70278 y Fl(1)21529 70096 y Ft(])168 b(+)g Fv(E)23886 70278 y Fl(3)24382 70096 y Fv(Pr)-27 b(ob)p Ft([)p Fv(E)27858 70278 y Fl(3)28354 70096 y Ft(])168 b(+)g Fn(\242)135 b(\242)g(\242)p Black 2000 73417 a Fg(C/CS/Ph)-5 b(ys)248 b(191,)h(Spring)g(2005,)h(Lecture)g(9)35704 b(1)p Black eop end %%Page: 2 2 TeXDict begin 2 1 bop 0 0 a SDict begin /product where{pop product(Distiller)search{pop pop pop version(.)search{exch pop exch pop(3011)eq{gsave newpath 0 0 moveto closepath clip/Courier findfont 10 scalefont setfont 72 72 moveto(.)show grestore}if}{pop}ifelse}{pop}ifelse}if end 0 0 a Black 2000 -4672 a SDict begin H.S end 2000 -4672 a Black Black 2000 -4672 a SDict begin H.R end 2000 -4672 a 2000 -4672 a SDict begin [ /View [/XYZ H.V] /Dest (page.2) cvn H.B /DEST pdfmark end 2000 -4672 a Black 3985 x Fw(where)303 b Fv(Pr)-27 b(ob)p Ft([)p Fv(E)8740 -505 y Fo(i)9040 -687 y Ft(])301 b Fw(is)i(just)5030 3919 y Fv(Pr)-27 b(ob)p Ft([)p Fv(E)8506 4101 y Fo(i)8806 3919 y Ft(])268 b(=)g Fn(j)g Fr(<)g Fs(y)13270 4101 y Fo(E)13811 4234 y Fe(i)14106 3919 y Fn(j)p Fs(y)368 b Fr(>)269 b Fn(j)17192 3418 y Fl(2)17958 3919 y Ft(=)f Fn(j)p Fv(a)20112 4101 y Fo(i)20412 3919 y Fn(j)20749 3418 y Fl(2)2000 7019 y Fw(This)302 b(yields:)5030 11625 y Fr(<)268 b Fv(E)358 b Fr(>)p Ft(=)267 b Fn(j)p Fv(a)10436 11807 y Fl(1)10933 11625 y Fn(j)11270 11124 y Fl(2)11767 11625 y Fv(E)12508 11807 y Fl(1)13174 11625 y Ft(+)168 b Fn(j)p Fv(a)15228 11807 y Fl(2)15724 11625 y Fn(j)16061 11124 y Fl(2)16558 11625 y Fv(E)17299 11807 y Fl(2)17965 11625 y Ft(+)g Fn(j)p Fv(a)20019 11807 y Fl(3)20515 11625 y Fn(j)20852 11124 y Fl(2)21349 11625 y Fv(E)22090 11807 y Fl(3)22756 11625 y Ft(+)g Fn(\242)135 b(\242)g(\242)2000 14725 y Fw(Our)303 b(shorthand)f(for)h(this)f(is)h (gi)-30 b(v)-18 b(en)303 b(by:)5030 19330 y Fr(<)268 b Fv(E)358 b Fr(>)p Ft(=)p Fr(<)266 b Fs(y)101 b Fn(j)12072 19089 y Fw(\210)11705 19330 y Fv(H)83 b Fn(j)p Fs(y)368 b Fr(>)2000 22430 y Fw(which)285 b(is)g(kno)-30 b(wn)285 b(as)g(the)g(e)-18 b(xpectation)286 b(v)-30 b(alue)285 b(of)g(the)g(Hamiltonian)h(\(or)e(equi)-30 b(v)g(alently)286 b(of)e(the)i(ener)-22 b(gy\).)369 b(Y)-133 b(ou)285 b(can)h(readily) 2000 23936 y(sho)-30 b(w)302 b(that)i(this)e Fr(<)268 b Fv(E)358 b Fr(>)p Ft(=)p Fr(<)266 b Fs(y)101 b Fn(j)16048 23694 y Fw(\210)15682 23936 y Fv(H)82 b Fn(j)p Fs(y)369 b Fr(>)301 b Fw(yields)i(the)g(proper)g(e)-18 b(xpression.)2000 25995 y(W)-97 b(e)328 b(can)g(do)g(this)f(for)g Fv(any)h Fw(observ)-30 b(able!)448 b(Consider)328 b(arbitrary)f(observ)-30 b(able)34447 25725 y(\210)34188 25995 y Fv(A)o Fw(.)450 b(The)327 b(a)-24 b(v)-18 b(erage)328 b(v)-30 b(alue)327 b(of)h(this)f(quantity)h(for)2000 27500 y(ensemble)303 b(of)g(systems)f(prepared)h(in)g Fn(j)p Fs(y)368 b Fr(>)302 b Fw(is)g Fr(<)268 b Fv(A)h Fr(>)p Ft(=)p Fr(<)d Fs(y)101 b Fn(j)28861 27231 y Fw(\210)28604 27500 y Fv(A)n Fn(j)p Fs(y)368 b Fr(>)p Fw(.)2000 29559 y(It)313 b(should)f(be)i(noted)f (that)g(it)g(is)f(sometimes)h(hard)g(to)g(e)-30 b(v)g(aluate)313 b(the)g(e)-18 b(xpectation)314 b(v)-30 b(alue.)405 b(T)-97 b(ak)-12 b(e)313 b(the)h(continuous)e(basis)h(for)2000 31064 y(e)-18 b(xample)347 b(\()p Fn(j)p Fv(x)296 b Fr(>)p Fw(\).)505 b(Suppose)346 b Fs(y)101 b Ft(\()p Fv(x)t Ft(\))292 b(=)p Fr(<)f Fv(x)t Fn(j)p Fs(y)392 b Fr(>)p Ft(=)291 b Fv(Ae)25064 30624 y Fh(\241)p Fo(x)26149 30303 y Fi(2)26591 31064 y Fw(.)506 b(What)347 b(is)g(the)f(a)-24 b(v)-18 b(erage)347 b(v)-30 b(alue)347 b(of)f(measured)h(momentum)g (for)2000 32570 y(an)303 b(ensemble)g(of)g(systems?)5030 37538 y Fr(<)536 b Fw(\210)-581 b Fv(p)270 b Fr(>)p Ft(=)p Fr(<)c Fs(y)101 b Fn(j)265 b Fw(\210)-578 b Fv(p)m Fn(j)p Fs(y)369 b Fr(>)p Ft(=)15958 36023 y Fc(Z)17046 36365 y Fm(\245)16562 38490 y Fh(\241)p Fm(\245)18072 37538 y Fs(y)19005 37037 y Fh(\244)19502 37538 y Ft(\()p Fv(x)t Ft(\))266 b Fw(\210)-579 b Fv(p)n Fs(y)101 b Ft(\()p Fv(x)t Ft(\))p Fv(d)63 b(x)271 b Ft(=)26787 36023 y Fc(Z)27876 36365 y Fm(\245)27392 38490 y Fh(\241)p Fm(\245)28902 36192 y Fd(\263)29625 37538 y Fv(A)30366 37037 y Fh(\244)30864 37538 y Fv(e)31402 37037 y Fh(\241)p Fo(x)32487 36716 y Fi(2)32929 36192 y Fd(\264)33787 35828 y(\265)34885 36753 y Fw(\257)34812 36717 y Fv(h)p 34812 37259 607 49 v 34947 38369 a(i)35955 36717 y Fs(\266)p 35684 37259 1291 49 v 35684 38369 a(\266)150 b Fv(x)37108 35828 y Fd(\266)38134 36192 y(\263)38858 37538 y Fv(Ae)40137 37037 y Fh(\241)p Fo(x)41222 36716 y Fi(2)41664 36192 y Fd(\264)42522 37538 y Fv(d)63 b(x)273 b Ft(=)268 b Fw(0)2000 41426 y(So,)344 b(in)336 b(this)f(instance)h(the)g(e)-18 b(xpectation)337 b(v)-30 b(alue)336 b(is)f(zero.)475 b(It)335 b(is)g(left)h(as)f(an)i(e)-18 b(x)g(ercise)335 b(to)h(e)-30 b(v)g(aluate)336 b Fr(<)377 b Fv(p)45050 40986 y Fl(2)45836 41426 y Fr(>)335 b Fw(and)h(see)f(if)h Fv(it)358 b Fw(is)2000 42932 y(zero!)2000 44553 y SDict begin H.S end 2000 44553 a 2000 44553 a SDict begin 13.6 H.A end 2000 44553 a 2000 44553 a SDict begin [ /View [/XYZ H.V] /Dest (section.2) cvn H.B /DEST pdfmark end 2000 44553 a 2196 x Fx(2)1594 b(Spin)2000 47768 y SDict begin H.S end 2000 47768 a 2000 47768 a SDict begin 13.6 H.A end 2000 47768 a 2000 47768 a SDict begin [ /View [/XYZ H.V] /Dest (subsection.2.1) cvn H.B /DEST pdfmark end 2000 47768 a 1956 x Fy(2.1)1329 b(Ph)-37 b(ysical)443 b(qubits)2000 52274 y Fw(No)-30 b(w)-79 b(,)397 b(after)378 b(this)g(foray)g(into)g(the)h (w)-12 b(orld)378 b(of)f(w)-12 b(a)-24 b(v)-18 b(e)379 b(mechanics,)397 b(let')-67 b(s)378 b(get)g(back)h(to)f(our)h (discussion)e(of)h Fv(qubits)f Fw(\(it)h(is)g(in)2000 53779 y(the)e(title)g(of)g(the)h(course,)394 b(after)375 b(all!\).)595 b(Ho)-30 b(w)376 b(can)g(we)h(mak)-12 b(e)376 b(a)h(qubit)f(in)g(real)g(life?)595 b(W)-97 b(e)377 b(need)f(a)h (quantum)f(mechanical)2000 55285 y(tw)-12 b(o-le)-30 b(v)-18 b(el)303 b(system)f(such)h(that)g(we)g(can:)2000 57344 y(\(1\))f(Initialize)h(the)h(qubit.)2000 59403 y(\(2\))e(Manipulate)i(the)f(qubit)g(\(think)g(g)-6 b(ates!\))2000 61461 y(\(3\))302 b(Measure)h(the)g(qubit.)2000 63520 y(There)352 b(are)g(man)-18 b(y)353 b(other)f(important)g(issues)f (such)h(as)g(docoherence)i(and)e(entanglement,)366 b(b)-24 b(ut)352 b(I')-12 b(ll)351 b(mainly)i(be)g(focusing)2000 65026 y(on)303 b(the)g(\002rst)f(three.)2000 67085 y(Examples)336 b(of)g(some)g(possible)g(2-le)-30 b(v)-18 b(el)336 b(systems)f(are)h (spins,)344 b(atoms,)g(photons.)476 b(Others)336 b(e)-18 b(xist)336 b(\(such)g(as)g(quantum)g(dots,)2000 68590 y(superconducting)259 b(loops,)268 b(etc.\),)g(b)-24 b(ut)258 b(I')-12 b(ll)259 b(focus)f(on)h(these)g(e)-18 b(xamples.)361 b(Ov)-18 b(er)259 b(the)g(ne)-18 b(xt)260 b(fe)-30 b(w)258 b(lectures)h(we')-12 b(ll)259 b(be)g(discussing)2000 70096 y(ho)-30 b(w)303 b(to)g(ph)-6 b(ysically)303 b(prepare,)g (measure,)g(and)g(manipulate)h(real)f(qubit)g(systems.)p Black 2000 73417 a Fg(C/CS/Ph)-5 b(ys)248 b(191,)h(Spring)g(2005,)h (Lecture)g(9)35704 b(2)p Black eop end %%Page: 3 3 TeXDict begin 3 2 bop 0 0 a SDict begin /product where{pop product(Distiller)search{pop pop pop version(.)search{exch pop exch pop(3011)eq{gsave newpath 0 0 moveto closepath clip/Courier findfont 10 scalefont setfont 72 72 moveto(.)show grestore}if}{pop}ifelse}{pop}ifelse}if end 0 0 a Black 2000 -4672 a SDict begin H.S end 2000 -4672 a Black Black 2000 -4672 a SDict begin H.R end 2000 -4672 a 2000 -4672 a SDict begin [ /View [/XYZ H.V] /Dest (page.3) cvn H.B /DEST pdfmark end 2000 -4672 a Black 3985 x Fw(In)303 b(order)f(to)h(manipulate)h (qubit,)f(we)g(must)g(manipulate)h(its)e(state:)5030 4028 y Fn(j)p Fs(y)369 b Fr(>)p Ft(=)266 b Fs(a)101 b Fn(j)p Fw(0)268 b Fr(>)g Ft(+)p Fs(b)149 b Fn(j)p Fw(1)268 b Fr(>)2000 7238 y Fw(As)360 b(you')-61 b(v)-18 b(e)360 b(already)g(seen)g(in)g(abstract)f(sense,)374 b(this)359 b(occurs)h(by)g(acting)g(on)g Fn(j)p Fs(y)400 b Fr(>)358 b Fw(with)i(unitary)g(operators)f(\(i.e.)547 b(g)-6 b(ates\))2000 8743 y(such)303 b(that)5353 13217 y(\210)4969 13458 y Fv(U)114 b Fn(j)p Fs(y)368 b Fr(>)p Ft(=)267 b Fs(a)10514 12957 y Fh(0)10812 13458 y Fn(j)p Fw(0)h Fr(>)g Ft(+)p Fs(b)14991 12957 y Fh(0)15290 13458 y Fn(j)p Fw(1)g Fr(>)2000 16667 y Fw(where)5587 16426 y(\210)5203 16667 y Fv(U)417 b Fw(is)302 b(a)h(2)168 b Fn(\243)g Fw(2)303 b(matrix.)2000 17635 y SDict begin H.S end 2000 17635 a 2000 17635 a SDict begin 13.6 H.A end 2000 17635 a 2000 17635 a SDict begin [ /View [/XYZ H.V] /Dest (subsection.2.2) cvn H.B /DEST pdfmark end 2000 17635 a 1958 x Fy(2.2)1329 b(The)443 b(Blo)37 b(c)-37 b(h)443 b(Sphere)2000 22143 y Fw(A)318 b(v)-18 b(ery)318 b(nice)h(w)-12 b(ay)318 b(to)h(think)f(of)g(these)g (quantities)g(is)g(via)g(the)g(\224Bloch)i(Sphere.)-85 b(\224)318 b(This)f(is)h(a)g(con)-48 b(v)-18 b(enient)319 b(mapping)f(for)g(all)2000 23649 y(possible)302 b(single-qubit)h (states:)p Black 2000 46559 a currentpoint currentpoint translate 0.971 0.971 scale neg exch neg exch translate 2000 46559 a 2000 46559 a gsave currentpoint currentpoint translate 0 neg rotate neg exch neg exch translate 2000 46559 a @beginspecial 0 @llx 0 @lly 241 @urx 201 @ury 2410 @rwi @setspecial %%BeginDocument: lec9_fig1.eps %!PS-Adobe-3.1 EPSF-3.0 %%Title: lec9_fig1.eps %%Creator: Adobe Illustrator(R) X %%AI8_CreatorVersion: 10.0 %AI9_PrintingDataBegin %%For: Dan Stamper-Kurn %%CreationDate: 2/15/2005 %%BoundingBox: 0 0 241 201 %%HiResBoundingBox: 0 0 241 200.7500 %%CropBox: 0 0 241 200.7500 %%LanguageLevel: 2 %%DocumentData: Clean7Bit %ADOBeginClientInjection: DocumentHeader "AI10" %ADOEndClientInjection: DocumentHeader "AI10" %%Pages: 1 %%DocumentNeededResources: %%DocumentSuppliedResources: procset Adobe_AGM_Image (1.0 0) %%+ procset Adobe_CoolType_Utility_MAKEOCF (1.13 0) %%+ procset Adobe_CoolType_Core (2.12 0) %%+ procset Adobe_AGM_Core (2.0 0) %%+ procset Adobe_AGM_Utils (1.0 0) %%DocumentFonts: %%DocumentNeededFonts: %%DocumentNeededFeatures: %%DocumentSuppliedFeatures: %%DocumentCustomColors: %%CMYKCustomColor: %%RGBCustomColor: %AI7_Thumbnail: 128 108 8 %%BeginData: 6358 Hex Bytes %0000330000660000990000CC0033000033330033660033990033CC0033FF %0066000066330066660066990066CC0066FF009900009933009966009999 %0099CC0099FF00CC0000CC3300CC6600CC9900CCCC00CCFF00FF3300FF66 %00FF9900FFCC3300003300333300663300993300CC3300FF333300333333 %3333663333993333CC3333FF3366003366333366663366993366CC3366FF %3399003399333399663399993399CC3399FF33CC0033CC3333CC6633CC99 %33CCCC33CCFF33FF0033FF3333FF6633FF9933FFCC33FFFF660000660033 %6600666600996600CC6600FF6633006633336633666633996633CC6633FF %6666006666336666666666996666CC6666FF669900669933669966669999 %6699CC6699FF66CC0066CC3366CC6666CC9966CCCC66CCFF66FF0066FF33 %66FF6666FF9966FFCC66FFFF9900009900339900669900999900CC9900FF %9933009933339933669933999933CC9933FF996600996633996666996699 %9966CC9966FF9999009999339999669999999999CC9999FF99CC0099CC33 %99CC6699CC9999CCCC99CCFF99FF0099FF3399FF6699FF9999FFCC99FFFF %CC0000CC0033CC0066CC0099CC00CCCC00FFCC3300CC3333CC3366CC3399 %CC33CCCC33FFCC6600CC6633CC6666CC6699CC66CCCC66FFCC9900CC9933 %CC9966CC9999CC99CCCC99FFCCCC00CCCC33CCCC66CCCC99CCCCCCCCCCFF %CCFF00CCFF33CCFF66CCFF99CCFFCCCCFFFFFF0033FF0066FF0099FF00CC %FF3300FF3333FF3366FF3399FF33CCFF33FFFF6600FF6633FF6666FF6699 %FF66CCFF66FFFF9900FF9933FF9966FF9999FF99CCFF99FFFFCC00FFCC33 %FFCC66FFCC99FFCCCCFFCCFFFFFF33FFFF66FFFF99FFFFCC110000001100 %000011111111220000002200000022222222440000004400000044444444 %550000005500000055555555770000007700000077777777880000008800 %000088888888AA000000AA000000AAAAAAAABB000000BB000000BBBBBBBB %DD000000DD000000DDDDDDDDEE000000EE000000EEEEEEEE0000000000FF %00FF0000FFFFFF0000FF00FFFFFF00FFFFFF %524C45FDFCFFFDFCFFFDFCFFFDFCFFFDFCFFFDC6FFA8FD86FFA8FD7CFFA8 %FD80FFF8FF27FD7AFFA8FFF8FFA8FD7DFFF8FD6DFFA8FD11FFF8FFFFFFF8 %FD6AFFA8FD15FFA8FD6AFFA8FD0BFFA8FFFFFFA8FFA8FD80FF27FD7CFFA8 %FDFCFFFDFCFFFDFCFFFFFFFFCFFFFFFFA8FFA8FFCFFFFFFFCFFDF3FFA8FD %05FF2727FD04FFA8FD73FF4CA8FFA8A9A8FFA8A8A8A9A8A827FFFFFFAFFD %64FFA8FD05FFA827A8FFA9A9A8AFFD06A87EA87EA87DA827FFA8FD68FF27 %FD05FFA8FFA8FFA8FFA8A9A8A9A8A87EA8A8A87D27FD63FFA8FFA827A8FF %A8FFA8FFA8AFA8FFA8FFFD04A884A884A87EA87D847DA805FFA8FFFFFFA8 %FD5CFFA8FFFFFFAFFFFFFFA8FFA8FFA8FFA8AFA8A9FD06A87EA87DA87DA8 %7DFD5EFFA8FFA8FFA8FFA8FFA8FFA8FFA8FFA8A9FD04A87EA884A87DA87E %A87DA87D847D7D7DFFA8FD5EFFA8FD07FFA9FFA8FFA8FFA8A97EFFFD06A8 %7EA884A87DA8A8A87DFD60FFA8FFFFFFA8FFA8FFA8FFA8A9A8A97D27A8A9 %A8A87DA87EA87D847D847D847D7E7DFD64FFA9FFA9FFA8FFA8A800FFA8A8 %F8A9FD05A8847DA87EA87DA87DA87DFD58FFA827A8FFA8FFA8FFA8FFA8FF %A8FFA8A9A8AFA827FD08A87D5227847DA87D7E7D7E7D83F8FD62FFAFFFAF %FFA8FFA8FF00FFA8A8A8FF27A8A8A97E847EA87EA87DA87DA87DA8F8FD56 %FFF8FFAFFFA8FFAFFFA8FFA9FFA8FFA8A9A8FFA827FD06A8007E28537DA8 %7DA87D7E7D84FD047DFFFFA8FD58FFAFFFFFFFAFFFFFFFA8FFA8FFA8FF00 %A8A8FFA8A87E28842928A87DA87DA87D847D847DA87DFD56FFA8FFA8FFA8 %FFA8FFA8FFA8FFA8FFA8FFA8A9A827A8A87D277DA87E287E537DA87D847D %847D7D7D7E7D7D7DFFAFFD52FFA9FFA8FD07FFAFFFFFFFA9FFA8FFA8FF27 %FFF8A8A8FFA8AF28A8A8277DA87DA87DA87DA87D847D8400FD52FFF8FFA8 %FFA8FFA8FFA8FFA8FFA8FFA8FFA8FFA8A9A827A8F8A8A8A8A928A97DA8F8 %A87D847DA87D7E7D7E7DA87D7EFD53FFA8FFA9FFA8FFA9FFA8FFA9FFA8FF %A9FFA8FFA8AFF8FFA8A900A9A8A9A8A884527DA87DA87DA87D847DA87D7E %7DFFAFFD4FFF27A8AFA8FFA8AFA8FFA8FFA8FFA8AFA8FFA8FFA8FFA827A8 %A9FD04A87EA87DA87D847D847D7E7D7E7D7D7D7E7D7DF8FD50FF27A9A8FF %A9FFA8FFA9FFA8FFA9FFA8FFA9FFA9FFA9AF27FFA8AF7E52A8A97EA8A8A8 %7EA87EA87DA87DA87DA87D847D27FD51FFA8FFA8FFA8FFA8FFA8A9A8FFA8 %A9A8FF2827F827F8F8F82700520027A8A87EA87DA87D7E7D7E7D847D7D7D %7E7D7D7DFD50FFA8FFA8AFA8FFAFFFA9A9A9FFF828FFFFA8FFA8FFA8FFF8 %A8A8A827A9A8A87DA8842727A87D7E7EA87DA87D7E7D847DA8AFFD4FFFA8 %A8FFFD04A8F8A8A8A9A8A8A8FFA8A8A8FFA8A9A827A8A827A87EA87DA87D %A8F87D7D7E7D7D007D7DA8FD057DA8FD1AFFA8FFA8FD32FFA8FFA8FFA927 %AFFFA8AFA8A9A8FFA8FFA8FFA8FFA8FF00A827AFFD04A884A87E2784A87E %A87D84A8277EA87DA87D84F8FD50FFA8A8A8FFA8A9A8A8A8A9A8A8A8A9A8 %A8A8A9A8A8A82728A97EA9A8A87DA87EA87DA87D847D847D7E7D7D7DF853 %7D7D27FD1AFFA827FD33FFA8A8A8FFA8A8A8FFA8A9A8AFA8A9A8AFA8A9A8 %A9A8A82728A9FFA8A9A8A87EA884A87EA87DA87DA87D7D7DA884277D8405 %FD19FFA8FD35FF27FD06A884FD0EA827FD04A82727F8277DA884847D847D %7E7D7E7D7E7DA87D7D7D27FD18FFA8FFF82727FFA8FD30FFA8FFA8A8A8A9 %A8AFA8A9A8AFA8A9A8A9A8A9A8AFA8A9A828A8A8A8A97DA8A8A87E7E7E2E %2727005284847DA87DA8528427FD4EFFFD04A884A8A8A87EA8A8A87EA8A8 %A884A8A8A87DA800A805A88405A8A97DA87DA8F8A87DA87D847DA8FD047D %597DF8FFF827F827A8FFA8FFA8FFA8FD44FFFD15A87EA8A827A8A8A884A8 %7DA87E27A8A87DA87D847DA87D7EFD047DFD04FFA8FD04FF272727F827FD %42FFA87DA884A87EA884A87EA884A87EA87DA87D27A8A87DA87E277EA87D %A884A805A87DA87D847D847D7EFD077DFD05FFA8FFFFFFA8FD07FFA8FFFF %FFA827F827F827A8FD34FFF8FD07A884FD08A852A8FFA8A827277EA9A8A8 %05A9A8A8A8527EA87DA87DA87DA87D847DA87D27A9FD1EFF27F827A8FD2D %FFA87D27A8A87DA87EA87DA87EA87EA8A87DF827F87D7DA8FD04277DA9FD %04A87DA87D847D84FD057D007D7DFFFFA8FD13FFA8FD3BFFA87DA87DA87E %A8A8A884A8A8A87DA984FF7EA8A8A87EA8A8A87DA8A8A87EA884A87EA87D %A87D7E7EA87D277D7E7DFD52FFF8A87D847D277DA87D847DA9A8A87D7E7D %A87DA87DA87DA87DA87DA87DA87DA87DA87DA87D8427057D7D7D7E7D84A8 %FD23FFA8FD2EFFA8A87DA87DFF84277D84A8A800AF7DA884A8A8A87EA8A8 %A87EA884A87EA8A8A87DA87D277EAF7D7E7EA87D84F8FD50FFA8FFFF7D7D %A87D847DA87EA87DA87DA8F827000559A87DA87DA87DA87D27002727A87D %A87DA87D847D7EFD057DFD54FFF8A87DA87EA87DA87EA87D847EA87EA87D %A87EA87EA87DA87EA87DA87EA87DA87EA87DA87EA87D847D847D27FD53FF %A8FFF8A87D847D847DA8277E7D847D7E7D847D847DA87D847DA87D7E7DA8 %7D7D7D847D7E7D7E7D7E7D7E7D7DA8FD56FF7DA87EA87DA8A8A87DA87DA8 %7DA87DA87DA87EA87DA87EA87DA87EA87DA87EA87DA87DA87DA87DA827FD %56FFA8277DA87DA8537D7D7E7DA87D7E7D847D7E7D847D7E7D847D7E7D84 %7D7E7D847D7E7D847D7E7D7EF8FD59FF7E7DA87D847DA87DA87DA87DA87D %A87DA87DA87DA87DA87DA87DA87DA87DA87D847DA87E7E7DFD54FFCFFFFF %FFA8FFFFA87D277D7D7D7E7D7D7D7E7D7D7D7E7D7D7D7E7D7D7D7E7D7D7D %7E7D7D7D7E7D7E7D7E7DFFA8A8FD5AFF527DA87D7E7DA87DA87DA87DA87D %A87DA87DA87DA87DA87DA87DA87DA87DA87EA884FD5DFFF8A8847D7D7D84 %7D7D7D7E7D7E7D7E7D7E7D7E7D7D7D847D7D7D7E7D7D7D847D7EF8FD61FF %7E7DA87DA87D847DA87D847DA87D847DA87D847DA87D847DA87D7E7D7DA8 %FFA8FD5CFFA8FFFFFFAFF8FD077D7E7D7D7D7E7D7D7D7EFD097D7EF8FFA8 %FFA8FD5AFFF8FD07FF7D7E7E7D7DA87D847DA87D847DA87DA87DA87DA87D %7D7D27A9FD50FFA8FD0DFFF8FFCFFFFFFFA8FFFFFFA827FD077D7E7D7D7D %7E7D7D7D7E7D7D27FFFFFFA8FD50FFA8FD0BFFF8FD0DFF277D7D7E7D7E7D %847D847DA87D7D7D27A8FD56FFF8FFA8FD05FFA8FFA8FFA8FD07FFA8FFFF %FFA8FFFFFFAFFFF827F827F8F8AFFFFFAFA8FFA8FD55FF27FD08FF27FD76 %FFF8FD23FFCFFD5AFF27FD80FFA8FD05FFA8FD17FFA8FFA827A8FD63FF27 %FD7EFF27FD7EFFA8FD1AFFA8FFFF27FD63FFA8FD18FF27A8FFA8FFA8FDF9 %FFA8FFFF27FDFCFFA8FFFFFFA8FDFCFFFDFCFFFDFCFFFDFCFFFDFCFFFDFC %FFFDFCFFFDFCFFFD68FFFF %%EndData %%EndComments %%BeginDefaults %%ViewingOrientation: 1 0 0 1 %%EndDefaults %%BeginProlog %ADOBeginClientInjection: DocumentProlog Start "AI10" %ADOEndClientInjection: DocumentProlog Start "AI10" %%BeginResource: procset Adobe_AGM_Utils 1.0 0 %%Version: 1.0 0 %%Copyright: Copyright (C) 2000-2000 Adobe Systems, Inc. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Utils 60 dict dup begin put /bdf { bind def } bind def /nd{ null def }bdf /xdf { exch def }bdf /ldf { load def }bdf /ddf { put } }bdf /xddf { 3 -1 roll put } }bdf /xpt { exch put }bdf /ndf { exch dup where{ pop pop pop }{ xdf }ifelse All Rights Reserved. }def /cdndf { exch dup currentdict exch known{ pop pop }{ exch def }ifelse }def /bdict { mark }bdf /edict { counttomark 2 idiv dup dict begin {def} repeat pop currentdict end } }def /ps_level /languagelevel where{ pop systemdict /languagelevel get exec }{ 1 }ifelse def /level2 ps_level 2 ge def /level3 ps_level 3 ge def /ps_version {version cvr} stopped { -1 }if def /makereadonlyarray { /packedarray where{ pop packedarray }{ array astore readonly }ifelse }bdf /map_reserved_ink_name { dup type /stringtype eq{ dup /Red eq{ pop (_Red_) }{ dup /Green eq{ pop (_Green_) }{ dup /Blue eq{ pop (_Blue_) }{ dup /Cyan eq{ pop (_Cyan_) }{ dup /Magenta eq{ pop (_Magenta_) }{ dup /Yellow eq{ pop (_Yellow_) }{ dup /Black eq{ pop (_Black_) }{ dup () cvn eq{ pop (Process) }if }ifelse }ifelse }ifelse }ifelse }if }bdf /AGMUTIL_GSTATE 22 dict def /get_gstate { AGMUTIL_GSTATE begin /AGMUTIL_GSTATE_clr_spc currentcolorspace def /AGMUTIL_GSTATE_clr_indx 0 def /AGMUTIL_GSTATE_clr_comps 12 array def mark currentcolor counttomark {AGMUTIL_GSTATE_clr_comps AGMUTIL_GSTATE_clr_indx 3 -1 roll put /AGMUTIL_GSTATE_clr_indx AGMUTIL_GSTATE_clr_indx 1 add def} repeat pop /AGMUTIL_GSTATE_fnt rootfont def /AGMUTIL_GSTATE_lw currentlinewidth def /AGMUTIL_GSTATE_lc currentlinecap def /AGMUTIL_GSTATE_lj currentlinejoin def /AGMUTIL_GSTATE_ml currentmiterlimit def currentdash /AGMUTIL_GSTATE_do xdf /AGMUTIL_GSTATE_da xdf / /AGMUTIL_GSTATE_sa currentstrokeadjust def /AGMUTIL_GSTATE_clr_rnd currentcolorrendering def /AGMUTIL_GSTATE_op currentoverprint def /AGMUTIL_GSTATE_bg currentblackgeneration cvlit def /AGMUTIL_GSTATE_ucr currentundercolorremoval cvlit def currentcolortransfer cvlit /AGMUTIL_GSTATE_gy_xfer xdf cvlit /AGMUTIL_GSTATE_b_xfer xdf cvlit /AGMUTIL_GSTATE_g_xfer xdf cvlit /AGMUTIL_GSTATE_r_xfer xdf /AGMUTIL_GSTATE_ht currenthalftone def /AGMUTIL_GSTATE_flt currentflat def end }def /set_gstate { AGMUTIL_GSTATE begin AGMUTIL_GSTATE_clr_spc setcolorspace AGMUTIL_GSTATE_clr_indx {AGMUTIL_GSTATE_clr_comps AGMUTIL_GSTATE_clr_indx 1 sub get /AGMUTIL_GSTATE_clr_indx AGMUTIL_GSTATE_clr_indx 1 sub def} repeat setcolor AGMUTIL_GSTATE_fnt setfont AGMUTIL_GSTATE_lw setlinewidth AGMUTIL_GSTATE_lc setlinecap AGMUTIL_GSTATE_lj setlinejoin AGMUTIL_GSTATE_ml setmiterlimit AGMUTIL_GSTATE_da AGMUTIL_GSTATE_do setdash A AGMUTIL_GSTATE_sa setstrokeadjust AGMUTIL_GSTATE_clr_rnd setcolorrendering AGMUTIL_GSTATE_op setoverprint AGMUTIL_GSTATE_bg cvx setblackgeneration AGMUTIL_GSTATE_ucr cvx setundercolorremoval AGMUTIL_GSTATE_r_xfer cvx AGMUTIL_GSTATE_g_xfer cvx AGMUTIL_GSTATE_b_xfer cvx A AGMUTIL_GSTATE_gy_xfer cvx setcolortransfer AGMUTIL_GSTATE_ht /HalftoneType get dup 9 eq exch 100 eq or { currenthalftone /HalftoneType get AGMUTIL_GSTATE_ht /HalftoneType get }ifelse }ifelse }ifelse ne { mark AGMUTIL_GSTATE_ht {sethalftone} stopped cleartomark } if }{ AGMUTIL_GSTATE_ht sethalftone } ifelse AGMUTIL_GSTATE_flt setflat end }def /AGMUTIL_str256 256 string def /AGMUTIL_src256 256 string def /AGMUTIL_dst64 64 string def /AGMUTIL_srcLen nd /AGMUTIL_ndx nd /rdline { currentfile AGMUTIL_str256 readline pop } bdf /rdcmntline { currentfile AGMUTIL_str256 readline pop (%) anchorsearch {pop} if } bdf /filter_cmyk { dup type /filetype ne{ 0 () /SubFileDecode filter }if [ exch { AGMUTIL_src256 readstring pop dup length /AGMUTIL_srcLen exch def / /AGMUTIL_ndx 0 def AGMCORE_plate_ndx 4 AGMUTIL_srcLen 1 sub{ 1 index exch get AGMUTIL_dst64 AGMUTIL_ndx 3 -1 roll put /AGMUTIL_ndx AGMUTIL_ndx 1 add def }for pop AGMUTIL_dst64 0 AGMUTIL_ndx getinterval } bind /exec cvx ] cvx } bdf /AGMUTIL_imagefile nd /AGMUTIL_imbuf nd /read_image_file { AGMUTIL_imagefile 0 setfileposition dup /DataSource {AGMUTIL_imagefile AGMUTIL_imbuf readstring pop} put exch load exec }def /write_image_file { begin { (AGMUTIL_imagefile) (w+) file } stopped{ false }{ Adobe_AGM_Utils/AGMUTIL_imagefile xddf Adobe_AGM_Utils/AGMUTIL_imbuf Width BitsPerComponent mul 7 add 8 idiv string ddf 1 1 Height { pop DataSource dup type /filetype eq{ AGMUTIL_imbuf readstring pop }{ exec } ifelse AGMUTIL_imagefile exch writestring }for true }ifelse end }def /close_image_file { AGMUTIL_imagefile closefile (AGMUTIL_imagefile) deletefile }def /consumeimagedata { begin currentdict /MultipleDataSources known not {/MultipleDataSources false def} if MultipleDataSources { 1 dict begin /flushbuffer Width cvi string def 1 1 Height cvi { pop 0 1 DataSource length 1 sub { DataSource exch get dup type dup /filetype eq { exch flushbuffer readstring pop pop }if /arraytype eq { exec pop }if }for }for end } { /DataSource load type dup /filetype eq { 1 dict begin /flushbuffer Width Decode length 2 div mul cvi string def 1 1 Height { pop DataSource flushbuffer readstring pop pop} for end }if /arraytype eq { 1 1 Height { pop DataSource pop } for }if }ifelse end }bdf /addprocs { 2{/exec load}repeat 3 1 roll [ 5 1 roll ] bind cvx }def /modify_halftone_xfer { currenthalftone dup length dict copy begin currentdict 2 index known{ 1 index load dup length dict copy begin currentdict/TransferFunction known{ /TransferFunction load }{ currenttransfer }ifelse addprocs /TransferFunction xdf currentdict end def currentdict end sethalftone }{ currentdict/TransferFunction known{ /TransferFunction load }{ currenttransfer }ifelse addprocs /TransferFunction xdf c currentdict end sethalftone pop }ifelse }def /doc_setup{ Adobe_AGM_Utils begin }bdf /doc_trailer{ currentdict Adobe_AGM_Utils eq{ end }if }bdf systemdict /setpacking known { setpacking } if %%EndResource %%BeginResource: procset Adobe_AGM_Core 2.0 0 %%Version: 2.0 0 %%Copyright: Copyright (C) 1997-1999 Adobe Systems, Inc. systemdict /setpacking known { currentpacking All Rights Reserved. true setpacking } if userdict /Adobe_AGM_Core 205 dict dup begin put /nd{ null def }bind def /Adobe_AGM_Core_Id /Adobe_AGM_Core_2.0_0 def /AGMCORE_str256 256 string def /AGMCORE_src256 256 string def /AGMCORE_save nd /AGMCORE_graphicsave nd /AGMCORE_c 0 def /AGMCORE_m 0 def /AGMCORE_y 0 def /AGMCORE_k 0 def /AGMCORE_cmykbuf 4 array def /AGMCORE_screen [currentscreen] cvx def /AGMCORE_tmp 0 def /AGMCORE_&setgray nd /AGMCORE_&setcolor nd /AGMCORE_&setcolorspace nd /AGMCORE_&setcmykcolor nd /AGMCORE_cyan_plate nd /AGMCORE_magenta_plate nd /AGMCORE_yellow_plate nd /AGMCORE_black_plate nd /AGMCORE_plate_ndx nd /AGMCORE_get_ink_data nd /AGMCORE_is_cmyk_sep nd /AGMCORE_host_sep nd /AGMCORE_will_host_sep nd /AGMCORE_avoid_L2_sep_space nd /AGMCORE_distilling nd /AGMCORE_composite_job nd /AGMCORE_producing_seps nd /AGMCORE_ps_level -1 def /AGMCORE_ps_version -1 def /AGMCORE_environ_ok nd /AGMCORE_CSA_cache 0 dict def /AGMCORE_CSD_cache 0 dict def /AGMCORE_pattern_cache 0 dict def /AGMCORE_currentoverprint false def /AGMCORE_deltaX nd /AGMCORE_deltaY nd /AGMCORE_name nd /AGMCORE_sep_special nd /AGMCORE_err_strings 4 dict def /AGMCORE_cur_err nd /AGMCORE_ovp nd /AGMCORE_current_spot_alias false def /AGMCORE_inverting false def /AGMCORE_feature_dictCount nd /AGMCORE_feature_opCount nd /AGMCORE_feature_ctm nd /AGMCORE_ConvertToProcess false def /AGMCORE_Default_CTM matrix def /knockout_unitsq nd /AGMCORE_CRD_cache where{ pop }{ /AGMCORE_CRD_cache 0 dict def }ifelse /AGMCORE_key_known { where{ /Adobe_AGM_Core_Id known }{ false }ifelse }ndf /flushinput { save /CompareBuffer 3 -1 roll def /readbuffer 256 string def mark { currentfile readbuffer {readline} stopped {cleartomark mark} { not {pop exit} if CompareBuffer eq {exit} if }ifelse }loop cleartomark restore }bdf /getspotfunction { AGMCORE_screen exch pop exch pop dup type /dicttype eq{ dup /HalftoneType get 1 eq{ /SpotFunction get }{ dup /HalftoneType get 2 eq{ /GraySpotFunction get }{ pop { abs exch abs 2 copy add 1 gt{ 1 sub dup mul exch 1 sub dup mul add 1 sub }{ dup mul exch dup mul add 1 exch sub }ifelse }bind }ifelse }ifelse }if } def /clp_npth { clip newpath } def /eoclp_npth { eoclip newpath } def /stkpath_clp_npth { strokepath clip newpath } def /stk_n_clp_npth { gsave stroke grestore clip newpath } def /npth_clp { newpath clip } def /graphic_setup { /AGMCORE_graphicsave save def concat 0 setgray 0 setlinecap 0 setlinejoin 1 setlinewidth [] 0 setdash 10 setmiterlimit newpath false setoverprint false setstrokeadjust Adobe_AGM_Core/spot_alias get exec /Adobe_AGM_Image where { pop Adobe_AGM_Image/spot_alias 2 copy known{ get exec }{ pop pop }ifelse } if 100 dict begin /showpage {} def mark } def /graphic_cleanup { cleartomark end AGMCORE_graphicsave restore } def /compose_error_msg { g grestoreall initgraphics / /Helvetica findfont 10 scalefont setfont /AGMCORE_deltaY 100 def / /AGMCORE_deltaX 310 def clippath pathbbox newpath pop pop 36 add exch 36 add exch moveto 0 AGMCORE_deltaY rlineto AGMCORE_deltaX 0 rlineto 0 AGMCORE_deltaY neg rlineto AGMCORE_deltaX neg 0 rlineto closepath 0 AGMCORE_&setgray gsave 1 AGMCORE_&setgray fill grestore 1 setlinewidth gsave stroke grestore c currentpoint AGMCORE_deltaY 15 sub add exch 8 add exch moveto /AGMCORE_deltaY 12 def /AGMCORE_tmp 0 def AGMCORE_err_strings exch get { dup 32 eq { pop AGMCORE_str256 0 AGMCORE_tmp getinterval stringwidth pop currentpoint pop add AGMCORE_deltaX 28 add gt { currentpoint AGMCORE_deltaY sub exch pop clippath pathbbox pop pop pop 44 add exch moveto } if A AGMCORE_str256 0 AGMCORE_tmp getinterval show ( ) show 0 1 AGMCORE_str256 length 1 sub { AGMCORE_str256 exch 0 put }for /AGMCORE_tmp 0 def } { AGMCORE_str256 exch AGMCORE_tmp exch put /AGMCORE_tmp AGMCORE_tmp 1 add def } ifelse } forall } bdf /doc_setup{ A Adobe_AGM_Core begin /AGMCORE_will_host_separate xdf /AGMCORE_ps_version xdf / /AGMCORE_ps_level xdf errordict /AGM_handleerror known not{ errordict /AGM_handleerror errordict /handleerror get put errordict /handleerror { Adobe_AGM_Core begin $error /newerror get AGMCORE_cur_err null ne and{ $error /newerror false put AGMCORE_cur_err compose_error_msg }if $error /newerror true put end errordict /AGM_handleerror get exec } bind put } }if /AGMCORE_environ_ok ps_level AGMCORE_ps_level ge ps_version AGMCORE_ps_version ge and AGMCORE_ps_level -1 eq or d def AGMCORE_environ_ok not { {/AGMCORE_cur_err /AGMCORE_bad_environ def} if /AGMCORE_&setgray systemdict/setgray get def level2{ /AGMCORE_&setcolor systemdict/setcolor get def /AGMCORE_&setcolorspace systemdict/setcolorspace get def }if /AGMCORE_distilling /product where{ pop systemdict/setdistillerparams known product (Adobe PostScript Parser) ne and }{ false }ifelse def /AGMCORE_in_rip_sep /AGMCORE_in_rip_sep where{ pop AGMCORE_in_rip_sep }{ AGMCORE_distilling { false }{ userdict/Adobe_AGM_OnHost_Seps known{ false }{ level2{ currentpagedevice/Separations 2 copy known{ get }{ pop pop false }ifelse }{ false }ifelse }ifelse }ifelse }ifelse def level2 not{ /xput{ dup load dup length exch maxlength eq{ dup dup load dup length dup 0 eq {pop 1} if 2 mul dict copy def }if load begin def end }def }{ /xput{ load 3 1 roll put }def }ifelse /AGMCORE_GSTATE AGMCORE_key_known not{ /AGMCORE_GSTATE 21 dict def /AGMCORE_gstack 32 array def /AGMCORE_gstackptr 0 def /AGMCORE_gstacksaveptr 0 def / /AGMCORE_gstackframekeys 8 def /AGMCORE_&gsave /gsave ldf /AGMCORE_&grestore /grestore ldf /AGMCORE_&grestoreall /grestoreall ldf /AGMCORE_&save /save ldf /AGMCORE_gdictcopy { begin { def } forall end }def /AGMCORE_gput { AGMCORE_gstack AGMCORE_gstackptr get 3 1 roll put }def /AGMCORE_gget { AGMCORE_gstack AGMCORE_gstackptr get exch get }def /gsave { AGMCORE_&gsave AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gstackptr 1 add dup 32 ge {limitcheck} if Adobe_AGM_Core exch /AGMCORE_gstackptr exch put AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gdictcopy }def /grestore { AGMCORE_&grestore AGMCORE_gstackptr 1 sub dup AGMCORE_gstacksaveptr lt {1 add} if Adobe_AGM_Core exch /AGMCORE_gstackptr exch put }def /grestoreall { AGMCORE_&grestoreall Adobe_AGM_Core /AGMCORE_gstackptr AGMCORE_gstacksaveptr put }def /save { AGMCORE_&save AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gstackptr 1 add dup 32 ge {limitcheck} if Adobe_AGM_Core begin /AGMCORE_gstackptr exch def /AGMCORE_gstacksaveptr AGMCORE_gstackptr def end AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gdictcopy }def 0 1 AGMCORE_gstack length 1 sub { AGMCORE_gstack exch AGMCORE_gstackframekeys dict put } for }if /currentcmykcolor [0 0 0 0] AGMCORE_gput /currentstrokeadjust false AGMCORE_gput /currentcolorspace [/DeviceGray] AGMCORE_gput /sep_tint 0 AGMCORE_gput /sep_colorspace_dict null AGMCORE_gput /indexed_colorspace_dict null AGMCORE_gput /currentcolor_intent () AGMCORE_gput /customcolor_tint 1 AGMCORE_gput end }def /page_setup { /setcmykcolor where{ pop Adobe_AGM_Core/AGMCORE_&setcmykcolor /setcmykcolor load put }if Adobe_AGM_Core begin /setcmykcolor { 4 copy AGMCORE_cmykbuf astore /currentcmykcolor exch AGMCORE_gput 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor pop }ndf /currentcmykcolor { /currentcmykcolor AGMCORE_gget aload pop }ndf /setoverprint { pop }ndf /currentoverprint { false }ndf /AGMCORE_deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt def /AGMCORE_cyan_plate 1 0 0 0 test_cmyk_color_plate def /AGMCORE_magenta_plate 0 1 0 0 test_cmyk_color_plate def /AGMCORE_yellow_plate 0 0 1 0 test_cmyk_color_plate def /AGMCORE_black_plate 0 0 0 1 test_cmyk_color_plate def /AGMCORE_plate_ndx AGMCORE_cyan_plate{ 0 }{ AGMCORE_magenta_plate{ 1 }{ AGMCORE_yellow_plate{ 2 }{ AGMCORE_black_plate{ }{ 3 4 }ifelse }ifelse }ifelse }ifelse def /AGMCORE_composite_job AGMCORE_cyan_plate AGMCORE_magenta_plate and AGMCORE_yellow_plate and AGMCORE_black_plate and def A / /AGMCORE_producing_seps AGMCORE_composite_job not AGMCORE_in_rip_sep or def / /AGMCORE_host_sep AGMCORE_producing_seps AGMCORE_in_rip_sep not and def /AGM_preserve_spots /AGM_preserve_spots where{ pop AGM_preserve_spots }{ AGMCORE_distilling AGMCORE_producing_seps or }ifelse def /AGM_is_distiller_preserving_spotimages { currentdistillerparams/PreserveOverprintSettings known { currentdistillerparams/PreserveOverprintSettings get { currentdistillerparams/ColorConversionStrategy known { currentdistillerparams/ColorConversionStrategy get }{ }{ }{ /LeaveColorUnchanged eq true }ifelse false }ifelse false }ifelse }def /convert_spot_to_process where {pop}{ /convert_spot_to_process { dup dup (None) eq exch (All) eq or { pop false }{ AGMCORE_host_sep { gsave 1 0 0 0 setcmykcolor currentgray 0 1 0 0 setcmykcolor currentgray 0 0 1 0 setcmykcolor currentgray 0 0 0 1 setcmykcolor currentgray add add add 0 eq 1 1 1 1 exch exch exch exch sub sub sub sub { }{ setcustomcolor pop false false setoverprint 1 1 1 1 5 -1 roll findcmykcustomcolor 1 }{ currentgray 0 eq }ifelse grestore AGMCORE_distilling { pop AGM_is_distiller_preserving_spotimages not }{ Adobe_AGM_Core/AGMCORE_name xddf false currentpagedevice/OverrideSeparations known { currentpagedevice/OverrideSeparations get { /HqnSpots /ProcSet resourcestatus { pop pop pop true }if }if } }if { AGMCORE_name /HqnSpots /ProcSet findresource /TestSpot get exec not }{ gsave [/Separation AGMCORE_name /DeviceGray {}]setcolorspace false currentpagedevice/SeparationColorNames 2 copy known { get { AGMCORE_name eq or}forall not }{ pop pop pop true }ifelse grestore }ifelse }ifelse }ifelse }ifelse }def }ifelse /convert_to_process where {pop}{ /convert_to_process { dup length 0 eq { pop false }{ AGMCORE_host_sep { }def } }ifelse AGMCORE_host_sep AGMCORE_will_host_separate not and { /AGMCORE_cur_err /AGMCORE_color_space_onhost_seps def AGMCORE_color_space_onhost_seps }if /AGMCORE_avoid_L2_sep_space version cvr 2012 lt level2 and AGMCORE_producing_seps not and def /AGMCORE_is_cmyk_sep AGMCORE_cyan_plate AGMCORE_magenta_plate or AGMCORE_yellow_plate or AGMCORE_black_plate or def /AGM_avoid_0_cmyk where{ pop AGM_avoid_0_cmyk }{ AGM_preserve_spots userdict/Adobe_AGM_OnHost_Seps known userdict/Adobe_AGM_InRip_Seps known or not and }ifelse { /setcmykcolor[ { 4 copy add add add 0 eq currentoverprint and{ pop 0.0005 }if }/exec cvx /AGMCORE_&setcmykcolor load dup type/operatortype ne{ /exec cvx }if ]cvx def }if AGMCORE_host_sep{ /AGMCORE_get_ink_data AGMCORE_cyan_plate{ {pop pop pop} }{ AGMCORE_magenta_plate{ {4 3 roll pop pop pop} }{ AGMCORE_yellow_plate{ {4 2 roll pop pop pop} }{ true exch { convert_spot_to_process and } forall }{ false exch { convert_spot_to_process or } forall }ifelse }ifelse {4 1 roll pop pop pop} }ifelse }ifelse }ifelse def /clip AGMCORE_key_known not{ Adobe_AGM_Core/AGMCORE_&clip /clip load put /clip { current_spot_alias{ currentdict/InksUsed known{ [ InksUsed{ dup map_alias{ /Name get exch pop }if }forall ] /InksUsed xdf }if }if AGMCORE_&clip }def }if /eoclip AGMCORE_key_known not{ Adobe_AGM_Core/AGMCORE_&eoclip /eoclip load put /eoclip { current_spot_alias{ currentdict/InksUsed known{ [ InksUsed{ dup map_alias{ /Name get exch pop }if }forall ] /InksUsed xdf }if }if AGMCORE_&eoclip }def }if }if AGMCORE_in_rip_sep{ /setcustomcolor { exch aload pop dup 7 1 roll inRip_spot_has_ink not { 4 {4 index mul 4 1 roll} repeat /DeviceCMYK setcolorspace 6 -2 roll pop pop }{ Adobe_AGM_Core begin /AGMCORE_k xdf /AGMCORE_y xdf /AGMCORE_m xdf /AGMCORE_c xdf end [/Separation 4 -1 roll /DeviceCMYK {dup AGMCORE_c mul exch dup AGMCORE_m mul exch dup AGMCORE_y mul exch AGMCORE_k mul} ] setcolorspace }ifelse setcolor }ndf /setseparationgray { [/Separation (All) /DeviceGray {}] setcolorspace_opt 1 exch sub setcolor }ndf }{ /setseparationgray { AGMCORE_&setgray }ndf }ifelse /findcmykcustomcolor { 5 makereadonlyarray }ndf /setcustomcolor { exch aload pop pop 4 {4 index mul 4 1 roll} repeat setcmykcolor pop } }ndf /has_color /colorimage where{ AGMCORE_producing_seps{ pop true }{ systemdict eq }ifelse }{ false }ifelse d def /map_index { 1 index mul exch getinterval {255 div} forall } }def level2{ /mo /moveto ldf /li /lineto ldf /cv /curveto ldf /knockout_unitsq { 1 setgray 0 0 1 1 rectfill }def /level2ScreenFreq{ begin 60 HalftoneType 1 eq{ }def /currentScreenFreq{ currenthalftone level2ScreenFreq }def l level2 /setcolorspace AGMCORE_key_known not and{ /AGMCORE_&&&setcolorspace /setcolorspace ldf /AGMCORE_ReplaceMappedColor { dup type dup /arraytype eq exch /packedarraytype eq or { dup 0 get dup /Separation eq { pop dup length array copy dup dup 1 get current_spot_alias { dup map_alias { begin /sep_colorspace_dict currentdict pop pop [ p pop pop Frequency }if HalftoneType 2 eq{ pop GrayFrequency }if HalftoneType 5 eq{ pop Default level2ScreenFreq }if end AGMCORE_gput ] dup Name end /Separation Name CSA map_csa dup /MappedCSA xdf /sep_colorspace_proc load }{ }if }if map_reserved_ink_name 1 exch put /DeviceN eq { dup length array copy dup dup 1 get [ exch { current_spot_alias{ dup map_alias{ /Name get exch pop }if }if map_reserved_ink_name } forall ] 1 exch put }if }ifelse }if }def /setcolorspace { dup type dup /arraytype eq exch /packedarraytype eq or { dup 0 get /Indexed eq { AGMCORE_distilling { /PhotoshopDuotoneList where { pop false }{ true }ifelse }{ true }ifelse { aload pop 3 -1 roll AGMCORE_ReplaceMappedColor 3 1 roll 4 array astore }if }{ AGMCORE_ReplaceMappedColor }ifelse }if AGMCORE_&&&setcolorspace }def } }{ } }if /adj { }def /mo{ }def /li{ }def /cv{ currentstrokeadjust{ transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform }if adj moveto adj lineto 6 2 roll adj 6 2 roll adj 6 2 roll adj curveto }def /knockout_unitsq { 1 setgray 8 8 1 [8 0 0 8 0 0] {<ffffffffffffffff>} image }def /currentstrokeadjust{ /currentstrokeadjust AGMCORE_gget }def /setstrokeadjust{ /currentstrokeadjust exch AGMCORE_gput }def /currentScreenFreq{ currentscreen pop pop }def /setcolorspace { /currentcolorspace exch AGMCORE_gput } def /currentcolorspace { /currentcolorspace AGMCORE_gget } def /n_color_components { dup type /arraytype eq{ 0 get }if dup /DeviceGray eq{ pop 1 }{ /DeviceCMYK eq{ 4 }{ 3 }ifelse }ifelse } def /setcolor_devicecolor { dup type /arraytype eq{ 0 get }if dup /DeviceGray eq{ pop setgray }{ /DeviceCMYK eq{ setcmykcolor }{ setrgbcolor }ifelse }ifelse } }def /setcolor { currentcolorspace 0 get dup /DeviceGray ne{ dup /DeviceCMYK ne{ dup /DeviceRGB ne{ dup /Separation eq{ }{ pop currentcolorspace 3 get exec currentcolorspace 2 get dup /Indexed eq{ pop currentcolorspace 3 get dup type currentcolorspace 1 get }{ 3 -1 roll map_index /stringtype eq{ n_color_components }{ /AGMCORE_invalid_color_space def exec }ifelse currentcolorspace 1 get /AGMCORE_cur_err }if }if AGMCORE_invalid_color_space }ifelse }ifelse } def } }ifelse }if setcolor_devicecolor /sop /setoverprint ldf /lw /setlinewidth ldf /lc /setlinecap ldf /lj /setlinejoin ldf /ml /setmiterlimit ldf /dsh /setdash ldf /sadj /setstrokeadjust ldf /gry /setgray ldf /rgb /setrgbcolor ldf /cmyk /setcmykcolor ldf /sep /setsepcolor ldf /idx /setindexedcolor ldf /colr /setcolor ldf /csacrd /set_csa_crd ldf /sepcs /setsepcolorspace ldf /idxcs /setindexedcolorspace ldf /cp /closepath ldf /clp /clp_npth ldf /eclp /eoclp_npth ldf /spclp /stkpath_clp_npth ldf /f /fill ldf /ef /eofill ldf /s /stroke ldf /sclp /stk_n_clp_npth ldf /nclp /npth_clp ldf /gset /graphic_setup ldf / /gcln /graphic_cleanup ldf currentdict{ dup xcheck 1 index type dup /arraytype eq exch /packedarraytype eq or and { }if def }forall bind }def /page_trailer { end }def /doc_trailer{ }def systemdict /findcolorrendering known{ /findcolorrendering systemdict /findcolorrendering get def }if systemdict /setcolorrendering known{ /setcolorrendering systemdict /setcolorrendering get def }if /test_cmyk_color_plate { gsave setcmykcolor currentgray 1 ne grestore }def /inRip_spot_has_ink { dup Adobe_AGM_Core/AGMCORE_name xddf convert_spot_to_process not }def /current_ink { dup length 0 eq{ pop true }{ Adobe_AGM_Core/ink_result false put { dup /ProcessCyan eq{ AGMCORE_cyan_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessMagenta eq{ AGMCORE_magenta_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessYellow eq{ AGMCORE_yellow_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessBlack eq{ AGMCORE_black_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /sep_colorspace_dict AGMCORE_gget dup null eq{ pop false ink_result or Adobe_AGM_Core/ink_result xddf }{ /Name get eq{ 1 setsepcolor currentgray 1 ne ink_result or Adobe_AGM_Core/ink_result xddf Adobe_AGM_Core/ink_result xddf }{ false ink_result or }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse pop } forall ink_result }ifelse }def /map255_to_range { 1 index sub 3 -1 roll 255 div mul add }def /set_csa_crd { /sep_colorspace_dict null AGMCORE_gput begin CSA map_csa setcolorspace_opt set_crd end } def /setsepcolor { /sep_colorspace_dict AGMCORE_gget begin dup /sep_tint exch AGMCORE_gput TintProc end } def /sep_colorspace_proc { Adobe_AGM_Core/AGMCORE_tmp xddf /sep_colorspace_dict AGMCORE_gget begin currentdict/Components known{ Components aload pop TintMethod/Lab eq{ 2 {AGMCORE_tmp mul NComponents 1 roll} repeat LMax sub AGMCORE_tmp mul LMax add NComponents 1 roll }{ TintMethod/Subtractive eq{ NComponents{ AGMCORE_tmp mul NComponents 1 roll }repeat }{ NComponents{ 1 sub AGMCORE_tmp mul 1 add NComponents 1 roll } repeat }ifelse }ifelse }{ ColorLookup AGMCORE_tmp ColorLookup length 1 sub mul round cvi get } def /sep_colorspace_gray_proc { Adobe_AGM_Core/AGMCORE_tmp xddf /sep_colorspace_dict AGMCORE_gget begin GrayLookup AGMCORE_tmp GrayLookup length 1 sub mul round cvi get end } def /sep_proc_name { dup 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or level2 not and has_color not and{ pop [/DeviceGray] /sep_colorspace_gray_proc }{ /sep_colorspace_proc }ifelse } def /setsepcolorspace { current_spot_alias{ dup begin Name map_alias{ exch pop }if end }if dup /sep_colorspace_dict exch AGMCORE_gput begin /MappedCSA CSA map_csa def A Adobe_AGM_Core/AGMCORE_sep_special Name dup () eq exch (All) eq or ddf AGMCORE_avoid_L2_sep_space{ [/Indexed MappedCSA sep_proc_name 255 exch { 255 div } /exec cvx 3 -1 roll [ 4 1 roll load /exec cvx ] cvx ] setcolorspace_opt /TintProc { 255 mul round cvi setcolor }bdf }{ MappedCSA 0 get /DeviceCMYK eq currentdict/Components known and AGMCORE_sep_special not and{ /TintProc [ Components aload pop Name findcmykcustomcolor /exch cvx /setcustomcolor cvx ] cvx bdf }{ AGMCORE_host_sep Name (All) eq and{ /TintProc { 1 exch sub setseparationgray }bdf }{ AGMCORE_in_rip_sep MappedCSA 0 get /DeviceCMYK eq and AGMCORE_host_sep or aload pop }ifelse end eq{ Name () eq and{ /TintProc [ MappedCSA sep_proc_name exch 0 get /DeviceCMYK }{ cvx /setcmykcolor cvx }{ cvx /setgray cvx }ifelse ] cvx bdf AGMCORE_producing_seps MappedCSA 0 get dup /DeviceCMYK eq exch /DeviceGray eq or and AGMCORE_sep_special not and{ /TintProc [ /dup cvx MappedCSA sep_proc_name cvx exch 0 get /DeviceGray eq{ 1 /exch cvx /sub cvx 0 0 0 4 -1 /roll cvx }if /Name cvx /findcmykcustomcolor cvx /exch c cvx AGMCORE_host_sep{ AGMCORE_is_cmyk_sep }{ Name inRip_spot_has_ink not }ifelse { /pop cvx 1 }if /setcustomcolor cvx ] cvx bdf }{ / /TintProc /setcolor ldf [/Separation Name MappedCSA sep_proc_name load ] setcolorspace_opt }ifelse }ifelse }ifelse }ifelse }ifelse set_crd setsepcolor end } def /setindexedcolorspace { dup /indexed_colorspace_dict exch AGMCORE_gput begin /MappedCSA CSA map_csa def AGMCORE_host_sep level2 not and{ 0 0 0 0 setcmykcolor }{ [/Indexed MappedCSA level2 not has_color not and{ dup 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or{ pop [/DeviceGray] }if }{ HiVal GrayLookup HiVal currentdict/RangeArray known{ { /indexed_colorspace_dict AGMCORE_gget begin Lookup exch dup HiVal gt{ pop HiVal }if NComponents mul NComponents getinterval {} NComponents 1 sub -1 0{ RangeArray exch 2 mul 2 getinterval aload forall pop map255_to_range NComponents 1 roll }for end } bind }{ Lookup }ifelse }ifelse ] setcolorspace_opt set_crd }ifelse end }def /setindexedcolor { AGMCORE_host_sep{ /indexed_colorspace_dict AGMCORE_gget/Lookup get 4 3 -1 roll map_index setcmykcolor }{ setcolor }ifelse } def /ignoreimagedata { currentoverprint not{ gsave dup begin 1 setgray 0 0 ImageMatrix itransform Width Height ImageMatrix idtransform rectfill end grestore }if consumeimagedata }def /add_csa { Adobe_AGM_Core begin /AGMCORE_CSA_cache xput end }def /map_csa { }def /add_csd { Adobe_AGM_Core begin /AGMCORE_CSD_cache xput end }def /get_csd { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_CSD_cache get exch get }if }def /get_csd_by_name { dup type dup /nametype eq exch /stringtype eq or{ Adobe_AGM_Core begin /AGMCORE_CSD_Name xdf AGMCORE_CSD_cache { dup /Name get AGMCORE_CSD_Name eq { exch pop exit }{ pop }ifelse pop }forall end }if }def /cachepattern_level2 { 4 dict begin /comparebuffer exch def /holdbuffer exch def /readbuffer 1024 string def /LZWFilter holdbuffer /LZWEncode filter def { currentfile readbuffer readline not {pop exit} if dup LZWFilter exch writestring LZWFilter (\n) writestring comparebuffer eq {exit} if }loop LZWFilter closefile end }def /cachepattern_level3 { 3 dict begin /comparebuffer exch def /readbuffer 1024 string def dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_CSA_cache get exch get }if /DoEOL false def { DoEOL { (\n) /DoEOL false def } { currentfile readbuffer readline not {pop ()} { dup length 0 eq { pop(\n)} { dup comparebuffer eq {pop ()} {/DoEOL true def} ifelse } ifelse } ifelse } ifelse } /ReusableStreamDecode filter end }def /add_pattern { Adobe_AGM_Core begin /AGMCORE_pattern_cache xput end }def /get_pattern { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_pattern_cache get exch get }if }def /make_pattern { dup matrix currentmatrix matrix concatmatrix 0 0 3 2 roll itransform exch 3 index /XStep get 1 index exch 2 copy div cvi mul sub sub exch 3 index /YStep get 1 index exch 2 copy div cvi mul sub sub matrix translate exch matrix concatmatrix makepattern }def /exec_file statusdict /currentfilenameextend known{ { 0 () /SubFileDecode filter cvx exec } } }{ {cvx exec} }ifelse def /set_pattern { dup /PatternType get 1 eq{ dup /PaintType get 1 eq{ false sop [/DeviceGray] setcolorspace 0 setgray }if }if setpattern }def /setcolorspace_opt { dup currentcolorspace eq{ pop }{ setcolorspace }ifelse }def /updatecolorrendering { currentcolorrendering/Intent known{ currentcolorrendering/Intent get }{ null } }ifelse Intent ne{ false Intent AGMCORE_CRD_cache { exch pop begin dup Intent eq{ currentdict setcolorrendering_opt end e exch pop true exch exit }if end } forall pop not{ systemdict /findcolorrendering known{ Intent findcolorrendering pop /ColorRendering findresource dup length dict copy setcolorrendering_opt }if }if }if } def /add_crd { AGMCORE_CRD_cache 3 1 roll put }def /set_crd { AGMCORE_host_sep not level2 and{ currentdict/CRD known{ AGMCORE_CRD_cache CRD get dup null ne{ setcolorrendering_opt }{ }{ pop }ifelse currentdict/Intent known{ updatecolorrendering }if }ifelse }if }def /setcolorrendering_opt { dup currentcolorrendering eq{ pop }{ begin /Intent Intent def currentdict end setcolorrendering }ifelse }def /cdndf { exch dup currentdict exch known{ pop pop }{ exch def }ifelse }def /cpaint_gcomp { convert_to_process Adobe_AGM_Core/AGMCORE_ConvertToProcess xddf Adobe_AGM_Core/AGMCORE_ConvertToProcess get not { (%end_cpaint_gcomp) flushinput }if }def /cpaint_gsep { Adobe_AGM_Core/AGMCORE_ConvertToProcess get { (%end_cpaint_gsep) flushinput }if }def /cpaint_gend { newpath }def /AGMCORE_ctm_stack bdict /push_ctm { stack length size le{ stack dup length 2 mul array dup /stack exch def copy pop }if stack size 3 -1 roll put /size size 1 add def } edict def /save_ctm { matrix currentmatrix AGMCORE_ctm_stack begin push_ctm end }def /restore_ctm { AGMCORE_ctm_stack begin pop_ctm end setmatrix }def /path_rez { dup 0 ne{ AGMCORE_deviceDPI exch div dup 1 lt{ pop 1 }if setflat }{ pop } }ifelse }def /rdcmntline { currentfile AGMCORE_str256 readline pop (%) anchorsearch {pop} if } def /set_spot_alias_ary { /AGMCORE_SpotAliasAry where{ pop pop }{ Adobe_AGM_Core/AGMCORE_SpotAliasAry xddf true set_spot_alias }ifelse }def /set_spot_alias { /AGMCORE_SpotAliasAry where{ /AGMCORE_current_spot_alias 3 -1 roll put }{ pop }ifelse }def /current_spot_alias { /pop_ctm { /size size 1 sub def size 0 lt{ /size 0 def }if stack size get } /stack 1 array /size 0 }def /map_alias { /AGMCORE_SpotAliasAry where{ begin /AGMCORE_name xdf f false AGMCORE_SpotAliasAry{ dup/Name get AGMCORE_name eq{ save exch /Adobe_AGM_Core currentdict def /CSD get get_csd exch restore exch pop true exit }{ pop }ifelse }forall end }{ pop false }ifelse }bdf /spot_alias { t true set_spot_alias /AGMCORE_&setcustomcolor AGMCORE_key_known not { Adobe_AGM_Core/AGMCORE_&setcustomcolor /setcustomcolor load put } if / /customcolor_tint 1 AGMCORE_gput Adobe_AGM_Core begin /setcustomcolor { d dup /customcolor_tint exch AGMCORE_gput current_spot_alias{ 1 index 4 get map_alias{ mark 3 1 roll setsepcolorspace counttomark 0 ne{ setsepcolor }if pop pop }{ AGMCORE_&setcustomcolor }ifelse }{ AGMCORE_&setcustomcolor }ifelse /AGMCORE_SpotAliasAry where{ /AGMCORE_current_spot_alias get }{ false }ifelse }bdf end }def /begin_feature { Adobe_AGM_Core/AGMCORE_feature_dictCount countdictstack put count Adobe_AGM_Core/AGMCORE_feature_opCount 3 -1 roll put {Adobe_AGM_Core/AGMCORE_feature_ctm matrix currentmatrix put}if }def /end_feature { 2 dict begin /spd /setpagedevice load def /setpagedevice { get_gstate spd set_gstate } def stopped{$error/newerror false put}if end count Adobe_AGM_Core/AGMCORE_feature_opCount get sub dup 0 gt{{pop}repeat} {pop}ifelse countdictstack Adobe_AGM_Core/AGMCORE_feature_dictCount get sub dup 0 gt{{end}repeat}{pop}ifelse {Adobe_AGM_Core/AGMCORE_feature_ctm get setmatrix}if }def /set_negative { Adobe_AGM_Core begin /AGMCORE_inverting exch def level2{ currentpagedevice/NegativePrint known{ currentpagedevice/NegativePrint get Adobe_AGM_Core/AGMCORE_inverting get ne{ true begin_feature true{ bdict /NegativePrint Adobe_AGM_Core/AGMCORE_inverting get edict setpagedevice }end_feature }if /AGMCORE_inverting false def }if }if AGMCORE_inverting{ [{1 exch sub}/exec load dup currenttransfer exch]cvx bind settransfer gsave newpath clippath 1 /setseparationgray where{pop setseparationgray}{setgray}ifelse fill grestore }if end }def /lw_save_restore_override { /md where { pop md begin currentdict /lw_initializepage known not { /lw_initializepage /initializepage load def /initializepage { lw_initializepage /initializepage {} def }def }if /pmSVsetup{} def /endp{}def /pse{}def /psb{}def /orig_showpage where {pop} {/orig_showpage /showpage load def} ifelse /showpage {orig_showpage gR} def end }if }def /pscript_showpage_override { /NTPSOct95 where { begin showpage save /showpage /restore load def /restore {exch pop}def end }if }def /driver_media_override { /md where { pop md /initializepage known { md /initializepage {} put } if md /rC known { md /rC {4{pop}repeat} put } if } }if Adobe_AGM_Core /AGMCORE_Default_CTM matrix currentmatrix put }def /driver_check_media_override { Adobe_AGM_Core /AGMCORE_Default_CTM get matrix currentmatrix ne { Adobe_AGM_Core /AGMCORE_Default_CTM get setmatrix }if }def AGMCORE_err_strings begin /AGMCORE_bad_environ (Environment not satisfactory for this job. Ensure that the PPD is correct or that the PostScript level requested is supported by this printer. ) def /AGMCORE_color_space_onhost_seps (This job contains colors that will not separate with on-host methods. ) def /AGMCORE_invalid_color_space (This job contains an invalid color space. ) def end end systemdict /setpacking known { setpacking } if %%EndResource %%BeginResource: procset Adobe_CoolType_Core 2.12 0 %%Copyright: Copyright 1997-2001 Adobe Systems Incorporated. All Rights Reserved. %%Version: 2.12 0 userdict/Adobe_CoolType_Core 60 dict dup begin put/Level2? systemdict /languagelevel known dup{pop systemdict/languagelevel get 2 ge}if def Level2? not{/currentglobal false def/setglobal/pop load def/gcheck{pop false}bind def /currentpacking false def/setpacking/pop load def/SharedFontDirectory 0 dict def}if currentpacking true setpacking/@_SaveStackLevels{Adobe_CoolType_Data begin @opStackCountByLevel @opStackLevel 2 copy known not{2 copy 3 dict dup /args 7 index 5 add array put put get}{get dup/args get dup length 3 index lt{ dup length 5 add array exch 1 index exch 0 exch putinterval 1 index exch/args exch put}{pop}ifelse}ifelse begin count 2 sub 1 index lt{pop count 1 sub}if dup/argCount exch def dup 0 gt{exch 1 index 2 add 1 roll args exch 0 exch getinterval astore pop}{pop}ifelse count 1 sub/restCount exch def end /@opStackLevel @opStackLevel 1 add def countdictstack 1 sub @dictStackCountByLevel exch @dictStackLevel exch put/@dictStackLevel @dictStackLevel 1 add def end}bind def/@_RestoreStackLevels{ Adobe_CoolType_Data begin/@opStackLevel @opStackLevel 1 sub def @opStackCountByLevel @opStackLevel get begin count restCount sub dup 0 gt{{pop }repeat}{pop}ifelse args 0 argCount getinterval{}forall end/@dictStackLevel @dictStackLevel 1 sub def @dictStackCountByLevel @dictStackLevel get end countdictstack exch sub dup 0 gt{{end}repeat}{pop}ifelse}bind def /@_PopStackLevels{Adobe_CoolType_Data begin/@opStackLevel @opStackLevel 1 sub def/@dictStackLevel @dictStackLevel 1 sub def end}bind def/@Raise{exch cvx exch errordict exch get exec stop}bind def/@ReRaise{cvx $error/errorname get errordict exch get exec stop}bind def/@Stopped{0 @#Stopped}bind def/@#Stopped{ @_SaveStackLevels stopped{@_RestoreStackLevels true}{@_PopStackLevels false} ifelse}bind def/@Arg{Adobe_CoolType_Data begin @opStackCountByLevel @opStackLevel 1 sub get/args get exch get end}bind def/doc_setup{ Adobe_CoolType_Core begin/mov/moveto load def/nfnt/newencodedfont load def /mfnt/makefont load def/sfnt/setfont load def/ufnt/undefinefont load def/chp /charpath load def/awsh/awidthshow load def/wsh/widthshow load def/ash/ashow load def/sh/show load def end userdict/Adobe_CoolType_Data 6 dict dup begin /AddWidths? false def/CC 0 def/charcode 2 string def/@opStackCountByLevel 32 dict def/@opStackLevel 0 def/@dictStackCountByLevel 32 dict def /@dictStackLevel 0 def end put}bind def/doc_trailer{currentdict Adobe_CoolType_Core eq{end}if}bind def/page_setup{Adobe_CoolType_Core begin} bind def/page_trailer{end}bind def/unload{systemdict/languagelevel known{ systemdict/languagelevel get 2 ge{userdict/Adobe_CoolType_Core 2 copy known{ undef}{pop pop}ifelse}if}if}bind def/ndf{1 index where{pop pop pop}{dup xcheck {bind}if def}ifelse}def/findfont dup systemdict begin userdict begin /globaldict where{/globaldict get begin}if dup where pop exch get/globaldict where{pop end}if end end def/systemfindfont/findfont load def/undefinefont{pop }ndf/copyfont{currentglobal 3 1 roll 1 index gcheck setglobal dup null eq{0}{ dup length}ifelse 2 index length add 1 add dict begin exch{1 index/FID eq{pop pop}{def}ifelse}forall dup null eq{pop}{{def}forall}ifelse currentdict end exch setglobal}bind def/copyarray{currentglobal exch dup gcheck setglobal dup length array copy exch setglobal}bind def/newencodedfont{currentglobal{ SharedFontDirectory 3 index known{SharedFontDirectory 3 index get /FontReferenced known}{false}ifelse}{FontDirectory 3 index known{FontDirectory 3 index get/FontReferenced known}{SharedFontDirectory 3 index known{ SharedFontDirectory 3 index get/FontReferenced known}{false}ifelse}ifelse} ifelse dup{3 index findfont/FontReferenced get 2 index findfont ne{pop false} if}if{pop 1 index findfont/Encoding get exch 0 1 255{2 copy get 3 index 3 1 roll put}for pop pop pop}{findfont dup dup maxlength 2 add dict begin exch{1 index/FID ne{def}{pop pop}ifelse}forall/FontReferenced exch def/Encoding exch dup length array copy def/FontName 1 index dup type/stringtype eq{cvn}if def currentdict end definefont pop}ifelse}bind def/SetSubstituteStrategy{ $SubstituteFont begin dup type/dicttype ne{0 dict}if currentdict/$Strategies known{exch $Strategies exch 2 copy known{get 2 copy maxlength exch maxlength add dict begin{def}forall{def}forall currentdict dup/$Init known{dup/$Init get exec}if end/$Strategy exch def}{pop pop pop}ifelse}{pop pop}ifelse end}bind def/scff{$SubstituteFont begin dup type/stringtype eq{dup length exch}{null} ifelse/$sname exch def/$slen exch def end{findfont}@Stopped{dup length dup 21 add string dup 4 3 roll 0 exch 128 string cvs putinterval exch 1 index exch (_was-malformed-so-was)putinterval cvn{findfont}@Stopped{pop/Courier findfont} if}if $SubstituteFont begin/$sname null def/$slen 0 def end}bind def /isWidthsOnlyFont{dup/WidthsOnly known{pop pop true}{dup/FDepVector known{ /FDepVector get{isWidthsOnlyFont dup{exit}if}forall}{dup/FDArray known{ /FDArray get{isWidthsOnlyFont dup{exit}if}forall}{pop}ifelse}ifelse}ifelse} bind def/?set{$SubstituteFont begin/$substituteFound false def/$fontname 4 index def/$doSmartSub false def end 3 index findfont $SubstituteFont begin $substituteFound{false}{dup/FontName known{dup/FontName get $fontname eq 1 index/DistillerFauxFont known not and/currentdistillerparams where{pop false 2 index isWidthsOnlyFont not and}if}{false}ifelse}ifelse exch pop/$doSmartSub true def end{exch pop exch pop exch 2 dict dup/Found 3 index put exch findfont exch}{exch exec exch findfont 2 dict dup/Downloaded 6 5 roll put}ifelse dup /FontName 4 index put copyfont definefont pop}bind def/?str1 256 string def /?str2 256 string def/?add{1 index type/integertype eq{exch true 4 2}{false 3 1}ifelse roll 1 index findfont dup/Widths known{Adobe_CoolType_Data/AddWidths? true put gsave dup 1000 scalefont setfont}if/Downloaded known{exec exch{exch ?str2 cvs exch findfont/Downloaded get 1 dict begin/Downloaded 1 index def ?str1 cvs length ?str1 1 index 1 add 3 index putinterval exch length 1 add 1 index add ?str1 2 index(*)putinterval ?str1 0 2 index getinterval cvn findfont ?str1 3 index(+)putinterval 2 dict dup/FontName ?str1 0 6 index getinterval cvn put dup/Downloaded Downloaded put end copyfont dup/FontName get exch definefont pop pop pop}{pop}ifelse}{pop exch{findfont dup/Found get dup length exch ?str1 cvs pop ?str1 1 index(+)putinterval ?str1 1 index 1 add 4 index ?str2 cvs putinterval ?str1 exch 0 exch 5 4 roll ?str2 cvs length 1 add add getinterval cvn 1 dict exch 1 index exch/FontName exch put copyfont dup /FontName get exch definefont pop}{pop}ifelse}ifelse Adobe_CoolType_Data /AddWidths? get{grestore Adobe_CoolType_Data/AddWidths? false put}if}bind def /?sh{currentfont/Downloaded known{exch}if pop}bind def/?chp{currentfont /Downloaded known{pop}{false chp}ifelse}bind def/?mv{currentfont/Downloaded known{moveto pop pop}{pop pop moveto}ifelse}bind def setpacking userdict /$SubstituteFont 25 dict put 1 dict begin/SubstituteFont dup $error exch 2 copy known{get}{pop pop{pop/Courier}bind}ifelse def/currentdistillerparams where dup{pop pop currentdistillerparams/CannotEmbedFontPolicy 2 copy known{ get/Error eq}{pop pop false}ifelse}if not{countdictstack array dictstack 0 get begin userdict begin $SubstituteFont begin/$str 128 string def/$fontpat 128 string def/$slen 0 def/$sname null def/$match false def/$fontname null def /$substituteFound false def/$doSmartSub true def/$depth 0 def/$fontname null def/$italicangle 26.5 def/$dstack null def/$Strategies 10 dict dup begin /$Type3Underprint{currentglobal exch false setglobal 11 dict begin/UseFont exch $WMode 0 ne{dup length dict copy dup/WMode $WMode put/UseFont exch definefont}if def/FontName $fontname dup type/stringtype eq{cvn}if def /FontType 3 def/FontMatrix[.001 0 0 .001 0 0]def/Encoding 256 array dup 0 1 255{/.notdef put dup}for pop def/FontBBox[0 0 0 0]def/CCInfo 7 dict dup begin /cc null def/x 0 def/y 0 def end def/BuildChar{exch begin CCInfo begin 1 string dup 0 3 index put exch pop/cc exch def UseFont 1000 scalefont setfont cc stringwidth/y exch def/x exch def x y setcharwidth $SubstituteFont /$Strategy get/$Underprint get exec 0 0 moveto cc show x y moveto end end}bind def currentdict end exch setglobal}bind def/$GetaTint 2 dict dup begin /$BuildFont{dup/WMode known{dup/WMode get}{0}ifelse/$WMode exch def $fontname exch dup/FontName known{dup/FontName get dup type/stringtype eq{cvn}if}{ /unnamedfont}ifelse exch $deepcopyfont exch 1 index exch/FontBasedOn exch put dup/FontName $fontname dup type/stringtype eq{cvn}if put definefont}bind def /$Underprint{gsave x abs y abs gt{/y 1000 def}{/x -1000 def 500 120 translate} ifelse Level2?{[/Separation(All)/DeviceCMYK{0 0 0 1 pop}]setcolorspace}{0 setgray}ifelse 10 setlinewidth x .8 mul[7 3]{y mul 8 div 120 sub x 10 div exch moveto 0 y 4 div neg rlineto dup 0 rlineto 0 y 4 div rlineto closepath gsave Level2?{.2 setcolor}{.8 setgray}ifelse fill grestore stroke}forall pop grestore}bind def end def/$Oblique 1 dict dup begin/$BuildFont{currentglobal exch dup gcheck setglobal null copyfont begin/FontBasedOn currentdict/FontName known{FontName dup type/stringtype eq{cvn}if}{/unnamedfont}ifelse def/FontName $fontname dup type/stringtype eq{cvn}if def/currentdistillerparams where{pop}{ /FontInfo currentdict/FontInfo known{FontInfo null copyfont}{2 dict}ifelse dup begin/ItalicAngle $italicangle def/FontMatrix FontMatrix[1 0 ItalicAngle dup sin exch cos div 1 0 0]matrix concatmatrix readonly end 4 2 roll def def} ifelse FontName currentdict end definefont exch setglobal}bind def end def /$None 1 dict dup begin/$BuildFont{}bind def end def end def/$Oblique SetSubstituteStrategy/$findfontByEnum{dup type/stringtype eq{cvn}if dup /$fontname exch def $sname null eq{$str cvs dup length $slen sub $slen getinterval}{pop $sname}ifelse $fontpat dup 0(fonts/*)putinterval exch 7 exch putinterval/$match false def $SubstituteFont/$dstack countdictstack array dictstack put mark{$fontpat 0 $slen 7 add getinterval{/$match exch def exit} $str filenameforall}stopped{cleardictstack currentdict true $SubstituteFont /$dstack get{exch{1 index eq{pop false}{true}ifelse}{begin false}ifelse}forall pop}if cleartomark/$slen 0 def $match false ne{$match(fonts/)anchorsearch pop pop cvn}{/Courier}ifelse}bind def/$ROS 1 dict dup begin/Adobe 4 dict dup begin /Japan1[/Ryumin-Light/HeiseiMin-W3/GothicBBB-Medium/HeiseiKakuGo-W5 /HeiseiMaruGo-W4/Jun101-Light]def/Korea1[/HYSMyeongJo-Medium/HYGoThic-Medium] def/GB1[/STSong-Light/STHeiti-Regular]def/CNS1[/MKai-Medium/MHei-Medium]def end def end def/$cmapname null def/$deepcopyfont{dup/FontType get 0 eq{1 dict dup/FontName/copied put copyfont begin/FDepVector FDepVector copyarray 0 1 2 index length 1 sub{2 copy get $deepcopyfont dup/FontName/copied put/copied exch definefont 3 copy put pop pop}for def currentdict end}{$Strategies /$Type3Underprint get exec}ifelse}bind def/$buildfontname{length $str 1 index (-)putinterval 1 add $str 1 index $cmapname $fontpat cvs putinterval $cmapname length add $str exch 0 exch getinterval cvn}bind def/$findfontByROS{/$fontname exch def $ROS Registry 2 copy known{get Ordering 2 copy known{get}{pop pop[]} ifelse}{pop pop[]}ifelse false exch{dup/CIDFont resourcestatus{pop pop save 1 index/CIDFont findresource dup/WidthsOnly known{dup/WidthsOnly get}{false} ifelse exch pop exch restore{pop}{exch pop true exit}ifelse}{pop}ifelse}forall {$str cvs $buildfontname}{false(*){save exch dup/CIDFont findresource dup /WidthsOnly known{dup/WidthsOnly get not}{true}ifelse exch/CIDSystemInfo get dup/Registry get Registry eq exch/Ordering get Ordering eq and and{exch restore exch pop true exit}{pop restore}ifelse}$str/CIDFont resourceforall{ $buildfontname}{$fontname $findfontByEnum}ifelse}ifelse}bind def end end currentdict/$error known currentdict/languagelevel known and dup{pop $error /SubstituteFont known}if dup{$error}{Adobe_CoolType_Core}ifelse begin{ /SubstituteFont/CMap/Category resourcestatus{pop pop{$SubstituteFont begin /$substituteFound true def dup length $slen gt $sname null ne or $slen 0 gt and{$sname null eq{dup $str cvs dup length $slen sub $slen getinterval cvn}{ $sname}ifelse dup/CMap resourcestatus{pop pop dup/$cmapname exch def/CMap findresource/CIDSystemInfo get{def}forall $findfontByROS}{128 string cvs dup (-)search{3 1 roll search{3 1 roll pop{dup cvi}stopped{pop pop pop pop pop $findfontByEnum}{4 2 roll pop pop exch length exch 2 index length 2 index sub exch 1 sub -1 0{$str cvs dup length 4 index 0 4 index 4 3 roll add getinterval exch 1 index exch 3 index exch putinterval dup/CMap resourcestatus{pop pop 4 1 roll pop pop pop dup/$cmapname exch def/CMap findresource/CIDSystemInfo get{ def}forall $findfontByROS true exit}{pop}ifelse}for dup type/booleantype eq{ pop}{pop pop $findfontByEnum}ifelse}ifelse}{pop pop pop $findfontByEnum}ifelse }{pop pop $findfontByEnum}ifelse}ifelse}{//SubstituteFont exec}ifelse/$slen 0 def end}}{{$SubstituteFont begin/$substituteFound true def dup length $slen gt $sname null ne or $slen 0 gt and{$findfontByEnum}{//SubstituteFont exec}ifelse end}}ifelse bind readonly def Adobe_CoolType_Core/scfindfont/systemfindfont load put}{/scfindfont{$SubstituteFont begin dup systemfindfont dup/FontName known{dup/FontName get dup 3 index ne}{/noname true}ifelse dup{ /$origfontnamefound 2 index def/$origfontname 4 index def/$substituteFound true def}if exch pop{$slen 0 gt $sname null ne 3 index length $slen gt or and{ pop dup $findfontByEnum findfont dup maxlength 1 add dict begin{1 index/FID eq {pop pop}{def}ifelse}forall currentdict end definefont dup/FontName known{dup /FontName get}{null}ifelse $origfontnamefound ne{$origfontname $str cvs print ( substitution revised, using )print dup/FontName known{dup/FontName get}{ (unspecified font)}ifelse $str cvs print(. )print}if}{exch pop}ifelse}{exch pop}ifelse end}bind def}ifelse end end Adobe_CoolType_Core/findfont{$SubstituteFont begin $depth 0 eq{/$fontname 1 index dup type/stringtype ne{$str cvs}if def/$substituteFound false def}if /$depth $depth 1 add def end scfindfont $SubstituteFont begin/$depth $depth 1 sub def $substituteFound $depth 0 eq and $doSmartSub and{currentdict/$Strategy known{$Strategy/$BuildFont get exec}if}if end}bind put}if end end %%EndResource %%BeginResource: procset Adobe_CoolType_Utility_MAKEOCF 1.13 0 %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. %%Version: 1.13 0 systemdict/languagelevel known dup{currentglobal false setglobal}{false}ifelse exch userdict/Adobe_CoolType_Utility 2 copy known{2 copy get dup maxlength 25 add dict copy}{25 dict}ifelse put Adobe_CoolType_Utility begin/ct_Level2? exch def/ct_Clone? 1183615869 internaldict dup/CCRun known not exch/eCCRun known not ct_Level2? and or def/ct_UseNativeCapability? systemdict/composefont known def/ct_MakeOCF 35 dict def/ct_Vars 25 dict def/ct_GlyphDirProcs 6 dict def /ct_BuildCharDict 15 dict dup begin/charcode 2 string def/dst_string 1500 string def/nullstring()def/usewidths? true def end def ct_Level2?{setglobal}{ pop}ifelse ct_GlyphDirProcs begin/GetGlyphDirectory{systemdict/languagelevel known{pop/CIDFont findresource/GlyphDirectory get}{1 index/CIDFont findresource/GlyphDirectory get dup type/dicttype eq{dup dup maxlength exch length sub 2 index lt{dup length 2 index add dict copy 2 index/CIDFont findresource/GlyphDirectory 2 index put}if}if exch pop exch pop}ifelse +}def/+ {systemdict/languagelevel known{currentglobal false setglobal 3 dict begin/vm exch def}{1 dict begin}ifelse/$ exch def systemdict/languagelevel known{vm setglobal/gvm currentglobal def $ gcheck setglobal}if ?{$ begin}if}def/?{$ type/dicttype eq}def/|{userdict/Adobe_CoolType_Data known{Adobe_CoolType_Data /AddWidths? known{currentdict Adobe_CoolType_Data begin begin AddWidths?{ Adobe_CoolType_Data/CC 3 index put ?{def}{$ 3 1 roll put}ifelse CC charcode exch 1 index 0 2 index 256 idiv put 1 index exch 1 exch 256 mod put stringwidth 2 array astore currentfont/Widths get exch CC exch put}{?{def}{$ 3 1 roll put}ifelse}ifelse end end}{?{def}{$ 3 1 roll put}ifelse}ifelse}{?{def}{ $ 3 1 roll put}ifelse}ifelse}def/!{?{end}if systemdict/languagelevel known{gvm setglobal}if end}def/:{string currentfile exch readstring pop}executeonly def end ct_MakeOCF begin/ct_cHexEncoding[/c00/c01/c02/c03/c04/c05/c06/c07/c08/c09 /c0A/c0B/c0C/c0D/c0E/c0F/c10/c11/c12/c13/c14/c15/c16/c17/c18/c19/c1A/c1B/c1C /c1D/c1E/c1F/c20/c21/c22/c23/c24/c25/c26/c27/c28/c29/c2A/c2B/c2C/c2D/c2E/c2F /c30/c31/c32/c33/c34/c35/c36/c37/c38/c39/c3A/c3B/c3C/c3D/c3E/c3F/c40/c41/c42 /c43/c44/c45/c46/c47/c48/c49/c4A/c4B/c4C/c4D/c4E/c4F/c50/c51/c52/c53/c54/c55 /c56/c57/c58/c59/c5A/c5B/c5C/c5D/c5E/c5F/c60/c61/c62/c63/c64/c65/c66/c67/c68 /c69/c6A/c6B/c6C/c6D/c6E/c6F/c70/c71/c72/c73/c74/c75/c76/c77/c78/c79/c7A/c7B /c7C/c7D/c7E/c7F/c80/c81/c82/c83/c84/c85/c86/c87/c88/c89/c8A/c8B/c8C/c8D/c8E /c8F/c90/c91/c92/c93/c94/c95/c96/c97/c98/c99/c9A/c9B/c9C/c9D/c9E/c9F/cA0/cA1 /cA2/cA3/cA4/cA5/cA6/cA7/cA8/cA9/cAA/cAB/cAC/cAD/cAE/cAF/cB0/cB1/cB2/cB3/cB4 /cB5/cB6/cB7/cB8/cB9/cBA/cBB/cBC/cBD/cBE/cBF/cC0/cC1/cC2/cC3/cC4/cC5/cC6/cC7 /cC8/cC9/cCA/cCB/cCC/cCD/cCE/cCF/cD0/cD1/cD2/cD3/cD4/cD5/cD6/cD7/cD8/cD9/cDA /cDB/cDC/cDD/cDE/cDF/cE0/cE1/cE2/cE3/cE4/cE5/cE6/cE7/cE8/cE9/cEA/cEB/cEC/cED /cEE/cEF/cF0/cF1/cF2/cF3/cF4/cF5/cF6/cF7/cF8/cF9/cFA/cFB/cFC/cFD/cFE/cFF]def /ct_CID_STR_SIZE 8000 def/ct_mkocfStr100 100 string def/ct_defaultFontMtx[.001 0 0 .001 0 0]def/ct_1000Mtx[1000 0 0 1000 0 0]def/ct_raise{exch cvx exch errordict exch get exec stop}bind def/ct_reraise{cvx $error/errorname get (Error: )print dup( )cvs print errordict exch get exec stop }bind def/ct_cvnsi{1 index add 1 sub 1 exch 0 4 1 roll{2 index exch get exch 8 bitshift add}for exch pop}bind def/ct_GetInterval{Adobe_CoolType_Utility /ct_BuildCharDict get begin/dst_index 0 def dup dst_string length gt{dup string/dst_string exch def}if 1 index ct_CID_STR_SIZE idiv/arrayIndex exch def 2 index arrayIndex get 2 index arrayIndex ct_CID_STR_SIZE mul sub{dup 3 index add 2 index length le{2 index getinterval dst_string dst_index 2 index putinterval length dst_index add/dst_index exch def exit}{1 index length 1 index sub dup 4 1 roll getinterval dst_string dst_index 2 index putinterval pop dup dst_index add/dst_index exch def sub/arrayIndex arrayIndex 1 add def 2 index dup length arrayIndex gt{arrayIndex get}{pop exit}ifelse 0}ifelse}loop pop pop pop dst_string 0 dst_index getinterval end}bind def ct_Level2?{ /ct_resourcestatus currentglobal mark true setglobal{/unknowninstancename /Category resourcestatus}stopped{cleartomark setglobal true}{cleartomark currentglobal not exch setglobal}ifelse{{mark 3 1 roll/Category findresource begin ct_Vars/vm currentglobal put({ResourceStatus} stopped)0()/SubFileDecode filter cvx exec{cleartomark false}{{3 2 roll pop true}{cleartomark false} ifelse}ifelse ct_Vars/vm get setglobal end}}{{resourcestatus}}ifelse bind def /CIDFont/Category ct_resourcestatus{pop pop}{currentglobal true setglobal /Generic/Category findresource dup length dict copy dup/InstanceType/dicttype put/CIDFont exch/Category defineresource pop setglobal}ifelse ct_UseNativeCapability?{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering(Identity) def/Supplement 0 def end def/CMapName/Identity-H def/CMapVersion 1 def /CMapType 1 def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end}if}{/ct_Category 2 dict begin/CIDFont 10 dict def /ProcSet 2 dict def currentdict end def/defineresource{ct_Category 1 index 2 copy known{get dup dup maxlength exch length eq{dup length 10 add dict copy ct_Category 2 index 2 index put}if 3 index 3 index put pop exch pop}{pop pop /defineresource/undefined ct_raise}ifelse}bind def/findresource{ct_Category 1 index 2 copy known{get 2 index 2 copy known{get 3 1 roll pop pop}{pop pop /findresource/undefinedresource ct_raise}ifelse}{pop pop/findresource /undefined ct_raise}ifelse}bind def/resourcestatus{ct_Category 1 index 2 copy known{get 2 index known exch pop exch pop{0 -1 true}{false}ifelse}{pop pop /findresource/undefined ct_raise}ifelse}bind def/ct_resourcestatus /resourcestatus load def}ifelse/ct_CIDInit 2 dict begin/ct_cidfont_stream_init {{dup(Binary)eq{pop null currentfile ct_Level2?{{cid_BYTE_COUNT() /SubFileDecode filter}stopped{pop pop pop}if}if/readstring load exit}if dup (Hex)eq{pop currentfile ct_Level2?{{null exch/ASCIIHexDecode filter/readstring }stopped{pop exch pop(>)exch/readhexstring}if}{(>)exch/readhexstring}ifelse load exit}if/StartData/typecheck ct_raise}loop cid_BYTE_COUNT ct_CID_STR_SIZE le{2 copy cid_BYTE_COUNT string exch exec pop 1 array dup 3 -1 roll 0 exch put }{cid_BYTE_COUNT ct_CID_STR_SIZE div ceiling cvi dup array exch 2 sub 0 exch 1 exch{2 copy 5 index ct_CID_STR_SIZE string 6 index exec pop put pop}for 2 index cid_BYTE_COUNT ct_CID_STR_SIZE mod string 3 index exec pop 1 index exch 1 index length 1 sub exch put}ifelse cid_CIDFONT exch/GlyphData exch put 2 index null eq{pop pop pop}{pop/readstring load 1 string exch{3 copy exec pop dup length 0 eq{pop pop pop pop pop true exit}if 4 index eq{pop pop pop pop false exit}if}loop pop}ifelse}bind def/StartData{mark{currentdict dup/FDArray get 0 get/FontMatrix get 0 get .001 eq{dup/CDevProc known not{/CDevProc 1183615869 internaldict/stdCDevProc 2 copy known{get}{pop pop{pop pop pop pop pop 0 -1000 7 index 2 div 880}}ifelse def}if}{/CDevProc{pop pop pop pop pop 0 1 cid_temp/cid_CIDFONT get/FDArray get 0 get/FontMatrix get 0 get div 7 index 2 div 1 index .88 mul}def}ifelse/cid_temp 15 dict def cid_temp begin /cid_CIDFONT exch def 3 copy pop dup/cid_BYTE_COUNT exch def 0 gt{ ct_cidfont_stream_init FDArray{/Private get dup/SubrMapOffset known{begin /Subrs SubrCount array def Subrs SubrMapOffset SubrCount SDBytes ct_Level2?{ currentdict dup/SubrMapOffset undef dup/SubrCount undef/SDBytes undef}if end /cid_SD_BYTES exch def/cid_SUBR_COUNT exch def/cid_SUBR_MAP_OFFSET exch def /cid_SUBRS exch def cid_SUBR_COUNT 0 gt{GlyphData cid_SUBR_MAP_OFFSET cid_SD_BYTES ct_GetInterval 0 cid_SD_BYTES ct_cvnsi 0 1 cid_SUBR_COUNT 1 sub{ exch 1 index 1 add cid_SD_BYTES mul cid_SUBR_MAP_OFFSET add GlyphData exch cid_SD_BYTES ct_GetInterval 0 cid_SD_BYTES ct_cvnsi cid_SUBRS 4 2 roll GlyphData exch 4 index 1 index sub ct_GetInterval dup length string copy put} for pop}if}{pop}ifelse}forall}if cleartomark pop pop end CIDFontName currentdict/CIDFont defineresource pop end end}stopped{cleartomark/StartData ct_reraise}if}bind def currentdict end def/ct_saveCIDInit{/CIDInit/ProcSet ct_resourcestatus{true}{/CIDInitC/ProcSet ct_resourcestatus}ifelse{pop pop /CIDInit/ProcSet findresource ct_UseNativeCapability?{pop null}{/CIDInit ct_CIDInit/ProcSet defineresource pop}ifelse}{/CIDInit ct_CIDInit/ProcSet defineresource pop null}ifelse ct_Vars exch/ct_oldCIDInit exch put}bind def /ct_restoreCIDInit{ct_Vars/ct_oldCIDInit get dup null ne{/CIDInit exch/ProcSet defineresource pop}{pop}ifelse}bind def/ct_BuildCharSetUp{1 index begin CIDFont begin Adobe_CoolType_Utility/ct_BuildCharDict get begin/ct_dfCharCode exch def/ct_dfDict exch def CIDFirstByte ct_dfCharCode add dup CIDCount ge{pop 0}if/cid exch def{GlyphDirectory cid 2 copy known{get}{pop pop nullstring} ifelse dup length FDBytes sub 0 gt{dup FDBytes 0 ne{0 FDBytes ct_cvnsi}{pop 0} ifelse/fdIndex exch def dup length FDBytes sub FDBytes exch getinterval /charstring exch def exit}{pop cid 0 eq{/charstring nullstring def exit}if/cid 0 def}ifelse}loop}def/ct_SetCacheDevice{0 0 moveto dup stringwidth 3 -1 roll true charpath pathbbox 0 -1000 7 index 2 div 880 setcachedevice2 0 0 moveto} def/ct_CloneSetCacheProc{1 eq{stringwidth pop -2 div -880 0 -1000 setcharwidth moveto}{usewidths?{currentfont/Widths get cid 2 copy known{get exch pop aload pop}{pop pop stringwidth}ifelse}{stringwidth}ifelse setcharwidth 0 0 moveto} ifelse}def/ct_Type3ShowCharString{ct_FDDict fdIndex 2 copy known{get}{ currentglobal 3 1 roll 1 index gcheck setglobal ct_Type1FontTemplate dup maxlength dict copy begin FDArray fdIndex get dup/FontMatrix 2 copy known{get} {pop pop ct_defaultFontMtx}ifelse/FontMatrix exch dup length array copy def /Private get/Private exch def/Widths rootfont/Widths get def/CharStrings 1 dict dup/.notdef<d841272cf18f54fc13>dup length string copy put def currentdict end/ct_Type1Font exch definefont dup 5 1 roll put setglobal}ifelse dup /CharStrings get 1 index/Encoding get ct_dfCharCode get charstring put rootfont/WMode 2 copy known{get}{pop pop 0}ifelse exch 1000 scalefont setfont ct_str1 0 ct_dfCharCode put ct_str1 exch ct_dfSetCacheProc ct_SyntheticBold{ currentpoint ct_str1 show newpath moveto ct_str1 true charpath ct_StrokeWidth setlinewidth stroke}{ct_str1 show}ifelse}def/ct_Type4ShowCharString{ct_dfDict ct_dfCharCode charstring FDArray fdIndex get dup/FontMatrix get dup ct_defaultFontMtx ct_matrixeq not{ct_1000Mtx matrix concatmatrix concat}{pop} ifelse/Private get Adobe_CoolType_Utility/ct_Level2? get not{ct_dfDict/Private 3 -1 roll{put}1183615869 internaldict/superexec get exec}if 1183615869 internaldict Adobe_CoolType_Utility/ct_Level2? get{1 index}{3 index/Private get mark 6 1 roll}ifelse dup/RunInt known{/RunInt get}{pop/CCRun}ifelse get exec Adobe_CoolType_Utility/ct_Level2? get not{cleartomark}if}bind def /ct_BuildCharIncremental{{Adobe_CoolType_Utility/ct_MakeOCF get begin ct_BuildCharSetUp ct_ShowCharString}stopped{stop}if end end end end}bind def /BaseFontNameStr(BF00)def/ct_Type1FontTemplate 14 dict begin/FontType 1 def /FontMatrix[.001 0 0 .001 0 0]def/FontBBox[-250 -250 1250 1250]def/Encoding ct_cHexEncoding def/PaintType 0 def currentdict end def/BaseFontTemplate 11 dict begin/FontMatrix[.001 0 0 .001 0 0]def/FontBBox[-250 -250 1250 1250]def /Encoding ct_cHexEncoding def/BuildChar/ct_BuildCharIncremental load def ct_Clone?{/FontType 3 def/ct_ShowCharString/ct_Type3ShowCharString load def /ct_dfSetCacheProc/ct_CloneSetCacheProc load def/ct_SyntheticBold false def /ct_StrokeWidth 1 def}{/FontType 4 def/Private 1 dict dup/lenIV 4 put def /CharStrings 1 dict dup/.notdef<d841272cf18f54fc13>put def/PaintType 0 def /ct_ShowCharString/ct_Type4ShowCharString load def}ifelse/ct_str1 1 string def currentdict end def/BaseFontDictSize BaseFontTemplate length 5 add def /ct_matrixeq{true 0 1 5{dup 4 index exch get exch 3 index exch get eq and dup not{exit}if}for exch pop exch pop}bind def/ct_makeocf{15 dict begin exch/WMode exch def exch/FontName exch def/FontType 0 def/FMapType 2 def/FontMatrix matrix def/bfCount 1 index/CIDCount get 256 idiv 1 add dup 256 gt{pop 256}if def/Encoding 256 array 0 1 bfCount 1 sub{2 copy dup put pop}for bfCount 1 255{ 2 copy bfCount put pop}for def/FDepVector bfCount dup 256 lt{1 add}if array def BaseFontTemplate BaseFontDictSize dict copy begin/CIDFont exch def CIDFont /FontBBox known{CIDFont/FontBBox get/FontBBox exch def}if CIDFont/CDevProc known{CIDFont/CDevProc get/CDevProc exch def}if currentdict end BaseFontNameStr 3(0)putinterval 0 1 bfCount dup 256 eq{1 sub}if{FDepVector exch 2 index BaseFontDictSize dict copy begin dup/CIDFirstByte exch 256 mul def FontType 3 eq{/ct_FDDict 2 dict def}if currentdict end 1 index 16 BaseFontNameStr 2 2 getinterval cvrs pop BaseFontNameStr exch definefont put} for ct_Clone?{/Widths 1 index/CIDFont get/GlyphDirectory get length dict def} if FontName currentdict end definefont ct_Clone?{gsave dup 1000 scalefont setfont ct_BuildCharDict begin/usewidths? false def currentfont/Widths get begin exch/CIDFont get/GlyphDirectory get{pop dup charcode exch 1 index 0 2 index 256 idiv put 1 index exch 1 exch 256 mod put stringwidth 2 array astore def}forall end/usewidths? true def end grestore}{exch pop}ifelse}bind def /ct_ComposeFont{ct_UseNativeCapability?{2 index/CMap ct_resourcestatus{pop pop exch pop}{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CMapName 3 index def/CMapVersion 1 def/CMapType 1 def exch/WMode exch def/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering CMapName ct_mkocfStr100 cvs (Adobe-)search{pop pop(-)search{dup length string copy exch pop exch pop}{pop (Identity)}ifelse}{pop(Identity)}ifelse def/Supplement 0 def end def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end} ifelse composefont}{3 2 roll pop 0 get/CIDFont findresource ct_makeocf}ifelse} bind def/ct_MakeIdentity{ct_UseNativeCapability?{1 index/CMap ct_resourcestatus{pop pop}{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CMapName 2 index def/CMapVersion 1 def/CMapType 1 def/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering CMapName ct_mkocfStr100 cvs (Adobe-)search{pop pop(-)search{dup length string copy exch pop exch pop}{pop (Identity)}ifelse}{pop(Identity)}ifelse def/Supplement 0 def end def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end} ifelse composefont}{exch pop 0 get/CIDFont findresource ct_makeocf}ifelse}bind def currentdict readonly pop end end %%EndResource Adobe_CoolType_Core begin /$Oblique SetSubstituteStrategy end %%BeginResource: procset Adobe_AGM_Image 1.0 0 %%Version: 1.0 0 %%Copyright: Copyright (C) 2000-2000 Adobe Systems, Inc. All Rights Reserved. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Image 65 dict dup begin put /Adobe_AGM_Image_Id /Adobe_AGM_Image_1.0_0 def /nd{ null def }bind def /AGMIMG_&image nd /AGMIMG_&colorimage nd %%don't initialize AGMIMG_&customcolorimage, it wrecks havoc in a nested environment %%AGMIMG_ccimage_exists not {/AGMIMG_&customcolorimage nd} if /AGMIMG_&imagemask nd /AGMIMG_mbuf () def /AGMIMG_ybuf () def /AGMIMG_kbuf () def /AGMIMG_c 0 def /AGMIMG_m 0 def /AGMIMG_y 0 def /AGMIMG_k 0 def /AGMIMG_tmp nd /AGMIMG_imagestring0 nd /AGMIMG_imagestring1 nd /AGMIMG_imagestring2 nd /AGMIMG_imagestring3 nd /AGMIMG_imagestring4 nd /AGMIMG_imagestring5 nd /AGMIMG_cnt nd /AGMIMG_fsave nd /AGMIMG_colorAry nd /AGMIMG_override nd /AGMIMG_name nd /invert_image_samples nd /knockout_image_samples nd /img nd /sepimg nd /idximg nd /doc_setup { Adobe_AGM_Core begin Adobe_AGM_Image begin /AGMIMG_&image systemdict/image get def /AGMIMG_&imagemask systemdict/imagemask get def /colorimage where{ pop /AGMIMG_&colorimage /colorimage ldf }if end end }def /page_setup { Adobe_AGM_Image begin /AGMIMG_ccimage_exists {/customcolorimage where { pop /Adobe_AGM_OnHost_Seps where { pop false }{ /Adobe_AGM_InRip_Seps where { pop false }{ true }ifelse }ifelse }{ false }ifelse }bdf level2{ /invert_image_samples { }def /knockout_image_samples { Operator/imagemask ne{ /Decode [1 1] def }if }def } }{ Adobe_AGM_Image/AGMIMG_tmp Decode length ddf /Decode [ Decode 1 get Decode 0 get] def and{ /invert_image_samples { {1 exch sub} currenttransfer addprocs settransfer }def /knockout_image_samples { { pop 1 } currenttransfer addprocs settransfer }def }ifelse /img /imageormask ldf /sepimg /sep_imageormask ldf /idximg /indexed_imageormask ldf currentdict{ dup xcheck 1 index type dup /arraytype eq exch /packedarraytype eq or }if def }forall bind }def /page_trailer { end }def /doc_trailer { }def /imageormask_sys { begin save mark level2{ currentdict Operator /imagemask eq{ AGMIMG_&imagemask }{ AGMIMG_&image }ifelse }{ Width Height Operator /imagemask eq{ Decode 0 get 1 eq Decode 1 get 0 eq and ImageMatrix /DataSource load AGMIMG_&imagemask }{ BitsPerComponent ImageMatrix /DataSource load AGMIMG_&image }ifelse }ifelse cleartomark restore end }def /overprint_plate { currentoverprint{ 0 get dup /DeviceGray eq{ pop AGMCORE_black_plate not }{ /DeviceCMYK eq{ AGMCORE_is_cmyk_sep not }if }ifelse }{ false }ifelse }def /imageormask { begin SkipImageProc not{ save mark level2 AGMCORE_host_sep not and{ currentdict Operator /imagemask eq{ imagemask }{ AGMCORE_in_rip_sep currentoverprint and currentcolorspace 0 get /DeviceGray eq and{ [/Separation /Black /DeviceGray {}] setcolorspace /Decode [ Decode 1 get Decode 0 get ] def }if image }ifelse }{ Width Height Operator /imagemask eq{ Decode 0 get 1 eq Decode 1 get 0 eq and ImageMatrix /DataSource load AGMCORE_host_sep{ currentgray 1 ne{ currentdict imageormask_sys }{ currentoverprint not{ 1 AGMCORE_&setgray knockout_image_samples currentdict imageormask_sys }{ currentdict ignoreimagedata }ifelse }ifelse }{ imagemask }ifelse }{ BitsPerComponent ImageMatrix MultipleDataSources{ 0 1 NComponents 1 sub{ DataSource exch get }for }{ /DataSource load }ifelse Operator /colorimage eq{ AGMCORE_host_sep{ MultipleDataSources level2 or NComponents 4 eq and{ MultipleDataSources{ 4 {pop} repeat /DataSource [ DataSource 0 get /exec DataSource 1 get /exec DataSource 2 get /exec DataSource 3 get /exec /AGMCORE_get_ink_data }{ filter_cmyk 0 () /SubFileDecode filter def ] cvx def /DataSource /DataSource load } }ifelse ] def /Decode [ Decode 0 get Decode 1 get /MultipleDataSources false def /NComponents 1 def /Operator /image def AGMCORE_is_cmyk_sep{ currentoverprint InksUsed currentdict }{ invert_image_samples 1 AGMCORE_&setgray currentdict cvx cvx cvx cvx cvx current_ink not and{ consumeimagedata imageormask_sys }{ ignoreimagedata } }{ A AGMIMG_&colorimage }{ }{ }ifelse currentdict }ifelse MultipleDataSources NComponents }ifelse true NComponents colorimage }ifelse ignoreimagedata Operator /image eq{ AGMCORE_host_sep{ /DoImage true def HostSepColorImage{ invert_image_samples }{ AGMCORE_black_plate not{ /DoImage false def currentdict }if }ifelse 1 AGMCORE_&setgray DoImage {currentdict imageormask_sys} }{ }{ image }ifelse Operator/knockout eq{ pop pop pop pop pop currentoverprint InksUsed }{ currentcolorspace knockout_unitsq }if }ifelse }if }ifelse }ifelse }ifelse }ifelse cleartomark restore if current_ink not and{ overprint_plate not{ end }if }def /sep_imageormask { /sep_colorspace_dict AGMCORE_gget begin /MappedCSA CSA map_csa def begin SkipImageProc not{ s save mark AGMCORE_avoid_L2_sep_space{ /Decode [ Decode 0 get 255 mul Decode 1 get 255 mul ] def }if AGMIMG_ccimage_exists MappedCSA 0 get /DeviceCMYK eq and currentdict/Components known and Name () ne and Name (All) ne and Operator /image eq and AGMCORE_producing_seps not and level2 not and { }{ Width Height BitsPerComponent ImageMatrix [ /DataSource load /exec cvx { 0 1 2 index length 1 sub{ 1 index exch 2 copy get 255 xor put }for } /exec cvx ] cvx bind MappedCSA 0 get /DeviceCMYK eq{ Components aload pop }{ 0 0 0 Components aload pop 1 exch sub }ifelse Name findcmykcustomcolor customcolorimage AGMCORE_producing_seps not{ level2{ AGMCORE_avoid_L2_sep_space not currentcolorspace 0 get /Separation ne and{ [/Separation Name MappedCSA sep_proc_name exch 0 get exch load ] setcolorspace_opt /sep_tint AGMCORE_gget setcolor }if currentdict imageormask }{ currentdict Operator /imagemask eq{ imageormask }{ sep_imageormask_lev1 }ifelse }ifelse }{ AGMCORE_host_sep{ Operator/knockout eq{ currentoverprint InksUsed current_ink not and{ }{ currentdict/ImageMatrix get concat knockout_unitsq }ifelse }{ currentgray 1 ne{ AGMCORE_is_cmyk_sep Name (All) ne and{ level2{ [ /Separation Name [/DeviceGray] { sep_colorspace_proc AGMCORE_get_ink_data 1 exch sub } bind ] AGMCORE_&setcolorspace /sep_tint AGMCORE_gget AGMCORE_&setcolor currentdict imageormask_sys }{ }{ currentdict Operator /imagemask eq{ imageormask_sys }{ sep_image_lev1_sep }ifelse }ifelse }{ Operator/imagemask ne{ invert_image_samples }if currentdict imageormask_sys }ifelse currentdict consumeimagedata currentoverprint not Name (All) eq or{ gsave knockout_unitsq grestore }if }ifelse }ifelse currentcolorspace 0 get /Separation ne{ [/Separation Name MappedCSA sep_proc_name exch 0 get exch load ] setcolorspace_opt /sep_tint AGMCORE_gget setcolor }if currentoverprint MappedCSA 0 get /DeviceCMYK eq and Name inRip_spot_has_ink not and Name (All) ne and { imageormask_l2_overprint }{ currentdict imageormask }ifelse }ifelse }ifelse }ifelse cleartomark restore }if end end }def /imageormask_l2_overprint { currentdict currentcmykcolor add add add 0 eq{ currentdict consumeimagedata }{ l level3{ currentcmykcolor /AGMIMG_k xdf /AGMIMG_y xdf /AGMIMG_m xdf /AGMIMG_c xdf Operator/imagemask eq{ }{ [/DeviceN [ AGMIMG_c 0 ne AGMIMG_m 0 ne AGMIMG_y 0 ne AGMIMG_k 0 ne ] /DeviceCMYK AGMIMG_c AGMIMG_m AGMIMG_y AGMIMG_k s setcolor } }{ 0 0 0 0 ne ne ne ne {/Cyan} if {/Magenta} if {/Yellow} if {/Black} if {}] setcolorspace {AGMIMG_c} {AGMIMG_m} {AGMIMG_y} {AGMIMG_k} if if if if mul Decode 1 get 255 mul ] def /Decode [ Decode 0 get 255 [ [/Indexed [ /DeviceN [ AGMIMG_c AGMIMG_m AGMIMG_y AGMIMG_k ] /DeviceCMYK { AGMIMG_k AGMIMG_y AGMIMG_m A AGMIMG_c ] 255 { } 0 0 0 0 0 0 0 0 ne ne ne ne eq eq eq eq {/Cyan} if {/Magenta} if {/Yellow} if {/Black} if {0} if {0 exch} if {0 3 1 roll} if {0 4 1 roll} if 2 255 div mark exch dup d dup dup AGMIMG_k 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 1 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_y 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 2 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_m 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 3 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_c 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec pop pop pop s counttomark 1 roll }{ pop }ifelse counttomark 1 add -1 roll pop } ] setcolorspace }ifelse } imageormask_sys }{ write_image_file{ currentcmykcolor 0 ne{ [/Separation /Black /DeviceGray {}] setcolorspace gsave /Black [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 1 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Yellow /DeviceGray {}] setcolorspace gsave /Yellow [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 2 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Magenta /DeviceGray {}] setcolorspace gsave /Magenta [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 3 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Cyan /DeviceGray {}] setcolorspace gsave /Cyan [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore } if }{ close_image_file imageormask }ifelse }ifelse }ifelse } def /indexed_imageormask { begin s save mark currentdict AGMCORE_host_sep{ Operator/knockout eq{ /indexed_colorspace_dict AGMCORE_gget /CSA get map_csa overprint_plate not{ knockout_unitsq }if }{ AGMCORE_is_cmyk_sep{ Operator /imagemask eq{ imageormask_sys }{ level2{ indexed_image_lev2_sep }{ indexed_image_lev1_sep }ifelse }ifelse }{ currentoverprint not{ knockout_image_samples imageormask_sys }{ currentdict consumeimagedata }ifelse }ifelse }ifelse }{ level2{ imageormask }{ Operator /imagemask eq{ imageormask }{ indexed_imageormask_lev1 }ifelse }ifelse }ifelse cleartomark restore end }def /indexed_image_lev2_sep { /indexed_colorspace_dict AGMCORE_gget begin b begin currentcolorspace dup 1 /DeviceGray put dup 3 [ currentcolorspace 3 get { exch 4 mul 4 getinterval {} forall AGMCORE_get_ink_data 255 div 1 exch sub } /exec cvx ] cvx put s setcolorspace currentdict Operator /imagemask eq{ AGMIMG_&imagemask }{ AGMIMG_&image } }ifelse end end }def /OPIimage { dup type /dicttype ne{ 10 dict begin /DataSource xdf /ImageMatrix xdf /BitsPerComponent xdf /Height xdf /Width xdf /ImageType 1 def /Decode [0 1 def] currentdict end }if dup begin /NComponents 1 cdndf /MultipleDataSources false cdndf /SkipImageProc {false} cdndf /HostSepColorImage false cdndf /Decode [ 0 currentcolorspace 0 get /Indexed eq{ 2 BitsPerComponent exp 1 sub }{ 1 }ifelse ] cdndf /Operator /image cdndf end /sep_colorspace_dict AGMCORE_gget null eq{ imageormask }{ gsave dup begin invert_image_samples end sep_imageormask grestore }ifelse }def /spot_alias { /mapto_sep_imageormask { dup type /dicttype ne{ 12 dict begin /ImageType 1 def /DataSource xdf /ImageMatrix xdf /BitsPerComponent xdf /Height xdf /Width xdf /MultipleDataSources false def }{ begin }ifelse /Decode [/customcolor_tint AGMCORE_gget 0] def /Operator /image def /HostSepColorImage false def /InksUsed [] def /SkipImageProc {false} def currentdict end sep_imageormask }bdf /customcolorimage { Adobe_AGM_Image/AGMIMG_colorAry xddf /customcolor_tint AGMCORE_gget bdict /Name AGMIMG_colorAry 4 get /CSA [ /DeviceCMYK ] /TintMethod /Subtractive /TintProc null /MappedCSA null /NComponents 4 /Components [ AGMIMG_colorAry aload pop pop ] edict setsepcolorspace mapto_sep_imageormask }ndf Adobe_AGM_Image/AGMIMG_&customcolorimage /customcolorimage load put /customcolorimage { Adobe_AGM_Image/AGMIMG_override false put dup 4 get map_alias{ /customcolor_tint AGMCORE_gget exch setsepcolorspace pop mapto_sep_imageormask }{ AGMIMG_&customcolorimage } }ifelse }bdf }def level2 not{ /colorbuf { 0 1 2 index length 1 sub{ dup 2 index exch get 255 exch sub }for }def /tint_image_to_color { begin Width Height BitsPerComponent ImageMatrix /DataSource load end Adobe_AGM_Image begin /AGMIMG_mbuf 0 string def /AGMIMG_ybuf 0 string def /AGMIMG_kbuf 0 string def { colorbuf dup length AGMIMG_mbuf length ne { dup length dup dup /AGMIMG_mbuf exch string def /AGMIMG_ybuf exch string def /AGMIMG_kbuf exch string def } if dup AGMIMG_mbuf copy AGMIMG_ybuf copy AGMIMG_kbuf copy pop } addprocs { {AGMIMG_mbuf}{AGMIMG_ybuf}{AGMIMG_kbuf} true 4 colorimage end } def /sep_imageormask_lev1 { begin MappedCSA 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or has_color not and{ h { 255 mul round cvi GrayLookup exch get } currenttransfer addprocs settransfer currentdict imageormask /sep_colorspace_dict AGMCORE_gget/Components known{ MappedCSA 0 get /DeviceCMYK eq{ Components aload pop }{ 0 0 0 Components aload pop 1 exch sub } }ifelse Adobe_AGM_Image/AGMIMG_k Adobe_AGM_Image/AGMIMG_y Adobe_AGM_Image/AGMIMG_m A Adobe_AGM_Image/AGMIMG_c and{ addprocs settransfer } }{ xddf xddf xddf xddf 2 index 3 1 roll put }{ AGMIMG_y 0.0 eq AGMIMG_m 0.0 eq and AGMIMG_c 0.0 eq {AGMIMG_k mul 1 exch sub} currenttransfer currentdict imageormask currentcolortransfer {AGMIMG_k mul 1 exch sub} exch addprocs 4 1 roll roll roll roll {AGMIMG_y mul 1 exch sub} exch addprocs 4 1 {AGMIMG_m mul 1 exch sub} exch addprocs 4 1 {AGMIMG_c mul 1 exch sub} exch addprocs 4 1 setcolortransfer currentdict tint_image_to_color }ifelse } }{ MappedCSA 0 get /DeviceGray eq { {255 mul round cvi ColorLookup exch get 0 currenttransfer addprocs settransfer currentdict imageormask }{ MappedCSA 0 get /DeviceCMYK eq { currentcolortransfer {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll setcolortransfer currentdict tint_image_to_color }{ currentcolortransfer {pop 1} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll setcolortransfer currentdict tint_image_to_color }ifelse }ifelse }ifelse }ifelse end }def /sep_image_lev1_sep { begin /sep_colorspace_dict AGMCORE_gget/Components known{ C Components aload pop Adobe_AGM_Image/AGMIMG_k Adobe_AGM_Image/AGMIMG_y Adobe_AGM_Image/AGMIMG_m A Adobe_AGM_Image/AGMIMG_c xddf xddf xddf xddf get} get 3 get 2 get 1 get 0 get 2 get 1 get 0 {AGMIMG_c {AGMIMG_m {AGMIMG_y {AGMIMG_k }{ {255 {255 {255 {255 }ifelse } mul mul mul mul mul mul mul mul round round round round 1 1 1 1 exch exch exch exch cvi cvi cvi cvi sub} sub} sub} sub} exch exch exch exch get get get get 0 1 2 3 get get get get 1 1 1 1 exch exch exch exch sub} sub} sub} sub} ColorLookup ColorLookup ColorLookup ColorLookup A AGMCORE_get_ink_data currenttransfer addprocs settransfer c currentdict imageormask_sys end }def /indexed_imageormask_lev1 { /indexed_colorspace_dict AGMCORE_gget begin begin currentdict MappedCSA 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or has_color not and{ h {HiVal mul round cvi GrayLookup exch get HiVal div} currenttransfer addprocs settransfer imageormask } }{ MappedCSA 0 get /DeviceGray eq { {HiVal mul round cvi Lookup exch get HiVal div} currenttransfer addprocs settransfer imageormask }{ MappedCSA 0 get /DeviceCMYK eq { currentcolortransfer {4 mul HiVal mul round cvi 3 add Lookup exch get HiVal div 1 exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi 2 add Lookup exch get HiVal div 1 exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi 1 add Lookup exch get HiVal div 1 exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi Lookup exch get HiVal div 1 exch sub} exch addprocs 4 1 roll setcolortransfer tint_image_to_color }{ currentcolortransfer {pop 1} exch addprocs 4 1 roll {3 mul HiVal mul round cvi 2 add Lookup exch get HiVal div} exch addprocs 4 1 roll {3 mul HiVal mul round cvi 1 add Lookup exch get HiVal div} exch addprocs 4 1 roll {3 mul HiVal mul round cvi Lookup exch get HiVal div} exch addprocs 4 1 roll setcolortransfer tint_image_to_color }ifelse sub} sub} sub} s sub} }def /indexed_image_lev1_sep { /indexed_colorspace_dict AGMCORE_gget begin begin {4 mul HiVal mul round cvi Lookup exch get HiVal div 1 exch {4 mul HiVal mul round cvi 1 add Lookup exch get HiVal div 1 exch {4 mul HiVal mul round cvi 2 add Lookup exch get HiVal div 1 exch {4 mul HiVal mul round cvi 3 add Lookup exch get HiVal div 1 exch A AGMCORE_get_ink_data currenttransfer addprocs settransfer c currentdict imageormask_sys end end }def }ifelse }ifelse end end }if end systemdict /setpacking known { setpacking } if %%EndResource %ADOBeginClientInjection: DocumentProlog End "AI10" %ADOEndClientInjection: DocumentProlog End "AI10" currentdict Adobe_AGM_Utils eq {end} if %%EndProlog %%BeginSetup %ADOBeginClientInjection: DocumentSetup Start "AI10" %ADOEndClientInjection: DocumentSetup Start "AI10" Adobe_AGM_Utils begin 2 2010 true Adobe_AGM_Core/doc_setup get exec Adobe_CoolType_Core/doc_setup get exec Adobe_AGM_Image/doc_setup get exec %ADOBeginClientInjection: DocumentSetup End "AI10" %ADOEndClientInjection: DocumentSetup End "AI10" currentdict Adobe_AGM_Utils eq {end} if %%EndSetup %%Page: lec9_fig1.jpg 1 %%EndPageComments %%BeginPageSetup %ADOBeginClientInjection: PageSetup Start "AI10" %ADOEndClientInjection: PageSetup Start "AI10" Adobe_AGM_Utils begin Adobe_AGM_Core/page_setup get exec Adobe_CoolType_Core/page_setup get exec Adobe_AGM_Image/page_setup get exec %ADOBeginClientInjection: PageSetup End "AI10" %ADOEndClientInjection: PageSetup End "AI10" %%EndPageSetup Adobe_AGM_Core/AGMCORE_save save ddf 1 -1 scale 0 -200.75 translate [1 0 0 1 0 0 ] concat mark /0 [/DeviceGray] add_csa /CSA /0 /1 [/DeviceCMYK] add_csa /CSA /1 /2 [/DeviceRGB] add_csa /CSA /2 cleartomark 800 path_rez % page clip gsave newpath gsave % PSGState 0 0 mo 0 200.75 li 241 200.75 li 241 0 li clp [1 0 0 1 0 0 ] concat %ADOBeginClientInjection: BeginPageContent "AI10" %ADOEndClientInjection: BeginPageContent "AI10" 16.497 200.754 mo 16.497 198.999 li 218.997 198.999 li 218.997 200.754 li 16.497 200.754 li false sop save_ctm gsave % PSGState clp gsave [1 0 0 -1 0 200.75 ] concat << /CSA /2 >> csacrd [204 0 0 3.36 15.84 -.850008 ] concat << /Width 425 /Height 7 /BitsPerComponent 8 /Decode [0 1 0 1 0 1 ] /ImageMatrix [425 0 0 -7 0 7 ] Adobe_AGM_Image/AGMIMG_imagestring0 425 string ddf Adobe_AGM_Image/AGMIMG_imagestring1 425 string ddf Adobe_AGM_Image/AGMIMG_imagestring2 425 string ddf Adobe_AGM_Image/AGMIMG_filter Adobe_AGM_Utils/rdcmntline get /ASCII85Decode filter /RunLengthDecode filter ddf /DataSource [ {AGMIMG_filter AGMIMG_imagestring0 readstring pop} {AGMIMG_filter AGMIMG_imagestring1 readstring pop} {AGMIMG_filter AGMIMG_imagestring2 readstring pop} ] /ImageType 1 /NComponents 3 /Operator /colorimage /MultipleDataSources true /HostSepColorImage false /InksUsed [ ] /SkipImageProc {false} >> %%BeginDataCountAtEnd: NoCount % 1 img %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&o)F=A %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)bEAK)^H& %K)^H&K)^H&K)^H&K)^H&r;V9~> %%EndDataCountAtEnd: NoCount grestore %image grestore % PSGState newpath % image restore_ctm 218.997 198 mo 218.997 15.498 li 16.497 15.498 li 16.497 198 li .999 198 li .999 .999 li 240.003 .999 li 240.003 198 li 218.997 198 li 1 1 1 rgb f 16.497 198 mo 16.497 15.498 li 218.997 15.498 li 218.997 198 li 16.497 198 li save_ctm gsave % PSGState clp gsave [1 0 0 -1 0 200.75 ] concat << /CSA /2 >> csacrd [204 0 0 183.84 15.84 2.02999 ] concat << /Width 425 /Height 383 /BitsPerComponent 8 /Decode [0 1 0 1 0 1 ] /ImageMatrix [425 0 0 -383 0 383 ] Adobe_AGM_Image/AGMIMG_imagestring0 425 string ddf Adobe_AGM_Image/AGMIMG_imagestring1 425 string ddf Adobe_AGM_Image/AGMIMG_imagestring2 425 string ddf Adobe_AGM_Image/AGMIMG_filter Adobe_AGM_Utils/rdcmntline get /ASCII85Decode filter /RunLengthDecode filter ddf /DataSource [ {AGMIMG_filter AGMIMG_imagestring0 readstring pop} {AGMIMG_filter AGMIMG_imagestring1 readstring pop} {AGMIMG_filter AGMIMG_imagestring2 readstring pop} ] /ImageType 1 /NComponents 3 /Operator /colorimage /MultipleDataSources true /HostSepColorImage false /InksUsed [ ] /SkipImageProc {false} >> %%BeginDataCountAtEnd: NoCount % 1 img %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&o)F=A %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)bEAK)^H& %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&o)F=AK)^H& %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)bEAK)^H&K)^H& %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&MuO(^rVc`qs8N&uq>UHokl:\^r;Zcqrr2uqrVm)q %qtpEkr;ZEg!rql`r;Qlns8W#Js+:9&s5*b[rr)fps8W)mrrE&^s8W)rs8N#srrDrprs&2oqu?Tls7H9l %s7>j[rrVrprrDtLs+:9Vrs&K$rVlisrqHEmrojC^rr2rts8N#srrDrprs&2oqu?Tls7H9ls7>j[rr`#q %s89)#K)bEAQ2^scrVc`ds69R`rqufqrr)lsnc/Lcrr`,nq>^Hms8Mio$hODunF68Rs7u]pr651ms+::7 %rr`9!rVkONs8Mrrrr2lrs7--drr3)sq>('irVulmrsSGus7#ORs8Vops8;ZlK)^H&]`/*5rVc`Ls8W)r %s8N#rrrDQjnb`4_rr`,nq>^Hms8Mio$hODunF68Rs7u]pr2'FFs,d6_rr)fpp]'=Ss8Mrrrr2lrs7--d %rr3)sq>('irVulmrsSGus7#ORs8Vops8::EK)^H&j8T5\rVc`Ls8W)rs8N#rs8VWhqu6TtqYBserr)lr %q>Uios8VTXq>^Kjs8W#qs+:9&s0r"1rr)fpgAh3Pr;ZcqrVuofs82fq"8_ihs8MusrqZR%oDej[nG3+a %q>^KmWrI\NP5kR]r;Qs!r;?Nmrr2rms8N#`s8W)rrr`9!rVlfr$M<ujs8;HYs7Q'brqufpq>LBirVm*# %s8W&ts8COKK)^H&jo>A[r;Qs!r;?Nmrq6<jrp0Uarqucurr)fprr3>to`+sho()hRp&G$hs8Dcm!;ZTn %"o\K$rVultrIb-%s1/10rqud"rVZTlrr2Tjrr26`s8N#t"onW%rVc`prsJDjs8W#fo)JCUs8MrrrV?Em %q>L<trVuors8W&$s+::As.',hrqud"r;6BhrVc`nqu-Nl!<2ionGiOfr;R-&r;?Nns7Z-Ym-O`O#5S<! %nbN"WrVHlsq>'g[p]'I@r;Qlts8W)Bs+:9&s6p!frqud"r;6BhrVc`nqu-Nlq>Tm`s8Mrr$N9o#rVuok %p%@\<rr32us8VWbq>1'e#l=Amq"OO_kihsE"9&9"rqQMFs+:9gs8W)rrrr>tqu$EkrquZlrquTknGiOf %r;R$#r;?Nns7Z*ep$D&Ers&<!s7,p\qYg9sqYBs^p\4^OkktG_rVuosV>l/IQiI*br;Qruqtp<irVl`m %r;cfqr;$?]s8W)rrsJ`&r;HZqp@\+Fm/I"hq>^Kbq>'mcq[!&oq=s^Ys6/\Err`6"s8LFGK)^H&lMpn` %r;Qruqtp<irVl`lrVl`jrp]sfrqud'rVZTls8Vfcp$D&Ers&<!s7,p\qYg9sqYBs^p\4^OkktG_rVuos %rVqKLK)`Rbs8Mrr"oS8pr;HTnr;6Hlr;$?]s8W)rrrW/sr!33#s7Z-Ym-O`O#5S<!nbN"WrVHlsq>'g[ %p]'I@r;Qlts8W(us+:96s8W)trrW3!qu6Hiqtp<jqu$Elrp]sfrqucrrVl^!rr2Fd;t'2Srs8/hpZqPH %p\FXaq?m&oq"OOXo^r1`p\b!?s+:9&s5j:\rr2p!rr2foqY^6fr;QTkrVlfcs8W)rrrE#sr!*0"nP`BT %n,E=mnb;eDp@e7Vq>U3tq>'g[p\=CQs8VikrIY'$s1/10rr2p!rr2foqY^6fr;QTkrVlfcs8W)trrW6# %rVl^!rr2Fd;t'2Srs8/hpZqPHp\FXaq?m&oq"OOXo^r1`p\aums+::As.',hrr2p!rr2foqY^6fr;QQn %rVc]orp]sfrqucrrVl^!rr2Fd;t'2Srs8/hpZqPHp\FXaq?m&oq"OOXo^r1`p\b!5s+:9&s6p!frr2p! %rr2foqY^6fr;QTkrVlfcs8W)rrrE#sr!*0"nP`BTn,E=mnb;eDp@e7Vq>U3tq>'g[p\=CQs8VikrV->D %s+:9gs8W)trrW3!qu6Hiqtp<jqu$Elrp]sfrqucrrVl]srr2Fd!`SRVrr38op\4"Ip@nCYrqZutq=s^Y %q"44Ys7cHiV#Q&HQiI*brr3&urVQTis8)`mr;?Woq>:<mrVl<ds8Mrr)#X:.r;HTo!!*'!oCV\Ms8W#h %o_/+Vr;?Qm!;uin$NL.toD8Fas8DoqdJnguK)b-9s8N#t!r`)prqZTjrquZlq>:<mrVl<ds8Mrr)#X:. %r;HTo!!*'!oCV\Ms8W#ho_/+Vr;?Qm!;uin$NL.toD8Fas8DoqrVqKLK)`Rbs8N#t!r`)prqZTjrquZl %q>:<mrVl<ds8Mrr!rVrm(&\%/rr<'!s7>mTq#CBlo^qkQq>C0ir;ccpq[3B'oCMhWrVuipri6!Ms-!Be %rVc`qs8DomrqQNhrqlTjqtpEks8Drro)Jahrr3'!rqucm#5nE!.kCPqrr38llg+TFp\=X_rr!0$r;$*] %s3oHqrVQTprRV"#s+::4rs/N$rr<#srVHNgs7uZkqu$?gs8;oqrr2Kgs8N#t!ri2srqcotr;S8tr;?Qo %#k%$Es7c9_qtpBk$2j_sp\4^:e,B7BrrE"Ms+:9]rs/N$rr<#srVHNgs7uZkqu$?gs8;oqrr2Kgs8N#t %!ri2srqcotr;S8tr;?Qo#k%$Es7c9_qtpBk$2j_sp\4^:e,B7BrrE#$s+::As.')orVc`qs8DomrqQNh %rqlTjrVQWls8;oqrr2Kgs8N#t!ri2srqcotr;S8tr;?Qo#k%$Es7c9_qtpBk$2j_sp\4^:e,B7BrrE#A %s+:9&s6osmrVc`qs8DomrqQNhrqlTjqtpEks8Drro)Jahrr3'!rqucm#5nE!.kCPqrr38llg+TFp\=X_ %rr!0$r;$*]s3oHqrVQTprV6DEs+:9grs/N$rr<#srVHNgs7uZkqu$?gs8;oqrr2Kgs8N#t!ri2srqcfq %r;S8K/,]>Ers8&Yli6_Rq"ssfr<`E"q=jX`e'n9oqu6ZpV>l/IQiI*arr)usr;$?es7uZhs7uZj!;ZWh %rql`ns8Drro)Jahrr3Z2rquWhqu$Ba()HiGqY9jc+X-jar;HR+qXsOOmdBs*0E;(OrVcHis8C@FK)^H& %lMpn_rr)usr;$?es7uZhs7uZj!;ZWhrql`ns8Drro)Jahrr3Z2rquWhqu$Ba()HiGqY9jc+X-jar;HR+ %qXsOOmdBs*0E;(OrVcHis8DorK)^H&^An63rr)usr;$?es7uZhs7uZj!;ZWhrql`ns8Drro)Jahrr3-# %rquWh%f?2%oG/5?r;-3`ruiQbrqu`n&c21nna>iB0/*A*rr)fhs8W%ts+:94rrDrpp^$odm/QMAs5W/> %q>UBroD/4^rqH]oqYU0grr2BdrVclsr;?Qk,jlNfr;?Torq[]YrVuoas8O]((E4=Vs8VX?/,]>Es8Vfm %s8(=HK)^H&j8T,VrV-a"m-Oc?mf2>-q>($i"7u?as8MctqYL*drVlfbs8DourVZTmq]kMH)>sF4rr2a9 %+8u6>m/R)</f,HGkPtSQ.kCPqrr<#ls8N)qKE$Q'\,QI*rV-a"m-Oc?mf2>-q>($i"7u?as8MctqYL*d %rVlfbs8W'$rr2lor;QR=mMQo?r;ZcqqB$gXs8VHcs"5o?)]Ru?s7.Zjr;?Qos7ZKmqQKpNs762YrrDrp %p^7&fm/QMAs5W/8q>UBsoD/4^p^$ZiqYL*drVlfbs8DourVZTmq]tSI)>sF4rr2a9+8u6>m/R)</f,HG %kPtSQ.kCPqrr<#ls8Vr>s+:9&s6]gdqu-9ss6T+PmdC,8j8&NMrr_lgq>^Hh#5\2nqu-Nnn,N@c!r`&p %rqdu/)&`AMs8N#o+!:I]s6Tdc/hRqZ)s@8$ngc6gr;Q`rpAb0hq#>sGK)`[e!;l`i$NKJZs6f=Tj5]t2 %rr3)lq>('ip]gTkqtp?krpTmcrW<&rr;QQomMR2dr;?Torq[]YrVuoas8O]((E4=Vs8VX?/,]>Es8Vfm %s8&SlK)_2;"S_Zer;?Qo%-ZpH/hS4q.SNM9+X$s9s8V?_q?Hior;?NmrpTmcrW<&rr;QR#oGntNrVufn %q&pp\rt+oL,PLj$s8P1>iV3BP*?FhPrrV]ZqpGFqs+::9rri)jqY^9jrt+DXo.DX;.On+c!$NN6s8V?_ %q?Hior;?NmrpTmcrW<&rr;QR#oGntNrVufnq&pp\rt+oL,PLj$s8P1>iV3BP*?FhPrrV]Zqu-PHs+:9b %rri)jqY^9jrt+DXo.DX;.On+c!$NN6s8V?_q?Hior;?NmrpTmcrW<&rr;QR#oGntNrVufnq&pp\rt+oL %,PLj$s8P1>iV3BP*?FhPrrV]Zql9[Js,I$cnF5fEs"WBeq<dPTr;7i?s7YR9s8;iprp0Rcrr2lnr;Rr> %r<iDtq'%$_oCMf&,6%TKqYD$*qu5O30/*>)!:Kjds8Drrg])m*K)ad/'CbMXs8Oh1hYHR+r;7i?s7YR9 %s8;iprp0Rcrr2lnr;Rr>r<iDtq'%$_oCMf&,6%TKqYD$*qu5O30/*>)!q-*g!rr5trr.`RK)`4X'CbMX %s8Oh1hYHR+r;7i?s7YR9s8;iprp0Rcrr2lnr;Rr>r<iDtq'%$_oCMf&,6%TKqYD$*qu5O30/*>)!:Kjd %s8Drr[/YaXo)G'V'_(VYs8Oh1hYHR+r;7i?s7YR9s8Doprr26`!ri2tqu$I;rr!3#qY;<Zs7>jY+sR$d %$2XK7qtpBNi%Hb_rrDKds8W&srmCats+::9rtFnkm/R)?hVS(qmJQl-s8VfSjo>8Wrr26`!ri2tqu$I; %rr!3#qY;<Zs7>jY+sR$d$2XK7qtpBNi%Hb_rrDKds8W&srr)kKs+:9brtFnkm/R)?hVS(qmJQl-s8VfS %jo>8Wrr26`!ri2tqtpF;!$V@?$MsVp+sR'YoD0XTrr3<$qA9&+rnu]f0E1tOmf*7drVlers+:99rrqlc %p](9frr32lnGE7c!WrB$rr2unj8],Xr;@!%,:!0cr;-9b+<^[`''g;Krr2WWlQ>lqmf3;-*WPs2rr3/h %r;?Nmrmq+$s+::7rrqlcp](9frr32lnGE7c!Wr9!!;PUSrr2io$N;7prVcZjqY20Urr3Vs()HoKp?V#d %p\4+UruE-[q>($i"RZ-brVcfrKE$Q']`/0(p\4^fp\t0snF6>TrrN9!rrDiSs8N#trVla&rZ`ZdrVZNg %p`L^Yrt=W5(B4=,lg#Yep[8(]*?G1Uq>UBtmJQn\rr0,$K)^r4"n23[s8Vimrrhi\qu?]r!rMutpuDDR %rqu^%rZ`ZdrVZNgp`L^Yrt=W5(B4=,lg#Yep[8(]*?G1Uq>UBtmJQn\rr1[PK)^H&j8T;Op\4^fp\t0s %nF6>TrrN9!rrDiSs8N#qr<iNK,Q7T=qYKt0+TDBRlP:98rq>[D+8>Nts8O)[s7uKirrqffr;HWoM#W), %\,QX#p\4^fp\t0snF6>TrrN9!rrDiSs8N#qr<iNK,Q7T=qYKt0+TDBRlP:98rq>[D+8>Nts8O)[s7uKi %rrqffr;HWo[/YaXo)G6[!r2QjrUCO#h;.l*rqd08s8VQfs8)`os8V0[q>Mi@+X-g_rqu]i*?G"5hZ#Sr %naZSXrupq&s6T+Cnh'b9p@n=]r;?NmrmCats+::>rrVujs8DI!s4uN+rr2d)%fcRts8Vrpro3tRr[Iag %+oVB=r;?@2*W"XLs#E+0nbrLf+n>+&m-O<6/c5G=p\4^cr;HWorVqKLK)`ag!r2QjrUCI!h;.l*rqd08 %s8VQfs8)`oirAiR!W4)g+oVB=r;?@2*W"XLs#E+0nbrLf+n>+&m-O<6/c5G=p\4^cr;HWoWrI\NQ2^jQ %rVm>rs8VKdrsA`*p\4^[o\0?ErWN*@+T;9<rr`*;*;BI4(B=I6rV$9k"onW%o^r1`%-H^Pq"XmfrVlfI %s+:9&s60I_n,<7qnGiOUs8NE*s7c9fo^pl;rr*&t+<^X]rr3)s*$"_Prtte:rVcHirrrH&rq,j_rs\&P %s7lBhrVc`p!<.WNK)`L`!:Tmd%IjDtmJm1ms8Vifs7Gs;s8N!#q]I$[rVlg!qA^LLrr3c7!<)lis8N9& %s8MZ_s8NMik5Y5Os8Doqric?Rs,d6\n,<7lnGiOUs8NE*rri)js7Gs;s8N!#q]I$[rVlg!qA^LLrr3c7 %!<)lis8N9&s8MZ_s8NMik5Y5Os8DoqrnII)s+::2rrDNdrseJts6]jd$31&"p]'mXgAh0O"T';arVc`q %"8WuWp\t1,!!)urpAb-rs8W)jo`+q"k2u^=p]CKorVlePs+:9[rrDNdrseJts6]jd$31&"p]'mXhuEWS %rr*&t+<^X]rr3)s*$"_PrtbY8rVcHirrrH&rq,j_rs\&Ps7lBhrVc`p[/YaXo)G6[s7uZl!rr;frr3H@ %')qY"s8Vcls8;osq>U9jir9/[+X-g_rr3u9*Zk+Vs7AE9hr"J#lojn/qss=Tqu&T<kPtSQbl<:pK)b<> %s7uZl!rr;frr3E?')qY"s8Vcls8;osq>1*Mrri9D+oVB=ruCqX*r,d8oK57nhuE'04n8(>o()\TrB!+( %s8VZbs+:9&s24m:q>U9ns8VKcrs]SRrqH0es7QElr;ZfmqYoLS!W=/C+oVB=ruCqX*r,d8oK57nhuE'0 %4n8(>o()\TrB!+(s8VYds+:9;rri2ps7Z0crrVZX.fTGPmHsT>0)tqRrr<#tr;HWoirB$'s8Drs!ra>d %rqmPt$Od"7rr<!;r;?Tjq>L9l,UDOPs8(.CK)^H&lMh"`qZ$9_rr3&gmje>:$LR6Roe-:Err<#tr;HWo %irB$'s8Drs!ra>drqmPt$Od"7rr<!;r;?Tjq>L9l,UDOPs8)]oK)^H&^Ae?4qZ$9_rr3&gmje>:$LR6R %oe-:Err<#tr;HWok5YD[s!.RBrr3'!+X-j_(@)>9s8W)uru:n6s7uKhrVn,gk5YJXWrI\NP5b[]qZ$9_ %rr3&gmje>:s6U*boe-:Err<#tr;HWoirB$'s8Drs!ra>drqmPt$Od"7rr<!;r;?Tjq>L9l,UDOPs8(=H %K)^H&jo5J[qZ$9_rr3&gmje>:$LR6Roe-:Err<#tr;HWoirB$'s8Drs!ra>drqmMs$Od"7rr<!;r;?Tj %q>L9l,UDOPrrDnJs+:9]rri2ps7Z0crrVZX.fTGTmHsT>0)ttNs8W)rrVlf^s7lWo,QI`ArrW0C+o_BT %lO++#s8N&u)uTX6q>(!fs!/lPs8Vr!s+::As-irfli$hel8LX@&.ngS!`)VErr<#bs8UjR+!W$0rr;us %q&::HrVcR@.-g*tp\--9rr;]cs8Nu!k5PA\mJd%`rVulGs+:9&s6]gdli$hel8LX@&.ngS!`)VErr<#b %g&E-=,Q@]Brr2^4)ts7/qC!cWlMpVQ.K9>Hp@eOd)<U)\rrDHcr;Z`qrr<"Ms+:9errDB`rrq[H2]E;> %rY#?/:Y>[Hs6SG=!$`O0rr2rsrqRKPpAOsd-n+BGs7c7:rr2rkpAb.1k2u[C!:Bd`s8DusXT*nPQi@3d %r;$<irr<#]qu6fio)JUa!rqufgA_<S+X-jarr3u:+<^U^s8(sC/hSjn('":4rUKFOp)a86nDr[1rqufp %s8L[NK)^H&lMh"br;$<irr<#]qu6olo)JUas7Z0?rri9D+o_K?ruCt[+T29>qWR,q/hn(Us8N#rnaZ>H %*rl90jQ-@?quHZsrVleMs+:9brri8tq>L9ks8V9Zrs/,cs82]np@d>Brr3-"+X-jarr3u:+<^U^s8(sC %/hSjn('":4rUKFOp)a86nDr[1rqufps8K;'K)_#6"T82nrVc`qs6':Z#P.HcqtpEep=fNLr?3?`rr2p; %r?*6\s8VrZkUnJB'c$cJrr)BWp@]R-s7#+1s8MrrrVulQs+:9&s5j7`r;?BhrVliskPP8ao()hXqu?B` %gA_<S+X-jarr3r9+<^U^s8(sC/hSjn('":4rUKFOp)a86nDrX1s8MrrrVukSs+:9]rri8tq>L9ks8V9Z %rs/,cs82]np@dMGq>UTr+X-jarr3u:+<^U^s8(sC/hSjn('":4rUKFOp)a86nDr[1rqufps8KJ,K)bEA %SGs&oq>^Hns8V]hrV,XDkl(A[qXjFXs4dP^,:!3es8Dol*$"_BnG`Fjlg+6;pAY'qmJm4SmM>g%!pJkJ %r;HZpe,P%"K)b<>%Jfi"rr2rtoDSX^lg*d5qZ?Wdo[a$N,:!3es8Dol*$"_BnG`Fjlg+6;pAY'qmJm4S %mM>g%!pJkJr;HZps8R]NK)`ag%Jfi"rr2rtoDSX^lg*d5qZ?Wdo[a$B,7>aqrr;rqq&CCKnF6GW"RGCH %p@eLc"mu?imd:kirrVEJs8;iqriH-Os-N`jq"Xm^p&G'jpAb0l"9/8trn@DP,QIcBrsJZH+T29>nGiOf %rr2p&mJm4]rV[HGrr3)ps8W&qrmq+$s+::9rs/>os7Q'bs8DZkrr)utrVkONs!.RCrr3?'+<^U^s7$'g %rr2os#OVQkq#1.+(&n48p](9lrVcfrKE$Q'^AeH5q#C$[s8W&ks8N!!rVc`Ps8Dut,QIcBrsJZH+T29> %nGiOfrr2p&mJm4]rV[HGrr3)ps8W&qric?Rs-!Beq"Xm^p&G'jq>^Horr)utrVkONs!.RCrr3?'+<^U^ %s7$'grr2os#OVQkq#1.+(&n48p](9lr;PINK)^H&jo5S\q#C$[s8W&ks8N!!rVc`Ls8O>Drr2p)r#d-[ %s8VTgs8N#srs.rks7lQk'c$`J!r)`p!<)ipM#W),\c2p0q#C$[s8W&ks8N!!rVc`Us7lWo,QIcBrsJZH %+T29>nGiOfrr2p&mJm4]rV[HGrr3)ps8W&qrj;]Ws762Xrs/Dss8VfiqtL*irV-Kjrr2cms4mVWq]I$Z %r;HZq/,fMJp&FgdpB(BPhu<ZU'E8"1rrDo>s+:9&s6TajqYL6lpA=a]rr;rl"8VrqqUkfNq]I$Zr;HZq %/,fMJp&FgdpB(BPhu<ZU'E8"1rrDojs+:9&s1nX>qYL6lpA=a]rr;rl"8VrqqUkfKq]Gq_r;?Nns""'J %s7QEerq?Kohr"G5rtGD2rr2upV>l/IPlD!bqZ$Thqtp-es8D]oq>U?nqUkfNq]I$Zr;HZq/,fMJp&Fgd %pB(BPhu<ZU'E8"1rrDoCs+:9&s6'CeqYL6lpA=a]rr;rl"8VrqqUkfNq]I$Zr;HZq/,fMJp&FgdpB(BP %hu<ZU'E8"1rrDoos+:9&s1A:9qYL6lpA=a]rr;rl"8VrqqV2&Lrri3A+T209s8OVJs8Vclq#:!hs52`5 %s8Nc3rr2otqPsRIs-!B`p%A7ZrrE#squ?WjrrD`Hrri<F,5hB<r=8]J+oV$(o)JagrVu-Hp&=sto^kC6 %nc/XRoCLN4K)^H&jo5DTp&+[d!<)oos8Dcn!;5+H"TBShr;?Qm%f7CmrU]XOs8W&rs68e@rr3;soKY\3 %s8V?To7I!os1/.2p%A7ZrrE#squ?WjrrD`Ps7uZtrZWQar;QX)q]R-]oCMPQs8Dorl07m?rsA>i5X=l> %s69.HY5a+Ro)G'V"nhQYs8W)prr_ikrqlZog]&6<,Q.K9q"XIu)"dk.kl:\\r8@VTl2UeY.4O*/rr3)t %s8Vl<s+:9&s6BUfp%@kTs8Mlp"7lHjqq(if,:!-aqY9jX(`;oFs60L_r;>LQs69R`paIZJh>[EVqu?]k %q#>sGK)`Rb"nhQYs8W)prr_ikrqk=I!$`F-r;?Edq",C?o`+sTs8W#pi;`iAs8VjC.G`hZrr`/us7iGj %K)_#6"nhQYs8W)prrVcjrW)iIru<7.r;?Edq",C?o`+sTs8W#pi;`iAs8VjC.G`hZrr`/us7k"AK)^H& %jo5MWp$r(^rqcWso)AXcfDcg8,Q.K9q"XIu)"dk.kl:\\r8@VTl2UeY.4O*/rr3)ts8Vlms+:9&s1/.5 %p%@kTs8Mlp"7lHjqqM/Lru<7.r;?Edq",C?o`+sTs8W#pi;`iAs8VjC.G`hZrr`/us7iVoK)^r4#l+;o %s8Vurs7$$fs7Q<i!qZ<dgA`5m+<^RYrVlfr,piTap&"R\o^r1_rqcQjr?`lks7-*gs8:FIK)^H&j8TD[ %qtpEnqu?]crr<#kr;Qiiqto+I*rR3(qtp?krr48js7Q'^q>'[Ts8N#or;?L?-NF,9rr<#rK)^H&\,Qa/ %qtpEnqu?]crr<#kr;QiiqtoCQq>VN7+<^RYrVlfr,piTap&"R\o^r1_rqcQjr?`lks7-*gs89&"K)bEA %K)aU*$7$nlq#:$^q!mnHo_nde!r`)s`rCYjK)`%S$7$nlq#:$^q!mnHo_nde!r`)so)F=AK)^K'!$hjr %q"Xj_p\=:Ko^r+]quZiqrh'4Bs+::%rsC"sq"Xj_p\=:Ko^r+]quZiqrlb=ns+:9NrsC"sq"Xj_p\=:K %o^r+]quZiqrqHGEs+:9&s8Ds),UE0[rqH0^naZ8DrVl]rrVc_ks+:9&s3goTrZicbq>^<fr:]j\o_JLa %!r`)sd/S^tK)__J$iVCsq>('eqY^'\qXjU_quZiqrqueJs+:9&s7u[&rZicbq>^<fr:]j\o_JLa!r`)s %WW.SMo)F=Ah#@c\,:!$[s8N#tr;?T`r;ci:s+:9&s02M2r?EQ_q>^Hns8;fpn,37co)F=AK)^N(!W=5L %,Ph08rr2rqr;Z6a!</VjK)^H&fDc6W,:!$[s8N#tr;?T`r;ci?s+:9&s/Z/-r?EQ_q>^Hns8;fpn,37c %p]#jFK)^H&rr3B),:!$[s8N#tr;?T`r;chms+:9&s3goMr?EQ_q>L?nrU^'erm1Urs+:9Jrri9F,Ph06 %s8W&hs8;lns+:9&s+::Hrri9F,Ph06s8W&hs8;kps+::As+::+rri9F,Ph06s8W&hs8;l8s+:9&s02M+ %r?EQ_q>L?nrU^'erpg#?s+:9(rrN'C![IO:rVuoroDeafT)XEBK)aI&$N;7pq>('irr;oo\,V'[K)_nO %$N;7pq>('irr;ooj8X`2K)^H&rr3?),:!$[s8N#tr;;ZVK)^H&df0^S,UE3]s8DorqtpEcrlY7ms+:9J %rsSfO,l.99rVccnqu?<fpA]aEK)^H&q>Uj%,UE3]s8DorqtpEcrhKLFs762As4mV^rZicbq>^Els82]n %o_uZ+K)^H&Yl>+1,UE3]s8DorqtpEcrp9Z:s+:9(rrN*E#pf?Bs8DorqtpEcrgEe<s+::&rsJ]L,Ph08 %rr2rqr3u]Xs+:9OrsJ]L,Ph08rr2rqr8[g/s+:9&s8N$*r?EQ_q>^Hns8;eVs+:9&s3goMr?EQ_q6p<T %s+:9Jrri9F,Ph/ps+:9&s+::Hrri9F,Ph.rs+::As+::+rri9F,Ph/:s+:9&s02M+r?EQ_q:P_!s+:9( %rrN'C![IO:L&Zc)K)aF%#9Y/grqufrrO)ZWs+:9Nrs'Yhrr2iqs8CpVK)^H&K)bfL#9Y/grqufrrJpo0 %s+:9urs'Yhrr2iqs8BP/K)^H&V>gcC+TDB<s8W&[s+:9&s+::Grs'Yhrr2iqs8A/]K)bEAK)aU*#9Y/g %rqufrrNQ<Rs+:9Srs'Yhrr2iqs8CaQK)^H&KDtoo"sEpEr;ZfqM>r2-K)aF%#9Y/grqufrrO)ZWs+:9N %rs'Yhrr2iqs8CpVK)^H&K)bfL#9Y/grqufrrJpo0s+:9urs'Yhrr2iqs8BP/K)^H&V>gcC+TDB<s8W&[ %s+:9&s+::Grs'Yhrr2iqs8A/]K)bEAK)aU*#9Y/grqufrrNQ<Rs+:9Srs'Yhrr2iqs8CaQK)^H&KDtoo %"sEpEr;ZfqM>r2-K)aF%#9Y/grqufrrO)ZWs+:9Nrs'Yhrr2iqs8CpVK)^H&K)bfL#9Y/grqufrrJpo0 %s+:9urs'Yhrr2iqs8BP/K)^H&V>gcC+TDB<s8W&[s+:9&s+::Grs'Yhrr2iqs8A/]K)bEAK)aU*#9Y/g %rqufrrNQ<Rs+:9Srs'Yhrr2iqs8CaQK)^H&KDtoo"sEpEr;ZfqM>r2-K)aF%#9Y/grqufrrO)ZWs+:9N %rs'Yhrr2iqs8CpVK)^H&K)bfL#9Y/grqufrrJpo0s+:9urs'Yhrr2iqs8BP/K)^H&V>gcC+TDB<s8W&[ %s+:9&s+::Grs'Yhrr2iqs8A/]K)bEAK)aU*#9Y/grqufrrNQ<Rs+:9Srs'Yhrr2iqs8CaQK)^H&KDtoo %"sEpEr;ZfqM>r2-K)bWGr;QZps8;lr#Q+Dprr2iprr2p1r;?TnrV$9kq'IH_p](3jnc/XgqZQrurqlTl %rrE&ts8VuorrDlos8W)nrrE#Rs+:9&s2t?Arql`qr;Q^$qtp6hrqu`nrr3o6qu?Tlp&G'e,pi9Ys8;fa %s8Vrmqu?ZpqYL3k!<2uts8)Zn!;ZWo"9&2ts82fsrr%`SK)_MDqu6Tps8;lr"oJ2mrVcWkrri<!s8N!4 %p](9i-R\]as8N#gs8W#mq>U<iq>($h!;uiqs7uZn"o\Dorr2ljrrN,trVlfpqu"A3K)^H&oDeafrVuoq %rr36#qtg<kr;Q]prt>8-s8Dois8VmA-MR97rVc9ds8Mlus8N#pqu6Tqrr2rtqu$Hoq>UEorqQKnrSmj/ %s+:9irrE&qs8W#rrs/GuqYpKlrVc`q)Z0F3r;?6fs7dldp@eOar:'adqYU0irr2cjrr2utrr<#pr;Qio %s8N3$rVc`lrrN,tO8jh3S,`Bbrr<#rrr30!qt^3hqu$I4rVccqrqHHmqBmZcq#C?mo)Jafq>($fr;$0f %rW)lqrr;fnrWW9!p\t0jp\t9nrVc`prVQN6s+::As+::Js8Dp%s8Vurs8N#qr;R'"s8V?\qtTs`rr35u %q#;K\nF6/Ns8VKcrsJK!rr<#tp\4[aqu$HomJQtaprrbis+:9ss8N#srrr<"s8N#qr;R'"s8V<ZqY0a\ %rr35tp\u?Yn*frKs8VHbrsJK!rr<#sp\4X_qY^?nmJQtap\=c?s+:9Is7uWoqYgBnqu$I"qZ$T\r;?Bd %r;Q]uq>(%7"![:*p\t1'mdC,Srq--drr2igp&+X]r;H]^r;H]ip&G!irr)`l^AifbK)bQErVliqrr3,s %q>L<lrpp3krr2fp'C"c]q"Xk%'*&"1q"X@Ys7GmQrq??pp%A+Trr2p!mdC,Srqu`ornRO*s+:9ns8Drs %rVlg"q>(!grr2Kjs8DoortPIrkl:DOrt,kCs8;Wcn,NFZo()bQrri#fp\4[drrVWVs8Mrsr;HQnrVukS %s+:9Ds8N#qr<NB%rqZBfrr2ofq#CBZ&c_\&rt?(Gs8Miinc/X^naZSSrrE&trrhudp\4Xcs8VK^s8Dos %s8DrrrVQN1s+:9&s7--frr;rrrri/nrVlfqo)eskrql^/l086Cq#:s>s8W&mq!e=`o^_SPpAY9gp%\=] %rr3&fmf3:cr;HWoiW"N0K)`girVliqrr3,sq>L<lrpp3krVcZo'`R=[s7c9f&J>'Cr:fsSs8V]]o)8:^ %"SMH^p\t0ls6]merr)cms8DusO8jh3S,`Ker;?m#rr2`hr;Q]po)&IdrtF\_s7uKj',1EGrqZB[s8Vc^ %nbr=a!<2ut"SD?\p\k*ks6]X^rVcfsrVlfpqu"P8K)bEAK)b`J!<2urrqufqs8;lr#lOMos75a\qYL-i %rqlrm-78cmoDARfrr2p'kihd@s8;0Io_ndtqs3SJl086Gr;6?erqQZnqu$EFs+:9&s3L]Frr2lqr;Zcr %r;Q^%r;$0gnaZYTq>C9lqZZU=-NF,:qu?]qrr38ekP,#Vr9ES>rVmE)lg+T8l2UYXqYBs^q"aafqY^;G %s+:9GrsJc(rVZQir;HTkqu6U$r:p'eoCN"Zqu$Knr;lU?""=3Lo_\[grVlg&kNDR=s82'FoDS[qqWdAG %kii'Grr)fm"T&#mr;HTnrr)`l^AifbK)bQE!<2urrqufqs8;lr#lOMos75a\qYL-irqlrm-78cmoDARf %rr2p'kihd@s8;0Io_ndtqs3SJl086Gr;6?erqQZnqu$EKs+:9&s2t?Arr2lqr;Zcrr;Q^%r;$0gnaZYT %q>C9lqZZU=-NF,:qu?]qrr38ekP,#Vr9ES>rVm6$lg+T8l2UYXqY:Blq"X[]qY^;Ls+:9BrsJc(rVZQi %r;HTkqu6U$r:p'eoCN"Zqu$Knr<;mC.0'>>qu?]prr38ekP"rUqs!A:rVm3#lK\E5kl:Y]rVcTrqYU0f %rVc`prVQN1s+:9&s7$$lrVcWiqYC*i!;ZWo"SVQJqtpBm(?alLs8U1?s7RQXlK\$=qsX+Hq#:9OrVm8u %o^r1Yq#BjQqYKRXs8MotrVcZlqu?WQs+:9&s2G!Brr)fmqYL$drrDlorri&hiVWNOrtae\n,NF/s8Vd8 %+R87aqtojQo(`4`iVicap%7nVq"XmZnbW+Krr<#rrquiprVHZorV_`UK)_5<"o\Dtqtp6grrDlorri)j %ir8rVrtanbo)Ja4s8Vm>,OFdkrVc<Zo_\[gir/lbp@\+Yq>(']o)&=Orr;urr;Zcqq>^Hnqu+V9K)bEA %K)b]I)#aF0q>('apA=aeoCMGHq>C9mpYk*2s5j7[)"[@u(Dm,OmJm5^,9n6o5MlG?mHs]Jrpp!e#lX`% %l086<nau\S"T/,prVkILK)^H&ci4m^r;?Eeq>^0^qtpEboC)MNr;ZfkiSjh:jo58soCMqt(]XO'!!#b= %,9B'6huE`DmJ-\[o)/Lnrr2r^l2U;Do_SCbqtpNnrr.WOK)_SF)#aF1q>('bp\Xjfo^qYKq>L?nqW-`; %s60I^"8;Hg)AF+is6p'k;'mV45X=9-s6f=Ns8V]drrq]Qs75aRrr*'!rVlfpq>^Hnqu+8/K)^H&p&>m%rVH?cs7Z0`qu?9Zn+leWs8ViPiW&r>rr3i,oDTOBs8VKe!)=a`*^;mGs8VKRq#:9`r;R'$rVu-Hs7,XO %qYC?lr;?Nmh>`*,K)a!n)?0R3qYBsep@eC\s7>jNq>'sgs7bL2s8V3[rttA!rYHCNs6]je:*Uu)5<n'* %s6]4Krr2Kdrs8W's68eJnaZ8MqYp<oqu$Bkreg`-s.00.rVcWhq>^3`qtpEco^M\PrVuoojQ-@@kl:Z# %s7Z0d)B/YUn,`Yg-70j#5iD\BmdBoNs7?'d"mYCQo()JQrWN2urr2lls8N#prPSYes+::Gs8W)qrs\i' %q=sa`l08'@s8)Tks#KT6lLm\:$O]!/',V`10ED252];,SZe!^;_o"G<"skQ=,9nfU'f6't+sQ[Zs8;BU %s7Q'Yp\4LZr;-'bn,J">K)a'ps8Mrr%K?;'q=jX^l08'@s7uKis"X$/lh<n>$k,33'H%r50`hD93#_>W %[+Ep?`5F\A#::cA,U>#Y(,Z=%,9um]s8DKX#QOMkp\FX]qYp?mr;2QTK)_5<%0$8'q>('UlMUS[qtpBm %"nM-Nqb'R/&.h#B(`X_D2$F.G4<F1g\D,cOa2^:L$7RDM-RUYe))qp/-78Nerrhuds82]mr;?QorVHQk %rlG+ks762BrrE#urql]sr;?BipEfe:s8VQPl2T;a3>NARg=kiWaO&<"cd1<!0[%Yjd*UL\^AYpcrlc;/ %dac"C\(THAeC;IV,m=H/s8VBZq"agarVc`ps8DThjo9r4K)aF%s8Mrr/H5SFq=jXWrVccrn*0*:e^ZVq %(F%Vglg)[?dHo9.gG(G,bh(7igV:N&_o)Ju*7WKi]tLr0g:#S``l9>1#;uP]lhUAQr;?Qns8N0#s8I`P %K)_SF"oeMuq>'gartY(ili5Sg3ZB"ahr!nkc.1A6eC<A5$T68VgXXj3_o)Mo`r=="f%/Qj^q8FY\_5ZX %aXIN&3<0$HrVc6cqu4>0K)^H&rVuosqu6`qr;$?d-2mfBs6o4:s4,X[()A(Ig?RtEd*V+)ce:',bKJJ` %d+Z4JrPHGNbSnpXe\&Q(g"Ea^eA]BQ"U-a_s6BCSq>:'frVlfrrUg*Ss+:9&s3^lHrqudIrqu]ip\4C[ %rVuodl085ueMn?],2:l<lcIQ%m*X580epnrf?r"#^VBcc_u@mseC<*`]sueM[as$L`[1oq2?3^Bq>'mb %!rW&srVllsMZ8;.Sc8lmrqlNeq#14(na#N@f@N&&)^XD!n*eNOeI_6"eDE,@cd1@re_e9^s2N(XckY-_ %g;(M9h;,Wpfu_>b#miTks6fjanGiCb_uG>gP5kR]r;Zcqrr3&us8N0#s82fqs7Q?j"Shcao_87_%Gfk; %qu7lc*'cd8hVR/gi%j3FgtC?4eJoRZe^N+#e(E=#f%/6lbJqQ?`l?0Gc,[Q4]tMP/aI,C_!$<<^o^qbH %qYpI#qX<nPrqZBhl083H!rW#qqtpNorVlZnK)^H&jo>A[r;Zcqrr2usrVllprr<#krVm,tq"++Ns8W)t %rsdc=qtpC<,9/p4cJ[X>rSepXhVR#@g=IAef@SR*f[\^0e(<4#c-=>N`lQ6Fcd0`3^BMg'b*tgg#QQ"k %s7Z0Zp&+gh$2jAbs8W#ps6T+Ns8W&pquZiqrhodJs1/10rqufqrr2otrVc`rqu6Wqp&4mnqtp*\q>:1& %hr"D2s!B'76:0)\jQ5Od0B_N[j5](ShV04ugY:E:gtCQ@f\PB9daHCbbK\;ZeC;d_`Pf^Acd/7V8d-Og %s8Dflrs85fs8W#ps6K"Ms8MuoquZiqrmUn!s762[s8W)rs8N#rs8Vcirri6!s7uQmr;6L*jQ-@4oD9XQ %-RT`"nESQSo)@Mdi8EMMhV?o?g"Fps*S&]hf%/:$f?hsod*0_Vb5TK]aW&::_7R=l_84(+_7\%;&0W2M %0D#,>k5P8Tn*g/Q!qZ$_qZ$Qorr)EfK)^H&n,NFer;ZcqrVuojr;Qrts8VolqtpC)j5^12oD0ON-RT]! %nESNQo)@Sfio8qUi83>GgY:@&+4o,pf\"^,g!\?udE^%\bPfR!bKIuD_S*Xs_o'L3_nOIC&gJVU1%kMM %rosI]rUKFTs8Vfgs8N#srLa+As24m:rqufqrr)lsp&+gnqu?]lrr2fp&E`-Tp%A8-+t>&[oCMA$fCf.) %rT4@Gio8nRhqTFf,MUu+gt^Q<h:L?5f@/3rdJhJkckapJaMPg3aN2QGaMZQY(apdi2>[@Qli-qaoDARf %p%eXerr2l>s+:9;s8W)rs8N#rs8Vcirrr<"s7uTjqu75gjT"iCq]I"/-Pu:AlIFGUrne^Ri8<GKgt^W: %g"%/ae^`."f$`1%d*g@hbfn5PrlG)\)ooe2]=Y_l_8O1+]Zn\4+X&KloDJOKrqlT]n,*(coCMtXs8N#s %rV->Ds+::9s8W)rs8N#rs8Vcirrr<"s7uQhqu75fj8\`BqB$e,-Pl4@lI=>Sro"jVio/kShVR&BgXmSi %f@SR*f[SU-daQ[mcHaVVrQ5_qbK.Q;]tM.t_oBU3^<b+<,7>_N1%kPFl2U_\naZMVs7Z9grr2oqV#Q&H %^An64r;ZcqrVuojr;Qrts8Voorql^,k2u^:p&-'Y.Ol>-oBk/]p&=(OjoXW'iYCD/hqTG$gY:E:gt:H= %f@ej/e'l^lrm1Sj(=("B_SX43aNMZG_q!9S-n$r1qZ$T]rr<#iqu?]hq>^Hnrr(4DK)_#6s8Mrr#laf$ %rr<#hs8N0#s5s4Y)#jO7mdC,TkPtQ*,paT.qW6i,gt^3Kp>Gr-(#Ig'h;$c>g=b02*?E\\daZdneC;eA %bob0RbK.cE`5K4'_TL$B^V@@o^;R7[\\c4m[ic\3/`H[,#k[cYrVcNirUp$erVliqr;VBKK)as4s8Mrr %#6+T"rr<#hrVll[qu7N4rr;ESs8V6]ruiX5*;TEkjR1dWc1Ubfro+aQiS`YOhVR)DgtEknf\"a+f@/@' %dEg/<ck=[Nc-+;Pa2bg2`QcZN_SX"%^^S5hZb48r]"0+/+>N!Vrs8Dpo`+shs8Voks8DrsrMfgKs1/10 %rqud#rr)fps8VZgrrD3Vru1J!s8VEbs!9'A+T;9&kjmZideW_"kih3ljq?e;jQ#:[iSiZ@-JmV6h;-c? %h>Z")f,rSpeC)dlcHa>Obgb.jaiVKAa3D0*_TU-<^aLKT2!Fo<#l4;hs8W#ss7lHjrVliqec17$o)G6[ %s8Mrr"9&/qrVliso`+gfrrh]_p[J2)s4IAOqthKh0A5USqs3S?o\o</kh4YGi8EMLhV?o@r7VM1+!9(b %e'umne'n9>$-g`=bfe)K`P]Um`#-D0^q@=i[C*?R]WnrT^qdC`Z+1ej)"6qkr=/Ypo)8@Yq>0scr;HWo %n,J">K)b<>s8Mrr"9&/qrVliso`+gfs!6t*p[J4_fDkmJq]@IEf]_Pqlg+06iU?6uf\#$?j5T%Vhr!;g %h$r-`,2(Z#f@SL&f$DXer6GPkbKIuH`r=!j`l>p2^Upta[_KSa]"5es\[2RJ]H8(3o()\X%/0Dpq"X[] %qY^9irr/GfK)`ags8Mrr"9&/qrVliso`+gfrs%iap[J4_g\q-i,Vq74m-O`?n+c\>o^qJ)gu@S_kiV$g %jQ$0t!T>C4-f3_7gt^Q:gXQ5R$.me[f%&3sccs`6c5=gNb/VH<^V@J%`k&t$aiV9-\\KC1*qf4(rseu$ %pAap_q>0scr;HWoaT$klQiI*br;Qltr;?Nms8V`kqu6U@m.^8Ds8UaOs82[90/)#Cl20f4o^q,3nEAQY %hVd>LhVR&Cg\fb4fH23df$i-ucdUAAbR)P=bfn8OaMl'7rkoYk_n`pt\@&`N]Y(MY\%oefZ*ChY(`;`1 %r;@*%o()bSq"ad_r;?Nmrq-5Bs+::9s8W)rrr`5tr;HWps7H?grr481p\41Ws4@;NqthHg0A,LPqWmJ= %oAT0,kLeGCj5].XiSWPLr7qh;+sP^nf%8O&f%/0mcMYulc-+;O`lA"u%*$<)^V@Ci\$j&d[(6XV_o'$l %[(IJ")tNRsrs\Vps7lBbqYL-frVleis+:9bs8W)rrr`5tr;HWps7H?grr32hp\41Ws4dMP)^I3qh<aM%n*g&Hjn/32gt^oRl0.9ljQ,@\ir7pFi?p#0hV6i@f\>01rmhD-f@JO'daHIdc2Q!*c-=DN`koL*]uJ(' %^qe(6^:Cei+s%fup&+h!rq?'cq"X[]qY^9irr11BK)_#6s8Mrr!<)op"TJDus8N8jme?8Ao`"k5q>(%6 %+X/-'l07d<rnll#daJ!Gg>_i"j5AkQh;-i?gAKVHfH)*bf$`$rcI1.ac-=JUbK7lH`l?!9`5]R,]"5Mi %_>_Ft_md+q\[eiE]XG8Y]">R>5QCfHp%@tPq#'jZp\Oaar;QHjK)^H&jo>A[r;Qcqrqm-&rqufrmdBi> %nauh\+Sba3+<VgNo]YN0rVbU7jjDKOg"G?Wp#>&nj5JtShqn:e$eupMg=k-0f@&7$ci29'cHa\ZbK@uL %aN2NA_nEat`Pqi!+ih4,bItToZ,!r^]Y;1s77@:\lMCAQrVccip@nF[r;?Pis+:9]s8W)rrrE#sr!NH& %r;Zfbme?8Ao`"k2rVcaB,pju7mdBiLs5WG2f%0iXhrjk4kNV6pkN;p.jlH@"(#gVii8EDHh:UN<e_/X. %f@SR'e'c\Dd0J+Dbf7ZCcHcF;$dZ],d_iu3\&H+s_#D1`84Wjdm/-\VrVccip@nF[r;?Q@s+::As.',h %rqucrrVl^%rr2iqs6f=LnaZ8NrrDj:q>VT]+sQ^El14iQhra(Lde_\OiqE*+i8EMKh:p]<r7N4F*Zin` %daQ[jdaH=`c-4ASaiVTC`l5m7`kT:"]">eprl-,!\$sDg\ZN!H[^N]W]=U<n!!)0Sp%8%Sr:]jYqYL-f %rpB`;s+::>s8W)rrrE#sr!NH&r;Zfbme?8Ao`"k5q"Xk3+<_p#kihU9rSHYtdF%dCg#;VsioK1\iSi\O %hYc1;g`drrg=Fm-dam!qrm28&cHXVWb0%iIaNDE<]tM/!`W"!da1Jt,]tL\U^q(>n]Y;1s77@:\lMCAQ %rVccip@nF[r;?P_s+:9gs8W)rrrE#sr!NH&r;Zfbme?8Ao`"k5rVcaB,pju7mdBiLs5WG2f%0iXhrjk4 %kNV6pkNCsgjS\$=i[>Hgi8EDHh:UN<e_/X.f@SR'e'c\Dd0J+Dbf7ZCcHcF;$dZ],d_iu3\&H+s_#D1` %84Wjdm/-\VrVccip@nF[r;?Q6s+:9;s8W)rrseo'qu$Ekl21AWrr;`e-g^m5o(_u#n*fH&jlkq!j5]4l %oD&+Pkigj[hr`hRhVI#CgtUQ:g&BV9*Zik^daQ[kdaH=acHOGRa2e.t"NJHp_86,i(rF/%[C*<W_Q1;\ %`l>KdW3<q0U8Op+_C,?\#Pe)lqYL*frVZ]prqHGEs+::9s8W)rs#'`Oqu$Ekl21AWrr;`em/R+Vp\,Zq %mcNZmkihQrioBV#p\47AkM4qNjl>C\iSi_Qhqm5GrnJ)0,2(Z#f@SL&f$Dakd*9hYbPTBl_8O:5aN;E? %^U^n``l>3s%_p0/]</3B_PX33XN/@3rr36%rVu`jqu-Kks8N"ns+:9bs8W)rs!msDqu$Ekl21AWrr;`e %m/R+Vr;7`0oBY`-mHsZ2kNVa8r;?<VmGd0dlMfuOkND!ijlGJ&j8S$N-n+!1gtgf=gt^H6g=Y!-e'lbE %d3-lcaj&)XdF-=ca25^-bfmN7`R)uJZEh![WN!&'aiQ.6rs/N$s8)ThrVcZorr1:EK)_#6s8N#t!ri2s %rqcirr;Z6S+ohT7q>('gr#6b$q<RA:nb;A8p%J+HoCMA:f&G]cjlPJ#h>Q14gtLK7rmqGs*S&]ge'lXl %e,IPrbK@uKaMu3<rknu[a2c-:^&GJE^V@giX4I6S(::NYXgPC;_SVV)PUe7"kihm=q>1'gqu?]qr;VBK %K)as4s8N#t!ri2srqdN0r;Z6Ss8V`eq>^Bj)]p0slK[m.p?LrBoaU9Yo'G_niSjUnjP]"Ur8Ih:hVR&e %gBf#Hg"Fs.f@/@'rm1nrc-=GTb/qd)aSs<eaN23/]">hr*m1[ig:"Gt[CEfZZ+@<L`l=L;R4p<6mHsrL %q>1'gqu?]qWW.SM\c;^/rr3'!rqucm./a#Cn*g;Vo_J=_r;7KZ,lR3#p%A7On+uqYnb;eKo%W?js6An3 %kNDj."mG15jlPM$i=mXehr!5GhV$`@f%Sj1f@SR'e'c\Dd08"KeBu[drknuabga)0iVgD)^;.Om^::\q %b++uk0ej[8mJm"XqYgBis8W)Ks+::As.',hrr2p!rr2ipq[WQ%s6oFVs7H-_s8;d6+;Z0rlg+*2pZq/< %p@dnFoBkqrio9grjl-3prS@Y3g=k3Yf*NH<e^`*se'HLlrlbVjb0%fH`l5pr`!+0$a2Gp0rjN'G^W3CU %f);ih['mEF[BQmP_NpLP.k;D!kkb,NqYgBis8W)hs+:9&s6p!frr2p!rr2ipq\T2.s6oFVs7H-_s8;d6 %+!::ClL=<:lK\BA%IEZVm-N9]iVDQqi8NYmiWJ,qhVA+b#pCJFg"+d,e(<4Ncj.nAc-+;QaiXP'rlPho %aMGI!]>DG-YHQZg[^ENQ\eM`\]!Sia`g`Hc0JFI5mJm"XqYgBis8W(js+:9gs8W)trrW3!r;QRAr;?T` %n,NF[q>('gr#6n,rU94Jp&+:IqYU0[p\47LgZRc"lK[NpkPXNGkN1gbro!i)'.;\pgtpo@h;-Z9g=Y$/ %e^`-sdf.Vte'umpdE;I,"jG3?[^P/n]GA5s^p^te\B;saS=;5f*:<.nq>'mcrVQWprlb=ns-Nccrr2p+ %rr2ilqYU3gq"++NpAY(2!%BAkmdBKBs6f=AnF5c+k2kafjlQ7(mF(RrrnIe8hVR/Ih:p]:rmhDr*7WKc %e'lXle'7g5#Kb*/`l>p5_Z%@M_'Qk2]t:ne_83:h^Tk&T^V@.]WiDqn`5K3eX.(=Y)tNRlq"Xdbnc+4@ %K)b-9s8N#t%0$8(qYL*er:omTp@eLc-NGSEp[.A7rr2<PlgO<-jlPRbjlGLsm-N-in_<![iSrkWj5JnQ %h#?"7+X,Olf%AX)f\"ULc54aMbK7lH`l>p7`5T^6_o':(^:hM)ZGRX![C*`d_n!4YY,\MDah=p_TI;33 %o()GJq#(&]s+:9bs8W)trs\o+r;-9er;??]oChnWrt,5[.JNE(nc/X[o'uDGn*93&rTX^eo((E,pYk8s %kPaWHkiLn+ir7jC-R[g/gtpoAhVQl`f_sD*e^N!pcd2U8rluh6bf\#J`m)c>b0%B0`6$-7]<SWDY05#' %Z*BuN-mA0Po_A4Zr6#%ks,[3[rr<#sq#pB`p](7#naZDr*qSLTq=4"Sn,i(Imf)STm-O!8l2p22jo+6; %h@n`$gtUT:f\"Xj)<Bl-cHan_bg?@5#0P*0aMu0:rk\ZOrP/NL]tM)X]*l'U\@T8]\@&ZL[C?+<"g5#1 %X/i9"W=1!rrUoj^rVl6Qs7>j]s8W'"s8)TkrrDeMs+::1s8W)us8Da(p%A(Zs7,XT*Zjq7jn\N>rpg3^ %naQ#9rpBdPrTjUMk2u[(!9O.<"QA=thVS7e$J$4<kigUGdalajrmM5&d*U(`bf\)MaN4A$"NJI#`5MYl %%)KWj^VIY!^:Lha\\%gH"gYG=Yct>1Xop.$s7uKirrhl^s7Q'ars8T%s7uKis8Vc"s+:9Zs8W)us8Da( %p%A(Zs7,XT*Zjq7jn\Q@rq$-[%.WlYnaZ);nF?&;mHso=!:9XH+QhhJjQ,=ZiS5V$mHr]\fA+p,g"P05 %f@SR'e'ZRicd2U9"jP<9b0%j*a:$,3bK.cE`kK*u]"J!KrjE0E\[]8`\g]*.qYL3k"S2-`p@eLc"TJE# %qYL3k!;GIPK)bEARK*<ds8W&n%e]Mhs8VWZq&UUKjlQ=.!:g'X!q5UGrp9dRm-4K6!pJb-rT!h4'A_L" %gY:E6f[C]UjQ+e8cI:"]d/M5nb0%fH`l,gp_>qFN^]V<a]tF?V$b!LR]"5D][Bm3I\,EK6Y-+n-X/c/u %$mR"qp%A:^rpK4SoCMt]"TJE#qYL3k!;HKmK)^H&m/R+bs8W&n&,#Vis8VWZq&UUKjlQ=0oD\:`naZ,; %n,D_Tli$/Ol/q.-j8e<>iWS6!i83>ig^;UQ*U)_<daH^mci2B#da6@dcHOGRaiMR&`rsE%`Pf^o_?n&l %]t_@u^:q1g!k>eQrNc[5ZE^X<YPt[--n,,kq>UBsnaZYPp&=ssrVcclq>UEoorJ+Es1n[7rr<#sq%*/k %p](9`nbF4IoB#*0o^r.SrpgKfnac5?n*oi:naGl4rp'RNr9"CKk2k[bio/kO+r2BimG-=Fgsss.g=k63 %f@AF#dF$=eci22nc-=JTb/sY($d$N6aN2B@^:_+i]`#5:[L0RU\@]Aa.4P;nqYpKto()hSpAY'prr2ro %qYpKppXfFss-Na"qYL*frVZTnk2uC;s7#154$+\[o`b3ls7GjOrpU!Xn*^2B!po:<rTXIJjlQI$r8%V5 %h;$c>g&BV@)&_5bbg"D_dF$FbaiMNC`l?!9`5BI/_>V.O^:h4mrjrfO[^`o[\@ArQZaI9HYck75Y-%]( %ri$+!VAM$Bl083H"n;QlpAY'hrrM`c!;D-GK)b-9)Z'=-rVcZls5rJ;s8VTNjuYXLp%A1]s7GpSrpg3^ %naQ#9rpBdPrTjUMk2u[(!9O.<"QA=thVS7e$el[Bi8Du0dFm(#f)Eu"cHa\ZbKA!,ao9<``l?!9`;[UV %_7dOs^^%Zh^:Lha\\%gH"L>><Yd",1#Hk),*&TV?m/I"enc/X`qYpWfp%>NgK)`Rb(]+"*rVcZls5rJ; %s8VTNjuYXLp%A1]s8MZioD\:hnaZ2?naGu:naZ)8mJcDOm/6#Lk2tddj8e3=i=$nSjlP%Df&#-7gt('U %eHF@Mda?JAd/M;oc-=JTb/sY($d$N5aN2B@^:_+i]`#5:[LB^W\@]AaX/d7!2XTo2rr_ils7lHj!qZ-Z %g])m*Q2gj_&-)\/mdC,To`+shk2u[h,RWi%p\FXYo()&8nc&"Zn*f]Dm/lY@l2BlKkiLq)j8@aVh;-l@ %gY(63g)D!_f?DXif@/3nb0%iIaN)??`5KR1_Z%@T^qd^u]tF?V#J%CV]=YVa[f3ZA[]cm;Y-"h-WiE&t %W"H#.Z_3s3*U3P$rqH0ar;?Ef!;ZWos87]QK)b'7rr*i9s8MHSs8V`ks8;$As!/lTlM(,Mp@@e=oCMtP %"S)$On*g8D!:0UM!pSk0ro=(@r8Ik<iS`SLrnIk:*Zj(jd+$S!f%0iI$I@#Cc-=GSb/q`Grl58``l5j5 %_SO%i_7dP]^';6_]"#8\])Au=Za6sBZ2Us5YH=q:Unf.Wm/I"fqYL-grVlWls8Vr&s+:9`s8N!9s8W)d %mf3=Zs8W#Zk5Q\PlK\->q=aCMl1FWIoD\:hnaZ2?naGu:naZ)8mJcDOm/6#hk2tddjPo.Wj!5o/iRQZ9 %i8!,=f@SU(e^W*sdF$=eci22nc-=JTb/sY(&';r9aN2B@^V7Fo]XG8V[JmWE]"5Ga]=P2L\u)>L,OYR2 %"T/)prr2onrr<#qi;\E/o)G?^rr*f8s8MHSs8V`ks8;$As!/lTlM(,Mp@@e=nGr+Yn,i(Imf)STm-O!8 %l2p22jo+6;hB:Y1gtUT:f\"ms)qW]cdF$Rpe'6%XaiMQDa2Q!8_ns:i_$.Wi^V.=nrjrEG\[oDb\[f0J %[0j@GYHG%1XfSP&WW&h/WN!4sTH,';rVc`ip\XmdqYL$es8W#qs+:9&s763hrYkh:rpK4Ss7H?kr9!/A %,UD[?p\FXYo()&:oD\:`naZ,;n,D_Tli$/Ol/q.-j8e<>iWS6!i83>ig^;jY*o#GreC<4'f)F#'cd'h\ %c-+8PaiMR&`s'K&`P]U1rk\WJrk8KI]XkTS\@K3LZim_AZE^\6YR%G7Xgk1&+X-4Orri2pr;HTnq>UEo %qPsRIs2P*<rYkh:rpK4Ss7H?kr9!/A,UD[?p\FXYo()&;o`"I]ndP'Yo'u8=nF5u<n*TNAlN$;Lk6^;5 %jlGL^iSifB(*qkte_8a8gt^K4f@JL&eC;podEp4crlt\lc-4>Qao9?laiV]HaMu67^:q4l[^NTOrjN?J %]",Gb]!&<KVPYR_mf*4hqtp?krr2cns8VuIs+:9Bs8)`pmJd+gmdC,7ir8r_1Z.*is6T:G"omK;s7,XY %n,i(Imf)STm-O!8l2p22jo+6;hB(M/gtUT:f\"ar*nf5qf%/?udDaDVc-+;Pai;9;_Yh4R^qd^u]tF?V %r42s>\@;FErN?:)XfVN%rhp..Z'MAg[^I7KoD\aerri/srr;irqu)3JK)bB@qYpN^rr3,hmf2;+rr3E` %hr"J6m.'WGhr"J*oD\:`naZ,;n,D_Tli$/Ol/q.-j8e<>iWS6!i83>ig_STe+l(l(g"G$-eB-4ie'ZRh %ccjPSaSa'^`l?!8_nuDhrOi<H]Y(lT\c&o7ZN@G<Z2Us6[^M[.Y.D1fp\4L`#5S8ts8)TiYlB=T`W,f6 %s6]gc"Rb^Xio9t;%5Zo!s8VHUnc.M(s7Gs_oD\:hnaZ2?naGu:naZ)8mJcDOm/6#Lk2tddj;Ht9iSQ"1 %io8bNhqd#?cJ.+-f\"d+e'ZRhr6>Jjc-4>Qao9B\ap?&.`PoX-^Uq,V[KX1N\%9/]rjrKH\=Kh,]Y#Ka %q"apoqYpKoqYL-Fs+:9=s8)`pmJd+gmdC,7ir8rZ1Z.'ss8VHUnc.M(s7,XYn,i(Imf)STm-O!8l2p22 %jo+6;hB(M/gtUT:f\"ar*nf5qf%/?udDaDVc-+;Pai;9;_Yh4R^qd^u]tF?Vr42s>\@;FErN?:)XfVN% %rhp..Z'MAg[^I7KoD\aers&;urr;lmrJCQ+s6Td^rr;BbrrhcXs5N&;rs^dAhuE`CnaZY:huE<>rpg3^ %naQ#9rpBdPrTjUMk2u[(!9O.<"QA=thVS7e(>9oTgt^K6g"=g(ajehhdF$:dbf\)Lr5T&^`l5j5_SO%g %_>LtJ]Y(lT\c&o7ZN@G<Z2Us6[^M[.Y.D1fp\4L`#5S8ts8)Ti[JtjY_#O91s6]gc"Rb^Xio9t;%5Zo! %s8VHUnc.M(s7Gs_oD\:hnaZ2?naGu:naZ)8mJcDOm/6#fk2tddjPo.Wh^9f2inWGKh:gT.gY:H7f[eX& %dF$;<c3;J;bf\)MrlG)]#fk!)`PB7']=\$M"h;(O]"5HO]*Z!WSZf60]Hd4Hq>UZqrr2roqY]=PK)bEA %U]:>mrV[W)o)JXcp@eO]q#:d4kPtSHl2U/<r:'4QnGr+Yn,i(Imf)STm-O!8l2p22jo+6;h@/5rgtUT: %f\"Xq+P56EdgaXSf#u:]bK@uKaMu3<rkf#Y_83q&^V7Fqrk&WQ^:h.j]"5D\\$WL?XTbc+Wi;trrhgU7 %XK/\6R$b&p)<q/"p$1iArr;cgrr<#rrr7TMK)bQErr2lp)Y3J!r;?9^s7lBh%1VM#s68eJmHsi@nGDhK %rpg3^naQ#9rpBdPrTjUMk2u[(!9O.<"QA=thVS7e"P+hDgY;_Z%FWq_cI(%dcd0k\bKA!,a9]i+`l5p8 %_o'@j_$I`f]Xtee]">NT]"5HL[0!_AZi790YmmqI\=K1s*?FMHs7bmHrr3/sq#:<nqlBaKs2tB@rr)d6 %o()hYr:]jaq"Xju%Hmckl0868mJQJCqt0O[oD\:hnaZ2?naGu:naZ)8mJcDOm/6#Qk2tddjPo.WgaN:R %iSjdk&D5mteC`F*f%/@#e'ZRicd2U9"jP<9b0%j*a:$/5ai;?>`PTI-^:jKU!kPtRrji0C]=S!L%(s6G %TXGscmf3=^mHsoQ"o.lls8VuJs+:9BrrW2urVcX.m-OB>q!deQoCEOns69R`m-OcFo`ajYp@.VBrpU!X %n*^2B!po:<rTXIJjlQI$r8&+Ch;$c>g"=s++sPF^cHjh[h;-QZa8O$W`W!d]_SO((^q[Ut^&GYK^:q:l %]",BN\,itBrN6("s/H!r!2ogq%\of/\<ae?-N=#Eq"X1@rr3#ts+:9&s7-*jrr)for#4qgo_A4NnGi+O %&HDdps8VHPs7Q'Sp@e"IoD\:`naZ,;n,D_Tli$/Ol/q.-j8e<>iWS6!i83>ig]Z4U-IpZGdK@eRiRe(Q %rQG2_rlGGd`l?!:`5BL0rkS]N^:_&V])K;B]"%^I!k#GCrj2U0riQL(VnB[2^q_Dus8Vopli-narN6*O %s2G!>rr)for#4qgo_A4NnGi+O&HDdps8VHPs7Q'Sp@e"Jo`"I]ndP'Yo'u8=nF5u<n*TNAlN$;Lk60r0 %jlGJ4io/kP/1fQ1f@\a*k2tLte,IendJhDpc-=JTb/sY(#0Y33`Pod6rk\]M]`#AE]"5Ga]=S!R$F6tD %X/j%OS\r>qrr<#qs6Tab!<(UNK)_8=!ri/srVR2mm.C)JnF6JLo+:s%l2Ubjm-OcFp$h\KnF?&Jn,i(I %mf)STm-O!8l2p22jo+6;h@n`$gtUT:f\"Xs,14f`cd0ejh:)ADrPniUrko)Z_83q&^V7Fqrk&HL^:h+h %\[h^L!OT02Xo>C$WW&grVuEY*USG?/QFsjWrr2rmq!78FrrE"Ps+::;rrW2urVcX4m-OB>q!deQoCEOn %s69R`m-OcFp$h\KnFQ8Nnc\LQnF,iFmJuSOliQG6k5OEAjo"*@iSi_OhYu:5f-Vipec*u!cJda6rlk>a %rlY5^$HL0+`Pod5_ns7+"2V^c]`#G@])fLQrO)d8[C#q>rj)O+#H+K4]UHXO.K9AIq>]d[rrE#'s+:9d %rrW2urVcX4m-OB>q!deQoCEOns69R`m-OcFp$h\KnFZAPoD\:hnaZ2?naGu:naZ)8mJcDOm/6#[k2tdd %jPo.Wh(1,3gXk*1eE5oLr6tYnr6bMh"jP<9b0%j*a9Ki2ai26;`;[US^:aET"hM:U]=YZR]*bjLZ`C.B %^n&B\/,oSKqu?$^rrE#Ss+::As/#bprW<&sr;QTnq#::!jlQ%S*rl3;iVic]p$D&FmdB`;!:g'X!q5UG %rp9dRm-4K6!pJb-rT!h4'A_L"gY:E6f[V8ocd1"he]ce&aSsF$bKJ#LaMu6=`5KR1_SO((^V@Lr]tD1t %^AYVG\@8rQYPkL'WiE&tW;`\*TqT/rV4aKjR@0-X*oR%srq?Trs7H?ko)AZ@s+::Gs8N!!rVcZnqu?Hj %rs7`JnfAkPrVb^Rrs8;am/QMAo^h\Rnc\LQnF,iFmJuSOliQG6k5OEAjo"*@iSi_OhYu:FfdJ8te(*+' %d,3a)dF$=eccs_Xb0'_)rl,>b`Pf[3_SO((]tM&V\H0@T"M;:U\$u=E!4Dg5'!npMVl.G4WhlQ)SXkug %+liV&rqQ`ts7QElo;hnCs31NBrW<&sr;QTnq#::!jlQ%S*rl3;iVic[p$D&FmdC)Hrq$-[%.WlYnaZ); %nF?&;mHso=!:9XH$0LC3jQ,=ZiSH1&0%nq4hVQfDjO)Z6f[na*e^Mpnd*L&;c3;J;bf\)Mrl>Jib/hQ@ %`5KX5`504c]_f;P\ur3YYct41_5!cm,ph[Qs8Mfts8V`ks7+_@K)_MDrr)utrVZZl'_V.mn*`(i/GJnt %lK\9;o(Me<p@\[Yq"XINnc&"Zn*f]Dm/lY@l2BlKkiLq)j8@aih;-l@gY(63egDioe(`g=cdU@Lg"G!, %eBcIa`l>p4_8F.,_83q%^V7Cp]YVFu]"5G_rjW!7YPkL'WiE&rW#)A/VP(N3SXlX[Xf&A+/+;s,s7lWo %oDaFBK)bHBrr)utrVZZl(\RIpn*`(i/GJntlK\9;o(Me<p@dtMq#9manc\LQnF,iFmJuSOliQG6k5OEA %jo"*@iSi_OhYu:IfdeT(f&,QLe(3*Zh;-i;f@/3ob0%cD`W!jc`Pod5_ns7+^qROp\c0/=]E,XSrO;d7 %)n!)\Za6s=XJN_JU8"]nZ)b4;/b8K4s8)cqoWA.Fs2Y0=rW<&sr;QR3p%A%ImkcjPp\3Y3lML/Cp@dS@ %p@%eOoCV\SoD\:hnaZ2?naGu:naZ)8mJcDOm/6#Lk2tddj;[+;iSQ=Cgt^uTl.OkI]]A/6hr!2Cf$`!l %bfp(3"jP<9b0%j*a9'Q.aSj'V`<3rj]tO?Vr4<`UZa6aQ`i5rA\$rQM[kICGs8Vrqs7=qDK)_>?rr)ut %rVZZl&,#Vhn*`(i/GJntlK\9;nd>*ajS&<9q"XINnc&"Zn*f]Dm/lY@l2BlKkiLq)j8@aih;-l@gY(63 %egDioe(`g=cdU@Lg"G!,eBcIa`l>p4_8F.,_83q%^V7Cp]YVFu]"5G_rjW!7YPkL'WiE&rW"Q#*VP(N3 %SXlX[Xf&A+/+;s,rr`&rs7;!FK)b9=rr)utrVZZl(\RIpn*`(i/GJntlK\9;o(Me<p@dtMq#9manc\LQ %nF,iFmJuSOliQG6k5OEAjo"*@iSi_OhYu:IfdeT(f&,QLe(3*Zh;-i;f@/3ob0%cD`W!j^`Pod5_ns7+ %"2MXb]D];>]E,XSrO;d7)n!)\Za6s=XJN_JU8"]nZ)b4;/b8K4s8)cqoWnLKs2+g8rW<&sr;QR3p%A%I %mkcjPp\3Y3lML/Cp@dS@p@%eOoCV\SoD\:hnaZ2?naGu:naZ)8mJcDOm/6#hk2tddjPo.Wh_6b>guR_a %g"bAqjQ,@YhqQo:daHFbbl5lkc-=JTb/sY(!mAd.rP\]S"2V^b^&5P@],%uaZ`M0dWN!,2\$*9M0D+o: %s8)cqoA9M!s762grrVikrVlg#nF68Rs7QBks"FB>rr3Juna5i8o^qnRq=jRToC;nPrp^'ZnF-AE&FJlN %lK[WukN:pfj5].Vhqn:e52=rHf@SCg)VNfhaiVN_jNHK>Z/4?cd_NT2e%`Z3`l?BP[^EN_\@B>d]=Q51 %[C*?U^S[p2XfSV&W2-Ajri6$rr29Okr1sau+!:=Sn,E=_r;?NnK)^H&qu6`irVc`q"n;$Ws8Vcks8ObO %mf*4snaZ#9nFZAIq>'dXp%.hJrpp9`o'u5=rpL3\lg*j$l0%6kjQ-=#!9*k61>h!Fg=k$t*o5Z#c-=Ao %kg&5K[,Blme\f5>f##;>aiW#\\[]/j]=Ytk\[]r1\$rui%`bo^]Y(he[C*9FZF7*GrN?1&riH.#ri-=, %,:!-ao)Jagrr/qtK)a0s!qcHirr3/knG3+ap&>!k0E1D=rt"YimI9W;o_81Wp\"4Np%A=Vrpp<ao(2GC %nbqtVmJuVQlN6>8kPXHHjlPL[i7]D;,N@_8daHG.mF:If]]eS8h93p^hTF!^dF$_'_8*k6_o'[9`5C9] %_SX:>dCd-1`59C)]t(_c^:V"crjW0@[^ENLZEjJ5#HfC#r;?-cs8Mlqrn%1%s.]Pnp]'FUrtt)%s7P[B %mk?Hmqu>sHm/R+To()JHp\=Lep\"4Oo()eM!q>^JrpC?bmHa'&l07Bnk2bR_inrYMr7r4FgtC<2g_LYM %,9$di:St#4f\"Q^]#i(BrlcS%^q.M(ZEhNobIYm?^!+^:['[6KWi)c'\uMd2X/`1sW2T]rqksFjr1sOk %X/d'Srr)rir;lllK`?Z(p&G'ds6'C])sdP(p$1i20JND$s6An9s8VTZo(D\Mq"XUVp&=U_o*"XTnaQ&I %mgAFIlg!d"kNCsfjSn0>iV_Uchr!8Dg><bc-RTuB#udk(cJ.+%]Y)J4eBZ@c_o'..aL/Ftc-<oHcG7TF %^:+$L&[ALA_T'*q\[f2YZa-mEZa6k7Y5bX'XT,@#WW]6'Y8\G[rr_ups80&#K)`sms7cQVrr4&*s8VcW %lL-D\qtpEYlKnQNnFH/Cp%S7Vp\"4Op%A=Vrpp<ao(2GCnbqtVmJuVQlN6>8kPXKBjXT9Ji8l%&/1`(W %%U$!=eDoTD`5L0Th:C0/bKIiNd(R-?f%.gkf#ZClb5K-g]=>AocbR?4_8!as]"5Se]=7dL#.CtJ[Bm0E %riZI(Z*>5err3)mr;??Fs+:9As8VinkPkJpli7"XlK[gl0`1bIlK[a9s7#UM$MF)dq"XUVp%7hGrp^'Z %nF-AE&FJlNlK[WukN:pfj5].Vhqn:e(u3p"f@Sdn(*b%C"U.]!VT[WEd(6g1ajU14,/D"*`Po-ga32Z; %bKITCbe^Zn[C*$4Vma1:WiN2#Whu_nri>porhfUi"J`#u(`<8O"7uKipkf$&s7$'gp]'FUru:;(s7P[B %mk?Hmqu>sHm/R+To()JHp\=OXp%A=Vrpp9`o'u5=rpL3\lg*j$l0%6kjQ-=#!9*k6.,Wq<g=kF%)(-dR %#mjP1Wm9ARd_*6:bgaq`cbmZ5aN1csaj&)CcHZO-b0%Hs[LodIY/82g\@K/Z\$NBG[Bm3CriZ:'riH.# %ri-+!YHJlarr3)os8Vu(s+:9hs8VinkPkK&li7"XlK[gl0`1bIlK[a9s7#UMp%A(Sq"OISo_%nVo`"Fc %o()DCo'u\JrpBdQrp'^Ol0%3kroPcnjl54VjW>Qq/0tc9=g,$Yj5\n4`73;mf%/HrbJ_cS]tMhEf#?4k %aOSh`rP9)X\@B`.^qde&^V@Cl]"P_f\,NlA[^NTOZa-n9Y6:i0Yo=Y]rr_okr:o7NK)bEAUAt8jrqucq %$8Lr8qtodWqZ$3[rq6<brqHEc!VQ!`o)A.\nF5oGmL\dQlg!d"l0%3kjQ#:[hr!;gh*g&Rg"4iu/1f<# %_<L3m4?OSp&DYa`aiW#H^V/%Be%*$6c,73,a1&OpY-,LI[_08Q^qcM9UnjrfXK8D%X0&V1Xf&)rVZ*Fi %U^O2gQE7/-nF6DUrqucpK)^H&p&G'hrqucq$8Lr8qtodWqZ$3[rq6<brqHEc!ql3Xrpp9`o'u5=rpL3\ %lg*j$l0%6kjQ-=#!9*k61>h!Fg=je)0A"gomHqJM5TgXNhUL&tb14;C^=(HZ]=ZA6`4it,\@BJ^Z,"&d %_o&q-"O4*U[']eA#dgkAZE^[<Y-.c+riH.#ri-4,S"$Xd+S>=)s8N##s+:9ms8Vuqr;Q^'1%"B*qsF7V %s7Gs_p&Fabp\smcp&=U_o*+^UoCDJBrUBgS!:9^N!pSt4r8n4Fjl54Vdkrg:h;-6Eo"RU^,oR]ah;-Q/ %h9!dZg=kB#_q3Mb`l?EB_9BL%ai;?Ebe_o_\A#_mrPJiS]=Y_e]"%aO#._:S\@&]Nricd9St<0j+S#"% %rVcZnrn@C(s.fStmc`m7s6'C]'&hgL%1W6gg&M*Os8Viao(i(UrqHHdrV$9^rp^'ZnF-AE&FJlNlK[Wu %kN:pfj5].Vhqn:e&)>snf@Sg,dhiq\]Y)hJf`&i=*$?BOdE92;e[`66Yd!$B^9FigY-,RW_QM/.TV/fs %Xg>X4TVn]jY,_K&"L,,6Vl0Nkrh]Og$*'SgTqSM*)ZAn#l1k7:s+::ErrqiSkl:\Grr3ViiVs>rr7Td' %s8N&up[[nNq"Xj_qtC'^rpp9`o'u5=rpL3\lg*j$l0%6kjQ-=#!9*k6/`5IAg=kK:f,Pdk^qe[Zgr[RU %*[)]Td`fJ@f=JQ;Z*E6F^Tk&kYHPd\`3If-e>B+]]"5f&Z*CdI]"5>TZ*LX>Ycb/.Xo>F%X8]+,YG7kh %V6:p]s6]4Rq>Ro(K)a!n"n(U<s8V9]rt=;Lrs]G8g"HE*rr<#mo()VOq#:$bpAagbo`"Fco()DCo'u\J %rpBdQrp'XMl0&!,s5cN*i8E_Pg`[j+`Pp`oim,lr-7UM"gXO<cho!@^]"7.jaL\t9\@B]+c+2ZdYcuEk %`6QrG]>DG'`50't]XtedrjrBF\[]/W[']h:$aQY,V5:@7)uo0erV?HRs+:9BrrqiSkl:\Grr3ViiVs>r %r7Td's8N&up[[nNq"Xj_qtC'\rp^'ZnF-AE&FJlNlK[WukN:pfj5].Vhqn:e&)>snf@Sg,dhiq\]Y)hJ %f`&i=*$?BOdE92;e[`66Yd!$B^9FigY-,RW_QM/.TV/fsXg>X4TVn]jY,_K&"L,,6Vl0Nkrh]Og"KJ&b %TqMXj)B/S=l1k7?s+::@rrqiSkl:\Grr3ViiVs>rr7Td's8N&up[[nNq"Xj_qtC'^rpp9`o'u5=rpL3\ %lg*j$l0%6kjQ-=#!9*k6.,Wq<g=kK:f,Pdk^qe[Zgr[RU*[)]Td`fJ@f=JQ;Z*E6F^Tk&kYHJn]`5Jq1 %e>B+]]"5f&Z*CdI]"5>TZ*LX>Ycb/.Xo>F%X8]+,YG7khV6:p]s6]4Rq>S)-K)`gi"n(U<s8V9]rt=;L %rs]G8g"HE*rr<#mo()VOq#:$bpAagbo`"Fco()DCo'u\JrpBdQrp'^Ol0%3kroQQ/jl54VjkSW7+mR%c %hr<Y@cd*pf.bi_-aN38V_pu?0l06:#]%OU'b0A2Ah;,<>cG[ZHf"8Q2_SjC/]=Y_f]=IpQ#._:S\@&]N %ricd9VP^2dY8\G\l080BrosH7s762ls8;lqru:b.s7lBbs8Ni6s6fpenaZ)Js7$'gqYBs^q"O^[!Vc-b %o)A.\nF5oGmL\dQlg!d"l0%3kjQ#:[hr!;gh'1Y0g"4j$e^YZ\g>h5HgY9cc_V)B+3B7Vg`666C]YD4m %])Kbj^rOL.^V?MM[(sJXY-*tqTV/0ZYHP%2YHYFB[/Qs$V>I%qVOX0^ZCIAP1\:5:rVuiqreLN*rrE)s %rr2p:q"Xmaq"asi('"=%s8VWZn,NFWs8Vrkq=saZr:U3do^r.S"S2-RnF6GG$LI*ElK[WskN1dcro4"; %r88dVhqd#?db*1q+l2;Ch;@,5_o(09[Q6G\`5Kj@ah5C']"7m^%)Bp(]ZA0p^qe1<]YG#mVoZ-J\$roY %[BHd<YHRr.riQ1$s/Z.!$`p(s\$r'(TK)`As8;iprj2WVs4%)Hrr2p:q"Xmaq"asi('"=%s8VWZn,NFW %s8Vrkq=saZr:U3dp%A=Vrpp<ao(2GCnbqtVmJuVQlN6>8kPXHHjlPL[i7Hg)hBjT0m-NcnjNu,pikN5q %6Q+.neC)daaN29:rm;>"d*TbWcEYI3eC;L\b-TU3^AZ"T_RmFm]"5HO^&P_E])K,IZE^[<V5:W/TU_N0 %o()\Vrr1gTK)_eLr;Q]q*VfF0q"X[brtYS6mf3=WnaHMXnGiObq>'g\p\+=[p&b!Zo)A.\nF5oGmL\dQ %lg!d"l0%3kjQ#:[hr!;gh'1Y0g"4j$e^YZ\g>h5HgY9cc_V)B+3B7Vg`666C]YD4m])Kbj^rOL.^V?MM %[(sJXY-*tqTV/0ZYHP%2YHYFB[/Qs$V>I%pVOX0^ZCIAP1\1V<qu-NnN;nM0qu?Tnrr3r4q#C-aq>^I0 %s8VNes7,XJs8VTgs8)Qeq"XU]p&b!\o`"Fbo()>?nG_k`m-F!&lKRKpjlGM%irJ'9i$.(9h:gT2f[q>j %h<*kUhquVp_qDK,3][hj`669E]YD4m])KbU^rOL.aN1Et'>Vi9]YM=\aK`"Z\%0&WYHP16YPt^(Xo>F% %X8]+,XJ2Gu\"TIf3;E:Kr;HWo\Gq0\ci<qBrr3r4q#C-aq>^I0s8VNes7,XJs8VTgs8)Qeq"XU]p&b!] %p&=U_o*+^UoCDJBrUBgS!:9^N!pSt4r9"%@+QD>;fA>@2-KFIZj5f:Jbfo(]^I(@+c-=bdd`';K_o)K$ %&]rDH`Qlc6aN2l\`lcH1e@rZq`<O2k]=b_d\c0;B]DoJA[LKOIZ*1"#[^Mj!S2Km.qu-NnjSsi3V#LGo %r;@E2qtpEnm-jEC,9u^=jT#2WmHsc@o(DqV!r2QbqtC'\rp^'ZnF-AE&FJlNlK[WukN:pfj5].Vhqn:e %&DZ'of@Sg0f,G[Hd*ThYcH?(8/@DnG-RZLLbhpjs[^NonbIkI!`N-&bZa7*K'H.m`\>,gsVlm2&YHP4= %[Bfe/rMBCe"J;csSXft\\@;k%hYmBM!r`)sOoL%5p\t6mr;@E2qtpEnm-jEC,9u^=jT#2WmHsc@o(DqV %!r2QbqtC'^rpp9`o'u5=rpL3\lg*j$l0%6kjQ-=#!9*k6&DuC$g=kK>gE%EUeC;[hdE_[?'",..-RZLL %bhpjs[^NrobIkI!)o]1kf>#)<_^-f`[EQ"b\@B#W['-[<YHP%1Y5YR&XT,@#WXGZ/ZD41p]tFp8irArS %!r`)s^&N]abPqSAr;@E2qtpEnm-jEC,9u^=jT#2WmHsc@o(DqV!r2QbqtC'_rq-3]"nM6Uo()>LnG_hU %m/H;Rl07Bnk5OKSjlPL[i8rnT,UCUeg!J@&e,8&R^:rtg0Z2GkkhFk,^W=pS`Pf^?]"6_<a3)OX2)W5& %_84.2`5KI']=b_d\,O)@]DoJA[LTUJZ)G(<U8"Wt\I.0KrVZQprVc`[s+::As/uA'rr)fpqum#lp%nOa %rrVj/(B4=@lLFEEs7H6enauJLp\jdcnc87[nH/4Ln,D_dmHs6)lKRQrk2tabj5StRhYc1tgt^T7f@\g2 %,9u+%h:L3-c/IWof@SU)^r+&N#RIWYc-FVA^V@UeXi.WTZ)Xf(!+T#/#aqTgW2Qi#WNi_8\@AoCVZ*Fk %U_';rUna]cS=H=JVi6S56UUMFqu?TorVleQs+:7Prr)fpqum#lp%nOarrVj/(B4=@lLFEEs7H6enauJL %p\jgco`"Fbo()>?nG_k`m-F!&lKRKpjlGM%irJ'9i%j3Ih:gT<h;'D)io&bLg"Fd3iOmdof%.XS_`A&/ %YKb>;cEt@$_6'iX_SX$u\cr@`C(Y2%YIM*Q\[8`JXf\h0Xf8J+riQ1$s/Z.!$aHG#Vl-YZOfh5GqYpBl %r;Z`prjDcXs4.,Nrr)fpqum#lp%nOarrVj/(B4=@lLFEEs7H6enauJLp\jgcp&=U_o*+^UoCDJBrUBgS %!:9^N!pSt4r8n4Fjl54ViT!#[/1g#Ik2>+Qf';P>i8EMMaiqsr&J;P(f%8NeaN2N4[`uh3_SO%t%>&\D %/%ipCaN29:^Uq+k\[f-I^AkkG]Df;=Z4"%9V5C,kNK'r)6M19Ss8;oqrr1mVK)_hM!ri/srqloup%A1X %rr3&m()HoL$L70Os8V`hr:0FOq=jj]s760Z!q>^JrpC?bmHa'&l07Bnk2bR_inrYMr7scrgtC<2f\5%( %,N%>5f@AEriShH$f@JNg_o"M@#d;LtcH`f3^VR%S`3m"XWi?%!@oZM7RAZs]W3*2$Z*C[G\?r-1rh]Ui %%\oepUSFl[S>)aUN/X]&!CQMYqu?TorVleVs+::KrrW2urVl]trq5s\qYpKrobJ>BrsJ&]nc/X]r;?*W %o_J7[pAadao*"XTnaQ&ImgAFIlg!d"kNCsfjSn0>iV_Uchr!8Dg>(N?-77a1i7lr<dGa&sf@SU)^r+&N %#RIWYc-FVA^V@UeXi/)n^:G)k"pT<eC*'Rg\@K/W['6[7YcY%,Y-.c+riH.#ri-@2U8"Q`Xc\aK84`UV %qu?TorVlf-s+:9trrW2urVl]trq5s\qYpKrobJ>BrsJ&]nc/X]r;?*Wo_J7[pAagbo`"Fco()DCo'u\J %rpBdQrp'XMl0&!,s5cN*i8ESSj")bFk2tUYhU^uW`Sf\3hoX*d6P0p?f%/I)]u\:;[^OH#`koR.%1Ro2 %F=Y#Ea2l?>_nWgq]t(\]rkAEFs1A9>riup=V5:&dXGr4>6:1>Dqu?TorVlfYs+:9HrrW2urVl^3s6AnD %p]'UH-1pj&i8FY!kl:\Lo^r1ToD\F_pAXgcp&apXo)A.\nF5oGmL\dQlg!d"l0%3kjQ#:[hr!;gh$r/p %g"4j0d*N[LfZ;.brm21ra5kXq\@BE:jIbMo(qdN\_B@%F\'E:#a2b50.8!3@3]]-dWiE%tX/i/'Z*_$N %ZDOMuV>d7sUSFW[US+QaWi?8kXf\OfQ6ZD+s8;oqrr/,]K)bTF!ri/srqmW5lK\-<s6T(uo^qh7i;`$) %s8VHXo`+OSrq6<brqHEc!ql3Xrpp9`o'u5=rpL3\lg*j$l0%6kjQ-=#!9*k6%H$(!g=kE4diKRbbfnf? %e.9U?jO)Ab\AI=fTB,&M]Y+6\"O"utcH[B1eC:ug3Eo^2:JXWe]Y(heZa6j;Xg,"1W33<&Xo>F%X8]+, %Vlm2,Yb/5,Xdkn0rql`ns8Drr^]/ocbPqYCrVc`n)#rmdp\4^Slm;;rp#+d.kii'Hm.BrMoCMtSs7ZHd %rq??arq-3]"nM6Uo()>LnG_hUm/H;Rl07Bnk5OKPjlPL[i8`MD,9u0pdGOrV&(&\jg=jBZbO+\qmHl(9 %`W"$ieC;:cf<s8`]Ke_j@=\>Z%D9j+aiVB8]t1eh\[f*H^AkkG]Df;=Z4!\;Z*1@&Y-+aiQ6Q>*s8;oq %rr26`K)bEAZN'b"%K68*nF6JXk;+pYq>'dKo)S1QmJcGXl0.?okN:jdj8S!?hVR/HhYu72h;-ibeI'p[ %)B.2SdE^=oc2PL2`PpN`ag8>6Vl)/]^;.Oscd/c1_7-59XIu4-*b&er$c8^8WN!/-ZE^[<YctD3X8T%" %WMlcpV[f>uWN)tnUnk)mX.gjbrX&2fs8V]js82`lN;nS2s8Mop$if_cs8V7<1[4`2pZV;JnbMYcmHj3* %lfmWsk2k^ciSihVir7g:iSiYmfa?Kg*?Eh`e^E.(dJh3.bKJi%bdOt@W2M>_^;.OsdF#2;`O`Ld^9Opr %06).IFr/E(X0Ah8['d3FYHG%3Xf_T(!irB%ri$+#W1^/jXK;Dt&?W%8UF.Ghp%A@bp&G'hr;?Qor;?`s %rVcZ4s+::+s8)`lr<rYon,NFN1,A+hq"EqIp\+UZrpg`lnF,c3m-F!&kND*mkN(^ckNCq*h>lI>i$0K( %gY:?;htttUlKZd/]B6,n0u:]IaMcun^=Uu]f\#-/cq[>oOH;!P]=Yko_84%'^:Uqd]Df5<[/RE3ZMq*G %WO&q<[&pL6[^ENE,:!0Xo)AXZrr2ckqu6Wprp'N8s/l=srXJi)s7#OXs5u0ol1t/Lm.:2Ip[.tH#jLR: %kND!gjQ$6u"Q&"mhVS7d!o;\erm_A-f,>RYdF$7jf$4300#bf_fu^S,j/8e-^:qCu][+p,_83UVUo^5^ %*Zed(BFD\QUoC>uZ*LX>YHY79ri?!t!i`,srhg'pWMuntUSO]eWt)2),UEB\oDej^s8Vuor/q#2s8N&o %rX8bqnGiOO1Ge:kq=j+Gr:0UP&FJiNlg*g!kiV!gjPf(Xio9sp!o`+prn.Y5gDq<fe^`+$g!Tf?)9^4] %i68X<jJ]"0^:qCu][>-2`PoEs[_B!^YqIbMG'4\HX/iJ/['[6HZELF6YH=r+X9,H'WrAt%W2QAhWiW<$ %V%Bc1XJ7-js7Q'bs7QElqu$Bks8;ftrr)fnao?tmfDk^Hqu$p&n*g;Vk;"gWq"XRHq=jU^p&=LpnF5o6 %mHj0)lK@?pkNCpejlbe,jSn!Bi8>h)hqQo;hr"=^/F)NJ]=[4*W\M?+aN2<WhnI^oc.L\,d*PN_Mia#N %ik)h<^qmk)^:q4i\\%jKs0Vd3s0DX/(oajJ['Zs<Y-taGX<Stgo()eZo)AXbqtpBmrr2BdK)__Jr;Q]o %$hODudEt>KmJltVq=4+Po`"=Xmf)VQlj2k>ki_-kjQ,A#i<8#ohqm5hgHOHLgXXj,g=dPfg!nO!g"F`q %bLXGC_SY*;\$FK3bo\%Xe\RuS`lQ63YHPR@Y*tde()ELNVl-PpYHP18Z2Lm*X8T%"WMlcpVZa&qUS=Il %Wi2kdR[TqNWsSLnk2uXBs8A8`K)bZHr;Q]o$hODudEt>KmJltVq<7MLo)A1Wn.>!Rm-F!%kih0jjlGCZ %j5T(th[e])hV$T;hVKD!gt:90gt_nX(#HsMaN38M]!Kl7bo\%Yf"n/Xa32X;]YVG/^V?hM)'pT._lp8K %Z2V'2Z*CM3Y5bX'X9,H'WrAt!W2QisU^aB(WLfTKU9:X-q>'7<rVuorrr;urqu4n@K)a:!qYpBj$hF>t %d*P/ImJlqTpuqPQq#0sdpAXaandY*Xn*TN/lg*j!kNV0m6KI4hkNCp_hVmPV-77a/hV-uKg#:oVd*U4h %jhJR<e^`"j,2M(sZEi'<hTk0An(lgBatl7H^":$6_83q&_7dOorji$9s0Vd3s0DX/'"+jDXK8e7ZDOFn %X/`0*p%@G.rr*!!r;?Qorr2QiK)bEAYlF_%r;@$'rVccr)uBEkmHsr;oDnCenaZ,<n*f]3mJcGXl0.?o %kN:jdj8S!?hVR/HhYu7Uh;-i9e^iC*)B.2Tda$Fpc+L^5d*TSDb0\MMdaGqJ_@6t%^qfr]&?E+BR6Nnu %4Ktfa]q;F/XK;E's02L+!j/K&ri#stW2KWl#,S/oT:_dLri$*pT:`$KQo#$Cq>UBno^r.]rr<#tOoL+7 %s8E#tr;@$'rVccr)uBEkmHsr;p':9`o^h\Fo'u_K'(>;Vm-O'(l0.?njlPR^iT&qWrnde9iSORe/DJo# %*no/pdb3=#`5L0Vf#G_Se'l([d_EZ9%1U_%_S*[tY/.rP9he5P^:+<UaJuYU[']b9"0er2XT#@#X8o=# %WWoH%X.uGcV#IJ%Una]cS!uA7r;Q`rp&=mqs8Door;HWos8N#9s+::(s8DrrrVl^&s8Dorru1b1ipH.5 %jn]2Wq=saZp@eLYrpglpnF,c3m-F!&kND*mkN(^ckNCp_hV[9"i?T]+gY:?;hq$-"rn\mFcI(7q_:6uP %`l8f2gsjj"e^_Y.nCD`)EH0^\db27I^V7G]])9/?\c0#:[/RE3ZMq*3Z`C..XT#X,Ws,hsQo+X7rr<#i %rqls"rr2lprp'N8s/Z2!rqu^&s8Dorru:h2j6c76m.C8Krp^3^nF,i6mHso>#jLR:kND!gjQ$6u"Q&"m %hVS7d-/ID3e^`7'fGY[ZdaHFlf$1k?bg=_P^rk$N^XCQG_SQ`kdD3Qs]+D$KZC*pA4?TjIWP+q+XfSW' %XoGX)Y6(i+WrAt!W2QWnV?WlnVk9TST`1nkTUuUaVjNi.q>($hs7Gs_rVlisrg*S9s8N&trqu^&s8Dor %ru:h2j6c76kk58Sp%7kIo()>Mn.P3YmHj3*lfmWsk2k^ciSihVir7g:iSiYmfdGP/*Zj%ce^E.(d)<lP %f%.j\c-t.VdaGnI_@6t%_SX"#^95;gVbIOn8kQh,\&bSW[C!==Ylh55Y,qW)rN$""ri-1%WN2ehUnn!l %#c+5jX.,S;r;?Qos7QBi#ljl%r;?Nmrr;usao?tmeGoLHrr)io$ig2(s8O#6qVpo0s5j(]q>'g\p\+=[ %p&=LpnF5o6mHj0)lK@?pkNCpejlbe<jPJbNiSc%-hqQo;hr!#2ci2cGcHahhf>5td_oB\4(YmNicdgRb %nF5"OF`DETdaHg\^V@Lsrjr$>!4i*:s0Vd3s0DX/"LG/0XK;E/ri64/R$]`+q>UEooD\Xks8N#rrVl9c %K)__Jrr2oq%K-.uq"QQuk5G8Yr;>mNo_A%noCMPCnaQ&9mHs9+lfmWskND!gjQ$6u"Q&"mhVS7d!o;\e %rma3af,5IVd*U"deB6(^b0SDO_nOdUbdFjth;&qd]c\H-YctmM[6??$+X+/![C`6?ZE:71XK/P.Yck73 %WiH&t!iW&qrh]mrV4OT_W2LE(U8"]iXJ;YiS/`OHr9jUbnc/XfrVQZoSH"3@q>^Hnrr!<(r:g!]0eqhh %rVufnlfIgEp%@qJo'u8Lmh"mQm-F!%kih0jjlGCZj5T(th^IIBhV$T7g=dPff[J<rf@S=!f$`+!aiVBR %gW[(5`SB5d)8.4<]!J^V_Sa8c5X7"W^V[k-YIV3O[BQm=ricI,Y,hQ(rN$""ri-:(WM6GoXK87qVZ*b7 %Vl?Yg+!:L]nGiOYs8W#oqt^'brVccqrm(Oqs3:TDrr2lqr!W8opb=Mcr;?Tlqs*DA$2j_uqYL$`p\+=[ %p&=LknF5o6mHj0)lK@?pkN<$0jQ5RfjSn!Ei8>e'hV$T4h;-T=i;VO`dF#nhhTiU>al))&,fhf!bf\)] %o(%0ABNJ9ihVQi!_o'7(\[f5]]">Pb\Gio9[/RE3ZMq*6WjB%=[&gC3rjNB@Vl-(**;oa&s8VTgs8;im %!;uKhK)bEAYlF_%rr!<(r:g!]0eqhhrVufnlfds@o+^fenaZ,<md9E.lg*g!ki_-kjQ,A#i<8#ohqm5h %gB-3eg]#_ef@LlXe^2[eeC;XdcH=JZ_o'4@fZ^b2`SK>f)8..8\?N3P[C&1R1*IgH[C*WBZEgU7XK8J+ %YHY46XK&<"W<0#sVuEP)V59c]Vl6PfU8"]iXJ;YiS-g5Ur;?!_s7--hrVcWorK@26s8W&urr2j*r;?<a %pb=McrVccor9NJ<#5.Z\oCDGArpLEcm-O'(l0.?njlPR^iT&qWrnfKiiSN8@f\5%"*SAiid+?mpf%/:" %e]GqLgY9r[[DgqV)&^+3,.b+e_Sa8c5X7"W^VU;o`ilq`[C*6CYPta-Y-+i)Xo5=$X8]+*WMuVmX/rD! %VPa?r(8n.2TH>9Trp]sfnc/Xeqtp3bqu-Knrr0k9K)aI&s8N#rrqm/uq"QQuk5>/Wqto[Bq?d)tqtg0b %q=jUVrq69]'CbM[mHs9+lg!Zrl0%6jjQ5RfjSn!9i!\He,2V#+e_T'2i8FUj/CDk`hVQPe\&mRd,UCGf %1sF+bg%+]]BP:IKgYUf<^r+()^U^nb]"5Mb]"%aIs0Vd3s0DX/#HG,:['Zp:Xo>d>YG\:h*$"nSmf3=V %s8W#qqZ-QZs+:9MrrW2urVl^&s7Q%/,6-]`p?h8>m.:,G'Ct\`nF5l5mHj0)l0.?okN:jdj8S!?hVR/H %hYu7rh;-i9e_&U0*?Ee]e'HUrc,n)YeC<.'ca:($mHqoqXZAKa',.XMWD=TX/h8GL;72scVS'7AY-+k%WiiM.Y-+l*Vu<ImV>d7uUSFK\W2?G^R[TqC&"o8_Tq!qrr;?9frqHEkqYg3kqu6S_s+::Ms8W)trVl^& %s7Q%/,6-Z^p?h8>kk4rK#5.Z\oCDGArpLEcm-O'(l0.?njlPR^iT&qWrne7FiSN8@gtpm1+PYJue(WOT %d2Llpg"kK3[^O<FmDZ0.4$+Ju'sk!C;^j.T2AS2T>JR29Z,aMi\$rWIYck77Xf\Y-YPt[+Xf\](X!XjH %Vm!;+XeVS`W2HPbV59hD2uipQs8Vlos8)Qeq"X[_r;Q`rrlP1ls3UcGrr2j*r;?Tgp*1g^j5]k$me,f> %$2j_uqYL$`p\+=[p&=LpnF5o6mHj0)lK@?pkNCpejlbe9jPJbQj5VI5iS<5@hr"Fa0B:jCi8E%m\'+4%bd+NH8hDYJbfe1LBk_g*BTA,0`l>X<]Y(baZa6pH\@K8b])K,;[/RE3ZMq*HY-tdG[&U('YHG%)UnjVA %2uipQs8Vlos82cj!rDlonc+4@V#LGnrqm6&qroCQrVbpJn,;\Bs7,[To)A.`nF5o8md9E@lj2k>ki_-k %jQ,A#i<8#ohqm5hgG%I>gXXj+g"@;`f$VmieC;[ke@E?/bfnJD\'Ve#[lHGK!$!C86;UJp9M@o'-S$_H %U^4JtZ*CI7Xf\](XTGZ.Xo>6sV?!IlU^!ThW1T]QSH>X`V#HhnUo:5eK7bEpq=*nRl08'Cq#^Elrgs.A %s7cNprVZTmq[;X7-2mf*n*g5Cmf2MB#PIc^oCMPDnc&"jn*fZ1m-F!%kih0jjlGCZj5T(th^IIBhV$T: %gtWtng=4X"f@S='gqgqIdF$IT]$S+&[l?>I!$*O=6r[+j)cg!80ekREriZUFUUn%G\$NEGriZI,XfS_0 %riQ=)XfVN&,-%ZHVP^/bXK/CrUSFlkXJ^f--n,#ao)J"?qYBs^q"ajcrVk+BK)a$o!ri/srqm/h,piQi %kj\*@mdC,=p\t!nq>'g\p\+=[p&=LknF5o6mHj0)lK@?pkN<oIjQ5RfjPJbOio24/hqHf8h;-T>iPrpY %eC<$\]@-\l&O&Ag%P0q5?#jsGQBmVCA8#ZUbQuLr]"5D]['[.<\,s=U]Df5<[/RE3ZMq*3[]HR2X8]F( %W=H57X/:T)-R\f^o)J"?qu-<lqYgBds+::As/uA%rVl^(qtoV(-2mf*n*g5Cmf2MA!:^?bnaQ&:n*]T1 %rp0pTkih3mk2bU`ro"":hV[2HrnB-_h:pK1f@egr)qNEac.(7deC;%D^WapL\$s_s]XKm]!!!ue-pga, %(JILl-RUDprhKh0R'Ep!Y-"h-riH7)Y-%]$rMBRkrhKjqUSsfWSXlUQV#HhcUo:5e$A3sV,l-s!s68eE %rV6Nkrr//^K)YoNr;?Qk$gAr`rVbpJn,;\Bs60%Zp%@tKoCDJBrpUQhn*TK.lg*g!kiV!gjPf(Xio9sp %1?%3Kg"G-8g`IWleC;mtf?W1,_8O:>dF>b=d(I$#3&gm<*@`O,<)af;<_kG)2E%bB$*V7A]"5A[Za6q9 %Y6:u0XKSi,Xob`-XT#7EWiE8"VPL#hX/htiUT:JtVhTpS./`Z,s6AnGq>'g\q>C0hrl"hgs4.,Nrr)fp %r!Vd9-3!o-nF6GFmf2MFrqZipq=saZp@eLYrpglpnF,c3m-F!&kND*mkN(^ckNCp_hVdB-iZof,g=k-6 %h:1EB`lH-LeCD1Cdf-ol5!BGd/4)[/EcO1+QB5WfBP@Ch#gTQ`]"#8W['K\@!kc1XrjDd5rj2X1rilU7 %XK8J'rj)O&%^N.9VM0^O-i<K*s6AnHrV6NkrVc*_K)_hM!r`&prVHpW1?[isoCMV?lfd^)rUBgTrU0[P %rp0pTkih3mk2bU`ro"":hV[2Hrn@M1h:qqZ0A"en):QmVb0eVXhVP^%jN>Wc\[gS@bg!c32Du]t)l9pK %9dqMB:JW]"[^3<TXo5C0Yct:4XfSY,Y,8)qV#mHgU]-thTqS:\RfoO`V4XFlTrX36W2-42+7Amtq>UBk %rV?NkQiD[;rr3Z2rr)cmqtg0d1,A"Sq=F4Mlg*`oo)A1Wn.>!Rm-F!%kih0jjlGCZj5T(th](P5hV$T7 %g=dMdf@&*leC;\&jLj^?cHaPD]AEP2%_B512^0:aW4BH9/hSn[#$*]C^V%5$r3ls?[^<6AY-"h/ric:' %!3Q7%!irB)rM:",YHOn)WjIqPXJi'B,P(j2$31&(qtp6dqu6T6s+:9srsJc)rVZTl1Ge7Yqu66imHs0% %pAXjcp\smcp&=LpnF5o6mHj0)lK@?pkNCpejlbe,jSn!hi8>e'h:L9-g=js9jhBsBcHaMB]&:iXe\f9s %8i8^n`nfHoGB\@mNGiajg"F]brNQX6ZEUdG[Cj/drjDd5rj2X1rim-CX/i8#ZaI3DYct^(Q*76h,pi0^ %r!EE'rqu]kqu$Hmnc+4@V#LMpr;?Qk$RYE6jQ-19rTN_=p@7VHn+Z5Klj2k>ki_-kjQ,A#i<8#ohqm5h %gI0lRgXXj,g=dMdf?r!jeC;XW_)W)>',/OIiO6;-_o9U7`Z60E]Xtei3&j8Q-U9qmXK8@rX/iA)Z*CL7 %XfJS+Ybn;sV#mHgU]-tlTqS*UVPL!hR@'B@TG*]iVO=B]P*.<iq!e%Prr)fnr;E/cK)bZH'E8"0r;?Hg %qBk_$jQ-19rTEY<p#GT<n.>!Rm-F!%kih0jjlGCZj5T(th^.7?hV$T;h;'.pg==a#f@S<ga$1:R(Dk9S %ijH>-_o0L6`uZHMrkAr\4Zu@g/Or=5[C*<C[']e@!k#58riQ.&rN6.&ri?F,X/W>-Y-+OoUAh/+U8k5b %XK7_R/c>P;q>('irqu]maT$klb5W%Prr)cm-h?ijk552Yl1+<<kk4]Drq69]%IilUmHs9+lg!Zrl0%4u %jQ,FckN(LViT&rE-/dM2f%o03aN-U]'c.\0io7GY]$&@Cg=e8I6/:P^kD"_RAS$=>ajSVHZ`^I9Z*^mD %[^NQU]YFHRs0Vd3s0DX/(pCBVZa6X/Vm!>/W3*1pY-+.Z0E(k@qtpBm!r`)so`'OCo)Glm!r`&prqd'M %naY]$qYgBVn*fu6mf;bMmJcGXl0.?okN:jdj8S!?hVR/HhYu7th;-i9e_&U0*$!SXdEU1jb/(nS&J5Zi %b2M<f\[fVs`Q#n<+<\>/]=p6a6RO6H5btK_W2-JpXf\k5YH=q-Xf\h)VZ*CnUnjdbU'[NeT;JK]Um[U; %rh'@\VP]alW2PlB.erf.p\4[crVZTlP5g48s8EW/r;?HgqBk_$jQ-19rTEY<p#GT<n.>!Rm-F!%kih0j %jlGCZj5T(th^.7?hV$T;h;'.pg==a#f@S<ga$1:R(Dk9SijH>-_o0L6`uZHMrkAcW4Zu@g/Or=5[03nC %Y-bS7[fWt@YPt[&YPkU(Xo>C.X/i5(Ycb.(U8%Xe';DM,Suf#ZQ7`%4o(i+]rr2inrP&;`s4%&[rr2lo %r$V(+k2uR@s69(DpZV;EpAXaane^fbn*TN/lg*j!kNV0mjQ,FckN(LViT!#[,phL'g=G*9eB#]r'bqN$ %bMqNj]"6)0c.^l+5sa;ejQD8PO_&*QI`^$d\$N6?Z*C[CZF73K]Y)#Y[K!W5Zi@?1Yo'[Q[^3<>Vl-`& %Yc+\+TWYGbQnSF:oDAFarrW/trp'N8s/l>$pAY('hr"G,p*B1us8UU=nb;;4p?_5?mf2\RlNlb=ki_-k %jQ,A#i<8#ohqm5hgH46IgXXiuiSbOfd*pJ(`PpOR+LT_KdaB)G]$fNpYf=]"_RZeNdAj35.k<\R8gPdj %\@B,cXf\e1Yd",.riZC(VPa?h!i2WerhBCcr1O"\'VD#"XehPXTV*b"lg4TKq"aa`r;N&_K)YoPp@eLc %&DuCEp@]d%nc/X<nF6/9l1X?1rpfsX(@gn`n*]W2m-O'(l0.?njlPR^iT&qWrnf<diSN8@d,a7*):R3h %kK1j&,UBqPf@8:i]=ZJJhlt,?`5K6mZIQ1`81uV[:D?SS._NO2_oT6n\$rfSZEUR=Yct5.YPkU(Xo>F% %X8AprWW&h$ZEgL(Tr"S;rpL'ks8)WirVaV5K)a@#s7uZo&E;^Lq"Q3.o`+sBoCMeEm.ol;q=b$cp@\(M %rpg]knF,c3m-F!&kND*mkN(^ckN>+khVQfJl5q,$h;.GDcf6;t]%>Q`e/Z'2eDfK"d*UJ!d*gA9f@OtZ %DLI"a=]s8+f>c%<YHb@<ZECUC\%TJcrjDd5rj2X1riuC*ric:'&\#6RVP^An1%Y#-s8VuprVlfnrrE&k %s+:9OrttY1oDejirq-6jjWl,0m-O$&qtTsJn*fc9n+cANmJZGSmHj3=lNlb=ki_-kjQ,A#i<8#ohqm5h %gBucmgXXj/e^YNTh>YMJb0%.<,hp;W^V;P8]$d^_ik)h0[+N42V*-smY-,('TN5*lZa619Xf\e1Yd",. %riZC(VPa?h!i2WerhBCcrLa.`qk"L\NLZZ7R[U#s,P:j/p@n=XqYcraK)biM(&Idus8W)to`+sQ,9u.4 %lfm[1q"WtMn*'9:nJ1Q_n*]W2m-O'(l0.?njlPR^iT&qWrne.CiSN8@hV$R&*T>5drll:k-n*una2,SI %]=ZIlXQ$h&[^Oo/`Ml3l))AJ%[\]g)>HbWLV8p!O\$rfSZEUR=Yct5.YPkU(Xo>F%X8AprWW&h/P*2N7 %Un=9X-R\ZerV63aqtpB6s+::!rrW/tp&4n#p](9W-77d@md0<=qtoUVo'#`GpAFXdp@\+Xo`"CjnF5o6 %mHj0)lK@?pkN<<8jQ5RfjPJbShqoY'k5Ndce'l&\.H/@h_SS(>]%!pem)?rebO=QSb%bZpnF6,#e;B.( %daG);YHP49ZEgX@[C<i_\c0#:[/RE3ZMq-,Yl:j)Xq@"eVl?YkUoZ'sqZ$TkqYL*drr2WkK)bEA[Jq*@ %qt'jfrr2Qis5bLOi9]gqlMLAOjmV[-kjJN=s6]dQ!q#@@rp'jSkih3mk2bU`ro"":hV[2Hrn@e9h:pK1 %gXXgl);Y;6/]u5E,UD-``P9/C]"6=lXl?t)['\K%_50:X/?Z.]TV,=dW3`h#^9+N@YHY81XT#C)X/;cn %V#mHgU]."eU&:S\T)t"3S.D9cR[U#s,P:j/p@n=XqYcTWM>meVqXaaerr*E"s8V1*,N.nRl08'>puVMD %kj\E<(%C_]mdBK/m-F!%kih0jjlGCZj5T(th[JK&hV$T=g"@AdiQTOFbp'_I.,W(c_8.n=]@!^]iju_0 %[bA^>WC'$.Z*Ca6V-@0-\duBKa0i=a\$i`NYctF;YcRi-rN6.&riH.#ql9XprhpHmP+e\IT:`&0-hmT< %q"aa_qu4>0K)aX+!r`)jrVmB%s8V:0-KFO^m-O]Jqrn%Mkk+oKr:^9dp%A=VrpglpnF,c3m-F!&kND*m %kN(^ckNCp_hW3Prh]jB.rmEXPe%[=\iQ0*W_D8^6e??(B`Pp$Dn)`ZRC2-rAnFb;\MMfI&d\t?mYHb@< %ZECUC\%TJcrjDd5rj2X1riuC*ric:'&XSi^WMu\hX=Ggts8VokqYU0hrp9Z:s02M?rr2rkpA=adr;7N%pAaLGmdC#7jm2sHip?.4n,D\Om1&FKlg!d"kih3mk2bU`ro"":hV[2Hrn@k;h:pK1f[\Lq+kFWOrmN5W %]tN"Kf?;@T/1eHefsAT6a2bEr]>Hit]u%Xr]=Y&A^7h5bSuo-nYl:a'XoPO%Vu<ImV>d:jU\gebT`C`% %TV.R8Vk^#TR?\p=rV-'Yp%A+TqYgBlRfA'@s8<`5p%A1XrVQI1p%A@Nlg=*:jQ,V+s5N).!qGgMrpLKf %md9B-lg*g!kiV!gjPf(Xio9sp'&hg+g"G05fH_`raN2uaej-s`rmqt1bebk\]%GZA_o'X>ZbaK"7n:P< %`k9)&^ojiZW2N4_['[9M[C*9DYd1O=Xfnr-Xob`-XT#:#Wr&dnW"l5"S#rZhT:_Q!-NEu?p\=O[qYgEm %`W(PieGoREr;R6Kq>('[nF?&Kl07X9s5rP;s7Q9_s7QB`rpg]knF,c3m-F!&kND*mkN(^ckN<35hVR5J %hC:#4cHcFE(e)?[gtLK.cbqCe^YIVYcHb>)aPc"@D/K:<$fTptbKJGG\4is0Zi.<:ZF.*L\[f0J[K!W5 %Zi@?1Z2Cj*YPkU1USG6$Ybn:i/1gf#!;ZTi!rW#qrVlKiK)_nO"Rb^Xr;?Km%P-c,k2bUck4SB=j65_( %na?2?rp0FI$g[*Cl0.?okN:jdj8S!?hVR/HhYu7gh;-i9e^E%"*ZiSOcIpk&!6`R5a2d)pc6amPgY9Ka %aN;Q:aiPhk4K5m%V6-l8^pTu6)mcZKrNQ:&riQ7%rho^l!2][js.fLd!2BIdrh'\'YF28bUSF6GRMGDa %rq?Tlq>:*frVlejs+::Mrtt.js82]ns8N&u.d-!VjQ,Fao^h\6kND^*nGhqUn,DhVn,D_dmHj3*lfmWs %k2k^ciSihVir7gDiSiYHg""d/+sPC^df/#=!mT!=a2d)pbp=[Lg=j<_aNVlBcd++172rMF]rJEF`PoHh %WZo$]['mEN[BZs?ZE^[:YHRr.!j/T+ri?(!ql0Ll'rSIIT<,,nWLf`S)YWn$qtp<hrVlf=s+::!s8VZc %rs(1BlfmWslK\BD"6Sq8roNeKo`FdWoD\:inF5o6mHj0)lK@?pkN<B:jQ5RfjPJbJhqoh1f%8OQi[4uY %dFZO`io893-c+Zrb1"i!imdGc95A=pio880cf3s.]=TH*Za9V=#-tYE\%0&XrjDd5rj2X1riuC*ric:' %%)0HRZa6m?Unsn.qYL3h"T/)pr;?NlqYu0Io)H,t"Rb^Xr;?Km%P-c,k2bUck4SB=j65_(kjAH:s6KOJ %$g[*Cl0.?okN:jdj8S!?hVR/HhYu7gh;-i9e^E%"*ZiSOcIpk&!6`R5a2d)pc6amPgY9KaaN;Q:aiPhk %4K5m%V6-l8^pTu6)mcZKrNQ:&riQ7%rho^l!2][js.fIcrh9=a!jAeq$)XSpUR@R>(%UqppBCBgqu$Bj %rr/;bM>meImJm(\s8N]1s8OS3kN1dcjlQ.+oA\rrqWRGKmf)\SnGhtVmL\dPm-F!%kih0jjlGCZj5T(t %h[JK&hV$T4g"@Pnd*gAAg`cgEc-s_Rhqu[)-,&$d^W=L?beDEL.n)n3]tLGPZc0nqWY)6T]!SiQ[^ENJ %YctF<Z)t45riQ=)XfVN&s/Psqr2:@.[C)X.XJr1jT:[%qpA4[`r;?NmrkSPcs4mYSo(i:j0'hifkih<s %rqHTXlg+Q3o_S4^o^h\Rne^fbn*TN/lg*j!kNV0mjQ,FckN(LVgYW1l-n*ZufDabW#LUrNb0&`'cR1*V %hVQE(e)KB:n*`nbCY.S*cHjhrilo$H-bm!orO)p9[C*KS\[MLFs0Vd3s0DX/r361(rN6RC^8J<DYcsq" %V&fF/rqlorqu-HjrVc6cK)`"R!qQ'Yrr3N>%e\]8mf!+Qn)F!3o&Jd&m-Xc=!pSt7qWn.G#jLR:kND!g %jQ$6u"Q&"mhVS7d2r3<Ee^`=%e.i_HgY9QpeLMFP/JAd@+W;+3beh6MTV0HMYVIt=P*3Po^VRUs[^Ma= %]-"MaXo5L'XT#C%WrAt!W2QWnVZ3LiV#@%uUS=-CYa1T[Z)EJ762^ZXqu6NmrLNt?rrV``p&=t&%1Vsc %h<k.<mdB'*oC:i"o]YcCmJlVPmf;eTm18RMlg*g!kiV!gjPf(Xio9sp/`G[Fg"G04f,5IWhquE*fIn$W %/.rR;*uG\+b.k^ETV0TUZoU6YSXmjBa2l1.`4`jZ_8.D0ZEgmG[']h:riuO,riQ.#!3?+!s/Gmorhoam %$D*itS=I'tXc8<0rr<#ts8W)t`W(Piec,^EqtpBm&/#WPj5]_1s7>jEq>'aIkP=62rU^*_rq-6^rpg]k %nF,c3m-F!&kND*mkN(^ckN>+khVR5Ih&d`ojQ+J?hD?>t2AmA[-QX-Cd)O)dX/k7>aB)Go^qf9[bg+AR %`5J_!atC]G]=kni]=52U\$`WKrjDd5rj2X1riuC*ric:'$E0o=VP_/E[?["Mr;Zcqqu$-eK)_hM!qQ'Y %rr3N>%e\]8mf!+Qn)F!3o&Jd&na6,=!pSt7qWn.G#jLR:kND!gjQ$6u"Q&"mhVS7d2r3<Ee^`=%e.i_H %gY9QpeLMFP/JAd@+W;+3beh6MTV0HMYVIt=P*3Po^VRUs[^Ma=]-"MaXo5L'XT#C%WrAt!W2QWnVZ3Lj %U]@4gUCErbR';mBZ*C6`LdCt:qtpBjrr&SkK)bcK!qGsVrr3N=%J8K4mJQnMmc!d/n`&R#kjSN<s6fgR %!:KjR&+&ZKlfmWsk2k^ciSihVir7g`iSiYHg"b32)&_#_ho47#0,GEU&eZ9.(_d\,^VAHpT[(ii3]^fB %SJ'#aa2l3;]tL2W_'H\!ZF.*I[/R</Z2h',Xo5=$X8].!WV`XnVuEP#St<B\S@>u0NK$F,s8W)us8N#? %s+:9trrVokqu6U,&eb'$j7<6MoCM,?q=a"7q;q5HoDnR`o`+O^ndY*Xn*TN/lg*j!kNV0m7HEOkkNCp_ %hVm;H+!9;!jN??91a!o!)&XeL*Z5jB`l@)?X5`-[=''sg_!B4gcH=;J`2h&'0#kN8]tM%i\$`WQ[C*:= %[K!W5Zi@?1Z2Cj*YPkU2W2RM/VSL!TQ'G#?s8N#pr;-GFs762ts8Vrpr=f52m5d;oqto[Op&G'Tio9k. %p#>3$!9aIIl2BoHli-/Tl0.?okN:jdj8S!?hVR/HhYu7[h;-i9e_/[1(`:WVhTF0j-0+$sjQ++la!W7a %YHPma`k/k72E%>E^:Uk`rjW-F]rJ]V&H8g1Yl:a'Y5YI#W<0#sVuERnV>I(dUB@6lXG.(`XH/F5\$pbp %%K-/$rqucpR/`$C#5S)nr;?Qn&aVM<lhgSEo^r.^k2G:qo^q,+mJcJPmJH>Nm18RMlg*g!kiV!gjPf(X %io9sp/)fIDg"G3<hAdNaio883dO=,7]&Vhb^;VBEd]KXi`l>d.gHIg%aiVN9^AbkL_o&^p#f.:_ZEgmG %[']h:riuO,riQ.#!3?+!s/Gmorhoam%(!:!ZEfa\UV+6j&eb-Brr0_5K)aX+s8Mrr&b/(MnGiOWq>('j %lf[I2q>'49nH/:QoDJ7[oD\:snF5o6mHj0)lK@?pkNCpejlbgfhVR8P,3'gig#qPIf[qhCm)/,R`l?1O %.bV/7cdC.he*gLFaR&9WrkoPk`lcH6aiPX;]=Ybi]=YP[[C<QOZ2V02[/RE3ZMq-,Yl:j)Xpi"WQFjc# %SuT`IL)1[*s8N#tr;HT`s+:9QrtYP4lg+QN!<:s6n^#PHlMpACjPf(km-4K5"R"t3l08$/#jLR:kND!g %jQ$6u"Q&"mhVS7d2r3<Ee^`7&f,u3_e'm4$cihkJ`nK.tf$,?]bgOq@f@R^L/ll#^^V?Paa0D_I]Y(eY %Y856_Y5PU(X95W-XfDB$rMfpuW2T]nr20Fh!2L+#Um%"KTqRmBSWoA5.4P2i"8VikrVlees+:7ds8Do] %lMghas5)W%cHb\=rpT=9i8F:ili6>OmJcPPm18RMlg*g!kiV!gjPf(Xio9sp/`G[Fg"G*6gE\&of%/m2 %e-FCK`7NVie&i^QajAD9f\"$V1LFM(bKI'8d(6Rn[)Bnt[C$ptZ*C[CZa9Y8riuU/Xf_T(!irB%ri,pr %qks@h%AfM^\u2I!TVIsEV_0V!r;Zc8s+::!rtFnkrriT+jQ-$`e*lc*o^qA0k54B2"RtpNo()VJrpg]k %nF,c3m-F!&kND*mkN(^ckN>+khVR/Ji$g,/gt_,HfaZirdGj0BhU*YsdF[!Zj5\Y=7=':6lg)m5_5jZ= %]Y)+k\0fnE^r!t'^Upn]\$E<CrjDd5rj2X1riuC*ric:''W%YFZEgL1XJ2Gj1Gf(1rqlTjqtp?jp&BXD %W;dV3rp/nM!!*&Vhso%=lK\E=nDrQep@7DBklg24kiq@-l3QY<ki_-kjQ,A#i<8#ohqm5hgGdsEgXXj* %f@M,fd*pJ$d*MpFeAg4rf%/(h+jAB_XOl(;]e3>d\%f\Qa2bHdXLu3VYHJ_`Y-.`-ri?4)Xf\W&X8T%" %WMlcpVu3FjV>d8!PEW>HTp_=>Pa%mk.K&rCq>:'frr/YlK)b`J(&e*rlMghas5)W%cHb\=rpT=9i8F:i %li6>OmJcPPm18RMlg*g!kiV!gjPf(Xio9sp.,j.Ag"G*6gE\&of%/m2e-FCK`7NVie&i^QajAD9f\"$V %1LFM(bKCO$d*TA2[)Bnt[C$ptZ*C[CZa9Y8riuU/Xf_T(!irB%ri,prqks@h%AfM^\u2I!TVIsEV_0V! %r;Zc=s+:9qrtFnkrriT+jQ-$`e*lc*o^qA0k54B2"RtpNo()VJrpgNfnF,c3m-F!&kND*mk=+Imjlbgf %hVR/Ji$g,/gt_,HfaZirdGj0BhU*YsdF[!Zj5\Y=7=':6lg)m5_5jZ=]Y)+k\0fnE^r!t'^Upn]\$E<C %rjDd5rj2X1riuC*ric:''W%YFZEgL1XJ2Gj1Gf(1rqlTjqtp?jqYu0Io)H&r!:p*g&b.4rp>"I&oCMJ@ %gZIYnjQ,RhkQ'fGkPscGl2BoHkm-G9kND!gjQ$6u"Q&"mhVS7d2r3<Ee^`Ko`#p2^`Pp6UegAu!hmg2B %ccIXd_U[2Le'g673hi@`]tL;Q\@T;a\[fDWY8=FGY5PU(X95W-XfDB$rMfpuW2T]nr20FhrhKUhTqi!R %N3]aUS"$`**rbd8p%A(UqYgEmR/_sA!:g$f&b.1pp"\@$o()8<g?%Gjj5]@cl2p;<m/HDPmeuM`m-O'( %l0.?njlPR^iT&qWrnf6biSN8@i5`k`,j!+ge_/V)eC<<^[EQk7-RZ^Xd_4,Y4?Pj/X2rE)ZGOKX_ZR`k %_mKcX)mllT['[0GrilC-!jA`.ri?1%X/c/us/>gmr2'q"W2Qb[P.8#mTV/e>,Q@H@q>'mcrP8Gbs4[JQ %pAP"'p+%ZiiSjh3q"449lg+K4kj@U%rp]sYq=FUV(\$q_mHs9+lg!Zrl0%6jjQ5RfjPJbUbq70h.I5:) %g>Cd@iSj(;^t72`0/(B"g;r.-:/4[+`oH=Jd^$0c]Y(ec`jiN+rkJlX_S<jt[C*KLZEO88s0Vd3s0DX/ %r361(rN6a=ZaZKr_o&@NWP'].qYU0bq#:*irr2lcs+:9Xs8Drrr;HX!/E5[6s8W)\lK/!,!pA_."6JS' %iqh^;jlY_)k6g51jlbghio8kRi;V[=i7Q];gu&+ds3ptu/Jo>SbKJAfg"HE+eBu[das"F1^q75%\@=@P %ajAD9`Po[2_lq)"[^No<R8KORXo>C'X/i9"WW&jpVZ<UnV>m@gU]-tfU&UhcT)YA\SG\i`%K68)roa=] %r9j!Cs+p^Rrr;iqqu-Nu/E5[7s8W)^lfeK7l08-2"6eq2jo4KBk7-Y>l0@U#k3;-rlfmNmro4dUjQ,@U %gYh#Mi8EMEf@em3)]RDScIW!N*!?E"f@SEt-,@=5]tMY#\MlIkeC:_GbK%`H[EAfu]=YtQT2q]bZN@G< %Z2V!,YPt^)Xo>F%X8]-sWW&jpVuEIrUSFQXTqJ(XT)]H$rrq]fs8MNWaT$klg].6O!rVuprVm$SjQ+_g %s8MEbmecJEmf2bTn-/:Lmd0<+qX"a[n*fc9na,]3nF5o4li-,Ulg!d"iSin[l/h".jk\blhZY/Hh:0s0 %ro57(!7KNPdaC&$dGN[3mFp8j;!$]r^<k6Nd*TGSe&0)GVP[Y!rON'@\[_XJrjMg6s0Vd3s0DX/r361( %rN6@,XfSS(WiH&r"/M]e')hh7lMpn_mdC)Is+:9Ss8Drrr;HX!/E5[6s8W)\lK/'.#j1:4k2tdcj5Tpr %!p/S,roXXJjlP[gk2PCXi8FUn"lS%cgt^fdh#Gk&eh%^UeB?%ag"G'Z!7]EDb/tm?]YM.kbIG&=1s++k %XMr/p_o&[t`jW=iR@-pCrN6(#!irB%ri,mqrMKXmrh]Xjr1a7erhBCcrgs.\rg`nU$4Zt4rr2*\s8;<Q %U&TcF!<2usrqlZo"YAZmcN!qDkj.I7kiq@0l3$85kN2^,rT=XRl07L!lfRHrlg*fsjo49UjlGL_gY:ZE %j5AkQf@S^0g)D!_cHb#?h%p1sgt10*d3ZTD_S*Y,\[aXXbgb.HbKC=7aiUs6bIbC(T:]/YrNcR2ZEaD5 %ric=(s/l:%s/Z.!r2K[orMTXj#,@rfU7n6Qrgs0%rVm&ds8W)fnBLubs475KrW<#qrVca"0BD3As8W)c %rpK[PoBuYIrpU*[n*]Q/lh]uXmdKW6naYu6mdT`7lg+Q7"mbI=l/CS&jlPb+jo=09hZY/Hh:0s0ro57( %!7KNPdaC&$dGN[3mFp8j;!$]r^<k6Nd*TGSe&0)GVP[Y!rON'@\[_XJrjMg6s0Vd3s0DX/r361(rN6@, %XfSS(WiH&r"/M]e')hh7lMpn_mdC)Ns+::As1/1.rr2p(q>('j(]+!fh;/(lroEM-roO(?"Qe\(ioKss %roGBek2bXckNCsdio&eSj5JtIiSiJCgZ@PIgY:]5cS70"daHA=`?\2R\C8p9[gpL#cc=)$<)bD"`i?&X %X/jRY]<T/eYctgIZ\u]tYQD#2Y5YO'XT#0sVZ<UnV>m@gU]."eT`V!aUApteU&:Pg*W#X3rqZ9]rr2uq %R/`0GrVlfrs7lWo"W.%3j5/YVk5a`Ekm$G;l0.<nk5OTCkPj]Eksjk#l0@QujlPO`jQ>Oaf];,Kgu%A\ %f\bTIdaC!1dFHdoaN2J(<l*JB^:k6(bgFPSV,^MK0?LE$b-A5%_83V"`O<4l\H9=(aSiRI[JmN5Zi790 %Y5bX'XT,@#Wr/jqW;WXoWW&h!Vl-DgV>d7q+o_K@s8;Zerr2us`;bGhi;`cTrr3<$qZ$R5rVbp<iVr0B %m-a9?melMWmd0<+mdBu>rpCcpn*TT4nF5l3lfm^"m-<lmlK[BgjR2HmjQ,UY#1tstfA#'2rluc_9Xia0 %^V:uKh<sFf`HHDq8E.=rfXJ?EaN2*?c+Ug4^qc>`rOr3C!kZ(Urji$9s0Vd3s0DX/r361(rN?.)rN?F, %X/i4uW$D9@#5n5is8N#onGe+?[/^+(!rr;qrVHaDk2u$iir8!8ir7p/ir8$:jTFT(j5Tprqr7\<rT6N/ %io8qVioJqOldaPFio&//i6frmh;&DFj3,Wpf\"Qh`!@>&0JLSX\Abtf>Uq>>^Vmq'Y0YFh\$rlY\ui*@ %]"5,_rN64(XfVN&ri5srrMKXmrh]XjqkO.b!29=ar1Nt[!##8(#5%cgs7Z0_Sc=NGrVlis$MXGpqYDK" %k3_3hqrR_;o]?#7!9sLH!pAb/r93t>r963(jlPRck3(^^mb-:Tjl=h=jOD]&i8>%RkK_B(gY:3$bRbsB %2E&dl]Z7Up?7dbG_T0X7ZdmU*rk/<I$,EjP\\Q"haL&>QZN@G;Z2Us-YPt^)Xo>F%X8]-sWW&jmVu<Io %V50pdUC.h5qY9j[r;?Tiq#&86K)aU*rVd6*s7lQkr;7r,l1*s"ros=Grp9:C!:BXN!:BdPs6fdOr9OFO %rU1<blg*j%lg<iso\\Qllfm'S-gKF>d,sI('C=5ugu75F`Pi-0,rn!Ac->;"epL+`g"G92d_OVlY5Z?H %a2ba$^rOL/cb$gf\cTFP\G`o9[K!W5Zi@?1Z2Cj*YPkU1Yct=6Y-"h,WiH&s$Q&a=q"XU\qu??^q=Xc> %s0)J$rW<-"q#1'n,j+7Uio9stqr7V6o]#l2r8e%Aj5].qjSRs;jo+=0jPo1Xio9%Th<WVAio8nBcf!3u %a5,PY$KK=Qe(E="`5Dp$*&'(f\@BMf\6LO7^V@_&^ol#0UUR_B]"5#GZb!`P_YpV=Xf\](X8]-uW;WUo %VZ*FlV#6tfU]."bU&:S]T)]N&p'10cqZ$9_qP+"BrrE&trXAi,p\XjaqBY4cmGm7(jnn34jo"<Bl2KlJ %kND"*kkXE>kr7eejlGRdkMbCfg"GKKj3uK<eC;\"i!g.YcHb"qgXFBj&0`;V2U&hHa1Aig/M4iVa2Q$( %e^XZ!rk/ZS^p:8V^qdD"[']e<!j])9ricC+riZ:'riH.#ri5mqri#[krMBXmUnn!b$PiO7q"XU]r;ZQe %r6G=os475KrXAi,q#10hr$Uann`T*7l20fGm.BTDmJ?5NmJcJPmecDLli?JPmgJOKlg!g%mH3R'hqp!N %lfm'SlIst=k2m<jm*sP?iSiJ/`<dh:3B>p?c/[C+HqR,cg#(6+^t[VHrko/aa18ara2bm>]=\$Q!kGhN %rO;d6s0Vd3s0DX/r361(rN6I2Yck44Xf\Y(WrAq)(]=4+q"O[_s7Q'\qYu0Io)H9#rVd6*s7lWo2E'@A %f&c,Zro=";qr.2,ro<q;rSmn=rT*t<$KC((i8EbZjlGL_ro,Qjj5f=`ea;bXg=G?GbM1e3`5FPl_UR)` %cHb"U^Y7&]aN2!7aN)NK0"/4Eh6[*l&@Jpb\$roU[C!<FZ*C^;Xf_Q'!ir?$ri,jprMKXmrh]XjqkO.b %rh9=`p7D9srr*&rq="=^QiE'FrVd$$s7cQn2)PQmf%0!KlKI@)kPjW?k5aZDjo=E@klU)4k5OI*k2tjj %kh,Coh;-cIkK_uBkK(_*3l]e'e^;dta2d2jf$;RUbfn2TcS2l=i8D&Y^V7=lbItU(]=YVa[^Q=I]<M7> %rilO/Ycmr,s/l:%s/Z.!r2K[orMTXkrM9FfrM'<,rr3&sqshN&K)ad/rVd6*s7u]p2`KUHg$7tlrosFI %mcsl>qX+7Jr9aLMs6K[L"n1mImHs9>lOiLMmI'E!p@dP,hsKg\jlPjS*6pc5bMD"/f@Soq^tdVrdF$=s %h<!qe:=e"kps&f^%`-!/`5K[4_SEt#^:qInrOMp;s0r!9rO)[4rj2X1riuC*ric4%!3Q4$!ii6!rhfgn %(Dm)N!r;Z]rr2EeK)`4XrVd6*s7lWo2E'@Af&c,Zro=";qr.2,ro<q;rT!h:ro4@Fio/hRk2k^cjQ$7! %0&u!QjlP%[mFp:FjQ+M=gZ-5j2E&G%eC)Xff"\uRd*TkT]?&(6bfh]J[b]cGrjiZK[DfVa\[AiP['6g? %[B$F3rN$($WiH&trM][m!2fals.oOerh9Cds.TFap7D9srr*&rq="=^SH"EFrVlis$MXT#2)X1?f&l8_ %kiMU&roX(?!9X:Bs5a1D!pJk1roH-%k3(slf^SCdh:^uScJROBaN-D'`n/hmdF$Xfa5Y\$cHa2KbfS2W %0Y"XNi3pD8^:V##]tM1m#J7OW[^W`XYl1m,Yl_/6YPYL&Xo>F%X8]-sWW&jpVuEOkV#I.fUAku-rrW)p %n](T\s4dSPrXAi,q>^IR2r<6@lL"!<l2Ku9lN$;JmJZDLmJcJPli-/Qn*]W2mHji<%.*?JmdAs*p>b2j %mHl(HjlPjSc9FP:h;-i;fAFBZgtCB.dEp_*jm),+f%0Wkc2Pos_84O;`5][2^qdXt^;@AX\c0,=\,Ni7 %[K!W5Zi@?1Z2Cj*YPYI&Xo5=&Wi;usVZNY1(]OF9q>'OZrq6;Cs0)J$rXA]$rqu["#k.0Jn(upuj6kn. %j5T(rir.p:ir.mCio/kShr!MTj7qUseC<[/dGj0Ed*V"/f[T0M$4>k6`m<;id*L%T`5KO0`R`V45X7uQ %\ZDml^:r!rXKoFK[BQmK]sk5M]WV4;s0)F)!3Q7%ri#dn!2fals.oRf!2KOfq4[h]qOn$;,lISorr<#n %U&TcF!<2us%/Ti!qtgU'n*TN4hr"Fpi8t+(jlQC%$KU:.io91bkN:pgqrSgKfBUo:k2tdSe*PlFfBqr8 %%d;$VdbEO+f%0iB'$&&7g=i8f6;G/)Yd!9-_pu#s%_09g]=,/c_nELe_6gYZrNuX4rj2U0riZ:'riH.# %ri5mqri#Uir20Fh"=P\trn[SRs8("?K)aF%rVd6'r;Z`o#mp1lnFYc$rp'LKqs<t@rp9RKrTsOLrTjmW %lK[WtkjIj*m-O`;!:9^N"Pqo'g=eOPlg!0Vn`&QaoCEY1ma'53iSiJ@f#c=ecHb/0lapA*B[tYO`;7g+ %ijZD2`l>m/]unL9]tMM!rOi9F]Y"0Srji$9s0Vd3s0DX/r361(rN64+Ycn#.riH+!"fEh"s8UpSrrVrh %rqcYHs763#s8Dp*n*g;*dkio\daHP:pAX+Lir7p.iqhU6ir7s<hZMcoiSjdq$K9t$hVR8NiS`YRro5$X %iSWe[fBMPRg=YHGc.Udu]tH*RaP#7tcd1%^b5T^1b0%3MhG-O0[)0\l]:$pg\?`Ed_83RaYe.NVYHPOI %YHRo-!3Q7%ri?$srMKXmrh]XjqkO.brh9=`qOdb[$C)n`oCMtZr:U'gQiE'FrVd#hmf1_`1G]%1rmLiA %qrR_;n`Bc2roF^Rk3(dbjQ5Lck2k[bio/kXrT!t?roQB)jPoFgg?n:`h:q,Ud,!O.^q_`^bhV",daH^o %dFQjucd05_i_`9=[`-5"^7<Tu]XYK%a2bg#[_]em[0!bN^AG8=Za-n9YlM$-Y5bX'XT,@#Wr/jqW;WXg %V>d7rR40TYpAb-kpVHl]s5<qUrXA8as4#OU2?24Wf),@Dl20fGm.'E>l3Q_Bm-X$#l0@R5lNQS=ki_-p %rTXCKrp16^lKI^*i:HR#j5K@kf&G]D`\>Cm3RZpHhq6T9dF$P#gt('#o^lm-@aO#ie'kSYhT3FFgWn*] %]tMM._n<Y%`Ork^])oRS\c0)=\,Nf8[/RE3ZMq-,Yl:j&Y5PL%X8](+Rk$#_pAb*ipAOshnGe+?[/^+( %%.EZbe'g-1rmK6Bp@eLGqr7V6oA]W*!94"<"Q/+piSjdq$K9t$hVR8NiS`YRro5$XiSWe[fBMPRg=YHG %c.Udu]tH*RaP#7tcd1%^b5T^1b0%3MhG-O0[)0\l]:$pg\?`Ed_83RaYe.NVYHPOIYHRo-!3Q7%ri?$s %rMKXmrh]XjqkO.b!29FdpRhGX$C)n`oCMtZr:U'gSH"EFrVlib"om$!1Gf%0df9+>jnn31jo4??jUgS: %kMtU`jlPXejlGL^iSinsj8e<@juDG_ip#^]mHr`cgZRbHh;-Vs^b[djgt^T2dalgnf%&<scb&2r;+X?f %`PoR*SC,`s\@C)0a1Jbb[_]em[C*c`qm6F2ZEjJ7!3lI*s/l:%s/Z.!r2K[orMTCdrhKgf.4Ouas8N#l %`rCYjg].6O%.EZbeC6?5s4,ZNqtpBWqs47Jna$,<#j^jDmHEculK\B7"mYC:kND10l2^/LljW1EkjRuu %oCM#&iU#ngf&G]D`l:#!dc09Df\"s+dFR+.f%/(;oP.iEd,3a0e$7cdaM,CCcHa;?]u\:4]Y)8']Y+3T %!kPqQrjVs;rjDd5rj2X1riuC*ric1$rN6("ri$9p.kC>es8DoirVc`gs+:9Ss8Dp*s8VLY8]Sm(n*elc %hu;X7iU5Y'iV_UDiT&tZgt^cEi8NYSiSi\lhAbA0iT0([hr!2Nk3UgUi8EM@db2gef&Pd.)<Ce@-csKG %a2cB?_T'UDYcogh[EH:ugY9iVZbXMtY/%i`\@AoQZEUR9[Jd3+Wrf<$WV`XmVZ<UnV>m@hUB%(gUAgk_ %Sc55[T*L`&)ufj.o()e[!:HT]KDtrNrr*?+s6W?J`l?["n(?RVki;g,jQ-=#$KU:0k2tjbi8N_VroFLJ %jPo.Wio/kUioU1&1ZRNQlK[ioh;mYVe^`I#cIq@B*?F=id*Kt]_p-HR`l?3Ff!Me@\[g#&_Va7q\@BN# %apbYs`kT7%]"5AZ[^3RDZ3%;9Yl:j'Y5bX'XT,@#Wr/jqW;WXjU\ghlS0&jQs7Z*Wrr2ufcMrLrf)P^J %%0-@r8kR1Gg@FgijQ-=(rorb6r95Bim-O-%k3)!nlK[^#lKIEoki_-mkj.X'm-*Zon*fr0isk;=khFkO %eC<CBllmY@rm_h5d`L%ig!eF%fBC5o8^>WAf%0?[hS[81cj[P2c,R`A_83k!]t2&Y\c92=[fEl6[K!W5 %Zi@?1Z2Cj*YPkX'XSo4!WrAq)Sfo9Ws7Z'Us8N#bqYu0Io)H9#rVd5up%'7InaYZ&kNL^Vro!e5qqgu& %!o`(qrndq<i8N_VjP('sgu%#JiSrhThqm5hgc+*HiT0([hVQrEiRuu?g=kECin;r8e]uGa,1+`be^i=( %e'l4^dD3Q::/4C.dB1F.Ycu!T\\8!R%CELP^qd7][(<iLZEUS3Y6(l/Xo>C%X8]'rVZ<UnV>m@gU]."e %U&LebUAgqeU^F#gRN3FDs8VfkrKmPDs8Dp$o^q\q*q8Y&j6,Uih;.;Sro=gSj5T+ZjlY^ghVR2MioK1^ %jQ,@\ir7jSiSin^ki^p`guRPPhr!8GiTB:YgY:E/d3U+<e0Wc$g=t94aO\q]`Q;"U9[qRsaiUru`kK1( %^qd^q\\?)'\@B)a!l(tLrO)X3!jf5=riuI*s/l:%s/Z.!r2K[orMT:d#caGd+<^R]s7jG1K)ad/rVd6! %p@KIMo((o-lKmKgroX4Croj@Go]Q;?rTP!Zl07L"m-Wlpk32$olKda#ki_..jVR+Clg=*+kNCjilJpsd %j5]=glf-j\hU`%b.kB<,g>:`Ero"O<io8A5gLOi'l061DhSmIbaN2X*`XBSt`QcZB^VRq0\%hmSrjr6C %]".gMrjDd5rj2X1riuC*ric:'qQTt&riHR0T:[5Kqu?]jrVc`bs+:9Xs8Dp*p%@nu+7\m]kND'ah#?72 %htu:&hZDcpi;VX6i"4l-j5etLgu%#JiSrhThqm5hgc+*HiT0([hVQrEiRuu?g=kECin;r8e]uGa,1+`b %e^i=(e'l4^dD3Q::/4C.dB1F.Ycu!T\\8!R%CELP^qd7][(<iLZEUS3Y6(l/Xo>C%X8]'rVZ<UnV>m@g %U]-tfU&Uh_UAgqeU^F#gRN3FDs8VfkrLEnDs8DrsoEt.1*q8[ZkND*ch<<ktj;$_8ioB(\k2tj`hVdDQ %jQ,F`jQ#7Zrnn^RiT9:ekMbCTjQ,.Shqd,Ik2tLSgY(!%,piQ?+P>E%gXt0"f%.gZa\l#1eC:bFagJOr %^:qJ"^q[Fj^;^Dt\@B)a^Tb6H[JmN7Za6t:Z2Up+Xo>F%X8]-sWW&jpVt?nnWh#\'+T)3=pr<>cs4dSP %rXAMooH5:Io&]0%m,?q&k5OQCkl0i=kQ'oHknE:Fl0@X%mH!?jkih<slg!d!kNDj+''JHDmHs9'kMkdl %j5f:]j6,ao%H?=(hUg@0/(rY1hV[5ii=jVuimH0.A7T-5l,DN9`PpELaNa_($c'Qsc-=#<_8aL(^\thE %])oRT\c0,<[K!W5Zi@?1Z2Cj*YPkX#Yl:j*XUD5&T-,9Rs8VilrVlKiK)`.V!ri,qrqZWlrr3lZ+QVV; %lK[6]gu@,EgY;&BdbWj>jOr5=io9so#Lq8_hVR/=dim]/kM+bShr!SNgZ@egf\#<6db<gEjPJbNhrinS %X&i@;rYnuY)Aa2*)B'bI-j_[c!!"Gg*>otB(`*u-+<V=29f+[6)B'e=)]g%7`5K7#]sb;T]stSQX1c^" %T"_hKU8#iSVm<V!W2R(uUTC>iS=H:MVPL&bUo(#^TGXbsQ_pIMT:hjLTqS9XTphF>U8"T^U_+4<rWE2s %qYd2h!<3#tM#RSVr;?BmqYL*grsBhij5\kYlJLFRjSdpCn(-(KjQ,O[gtUuRro+mLf]D,Pj4;fCjm1d[ %lJppihr!\en(ZU\f%/^Wkl'KFlf-p->?`!E+"\KR)]K\9*@33d$o^*F!%]9:*$Z[J)]KkD,8V.n3&hBh %*[VsN,9n)JahPa27(g(@_S3ahZ,=u:Ur:*cVl.qiXgkm9Xf]16WNrV,U8"QdX/W,!WN3(sVQlY]XJ_tm %VP^2fVlHboT:_dRVQ6Yo',1?Es8:.Af)PaKYlEDV!ri,qrqZWlrr3<K+m%h@mHrrmiTU7#3:u"]kN_@# %io8q`m-*Zrh;.D[kNL^VlK[m"jRDBsnDrZup%@;&mbHUXmdBK*kNM.!kifB]?lo:ms!)J*+<MgQ.krak %4?NfP1+"=l.4HDl/MT.A.4J^t8KTT=2(gL70-nuoaNDZC^qe(2`ONG#f\!7JaN1Nef\!RG^T+ZJ_6C/S %Za6X1Y-P@;ZEg^?ZE:7=USG/uY,nh1Y-5%7ZE0n!UoLGsWi?^GrVlrpq>C*hWrN(th#HsF]`/'4r;?Qj %-N!iClo$cTg"#<MhrWtZg"GZUdH0KEkig7Wm,-RPk2t%LiUb79ro=CBhW*JLd,sKDb'qLpgY:H9cU'qu %6UMV/*#fh/(`5r?U#k1hi8<GJh:^H5g>1T9_o"]'f#PhYf%/6pcc,DC\$no<\B24hb,qehbK^V/'/;3U %*??+E,74c(C22P(S=II5SXlmcY.(F2R^05nXf]%?UR[jPWMuYeU84T`T:_jQUS4?RSHkaXTV.pGR[a;K %"K&%=+SGa6s8&Mjrr2]mrr;oqR/[6er;?Qj#Q+Q$lSUQPfL=?SkhtUcjP/GVmF:CbhsB^Vn*f8nhs0LU %jlQ3]cKFETio9+[imd5Wh9O=1hr!8GdR?S)7n4I?+<DR<*#qbNV<Hpuro5loi8*2DhVd>Fa2^P7g<.Rg %g=k'*e&h4Q]=UbL]Zn(#cEXY#cdNUD(cOAk,9nB].1d%@D^98\YbIl4a.f<7['[KMYb8M9W3W_A]W%Tu %XKSh,Vl-MnY,.uoW!K;uVPBr_VP^0gT*M0fUT1=<,5D0;s89e7iW&oVp&Fsh[f>Cf!ri,qrq[u=s8VIF %2qm!<lK[HqlKI-_o((K&n)a04f(J_"jQ,dug$7l#eC=Kb0^%WckNCOen)DgFmc<Hhj4I!t##%]5,paf^ %)Bg8(WiGLNkiq<pk2t[^iT'(_hp#3H84_Xbd+dL:g?%GNs8U?g?I$jQbfnnY^t[W$*ZcIg4s;C*.53Fl %(G^/Wl*mXkcd/Si]">Sl\$r9M^TY2Y_o&^WW3j"AYck78Z*g[7YHY76YHRr,%Bck6V59rcW26Ss,:!!_ %rrW#lrp]rqs8N#js8;lUs0r"0rqu]nqBl+>s6MX%g"Fp>khkL`in<#MlI"_TgZ[kFm-NWagZIYFiSjCO %bPpQ*hVR;LhL<i6k1Ro"jkJPDg<W)P!(0*h*#on:&Ju?YTqUT*hr*DLh;-c:f\50;f#,Bi5M!lqdFQmr %cd0T"n@,kt\@BYi\&thTbKJ0A%hgZP'HJ26,9mO&-#.2MWgoTr_O[7"Y-,76Wg^6!U91Q+[\K@_Vl?Yj %U8"HZW1T]VUC<okTV.jIStMaKR[T`FT*2$g+<^@Vs8Vqjs8N#rs7u]mrg<]erqu]nq?$Qos%;T72;$R3 %kigsek2b:OmHrEfl/1jod-pG_hr!_ae)f]bcHbV:ki1Uaio8JPl.sY1l/1CSh9n_\!(TNt+<V^H'HA)g %V5<D8ir7sli8EGHgtpuIfuM-#6e]]*e_8a,e'lG1o=MV.]Y)M$]?[[dcd1&T'c8kg)'^@M.4H\W&1_[; %iio/Oa2apKZa@*PYcse1\>Z^=]Y(5;TrbH$WMcYnWNN(orhp+#VP^,aUo(#brgsFkUnari+sQg]s8W#< %s4mYRrq6<hrk&3errW2tr;QO>qu?]`2`KIEf]qb_lK[Tjht$?kn*fB0o@EU-kiCgnn(I!kr7'6qm47A_ %m-!Qbn*f8be*c;Xj5\cb9*S'`+=/<Z,T7gL<N<(ekih9pkiV$eiSe#$k2tRGbt(C_d*UP*i7d;Sg].;u %c!J]@hTX4"^qe^Zh]<g^5!C,>.Od&*(DeiMG3QK8WR&niWOf^R_md+Q^V?t_\\l=hW2R)3[]ls=Z*C^< %XKSk4Y-5&.X:;>8WhlPeW2QPoX<Stbrr3&qq>U'eYlF_%p&FshkPqjf!ri,qrq\)@nF6Ge%I!$<g"GWB %f[fEUf%/=4k2"2&lKIHXk2t:Im+pL=mHr]ij9s5WhW3bLhVQs;//eC+DDSo:r49JnhVR8OjPo1Whr!AF %g"P6:g=k0-e'QFenA`H^']R?\`n&_fcHae;X%Z2G['\B)aKX%<UnkK5^!NOL`4`jk[^Noa[R!1p(+(@< %%NQRoY-+S!W4n[fZEC@!R\R6sWgB'MVP^&\%[s,dX/`1jUSFENS=Z=Erga:dT9uLQ,pi'[s8Vtps8;lr %s7QBlrqu`orgWoirqu]j2u<CJn*g8b%-Qg9g"GZEg=Yi]g"FsAlJ^%6md'2flK[-YnDW?LnaYQ#kKqT7 %kigd\inc@C*W7)j2nm$+^:rI`io]Cdk2tb(j"T9DhV[5IhV-Q3eC2n=aiPA:jj28qg=k$&d*f)":JX'^ %\D#0N[FWp.WP$-deu>W;ahu$-]=Z#"]LG@1*%WWT'I+j2['Zg8Y/Hs)\$NE6TW,K4Yaq>eX/i.rT;STl %Ycsn%WMH8_Unji]U7n?WS#WJ:..dH<s8C4Bh#I<OoD\gir;HWo_uJEi!ri,qrqZfqnaZVh%fY]Dgt_;Q %h;%SlhVR#VnE/6Mo^VJ(n*f2mp#bDap@dV8mFKkOmHripkN"KX,5ies4iG;=_o(QukNhI$lg+N6"QJG% %jlLLCjP\hKg"=sQcd*UPldaP4hr!,Qlg;^3B4ju^b3.I2^YdqRZ,Ff-h6=-2b0%Q;_TU-?:/3#Y1G]sh %.Or-D]<ScObGM/O]"4f;Ye\&`UnkB'ZEC@.Y-,:D\#Q^<XfAD&XK/>"VPg>_XK3fuoD\akqtpBhs02P$ %rq$-irqu`orpTmXs1J@5rqu]nqYp@GruW?'a7S<JeD/j0jlOk9hpg06bKJ\jeE,WHcd1J/jOW;Kd,a9; %e/0DT+92BsbQH)Rf%0cOFj0OOhqd,Bg=Y*3g>(K>g=k?=hV[5IgY:E5f@e0`)B.&YgWJ7(d)a;S5X7n4 %`n&_Q]"5\n_8jU,`5K*s]Y1VV`O*"QX2D*C'X+[B]"3ub+VkhE(De!cUp$VkSXlUPUS4lpRA-FPV6d/# %T9PS5VP^'eSc>;[U'dQdS"cVn(]O@1rLj/lrr2lqr;?NnrU^#]rrW2tr;QNtqtg0h*Zi>@0D+2\e_T'5 %kNC@Ein2oEcd1P$fBM>Ue'm:=kM#%ZeE?#Hf,Q+a,6.^%d*V.5gAK_2d/!LtiSiYMrnI_7hr!AKhV\:k %1Z@3IgtUT=b/tbHf&,B0hVQ`(b0iXE9MEU_g;(J<`Q#pAbeD6B]>;>#\@B_n]!/E\ZnJd)[C!<U^Qk'2 %)]LOP*$;2\[&^7%U8t8mVR<h'W2Qbt\Z`35R@0nQXJ_hgUnn!f$DsVpSu/A')ZTg9_#N?m!ri2trquWk %oDZK(j8T2[r;?Qj3W&aPru`H*aS4`Tg#:oElg*6WkMG(\f%0!>h<sOlf\#BSmGI3og$S1_h'"=#.0]u< %e^a6Jhr<Ypi<Rp5s6/V-j5^-u''&*8k2YL`kND'mkN(^`i8EV@C!S%MgZ7GEjQ,"Ujm62U@q4<\m*3bu %cd:%geAfn`_o^$C^VA45_77#%]=T6!]=Z,(S=D/T+upkm-F'hfZEgL1ZEUR9]Y()EYHkIL[^N91TWGN%YcFh+XKAY.Wi;tjW2LUQs8;fnrp]rprrW3!rVl`krU^$Rs0r"0rqu]nqYp@BruW?'a7S<JeD/j0jlOk9 %hpg06bKJ\jeE,WHcd1J/jOW;Kd,a9;e/0DT#Ts*I1<du,f%0cOE6S"Jhqd,Bg=Y*3g>(K>g=k?=hV[5I %gY:E5f@e0`)B.&YgWJ7(d)a;S5X7n4`n&_Q]"5\n_8jU,`5K*s]Y1VV`O*"QX2D*C'X+[B]"3ub+VkhE %(De!cUp$VkSXlUPUS4lpRA-FPV6d/#T9KVGTVeT[SXl@DrLsXlTUV[M(Dm)Kr;E;g!ri2trquWkoDYE_ %!ri,qrqZ]nqYE&K*Zi>@o\eZXh;-]GkLA#@f\#92cf!F,l/UgQe)BKQg?%GGkNCIK*%!!W!!"q(d-TK? %r7hP(q>'(0iSNGjg]lWmhr*AJhu2OeiSNGHgY:N+arVVThqu]8hUBWidR-Aq9Zl)C^q[Y'`l?6H^<4U1 %_84!u\BDH?]!/E\['UaZ['[T_Q'E[8)_rBQ+0)?JX/hthX/W(q[C)U)W2lu0YHOdjRAI!dVk^#_V#I8! %VPL#ZVPY7Ms8N#:s4dPTrr2lqr;-B`rkncmrrW2tr;QOQqu$Bl+<\bHpZ(;eiSiPWle0tShVRPKf&kfE %mciugf]VYhhs0L[mHr`c+Y5/n"pR0>eahVTio9sr#M&kSkiV$fj8S$Ij5oCbj5]7akNM-mjQ(4<i8EV@ %cQjdjjQ+eNjOrYVls!\(A)-G;c-4DXd*U:l`mN2OaiV]?^XBs7\@Bnt]-4i!]>qs^S1Pp/3?oaqZ*CpH %ZDsq1Yct:C]VVg8ZEh9S[]H-pXL,@=X/i>'Xfeh,WMuPhW#?TSr;?Nmp&D5q!ri2trquWkoD\4YZMt"* %r;?Qj.Jri4jX)>HoYfqUf\bTIb0&u5f?r"#o^oNHh;lSqkNCFOgs%/m(_dYk(`;hgc/nQg^[:FfdgGF, %e*ZPe`l?K[f`'_+g&g0hjSma/fDaG%f2(8Zh'+&]hVR&4c-P/!WC0.l_of^-\'i^;`Po9o]YD5#[^NrZ %[^<uk[C)OTeJZ!3]V2%Fc_R"uT!GYr1c,1s5H1WaPa%l?W33eGR$dl:#.UA#Q_U=LrLOUpUSFQUT;8!I %%hJ[8q>:3lq4mrirWN5tq>'gbq?Hior;?Nmrr2rqrVlehrr`8ur;&>JqYTsYj<Z,Do>KhTg#1fNbfoG? %g==a2q"VAXiTSG,lg*6^i6Wr'*#KM3)thS)kkFhhnaZV0$LdH8naZ"hb1>A'ro*k5!oi5'r7_2*rnJjT %g=kNDi$B\jio8kBd*g_)W^]It`m)B;][tcPbKIQ2_SjC9]=Tr>]Y(htah#'Xg=dUa_SW1IeC:LkTVT'+ %W&csD77FD`Z^R>[Y-,+J_Od?eR$bUbVOa]cVu<D'VQ$PlUSFc[T+Ve:qtp?ls8(%@f)GpQrqlNeq#:*o %qtp<hrVlfqs8;iprlG,mrrW2tr;QOLqtKjI-R\T[a6MsGjQ,URdIHbag=kZfrk@RYma0>MnDE?hehAd$ %*??:Hqps?dr;=Y0pAWhSo^pr5p[Z\Xgu75kk5OBBkihF5huDX7i;V^7i(rOujsqt-kih-Zf%C!$b[P&? %iS`58`o5msd*TVFa3)QP_o'^9_nj^H_83,0i?cReafV]"gTdZSX1l<O5sYrR9X_C@TqSTr[CXK%V5=0a %*6#(`Up@;0XK8J'Xfnq/Vl-PgTb8"<qYL*grqQ?iWrE8%rqlNeq#:*oqtp<hrVlfqs8;iprq-6]s1J@5 %rqu]nqD8$Bp>mVJo^p)bkLe\LjN>X0l.=>1g[t-Fh;./3`olO9gt^.$-5[F2(`;hgc/nQg^[2$grmM5? %ldP7gl,L`lf\$2Zrn7G2hrOdfrR_&$rmss&h;'8!`89A+c-=ShgSmS/_o'X2^:2P=]Z%ju[_0Ai`O<4i %[^NQ]`3m"Ce^YPL]Y'r3cd/DUR\$gjU,4\,5<l-HXd#'DW2Ql3]U5)cP6SOjTpMOLU&CPpTqeBWT:_pL %S.?/0q>'pfs7rGi"oeMuq>'gbqZ$Eqr;?Nmrr2rqrVlehrrW2tr;QNtqt9XC,pi0S/B$`7g#1fNbfoG? %g==a2q"VAXiTSG,lg*6^i6Wr'*#KM3)thS)kkFhhnaZV0$LdH8naZ"hb1>A'ro*k5!oi5'r7_2*rnK3^ %g=kNDi$B\jio8kBd*g_)W^]It`m)B;][tcPbKIQ2_SjC9]=Z%p]Xl5,]"4Wi/(u&\_SW1IeC:LkTVT'+ %W&csD77FD`Z^R>[Y-,+J_Od?eR$bUbVOa]cVu<D'VQ$PlUSFc[T+Ve:qtp?ls8'\6i;Wu[rqlNeq#:*o %qtp<hrVlfqs8;iprkAEmrrW2tr;QOLqtKjI-R\T[a6MsGjQ,URdIHbag=kZfrk@RYma0>MnDE?hehAd$ %*??:Hqps?dr;=Y0pAWhSo^pr5p[Z\Xgu75kk5OBBkihF5hu2L4iVqa9kN5M$.kAp/kiLCHf`(lo@Ue<T %i7-8riShi(d)!Q=b0&,L_p$$9_9gQF_5ZDP--43MXf^@4Z)=M#^:pd:5n-L][^Nc@Trk`1]#i'jV>d,%`NHA>ZEg[8XK/D(YHP")VlHGa&eb6@qYU9kq!e<jrrrE$qt^'_rqZirqu$Bjrr2osr;HWolMn?n!ri,q %rqZots8O\+gsFF,rnAXHeDf?AgY:<4g!SU1ma0>9d*Ub1(*+DTa2d5bc1:GCe^Ybaf\"[6jNQ$!io854 %eDAd-lJLLLe^iU6hpp9"i8EJjgB66eh;&"a;s<E`)U?CDf"f)QaN-\<8&<$LcHabF\&#kqaiVl0X0K7I %\^8^#[^O?$[&U,?\<iPl\=]Cf\@AQBYH+%X]mbD^/LDP]0n+SGV59QHZ)t.#O9:TRS"'DJ':bSaTV.pH %S#MgD1,@2Qqt^9loqVNjrr2fiq"F^_$2XMqqu$Ekrr<#rquZirrh08mrqu]nq?$Qos&1K'gX"4)gY:N6 %e`>ZHhVQrAh::HAo$c(FeC<R?)Bg7dbKK%qdIm1Qg"FX)gXkWOd+-\.jj;Z4iS*#Rj5\hGg>_,Pg"F[2 %j5JnQhVR/Ji8=Oj-g^1?*R`-Sg;LqaaiQnA8]/HVdaH[Z]uS.4cd1.HZ+%Na^=Ll:]J$qEd(-Bb)SV`3 %^:pD=VnTmL['['/T#-/61,:C,,r^I/W2ltjT!kr1V3[F\TqVI\';D4rV59rZT<4ZT1c3VYrVQWppW<Hi %rrrE$qtTs[rqQlsqYU0frVc`qs8;crrVlf6s5*bWrqu]nqGmFms"3'_dF%%3hVd)?l/h$ej5/hVgZIYn %g"GK@g?RrF-72(+d-T?7qtnUohUCHBh!OL[gY;&[f%o0Fhr"(ikhb1RkND'chUC`RkN1gdjQ5Od!9O4@ %%.Wj4,M1;hi5s+!lg+O]?JjYajQ,4=a3DfNeC<3]\%Tl(`nfIW_o(*X_7-ls`MB<K`N6/D`Po<u]==]6 %b);0=3\r<<5)P6$ZEg=']t(\TSXm^!WiW8%WiE&"XJhnhYFhFE2:;@"qYpKep&D5q"oeMuq"XR^q$Hoo %qtp<irVlisr;6Wprr2BdZMt"*r;?Qj.Jrc0"o\DTgum5<hp9WujlOY-hpp9/\[gD0_'L<N'c#]\ft6A%hU'USj5[u4hUL$'rmq;6j5\S9rnIG.!mK*@rn.5$$/F=qf@SO#daQ\Ee2,P"d)atr()GiSce%.7]f\DU %\[fu0bIP1(bKIl3[)0\ia2bm:bIY*h]XG8MXMh?I,eX)f)Pj1BWMur/\Y6@9Xgbd2Sr1%fT-,7(O,q/p %$]^R?U8k5]Q'Il4T`1M]Sdh*UV4='(I9HUMq>^KiWW)ttqu6m#r;-9br;?0`!rVuprr/Vk"9/5rqCqdB %qt'C^r;>=(kLJ,@d*UA,kKV92g"G,n^"pZH.4-AZ)<BT.^Zk"Ae'mLC`8]eUf)j^\gA^:8f)FP=iS`Y@ %f%/U1gtCB7hr!PLg=ZATrn%n8e'lOuh\mEndaHk2jhX&A<4fdAcO[_&bg=_[]=Z2,^<Op?d*N39]"5bk %]X"ib[^IX%rP1IoWktpAZ+drL\@AlX]VD6_^:pBh,qYCIa2aF8SZ&csSsu4DVP^,`U84TZSt;pSTR_Pt %s8Vurs8(%@h#@BRqYp`sqYL!br:Bder;?NmrlP2nrrW2tr;QOQqt9Udrr1a0lIabMe'm%;m*a>Fhr!D1 %_rJn^/hAOp*pVbE`U<0Wg"G`Yb3.sDgt^lHi9fmtgY;_hroO:4gY;_d$K'b!jlPgdi835Cs4mV0Enf:# %dH0I3+6hG1i9KUI@:=H7g$S1dd*U=rg!7=GbKI`Ne&^1oaMG^7_o'$qdCm4IaiMQDa0Dnk[C*N``NHtj %]#;OfX-U`DX"5eYS=ImMS"uj`\$r30UoUW"X/i2!WhuMbX.l>=J6`-SqYpKgqZ!f"!<2ip"oS5nq#('] %qZ?]nrVlfhs763&rrW2tr;QOKqt0LarVbO,kLJ,?cd1,&jiYa'e^`9^\_4g8,pOWL(#dj!]B//2d*Uh5 %_;=%ue'lq#"kVhqj3lBTg]$"1bgOr=f`'G.gt^o@f@86se'n<G1XaXsaP5Gb(?!NbfAY]%4?QQQ\]rCB %\[fc(bJgiq_SWh'a1][>]!\rY[^N9=`3?Hk]`#GfUnk]'WN3S?TsM)-\$qs#MR^0g+<W%mO2AboQ^=GH %WgT-;SH#8]Sc52iR@0nAS:,fgs8Vops7iSn!<2ip"oS5nq#('hqtBmgr;?Nmrh9>nrqu]nq?Qoho*#!h %gY4(<e^`U)d+7CCc->8$g"X3Rh8R>^-70TJjP8P*l070Ue*#o4io9sh!o)G_roa=4rne=Hi8Du5f%\s7 %g"G*:hrWSGf_sD#fFuibe'-_,)B.Yadb<gE_)shZ]=\'g)83`-d*TtJ]?/1/c-=/Qd(d0'_S!OeZH9NV %[OK)l^cJKq_QL&H^:pJS\?ii\USEma^8*&$/X;UAa-<-cW3ELtS"$.LVPBo\Unj`VSuJBUJ:Lo)s82ir %qS`ErrrE&prrr>sqY:!doD8Uer;HWo^]3?o!ri,qrq\YPp%8OgrnZDqf\#96e(X0TdaI=9hr2Jjj3#Ls %/1_h`lJggBmdB8kg$J(JkNC[Vgu72LmHj2og]$=6joX)fg]$.?hr!ARjm1j_hV6f?h#?+4gY(9-j_a*$ %+6hG1i9KUI@:=H7g$S1dd*U=rg!7=GbKI`Ne&^1oaMG^7_o'$qdCm4IaiMQDa0Dnk[C*N``NHtj]#;Of %X-U`DX"5eYS=ImMS"uj`\$r30UoUW"X/i2!WhuMbX.l>=J6`-SqYpKgnGg*"!<2ip"oS5nq#(']qZ?]n %rVlf^s0r"0rqu]nqC_[Fs!lRLd*T`#nA=\ad'gCFk1n"tl.+<;*?EVkk/5*WgY;88_TCp$b0&_oeJ6rb %bfe\mbLG%bbLb.hgs+*tg"G$1rmq>)e'l^qf)F5"fDaJ=f@/4&f[puVeCrWmf[rAR6,q0o_o)Jp5.eVG %^;e1-^U_4u]X>/\\$rua^U1A_\@<3TYcsq!Za6R0Wir"c[&L$tS"$[f^7Lp^^qbp[.hE7CY-*bT$(\Mh %Pb+YFTV.nUT+.9ZStMaj^&\35qZ$TnWW*+ur;?Qnrr3*"r;?HkrW`?"r;?Eeq>U0gqZ?]nrVleirrW2t %r;QNoqu?[\.Fckncc#>B_t!9F\@Cefi60=2g"A/)+kPuCa2c?ZhXne+c04B:cK<d3iR#rsh;-B.f?_ds %e^`U*dG<U5r7_D/f@SO+gA]b)g]$%=g=Os4gtWedf\PB%gt_lq"NJd6`Pqi#'#;K*`6?HE`P9L8_Rd=r %]tM5"7`;jJ`P0&(['mECWk#[BYctO2Uq3b5V4aKj\&4u9SArR30JF7X1:4EOUSGJjR\Zp^VP^,aUnaQS %U8+L!^]FK8r;ZfraoC?""T/,prr2os"9/5rqu6R!rVcZlqYBsdq#:-lr;?Nmrl"inrrW2tr;QOZqu?[H %f%/6ra7JoCo^p_I]^G4LdF%RCh`3#1h!a^Ubg>G3qTI(1mdAQQle^L]e^`10j4)o@e^`U3g?$o:j5T(r %i<A,ogtLZCrnd\5ro4aOgt^rKi?09"j5\;Ai^[Wolg3utir7h<aj/2Pcd0\R_Tg?G_SXL7`5g'E^qe15 %`?;e+]s4iX^pLS[]W8*L[^N<9VnTmfWiDi=c'^LL*?@/P]:,b"_kNm,Z*CI7WiN1uUSFW]V89tKs8Vrp %rquHh[JpC,r;?Qnrr3*"r;?HkrW`?"r;?Eeq>U0gqZ?]nrVlfcs0DYMrr)fnqYL$bq]=MHg"G-$aQM%$ %dcfoFe]]'U.4-CRh;-B#bl68ubfnAgh>Yq!eF_>be,n1NfDX>%f)F2Bf@Sm.di07W`5M5re2ou`d^cp8 %d*g%X[E6P*]tM(k^&Gf!]tM"b[CNo]]Y(ALXtQ9P[Bm3EZ*(..WMlbnTV/6_WM6,^X/i=uV3AL%Wi?qu %)&YSSD6fY#Tr4f]TVS6RZCIGVT:_dL)ufm;r2BVqqY^?niW/!:rseburVuoqr;Z<Ws7Gs_RK!BgrVcX: %qYL$cr#jhOgY:Q-bNmd3f'MbWg<q8n0.\Zki8E#0d/Mi(d*U1ui:Yapg@a)"g"G-Yg]6(-fc/Z!i76?t %*7r'En^5`D77Gb?^!kH]c-<fEcG][u"iJ@"a2Gn3_7R=n_84"*Za@(rTt@qI\[T&TZ*CM3XoG9tY5Y@? %Z*CU7WgLT;YHO35+%('h\"TLnXf\ItWMQH"TV2:Y!i)M3rr<#tc2ZT!!;cWns5O"W%J]_ss8W#ps7,XZ %o^r.!s4RDarr)fnqYL$dr?:%Sgt^f3c0kSb&+K)FhUX/+1bg`*k2t:Gec+P2e^`:6k4RR&ht>e.gY:Q@ %hAG))gtUT@iSj7dj>JpdkNDmDrFB/<ld=,Zk6^#%`nK.kbKIlDrPq.?_na.+`Q6-Bah#*r4/g$5^qd[u %]=>AZ[C*BDXgPUGYHP1?\@JlLTZ>*][[\Zk8pYfuWiE;1['$R8X/il1U]R<d*rc0@r;?Qjs02M'qY^Bn %ir/ldq"Xgfs8;fpnaZYOo`"7Xo)HB&,l[c@r;-9cqthGhgY(97aN3Pne'dIDe^_kb*[rE_]A;;gbfp(> %"O,*8h;.bR!7phop!a&ne^scP!7q/"+P56%e'f6Tf#5MteC6QH6INETd*U4_agK74^V.=n]Y4<[2nco9 %[C*QW]=beYY-'FI[C*?IZ*CI4X/W%rVkB]]WMuVdUT:GsV59Be\uMcl)&YSSD6fY#Tb"'!TV/*RTX()X %StDXJTH!n1s88hq!;cWns5O"W"Shcjs8NB&r;Z<Ws7Gs_RK!`qrVcZjqYC'e+Pkl.gD8VgbNmd3f'MbW %g<q8n0.\Zki8E#0d/Mi(d*U1ui:Yapg@a)"g"G-Yg]6(-fc/Z!i76?t*7r'En^5`D77Gb?^!kH]c-<fE %cG][u&&ZE,a2Gp4]=Yen_8='qZja;uTt@qI\[T&TZ*CM3XoG9tY5Y@?Z*CU7WgLT;YHO35+%('h\"TLn %Xf\ItWMQH"TV2:Y!i)M3rr<#t_uJm!!;cWns5O"W%J]_ss8W#ps7,XZo^r-ls5X+krr)fnqYL$dr?:%S %gt^f3c0kSb&+K)FhUX/+1bg`*k2t:Gec+P2e^`:6k4RR&ht>e8gY:Q@hVI#CgY:WEiU>h;j>JpdkNDmD %rFB/<ld=,Zk6^#%`nK.kbKIlDrPq.?_na.+`Q6-Bah#*r4/g$5^qd[u]=>AZ[C*BDXgPUGYHP1?\@JlL %TZ>*][[\Zk8pYfuWiE;1['$R8X/il1U]R<d*rc0@r;?Q`s1841qY^Bnir/ldq"Xgfs8;fpnaZYOo`!nN %\,RWNrVcZjqYBjY1tC.$c0NBhho3RaZa2\R$bX-ibKJAfg&B=sf`'4sg%j.Ye-==Jd*^7jeGe&@e^Dmr %gY42-\)uhj5s[rV_W&qhZa79R\CJ1%`P]Um_#D.a^:q4t`3u_I['[$`d$W4`Y-"h-XSo4!X9,W1Xo5:% %W2-6gU'[fcQ]@*@X/h.>'KQehPH11BT:_mNT:hpQStDXJTH!n1s88ep$LdH`s7QElmh$-h%/K_trr*31 %#X(?&s8W#rSc8uprVcZjqYBm[)`?3tcHbh!al:FafXJ=T5S:oOb0n_kh;-Q.df.u(daHV#h=]Clf_*i# %e^`1"e_&ORgFLq,e^rX5.OqpgjMF)E6cI%,eC:t:^V%55^V@q4aN)?@aN2E@`PTa=]W_XF\[f)uet(Fk %Zi@?.YpQcb[^36DYct:0WMc\nYFV5KPf9l2OZu&GR@1=RTr"TbUnjibVuEClUSAn0s8W)>s5<nnn*g;V %p&G'\&J6nrq>L<l#mgl#4kK`6r;OM3hZ"burVcZjqYBp]2V?[/d-o-"jiks']=UI!(!+JBf@Sp>ir7U0 %iVqL0inWAff*'d[h;7!0hq[#Lm-I/0df9@1C2.\Bh#-C"bKJ8Wc0!3me'QJ@b5THl_o'::d)3?%^qdS< %h50!,])T><\0ec"]t1_`\$rcLYcb15[\T^gS'8@NQpsOcU8#5tW3!)(WiE&!X8\mrUSAn0rrW,rrq6;u %rtk.ms8Vcls6gO32>R(Hrr*31#X(?&s8W#rm/OBk,l[c@r;-9cqth5D^$4dsm-MsRhp3l+a2c-[jlXS& %gsaa"daJ-F!n,NEr6tGio[<E].b)tqcd1(hg"P01cHabbdi9@gg"APN42\nN]Y_PGj35Qa_TL$:^:q7m %rjr]P\@AuMY-l0ba2as]Z`pk9X8Jt4X/rD)Yct%&VQR)'U8"?]Whl_qT:[!fQ'Io5TW0h*!2H<UQ]@f7 %Ss#8.T:_dL)ufm;r2BVqq#13np[o0ls5rJ/,:!4*)"I.rq"XIWqYg?kT)SolrVcX:qYL$dr>E>`lg)FV %n'L+Te1rf(c,o;;mENo9f@SO&ec+2(e^`1$fA+paf\"a'e(<4-hVQoad2^`g*?F7ofKD5T_8XC/a2dB+ %d*'VQcd0SJ_ns:i_#hEd^(.f^Zb+<"c-<5u\[K)SZ21[)Z2V$T[^N9<X0].<W2QVtYH"h2V59`PS"ljX %YW=fGWMuGZPGkFTQBqNE!i)M3rr<#tc2ZT!!;QNm'_h:ns5rJ/,:!4*)"I.rq"XIWqYg?k`rF`l,l[c@ %r;-9crr*hO_!LF+naY)jk1;IJdF$80nab,VkhY(KgY;_a"P_\bh;.bZo\9&o"PVS]e^Yntg#1iJhq6T= %jQ&0UrVQJ"@UeTRf?r4%p\3Otg!\U.cHON3`tQG2`50:)]"5c)cd^IK^qdY#\@DCE.Ccq!]"PeaZa76S %\Z`3>[^NHM\#c[,U8"ZiXg^Yb$F$b1UmeHhVjj1TU]R<d*rc0@r;?Qjs02M'q#14,p\"4Zk2tqR,QASt %naZYSq"+@YrVZZcs763&s!7UBrVZNgq>:%+]tN[p_!LF3hqua3/]YoMjlPXE`n]%ldF-JBeH41IdIYfe %de2&]djiksdEg.fe(NI/e]uIde'f9VjOr3M4$1?r_7[Y%j5\A(a26!A^qROq]`,MR]"#8YY-,1M_oKfm %Za6mDrN#jr+02KEXg#%-VP^N!XJ2G_WiDnqWh5oMQ'Io5TW0h*!"Yj"Q^<`,U7RO2StDXJTH!n1s88hq %!;QNm$hs>es5rJ/,:!4*(^T[%s7lB\qYL0grgs-!rr)fnqYL$dr>E>`lg#>'n*eW`j4#h>c-=Arlg;sA %j4Do4e^aZO"P)&Pf@Sg/$J="]e'lq#h;7#@rm;_:ef>dmf[r>I3Pi\R^rOLYkKqDqa3W)N_o'@.rkT#Y %^:q7dZb+<"c-<5u"M(tPZ*F/0!3uO/-+:7`X/iS5ZDa_"YHOt1Ybe1eS"$1MVQ`*B!NE&hSWg"NUR%5F %U&q*b*rc3>rkncurrDimrtP5#p&F1:l6@PR(`;f5s7lB\qYL0grk/9ks!7UBrVZNgq>U@3^qf='`:<BH %k2t8Q2:9gsnaZ1udcfNCg=tB]h?;Tfg>1TXh"9@og^`&lf@AF)g#1iJhq6T=j;I#92?!FL?t*U0f@SF% %fD#$rg"Fg-g<Rpdrl5\k`PfU/^Uh"ncd1+jYe\&f_RR,P[jeht\[oJf['R*M]",#JY-tdD\$rH?UnXT` %Xf]'"6OL'%UnjH^Y,@bYrhKUjUE9F7!rVuqnGg*"!;QNm'_h:ns5rJ/,:!4*)"I.rq"XIWqYg?kkl8-l %,l[c@r;-9cs8OJ.jg_h;hquE_%26h(hVQ$#g!$q7da-7feC=KG"OtrLcd2F8rR1>cp!P>?e^DdidF$Io %e^;XdldF2o'%k1B5=J#ghr!D/_7R=jhqtfW_8O7/_86,drkB2^a2bBbXK/D'`5KNkYct=7Xf\\)Wr8ps %W;`RkWW&\$WMu`%[AB^lY-,=,'V:>PR%H2lVl-5PPI6gHStDXJTH!n1s88_n!r2Qfrr3'!rr3<I+"-m[ %s8VEUo)J^erVZ`qT)T)qrVcZjqYC0k)^sn4]"5i=iQ2WB(sU=djM]s5e%WQLdaH^ufDa;'f@SU%dbN@n %g"Fs*e(*"$g"Fm%d-]?4',0';`'-OUcf='I`lA"m$01'V`l?-AaN)@"`r<pZbfmH"&[J[HZHC>2XgY[G %[Bm3EYct>/Y5YF"XrXL@WirV+]"4oAUpRMCUnj6HSu"J/Xf\LgR(8cYrh9IhUE9F7s8L+>hZ!ZPq"t'j %%K?A,+!2m+q>^K\o()h[r;HQork\Wks!7UBrVZNgq>^IDkifXj`oH+'',)>3d-0]7jQ+t2_qs%ugYL]b %gB??ggXt0Og[s4kgB?0Ze^i=NgHF<CfDFRe.kC/Pk$W"Ap[n+Of%/0nc11>CdF$CidETq[b0%iIaN)cY %]=GJ^\@L#7ca:C!]Y(he\@8rUr3cO.!k#GErimBM[^!]dZ*C@A]>gnPS#<0e6:/)fXe),tU8%X_!i)M3 %rr3&tr;QBhZMt"$q"t'j%K?A,+!2m+q>^K\o()h[r;HQorpB`ks!7UBrVZNgq>^IBjlO"^_Va7j%1Nul %aPPdgg"FTY\'iUKdaZeGdKJ(Lda-8=deM8_dIkp;e^`*ocdC.ie^`'lc0Ng+&e`j9`BQd[dGNj?_83aq %]&2DP_84(-_nj1g_#D(`^;n9tXK8J'XMi&oW3EM0YH=q.WiH#ss/>plri,mm#-"Su[C)j-)5"(7\XoCQ %R$aL&1oI7FPEWDBR@^%CTV*8's8W"nrr`&kqu73,s8N#t+!2m+q>^K\o()h[r;HQorgs,lrr)fn+Sts1 %s8OM1kIS7CiShli&/`[:jQ+8:hp]<Rg!\="f@U#P"P;8VdaHq$*SK,se'ljtf\+s-d*V10e.WMK`5Fi, %6dOfQji5=>^Brr\\]2Y2aN2EBrPnlV(<+MA['I!BZ*MNpaK;nZ[C*?IZ*:I9r3$$uriR9@WN*/*Wk,dA %Whd#/^8.QhSt;c>3j#N^R$bFTSc5>bUSAn0s8W)Cs4RDRq"Xacrseu,ruW=1q>('jlgjWHrqu`n!<1"< %g&E>srVcZjqYC0k.Hp!-]>imkbS(X/d*V"?aQ2F7_o(?`f\>6<rn@S3h:pT7p"T,mo@j?!e^a]NrS'Hd %fDFRe.kC/Pk$W"Ap[n+Of%/0nc11>CdF$CidETq[b0%iIaN)cY]=GJ^\@L#7ca:C!]Y(he\@8rUr3cO. %!k#GErimBM[^!]dZ*C@A]>gnPS#<0e6:/)fXe),tU8%X_!i)M3rr3&tr;QQmXoAItq"t'j%K?A,+!2m+ %q>^K\o()h[r;HQorpp*[s1J@Wrr)fnqYL$Ynf6<7j5][Na;s*me%WQNgX`mEcJ73nbfnMae,I\se'lah %bk9<_dIko[ckXmQcHXVXbfe8UcdC.Lf%)/p`^r`VrlZ"ra1pHd[^OJt_7Ib1_8*k#^:_"erjW`SZ*CUT %a0N"RYct=M['[0GYct71X/Z#q)6Ks?V59raVPToWP,"e>R&QC;P`V!AN/Y(RGBY,N)m$-$TV.mKT:hhr %rr<#rW;d"ts8W#prr38gqYL6_nga;(rr35im-XiQqu$BkrVukirseu+rVZNgq=F2!g=kZM(A,en+Q220 %_SY9jgV1DPj5\;/d+-b"rmM#%f@A6pgsl>P'%,+Rd*L+ee(*!Zf[qQ!a%/`TrlPr!bf/W&]=ZP3`k]mF %`l5p7_nj+&rOrQG[^XK)\@AlQ279g7]"5D][^NNIZ*1=5Xfeh4Z*C=/W3!)$V59QYWLf]aS=H"5QGerL %\UAlP,p9ItPGG#RU&q*b*rc3>rkncurri6!s8;fors7lcqZ$-W.eNB4rs.oWmJm4`r;?Qms8Kb4j8UD( %rVcZjqYBdU+5>Q4k4['E,NIh=`Pps#i5<Idkig@Df%]!8rn.G0gtUE2p"Aukp"9i*e^W'sdaHUoeCr^5 %a6!Tg4?VG3Akr?l'\:j\m-M^1gs=<gf\"NqcHOMTa2e2!!6>)Q44Mcp^Uh(j]@+O3^V@Iq]"#8Y[C*BL %[CNfWZ*CL=Za-[6T<PPrV7!(nTUhXsS"%6JKe4l'\$q^'WW&[pUSAn0rrW,rrp]s!rri6!s8;fors7lc %qZ$-W.eNB4rs.oWmJm4`r;?Qms8M<`\,R`QrVcZjqYC0k/?c8%c+k;=cHXVXf\!gJb1>.mdF$Cec-Xkc %rm(_pdEp._q9T#co[*9W--a]\d*U+bcHsqfg"GQ0a:/SC@Ud[/cIBSBYMnHabdtX,c+L^g_]?P.]XYJ[ %\$rl\]sP,PXf]LS]pke&ZE^[<YH=n-rMp'tV66r&rhL%+XfS:mXKf%#S>hpEUm)RXURn'W\$r!%LFk*. %Y-+@gT:hhrrr<#rV>ghlo)A[hq>^KW#5%OHo^qM:rVuokrqcirr;HWoT`5;srVcZjqYC0k#;*3ccHa9K %+9'Xsd,!No_9gumg=Y'2dF%sCrmLeqs3]WN-.1,heC;srdaQ[tgt_/:apnnH@UdX-c-sSJ[H?W"d_EiC %e&'!$a99N&_S3b`]EGsd_n*Ai\[/Wa_o&1I\$rfS[C*?HZMh'.WrB=+WiE&tZ5T^AZF@<;U9C2]Wg]BU %Unk6.]qqQa1Ga`jZMpR"USAn0s8W)>s5*bdo()e[s7u]pk4J:)o^qM:rVuokrqcirr;HWo_uJTn&H;Y, %r;-9cs8O^WZI$t:+X-g6&)cBb`RNl*hqd,Ff%/O.gA]_-g=k62f(I\fg%Eu#e'lgtf)F5"f,NW-j7h3Y %,U?E?J*cXmp!(aqn*f#caO&;hbKKn4*R;sQ`l>s9`Q$'C_8*jt]$SUBW3F"M]tM(k]",BM\Gri5])Ju6 %\Jh]V\\>eWWOA\$Z([kqXf].P`2p&'3B;r*\,N0)USAn0rrW,rrq6;srt"\krr<#os8V6RoJcF7m-O]N %s7ZHh"T82rrr2BdZMu3LrVcZjqYC0k/?c8%c+k;=cHXVXf\!gJb1>.mdF$Cec-Xkcrm(_pdEp._rm1Ac %o[*9W--a]\d*U+bcHsqfg"GQ0a:/SC@Ud[/cIBSBYMnHabdtX,c+L^g_]?P.]XYJ[\$rl\]sP,PXf]LS %]pke&ZE^[<YH=n-rMp'tV66r&rhKk&XfS:mXKf%#S/J;oRA?(3URn'W\$r!%LFk*.Y-+@gT:hhrrr<#r %V>gYgo)AXss7u]pk4J:)o^qM:rVuokrqcirr;HWoT`5,nrVcX&qYL$fs"1L\cHa9K+9'Xsd,!No_9gum %g=Y'2dF%sCrmLeqs3]WN-.1,heC;srdaQ[tgt_/:apnnH@UdX-c-sSJ[H?W"d_EiCe&'!$a99N&_S3b` %]G8/u_n*ChZa7ck_kF'=\$i`Q[Bm0ErNZC&rj)[+Wi?!')QB^A\$r*+YFhGeR[U4OUp.PGV59,,1PN-? %rh9IhUE9F7s8L:Cg&DTRo)A[hq>^KWo^k*7o^(rCs8VflqZQiprVlf;s4RD`rr)fnqYL$fs":U_d*T]S %+oTn$i8DSneD]BDh;-r=f%Jd2rn%A-g=b'.p"8oip"0Dre'ut"rm`%@fAGWKpXn+D,Z]DEm-jE9c-<uk %n(ZU<d*URkbPom0cHaSP`l,j8`lcH?^qdOmd)sM0YeIib]tD"h\[h[Ks0;R7riuI5)R-HV^:pSG[\fq, %TqS]mXguBgXK7RF3Jk5SrhKUjUE9F7!rVuqqZ!\t&+];js8Vops5rtG2tZb/m/?tapAXplr;?Nmrq-6] %s1J@Wrr)fnqYL$Slmh)Wb/uHddC/,saOo.X]].&Tb0SDTd*U(_c2Q#lc-=P\d.GWJcMZ&hdJhQ;dEp7\ %bKDXr3#inE*??OG)'9h<)&YE;YL'>N_8=(*_7oo\'u%DuYcu!NZaR<EX/j"ZYHP+3Xf\]&WuS4;V5L8j %Vl-JoX/r>$Q(k"NVkKWNX/Mt\S"#HLX/hh`XGVliNK'O%T:hhrrr<#rVuI;*r;Zfarr2QPk5Q_R!;,mg %s8V0ZrqZTorqZcpqu-NnT`5K#rVcZjqYBOG/*5m:bS)e]e%+Z)bh_*l_WT7kd+6doe'n<DrmLens3pYh %o[3?[r7(Yq)q<?cb0A0e1H?Hr$6C6:+<W!U,9J!k[C+SjZ2VcF`l>pq^^J&t`jN4q\[fAcZEOY>`R;0% %['[0GZMUp,Wr/t?Y->.8YcsUqW3*2"TqS`oY*kuWQ*ITiUp5uA23F%#U&q*b*rc3>rknctrtkV2s8VKc %rq,@8s!8rko^r1`jSo/Ss8W)p"T/)prr0Y3j8UD(rVcZjqYBRI/a)<Abr+&%]^"e/i8DVpm*sP8gY:62 %g"4g+rn%A)f%8U.gt2PUs475%rn7M1gY:?6*83hM9/JIK2`F#H+t+cb+sKCc]%sm+cd:%ddE_a8(!t=V %]tMb-^r+($\$sT7]Y(kg]"5HL\-K=F['d<K['fnC)Rm2MYHP=?Y,J;/[C)[-Wh-c3XK8psPrb1qrhKUj %UE9F7!rVuqnGg'!(]=42s6]gbo]G<9,p`Q`o`+sPrr2`ns8Mitqtp?krp'Nms!7UBrVZNgq>^IF_o!]D %\)6)ma2cB3[b'-Pc-=PWbK\J`bfe3/cNMG7bgOr8cMc&\bk970cd0hYbK\;Xbfmu9]&V/a/1aZ?aj&Pn %^<=^9d*TVF\2#fP3&hWh(]5*e)^$7LSXmKkV9$``W2RV'YHP+3Xf\Y(Wr8n4Yct('VQ6bsT:_[MUp-2P %W2QPjVj!qWV>ctrYb%GTR\ZOHQR=/PT:_dL)ufm;r2BW'qZ$Tip](0hqZ$R5'`S+3-R\<K4OV[Us8Vok %qYU0frr/Sj#laf$r;-9cs8O#h`Pj,L]&DW#b0&&A]%l)de'ljqdaZk!d*Br9dKIk@d+6e@dIbcXd4!Mo %dEg.ddF6Ih`kB(IdaBa#;p*8.g=j9gdE'niaN2(T3#FhC)B9ap*=!Z4,q>X`_lF9JcH`r&Y0!BF[C!<H %ZEa;1(UgcSXK8\3Y,%kgWN!=sSZ],qXf\"lX8\h#[\T^lTW+]]Rk$#gU&q*b*rc3>rlG,uruh1<s7c9f %r;?Ekru(h8s!K2]m6&hFr;ZfmqYL*dr;Q]5s5*c$rr)fnqYL$fs"271-76@bj4hi'e%WQTiR6B2g=Os0 %gY:9.eGe)'eC<%'g\'1jeb.N#eC;podF6RreC5Pb`PqE*h`sG<iSikho@MLAb1YIkbJQJ++%8UC,piO= %)C[*d1,:efWQVTQe^_FB[Etkb]Xtee]"#5YrO+#c]sY2Q\@ArJXK&M/]qhI3[B[*GTX(l&WiEh7X/Mu$ %WMuLD0`IjLUSAn0rrW,rrq6<!ruh1<s7c9fr;?Ekru(h8s!K2]m6&hFr;ZfmqYL*dr;Q]as0DYMrr)fn %qYL$fs!u"),9s\Thpf]ebI4k2f>u4]cHFDUdaH@_bPofjbKJ,Xdf.PecLf?Rc7%#bbfe2Sc-OVX_n*G> %d*O<p;9?r)g=j9abJDQP_83W:1(lQ+'c.\a(`427+=3SL^87[IaKhbC_jdj5Y-+n/X/`2uW=cA=W2?Gm %X/V_`SYW'cQ^=YL"f8,pPGP,TS.MorSsl+DSt;8r-_?s&TV*8's8W"qrs&?"s7c9fr#,G/s8Nu9rr4>n %mHm$ades.Fq>0sbqu$HmT`5,nrVcX:qYL$fs")..,pg.]iRl;qcap^Cgs4Bte^Dmqf%/3ncMl5pcHaef %f(IG_ch5[6eC;mlcdC.hd*TeG^#d\j/hU)Fb0J_p^<t?Lf%.p`^,S(h5!Bl)*;gfY+!i3H.\`ZTX/jOk %\?<!VTs_;8['I!Bql^gE[]QX4Z*CI-Unaog[[itlY,\V+RB*CfU'e?)UnFB[USF;//,l7EUSAn0s8W)C %s4mVsqZ$Tip](0hqZ$R5rr2pF-gg:`daJ'ns7uNfqtp<jrlG,ms!7UBrVZNgq>^IH`l9>P]Aqr+c-=_O %^>\&!f\"p0f@ep5e^W+JfEB^Re_AjOfC[Vdf*'UQda?Gee'lpueBZ%Po&&=i5\8p5jR_upeC;XofuqRV %4ZslU73a*)r[8[6.4d502lWe"ZEi$2^U:JrW4]dT]=PS`\$u=E-,%""Za70O[B-I0Yctg:Up[V8['ZL3 %ZDjk(^T4E6W3E8#T.htuU]R<d*rc0@r;?Qjs02MGqZ$Tip](0hqZ$R5rr2pF-gg:`daJ'ns7uNfqtp<j %rq-6]s1J@5rqu]nqAK2.r"_%CbfnDA[`[%He^)R_aMu<BaiDH?kKEM@rQ5,`rln9_bK8&Td)a;[f@7m_ %h'OJmb/uV#1<.>Phqu?.hT4-n`5KXCd_*E4c+1C/beCj,ZHC=h4$*Zm,U4NU)]KD>'bq8k2)V,9[AK^o %\Z`3<rM]^q"/hohVu<.mVQ$PhSt;[LTTL%kX.5],]=XgR(8d@^Q^8rfo)J^goCr"Ys8V`jrrr#os82fp %oD]'ip]('brVuosr;Q^"o^r._s8Drsr;QWo!;uZmrr2iqrr2iq&H2V-o()hYr#H=[s7Gs`'bq00/bAo< %s7lBhrVcZlrVZZqrM9Gprqu]nq?Qorr>.7Gc-6jK\@Bi8f%JO$c-=JXcHsk^b1b2?c2c2icn3Sic-t.k %bfnhrfZ_Rt.4NTfbr@[?aN2B[iPjp?cIgdmbKSVk_T0^G^VA1Drkf/RcH`OW5Rf1m.4HMb&g/#E)B'A, %4$0@P]<%s0^U:JSrN?.'*3?-=XJ;PbU9(Q%W2-5fVP]]bZ(dtC_83#f)QE\'![dR3rr3&mp\4[es7H<j %"nVcoqu6Tdrs/;ms7uKhs8W)rrr3/oo`"mjrVliprr2p!s8W#ms8N#qs8N#qruV.<rpoX[r;7QH&HDCp %rtQ8#/bAo<s7lBhrVcZlrVZZqrPJTprrW2tr;QO1qu6R31c3M'e@N6<g"G35f?r!me'ljre'Qk!"kD,P %e'lhGed'^SdaQ[pcHcFF#1:i_1,@V;51rCp6J'i>nF4rgjNcH3bKJ2cgW.O^gW%7fgWn0m_qa%Z7n47J %0eb:3-RTup+X%jH6:.lm_R$GL`k8sorO!3G[^NNHYdCF1WN!54[]ca4ri[03\[e]=L<%?8*ZhAOS!fZk %oCN"\rU]dXrr<#jrr32os8Vuqrr;Wj#P[umq>(!hs8Mrqrrr&err<#srr;oqr;Qcpq>^Hnr;Zcqr;Ri: %rr2KZs8;d8&.nm6o`#X@/M6Slr;ZQes8Door;HQn!<)?c\,QO/r;?Qjrqd<M,9st<g""X!`5Kd:`PKC/ %aiXP.!7'rTnB;'Zb0%iJb5TU3b0%f>^<F^@bfn#Veu'rGahGLAfX&rO-b?n:`Pp?MbLY7]Z*DOP`\F9b %Ycu0^^:MP4Z+IWM\@A]EU<1NGa0;eLXHAW"$484-,Qnhs)AsD*&f*VnIBg&QrL="dVP]uW)4mV&WLKKN %Mi5KNVgPeU-(10tV(DWFp$_AKrt+htq#CBgqYL6_o)J^grVc`prs/Q&r:p'ek2uUA#kn5qqZ$Tfo_/:a %s7,+Krr2Zl!:g'g!rDcd')2/#o(),4s8N#fqYL3irVZTlr;QcrV#LMqr;?Qj!rMon(*FkJ^qe^Wf[Im] %c,n)Ja2u]Te^i=$gX#rGrQP>frm3";cHO2Dd*9h^d)XkoW[o^E_84jZ[F3JP]Y)_;bhLRoh;-/]\'k9" %%]ZP:[EQP+^X:H:_83Il,/1FkW6W\]bdOscZBpn9&.gKD.1-t3+<M[A(E>b.K=A=irLt@5X/i(mUoCQ$ %TqnKHOiXW*J@E!9SXl[V0E;(HnaZVY&G5bms8ViiqZ$-Ws8N#rrVlfr#QF`#q"XmOk5>5bpAOsds8V`` %pAY*lnbW:Ms8N#lrrDTgrtYD,p%S4\o(),4s8N#fqYL3irVZTlr;Qcra8b#r!ri,qrq[N0rV[od-,IFR %g=k-#b0eJYbKJ2]e_8d4g=t-XeG[hreGdu,eC;pa_pH`UdaH@shbLL82:p*tkifqCiAf$(ilfO"daHt%bIY::dF$ILZG=9-cd0elho!OV]#DY#]<Bc8VprDn\[e<'4r5"n0ej7`+X\T`*ZcOt8W(6rZ2LXPZ*L[: %X/iJ6\#QL0R@2C-Z\?$'.\E?2V_A&Kp@%JLs8V`dq#CBgqYL6_#4hfnrr)fprr36&rquQds5rJArs8>s %rVHQoo^qkVs8VWKs8N#lrrDTgrtYD,p%S4\o(),4s8N#fqYL3irVZTlr;QcroDc,r!ri,qrqcWk&g&>C %^VAIPe^)1Pai268_8OI;rm(Sin]^=C"j>'2aiV^)bU1KTaM,C4aiVcN`7EM;.4NBQ^=_)Ed*O/O]$\L9 %eB?%df#"\sbl5U:Unk6!a1f:!bfm?(]</TQY-+M@adU8SYcOpgOYI1M.3p/A'bqW))%mPt4["4uZ)%>g %*i,[1T:VXLWMuAYSr8NEVl+pJZ6bp,V55aBrq5aKrr3Q%q"Xmhp\Oado()h[rr)fprr36&rquQds5rJA %rs8>srVHQoo^qkVs8VWKs8N#lrrMZi(]XO3qXsUWs75aHli6t`nbW+]rVcZlrVZZqrhTPrrqu]j)uBF. %r;7Z_,f%4Mf\"Zna3D`Ja2c<Kd+-^ueD&=McMbufcMl0;cHaYO_pHZQd*Theg8Z\TbJD$Kg9oAW.D3=B %bfnhidbWa#\$sfbbR(;L[C+5r_nXUH-age,ZbF/\[&D9qTZjjQZEfg`2@pEQ.4GTB)B^+D(De&X6A)bV %Wr8Y5WiN1sUnjunYG%bfOcd_dXFRdh.%Qp,V_A)Mp[ReQrt+htq#CBgqYL6_o)J^grVc`prs/Q&r:p'e %k2uUA#kn5qqZ$Tfo_/:as7--hjT#5Yp\t6`rr3`0qXsUWs75aHli6t`nbW+]rVcZlrVZZqrlkDqrrW2t %r;QO1qu-I;,pgCDh:gT6b0&,Vc-+;Ue^`C.gY1E4!7^tr!7_"u#Lq8O_o'jIcVr9?bhq<a2)X"1c04B/ %iScc>bMp^ggX=O+h93C@f?r!qZEh9]f?_ddhqu>maL]@0]=Y8seYgp1]t(\FSj!r,2DHou+X&3[-6=3Q %8P+fR^9RX9-F'k^XK/D+\$rB<X-oC%Za5@t].0GFVl)3Irq>gLrr<#jq"Xmh$hsMos75a\rr2lprr2p& %rr2ijq#BL=r;R&rrVcTms7GsWrr<#girB#Wp\t6`rr3`0qXsUWs75aHli6t`nbW+]rVcZlrVZZqrqQNa %s1J@5rqu]nqAK21ru/bkf%/-ea1o^:bfIlD`5Td;b/qcHkK<G>"Ned,aN=G)2Ta(]aN3h]]#)>3f[pt\ %aP4DAdaH=V_ooX&d1[2&b0%rP\^]->c-<NEf#c%MYctIB[^*EQrj<og`N$8N1RGqoVP_YaVl6PsX/ik9 %YH"S$Xf\FKIR"DS+T38d+sA*L*ZcUC(:+jJS=uX7PEW;ET-08YS!s`as7--ho_eXXrVlurrr2?`s8W&r %rs\o+q>^K`s8VfdrpfOWs8V`hrrDKZrrW/sr;?Qsrqu]mr;Zcqq#CB^rr3>to_eahnGiOPs8N0#s6ose %rr)fm!<&Mh!ri,qrqZlss8O(W`7W]Od)jDIbfnGYc,n)McHcF9!7'<CrQI=IcHab\c-+AVo=hrY`mrl" %)9^4[^qeLNcGmlL^:r,9)SXVHe'l+egV;4d\(ocacGm9"\@]A^]tOEW"3\ll\Ho`*S]8[MX4,PsXVJ4I %Ye[ZSYHG%7Z`Ab47MQXb+X&$Rr[/d2,9n]Y*4_f<Vl,ZER'rfd,a=OaSIGPuoDejar;?-arr`,srpK^a %s8Dor%0$8%s8VQfs7Z0cnaZSXs7H6h!:KLZ!<)rqr;Qlur;?Nks8N#ms8VNdrs88hr;Zfds8V<]rrDNe %s8MuqqZ-T-s5X+\rqu]nq@NQ(ruK(tg"FfsbJhcPeBlSAcMuAme_/CSdaHOjdf.`.daHLdbk&WcaN3,q %iZm"(l,t?qhr!)4cdp%QgDLmBdF$Fl_VO%cf@R^qin)f.^V@Y*`ko[4rk]u0d^R$-5GZQKZEi6>['d<R %\$sGk]XP>X]"52*MbP02/LW"r.K1qA.4Qf&,pgC-WiiLkSt<NlW$[grSXg2hs760goDJOWrVlurrr2?` %rrDutrVca)rr2`ns6p!fp@eLUnbrLfo_e^hme$M\rVZTkrr`8ur;HQnrr2]ms6fmd#k[ces8VTgs60F] %!:Tperr)fm!<)-]\,QO/r;?Qj')VY+%*Qi,]Z\[K\]Dk=bfn,Jrl"uX_SX+T`ULhHaSj-ZaSs:#aN2BG %c*ka9iShO%/'5K<\)6)jdD`u>`7!)UrlP]m+2>S>a2c-Cc*>1(Yd",N-bR%%^s($?YHPCCX0JoI^8Ilt %R_lqKYHP%"T;AQfV4s]_W3ES5WW&OrT:_dLU7e0MTc0W(N/Sts((h-$',*#+$5tHH+sJ0.rV?KnqYpNp %l2L\doCN"Wq#1-grr!#tqt^9ln,<7dmJd+lp\4^`q>UBno()e[%dEfbqY^9irVZNgp\"4VrVQZlrqZTk %rVccqoD]!lr:]s^pC6uqr:]jVo_84YrqZBfrVHTnT)Slkr;?Qj!rN#t%h6b,^:qnAe%NrJeBu[gc2Plg %b/hZDgW9WCbKJ&NbPoa*bKJ#Ud_!cKjlO?30$M,H]&M`!eB#VJa48_arm;T1-H='ZcHaS]e$dB?[C+H1 %dDEZ5`R<2V[3)fh]WnoR+2b1]T:a3G\[AiNV5:5sYc=Y#Xf]%@\$,e.,G_-4VPpAhU8FfjP*.76*#BD; %(`5%=%N[8V,U=T6s82irr;Q`rl2L\doCN"Wq#1-grr!#tqt^9ln,<7dmJd+lp\4^`q>UBno()e[#3ksZ %qY^9i#Q=SsqY0[Uqu-EmqYp<jqu-Knrq$.'r;?9aq=ja^r:]jVo_84YrqZBfrVHTn_>iBl!ri,qrq[<* %s8NSScG.-@e^_I\cIgXrdF$;>ciVM<bM1>CdJ_E'dF-IldF$:fdCR]Okig)E1_/'Xai3Z7hVQ]*c-P2# %e,I]S-76aPgsFEnf@R^^cb@-IgY9rpb0\hpd(I$/_mmCn-Hia%VP_\c^q@=jXK8_:\$E3@['[N\^:+$C %,HIlIXfnk/WNE;1S!u/Y,T\!W*Zd9R&g/n`,U=T5rqcWnqYpNpl2L\boCN"W!VlWkr;QWuqtp3hs6opd %!:Bdc$2=2oq>($hs75a[rsn;hq>1$erVcZjqY0[Uqu-EmqYp<jqu-Knrq$.'r;?9aq=ja^r:]jVo_84Y %rqZBfrVHTnmJjKl!ri,qrq[9)rV[/JbIkL2d*T>EaO&/Ta2e1u"2r'n_"#D0`;n!X`rO3[aW&=B`m)c: %aiWN#^FLhV]tLo4hpKij_SX7>d`ML2%Nce-^XL6D`6HQ3_o&^_rlcb&]"5]$bepWf[^N6AYo19RVja'k %_R-MMXIl,]WiDniU8Y#pZEgJ/T`:YaTHBo$TUhdMWJlc\()@Jo+;5DA$47\&/0Z8\rVcQls8)`ps69O_ %"nV?cq"Xgcr;QWuqtp3hs6opd!:Bdc$2=2oq>($hs75a[rsn;hq>1$erVcZjqY0[Uqu-EmqYp<jqu-Kn %rq$-ir"Ar$q>'d]qY^'\o^qnSqYp<dr;HKmrLX#krqu]j'`.\'s8NPPbeCg:e'l"RbLFqec-?72"3S^+ %`nST=bfe2Pb00e/)p?FHdaGbPc/n'(/hYA`^q/ObeC;RY`Q-NZbl6!(-76aPg<S!de'kbIagJP)dF#hG %^EgeHd`Jo)]Y(MX[NEDgXIl-+aLS^dZDFCuYct.+W3*21\$rR?VB_n4VP^;hVP9rbY*+qs*#ob2,o@IT %%LsO50-hees8Vurs8;lrs69O_"nV?cq"Xgcr;QWuqtp3hs6opd!:Bdc$2=2oq>($hs75a[rrMB[%/Kbt %r;HTlqYKsZp&"^c!;c]js82cns8MWi'E%e%q>'d]qY^'\o^qnSqYp<dr;HKmrPnljrrW2tr;QO+qu?[+ %cHa2>d+-[^cHb(leBu[irm1_lcHFtg!7Cbl$dmDNe'ZRhdF#PPckGX,a>>a(aiVNhmG?^Jc-=Sigsc8L %3@6)m`n\qfcI^[]cd0>>g=tB+b0&)ag!ICE_o'!t]dCq/Z_jVGcbR3+\ZDm<\$rZHYI([M^:q&TXWsmI %Xf\e/Xf8G)[@<X@,U=EP.io`k&eZ<A0dJ"grr2cnrqcWos69R`#64;ds7lBfr;?Qm"oJ2ms8VQdrrDHc %rsAGos7uKirr;Q[rr3Jmq>'mbr;HTlqYKsZp&"^c!;c]js82cns8MWi'E%e%q>'d]qY^'\o^qnSqYp<d %r;HKmrUU!Zs1J@5rqu]nq@NPupFA3_\[fo-beM?E`Pf^o_uI[S`W4!@`:_%K`r3jV`r='Z`r<nVa3`2B %[jeMagX+:h!!'sU`ATV(]"5]+e'5S>b/tGL/#:VAaNr27Xh(a@\])O]S"%%)^TFWO^q^PW['[HWZEgR$ %S$B<+V5'fcY-+\#R[9A7Xf_StrhTmpU7nE[X0Jpl4.;VAYD]TfQ)UaM+X%aBnerDt*#p(>)C-jb&.fE] %$TR;2oD&+Yr;66_p%\=[m-Oc0hu3NRq"Xmaq#::#rr2cos6]1>s8Dolrrr>tqtBg[rql`krV-Nmqu$Hm %qu6`srqcTn!;ZWo#Pe)oq>('ap'(Bls82]nrqu`l!<&Mh!ri,qrqZlsq"QC#3P2m4c-FVPcd0bUaiMQF %bKKk.gW'<:rQ,&^rlb>arl>PmeC;+B/@)S<e'fKA!WL.f3]\n-^;SaZe&92Ocl=bpWn>tLe^_"4^p^\d %bKHfWTtnXdZEhBe*5r_m\[fPm\@Ai<TshJ@X/Mu$['Zp9TU_OLZEjJ/8#iSiW2QSnWj&tAQ_:"Z[?.c& %RB<T],paQPoc+r(*ZcLD)C-jb&.fE]$TR;2oD&+Yr;66_p%\=[m-Oc0hu3NRq"Xmaq#::#rr2cos6]1> %s8DolrrDs"qtp*^q#:0jq>L'kqtp<jrql]srr2cmrrDlorsebus7uKjp@eF^s82]nrqu`l!<'S1j8T2[ %r;?Qj&Gu;!/il&+][+sO`R3)Xbfp(2"jkWDdaHOtbluJ?cd'h^rm;>(ccsMNbLY7X]ed40kM=rF$NLS6 %cU9oZ0ttB?gt^K#`m`BY1c2Ajgsb!2\[f_m]Z&=IY,J;>bfmZ0b08'NYe\&qaM5L#W2RDF^p:/I\%B8Z %[&9[oXgu"AYVNJgZELI6Z*CdR^n@X)]Y'QA\t-+2SgPm+*VC?j/K5WO)B'kP/.`@)$O\rVk4ABCr"T)+ %p\4@Uq#'LFs52`4rVuZfs7lBgrsJc)qZ$T_m-OcNrV?Hsr;6Bbq"Xjcs7uWg"T/)orr2fp!ri2qrVlln %rr3H&q#C0cs7Z0ar;ZZks8MrpqZ-TYs0r"0rqu]nq@NPupFA3_\[fo-beM?E`Pf^o_uI[S`W4!E`:1\F %`r3jV`r='Z`r<nVa3`2B[jeMagX+:h!!'sU`ATV(]"5]+e'5S>b/tGL/#:VAaNr27Xh(a@\])O]S"%%) %^TFWO^q^PW['[HWZEgR$S$B<+V5'fcY-+\#R[9A7Xf_StrhT^kU7nDKV5pl+Od_`BYD]TfQ)UaM+X%aB %nerDt*#p(>)C-jb&.fE]$TR;2oD&+Yr;66_p%\=[m-Oc0hu3NRq"Xmaq#::#rr2cos6]1>s8Dolrrr>t %qtBg[rql`krV-Nmqu$Hmqu6`srqcTn!;ZWo!r2Qj$MjMtp@eF^s82]nrqu`l!<&Mh!ri,qrqZ]nq"PIQ %3B=^`c-FVPcd0bUaiMQFbKKk.gW'<:rQ,&^rlb>arl>PmeC;+B/@)S<e'fKA!WL.a3]\n-^;SaZe&92O %cl=bpWn>tLe^_"4^p^\dbKHfWTtnVj`Nlee`PiXl\[fPm\@Ai<TshJ@X/Mu$['Zp9TU_OLZEjJ/8#iSi %W2QSnWj&tAQ_:"Z[?.c&RB<T],paQPoc+r(*ZcLD)C-jb&.fE]$TR;2oD&+Yr;66_p%\=[m-Oc0hu3NR %q"Xmaq#::#rr2cos6]1>s8Dops8Ds$r;6Bbq"Xjcs7uWg"T/)orr2fp!ri2qrVllnrr3H&q#C0cs7Z0a %r;ZZks8MrpqZ-T2s5*bWrqu]nq@NQ"q(=]h]Y)S;d)FD[c-4E2bluJ@dF-IjgW]oKcd0n^ci2<#cd0kV %a33&b]tH54\HV0Ph(/pArm*tq4Ya[b`8'/!`l?KV+#GgWgt^B4g:=c6]Y)53d]TOIa3;c=]#r7@*jEGq %aN2-2\YuI?^qd7ZYID-U['Za+UTM);riduZZ*LR:Xg,.?^qcVAW4]d/]"4H;Z(<<j*?Fel)_E!J+;u.D %/1_>D&ISt+jr*=Qq"XdbqtKjXq"XdRm/Pu#rVcckq#C-arr3?)rqcZpmHj3>rVcQl"oS8ppA"F^qu?Kj %p]UKkr;Q]mrrW3!qYgEoq>UC'q"Xmbq>^0^r;?Tlqu?ZnrVHTnmJjKl!ri,qrqcWk$PWsVh;,uSZHg>( %_>V7M_Z7XC`TkG@_uRdU``0pr_ns:PX/d^"]#;P0\$n?)[F<S]WiEu],0HUQ`QlcUd'gj0jphkSZEgpI %g<.RIYcuQtaj@rCUnkT-Z5gHVX/)PTPIms!YHY7:Yct.)VPpHmX958gS=fbQ+eP?tSY)OJUnj9ISsl+M %NfL*7Uk(0P.kCW!s7QElrUfa[ru:q:s5l:#)'L.N-RKrY*?l[V)]L*qo`+sZqYL3k&Es,ms8Vcdp](0h %oD/4YqtpBj%/]quq>'d]qYgBlrVcWi!rMrpr;Zcq#64PrqtpEd!;6?U#lXf'nF,i9nbE+`!r2QhrVHTn %T)Solr;?C#qYL*fr=o_LhVQ8[[F4um"NSR(b0'_,!6j3>!6G,Z!6G/^1W[YWa2dGKYV%QAa2cH9\i[C1 %f%)d_Y/ht<c_m\beC<(#]ZJ:^'GNF7\@fK4d*TJ7[O0YQcdp1YWN!YA[irPlZ)O^jRDH59['mEQ[^NE@ %X0&M0Z*C:%U&1Z&Unjc]Uo(/lS"ujQTX'cFY,J:Q1G^X9rr2umrr<#jr;R`7s8V4@3#Nk_-RU5`+<;XM %.2s3Po^r1`meZeZrs\,jrr<#kp\4^cr:B^dq>1!crqm3%qtg-ap\OabrVlcoqt^BkrVcZorr*0&qYL*d %s7Q'akm77fs7#LGnaZDRrrVujrVcTnrPnljrrW2tr;QO.qu6R2%M%FTa1&P.aN2KGb08)Scd0u;dFunE %blH&gcNhb@bf7ZdZEd@^0Z;8^f>GKp_84s`5I%K:-R[6>WQs,Ig"F-abjZGd3PE,B_<'8!_n<Y=f%/[' %c`jXn^:l#9\@AfKTV0B;]">Yh^V.=iZEgjE\[]/SW2T]s)Qg-CX/i8%XKJn9UT:GoW48:bZE1-_2)R!= %rr3/prr2ifo_e_.rVuo[3&hd!+X\Wa+<V[K+t4HM-1pj0s6fa[rr3Pnrr2rtp%S4\r;?0^q>1!crqm3% %qtg-ap\OabrVlcoqt^BkrVcZorr*0&qYL*ds7Q'akm77fs7#LGnaZDRrrVujrVcTnrUU!Zs1J@5rqu]n %q@NPtp+$jm`Pp!;_q;9#`5T^p_udck_#D+3`V%1R`5BL0_ScAl.)Ws=`Pni00"8=8`5KhN/Y(n_]tFE` %_pY3N.coct_83UifrV9[`Pqhf/jDRpXf]dEVoPm?Y,SD,Zbi]@'<Am_[^NNKWM#ogXK8+iU8FrjWMu\f %U8=igrhTFd"ehW^XK7U"Y-+UtNkW5uS!u9rO!Z4Pn*g8Mp\t18nc/Xgrq?*\nc/X]q>(!fr:fsYq"Xdd %rp;9h()A>D,Q8Gd-:1$,$Rm2@o)Ja^rr)lrq>V$'rVccrrr)fnrVc`kq>1'gr;QitrVc`q"TA<!r;?Qo %"o.ulp&G%$s8Vchqt9CFrr)fnr;HQn!</eo!ri,qrqZlsp\-3S(<4>tc,IZW[^Q1W"Nnm/a2e.ugW9H9 %rPeiXrlHS/a2Q0BY;.lF]@"[>c7grEkNBXr!6<.2V55j2laY!U]tN=/ZFJ*$rkK+77B!T#d]TatZ*C[= %Y.;*`Y7@`RZ,FSm]=>ARVP^f,Z2UX.XK\q3Y,\G!X0/W)WWK0!W;`b7Vl->rZC/),X/hK&_kE]p3KoXT %.0&i-s7uKirugk3s8N#kp\44Xs7H-_rVcZgp\"=Vr;Q]_/M._R.3g):((2HU644/M+<^7Ts7H<hs8Moq %'*&"/rVccrrr)fnrVc`kq>1'gr;QitrVc`q"TA<!r;?Qo"8Mcjp&4mup&"XZmdC)QrVZTlr;Qcr_Z/Zr %!ri,qrq[9)q"QEX(rs\Ba2d&I\]i=CcHcF6rQEs@"jP98bKJ00c4S:EbK.c,2)W(\fZqdp3]a81(@fDa %#04d8U7s4-n%?ie_850?[_0r4rkopM8?B;0eZlC+\[f>[[D9T([^I<gbfmr@^V@4ZXhD6SriQU7\$rcQ %Z*1@:[^Q1?!jJo4ridrVY,f.FU:\%DZ^T"XV50nKQ'EaGs7#OWp\4[es7--hrr2Wcp[S:`o_J=]&cMY% %p\"=Vr;Q]_/M._R.3g):((2HU644/M+<^7Ts7H<hs8Mio&GuG)s8W)srVZWmrqZBdrVcZo!ri/srr3-" %rVufnrr3)qqtp'brsSMsqt9CFrr)fnr;HQn!<2Ed\,QO/r;?Qj&Gu1p.hrf<`QH*9fWqg$`Pqhp!l;^g %rkIg=nAPRL_o'@._u@V'_o'=0`MtOC\$sZ$`60_aSE/bE]`>sfd\*6_jlNea_7-o,XK8\G`W!G$5<kmE %XimW?a/lAFWN!51_PsLJX1uEX[^3<>TV/NjXJ)A_VQ-YqWMH8_V5^HnV#-neTc'PrXK7VgY,.tT^:p/%Rl-7f-78][n,E(Urr4,2s8W)tp@n=Os8V`eq>L9ip\4@Uq#(-jm4Bn*(+CIQrY>kg6:)%f.3Kc(s8V`j %rVulmrt,)+rVuosrVcZmrVlWgqYgBjrrW2urVlg"rVccor;Q]rp]C?ip&4mup&"XZmdC)QrVZTlr;Qcr %V#LMqr;?Qj!rM`d$7lr.`l?9B`S@o1rlG;cb/q]ErPmU6!6>&X!6>)\.*'BIaiU_A1:t0Ga2cIZ0V@Ok %^q]rja4@)`0C.r6a2bm,hm0PtbKKn#$q3U`['\8aY0F5V[&t(F\[fbaY8OU``4NXk\?;^+[^!+:V[BN0 %Ycb./W2Qc"Y5YF&WMuiqW>_\4Up@:o['Zm7Pf(D4T:\--P:.jZnaZYTq>UC:nc/Xgrq?*\nc/X]q>(!f %r:fsYq"Xddrp;9h()A>D,Q8Gd-:1$,$Rm2@o)Ja^rquotrr;ip&GuG)s8W)srVZWmrqZBdrVcZo!ri/s %rr3-"rVufnrr3)qqtp'brsSMsqt9CFrr)fnr;HQn!<1%=hZ!ZVr;?Qj')VJ!/Jo>Fa3M`GhRU2@c-=PZ %rltDbgWfuIbfn8Rc2Pusbfn8OaK7<W]tN(Dc5YCs3iVZ>`l85'a4?uZ/FW&?bKI`<j0lD/cd2U/+@o&) %\$snmZ-^%l]=#&^^sBHt+LoY>_SX(&[]Q[F\@DO@$F@4N[C*9CYHkUFrilO/Ycn&1-a'VQ]"4WJ]<ei4 %aiUBTUcXj,-n,,bnG`1Vrr<#gs8W)tp@n=OrtbY,q>(!fr:fsYq"Xddrp;9h()A>D,Q8Gd-:1$,$Rm2@ %o)Ja^rr)lrq>V$'rVccrrr)fnrVc`kq>1'gr;QitrVc`q"TA<!r;?Qo"8Mcjp&4mup&"XZmdC)QrVZTl %r;QcroDc,r!ri,qrq[3'o^qQ/270a;^qd_/beV*4rkefR_8-&dn\aY0rPDLN`5KX4_njF8aWVh=]"d7a %Z4do#ZEhTo1ss^Mmd:^s\%p#']=Z2-b.c<PZe=$(T?\;lXQ8H3[^ODg[^<EH]Y#ns^V?8-]tLDNZEpI, %ZDsr(WW&h&Vl-DgV50l]U7rg)USFWWT:(q.Y*YKJTVma-W107iR@+Bhq#CBes8Vrip\t1(p\4^bqtL!b %rVlfrs8Muqqu6Ers8VWhs7lBgrrE&ts8UmRrrr)g/-cD+rZ;"["X#!5,UFc7rX8Z#qYU9ks7lBcrVcZo %$3'o%oDej_o_\RlrUnt$s8)TlrU0gfqtp?l"TA;sr;HQn!<&_n"9/5rq?m)qqt9XN2E&"Pdf.,ecd0SM %`r='W`rO38`WaE&`l5p:rl?n8`l--Hc6amP^;B!n[2'P/['\*&2qHQ_oCEd3]uJ:?_84IEd)FYi\_l;@ %V:6S/ZKg]mTtJ%d]Y(he[_fm=Y/SARTu4dO\$roLXLJ,2"Kno0XK;E%!ii6!rhoap*MoU)R[UUSSYi9c %Occ`;T,*ug$k3"4s7cQnr:fsbrt+r!s82]fqtp?krr<#trVcWmq?I!"nc/Xaq#:9nrr2rth#@<Xp%9j@ %#:1Gk*rR/a+<i!T,piKg$iKktqu6Tpq"X^arVZ[-rr)fes8V``qu-Kdgt_r+qZ$N_!rr/prVm$!rVZTl %r;Qcqbl?Ar!ri,qrqZotp@du72n-9Grl#)id`BSRbfp(2rlbAeg<BN=!6kGf#L(E7bKJ-Y-qD(gb3eT2 %+X,dX^=1Oof%."mmh<ORbL+_W`m`GeakY[bj5[):fHMNJmHp^e_qDrF_83h,aZQuTbc%J_b-o("^pLJ_ %\$u@F"LYYEZa9Y:!jSu6riZ7)*NZ?>U8#;rUopl+Q^=tQU_o_r%1W16s7QBjqY0a`s8Vg's82]fqtp?k %rr<#trVcWmq?I!"nc/Xaq#:9nrr2rth#@<Wp%9j@#:9?jr>u1c+sJ9Y-2d`Mr;-9err2rmq"jsfr;RB. %rVc?fs7Gs\rVcEEh#I6Is8DBfs82]lrri<!r;?NkrrE#ms763+rrE&srrW2squ6C4qYpKo)&^]D^:h5%^:qD%`PKC+aN1I*b/;'3_nj1g]`c0f_nj1]_">E5aiVB8]@PQ'f%.gbbnnOF_SW[p^X4)Dc+CU,`?Dt0 %_nNi6b0%<CdC-Kqd*Sr9a3;!#bfn8?\AY5?.D<Em\@A`G^9b/4b4r(BXK/D%Vl0Hk"/hulV#I.hV#I%d %W;`LmS"$;gVl-Z!U5OrCQ^8qmUa%,_s8W)qrsAZ&qtp3`p\"1NrqZQis82fn#lXSpqYU0fr;QHj#6+T" %r;6Bfo_SV.r>P_YrZ_^h*#:.Z)`0DBo)AXhg%t^Vp\ashlK\E9m-jW?%K$&%s8W)srV$9kr;?9fs8VQe %rrE#rrrDl"rrE&srrW2squ6BkqYpNp)ZS(u_8!b7_SX76b/_QBcH``Bd)sAJaN)@#_ZIm!aQ:E1cHaJN %^t[V<gt^*#d2^HW`l>O+_q$%WdD*H<aX+g@a25\Gd*TS[f=\c4e^_%NbgF)9daHOV]um@T0>bT-^:pt] %`45r[SC%5?r3HL2Z*CP0XTPZ*X/c/u"KJJuV5F6ori#jgri-O6Yb[;>^6k95Unf1YrVuorqu7!$rVQKf %p\4@Qo`"[cqZ$Hlr!<8sq>1!cr;?Qgrs&K$rVZQiqY'dfqthB3)ZUuZ,7,>0(+q3Y1c4dorr2uOqYqH%r;?T[lMp5;n+HANqu6Wqrr)fhs8W#ppAY*ln,E=erVc`rq9&a$rrE&srrW2squ6BkqYpL5)]R,L_SO(? %`5K^@c-+;Qe'keWf$DUccd'i8ao]l6cfNChf%/-laPu3Yj5\S;e/m#baN1s3`RlI_e%m`SbKD9O`6#s9 %0\=pshVQ/faP>R_e'm!f_qE_q`5L'.Yr9_GZc0nq]?A"*UY!&eqRQd>\@B$IZj4"H['[0FZEaD5s0;R* %!k#GCriZp7X1,OG]Y(G8R)bkm.]]Ts-MRNHrVcWjq=jXVo^r.Y!;c`ls82fn#lXSpqYU0fr;QHj#6+T" %r;6Bfo_SV.r>P_YrZ_^h*#:.Z)`0DBo)AXhg%t^dp\ashlK\E9m-jW?qtpBms8MuqpAb0jr:^-is6ose %!<)lr!;Z?g]`/!2rVlruqtpBg*r>m8rtu^!c+^m)dD!?1`Po[0^rXTub0%W<_8F+*rk/HN_8F+*q7uI7 %8BJui_7S:LSCZ91c-7'Ib/2$&^VA/;*mM=/`Pj"7^;I\!.E]fEdF#D2]?np-a2cE4[`lt=\@BJRV('*k %Vms7?YJ.?LQcf**"g"c*Wi)cmVurroV54*cs.oXerhogks.]O_rhg=0XeL`3]pG'1Unf4[rVuosqu7!$ %rVQKfp\4@Qo`"[cqZ$Hlr!<8sq>1!cr;?Qgrs&K$rVZQiqXjXb*;pfV+9!Jk*#o_H/fQW(o()e[!875K %#5A&ns6AnL'("uRp%A4Zrr<#trVcHis8;fgrr<#err2usrVllnZ2Xh'rVlruqtpBg!rDrs)ugfpcHa8@ %^XU-;`6-6Ca2ZEMZI$t@`l?*?a8WsXa2c9_`^%hpa2c!MgS3KYbL+]WcHaGL\AQ58,9tUN^WFSD_SX@1 %_Cj3^^t72N]YW.K[*6bA]Y)\@dCm69Wi@_h_Q:HV^9k8c\[e6WrNc@-"1#2:YkkI(XK/D%ri$%#WhlPh %riQ0us.94i&?rC7NfLi@QmAK'+sR!cs8Dip$2si"qt^!\p%7nUq>U6jqu6L!rV?9cqtp<hrqHEsrr)fn %qtp6eqtg0i*;pfV+9!Jk*#o_H/fQW(o()e[!875K)>F(,s6AnLm-O36p&"Xcs8W)srV$9kr;?9fs8VQe %rrE#rrrDl@s5X+Zrr)iurqlTlq#L9jru)gqcd0JE_:QWDa3DlPbKA;_\(9-Vc-=S[cMkrfcHabtbnSa[ %cHaMjii1tudaZbfdF$%V]#DWGfHhim_84=<-cEsF`5F@]f>lb)_o'RNgq2%afu(_\g"=6]dBTr7aiUm. %`Oib*^qc_s\[hRJ"1bqO\,N`>[C*BKZa-mArilF-riH70[C#q:&Z_tA[^Ni]YF(]tTV*d8X!T1frs8T% %qtp3`p\".Yo`"[cqZ$Hlr!<8sq>1!cr;?Qgrs&K$rVZQiqXjXb*;pfV+9!Jk*#o_H/fQW(o()e[!875K %)>F(,s6AnLm-O36p&"Xcs8W)srV$9kr;?9fs8VQerrE#rrrDlls0r".rr)iurqlTlq$$WorotICrk0&Z %]YVM'a/uJ[_8F@8^r=9u^V@Y%_>_.O_84"'^])%D_">B5\[Jrb`50'tcaC0j*ZhniVTmB=Za7dl)7@N* %dErcVcbQ`f*43)k_84ID^UCT"\@Afgc(UiEaN1@$a1f-r-lO#C`LsoX[AEZ#"0AQ(WrB!rVuWapV?Wln %VkTodX!ss.OHliGXeqthNfL->TshCa1,>/pW?`baqtp$cs8;osrr)fnr;-3`rqH3crqd#sq"ad_qtp<i %rVlfos8N!"r;6Bfo_\^grVZWo(B4=.qYL3WlQd_p!s;+5)AsJ5'br_@$P=<Ws75gSpA4XarVlg%rVZTW %qtoaHrr38ts8Vops7,^Prr3&qq=M&o!<2rs"9/2pq&T;,qZ$T^*Zi&0^q[Y'a2cE/Z,Xf*cHaJSbdk^3 %rl>#Url>&Xou?XC4MJJ@aiVT>_:?-.^*4c8WiFIoh7'l=*?D]6bLY5`e'l:BZQQijb/_QQe]#26ftG)%e'k4m_Tg?.bfgL6^V;BD+Nhj'_o''drNc@-"1#2:Yl:j+Y5bX'XT#7QXf&)$YcO.VR]s$&WMu_VOfba\ %\@@;M1RG,A,UE0]qXaaequ?]qrVcZlqY9jbp\=[cq[*&mq>0sbqu$Ekrr2iqrr*&uqtp6fp&"ghrVZWo %,6%T:qYL3WlQd_p!s;+5)AsJ5'br_@&K:]Lo(;SJqYL0hrr36%r;>dUqs<\Krs8>us7u]pnalAOrrW#l %o[j-"rrE&srrW2squ6C4qZ$T_+!884_SO(0aiVl:[EHb<e'lOgdD!iKcd'i8b66,9ccjW+c1K3k`P]U@ %dE]hSgqghG,UC4-X?+hZi46DF+!8/@cIgbif%.mL[3EH'dE^%mgs![Ri5ERIg=i^4b1+qLe'lL\a#,4l %daG8?b/(Bo\b`l>\[]/YrjMj7s0Vd3rj"&]Y-,7CZ^mY]\$rrV[BZ9n\[ei[_iHoBSZo=H./a&Bp&G'j %s8W)srVZQpqY9jbp\=[cq[*&mq>0sbqu$Ekrr2iqrr*#tqtp6^quH`pr;HX>rr2]hqYogH,U=<2"%aCL %)&jM0'fcj<)ZTj.o^qkRqYgBlrs/N#r94%Tm-O`O#kn;uq>^KboCMt]!;QZko^r1"rrE&ss!7U@qt^*b %qt9X^(De2:bg"DK^V@Y#^X(6.\@BDb\&Z1q^qmkd^')9g^qIGS^Au+C_+DGbb/M?!_SXR.\KS8am'O.2 %\us)o[EZr'cHa&6&APuo,9tOUaMG?p^:qLo\$jB!-RL/O&0NDN\%KAP]"5eXW4',nUSGB<poOn)X/i8! %W2HJgUnn!brhL$oXf\=lS?/ffQ'J/3Qb3j+VML&.Pa"%fOf=e<+!:+RrrV9Bs8;itrVcZnqu?NjrrW2u %rVl`lqu$BkrVQTurr2lor;6-b%K#qqp\4L]r;HKgpAOshqu$Hqr:fs`rs%fhs8*l[+oWS`+T<Jj+!2OE %*BE]]s8V?_rrhrbs8;forri#frVlf&rrE&srseu)qt^*bqtBa`(`4D>rm).p_SX=1_pm2B^:q_&^!4F2 %rl4rUrl4uTou6OB/'lPbbHK".d_EOD[^P\8\A#\_bKIHDd14UQ^V:K#_nmcKe'?7Y]tMA&ao8pgcH\!l %.i&mI/hXfQ_61ShaKD\X]0*%oWP6ORZM_$:ZE^[=Y-+n-X/W(sri%$?WhH`(Vl-5oZDsC`WLB9jWMtf6 %XHo/1P*2f5RN<OArr3&[j8]&V!r`)qrql`lr;QitrVc`nqtp<hrr)`o"oeN"r;?Hcr=Al*qtTs\p\Fab %rVHBarVc`mr;Qirp\4Uc#4)<hq]?n'rZD%\$6L?2*?@02o)JaSrr3,moDeadrr3,op&4mhbl?o,!<2rs %%K?8%q>0sbp\4\+)BpC)d1aR>`QH6Ag"EjP_p6-9d`T_WcHcF4"O><;b0'D$o?A0(f$`!Tcd1=b`\+d2 %o=MWN_6qS6][YFBeHj^B_A:/2`@<A:eHO7:`66?Nrkf]*eMK$:*??^h28dMV[E$>6[C*lg6a3f7dCHga %\d5jV\@8lR['I"7YTU3UW4BIAY,JnAZ(dtsVl.bG[$R,fTV+K;R]iBW+sQa[rrV9Bs8;itrVcZnqu?Nk %rr`<#rVc`nqtp<hrr)`o"oeN"r;?Har=/Z!q"OOYr;?NiqY'mdrqlWn!rVfer;Ques8Vs<+!LV*r#c=g %+!)FC3V)b@s69O_"S;6br;?Qo"SMHdrr2]m]`/!2rVn/Bqtp3cqYTsYrtcIo+O&*T_8!b%^VA+@XgkmX %\$sDk]thJ#rk8NO_8*atq7lmCoYF,7b0%]BWPZNs\[`lhZL"s*]"5&ba0j1:$I6r/]+D`l^*=lKaN23, %\%]So\$rfea<r;]&.fs5.CZt&W4KRXW2R/52l!.Y`;$GAXK/D%W2QVjV50pdU].%qS?8ofU7A<dUm2XZ %UmIF\VP]0*Wg&`*OccW3RNEXCrr3&\jT#/W!r`)qrql`lr;QitrVc`nqtp<hrr)`o"oeN"r;?Har=/Z! %q"OOYr;?NiqY'mdrqlWn!rVfer;Ques8Vs<+!LV*r#c=g+!)FC3V)b@s69O_"S;6br;?Qo"SMHdrr08( %!<2rs#la_uq>0sbp@\Xh(`4D>rm).p_SX=1_pm2B^:q_&^!4F2rl4rUrl4uTou6OB/'lPbbHK".d_EOD %[^P\8\A#\_bKIHDd14UQ^V:K#_nmcKe'?7Y]tMA&ao8pbcH\!l.i&mI/hXfQ_61ShaK>cN]=U2)WP6OR %ZM_$:ZE^[=Y-+n-X/W(sri%$?WhH`(Vl-5oZDsC`WLB9jWMtf6XHo/1P*2f5RN<OArr3&[j8]&V!r`)q %rql`lr;QitrVc`nqtp<hrr)`o"oeN"r;?HhrVHI%qtTs\p\FabrVHBarVc`mr;Qirp\4Uc#4)<hq]?n' %rZD%\$6L?2*?@02o)JaSrr3,moDeadrr3,op&4mhdJr8,!<2rs%K?8%q>0sbp\4\+)BpC)d1aR>`QH6A %g"EjP_p6-9d`T_WcHcF4"O><;b0'D$o?A!#f$`!Tcd1=b`\+d2o=MWN_6qS6%D:3?&Co=J_A:/2`@<A: %eHO7:`66?Nrkf]*eMK$:*??^h28dMV[E$>6[C*lg6a3f7dCHga\d5jV\@8lR['I"7YTU3UW4BIAY,JnA %Z(dtsVl.bG[$R,fTV+K;R]iBW+sQa[rrV9Bs8;itrVcZnqZ-HmqY^?prr)fpr;6Bhr;QZlrrrE$rVZTj %o_f6rq"XUXq>C0hqYKparVl]lrrW,mp\b$qli7"^+!2[*+8d5g+!2OE*BE]]s8V?_rrhrbs8;forri#f %rVlfps0r".rr)jBrqu]jqtp<]na6AV'bqt-^:h%d`jiOo^q[q1_6'iH]=Yhn_#D%N^qd^s]DfP>^@]/\ %Z)=M1\]D+`\2ZIU^V?PS\_PuSbKIHCd(CVL*Zk;"-nN6P[]6@E_o&X[`o#[iW2Lg[*[N*\_83Fo_S`mn %ZFd``^S.Br6CmnR!j&H'ri-+"VP^/brhB^pVP^_eQ^jQbU6Ce7Z*BgpUm%LGUSG"6*fZkeW#d#[s6][Z %rr2uoo`"[drVlHh!<2or!ri2trqu<drr2fp#Q+DurVccro`"jrr;?Nkr;ZfrrrN/nrqu]o!ri2tr;7&p %-70KD/J]*P*ZbhS4P9W4"o@rds7uK!rrE&srr`8ur;$ctqu$'Wmf3;&(+&sq'"km#]Y)5&`6HQJ['[E[ %^r474rknrZ`l,[.kenLMXf]@QcFLL"4[$Ep_l(2]i8DJucb7iX^aLTT,5rYf0ZM,DYHRrH'"#$ijQ+@a %XsG>=.Om$ja1011%*?5t\&#o!`2BQ48>?'gr3HI1Z*F;4/$>qRWMuhqWN3,%\Xf:bTr4<HVREq-W2Q#X %Uo1,q+<Z]>UT#=Ws8VK^q>UBoq"4R]s8DrhrrE&rrrW3!rVl]ps763hrql^#qtpElrVuoirr3?'r;HQk %s8W)us7ZHir;Qitrr)cm%e1km()AJ;(+UFI%m2u,rVm&tp@eO^q:Yf)rrE&ss!7UAr;-<fr:KXMs8NlO %-c3a<^VA(/^WO^?daHCN\\Q8+bK\<2b66)7bK%Zeb7M@o[)U,9^qdoW7)Hp^WPH:Xj5\,,d_FDc_^[,] %,lStk1<@PM\$u@_+hPA8lg)j([4EgY0ekN1cG.ZMd)Eu<aN2TLY-5$)WO]S9\cTFP\Girf[Bm3DYck:8 %ZEpmQUnjuhY+VGj]tLDP[%ae/ZEh(l.[I-9Y9bLps7#p_rr2uoqYpBkq>^Emo`"pjr;Qitrr)ionc/Uf %qu6ouqu?Wns8V`jrsJ]%rVZTns8N&upAY!frrW3!rVZR'nKoRu(+g:;.io`B4?V9prrMui"8;cjq=aj) %rrE&ss!7UAr;-<fr:0=Es8NfK,JLn*\@BPg\A5npa2c#uXgG^P^VIYa^')6e^Uq,N^&Yq@^E'SWVn'@Z %Za7/$346N9UUdqjgqLtT\^8^9,U=EPrYm7:_SWa]WkuZkY-,e%hnc7i+<DRM,q-UGZGOJr\@AiV]>)+S %U7suFpoOV!X/l6""K82pUnn!b&Z)A%[$R,LS>)42Ts:kmUnj1dTqS6VY9"aETqSD+*rl9-qYL3k!;Z9d %q>^Emo`"pjr;Qitrr)ionc/Ufqu6ouqu?Wns8V`jrsJ]%rVZTns8N&upAY!frrW3!rVZR'nKoRu(+g:; %.io`B4?V9prrr8mpAasa[f6@,rVm?+r;?Egqu$'Wmf3;&('#Z[^_4;mbIkL,`Pg$GaL&=c^qdn.`r<mZ %`l>s4_!&]W[]Q[H^WsC#^-+Wk_o&Cc^#7hccd0;SeA*I\+sR"."Yds9]!&=:a;hRobiIj*Y-'&r,Ut8q %a2b^1a2u'0\&#o!`2BO8W(<Z]ZM_$1ZE^\6YUclWX/W(sWMur"XLXmmTqSBPRARF$U8Y#VUnjodYok0L %USFe1+92B.q>($i!;Q3cq>^Emo`"pjr;Qitrr)iopAb'jrr2fp#Q+DurVccro`"jtr;?Nkr;Zfrs8Vfl %r;?Qrrr2lor!r6D-5I@K()ADA*Y1@qf_tgRqY'X_q>&A:kl1Y^rVn/Br;?Egqu$*Yn,ND((FR):_nWt3 %^V@q6aO8M]\[fMra32`PrlYGhc-+/JkfXmX['[ime\Ju>6q"o2`MpYgj5\,,d_FDc_^Y^;,UE@5"Z"0? %]skKMcQTp4e*H>F[C%P9.krb8cHa2McHsPL^<"C>bc\.Q:T:n8qRQa=\@DOI/%)^iYct=8Yd1UA^ndd* %WNMneY._NJ['ZR3Yd1RH.OpabX03fqs8VTcqu6Tqq=O[bs8Durrq-3jrquctrr2lqr:0gdrql^#qtpEl %rVuoirr3?'r;HQks8W)us7ZHir;Qitrr)cm%e1km()AJ;(+UFI%m2u,rVm&tp@eO^q>:3)rrE&srrW2t %r;QQnrVlg8oCF1O_AX?)^V@h$]=GJu[C)jE]tq7i]t_>]]`c*b]t(]L^&>Y:\k1Yq`Nc\e[^I-UX00q# %^Uh#"bI4XZ]>qsq\@A0'/^DY/aN233^;mF\`Po0`WiIKp+q"bn'ca]lbc.SV_83=n`3m"[_SVA\poPI9 %X/i8'Y,nV%Vl-DiVl6VqNi]=\W1^5nSs((VXK/D#SXm3t&"T8pP*2FQ(B+43n*g8Us8)Tkqu6Zql2Lb_ %qYpQprr)Be"TJE!rr2fp!qZBhrr3>hkjSQOrqu]os8)Wmo`#!fhr"G5'(>;hqYL6Hg]-a2p%A@^qu?Eb %[f6@,rVlrur;?Qk!r`0!)uoR&,UC;J*5BD/bJ1g+^=9d,X2Mrt^V@\*`W!aX`Poa0^\,J9^Hpi%bI=t( %]Y#AkYdE$6_nNk2capKj^WXg,]Y(#71"+L?bfn&D_p,Tsb0%5uYd#c3-P-h.)^;u/d]Taka2bU1#KjWh %\]DjWf);oPZSf%nZ*:R@ZELI6XfSY,Y-5$mZ*CF5V6R;$R@1=_Y,n:h\[`<FTWjWDTGJFCrVu<RrVuon %qYpBl!<26_!<2ip!<2urqu?Ej"TJE!rr2fp!qZBhrr3>hkjSQOrqu]os8)0`!r1[1rr3W"n,N7\s4c<. %n*frBs82]np\32;j8T,YrVlrur;?Qk!<)os$MF'=-H7)J_8XC>rPK#r^qd1raj%iFb08*/aoor4b/VHo %an3UgkgInn^='p:-b-[ug=jT`_:$cF\@=*-cH`o7^o+(ef%-J>ccF8Oe@`HBd_E9#\26#p(De8>.E'0X %[^OB)cFhQPrkScac^`h%\b`lg\[]/Y]=YV^[^<EJ['[6L[[O_9['ZpE\>u9q\@K/ZX/j.U)QB^FR[U#l %*<-!<n,E=eq>1*grrN0!l2Lb_qYpQprr)Be"TJE!rr2fp!qZBhrr3>hkjSQOrqu]os8)0`!r1[1rr3Z# %n,N7\s4c<.n*frBs82]np\4]srrE&rs8W&sr#>Y/pAa@?2`JLa]EU;RQ/U].Z_P@Qbf%H:\[h^Qrk&0C %s1/-Alb#f`VP_S]^;7W9ZEhH^]WT5m]Y(?-jgM.fc+^pMi!Hm%aKVnY`PolrW5$*K1G^kq[E#PW*?Dr& %[(aGq\\c4tSt<j;]Xte]]D/K6XK/D%WMuhnVYd.nV59cKQ)U_uZ_!b]WiDJOPc0=k()Ep9QD:msQ7+0\ %mem(dr;HTlrql`nrqQNdrqZTnroO._qYL6lq>UEor;Q]uo^r1W"SVleoDegdr;$?gs82fq"m4t6s8W#r %rri5rs8)TkrrVHLq6^/%rquctrVcX:r;?Qhq#BXE3B=sk^C!%aRH<P@\Z!Qhe'#qU^V@Y'_u@FS_o'@+ %^\,G8_E=ctX3o>4a2]pE\BD\'ZH:5(^p*(f\ui*^_SYBp%(j-q['[KhbK[/k`5Jr@3'"R]c*t/+,0%4* %`6$+0^<"C5Unl,S_SO'u_>U\;ZO4"CZ*:F8Y,n_)WrAt=WiN1qR[UF`\>5ptYHORbQ`Gt")&]NDRA@=$ %QROB_mem(dqu-Kkrql`nrqQNdrqZTnrW)u\rri2ps8Voos8W#rrs88hs7Z0doCN"]qY^0gqZ$HlrrqQI %m/R+`rr3,uqu?Nhrr3&al1rs2hZ!TTr;Zfqrqm`7q>('VlT.)F_8-OC4e:j%]tLPlbh1:hc,Rd&b5TK] %b5]KSaRmRcYHtRgfuhUc35<5V_o&n+bT"I;Zg@%lZ*Dft`TZLs^VA.*\A-J?e?lU+bIRU;)oBJA^:l$F %c,%6>d*TbXccW;hd*TnUaM5g,\b`lF\[]/Y[^NTMZa$d>rimKLZDsUl[^NrOX0&h=VP9fnPER7;[A'Cr %^:p*i0)kD=rrW)rrVZZls8;lks7QBes8N#Zrri2ps8Voos8W#rrs88hs7Z0doCN"]qY^0gqZ$HlrrqQI %m/R+`rr3,uqu?Nhrr2u_!U9FPs2"^8rqufrrVl^6rq?'ckiara^V%2`2`I#\iNokc_84@6`59'qrk8<C %rk8?BoXsk08YW)Zbfmf;_(2gs`Orjd`PoL&XQAQPWN".V^>RoU\$sG_YdhZka/GrO^T94I1psa3Z*>;i %^pLJ__o'%%_S2V5_o'.!]<]'DXU)#/X/`.uW2?HhU_'B!Ss>S?WO&1fTW5#[Pa&*TL5$HZWg8sG[^MJM %./rZ4rrW,srVZZls8;lks7QBes8N#Zrri2ps8Voos8W#rrs88hs7Z0doCN"]qZ$Bjq>U6jqu6U!k2u%1 %s8;lr"T/)rqYL3k!pStF[/U.*r;Zfqrqm$#q"XmSl8^j?_S<hm4$/kljghq#a2cZPbK.H5_Sa:j^]_Qm %_S<kY_=YT6W2luHdDO#F0t=a:^qd7tahY]rl05d]XjP#&jQ$`]]?IXh]Z\LCXf]O[Z8ag(]"6.q[j!$9 %]"5i%ahGj;_ka*Mahkjq_77>[ZM_$9ZE^[=YHP+1XK&<"W?/(?X.u,PYHPI3Uo(?!T9knFM2<)fXI5KP %\$q\Q.K8c5rrW)rrVZZls8;lks7QBes8N#ks7$$kqYL6lq>UEor;Q^%o^r1WpAaaUs8Mlmq>U6jqu6U! %k2u%1s8;lr"T/)rqYL3k!pStFc2[#-!<2ors8Drp)uf[/s6Ju33lJkN$p?bEl05mpXj##Ad*U%W`r=-[ %aSs?^`q@FFaVq@hZe=$ScH\Da^XC$;[EQk4_mA^r]s4il`=^)QkRbMDd($U#daHXP[*-Y'r]hF>_UQ<6 %.4NNX_9:3P`QulQX/jUoaiMQ<aLSkX\dQ'Y\@8oT[Bm3EZ*=54*O;uNTqSp'^T4E;[^N'-U:-8L,UBdl %U8u#BS1ZGnnbiCgqu-Kkrql`orW)rms7QBes8N#Zrri2ps8Voos8W#rrs88hs7Z0doCN"]qY^0gqZ$Hl %rrqQIm/R+`rr3,uqu?Nhrr3&al1t/T]`/!2r;Ro<rVZWmrr<#Zs8Um00YbBJWMqhWX2Dik^:q"OV:3#e %rk/6?rk/9Bq7HU;o=dTBe[2]S+!7O(*==&;/KPrF&L3p?fXSGs\[eiE)SWp6$O\L"'F$TZ%hBMTVpDHG %U"J#'ZE_Nn_6UAUUSH59WOTJ;VuaB1poOY"X/i9"V>m@jU]7(fTaA67ZB^]3R[TtF&#-;&U('.EXK7l' %]SE/Q,lR`Cq>UBqo^r1[rpTmbrqZTnrqZQorq-3lr;HTnrqlX#o()\Xs7Z0_o^r._$i0Sms8Vins7?0d %s7--ho)AXrl2CSUrr2rnq=sa`s8Vo'rrE&rrs/N$r;HTns8O&"s8Up21;UfSXfX^iYfY#,`PoHjXP1G( %_SO(f^')9g_S<kY_"5H/gY9<NUEh+i,9maI-SZbf'br*jU>3Do[Cs8YYoU]u.h3%C)&WiJ5SY"SXK9sX %ZDZR9\@AumcGm?&]Vqd\Xobc>^&G/8]X7XCr3HL2Z*CP4X8f4"WW&jqV['rF\!rkITV2:_%^r73&3`:] %YFWDALn^UirVllnrr3&lo`+den,N=bq>^Hnq>UHoqu?Nm!rW#qrr2fn$1dZas8VfdqXjFZrsJSsq#CBg %s8V]gr:'ado)AXrl2CSUrr2rnq=sa`s8VoEs5X+Zrqud=rVcZmrVlisk5YJ<hDE-fe?H/AZa7p$bK@uC %Z*E3,a8X3[`W"!Na7ROib2VEs_5]"9\1/sE/1`\+-5mdRVl)0+_83_"_R?lsa2]kI'/^mT'1YP4*$hnu %gpstujlO7l^"(ZX^:qLgYMQ[p`5MY_"2ha]\b`l>\[]/Yrj)R/s02L+riQLF^:p>9Q)CPZY7A7MYSp#% %\@A?S`f@!r.K08HqYpKroCN"Yrqufgs8;lls8N#nrrE&jrrW,srVlfnr<`&cqu?]ipA4FRrr3?$q"Xmh %p](9br;?'as760h$L.Nfq#:9mq>'g\rVlrpq>[r(!<2or#Q=W!rVccipAY'nr;7c<[M$<g\.B2s,cnJa %a1&OX]"5Pd]Df8@]=Y`R](il/\4Na/[CNh%\@B2JV:`DlVo6Nk_l,a_#9tH3()A;H*[N,1daFf1ai1Tm %[C+,j^9"cOf9r&D_Q:SiY.M<[]Y(Vd^V%4c\@BGLpoOV!X/l&r!i`,srh]gfUSG-#+18&GSsu480/&Zr %Y`+O1USFrhV^1Bcq"Xj^pA"[frUg*brrE&trUg-hrp0Rarpg$grqQKqmHsrK#5J&ps7?3frr2os%0$8) %r;?Nhq>^Kgn*g8U#k.fnq#CBlr;$?ls8KJ,!<2or!r`)q"TA<!p\4[e)#aCY\@B)c_7UHr.Oq^:^!4:* %Ye\&k_86,a!l;^io>("44L)N1^V;\@^;6hLh7p_)aN2B@X?o5\-70`O)D!E`.4M=JeYCI:bIP0q]?eF6 %Z+IX(St=$EZH("l^q^As_SWk&`PKC$^:q^drNc@-"gYD<Yck8.YUZiYXfSS(Tr=p!\%8`FUnOKP1,>?+ %[#gB@VP^PrW@$ciq"Xj]p%SLdrUg*brrE&trUg-hrqHHcrrE&gs8W)nrsJ/\s7lBcs8V]hrVlfqrs\o+ %rVZTlq>('jp@%JLrs8)ns7lWor;?Bis8W)Os5*bUrqud$rVcZmrVuZfr;RNZ]"5Pm`5!3,/hXTL_U??> %[`?G1aN4A!!m&I)o>gLB&@fTo`l:0\`Q5<hjM]!?c-8;mbHXQ-%kB.S+!33l-S@$Ug=iLVf$_@L_SXmI %bIGI-jJA^!cah?H]#_t9aiVBCbfIl@`Pp3+\[hRJ!kGhNq6qi^[C*?HZDat1^:qIl[B$7)UHCZ8]tKi% %VQHu.Y-'5<l2(8Vp%A(Zs8;`mqu6Ek!<2uro`+pili-tanc/Xgq#:]gmJltVqZ$TerVc`prr3E+rr)cm %rV?9hs7YpMrr3;ns8Vlos8;fjs8W-!rq?B.rrE&rrs/N$r;HTop@eLc!rVs?rjEHR^:4^c,UBJ#\&Yte %Wk,dS]=\'O!kZ(Wo==q3osdSo[C*QU0Y"X*V5;hV];NTc_o&E:4pN;W)AX):-lsZ\Vpa"daiVN.ZaI3_ %^:p\W[b$q8_SWCj_61D^^:_+c^V@FoZadN_T_PVjXK/DtWWK/uW;`Y(S"laaZF-X0Ssu480/&Y,Ycs(F %S"la\Vl(g%jnSWMp@e:]s8DThq>UHorr)Khrr26`!<2Ngs8Mfn$LR6\q"X^cs7?3frr2os%0$8)r;?Nh %q>^Kgn*g8U#k.fnq#CBlr;$?ls8KJ,!<2or#Q=W!rVccjp\t3mr>$Zg\@KGl]G)&0.^?\#c+^or^qdh' %_>_+L_84"[_">?1Z+IW_^G`g?_5aNk^V?eiaMu6$6:)#+-64!C/1_to.BD"LUX.90\[f>acc!c,]=Zmj %T#f!Ya2bO%^r4+,\])P(_7@8]^<*8NZM_$4ZE^[=YHRl..^,tVXK/CqW2R27\ur33TqRu317PYXOH?'2 %VQZtu-KaIcq#9sZp](9lo`"[d!<2uro`+pimJd7fs8MQgs8Mfn$LR6\q"X^cs7?3frr2os%0$8)r;?Nh %q>^Kgn*g8U#k.fnq#CBlr;$?ls8L@Ekl1Y^r;R$#rVZWms7lBertZrm]"Gu"^_dn@0"/X6d_iu2a2c<C %aSs*ZaN2Kpa7R=h\AH,&`]_;[aK`#2`5Jk(c-+;87n4(?.j?&h+#,Jt/hXB^g8NTRd_NZ8_UcoR\AQ5F %V5;Ma\^&L3aN2QHahc3FaN209`R(`t\b`l=\[]0F[jnho[Bm0EW3<D=^;@:cX/Mtl4?TIR]pY:cXf]"6 %XsrW"qYL6bp%SLdr:L!es8Drtrr2lgs8N#`rrE&gs8W)nrsJ/\s7lBcs8V]hrVlfqrs\o+rVZTlq>('j %p@%JLrs8)ns7lWor;?Bis8W)qs/uAPmJm4_q@g$7d(I#q[^O,m+=&5)dF#M9]"PGV]=YJa]t:ke^TarP %\@&r\*43GoZ`0qFZEgsK[_]e[`l>7(a;,Q!Za6mkgme;T$+[UV\@K2^\[JsE\.lKb]">Vf]reEH]=YAS %YID!S]Y(lT]H4Yo\@8uX\\c4mZEgsK]=58SYd_*AWh?#dYHOq,XT#15Vk0K]XK.VOT<YZ#Q^>@tS!9-c %,8VRI['Z0iS>)aKYcs7_TKVl:s8VTgs8/8bo`#!lrVc`nrr2rrrVZ]os8Jbm+R]:0r;7>7Yg^A%[(<ik %asAMeV:aG9^V@[s\\Z+o_o)Jh&B2&b^:q1o^q.J&\?E*]\$u@L&B;_obfmK>bo@_7\@B!+iM$7b$,+$a %]=bkl]XbTM]G%ul^VIY$Za7B^_77"^]tM>#_SH,d$Ga?g]Y2"na2bm&6as_@^q@=h[Cs8XYbn;'[C*0C %ZELF6Xe_buZETgfV73q;S=IF3TUM<$-n$FP\=9.aVP^#mZ]h,X5P+LHs7$'gqo8ZWrrW2urVl`orr;rq %r;Z`qrm(Poruge1s8Dm4ZEi&u_RR:mcH[jl0<3ja`Q-$A^qe%4_TL%#`t6J.]u@t,a2c$>bJ1Koe\Alu %_[t,=\'rg>eC5]f_8!aul05/G`!4,s_84",_udfj^\bk\_o'I5`lG[%`Q6-8^V%M'b/qd'a8j9[`(J"f %`m;uL^V@_*aMc$2]Yqat\#ldC]Y(Y_\[JoR[&^7<\[S<-XM2EWUSGrQVkKe@0/"om^ndp-Y-+Y5\sTCn %62($Ps7$'gq>UBds.')jrr)fpr;Q]qrVcZorVulns/Z/Jq>('Tl2UcC[^Ni_^;dUi^V?AP]1;o%5GtEg %a2bj*`2KWJZ*CXUa"FX%aJu8`Z*CXYbI4db_o'*[U!9^A^(hB`X22s$WNWMA\[f5Z\$i`S\@B#T[/7C* %]"5Me]tUSL[^s&W['R?T]t(\X['[EU]tD"g\$rfU\@9#Z]"55JWi</-Za$dM^T+!$ZE(%1UnkQ!VlHbf %St<HHL6p<8J:JCW2E$hrUnrB``1s*$TpV(/VC!Y=s8W)j"onW#s8Vbds6oshrr)fpr!!*!s8DoorqlZl %!r`,tWrN(u9)JMclg+TN3k2]7_SXI,]#DXa_8/nJ!Cj2n]ZeU:_TAs`_RI"bbfmQ*cEFG![^N`odCd$# %aiV>rVphrW_]'Q"Z,Y,9Y-k[Xrk&TL]",A`]Y(hc\@qjR(qmYt^VIY$ZEh-Y^q.+f^qdh%^UC_b^qfrd %!l)F^!5/<ErP(D(Yct=<\@AuU`Po'ZVmin7[]6@AXK8V/USO^!N/X=Zf7o#+4?T+4WN1JsaJPi2V43g< %W$j(Ds8W)k"onW"s8Vc;s24j<rr)fpr!!*!s8DoorqlZl!r`,tf)O1u9)SVem-OcP4M&,@`Pp*9^<+Kq %a2_-a#>;G2_pd)Vaj@H'ahGL)e'l%Fe[Dp=^:qD8fYbM?d*Th9Y1gIub9A.?\BWUU[Cj/trke]N#f"-j %_SX+&^;Kod(rO;1`Q#p<\[fVua2,U-a2c?B`kB4)a2e2$"3/9t_u@UQ`]CoE\$ioa^qRP,bdXaX^:1Sb %Z*D<TZaR<BX/j1&PGI'lNK#JV6_^fhZA44^Y-+n/Tq7jW/M5TSs8MZps8Vrnr:9^aQi@-drVc`n"oeN$ %rVcZnqu-EnrVcfroDc5u1AUbGl086J34?9.^:qUq[_KSK]=UT6!'dBZ\&ZP%]YpbI]s4iKa2bHiaJu8` %Z*CXY,g3X'[)9enTqT`5XhGMbX/j(Zb,MSJ_7@+d\$rfS\%&rW[']_@;nBQP]tM.]XL>^O['[0N]"PYb %YdCdK]"Pbh\[T&V\@B#Y\[oAYWiE&$Za6pA^V?eBTsC`"Yb\)*Vl-PpSXuF_L5)&Bd=?`h2E$hrUnrB` %`!iE9TqRj<PbocSe,TIIoEG9pr;ZfiR/d!^!ri/srqls!rr;rqr;QTlquZirrhoc#qtpEZli6uP3k2]7 %_SXI,]#DXa_8/nJ!Cj2n]ZeU:_TAs`_RI"bbfmQ*cEFG![^N`odCd$#aiV>rVphrW_]'Q"Z,Y,9Y-k[X %rk&TL]",A`]Y(hc\@qjR(qmYt^VIY$ZEh-Y^q.+f^qdh%^UC_b^qfrd"2DO_]`,VC^B(mL33]Tn\@AuU %`Po'ZVmin7[]6@AXK8V/USO^!N/X=Zf7o#+4?T+4WN1JsaJPi2V43g<W$j(Ds8W)k"onW"s8Vc1s3:QF %rr)fpr!!*!s8DoorqlZl!r`,tbl?Ju9)SVem-OcP4M&,@`Pp*9^<+Kqa2_-a#>;G2_pd)Vaj@H'ahGL) %e'l%Fe[Dp=^:qD8fYbM?d*Th9Y1gIub9A.?\BWUU[Cj/trk]&Y^q[Y#_SX+&^;Ihe_AL2/`5Ta9a18au %a2c$4^rOL<`l>^._8jUqaTKQ$`5DSmrPgn6\$rfX^qd[ubfmQ!Y.hBS]s4i^Za7*KWiN2=PEVg!hMmLG %6URTPYd0%>d&sORXeD>XX=Z$Us8W)k"onW!r;?-Ts.TGorr)fpr!!*!s8DoorqlZl!r`,tq#@Su/cGYA %s8VojrZWPe^V@UXT[D0$X/iJHae^+&17+?!T#eRW[(O&gW2RAA]!o-nXi88jYcs_5^9tABa2c&oVAQ/+ %`5Jmm]WB&i[(Er\\$rlWrj`-@\$rmF[fX(L\c02DZEh$R]`,DI]Y(h_['6mC\@DOK!4Vs90=A3r]"5Pe %\[JrX_54!B^6b1XZEg$uVQHhsZ(@PXSZnreT!Ykq+X&$RX,;e:WtVOrXK8=QKUn[9Za6/K-NEK#oCJ:J %oD]6trVZTlrr2rsrquWhrql`nrr)iqWrN+u9DAJdqYL4;,d5,'`MKE_f>Fku[a<C&,pbL@SYW(+_SWn# %_8rd^_SX+%]s>f'^p^\I_o'*uVTmB+XK3JDX3&Jl_SWS"ago."]`#GG]tD"i]"7mQs183A#edsd^UL\e %_86,a'Z.`&]"5;[\\5\k^:q:n]Xtbd]Y?\G_83n!]YMOfX2MrISYN^)UT:H$Y-,4/Una]nX/i&,\Y:H! %-n)?^OKu*pQa!]pLkqauYdV!3-n,,`me$.gs2Y-JrVcZlrVlfrrr2ilqYpBlr;QZorm^tus%iFis82]n %-76%<`lY0XgY9fX[_()?Yq.FiUnk&leB,hKaN2]8[E6P2`5K47d`9&7X3/T%_QD>;cEji'ZEhj(]ueC, %dF#bK`P]R0_o)Jl!lDdiqnaAk_o0O5`kK1,aN2<<`Q?6B_83e"^r412`Pod5_u@M@_oB^;aMu-8a3Lur %bKH]WWkZ<KZa73N[_8`BWiEb<ZE(dVW\,nW0=[@8]!o/?\@Al+O/T"b]=Xdf/-#),oCN"]rr)fgs-s#s %rVcZlrVlfrrr2ilqYpBlr;QZorW)tts!IaFs7c9U+<[r)^q?,)XK8t@[\h$_]=#&B3]\Q5*3H?HXf\S4 %\1=_bX0Ah:Xf]%<ZdQ=lW2Rt?WO!3M_nWt!]V3-V[]HRF]"5AY[CE`W\@DOIq6^L:\$rlU[^ioXrj3KN %\$W9>]",A[[^*-AZ*h!M_83^i['I":ZQQKT\[d`\]"5DHUVO=HUpICcXf]7KK1/3J%hC@QN2rupU7IjN %Q'J#1RA%.#WMu2GOg,#lq<dSKrrr,irVZTmUAsZ]"TJDur;HWp!ri2tr;?Qmr;Nhuq>X7cq!]IO[)9es %St<6n^:_+[bfmo8];e+].OlXJZF.$FYJ%WUZa$pG]X+rV\@C/(]reEbYHPJR(s0_7_SW4j`k/L\`P&sr %\[f>a]t:oU](riA\[oAa]Y)"n^Ab\S]Y(e]ZbX;h]Y(b_[^Wl\#JS7!^q.+e\Gj#t[^<c_Pa&u!^8\*O %]=Y)R\WO5)_SV.%8g"i`2Nj6.Z)=@lWgfKTSXlUi]WA3&Pa&KY#5[cUrr3/qpAOperm(P\rri?#r;?Nm %rrW3!rVZTmrVZZJs3:R9qYKb.,e(e5`1j!7[_fksZ-gt=_SWQJ7kl_I\[fAa]!fSs]=YSc]Yh=l_S<kB %`5K$ifs\?)+!8kQbK7l/c-=,8\BMq2_8*hk_o'F0_SO++rkSNJ"Mhgh_SZ;i!li3urkTDh`5&sqa2Z-: %_nWmu^;@b+cHaJH_8!ba^c/s=`Pn=9a2c0'Yg()'Z,"/B]"6#*OASk&*#q,0RCKc1WiE=uU918gXi&&_ %Z_!SQ[L*B=n*g8U"nV?^q"X^^s-EZfrr2inrVlfurr2lor;QWprr)iis0M_Zrr<#mp[0.HZ,"/fR[U=Z %\[JrD`PoHs[A5iE,paP5Xfnk/WOTI@Y,ee2[]Q[?ZQZ['\$r<7c)I\K&e`*s^V%4Q^qdC[XM;?X\$`WR %\@K,ZrjV^2#e%4O\@/iV\@DOF(Upl\Xf]1F\[JrPYctC?[CO,i]!SiMZMq0[YcbOINfL]^\>,h7[^N!< %Z\trf]Y&kc72laJ0T:skX.l/UUm74<R@0`W\@AN;QB@<7"9ePfmJd+hp@eI_r;N)`q#:Krrqu]mrr3'! %rr)cmrr)coV>pSj:%0>N[)9esSt<6n^:_+[bfmo8];e+].OlXJZF.$FYJ%WUZa$pG]X+rV\@C/(]reEb %YHPJR(s0_7_SW4j`k/L\`P&sr\[f>a]t:oU](riA\[oAa]Y)"n^Ab\]]Y(e]ZbX;h]Y(b_[^Wl\^;n:0 %]"5D]\[a]1[^<c_Pa&u!^8\*O]=Y)R\WO5)_SV.%8g"i`2Nj6.Z)=@lWgfKTSXlUi]WA3&Pa&KY#5[cU %rr3/qpAOperl"i\rri?#r;?NmrrW3!rVZTmrVZZ@s4@9MqYKb.,e(e5`1j!7[_fksZ-gt=_SWQJ7kl_I %\[fAa]!fSs]=YSc]Yh=l_S<kB`5K$ifs\?)+!8kQbK7l/c-=,8\BMq2_8*k(_o0F/_8=()^];1L^BD?f %_8=(g_ZIis`W![i`5KI&]#Vh1_o'7&]tVA#`QlcL_83n$rkLJ+]>_aYS&`RgYcuBi_m."mR(BlNacK@s %-QF*hR@1RpYH"V-U8"cdV6.YQZa66kRC3G0qsX"Qrrr#cqY9j^nGf0]"TJDur;HWp!ri2tr;?Qmr;QTn %Y5^$Hkii'Hr[92)Y-+M?aL\sY]tLt`[%Y4J\>Q7A_Q"Xu-P6qEWiFFmVS^2!Wh#]r]"4lHZE^[LSt</I %3fg/8Y-,gBVR=1RXLG[EZ*C^E\$WNK[C-"Br3ZO5rjN$<[C!6Fric=,'sFgP\[f/WZ`p[=[C*QDW2d#' %ZEh">]Hk+lY0bOqWhZMkUU.:pWMuRE0,YX!C20cU[%3k_Vl,oYV5ga;Yb7_bWgK0BR\kt"]GMLcqYL6l %o_J=_p@b$VoDejirr)cp!<)orT)SlelK\BK:F[j,ZEgCQc+q,o`5KF&];WWb^9+NXa06g7/Jf3\Ycu[. %XN8JdU8#WB^ot8X[^O/MUU<?PQ)gsm[*>\R]>VXn]"5;V[(*WW\$rfU\Gj&:\-':Q]"@sQ"LkkI['fnC %&[f$^^V@Fo\@/iT]=Ye[Y->5`ZadNY_84"(['\E8Yct(/Y,StBT<>>p2)QHt:2k0U\[eH3VQ?kiX/iG4 %[f3-=Y+2#RSuI^/^De-lr;?Tpp%eF`p@cT-a8c2=rr)cp!<)orb5^#l!r;0Jrr5YC/AAO"WmK,2`3.5( %`5'0jb0%]1[*Ht+.k<Ft*^$p@h;,E`caKjRbf@c4^V@Iqbc7\V7n9)TZFd`uZa7NlbIPO.]tD"o_8F%& %!5A<G!5STM!lDglrkS`O^:V"irkB2\]Z8%3_o'7&]tVA#`O3+_]=Yhm`;[k)aLf(?h7'ks[C*6S^o"NI %Xunfn-<586[_]eZXf\q9Up@;8]tOEI(:Bm2Unk,TOhi%Ys8;forq#gUrUKFTp&CN]s8N#rr;Qcqrr2Wk %WW+=>kii'Hr[92)Y-+M?aL\sY]tLt`[%Y4J\>Q7A_Q"Xu-P6qEWi@\ud&+[sWh#]r]"4lHZE^[LSt</I %3fg/8Y-,gBVR=1RXLG[EZ*C^E\$WNK[C-"Br3ZO5rjN$<[C!6Fric=,'sFgP\[f/WZ`p[=[C*QDW2d#' %ZEh">]H=bgY0bOqWhZMkUU.:pWMuRE0,YX!C20cU[%3k_Vl(T'V5:2rYb7_bWgK0BR\kt"]GMLcqYL6l %o_J=_p@b3[mf3=drr)cp!<)orU]:8l!r2'Grr5bD._N'mVp3K%^o>8j^Uq+V_o'3jXiJJd,U=rX(H&G$ %e^^bBaKM>4`PB9m\@AuU`M9395X:U8X0f7YXK9%P`3Qtc[C!<N\@T/Y[^`jH\brr>\[oAarji6A\$WNM %rjWBE[D9Pl]Y(b_[^Wl\0tsfnYd:[G\@o_p_SEOcf%.(0W33;&\[e?8Y,=-7+!46sE3Hg_U8FfhXIZDm %YI:n=VA68(S=Z=ONK([l)uoj6s8Vcfq>^0^c2YZ\s8N#rr;Qcqrr17Dd/O1Clg+QM7k?4*[C*$]d)<l* %aiVK:^obc%`O*"tcF5;S1`d]#\$t2LZd6t+WiF:`a0rat]tMXiWkCnmS?fH4]@=0n_TU-5_o'1#]EQ-f %_nWt#qS<0IrkSZQ_ScAh"MVU^]=e-X'th3"`l>p6^V.=p_SX:"[C<c[^V@_daX,$?]A;;P\$*3IYe\&O %[C*/"4=2CTGB^L3_5XQ=Za6I5ZF@N\riHsDU8"HZXc\a^*?G1Xr;Q]ep%A:Rnb`1_QN.!arr)cp!<)or %qu?6e[Jp^(mf!1cnF65<l5.%CdJ^3j[\BLl_SWO^Z*U-t]=X]\cD@nTJg;TY(a#NJ\^Jon[L9OZS=IO9 %[)Bm"T:c,*'u%DDd*T&"Xh_NZZa-mH\@T,W[CNjI\GN`:\@B*K[/I<<[(!NU]Y(DQZF74@\,`u8[0=7[ %_7R=arN7QFV50ogXKB=TN$BPo*Zd&>YFM,AaN1*SW26;cR@0qWZ(d>ATVSBW&"oSlV4k&p)Y3IpoCMeR %p&>!kop>^Rrri?#rVc`nrrE"grs%r\rr<#hndtZall*UPf!;Tg[(N?9Wl`B^[j/G]Vnp3FeC:P1\qhda %*ZcW,WP7$;T"M_TU8#fQ\]W&9V5=1<'uRqTf%.=:Zc9\l[^ENU]Y1kd\@fKR]DK/@]=Y`T\e;Qa\@B,` %]thM%[(*WY]Y;(m]DfAI]=Yu$a2#L"ZTGM"[&^7,WNrh9a2a>k-nHVh2mp&eTp!^HVlm2&WMuJ\XLG[; %Q'J5FW26;cWMu`"Z5iN/qXjFVqY'pgs7O;0bl7hFrr)fpr;Qcq_Z/Eks7$$f3V2k?md;+3_:c9*\@B>V %Xg$*r]Y;+qY-,jeXP;L8_820e0dS+sYcu.)hke6.bc.ShdD4/W-*43If+Z<LS_`,9]"6/*`P0%!`5K[3 %_8-&g!5nfRrk\ZQrl"fPrP2IM`5K^<ah,=&_o'I3`5BI/_8=(3cHaJN^:Lnf]<\`HYdq<UcH_h30Jb40 %5.nP,W0u2dY-k[BYcst#ZbF/WS=H^aY,nY'YHOq6[N>2;qXjFTq"4Ra!qGgYnGf0]"TJE!rVl`p!<)?c %XoJForqm<+rZ\VPUogc,[CjN!_6C0CZ4`bTcb$fmbKHEn_qq>jV5:XV1+WkF%i66,+LehDPI;AJW6!&B %]Y(MS`1<I1Y-,FK]!ATG\[f>[[C!NV\$iaB[JmU*ZEgjG[^W`R['[<T]W89@[C*NR\$`NIZ+R`WW2QA^ %VR<hI_3UBD1_LEP&e[$hRA$LT[>0O/T"1VkV2:&']tLGGPEhE-TE_'oTV.jVX8\Uo[^HPBrqH6ar;Qio %nF2tJnc/Ufr;QcrS,ZUjp@eI`rr<!E[C*!>ZF[W`bfn,9[^ilVUXdo1^pMM:U<(F9Y-+e)]f.k`'GMN3 %,:1%:R@1Z0+K`r7QbpVJ[`YA?^U(8`]tLh\[(O&c\@B#]]t1bbqmcX9!k5YLrOi-@'"u,tZ*h!O]=ttl %]"#8Z_SWpf4g(WXX1Q!_a.&PY3>`Sg(`5<+T;Scl]8_fFUV<_,X,i=?_o&[]R@B\EVP^huUnY&rTV.pf %\IAN<q>0scrrW#cnAtXKs8N#qrrE&=s4%)Kp](6ls$A-D\?**G^V@e9dET;8^;%F`gt]ul]\(l9cd1pb %[B[!T5!Bl()^?g^/B#K"TY`'([FNg!aiV92dAj4d]"6#&`W!OR`5K[3_#hEk`W!aO_>_:Q^:qD]_c+Fg %_8OF9\@fJk_SsI3_8!b!aiVE-[B-I9_SXRCU7sq>+!3Kb+$ld$Y-YIOPa&2J`NZSPQBn_sb-naOU8"in %XhLg8W3s%1VPCi<%fcS)qYL3j"oS;klg+H@s-`odrqucrrq$/gs8Vckr"&f+,-eDKXf]"=]Z.t-Yd",4 %%A(nl]=Y8ibFHJfhPdA-V5:XV1(=a)(EFM=\$qQb[Mg'_aN0LV]Wn`[SXm?pY.V?WZE^[F\\#8W[(<iX %[^Q(@rjG2"ZF%'K\$rcP[(!]\X0Ah9[CE]T[Bd*C]Y(YNW1]f\[C*fdQBj?a&eZ`.&i?#ETr+]pLPMIm %\YGprM2@t?]rJ(?PEhE-TV/Q_TUi-argX5%[L3$5p\FX_rrW#cn=fmKs8N#qrrE%ks82gtp@eI`rr<!E %[C*!>ZF[W`bfn,9[^ilVUXdo1^pMM:U<(F9Y-+e)]f.k`'GMN3,:1%:R@1Z0+K`r7QbpVJ[`YA?^U(8` %]tLh\[(O&c\@B#]]t1bbqmcX9!k5YLrOi-@%DBToZ*h!O]=ttl]"#7:\&-"oY-+UtX1Q!_a.&PY3>`Sg %(`5<+T;Scl]8_fFUV<_,X,i=?_o&[]R@B\EVP^huUnY&rTV.pf\IAN<q>0scrrW#cnBM!Ks8N#qrrE&B %s3L`Fp](6ls$A-D\?**G^V@e9dET;8^;%F`gt]ul]\(l9cd1pb[B[!T5!Bl()^?g^/B#K"TY`'([FNg! %aiV92dAj4d]"6#&`W!OU`5K[3_8+%/rkeQKrk\`N^;0]b;o6Ae`5p$0]Y)+u`Pf^2^V@M)ahkHnXK8bF %_TgB#U-V'e+#tDb6)LN^Za7N5PcCb&YctF!QESHR[^Mj'U9C]$^8e33[C)m/UV4>Ns8VokqYpHtr;?6R %lhgPYPlLa^r;Qcrq#Bpb[Jr#Vp]'jVs8W&am/8+P]#)=o\>$"'\>H.3Xf]"3X.Q#tLks!IVk(Q9WiE+u %W4B"2`hXoVV)^OM'HIMf+WVT0Xf\Y)YI_<RZa6I5ZDje$Z*CX;XfSh6Zi.3.Z2V$1WN!#uYm.;,VPgJq %ZMh*_ZELI7YctC?[=q%<*#oh@,9.+O30fcE^o40/X/;c-VP]Tk]r\<-Y-+;+\t4qBrila,Vk1/uQCsnE %&Wi*][%@R.rq?'aq"Xgdr:]j`rrE%cs7ZKlrquffri5u&q"Xm]o`+q7s6f=T,pg=G`kB'`Z*D$EXLtmG %]<SW;V8J:Pb,qe@_o)JX"g5#CZEh^RWZs_m)B'h3&18\I\[&NGZ*hB_]XbSQ[C**:X0f7BYct==[C6%A %rNuR3!jAf6rO3!9XK8P/Z+0bC&%AsS['d<N]=Wtn8g5H$-p8t&&O&CJS&WINXf\k/X2:p<R`!%KZDFq8 %U;4R>Pa&Yd[]Q[,\$qj&Uns<?\@A7@$ig"ss8)Tkrr)Qarr2ut`;e![rr2iqoD[)9h#@NRqZ$9_rr4,1 %nGamb_TL$<_Q:2S_m6Sb]"5bg\?)dSQ'Kb([&V9krjN'=[Dobfe,HTt7ReOE.MimR.Or6E\[]/^a2c*5 %^p1Vf[C!<S]t_+g\A#\l^&YnC]`Z!W[^uFO#.V"G[(*W\rP2.A]Y(kh]Y;8"P#5(*.4-]$.2YKBU8#oW %[C!<NZa7f[ZD#F`\[efR];`ikWgfKl^:gn\X1l<BWiE+gR_?D3%hJ^:qYp?fqtp6\o)AOeqXFNVs8N#q %s7?6es02M6q"XmcqZ$Tos8V(F6CPBmrj<0-TW5)pY,\M&Xf\e1rNHU3YI^p@^V?_`_%irQYFW25`K?9: %0WDh%[%Es3*#oe4rY?%^*#p"7'cBM3Ocd,TXf8kAkcj_!$O@#)Mi4sL[]?I-Xo5L0YHP(/X/W%rrhgI3 %Xf\V'WN)toS"$FRUn40KT:_dJ%\B/iWh6Q$T:`2.+o_!#r;HWoRK%s?s7Qj#q>('jrVuoX6URCA\-f%%Y->.9[C*HQ\Gj&=\GioW^U(8__5kGiWirUs]tMUTQ8UY)`PoBaV'I3-*Zk;#&0;u<,T@[D9hgt@]X+rJ %^VB!@ocXDI%S2^COh/-:Yct::\$rfS[C*?GZ*1=5XfAD)Yct73XKAV'St<0dWhcGcVl-JkVk^8lT<YYn %T<'1Zrp]FTrVlf8s+::&rri/ns8;fmrr_IU8>5sq$EL58\$roZ]"G_irkJKIrk0>l]=Z2,ZcgOu\@AES %`6t3I4[$6tbeU<].juel-2o+u,q(/l+sJ=4<1]]!]".sO`l@5UodCUk'i13a_84$u\$`f]^:h4m]XkV_ %[^EOBZm3)m]=>A^]=YMRXh;*NXf\\*X0&>!V5gPfZ*BpnX<AbdnF6ASrr2HfK)_nO&,>r"qYL6lrVuoW %6:.-M\,NcDTV/<dXKJS'X0&M-YPk[.YHPO@Y8Y0jW56<LYHOM,\AaSm0JKK@^U0W**ZQ.:)#b9^(`XM: %'bqTV8!/qCXf\S5\`g9j)[coW6Apc/['m$9W3-$'#Ht>5X/i4uW;`\*XKAV)Wi<"uUmmjRUnjTR':kbf %TUqaEWiD\rZ(IYi+X-jSnGN7args.As8N$-p@eO^q>^Kns8V+H6_+(a$DaK#YctF@[C3TTrji'=rjEi^ %Za7KaX2;`RYHOM1]uu_-2E%bX`OVhA,U"<P*r[,j*[)[P)]Khm9p_3ZZa6jM^Z`-"+[7+[%S2_E]"5PY %Ycb=A\$i`Q[Bm-CYHG%1WiE8,YcY%/Xf\OnT!55pUnjc`Vl6MkUT1>dZ*BpnX<AbdnF6ASrr1(?K)a:! %"Sqlnr;?Km"6`9HU&;V3X/iY;\%0)]]Y2#X^]2%I]cG,)]?/1$bKI6%\>I3_d[cpl4grSY^oXUf-n$Af %rZ_[p-n$Si+sg2f#G.O)]"5>i`ot,/-l3U5:RINc_8Eak[CX)d]tM(k]"#8Y[C-"@,Ik@t\@B,^]=+iD %]XG8NXfSS(Xf/1pWiD\rZ(IYi+X-jSnGN7arq?ADs762qrtYG.s8VZXmf1ed0<D7OV6IPB\%oecri?"" %ric=*%'GSL_83aFOM\oQ`L[I/W$NaaU:@/#RCp33YPYL%Y7.qNZ%.?^2%q&R,7tOO*;-KBW2Qo.[^`iS %Z*CP4Ym7M;YHP(0XK)2tri?m7WMleqUn!sVVl-5^TVA0VU8"9SU880aRCBX.s8Vops8;iprfmG;s8Vrq %rt4himf1hf0s7[XW3a1N]>VXsrjMj9s1&';rjE'<P*3`#^6+QW_[XS\Uol3uVl.83Y+NSJos>.@]si]L %4$+<+,q0WHkT]]-#d1>;]Y(qk]!_[K[^Z4D$FI1HZ*CO:YHFt.riZ[1XK/G(W1]fgXK;E!&uqt5X/i1n %U8=9G\$lM?s7u]pr;HWo_#K#dg&DlerVuojo()h7g,?:DY-,@S`50[A^:V#V]`5\E^AbeN\s\u0bJp!> %rlbktX/iW`19[n#[C)mRah7A[&%oj!^5S";66Ig10HM8a.I&AT]EbjP]>MP*`PMPe!5AEF#J@^\\[f2X %[f3ZF\@T8\\%0)][]cmK\[erKriZm;XK8CqU8=9G\$lM?s7u]pr;HWom/M\;XoJFnrr<#drr3H=^:qS* %Yf4SWS=HU\XK2<$!j/W.ricX:YctUG[B?YIXK&;'^V?p'/\J`dYct:A\ui0>ZEjJ:&@/LCXeVZ%_83Ia %YIM*NVl/a]os"n<]sF];Vl-Z'ZaI.<YQ(d)XT5I%Ws#H&X/`3!V[fZ(Un=9WUSFHRStVjPTamcgY-+Fd %R^KOQlK\?Dq>:/Xs+:7Ps7>j]s8VNdrsKCR^rXU'aiUKSTW\:&r3cO4+1J_k[C*TW\?N3?X/iGC`Nq<T %_SW%U[^3cbZaI3M\,NoL\$`WMWN!YP`jrXe^:q4]Xm!.b[faLa\ZQ7AXK8_<\[o>Z[JdH6Za-n9YpQ]X %Y-4t0X/i8$X/MegXJi(oV51&gWi;tqY-+FdR^KOQlK\?Dq>:0/s+::#s8Vcks8VWgrsKR[`6HQ:cd/bl %VmZ?4,.tS%^:qLt]Y_P$\@AuRZae6'\iDdmaf2te]#Vk&]Y)"orkJuX]Y(h[Yf=r4^qdS$`<*o`[-5-p %^'i')^p^\Y[(3uf_8-#^"M;:W\[h^LrjVm:%(<US\[f2TZFRBNY-.c+&?`(7WNNCsR[UXl.dH<tq>'pe %n,J">W;lnirr<#drr3H=^:qS*Yf4SWS=HU\XK2<$!j/W.ricI5Yco%T\$`BAXK&;'^V?p'/\J`dYct:A %\ui0>ZEjJ:&@/LCXeVZ%_83IaYIM*NVl/a]os"n<]sF];Vl-Z'ZaI.<YQ(d)XT5I%Ws#H&X/`3!V[9<# %Un=9WUSFHR':tnkU7n9QY-+FdR^KOQlK\?Dq>:/]s+::Js8V]is8VNdrsKCR^rXU'aiUKSTW\:&r3cO4 %+1J_k[C*TW\?N3?X/iGC`Nq<T_SW%U[^3cbZaI3M\,NoL\$`WMWN!YP`jrXe^:q4]Xm!.c[goma_RZhP %XK8_<\[o>Z[JdH6Za-n9YpQ]XY-4t0X/i8$X/MegXJi(oV51&gWi;tqY-+FdR^KOQlK\?Dq>:04s+:9s %s8Vcks8VWgrsKR[`6HQ:cd/blVmZ?4,.tS%^:qLt]Y_P$\@AuRZae6'\iDdmaf2te]#Vk&]Y)"orkJfS %]Y(h[Yf=r4#Je-e`Po^$[-5-p^'i')^p^\Y[(3uf_8-#^"M;:W\[h^LrjVm:%(<US\[f2TZFRBNY-.c+ %&?`(7WNNCsR[UXl.dH<tq>'peo`'OCo)H#qs7ZHl&H2S'lg+6e+I\alYctIF\uPb1(94C6WN3,%YHY72 %Y-+Y!]XG8kOH?rG&>C)GY,J;)W2RA*V5UDoXf_T+&?Vt4W3iq-U8"fnXIc#Z\[gq+orJOsUo:ArYHP+1 %XK&<!Y5GF!X9,E#W;NLrV4s]ZTV2:Us.K@b".u<^V['3##7(/+s87cSLB%;Hs8Nl7rVcW[m.VYHSXlO_ %[(!c`YI:mI[']h=,.+_b\$rQHZDjh<\$sSDOgq?g+LJMYY.(R:_5aN<YctF=rj36BYct:@\Z)L)Za6p4 %UoM/Ckd0re"KJK(ZEjJ:!3u[3Ycmo0qm$@/Ycb(/r2Kq"VP^;gV>d:jVuEV&VkTo`WMp+-qu?]o[f:sZ %g&M*Hr;R9+nF6?&-DR?8]"5So`O5]Wr4+#`]=bhj[^s&TZ,aYqe=)iAYHK=c]=#&\[C+,]Z*h'M\[h^O %'"PK\[D9S^Y-,@I\>u[8`PoF"lFQYu"L55>\[h^Os1/0=qRZL5#e7@Q[C*KR\@;IFs0DX+&?Mt8WiE%m %U8Oui#7(/+s8:mVK)_tQs7ZHl&H2S'lg+6e+I\alYctIF\uPb1&ZVk1WN3,%YHY72Y-+Y!]XG6`b)h^o %U7rR/Y,J;)W2RA*V5UDoXf_T+&?Vt4W3iq-U8"fnXIc#Z\[gq+orJOsUo:ArYHP+1XK&<!Y5GF!X9,E# %W;NLrV4s]ZTV2:Us.KCc%&';fU8Oui#7(/+s87rXK)YoPp%A=a(&e+.m-OHi+e>1!['[<V^9=uR[C!=? %ZQcc`[C<WKZEgI/^UL\rOcd/PW$&ISY-,7:Y/.-<Y->.9ZMq3BZEUR9\[e];VmE_7Unk$)^?DorYlh#+ %Xg.r4rj2d5ZEUP/Zhq$2Yct:3XSf(%WMZPkV5=0es/5jp$`B_nVl?X##Q+Q$r4Du\s4%)Kp\b%$rp]FT %-75L_WOf[S`Po7a]DT2`]=Y_h]sbM`Z*D?b^sngA^osph]=YJY^9tAjZ*C^G\%0'K]+)<[\$a#eYcb.? %]""fA!jT_`kdpGs"L55>\[h^Os1/0=qRZL5#e7@Q[C*KR\@;IFs0DX+&?Mt8WiE%mU8Oui#7(/+s8;'[ %K)_nOs7cNm(&e+2qtp3aq#20M\[fkZV5^>h[&^8,WX>`)WiN2'YHPC@ZON=jU8+KQdaG!7+1.i>ri61/ %['cHqor\8!riZR3Z*LL6Vkg-PWqEJ%YctI@['?m:W2Q_unuN(pVP^2dVPU-gU]dNhUS=IaUSO^aV$=B: %R]NS>.K9>Kq=jWLs+::Ms8VflrrW,rs8Mm.q>(%1*5&r/WN!#"WjoFCZa-n9YmIbC['d<R\@A*#rh]sl %e^^TD,e9qTricR;]"=`4ZM1[/ZF@<N[']hA"LGG:WiG9dp9P.5[^N]V\[JrOY-+u%ZM^s/Y,eW$WWT6! %W2]]n%'$>.XK8J2[[O;!.4P8r!r;Tb_Z,5fdf9@Arr3c5rr;rqrqu]o+<\M:d]TaZYctjQ]".aK'tLle %]Y)+r^SRd/Y-+YXh6AL^^p10D[fjO`_Q'X/\cfa]]XtfT^')$Y['?n"[e73=]tM1s_7dOl[C*L8\H9@R %[f*T6\GWf;[^EOBYmdh>Ycb.2[^MX+X=5UtrrW#jp[8'5s762lrt,&'q>^KdqYD?YW2$,qSt<+]W=l53 %X/rG*QaaH.Yd_g!WJcZpV\#c,Y-,@IU7IjS\@A]DXfSW'Ws5Z-XfeV$V>[(kW3NV7ZEi\sorJP$WhuPd %Unk#nY-4u(X8An*XK8=rV5C,fV59uaV>R(aUB6C5Xp,FKp\4UarJCQ2rs&K%s8N#trrE)uq@3K)p&+_5 %,cdi@\Y>h)rj)I,rj!WPZ^e\@['[Hic)cna4KY`i['[WaVk^#i]tLeZZa$e7YRn(GZa?m<X/DkmVQRD; %]"#96[.U[0Yct4-W2cl%Zi[VAZhq$(YRIeAXK&;$X/r;"W2ZcqVuEXlW<nNBXq20=p\b!g[JtjYeGoOH %%0-A's8OJqYcOq?W2T[)rO2d:rja,^\tm6]]Y)/5f!La/7's>1]=Z,(Y,\M0`PoI#]"#9L[h?3^]">AX %ZEC@4XgPmW_8!as]B[$$\HfUQZ`gR;Z+'_E!4r';qR6mE]!\oP[^N`U\$ifVrj;[0riZ7%$&jhG&.nU1 %r;HTQs+:9Lrt,&'q>^KdqYD?YW2$,qSt<+]W=>l.X/rG*QaaH.Yd_g!'rd+L3N&dUY-,@IU7IjS\@A]D %XfSW'Ws5Z-XfeV$V>[(kW3NV7ZEi\sorJP$WhuPdUnk#nY-4u(X8An*XK8=rV5C,fV59uaV>R(cUC3il %N/XnN&GPqsrV_cVK`D)O!rr9!rr;uo%KHJ$r;7fcX/Dl+U8#!nZM_!,Z6-EZS@lMA[(FT-XGr3%Xf\h7 %[(sJTUSG!*]sP,PZ*F;4&@&RJ['$R4Vl-DhY.(mO\@Cb0os"V'YcOc*W2cl%rj2[3qm$"%%'d(=WiE,# %XJr1tWN#lpri#^n$&jhG&.nU1r;HT*s+:9ss8Ms*s8Vops!T;"XK9.7W;X7)[fEr;\KADoUr1*_]Yi=O %[$I"G['[<S]>qspWiEJG`Oi^m\@DOI%Cj!\]=#&PY-+n/[D'?V_8!bK]Ci]>\$r]IYHb@Arjr0AqmcL3 %%(a$X['[9M\[T&V\@DOFriuI*ri?EbN33^'p\4UarT=-3s/H%tr;?Qrp%%\QrXB);WkQ3@['Za0W2Zes %q5XS*XfW>3TqdBu^,J!2X/iRpRBE]_^:pSAU].=oWrAstWrB%-Yct./XL5IBVP]rYU"lUVYHP(0XKAV/ %YHOq$X/l3!ri,jp&ZVk,USF`bW2-5aV59iYTq\:\UA^be\$m@Urr_olrV2WWK)bcKrql`prr3&noCMt] %#RUp@_o&@]\?#V4s02=()nWD]VP^;NN5@\>PHhC'St<<rTu=mQWN!/,YktU7YctC?[BHmA]=YVSX/)Vi %kcXW_%'R(HZE^[@ZaR6JYGqE'!3cC)riH=.Z)jt*riQL+Wi2qtUnspcVZ!=m\$m@Urr_olrV42.K)a3t %!rMonr;Qinp%A=a#S%?La2b3n]s.LEs0qg6(rEhoXf\djPKH6[R^flCV5:f9W6<AmYd",:s0r!9!4Vs; %"MDCV\[_s^_SELaX0&MZ[L9a\]"#8]]"P_f[^#_=rjMg6!joMKrj3$B\@]5Z[^`iPZEjJ6ri?$s!k5WY %rVlulrVcNXs+::As02MTq"X:UrVZ6Wrq5sUo-giIOJo+jVl-JnWiN2%X/i8"WN<(uVP_&<\f7!&^S2+1 %Wj8q.Vl6o,SZf6pWrB'tWrJppXp:buU8t?#Z*EMmor/=qV5g]$XK8:qV5pm"WrAt!W2QWnVZ3XpUC*ru %WMH>aUnjc^V>d@lV>d4lUmRN"$1.$JnGiLerVHALs,$dUrr2rtpAj[]rY"kqs7c9]p+3SXPcUt%Xf\b1 %Yl:pLZ*CO:YHb75X/j+P^EB#8`2BN;\$rH?Y.(m8[C*44YQD#/X8]F1WiE#&Z+.9Pkcj``#ck#1['[*C %XK)E'YdXM7"L##3Xf_T("fnl3X/`3!Y6V)-Vl?YoWN#ls!i`/srhp6mQn.OinF6JWrr)]i\Gq0\h#IER %rr3&pq!\4^!qu?frVA*!\@@p2Z,O)W[C<WT\@K,Z\$i`U[C*<Gai;=JUSH#8Y.)-ZZa7'R^8eiY[eI64 %[^*4<\d>XHYIM*W^:q(clF6Gp$aR(I]=YS_Za-mG^AYMB[^NUC[/RBB\@AlP[(3`[\$rcT\@&cRrj3<@ %Y-"_(X-f8)m-O62s8N#rqYK:QK)_nO./<T*rVcZbo)A=ToCFB7Y`Pf^]Vh[+WiE,#XK/D%WMutuWMZQ+ %]"/FlQ^>I]U8kN)Vl-K!ZCS2&r2TasrMomoriQL%UnXojZE^[uWqE>!V5:2pY,n_%V5:5trMojr!iW&q %rhf^prhBh!W2ZSgU84T[V5=0gs/#aj%\oheQn.OinF6JWrr)]iOoL+7s8N#t!r)HXrr*Q&o`+[[p@^&E %[$7Yn^oa`AYd",4*jMuSYHP46Y,eV?^V:n\S&D5&Yd_*CXKK%AUU@M5pTO_&X/l6+#HFf&Z*CgJ\*1'h %Y61i+Yd=YBZ*CC2X0B&2YQV/5Y-"i*X9GZ/YcFe(riZR,Wi)hqW2ZcqWWK0!VuEV'R$]Djm-sNErr2lm %qRuo\s4@;Nrr2p!q"X=WrrVofs8DdG0=\NZZ*D9T['dBP\@B)Z\@8oT\[AiNZH:,+-_mH[Y-,7J^9b/R %^:pV[]XIRD!k,D?rji6;Z*1[I!l)I`kdU5n$aR(I]=YS_Za-mG^AYMB[^NUC[/RBB\@AlP[(3`[\$rcT %\@&cRrj3<@Y-"_(X-f8)m-O62s8N#rqYKIVK)__J$NC&&qtp6cq;q&4rr!QI(9Y0WVRj@-Y-*tP\"TM, %W2QSWP6fL\Ul^ZSXK8ClW;NLfU]dNeTVeRrVk'BUWMuX9+ntEmr;?Hks8VhZs+::Js8DourVZTmqZ?!O %nc&P0)B,op]rJf\T<kkkR(T;n^TFW>R@2UUWg8qlZEg^DY32teYQ(d*Xo>C"WW/dnW=>JlW2ltq+X-UJ %mem"[rr<#m_Z,5fdf97E$N9r$qtp<gqs!\Brr4#[*OW\uY/\JY]"4N+`3$/][C*?6T\S>-SXh(;\[LP+ %]=%XH"LkkK[^c7E!k,D?rj*'1V67#*W?EGZmdC#Nqu6Wqp[8'5s762os8W)tr;HI;rr2lpmNEaQW2PHT %Ya;5a^qc;@Ya2AlVn'@?Xc5;"Vid+FWV*6jVuNRiU\phfTWtd$R0]:O^5ImsqYL3soCMqZs8)TfMZ8G2 %rVcfqrqlipqu-Kn+7U[)Y-"ga['Z@(X2MrH[C)L/Z)k^TZa5i[5H^B@[IgW5XmrM(Y-+n.XK/D%WMuho %Vkg],rgXOkT#$AE.Jio@oCMqZs8)Tf[f:sZh#I<Os8Dim!<2rs!qRiirid9#]Y(#FZHUOf]Y'uL\[9Ar %]"4>!7CA_Y]_&Vo[)KBR[C*C?[0X4K[C3KNZ,4BWV@]Q!a,lB6qYL6`oDSXfqYL$Is+:9Os8W)tr;HI6 %rr2lpmNEaQW2PHTYa;5a^qc;@Ya2AlVn'@?Xc5;""/h9DYOnfoVuNRiU\phfTWtd$R0/qJ^5EDX-i3]> %oCMqZs8)TfO8jh3!<<#s!<)op!rMlnrVmu0-75mtXc'QnS?&^/`146CS$B6"^V@+]P<V:7R$b;RY.q+* %XUhS;XfSV)X/`.uW2HPh[']h&&>#K0N/T4^qZ$0YrVccmqY@c'K)aI&r;Q`pqtpHnrVlrj.4P8#)32AB %UU%2LbbMh`U:IhA`l>U$RRKZQSt<Ue[Hk38Zi[YC[/IB<[^ENO[C*9V_Z$DDUnl%mO=^8)s7>j\rVu`j %q<.d0s/,f@rr2lor;6?eo)AXPkl(AS/X`$MPa&J\[%EtrR@17`Z(S.u#`FU!R$an\[$pWdWi,cir1X1d %rhBFis.Kb&USF!_\I\`?kPG2[qtg/Ts+::Hs8W)sr<E2tp&G'Xli-o(17k)aQ^>(g\"TM(SXm-r[\g=7 %P*.u%TsDAFU\(b.XllhcYPkR)X/`3!W",Z(WhZ>oUnj0a\I\`?kPG2[qtg0+s+::!s8;ipr!E8tr;6Ba %s8VHPrr3rpTV0`*T=hqRWiEe0V7XIUXgkm/R7*sN\\l=aoX=7r]<qRF"LbbH[C?(B%^NRQXf]49X-pZ7 %'EA*qqYpWoqYKX[K)bEAYlFb&rr)in"o\8mrVc$\r#>_<YG\;4UnjZVVm!;.Xf[qmXq2/ATqSEl[%+,g %WN)osVYd4iV#@,!SXlXTXKo-q0/*%lp#uVZs7uKYrr<#tN;nS2s8E#tr;?g!qtpEnmf*5*"pVH6WPGC. %USFlqZF.!DS[>a@(p0g<Ye@`HXfh2sril[3Yck74XK;E%'<%UuW2Qi(ZBR!qp@\+Cs8Vojmf*7drj_u[ %s4mYPrV??ps8;fps6ose)[H_XZ*DBRYH+_1]"5Pb\YQjL*Zh\mYd_NfX7Wj_[DfQQ\/i,j\@B)Z\@K,Z %[B?[<ZFIHURklksp%@SLs7uKYrr<#tjSsi3X8i5!rr)in"o\8mrVc$\r"fA7YG\;4UnjZVVm!;.Xf[qm %Xq2/ATqMRe['Z@qWN)osVYd4iV#@+qSXlXTXKo-q0*s<*p%@SLs7uKYrr<#tOoL%5rr;usr;?g!qtpEn %mf*5*"pVH6WPGC.USFlqZF.!DS[>a@(p0g<Ye@`HZEEPsril[3Yck74XK;E%'<%UuW2Qi(ZBR!qp@\+C %s8Vojmf*7drk8>`s4@;KrV??ps8;fps6ose)[H_XZ*DBRYH+_1]"5Pb\YQjL*Zh\mYd_NfX7Wjd[D93L %\/i,j\@B)Z\@K,Z[B?[<ZFIHURklksp%@SLs7uKYrr<#tl2QA8V#LMqrVc`nrr*c*o)8"EoC_c4USF9W %WO]R3\$qs'U8K:`#c4A`XK8.hTWIdaWi>ol%&9SnUSFZ]UnaicS=BeaQ^9>lmJ[%as7uZn!rr;oPlH@8 %pAb'irr4/8pAaaUq"jhHUnjK\X1Gm:]"4Z7VlhO#Xf\2&[B-C.[e-`@YNN+gYnaLIYHP(0XK/A$VQ-Ye %SZA'B/aVj%rr<#orr*!!s7X8.K)a:!p\b$hrr4/8pAaaUq"sqKXf\A)Zbs\\_SW=UY-]r>Za6I>]<\ZF %]_&W$[_'!I[fj4N\$rpG\-fRP\>Q75St7h0nbrLfq>U?ps8VfZs+::As/uA'rr)fpr;Q[>o()bImdp,E %1S^_6WN!G=T=;;$U8"P3-)IH(XK8.hTWG*bW2cipU_BMuUna]]Unjc`Vjs9XQ^9>lmJ[%as7uZn!rr;o %MZ8;.!<;urrr4/8pAaaUq"jhHUnjK\X1Gm:]"4Z7VlhO#Xf\2&[B-C.[e-`6YOSgqYnaLIYHP(0XK/A$ %VQ-YeSZA'B/aVj%rr<#orr*!!s7Wo$K)aX+p\b$hrr4/8pAaaUq"sqKXf\A)Zbs\\_SW=UY-]r>Za6I> %]<\ZF]_&Vo[`,]S[fj4N\$rpG\-fRP\>Q75St7h0nbrLfq>U?ps8VfPs+:9Ms8N#sr;uQhrr2j7r;?9d %r7iVGWiiM.YI'X_Z)+9HL5)(_`0m%mVZ<I`VlH]nT`h$]TqJ(XTa@NrXJ)>W/M7"[#2fCPp&+1Cr;Qci %O8jh3pAY-cqYpcss8V%*-`d3M&@\*s[Ap5\NK'U(bbCi9Z*Eo%^TQh(#-G#/XK&8!rML10YG.b]/1ghX %hYd'>r9WeJrrD`(s+::&s8)ZmrVlcro_SS-r;ZfV0JKlD\@K/bU8#?+Yr@o3VP_e?W4'1EZLkKh[D93L %ZimeE['[:=[1Bp_Xf\KW1]QIos7Q'_m-OZM!;5OTK)_PErr*l5rr2EVnbW+Wn*g0(.\iH$WiE+nTs'#u %+hG5jQ'J5T[[j4iSb/bYVYm%hSt;RGT)PAc[ZcoTWX(<?jn\iPs8N#srrhl^qY^8Ts+::@s!7RCs7GsV %s8W&io`$BjURRaRX0&.l["X2]_82_7YJJ&QYct,!X2M+&XT#=+XK8J'WMlcpV@C)%QE$r>jQ-(2q>^Hn %rr3,knbW1]^]/ocdf9=DrVZZnrr+2@s8V]^p&G'jp%A>@1T[CJ['[6BXLjIO0#u#.Up\4^XgPR>oWmtm %\?l4Bs0MU0%E>0<[C&-_li6t`s8N#srrhl^qY^9Ws+::As/Z2!r[%F?rp]FIqYL!Un,+XbURIXOWiMhe %YCV6J]"4/lVREq(UnjQXoqe[cr1=+`StDUGrh'b0PEW#H0]hElr;?Torr33&s7,XUr;;EOK)b`J,lRcC %o^qhVs8DT^s!fLnS"$IZXeVYuKnUnj_4I7%_83%RYc78q\ubG'riHC+XK/D$W2T]m%CqdjWi@f7jS/KG %s8N#srrhl^qY^9!s+::+s8Moor;QZorZqFAs7>jTs8W&jp&?g(XJDZ!['d!:]8_e&a2b!O[Dp4g[C*10 %ZKAL1Zi@E4Zhq*=`hT<:[63d@s8N#trr2os"S)$Yr;>ORK)__Jrr*0!rr2HXrTrnMr"\Dip`mD_M2Ad? %VOo:dX-AjATUh[G"/M9MWh#s^TE:g[T`1VkW/m"BXrm0&s82lprqZuWs8VWZs8;fpq"U!OK)bQE#Q=]& %p%A@Tnc&P+m.g?#]Y',Z];_d)/M45rR]39`W2QnoU:%;,m&DA8YHG"0XK8G$WMl_mX-/XKXs!0#s7uKb %qYK"Is7,XZr;?Tipq?]Zs4@;Mqu-HlrVld$qu?]go`+IOrr3l&s8OXh`KQM'Z*C>e27T?RYHP%1Y-b+) %]&'^-Z2V*5[C*BK[f!NM\=]D(\L[CIs8N#qqYK"Is7,XZr;?Tiq!%g1s-WidrVl^+rnu`3+!7\iV4=&+ %WMtof\.FpjTrG#bSXljRStMgPUSFXaU]7(fV#I4iVZ*L2UCj5pVP^/bStVjXVl-&aWL]HFrgjG#Ya2)\ %VQ6a7(_6K4n,N:^s7,XNp\4R^rfR54s6K^brVl^?ro2r9+X++qW1]e:Xf[f#]pkLhYct(&V6d/#X/rD) %XfSS(WVi^iVpMCCWV*8'W2Qi#X/i(qW3NM.UTUbnSXobS(pgQ:Vl-JqXVi#UnF6JUr;Z<WoCr"Vqu4;/ %K)`Ucs8Drp*rb3[s!&bpZ`Bgp19e!L_82e;XL>R>X/ie9Z*UjGrjDs:['R'Dos=S%mBYr[orTgIXKf%6 %YGeP(['I!8]"5#BW3*2&]Y'l=XfJ\1)B/VCmf*%XrUKFLp\4R^rosH7s762as8W&sr#5Rmi;4T<YHOdm %S1CS<NjuTaQ(b1VTq.aUSd(dZU8"EXV#I.hUAgtfV>d@kVo,8AU8"N^UnjTUTrP#gS>iKYR@4&G'<n^, %UnjlgWu)]On*g;Rqu?3Vo*"g^qtpAJs+::Ds8W&sr$;:$ir(#DZ*C7#TJ*FLPJ+Z!S#<KpW26>sWMur" %XKAV+X/i5tW;*::WVELmWY)2.Xf\Y)V5U>tY-+P&Y+_DWrh:79Z^I_hW3*0>)?0-ps8;fpnaZ5Fp\Xje %Zi>XWaoDD>rqmi:j5^.a,I=_WU7sEIYa<2BTV/Bp[]QU2\ZrEG[C-"B"LPPBZEj/0o!8"qkcj`^/Zc%Y %Z*1@0XK8e7ZDY:FXf/2#XfK+IT<55rYco#arpK4Rq>(!ZnalMLqtpBMs+:9ArrrB"qu$Bjrr*N#neN"$ %2E%:lOeoY#X/i"qWXGH"X-B<OT:VXHT;)=[s.TFfrh]UkrhmZ/s.oUfrhC4&Unjo`USY6#[^MX'W0F]t %V]?fRq>UBpq"4sdqY'XXq>'sdrJ^c.s7$$lrVcWkr;HWp,5(UH)3Hp>VNmFI^V@%YWNi_*Za6.%X/`+s %WMunuX/W"pri#^lrhenXkc+N\q5XIqrMfdr're77Y,J;!['[EUSZJoZ\$r=Y+8Yj5rsSYqp%nCUq"aa` %r;F/*K)`dh"o\Dsr;?NmrttJ')]P#(4K4^8YJ\8d[]['IXLYm8['[.;Z2V*3Za$e.ZhLcrZKSOcXoGR& %Xo>IKXfeh4['[9W^r=9i[C)R=]rWD%qtpEmrqH!Sp\+=Uq>'sdrT+!1s-Widr;QR)rVuoSoCMt\(r3qS %U8"6MSIh!KX-f9PVP^,_U7RmFSXlGQUApncV#I4fVSf/MV59fVTqSE\Umn$MY*>0HWiCu8Y,.u"P*.]t %q"jgkqsEeNq>($fr;uoprVle\s+:::s8W#rq[NN(s53MBs8O%U_jmR"rh9XcRB`BVY-"i*WsYf%V5C,g %WiE"pVZ*OkVuERWW9L;RW?nUGV5:)fY,eUtVP^_fR&I0jO,pQEW3__Q2Z!:Iqu#jKs7uKir;?]pr;HWo %_#K#d^]4?3rqd0's8V$NpAb.5`PnIJW;`XsSt<BdV#I\0YdCdBY-+t3Z*UdBYd!W&mBYr[orf[HZ)aq%XgG=:VlZu2Unk?,\=&bqYct[,RQ:?Fqtp<Wli6\Pr;?Kpr;?Nmrp9Z:s762as8W#rq\oG5s5*A=rr*bM %^mLjjSt2F9PH1(<Vl$>dU'@?`S=H.@T`1\cT`1bdV>I.-UEub5T:_gNW2-5YTV/HPPbb=ZMi4a7V6Q2H %2>HtCqYT[Is7uKirquuurVZTlrr.fTK)bNDs8;ln%K6>,ht?[Bru8knS>E(]U'I*SZ(IYkXf_T'$E0et %VP^;lWi2elri#^lrhenXhl6US-*+)CV5L5oX/htlVR2_XW33:aO0PX^Z]p\4qYL*dr9`nOq>($fr;uop %rVlf)s+:9ms8W#rq[NN(s5<VEs8O+Y`Lj*-rh]giT!kGjrj*'<['[*@Y-5%6Za6sAYi`7cZKSOcY9gHY %X/iA)['6d4XK9"/UpIS@R@1UiYdp3k3W8pRqu#dGs7Z0ar;?]pr;HWoir=W1Sc9B$r;-<fr;HTorr+5k %p(7n8Vl-*a[fW50Zj)_hURIdGTDG5[U&LhdV#I4iVU)%1U)p))TV/$RVPBoWSt;de[\T[nW2Q/ZU89.^ %s6An>nc&OhqtpKmpAY*lrr2lrrf7#1s7$$nr;?Egqu$Hmrr3`^./=PkXK&:p]Y(qkVRj@,WiDbjVl9Qn %!3#Uhqkh]<rMfOj*2]U3W3!#!USXfg]"4i;VQ?kiV5:(;-i`Q"o()e["8i#opAY*lrr2lrrjr,]s2=p@ %r;?Egqu$Bl(+Lg2()F*UXerkJ_831f^n7j8Vm*D1rNc=*os4=so!.D^or]"4YH4h.Y-P77WN)u'`Po0g %Z*q*<riHAV/cY;.o()e[rqZWerr<#trr)lrk5U&5R/[p!r;-<fr;HTorr+5kp(7n8Vl-)p[gT[STX;(i %USF9LStGkPrh9=drhTOirhe#:oqEM&US+9SU8F]\SXuFL[^N!,USt,[U8"J1-3*8qnaZVY"8i#opAY*l %rr2lrrfdA6s6K[ir;?Egqu$Hmrr3`^./=PkXK&:p]Y(qkVRj@,WiDbjVl9Qn!3#Uhqkh`=!3#Lg*2]U3 %W3!#!USXfg]"4i;VQ?kiV5:(;-i`Q"o()e["8i#opAY*lrr2lrrkJJbs1eR;r;?Egqu$Bl(+Lg2()F*U %XerkJ_831f^n7j8Vm*D1rNc=*os4M#mBPlYor]"4YH4h.Y-P77WN)u'`Po0gZ*q*<riHAV/cY;.o()e[ %rqZWerr<#trr)lrli2S:o)GKb!ri)orq[-%s8Vm"#QOi&p%9]1Vloud#FD!PVO*XGRK8kMrMKgnSt;UN %V#I+fU\gk)UApnbU`?)&U8=NUQEd]^XK7q^UD=UqlK[g;s82]no^q\Ns8;kOs+::ErrW2squ6Eqqu?]m %#RLG0*V]:XWiE@qSXuFCUSFo]SZAKZWNWM.Y,S7oVQ$QlVu*@TVs()SVuEUoV#@87V5L5kV59Zg[%"8& %T:_qt)(k1?n,NFbqu?9ZnGiOfrr;oqZi>XWb5VPBqtpBh"oJ?"q[!T.rtG5(/Zl.`TqS6VTVn]lUSG&n %Wj2N3"gP23YHkJ,Yk#'nZ08CaYU-ERZ*CU?Y-5%7Xf\D4]qr3IW2Qd>+#<?Tnc/Xer;Z?Yn,E=brr;oq %huA<.T)SlkqtpBg(&I\!pa7H^p%&+]m2d;aPa&_hVl6O*R&-XKR[TqJVl$>bSt;XOV#I+cU].(,U*$#" %V59u`StVjVU8!jj`L<BiTqNn'n*U,Rlh:&2iT^=@!WW#ore^Z,s7-*jrqlTlq'Pt5q"Z<dp@e.Ys7%6U %)O[#-^9"K?Su\ocUSFflYHG%,V5:&hWrApkVTYn5V]V\/WiE%tU8=]gVl,p'aIT#uUnfL2o'cVYm.U/2 %i9C1>!;ZQl[JtjY`W$#=qtpBg!;c]j+t4u8p\+Xeo->S%S=II5Yd:[2Yct"*X0K.C[^NHCXfo(;l`fra %kcXT_+0;QMZa-m;Y-,4:YFs:jVQ$PrX>0MFoDejZq>'".lMgebrr2Ziro*m/s-`lgrqlTlq%3Dsp\6*` %p%@nTrp:aJ(6k$u\[eW:W0jEXS!oe>Vl-DhTq7jLUnn!aqkO.d_kJ3ET;AB[Un49RW1p#M`Pn:;StVi+ %n*fZCrp0:OiSae$r;Qcnr;M`VK)b3;!ri)orqRo;q"XY5./*B,s8VU4+W?c:^:p\OY+D\pTqeB^YHP+3 %W26>fWiH&rpnlE9oVWe+UT1>nWM65cXf&(aaN0pGTqnJ6o()8Ls6TIQi8EktrrDlmrjr,]s1nX9rqlTl %q#L9jq'%7:p\4C]s77K]*LrY:_Q^AQUTgu"X/iM7\$i`MXf\e5Zgb3dYir7_YTKsJZa6sCX0/V6YHOVH %dAEnBXK4/Oq"+Ocn+le<iTgFB!ri2nr;PjYK)bEAU]1DpqtpBf(A[n+7K!)Fjo=c:o`"jg',-b#S#)sK %ri?*p$_sGhTV%jLTqS3UU\1A-U%>$!Unjc\Tq\9XUnj`;K:TTb&J>$.li624rVuoqr;Q]uqt9X^rr.NL %K)bQE!ri)orqHlsr;9"]r8m&?n*fuLrs';TSXlCQWh'-o!i`/tr2'UpVl6So_l*:,r2'[rVl$>fVPa?k %&uC>;TY.oO'`[Ods68eHs8Vrlrr3)roCN"]riZ9Qs2t?CrqlTlp^?oqr'gP]jlQO2n+Zh]#8e;NTVJZm %U&MJ'Z*CL8Y5YR'YPtd!YO\plYir7]YQhA;Yct=8Yl:p;YDeF;_SR0.s7,XZmHsoQs82fq"8VNYs8N#O %s+:9BrrW2rqYp7)q'76@rr2rtq#('bqYK+DpELoUVl()nT:_=IWhGfIQ^=;=USOTWoqKd+oqVParLaUs %UnjTYV6ZegZQULir;QL#qZ$TioCM_Ns8DorrrE)urqZQqrVZSUs+::@rrW2rqYp75q'.->rr2rtq>L9g %r;>RNqBmYdX/heeUmSBjVk0KNSYZ7as/,[kqkh];rMKCfs/Q$n%B68'U8Y$!UnkFD,Q@]Aq[iW(s7c-V %p%A@^qu6Wqr;Q]krrW/sr4W,^s2G!>rqcKjp]L=:,M`7t'`%b-qu6TVrV\5sVm!:tW2Q5r\?>e,!3?+( %o<.hlo!%>\os"J'rN6O7Z*CC9ZG<K?]I><-rt,20s7u?\p@eO`qu6Wqqu6TjrrW/sr9=65s-`lgrqcKj %p^m6H,i&Cus8Vllr:p-bhtQj[,9rkZVjO*KPH(XVR$a5,Sti'VTqV.Rc_:$,s/,af%AoqsSu&9hTqSe9 %+oM9;q$6crs7c-Vp\+ahrVc`qrr2`n!r`&pQN)R:m/I.dqYL3d+o*?-h#@<Qs7uWlqY^9NqYDQeUoUPe %UnjB^Yc"(aSXlSUWW/jmVu*@<VZ<XfVZ3[pU^a<$VkU,g[\T_-,:!3erqd9's8ViboC_eVqtpBms8;lq %q>UNpr;=G3K)`Xd!ri&mrqHTk,9u"BrtP;.rql]ojo,-./#TSSTr=o[\@A^?V#[RqZ1G-rYjJ[YY4]%! %[/I-8Za$d:ZEh9GWk9c0r;R?-s8Vofp%J+ZqtpBms82fpq>UNpr;?!_K)bEAirArUrVuiqrr)iq!<;]j %kPlh*r;$0go^r1[qA]G5qtTs^q>L?nr;$0Zn*g)J-)ml%[^N&t%$[fVPI%TpP*3&=S!j5L$_<r`Tq.aG %SXlLCRJro^S"$5FTE:aXT_tJgT:_[ES=Z@Frh)!<T:hpQUm.+FT:_gNT;efVU8OoYS$9,dTV/3IPc::I %'EA*ulhLM[qZ$Tfp@e@ZrqQMFs0ht*rr)lqrr2lqrW)ujrpKg_s"XHLq>('_o`+da)u]a2p\4IXr;Q]o %qYKjSnbi;5XK7Gn\uM0dYaCff\?;0b[\9CerMTgoVl-KmU]dEdVk9U\VZ`]eWMQHaVZ*D#VP^8hVPU,a %U8"H[V>d@kV$j6#WgB'UTqS6VTrTK?RA?g]St<6nSYMs[Q^=bHTb[V-mHs`Ls7uZno(D\Nq"t$grr2ks %s,-jSrr2ots8DrrrVlcrs7H<Rrt>8-q>('_o`+da)uTX/p@e:Vr;Q[Mqtp*Xo)J_?YHO)&^94*#[\'2, %^U9Z)]Vh[)Y-+t3Wi`D+WiE,$XK\Y%YctC4WjDZ-pTFY"XKDH(#d(20Wi;tuXK;E'2ls*_YHP4(TX_#% %Xf\V1[%a\/Z_s_5];D[2Z_3tuUnek-s7#OTs8Vurs7H$Yq>(!grr;usrR_($s4dSPrqcZorr)lhroa;' %qtpEnnac8N-n,,mqu-Nns8W&pqtTp[rpfOWrTjXi+]NuBSti':]tKPjS#<0NTV/*_XeMP`O,oI/Z(%;T %U7.PMT`gjSUn=:KT`:_bTF.<_StD[KTqS*LSc5-0SZo>bUnji`RA6OdT9Y\IZC[YYT:`$eZ5F2brr<#P %gAg@!rVuokq"Xdbr;VBKYQ+S#qZ$QorVuNhoDeL`48\pTs7,[Ns!T;qqYL-grVlfpqYL$_q#BsWs8VQo %#Zue7USk#L_82G'Trb>dV5:2uZ`'h#Q'I`H\Gi30W1T]ZVPg)[WMH?]V>I.iV>[2"V5:&dV5'fZU8"Eh %Z^I`jV\>SsV7NCgR'a5nTV%pOWjT5R&eb3D%G]b=kii!Fs7Q-\q>'sfrr2l#s+C=Orr2ons8N#rs7H<R %rsel&s8VW[o)C*ds7uKfrVZ`orq\/@q>^-\s8VWt$X8FCVQR(daN0pCVmE_)XK8Y:\Z`3>S"$%a^8S-7 %Z)O`%YlC^)ZE:8%YQ(^$Xo>F$X8T.DXK&;!WMuo1]VD^8Z*C..Y/@<6TtS.>Wi2u!ZbF."()HoL"Q/,: %lK\BK"o%igqtpBlrrW3!rS7F)s475KrqcZorr)lhroa;"qtpEnnac8N-n,,mqu-Nns8W&pqtTp[rpfM* %rVc'c"B9o%Sti':]tKPjS#<0NTV/*_XeMP`O,oI/Z(%;TU7.PMT`gjSUn=:KT`:_bTF.<_StD[KTqS*L %Sc5-0SZo>bUnji`RA6OdT9Y\IZC[YYT:`$eZ5F2brr<#PgAg@!rVuokq"XdbK)_kNrVlZnrr2lro`"Xc %nGbTIqu?]do()f/.0'/?r;HTnrr)]iq=saboCN"^n-B;%KnZ;"ViAO/QBn5GXIZ2aWjB%1W2GoGR(0[* %U'dikT;JK`TV/9[V":G[VZ3LkU^<loVP^2bUS4EV"/E3/RJj#sS>E'nU6q=T[%O(aTqSKo[2T_krr3G_ %h#HU%rVuojp\4LZr;Q]prO)ZWs8DurrqcZorr)lhroa:jqtpEnnac8N-n,,kq>:-h!;uim/,B#@p%A@b %nd>h0Lkqq2Y*@#KSXl[bZ_OV'Ydq<JYHF@aT>&%<XK8\+WW'+)WiEA,XnAmtXS].!XT#:!XWadGWi2nr %Wk?!>YctC;V66u=X.c6#]rJ*2X/iS@^*OO1rr3,YhuE!,rr3/rq>'pbrr2p!rr2lTs+::As5<qUrr;rr %s82fps7H<`s7H:#s7,XVqu?Wn+7J[rp@eF_rsJc%qYC$cq>^Kco)AUkeM/cnUa2b8SXke$YF:oFWiDJV %S!B8,Yct!`N1li7UmmjITqImEUR[k?TEV$`U7S$NrhBFcrLG@3USa9?VP]ucWg0'MV4jTUTVnQ['c\4b %s8VKNl2Ue[s8Vcls82cnp&BXD[/^+(s8Drsqu6Tpo`"O`qYpBk%fc(hqtpElr?(Lsr:KXXrVllrrqZQi %s8W,krr4.o1c-&IVlQJ`P*3/CSsusgTV8'MSY3O(YEbBQUSFf^U&LnlTV/6XU@kA^VYm:jVZ*IpUo($g %W",Z#US=KXUnjoSQDgaUX9>VkSYrCaU)^//V&(0op&G'[lK\ELqZ$Tes8VokqY^9irr2lqr2]jRs8Drs %rVliorr2rirq6<`rXStunb`4`rV[i,n,2bIq#10or:p'_rqcZps7ZHl+keh4)m-6JVP]`J\YQ$o[C)j. %VP0][]tLb?RBEWmZ`:&)Y6Lu*ZE(%0YP57"Xo5@#Xo>I)X0&N'Y6:r.Wi;usWXGr!S?B#mZEg$qXf_Q# %(pBs>*@)p-s8VNQli7"]s8V`ks8)WirVcWn!<1UMK)aU*!<2ur"T82srVcWk!r`)srr)]mo)JXer;HWm %&F'5poCMVEnK@l3rq,jXrr2]m#5\2qrp]pd.K9,;r?3>RU8#0-Q(FSNK7gXqOfPOYOccN5T9l+>V4='K %TV%[AU7.PDTE:g\T_tDgTqS6WUm[aCTV2:XrLY!lPH^p]Xf\LoTTHITUnXTNQn'L1kl1SNnaZVY"mYCJ %s8Vcbs+:9SrrE&tr<3&rrr)fmquZiqrr2lmrpp*hrr2oprVl^+l2UeToCVSC+TMK@naZ>Nr;Q`rrr)j" %qtpEno)AY;r;?R>,Ft^/]=XK*U:#f5^6b1mZ`KUaYGeCmUSFi_Tr"T]TV/6UTCo&[VAZ5,UnjiaVPpMp %St_sUV5L2fV50o`Q'JYR(9"C=WM6,M[&0^rUmd`(-R\3Zs7,[Nrr35hlhLM[o`+sjr;uuts8N#sr363R %rrE&tr<3&rrr)fmquZiqrr2lmrpp*erqu`or"ePss7>jSnaRb%s8MKUo_SF_rVlcorr2p#qtpEno`"k5 %rr2pI.\s/I_82bAVn.nK_jm7,\?VWsZ`L7)XK8e0X8]:%W<0?(WUm8*XfSV)X/rJ,YHb@0WN!#%Y-"i) %X;[Or\?<!A['$@+R(B?!WiD_b1+b*Is8Viao)AXplg+?Gs7QElrqHEmrnRO*s472Mrr2j!r;?QmrVQKo %rVc`prVHNas8;lorVl^+l2UeToCVSC+TMK@o^qqXrqQNnq?$ZqnG`D8q"Xe2+e,4#\@@fqT!*d![ulfR %X/(l?VOsKISXlUIS=lOIR[Tt>Re<<TTqS.WT*_3bUSO]RS=H7Frh9:_)O$AhVP^JtVkB]EZD=:jU6q;u %-77sUrp]IJrr3/elM1DZp%n]?s/Q)!rr2j!r;?QmrVQKorVc`prVHNds8N&rrqu`or"/,ms7>jSnaRb% %s8MQYpAFjfs8W)srri5rs8VZhs![gCs!&bZVP^u;RA-F`Lkrd3Qa=$"R[UFYW1]o\WhH,_V50cWW1T^T %V>d>+V59u`V5C,gWiDYbU8=]aVP^2cU`6.qQ*R?eY-+auU6;m\VPL#VROom7lMpnSo()e[#OC^Ns8V`k %s8Mrurr2rsrr2i's+::LrrE&tr<3&rrr)fmquZiqrr2lmrpp*erqu`or"ePss7>jSnaRb%s8MKUo_SF_ %rVlcorr2p#qtpEno`"k5rr2pI.\s/I_82bAVn.nK_jm7,\?VWsZ`L7)XK8e0X8]7)WN!/%WUm8*XfSV) %X/rJ,YHb@0WN!#%Y-"i)X;[Or\?<!A['$@+R(B?!WiD_b1+b*Is8Viao)AXplg+?Gs7QElrqHEmro*m/ %s763Irri<!qtg0grqlZnrqu`orp]serr)for"&]%r:KX[rU_s)r:]jHqYL3es8;co"n2Egs8VuqrWDWX %p%KI#-mBk(R]E0WKttKK]tL)3OIM`)TV.F;S>MjJrgj7^S"lC>oq25V&tbefStD[KU84TNR[Te<T:VXF %rgY"8Z]CWHS"$+AS?%[Y[Zm"-/G8l9q"44IqYKFDmf*4ho^r1Vp%&-7s0M_.rVcWiqYpKkrVlforVlfc %s8N#rrVcX)qtp<`o_na\2)Y=*p?),Drq6EiqYpEm"n2Egs8W#rrugn'p\FV7,UAnMY,.tP`Pm>F`2KW% %V59fbX.5lWX.l?fUBI6_W1KURU]REjV>R+qVP^;kWLTTQUSIgarLsS*[?7#NS=H=E'V2=d\$qWf/M6\o %r;$$YnGE+ImdC)S"S;6boCMt]r;H]prqrhsL]7MUrVQHfrr2fnrr2iorr2Eerr2lprVR3'qu$*YrVc@G %2>m1Ak4SEHoE=sarVlfqrrqlirVuorrr4J>oD/Cb0.JHFTsLc!NloLra2b9_S>`B\Y-+CtX0eq.Xf\\) %Wj8S%Y-.N%!j/T+rMpC/Xf\e2YbS(mWiE/$X8T"<\$qQnT:VXMT:`9K\[e&n0/*/#rqlHao(i+EmHsoQ %"S2-`oCL0*K)aR)"TA;rqYL3jqu-Nnr;HWonGiLerVc]m&,Z8%o^r+\oJJN(p@dYFqYp<jr;6L!n,<4b %s82fp+o^s!p%S2/+sNJEX.l>B^qb3.]qD$[S"#\9TTPb7VOa:WSckOPUR@PCTDkJrT:_^HT:hjOUnj<F %R[p"ASt;MPS/nrBO.;`0S"Z@BX,aWsPa!^Mp%nO[o^qVKqWRA8rr3,no`+UWp]#jFY5\Y'rVQHfrr2fn %rr2iorr2Ees8E#trVc]m&,Z8%o^r+\oJJN(p@dYCp\sjfqYL3hrrqlirVuoqrr4,3o(VtU.O6:0S?A]b %MT*Pa`5JUQR&-XOX/hbaTrXo^rhBUhTW"HRoqVYdVPX3d$)XSuWMuD[T;/1\V#@"i[C)-f)4d:fU7IjV %O12T`Pq=T]r;?B`p$hkUl0e!=rrhrbs7>j]s8;irrVl`!s+:7RrVcWiqYpKkrVlforVlfcs8N#rrVcX) %qtp<`o_na\2)Y=*p?)&@rq$?gq#13krr3/jrVccrrVlgCoCMeWr\#`NTqSfmWfG6EK#bp5XIQ5fU9:Yk %X/iV.X0&M*Wi?-+W2TBl!j/T+rMpC/Xf\e2YbS(mWiE/$X8T"<\$qQnT:VXMT:`9K\[e&n0/*/#rqlHa %o(i+EmHsoQ"S2-`oCL?/K)aC$"TA;qq>($iqu6Tprqufprr2<bs8N#rs8;ln'*%OnoCFBtmJlnRo`+si %qYL-frVm$!rVuWdrr4/;q==Oar;Q]ekN=HM22-aJVP^V<EOiWKN/Y?"Jt&3tV>QkeS=HCCRIHjKT)P>i %TV8'OTqS6VU7e0NrgadtTrXcVXf[Y`WMQa7(ag^&oC2e[nbN1gqYKjas7uNkK)_hM"TA;qq>($iqu6Tp %rqufprr2Nhqu?]qrr)lprqdB/o()DD..-F%p@e.XrqcB`q>($hrri8ts7c9errW)po_e_,o]bTo0K=lE %R&d9tG^.*BUR%4aNK'd,T<%ma"JMNgSt>VNrh]Ogs/#^l!i2`lri#jorhC7(U8"`^TWbP\X/i,$)&XhN %o^q_Ss76!c"oA)es8Viks8N#srVl`&s+::Krri<!qYBsds82fps8MrrrVlf`s8W)trVufpq\0##o(2H$ %mHsrIp@S:\q"==Sp\b$i"T/)rq"Xjg!r`)kr;R`4md;tk5)kPlYctcfI)X(%R$bpUOJo.X[&^8-XT#7% %Z_s_oXo>F"X8f:#XTGT,Y5YU+Xf\Z'WYMA,Y+hYqZ'2;lW3R?].Ot2eo`+s`rr;us#QOi"q==RcpXB.o %s763Qs8W)qrri8tq=saarVufpqZ-QnrVl`prVul^rrW3!rVl`oq[39!,9um]s5s%Ks8N#ort#,-rV-?l %o^r1Jl1XE-p\Ys-r;Q]eoB@YO09_U#Vl,,uS?/fNR@1%AR&0_N"J)*\R@3W;r1F"\rga%_rM(X4TV.mK %T:h^E\!<5RUSX?F1_'Kbp\4@Rs5`86s8V!JoDJ4Orr3-#rr;rqo)F=A]Dqp1qu6fsr;$-_rr)lprqc]n %rr)ios8DuslMpn`!<)oprqd'#r$*HZs8V6TpAb-hs8;oqrr*E+r;?<hs7Q'blg+<3m.pYZ)#sX/p$4+Y %1mjZ9Y-*\@VRO%$UnkDhSZ;U]"JVWkSt>8D(Sd_!Vl6PnWMlYiUnsobSt<HXQDLFURM;2K&-)\*q=jX` %k2uC;s5EVBr:9FXrri<!s82]mrrW3!rVZQnrN#sZs8W)qrri8tq=saarVufpqZ-QnrVl`prVul^rrW3! %rVl`oq[39!,9um]s5s%Ks8Mfnq>^<ir!iQ#p](9epAaLGq<m\Jr;Ru;qXH6n31QMHZEfLNWO]R-VP^i" %VR*>(WiE,$XL+q)Xf_?"r2]k!ri7TMWN!&(YHY77Xf\Y*XKA%a\!E>UUo'QJ2%KZdq"XRVs5iA8s8V$I %nbM\Drr*&tqu?QjbQ!1oirB&Xqu6fsr;$-_rr)lprqc]nrr)ios8DuslMgqbrr)iorqd'#r$*HZs8V6T %pAb-kqYpp%rVcKjs7Gs`l0/<DlK\-Cr##G4oCM2p-ngdJX/DkIJt/pDN1$*5R$a`JS-5CRVO<kCT)>5\ %T)P8\U&C`3U7e0NT:_dHS@=cKUSFZQQo#9Ps7c9\p&F+6p&G'LoCMnOoD\amrr2rrrV->Ds0ht-rql]u %r;?Bcq#:6lr;QQnr;QZor;Z`qrpBabrrW3!rVl`oq[39!,9um]s5s%Ks8Moqr;Z`prXSo)r:g6kp%A@N %lhBc4q>U=0s8VcblROJBR$b1^Y)A48\$q^"UpZbaWr/OnU8"][T'N0bUS=K\W2Q\pW26>dV5:&\T"((( %QDLFUR[Q,Fs8Vojp\4^Mk4\iTiUld?o()e["TA<!qtpBm!ri2tr;6QnYlBU\s8Moq"T82nq"Xjes8;ln %!;uiprqufps8M<`!ri2trqucm$N0fH,PD*:k4\NKrqQNhs8)]l%K$%ss8Vfds6T+JmdBuMruLt4nLuXV %S=I!mZAssE\[e-*VRNG"Z`C.,WiN5&!jno)or\.ms/c4#/?5\KY-5%5Yck12X/rD)SXm6UQDC=RR@,oB %s8Vlhp@eOJjn8ZRi:6@5nF6GV"T/)rqtnb?K)a[,s8Moq#Q4Mqp\4LYq"sdeq"X[ar;Z`qroj@`rr)fp %r!r`R-M@'3naZ2Ms7l<]r:g3mq>^I*r;?0\p\F^`rqH0err2T`rr!f#.k:TO/Y&>qN/Y!'OeJ),Un!sE %S"-(AVjWtGScYIRT)>2eSXl7=R[BM2R[X2C(n@+fY-+%gW#Zm(-77CFrr2N\p\4(Ts7uTm"SMfpqYL0j %s8;fpK)`+Us8Moq#Q4Mqp\4LYq"sdeq"X[ar;Z`qrpp*`rrW2urVl^)s!B)cp&FRPo)Jabo()SRrt>;/ %rr<#os8W&ro_J=[rVcckq#:<npAY(2mP$<s1c2&*SX5\TSXljOS#N*TTV/!RUTC)[oq_S^'VqP$V50l] %Tq@sJT:_dLT:VXHTqMjiYcsIoWZN<0-n*gKrs/2gq"X:Ws82`o"SMfpqYL0j#5S)prr2lprVZZn[Jts\ %!ri3!r;R$"r;$*]q=sa^pB(-bq>U<lrVul\rrW2urVl^<s!B)cp&FRPo)Jabn*frIr;HTnqtp?krqZTo %rVcEcqY^?ms8N#ts8;lr'D"%;"unT@W1]QH]q:q#V5:N!X8]+%XK8h.W:d:mWrB%JXK8J&Wi2hnUo(#e %Vl$;eVPpGoYHO7kW?**,-R[UIrr2Q^p\4+Us8)`p#6"Mkrr2Zdrr*!!q>&S@K)bEAi;WuZqYKsYo`"jt %kNDO<s7ZKmmeHSVs8V9]rrE#hrttA!rr<#oq>^Elmf3:rq>('jkl:\OqYL6kr;Z`qrq69qr;??^o^`%S %ruD"9+!2UR.$U6lTr"TXWiDANT<##PSXlFGT:VYRSJ@`hTV7jESti'PSrfhHQ*dp!SXlIJrg=,!NK'ST %+qQk!i8FV7"5s4QpAOjip\=O_r;cZmqu?TorVlfbs+:9XrrrAtqY0XSrr3>gkOnlTpAb0\q"Xjgs6'C] %!<)Nh#4qHcs8Voj&c_h.mf3:rq>('jkl:\OqYL6kr;Z`qrq69pr;??^o^_VR*<#gX+!;s[Pan8;WMuYq %Y*k]PY-*n\TqnHYU8%X\'r%M"V4XBTVl-8`Q)gsS\@A`9Tr"UbSIDuiOej6G&3N)5i;`f[s5<qNpAOji %p\=O_r;cZmqu?TorVleds+p[YrVHBbo^r._$KpUFs8Vfms6f[Wrr<#]rr2usoD][!oD\diq>('hrU0^c %%Jfi"s60L_n+un\rqufps8M]k"oS;no^q_Gru(e6+!2UR.$U6lTs:l'[^Mm'Wj]@(WMuu"!ir?$ri%-B %XK8P"Uo:DtW2Q/hYb/YD[&9h%WhZ;_]U+tb+sIR\4Q,/srr_3Zp@eI^!r)Kbrquimrql`ns8DrraT$kl %g]%HUqYKsYo`"jtkNDO<s7ZKmmeHSVs8V9]rrE#hrttA!rr<#oq>^Elmf3:rq>('jkl:\OqYL6kr;Z`q %rq6<kquc`do^_VR*<#gX+!;s[Pan8;V59faWg8sCX/h5NSY2UISt>qP'qV(kTpqOCUSFEPOJ\n?['Zm) %SY;bVR0p6ZNM%I>&3N)5i;W`Yi;`NErVHZjq"Xje!;ZWks8;oqrr2QiK)`%S"o\;op[n+WrsIrPp&G'c %s8VN^q#:<nkPkJ]rU^'ho+q?*s7uKjrVc0arsef"s8V<_s6og\s8MrrrVulirrr>uq"44LoD]g/r?!+( %-n(=MS=up]UTUbfRA-jeOeJJEUSFQXrh1($UnjiZT;/<^U8!pRX.$Q.YG%YdV>d"j[ulfL+sIR\!^,E! %rr3)Ys7Z0bqZ?Neq#:3lq>U9kr;Z`prh9@ErrE!#qYKsYo`"jtkNDO<s7ZKmmeHSVs8V9]rrE#hrttA! %rr<#oq>^Elmf3:rq>('jkl:\OqYL6kr;Z`qrq69pr;??^o^_VR'`ItP+!;s[Pan8;Z*C@<[\9Cp[^HF/ %WMuu"X/`3!W?\FEXKA:oW3*2#W1'rpT>&%HVl-PpUS=KqQ^=]r+qQk!i8FV7"5s4QpAOjip\=O_r;cZm %qu?TorVlf@s+::%rtPJ0qtTp[n`8an4<itOs4uKW0/))VrrVlhq=FV%o`+shr:9gbo_eVOh;/&.rr<#m %q>'FWr;Z`qrqQNmrrrB"qY0aVo_]m.m-OQDmJm2D-70]d0RKIcX/i.XNKgZOTqJ'MSt):>Rf8ceSt;@> %S"6+;TqR[7Pbs=qri$PA%kT%P-MmT=qYL6lq#CB^oD/4\rVlZms8Dipr;Z`prqZSGs/Q)5rqlTfp\44= %j?,OKkNDm$h'F^-g\UpOp%eFYs8;m4o`+shr:9gbo_eVOh;/&.rr<#mq>'FWr;Z`qrq69prVcTep[n+U %+SkBjq>'FXs"u,M*&KL%Unk2tWf`F2['Z[*UnXTVT:c+S&>,\kSY)OJTq%sUQ^F/?O,s:B";;G'-n#QT %qYL6gqZ$Tjs8VNYq>(!frqcWorVQWms8DrrVZ28JrVmT2qtp0_p[R>*4?OhNkPsAo,qgq+qYpWiq>'X^ %(A.Y,r;?-arUg$c5Mb/orVlisp\FXPrqufps8M]k"o\Drp\4=Pr"/\jm.pJEs8Or'-6,-1LTIQf\$rZ2 %R@q4*XfSV(Wi2hnrh^7)W2QJfV5L5cWiDV]T!4HDrj*7U))a*"0DbPFqYL6lq#CB^oD/4\rVlZms8Dip %r;Z`prmLgus763Qs8W)qrtt_5qtg0hp%A@b,<%R=s8NWY.0';Gp%@qUs8W#ls8N!!s8V-Urr`*@+m8e' %"SVQYs8Vups8M]k#6+W"qYL$bp&"ags8Drs(A@Ouo^(p/$O\("'-%u`IX\&dU7n9QqjnFsV3.",WiE4W %LJ@gL(E+2;,RXPK"QnkEnF6GQ#k[cVp@eOdr;?Nnrr)ir!<2oo!r`)smJhe<]Dqp1qu7N3rVQHfs7Q'b %s!'H]huE]f-n,,prq5sUrr<#rq#C?m!rr;\rVuls"8X/akPY>_p@e"Us82cprq69prr2ilqYBd\rr<#s %rr3Q'q"XLOnO!ft,U=0K+AIH>rhfgoV5*p^&uhjrR@14\Z]'i@!s9Ma*[iEHrr3,dlMpACrqQZgo^2>T %pAb0jr;HZprVlfsrquZqrVc_as,[3[rql]urVcWiq@io%p&G%:2`KXort$S,s8N#jp%/1_s8;Zlrr*!! %s5WtU"8X/akPY>_p@e"Us82cprq69prr2ilqYBd\rr<#srr3W)q"XLTp.5u6.4H5_,uTMRXfM]-WiE%s %W;WV,XK7eZS?]?,NfI*C"Wnm2.k;52rrh`Vs7#OWq$?WbmIp8Rs8;fns8MurrrE&rquZiqrl4tis5O(Y %rql^4rVcWiqZ$6]s8O<&2rFZ8&1At,rr2T`oD\dir:p<krW<-"j8/cXqB7$Fr;Qonp@/+^qu-Qop&G'k %"8r#lq=OR`s8W&srtb>'q"3q>577iA+;5_78Uc,`U8"?TTDP2mV59<=PcCadLPJV)!#HOl,U<`rqul0E %r:'4Tq$?WbmIp8Rs8;fns8MurrrE&rquZiqrpp)@s0ht-rql^4rVcWiqZ$6]s8O<&2rFZ8&1At,rr2T` %oD\dir:p<krr;uuj8/cXqB7$Fr;Qonp@/+^qu-Qop&>3prquWhq=OR`s8W&srt+o!q"4+H6Os\Q,SqRG %9nIurVZN]kU\gbuWMu2ORBE^!N/UX:!ur@'-n#T)rs%cRs7#ORq$Hlho^2AGs8W#prVulqrr2utr;6Wp %rViGhMZ<_Uqu7N3rVQHfs7Q'bs!'H]huE]f-n,,prq5sUrr<#rq#C?m!rr;\qYpZo+X-%Hrri&hnGiOc %rVulirrrE$r;-9co_\Xfs8Drs%JKSlo_.uM'br/H*$lm<;MU%0XK8G%WMlcoV\6)4R%0\OZ*fUP<<WOJ %+X&?d&cVe5mHsrCnG`4ho^qPEpAb0jr;HZprVlfsrquZqrVc`=s+::"rtbV4rTF4\rVc+,+o(p1rt?(4 %q"Xmhq=jpcrX/Mus5rJ<p\jdX&H;\6p\4LZs8DoqquHcprq?Bhs8Muhrr2Zqrr2`epAP""lg+B<oDJO[ %q"X,,0)QUd)?:`U*"!Ju*$Z[D((NAdcMIGFq>:'ej5^"9s8;fprq?Eio`+jfrr2ZlK)_bK(B4:2kPtS\ %rTtaOq"jje',0a-q#CBip](3krr*9$qZ#^?p\4XZoaq-&#5@lfq>^Elrqlcrr;Q3crr)KgrqHWqrqZ9] %rVm;pn,<"Ts8Vuor9c<qr#PbX!$D1_$61$.-n#uP'0\V.qYpQprr<#]"9/?#r;?TopAk*_s8;iprhTRG %s8)a2rr)fYs8W&rm3*YJqYL4*'C>Mhs8Vohs8)^%qYL6Sk4eWKp%8mqrs&5lq>('hrVl]ps8;lcs8Muh %rr2Zqrr2`epAP!oo^r1]r;?Qro/AW-,5rhd,Rl%G-6=3Q.k;V\(-t7:pAb0Xrr2urr;Zcj!;lEgr;HWo %d/S^to)IPG(B4:2kPtS\rTtaOq"jje',0a-q#CBip](*h$MsW!k2uF4rUogprr32sp\FXbrVc`n!<;ur %nGiLd!<2ZjrqHWqrqZ9]rVm;llhU/Dr;?9`q!'Iar#,JP!#tnW$5XKu,9ms>%QZYrqYUZqqtp<Oj8/fU %r;?TopAk*_s8;iprpB`;s0;S>rr)fYs8W&rm3*YJqYL4*'C>Mhs8Vohs8)^!qYL6Sk4eTPrUogprr32s %p\FXbrVc`n!<;urnGiLdo`"jb"TJDrp@eIb%.EZ`p\4^fqu$B[1,AbJrZ2%]rZDOf*$?XX)B'8Q519<%!<2ut"m>(Js8W#prrDcpp\4RWs8;iprgNk@rrW2ur=eAos8Do`+X-XWqYq3Bm.gAUs7uEhqYgiuqZ#^? %p\4XZoaq-&#5@lfq>^Elrqlcrr;Q3crr)KgrqHWqrqZ9]rVm#mo`+jer;Qok2`Dp)!$_CerZhq!,pjZS %,:b8b*>Uq,eb9%ClMge`r;?TopAk*_s8;iprl4tis4.,Lr;HX)o,f(Jo(!Cep](-fnaZSXs7uTmrr2lp %"TSMZr;?Qo$8j^<p@e%Cm.^8Rrr<#ili6GR$M*cfs8N&un,E=dr;@)hl1+`NnEoW<q>'m`qu$Bkr;c`n %r<r5Vir/NAnEB*7rUTd_"Si#snF6DV!;H9grr)otq>TsbK)_hM!;ufq%J(Y`p@@bdp\4^bqsj4Ts8Vom %s8N#rrVum!hu*EOrsCV@qtBaRm-OK@rr2rto@a-Mo()h\rr<#err2fp#jq$Ps8V]\nbi@a!<2Wj$hrfG %s7uK_m-OcPpA=jlrVcNk!rqcZrVlllq#C?m!<;loTDsNCr;QcprVm>u+!:4Ine(Wjs82]`nbrLfq>C9l %rr)cus8V!Sr;Q^'2)Y:)p@7M9p\4[ds8V]DrsA8es8W)us6osdqu6feme6\\"nhHWrVlfirrE&srsSP^ %jo>)LoBY`Bs7Q9h#6"Mqs8VTXrVlllq#C?m!<;lobQ!1oci4IAmIKiJ',11+5OndRlMUY`mHsiJrrW2u %rVcX&q"X[bs8)R)lg+T@nbiCjo`"jip%@hSkl1e`r;ZH_rr3Gsp%A:HkPP/ToCMqRp&=mgr;uopqu6F1 %rVcB`q#10go()Y:ir/`Mq"Xg[o_eLZo_eXdrs88hs7uKjrVuorrr2rsr;clsrpp)@s.fT'mHsK8rt?(A %5<n]<s6BO^!q#CQqYpZsrVcZnr!`Aqq>^Kkq@`,[s7,XWrrr&orr;ZafDc!Or;ZH_rr3/kq>('Vli-ne %p@eO]q"Xjorr2lrs7lNirr3N&pAX4:s8N#qr;ZQes8;crq#('hrs88hs7uKjrVuorrr2rsr;clsrh'4B %s7ZI%mHsK8rt?(A5<n]<s6BO^!q#CQqYpWrrVc]m%/BVns8Vrl''nl`naZPW"n_fns7Q':rri8ts7Q'a %rrqogqZ#pKrr3,rq#C3eoD][%qtpEnrq5s_jlQO@rVQKlp\4^bqtL$drr38ro`+a_s8DutrVlfrrquis %rr1+@K)bEAg&DNKmIKiJ',11+5OndRlMUY`mHsiJrrW2urVcX&q"X[bs8)R)lg+T@nbiCjo`"jip%@JI %o)Ajjr;ZH_rr3Gsp%A:HkPP/ToCMqRp&=mgr;uopqu6F1rVcB`q#10go()Y:ir/`Mq"Xg[o_eLZo_eXd %rs88hs7uKjrVuorrr2rsr;clsrojB6s/l;1mHsK8rt?(A5<n]<s6BO^!q#CQqYpWrrVc]m#5Iuhs8Vrl %"VU.es7,XWrrr&orr;ZafDc!Or;ZH_rr3/kq>('Vli-nep@eO]q"Xjorr2lrs7lNirr3W)pAX4:s8N#q %r;ZQes8;fir;?Qo"8)6cq#pNnrVuorrr2rsr;clsrg!M8rso(rmIKiJ',11+5OndRlMUY`mHsiJrrW2u %rVcX&q"X[bs8)R)lg+T@nbiCjo`"jip%?r:"T82tp%A=a"n;Bbs6T+Ors&8ns8)Tls7QC/p\Xjfs8M]a %rT3/@rVcWjs7c9fqtp-cr;Q^%o^r1Zq>^Ens8Drrs8Mrss8N#6s+::,s8N#qr<i<!s7lB[*?G.n'E8"7 %h"pm=oDS^hqYpNorW<&sr;QTmrsIlL.kCYurV$9knbr4aqu6TorrDr_s8DuirW<-!rqud#nGW=crr2*Z %rWqukrVQTnqu$Bir?(t7qtg-apA4X_qt9sfrVlf_rr2`hrpoXWp@eLarV$0h!qc-[rr;rrrr3&ur;>gZ %K)`+Urr2io$MXT#q"XD#*WHcdrr3,VqYKgTrVuoorr;us!r`)qrql`q$if>M.kCYurV$9knbr4aqu6To %rrDr[s7H9ls8N#qrrV]grVlfslM^_eo)Jahs8W)os8W)tr;c]mrW)clrt"Sus8;fpp%A@\q>^ElpAb*k %!qc-[rr;rrrr3&ur;;l\L&_/Or;?uss8Vlhnf8bN',1BF"PikMoCMq\s8)`prr)utrVZZlrr3>ejXVk] %rVcHis7-'_!rMurrr2uqkl:;S!rr9!r;QifrVc`q!9jC]!q?3g"oSE#r;HTlrYth6r;69ap%eF[qXjab %r;HT[rVcNdrUKFSp%A=_!;??j!qc-[rr;rrrr3&ur;=G3K)aL'!ri2trqm3'rVu0Jrr2pZ3rnmDrr3?' %s8VTXr;HTor;?Qorr)utrVZZlrq-KqrriT$qYL3e$ig%up\4^_q#16mqXOUcs8Drers//qs7Z0drr2lr %(&Rn,rr2`hpAY'`r;?3\pA"FZqtp<jq[EK'rVZTlrV-<jlM1/RrWr5kp&=shrr2`ms8W#srr)isrV6El %rU0];s/c5%rr2lqr!`Q&s6AnKrr5&A!;#g]rsJ](s7#OUrVccor;Q`qrW<&sr;QTmo`kHr"U4\tqYp9u %s7uKbp]($`rVuoon,N@cnc&jcs8Vfds8N#rs8W)trt,,+q>^Khs8Vihq>:'frr2rsrqcWuqu?]`r;?Qo %!r;Zer;Qcprr<#rs8Mus!<)]mrr&>dK)YuRs8N#rrqm3'rVu0Jrr2pZ3rnmDrr3?'s8VTXr;HTor;?Qo %rr)utrVZZlrq-KqrriT$qYL3e$ig%up\4^_q#16mqX=I_rpg!noDejapAb-krVm#ur;Q`r&Gl7ts8Vcj %rUopZq>'pcr;HWm%/p/&qtp<hpAOsSp\4[c#kdl_rVcZmrV6Bls8;orrVllrq#C?la8^bko)I_L!ri2t %rqm3'rVu0Jrr2pZ3rnmDrr3?'s8VTXr;HTor;?Qorr)utrVZZlrq-KqrriT$qYL3e$ig%up\4^_q#16m %qX=I_rr)lirs//qs7Z0drr2lr(&Rn,rr2`hpAY'`r;?3\pA"FZqtp<jq[EK'rVZTlrV-<jlM1/RrWr5k %p&=shrr2`ms8W#srr)isrV6ElrT+!1s0hq/rr2lqr!`Q&s6AnKrr5&A!;#g]rsJ](s7#OUrVccor;Q`q %rW<&sr;QTmp&G'l"TnJqqYp9us7uKbp]($`rVuoon,N@cnc&jcs8Vfds8N#rs8W)trt,,+q>^Khs8Vih %q>:'frr2rsrqcWuqu?]`r;?Qo!r;Zer;Qcprr<#rs8N&u!rr<!q#C?lOoL==!ri2trqufp$NKDVrr2pZ %3rnmDrr3?'s8VTXr;HTor;?Qorr)utrVZZlrq-KqrriT$qYL3e$ig%up\4^_q#16mqX=I_rpg!noDeja %pAb-krVmB*r;Q`rqYKsds7Q?hp%J[bq>'pcr;HWm%/p/&qtp<hpAOsSp\4[c#kdl_rVcZmrV6Bls8;or %rVllrq#C?l^&N]ag].9O"9/?#rVca#iZ0'>n*f]:rr2rtn,E=pq!./Err27?1]RLDrr)lnrqccpr;HWo %l2TcC!;QNm#5.rnpAb0erVmQ)s8W&ts7ZKmrqu]kqu?0Ts8;ffrmCats0)J%r<*'!s8Dor#3$XDs6oFE %o`"jis6ose"o.BJs8N!$ln^Hts6oscs8)`l!rVuprr1(?!;cZo#5A/tq#CBirVllmr;Qcmr;R$$rr;Q[ %s8N#fs+:9'rrE!$rVc`qs8Dor#3$XDs6oFEo`"jis6ose$i'#Ps8N#a1Gf(2n,E:cqYp?nr;?NmrlkBD %rr2ZjrW;`iqucWkrq?<i'D;A(r;Q]hr;?HgqYBsbmHsiIq=XWbs+::%s8Ms,rr<#rkih$c8H8_\s8W#h %rW;leo`"jtlg+QMs8;`i2;R*drrVTdrVlZqr;?NmrpKgDs8;]mqu6Tqo)AY*k2u^Drr<#ps8W&fnale\ %rVccfoDe[`p&<PBK)_kNrr!?+s8W#\ki1Sms8VZis8;Ng!r2E[rr3&cli%.hs8;`i2;R*drrVTdrVlZq %r;?NmrlkEBqu6NnrVlfso`"mjl2:P]r;Q]to^qkTrri&hs8Dois+:9&s8Dusr=8i,s8;*Eio3N/s763i %r:Ksiq"44XrsJ)Xrr<#rqYE)*h>I9SmJ["_qZ?]nrVlf?s8Vlnq>^<jrW)KfrYO_Zrr2lqrqZQmrU94E %r;?Efr:'4Rp\4@XYQ'4So)IYJrr!?+s8W#\ki1Sms8VZis8;Ng!r2E[rr3>kli-qar;-7Ih;/#/!q#sb %rqccpr;HWojT"KEr;$Birr2uhrr3esk5YJ\s8Vrqs8DKXoDejhrVuK\s8)TbrlkCos0Vh*r=8i,s8;*E %io3N/s763ir:Ksiq"44Xrs\5Zrr<#rqYE)*h>dNSrrVTdrVlZqr;?NmrlkEBqu6NnrVlfso`"mjl2:P] %r;Q]to^qkTrri&hs8Do_s+:9,s8Mrurr<!+r93A(i^j+Lo)Jafo_npeo^r._$L@$Ws8W#nqDI*br;Qic %rVc`m!rVuprr1.As7lThs8)`o!:g'f!9P'Zrr2lqrqZQmrU94Er;?Efr:'4Rp\4@XV>l/Ig]%BSr;?Qn %rsJPrs8N]&oC_>2s7H9jqYgF-r;Zfno^q)p0'rW<r;?3drq$0ir;6Wprr2-]jT#8Yrr38ro_Ib9lMpnQ %rVm&qmHsrBn,*+dp\4Xcs8Vf3s+:9Srr`5tr;Q]q$MaDrrt4kop#tW>o_njerVm0$s8Vrfo\hDT$LIfm %r;?3drq$0ir;6Wprr1+@s8Drs#kdlelK[^8s7$!e"o%HQs7#OTrrVujrr2rtp[S98s+C=Or;uoprr2p) %q"Xmh&bGVekii'=rW)fnrtG>1s8)B[i@ZbLs8W#po`"j]s8W#p!r`,tbQ%V?rr3,moD%P5"7#pdn,<7j %p?_/Gn*g;Sr;uW`qYpHno_&-^s+::'s8W)tr!<9$ru:_,-n+res8)`or=8l!oD8=`p%A@`r?_LDq#13r %oDej\s8W#qrr2<bhuE`Lq#:onmf31]m-OZMs763ip[.A:rVluuqtp31s+:9Ps8W)tr!<9$ru:_,-n+re %s8)`or<WGpoD8=`p%A=grV\&Bs7lQm"nVconc/XerVlf>s8Vffrt+Vds8;f^mJ[(bo)JabmdBTCrr`8u %r;-'cK)^H&s8W,urqm'#s8O&4pF%Hdq#C3irr!?,oCMhTs7Q'brV\&Bs7lQm"nVconc/XerVlf>s8V`j %s82g-mHsrNqs<\Hs8VWhs7bgDm/?kdqYBs\rVcEeYQ'4So)I_Ls8N#q#lXf')u'(T./N`=qYpKm%fc.l %qYL6bp&G!h-3+#?rVm&ms8VWhs8;ipro=%Cs8Vcert+Vds82][m/6n`o)JaamHsB@rr`5sqt[u+K)`:Z %s8N#q#lXf')u'(T./N`=qYpKm%fc.lqYL6bp&G!h-3+#?rVm&ms8VWhs8;iprlb?ApA"Y!mdC,Qr9`nM %s8VZis7l$MnGW@hrqu]jlMlJ9MZ<_Urqlirs8N6Ap\-'aqY:*err2j+s7>jYqZ$6]s8DmBs8Vlmrrr#o %s7--hr;HWobQ%V7q#:H`mJm%lqs<\Hs8VWhs7bgDm/?kdqYBs\rVcEeV>l/Ih>dNSrqm9)s8O&\+8#3p %s8UdPs82`orr2io($,DpqYL6[md_GAq;C2po^qqRs7uKir;$?Us5O%Yq>L3pp\=OG4$3H+rr3/OeGo"+ %+o_N?q#:9nqnrGcs0;V(rr2g*rVum;+!:.InGiOAs8Vuos8N#qr=.ifs8)TlmdBWf+8OjQ#O(gPq"Xmb %q>U<frlP0?q>L3ipB'G<49"ICrrpm#s6f:trr<#ns7cNm!;c0aK)^Q)!ri2s&H)J)s8O&\+8#3ps8UdP %s82`orr2io($,DpqYL6[md_GAq;C2po^qqRs7uKir;$?6rrDooquZZhq$#nC4R21qrr3/OeGo"+,6%WB %p]'sdrrW#rs7QAks+::'s8W)tr!r]*ru<+&o^qYQs4RGPqu$Knrqu^0jT#8VqZ$!OnfJtLi8Ehko_A4] %q>($fq>Td]h>[KNrVQinq"Wu549"LDrrpp%s6oD"rr;rlrr2uqaT$klXT/>"rqm9)s8O&\+8#3ps8UdP %s82`orr2io#iu$cqYL6[md^c.+8OjQkk+NBq#C0crquTkao;A:rVQTg!p)L*roj@]"k1s#md;4ss8Vlo %p\t0mqXjf>s+::Ns8W)tr!r]*ru<+&o^qYQs4RGPqu$Knrqu^0jT#8VqZ$!OnfJtLi8Ehko_A4]q>($f %q>SM9!rDim$N0hsq>'/84R21qrr3/OeGo"+,6%WBp]'sdrrW#rs7QAps+::As6'F^rr2p.rr2imqu-Nn %s8Dors7c6\rr2uqr;Zcqs8Drp$NKqtp@e+Xs"Wp.rVm2onb;eOs8VTgs8N#Ss6'C^o_ndirVlfu*$"\N %rseW#s6]IN.H]dmnF5u<])RB^]Dqp1rr3N.rquZjrVlfrrVccrp\+=[rrDros8N#trVl^%s7uKap@J=a %1%"B,s8VWhpBC9js7$'grr0k9!;$0h!<)os!ZN*PrVm2qs8VHXoI8n`s8DHdrrE&`s+:93s8W)trs/Q& %r;6Birr*0&rVccrp\+=[rrDros8N#trVl^%s7uKap@J=a1%"B,rsA5cp\4C]s7$'grr0k9!;6<j!<2ut %!ur<Ts8N$)p&G'[p%9fqjT#2Irr3&us8VckV>l/IirB&Xrr<#srqcrurr2rXj7;d?rrVliqYC-mrr)fp %r"AT#s7uKjl0/uMm/,\trV#sMlM^b_qr%M3rser*n*oiE)]Sh<jSJ]crr3/hmH$#UjS]#ZoCMdqs+:9Z %s8W)ts8W&sqZm&urr;$=o()e[!qlEdq>UNqrVc`n%J'Q!q>('Tkn`XPqqp96rV#sMlM^b_qnE(>r;>sN %n,""As5N&5p_!N*"mkU:0JMPbrrVc^q!\67s,-jVrr2p!rVcU"qtp<jrr;$=o()e[!qlEdq>UNqrVc`n %'(Z)&q>('Tkn`XPqqp<0p@de:rVuop]`/''oCE7e*?G1Bk5>,lrr3/jn)lD[jS]#ZoCMdJs+::,s8W)t %s8W&sqZm&urr;$=o()e[!qlEdq>UNqrVc`n'(Z)&q>('Tkn`XPqqp<0p@de:rVuopjo='7%K67onF6>p %)uo![qYCj(rrqfWjY/CLr;QiioD-K-K)`+Us8N#ts8Dro#Q4T#s5W/1o)AXjp%nO\rrW2urVl^#o)Jac %q>]^D(('?oqqp<0p@de:rVuop^AeZ?r9`tAq\gCQio9b.&cVe6m-Nde0]W*2!qPpWo`'OCL&V5Rrr<#u %s8Dro#Q4T#s5W/1o)AXjp%nO\rrW2urVl^-o)Jacq>]^D(@:Dbhr"D+p?LrAs8Vu1rsf#.nalAO*?G1B %k5>,lrr3/jn)lD[jS]#ZoCMdOs+::As6'F^rr2rtrVl["r;Q]cq>('jlMgh`qt^6nrr)fpr!NJpo)Jad %0JNIjlMgegrpoX[s8Dfjf`149#5e;trVcWjrVmQ[..dK=)&Xb#s6B(As!8ubrVcNdrVuos_#K#d]Dqp1 %rr<#srqd!!rr2H`q>^K[rr<#qq>UNqrVc`n$NK\fs8VpL0`C;%rr3-#o()h\!r_ul_#GMQqZ$KkqYL6k %rr4>no)J_+(F9%\l0e!>,UE'\r:p'cs8W&as+:93s8W)ts8W&sqZ?]prWVifq>^K[rr<#qq>UNqrVc`n %$NK\fs8VpL0`C;%rr36&o()h\rVHB+s8W&ss8W)srrX`#pAY^()]L1)s6]@Hs!8ubrVcQfrVuosRK%m= %irB#WrVm'"qtp-\p&=jjrVc`mrri8ts82]mrtk:uq#10kn*g)J%/g%os8W&srqcEbqYL0js8:gTiVs5_ %rVuosp\4@n&cVe>oCEdtrqZNkrnu]tmdC)Ss67E#K)`:Zrr2lr"o\>qp\"4YquZiqrql]ur;?Tlqu6U. %oCMbUrVu?Tq=tHsr:9mfrVld!qY9j^qYgHor4r==rVccrrqH0\&J>$B%J00-rr2`lrVka54mqb;s8V?O %s+:9.s8N#rrrE!#qtp-\p&=jjrVc`mrri8ts82]mrtk:uq#10kn*g)J%/g%os8W&srqcEbqYL0js89\4 %#6"N#s8Mce!qm3<rr3H!o,%E*q>L9ki8?cdmf*7dl'q^)s5!_Srr)j#rVQKdp%A=^!r`)squ6fsr;ZZk %rr3f+oD&:_s6oFPq$d3!o)Jagrr2chq"jjcs8W#Ys4mV\rVccrrqH0\&J>$B%J00-rr2`lrVka54mqb; %s8V?(s+:9Us8N#rrrrAuqtKdVrqlirrVl]o"T82tqtpBm%J02drVccbn+lbfr;?*ls8W&srqcEbqYL0j %s89\4$2si&s8Mcep(7o9rseSk(]OF0rVc`Ri'$Mrrr<#_oDaFBL&_/OrVm'"qtp-\p&=jjrVc`mrri8t %s82]mrtk:uq#10kn*g)J%/g%os8W&srqcEbqYL0js89\4s8<3&s8Mcep(7o9rseSk(]OF0rVc`Ri'$Mr %rr<#_T`9WDo)InQ!r`)srVm'#r;?Bcq#:*kqtp<jrVld!s8W&dn,E@dq?I!"na>fr/H,STo^r(\rqlKc %qtp?ls8C^Pk5YJ\rr3f5rVmo[md]iIs"XEJs8;fis8N*!s68eIrrDQ&s+:9_rrW/trr)j#rqu]iq"Xjb %!rMlmrr)iq"TSN#n*g8UrqZj!s7,OF/1gc"$2!lfrr2fiq"sses8W&5s8W)trtkY4ruN6LnaZYZ1&LkJ %r;??irrE*!l083I!:]:RK)^o3!r`)srVm'#r;?Bcq#:*kqtp<jrVld!s8W&dn,E@dq?I!"na>fr/H,ST %o^r(\rqlKcqtp?ls8Bb5s8N#t#6"N#*Zjb>&Fof#1&LkJr;??irrE*!l083I!:Z?TK)aj1!r`)sr;Qs" %rquZjqYg9kr;QZorr;Nfru1\-nb`4`o()]//,oPHo()SSrV6Bkqtg0er;HZqrS[_:s8W&prtGA0s!8uj %rVccr(&Rn)o()hWqB5b:"oe;ls7c9,s+:9ZrrW/trqud"rr2imqtg9g!;uiprr2rfrr3`.q!n7Ys75aY %.kCVurUTOSrVcNjrWN,pqY^9is8W&8s8W&prtGA0s!8ujrVccr(&Rn)o()hWqB5b:"oe;ls7c9Xs+:9. %rrW/trqud"rr2imqtg9g!;uiprr2rfrr3o3q!n7Ys75aY.kCVurUTOSrVcNjrqlQgr;?Nns8Bk8s8Dip %s8<Q0,piQhrVum4qtp6\o)JR_+T;<DrqQ9gp\19ZK)a[,!r`)sr;Qs"rquZjqYg9kr;QZorr;Nfru1\%nb`4`o()]//,oPHo()SSrV6Bkqtg0er;HZqrT4(:s8W&prtGA0s!8ujrVccr(&Rn)o()hWqB5b:"oe;l %s7c91s+:9UrrW/trqud"rr2imqtg9g!;uiprr2rfrr3Q)q!n7Ys75aY.kCVurUTOS$2shtrr2fkqY^9i %s8W&8s8W&prtGA0s!8ujrVccr(&Rn)o()hWqB5b:"oe;ls7c9]s+:9)rrW/trqud"rr2imqtg9g!;uip %rr2rfrr3o3q!n7Ys75aY.kCVurUTOSrVcNjrqlQgr;?Nns8Bk8s8Drsrr3Z1rVn/irr)fqrtYG.qXX4W %qYD?5rrrDsq#C*_U]5rGo)InQrr2`nqYp?ks8N#qrr3f,o_ndg%HcgQs8)cqrq?'crr2imqu-Kls8W)Q %s69R`rqud(qtBa^+X-m]q>^I;rr3H&q"asir#m6Yq!S1^oY1?Ws1A=1rqZTjrqcZprr2iprtk>"rVld* %k2u^DqZ$Tpp@eOcrquZjrVc]ps8Kq9s8Mrr$iBYkr?3?aq>('j+TDBMq"X[bs84#`q"X:Ws7GUVK)^o3 %rr2`ns8MrqqZ$Tprqucq(\I@urr*Ahk5YJXs8W)lpAb-kr;6BirVccrrknd9rqud$qtBa^+X-m]"8Vus %+TDBMq"X[bs84#`q"X:Ws7DZXK)aj1rr2`nqYp?ks8N#qrr3f,o_ndg%HcgQs8)cqrq?'crr2imqu-Kl %s8W)Vs5a4[rqud(qtBa^+X-m]q>^I;rr3H&q"asir#m6Yq!S1^oY^]\s0ht,rqZTjrqcZprr2iprt=tr %rVld*k2u^DqZ$Tpp@eOcrWN/rqu-Kls8W)9s8W)rrsS_tpAH-Xs7uKjruh=@%J]_os8W!?+o(j#s8V`[ %s+:9.s8N#qs8N&prqcZprr2iprtk>"rVld*k2u^DqZ$Tpp@eOcrquZjrVc]ps8Kq9s8Mrr!rM]b#lPni %s7uKjruh=@%J]_os8W!?+o(j#s8V_]s+::,s8N#]rt52,rr2Weq>^0^2?3^Rqu?Tlrr3&urr2oqs8Mus %s8M-[f`)`_oCMf!*WOsOs8Nc2rU^'ho(2JQ)B/PR!quNgb5[(nZ2ah&kl2:nr;Q]hq>('ap,2mMqtpEk %r;Qp"s8Drrrr)lrrVuos]`/cCoCMf!*WOsOs8Nc2rU^'ho(2JQ)B/PR!quNgpA]aEL&_/Okl27mr;Q]h %q>('ap,2mMqtpEkr;Q]trVlfqrVulqs8W)4rtte9q=F4S*?G19h>dKgrVc?fs75dQru)gRrrVokqkO1C %s763Ds82clrr2p4q"X4Brr<#=0/)hgpAb0arVcHgrVQTndJr5+*rYm/r>m$Ks8VQV/Gf5Cl086@p$j@U %o()hWqZ$Qo_#K#dY5eCtqu6Tp(&7Rjm/I%ba"K+8p@eOdoDSX]rVcWmrr)l*ruV.6q#)6Tn,NFVmk">3 %s68eJp%@i%-M$a-qYL6krp9Z:s+::JrVQTnrtY>(m-O`Os2QcGnFlSUs7?3fpAOserr05'#Q=Gmr>m$K %rtbY'mk">3s68eJp%@i%-M$a-qYL6krgEe<s4./HrVQTnrtY>(m-O`Os2QcGnFlSUs7?3fpAOserr1LK %h>\Ppq"Xe/*q0./n*_h(qZ#gEs7Q'T-78<Ss8)Tlrr0n:K)_hMqu-Ekrr3f0q!@AHs8U+m0C\]/s8V]h %rV$3gqu6Qprj)PFrV60d*ZjeMs6oD-qYL6Vl2UGLnKoURo)JR_s8N#fs+:9&s8;oorVQTnrtY>(m-O`O %s2QcGnFlSUs7?3fpAOserr05'!r_oh)uUg!n,NFVmk">3s68eJp%@i%-M$a-qYL6krgs.As4IAKrr<#k %rW;ccqYgHnq$6rtr;Z6Sq"Xjg"8VusqYC0kro3t5s8W)trtG>.rZ*$Ns8VHP'*&"#qYL!\p+$%@"82]o %m`>E[s/c7trr<#krW;ccqYgHnq$6rtr;Z6Sq"Xjg!;Q]rs8)Qks8K_3s8N#t'E%e-*?FbOs6T(bs8VQa %qY9dX.fKALp&G'[o`'OCK)blNqu6Wqp&5$cp%nXerqQg!r;?T`n+c\Wrr`)ss8)Qks8K_3s8N#t'E%e%*?FbOs6T(bs8VQaqY9dX.fKALp&G'[U&T`Eo)IeNs8Moos8MWi(&@Rss8Vliq>]^Ds5iABs6o[Ts7Q'\ %s8N#Ms5s@]rVlirq\9n`s5W-)5St^jnGE+Ts8OA2m/R+Xrr<#n_#K#d\GuU.qu-QooD]R$p@eOdq"aac %l0860jo>ALp@eOZp%eXerk8@3rVlirq\9n`s5W-)5St^jnGE+Ts8OA2m/R+Xrr<#nm/M\;N;rqWqu-Qo %oD]R$p@eOdq"aacl0860jo>ALp@eOZp%eXerk8@3rVlirqZ@WNs5O^O5X6/2,OkU-o`+q:m-OcPo`"mj %pmM/6s53kVrqlZorq$.)q=aO^s7lEcs68eJjlQOBn+QJTp%A.\rr1aRiW&rVrr;up'c.\dj5WBi(aC9p %qtp$cs!6sts8V`js8Vl5s+:9Ws8W)qrVulgrtYA'pAb0fq>('Tl2Tl,s8VQ]pAagYrr;orrr0V2s8Drs %rqdEH(]WOU5X6/2,OkU-o`+q:m-OcPo`"mjq!nB9s+gXSrr2lqrVulgrtYA'pAb0fq>('Tl2Tl,s8VQ] %pAagYq>^Hn^&S-2rr<#q(Aemas5W-)5St^jnGE+Ts8OA2m/R+Xrr<#nT)XEB_>jK5!r`&prqcihp@e@Z %qu6Zpf`0k/%0$8+r;?Efs8;fa(`<8P&G#Dbs8W)us7aga1%k5>s7?6is8'n<K)_,9rVclsr;?Qk"S29[ %qYL0j!rr<![f6d8rr;ooqYL6ir9tO?rr3Q#o(E%_rr<#mcH\0;p&G'`rr<#ppA]aEK)b'7rVclsr;?Qk %"S29[qYL*h!<'A+"TJE#r;6frqZ$Kkn/*#Art+blp&G'ks8Vi=c8#"bs8V]is8Vqjs+::As3(H@rW<&r %r;QQrpA"F\r;6Korm(Q+rt"u&rVccipA6EnnGW=\q"k!a$31&(5sb/Cs7,XYrrDT's+:9Cs8DourVZTm %qZQWfq#('errE&ps184@qYL0hs7Z0`/M6JjrV60arq?a!s8>5Lo`+s]nc&Ogn`p.+s+::As8DourVZTm %qZQWfq#('errE&)rsS]"rVccipA6EnnGNIfq"X^bpBgm"rBWaAs8VWZrr2ugQiD[;`rH#:!r`&prqcil %q"Xdbqu6Zqe,SD,&,Q/$rVuTbq^jDhrVcNdqYp3qs8W$`61k3WnaZVY!:du,K)_;>rVclsr;?Qk"SVWc %r;?Hl!ri6"[Jpd6qYgBmp@eA8/b&`;q"X^bpBgm"rBWaAs8VWZrr2ugn,J">K)b6<rVclsr;?Qk"SVWc %r;?Hl!<0>)#5\2prVuTb#l?2*nGW=\q"k!a$31&(5sb/Cs7,XYrrDSZs+:9crrW3!rVZQrqu$BjrR(Z& %rt55.s8)TjrVZKer#HgXqYL!^rr39#s8VKo$NKM\rr3,uqu?6Xb5[(nPQ(^`rr)cm"T/,prVc]pZi:X9 %rVu`jrVcZiq>;6Rs8)Teq#::!qZ$T`$4?h#mJd+gqtpEao(N*8s+::5rrW3!rVZQrqu$BjrNH5(rVccm %q@*?$r;$0d*?G1VqY9jbrs8K$s6^4$s6]4Qrri5rs75`Us+::As2k<?rqu`ms8N#?s69Oop%A@_r;HTk %s8V]s#l+Asrr35kme6\\nLcHnrs/>on+un\q>%i+K)_DArr2ior;ZcqpA_i+&,#Vqr;?Nlqu?]g#RL5( %rVlg%mdBfKs7%]orr35uq!\(Us7uKWs+:9&s7$'frqu`ms8N#'rsn_ps8;fnrVQWpoEY`tr;cfqrs.u[ %pAb0_/h[/'#Pe)_qYL6fq3h87s2=s:rqu`ms8N#Ds5a1jp%A@_r;HTks8V]s#l+Asrr35kme6\\nLcHn %rs/>on+un\q>&#0K)_5<rr2ior;Zcqqu=2+&,#Vqr;?Nlqu?]g#RL5(rVlg%mdBfKs7%]orr35uq!\(U %s7uK\s+:9&s6K^arqu`ms8N#'rsAAks8;fnrVQWp"nW'+q#10jrs.u[pAb0_/h[/'#Pe)_qYL6fq4@V< %s1eU0rqufprmh&+rt>)#s82]ns8MuqpJ+KLqYL$`p\t0tcd+cSs5*D?_Z,5fPQ1IXr;Z`pZi:[4p](-f %s8W)srV'&^lh^JRq=jmg#LC^Zs8UsJo^;a2s+::5s7uZls8Dr'rri)js82[&s8W)srV'&^lh^JRq=jmg %#LC^Zs8UsJoUGl4s7633s7uZls8Dr?s69Orp\4^bqu?]qrVcIc:@%cQq>'dars-lr4obQ=o^oZnK)_DA %q>U<lrVlQk^&J`>p](-fs8W)srV'&^lh^JRq=jmg#LC^Zs8UsJo]6%(s+::?s7uZls8Dr'rsnets82]n %s8MuqpJ+KLq?-Tiq=jmg#LC^Zs8UsJoTB0*s1eU5rql`nrmLi+rsS]!q>^Koo^r11d.mP=s7cNm!oNtT %rr3/pp&4pjo>CT[s-*K^rql`nrr2r+rsS]!q>^Koo^r11d.mP=s7cNm!oNtTrr3/pp&4pjoC)^2s+::5 %s8N#ps8;l&rs/Drq>^Koo^i7cd*VRcs8VimrrV*VrVlg#p%A:`s7;c\K)`%SrVkILh>[`Srr2rtrVHBh %rsAAklK\EJrTEtNrr3/Skii'Hqu6Wqo?.)bs+C=Orr2o(rs/;trr<#sqYL0j$2*uVlMph]kP4iOrrq'= %kl:\[rr<#ipA]aEK)aF%rVj2(!r)]n"TSN#qYL0j$2*uVlMph]kP4iOrrq'=kl:\[rr<#iU]5rGo)H9# %rVk+BkPke]rr2rtrVHBhrsAAklK\EJrTEtNrr3/Skii'Hqu6Wqo>(BXs,I'WrqcZ,rs/;trr<#sqYL0j %$2*uVlMph]kP4iOrrq'=kl:\[rr<#im/M\;K)ad/rVj2(#P\5ss8W&oqYgEooa(6UlMph]kP4iOrrq'= %kl:\[rr<#iRK%m=]`/!1rVlfr!<2ure,SM/&cVe-s8VifqZ$Tcr;?-cs8Doqrrr2oqXsa_rr<#`rr2un %_uG>gOT,=ZrVlfr!<2urs8TV/&cVe-s8VifqZ$Tcr;?-cs8Doqrrr2oqXsa_rr<#`rr2unn,J">K)am2 %!<)lqrr2utrr';*$3'r%s8VifqZ$R#nbi=Us8W&rrr3/sqYKm^qu6WqlMge`pmhA9s+::.s7H<`rVlQr %qYL*drVlf:s+:9&s0Matrq66hp]gTkqtp?krq$/As+:9+s8;llrq66hp]gTkqtp?krh0:Cs762As69RU %rq66hp]gTkqtp?krk8>`s+:9as7H<`rVlQrqYL*drVlf\s+:9&s,m?Rrr;rkrVlQrqYL*drVle^s+:9& %s5a4Prq66hq?Hior;?Nmrke\es+:9\s7H<`rVlWtqtp<hrVlfas+:9&s,@!Prr2oirVlWtqtp<hrVlec %s+:9&s53kKrp]mcrl+nhs+:9Ws7H<[rVlfds+:9&s+gXPrqZQ_rVlefs+::As+::8s7H<[rVlf.s+:9& %s1SI)rp]mcroa<5s+:95s7H<jrUTpdrfmG7s+::&s7QB$s+:9&s/Z1mroF*2s+:9&s8N&krfR54s+::! %s7QB)s+:9&s/,hhrosH7s+:9&s7u]frg*S9s762As4mYIrj2WVs+:9Ts7QBKs+:9&s+LFPrqHDNs+:9& %s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+::As+:9ts8)`+s+:9&s.o\kroX64s+:9& %s7cQirfdA6s+:9os8;iprkSPcs+:9Cs8;iprp9Z:s+:9&s763frVleas+:9&s2P*:rVlf8s+:9&s-iuc %rVlfds+:9&s+::<s8;iprgs.As762As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+:9&s+:9&s+:9&s+:9&s+::As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+:9&s+:9&s+:9&s+:9&s762As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+:9&s+:9&s+:9&s+::As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+:9&s+:9&s+:9&s762As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+:9&s+:9&s+::As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+:9&s+:9&s762As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+:9&s+::As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+:9&s762As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s+::As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9& %s762As+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+::A %s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s762A %s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+::As+:9& %s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s762As+:9& %s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+:9&s+::Fs*t~> %%EndDataCountAtEnd: NoCount grestore %image grestore % PSGState newpath % image restore_ctm 240.498 198.999 mo 240.498 198.504 li 241.002 198.504 li 241.002 198.999 li 240.498 198.999 li 218.997 198.999 mo 218.997 198 li 240.003 198 li 240.003 .999 li .999 .999 li .999 198 li 16.497 198 li 16.497 198.999 li .504 198.999 li 0 198.999 li 0 198.504 li .504 198.504 li 0 198.504 li 0 .504 li 0 0 li .504 0 li 240.498 0 li 240.498 .504 li 240.498 0 li 241.002 0 li 241.002 .504 li 241.002 198.504 li 240.498 198.504 li 240.498 198.999 li 218.997 198.999 li 1 1 1 rgb f 16.497 198.999 mo 16.497 198 li 218.997 198 li 218.997 198.999 li 16.497 198.999 li save_ctm gsave % PSGState clp gsave [1 0 0 -1 0 200.75 ] concat << /CSA /2 >> csacrd [204 0 0 2.4 15.84 1.06999 ] concat << /Width 425 /Height 5 /BitsPerComponent 8 /Decode [0 1 0 1 0 1 ] /ImageMatrix [425 0 0 -5 0 5 ] Adobe_AGM_Image/AGMIMG_imagestring0 425 string ddf Adobe_AGM_Image/AGMIMG_imagestring1 425 string ddf Adobe_AGM_Image/AGMIMG_imagestring2 425 string ddf Adobe_AGM_Image/AGMIMG_filter Adobe_AGM_Utils/rdcmntline get /ASCII85Decode filter /RunLengthDecode filter ddf /DataSource [ {AGMIMG_filter AGMIMG_imagestring0 readstring pop} {AGMIMG_filter AGMIMG_imagestring1 readstring pop} {AGMIMG_filter AGMIMG_imagestring2 readstring pop} ] /ImageType 1 /NComponents 3 /Operator /colorimage /MultipleDataSources true /HostSepColorImage false /InksUsed [ ] /SkipImageProc {false} >> %%BeginDataCountAtEnd: NoCount % 1 img %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&o)F=A %K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)^H&K)bTFJ,~> %%EndDataCountAtEnd: NoCount grestore %image grestore % PSGState newpath % image restore_ctm %ADOBeginClientInjection: EndPageContent "AI10" u userdict /annotatepage 2 copy known {get exec}{pop pop} ifelse %ADOEndClientInjection: EndPageContent "AI10" % page clip grestore grestore % PSGState Adobe_AGM_Core/AGMCORE_save get restore %%PageTrailer %ADOBeginClientInjection: PageTrailer Start "AI10" %ADOEndClientInjection: PageTrailer Start "AI10" Adobe_AGM_Image/page_trailer get exec Adobe_CoolType_Core/page_trailer get exec Adobe_AGM_Core/page_trailer get exec currentdict Adobe_AGM_Utils eq {end} if %ADOBeginClientInjection: PageTrailer End "AI10" %ADOEndClientInjection: PageTrailer End "AI10" %%Trailer %ADOBeginClientInjection: DocumentTrailer Start "AI10" %ADOEndClientInjection: DocumentTrailer Start "AI10" Adobe_AGM_Image/doc_trailer get exec Adobe_CoolType_Core/doc_trailer get exec Adobe_AGM_Core/doc_trailer get exec %ADOBeginClientInjection: DocumentTrailer End "AI10" %ADOEndClientInjection: DocumentTrailer End "AI10" %%EOF % %AI9_PrintingDataEnd userdict /AI9_read_buffer 256 string put userdict begin /ai9_skip_data { mark { currentfile AI9_read_buffer { readline } stopped { } { not { exit } if (%AI9_PrivateDataEnd) eq { exit } if } ifelse } loop cleartomark } def end userdict /ai9_skip_data get exec %AI9_PrivateDataBegin %!PS-Adobe-3.0 EPSF-3.0 %%Creator: Adobe Illustrator(R) 10.0 %%AI8_CreatorVersion: 10.0 %%For: (Dan Stamper-Kurn) (UC Berkeley Physics Dept.) %%Title: (lec9_fig1.eps) %%CreationDate: 2/15/2005 5:58 PM %AI9_DataStream %Gb"6BoaR\OWaG4JGKfFMZ=(<b`;0;_HjcUi18[BPU(jD[^BcWL_<j"f1m>SYrEZHY@"ot4<e*D<\c,/ebQj1W*RQLEGZ%S,(BZ %G'O&c]<>SVqr[DIJ,OCHQElE9gnd!snrTJ.qq9<pp%9-)^0BH9POZ)N3U]kEE05ot6[,0ZJ+`cp=78> %ro*fWYJ0o%q#8P8&)[>+ %GPpdMGIq4sr!'l\\bgk`]m95K0>#,kQXB\%G\6uVr8m&5RobsN+5Xa0\=7@? Wf1<5_ghFkSq719DlNce]<C(=s7NG=iV?P^s6;1` %ruHMDIn:HkHhHnRF;<Xn@ZS7uQ\4bN06[M`TE"d)YJ,;\h8^$Z5JDUHm_Ac'Dr(G.ig9Z4e[I4$YTt&Jb!mWEd)j&kEk)@q8g8& %[CbACO2'=U'E?,@\)1Z>GP'Af0,iq:Q]XqG$8%m0poiM^rX8`94'3GNcf^pmn/ ['uR"enhn9'ft`mkGdGkC1K8Y!]U^O#eES!P4( %d=TAH_?I'0QIYuc>@DAZh03kqjdL@6RH;W#hQQqAlW8T3jmM^b:Z:blFh,TQmQZ*sh<Y(MM`?])2qK2&? [Vn9eV?B%Hi4Q=MX)`V %qWml_^O!eu-]_Wk]VP4B6_g8oa7!Aapu^*s!7U[\^;n@qjfT$gh/C#Wqr6^E?[_]E)m! EGp=i[;IfKEIU$d@Fa1Nq-i1bm0G'+XF %JX:3ni=!,.g*/_@%r8L2'gMR8!:RB=? @VSCh(NK2(nBTPT>1<teV>eaIJ*,sT0YWa)pR8Q=hjtoFIf'"/5A:>-OVL*bD4\V2c-*` %Y4)r?pe>c.X8\IU_/+Ptq!+C[GlI:.s7-'B5J;F>)CIC-$U`S^m(`XF^q8(=O"XpU+q4HX? i@1aiNF>;3t:\9&V!Ohri?ia*fjJD %,Q<]8^Pri?NKLuPFk=[2$#c:[]UC1[D49t&Bt@QVd9?(3>4J0k+*tS#]WG5I %KF;;Gh_bE[iLP)kjaJd*05?jjauAr0%34L?S6T@ %jh_OJVn("+,CV"iMi[/t0uDuG$ZEq&iD7)qa/,Qmmr2+u'CWb'iD1B(:'X"Bj2.F5KnI77fG %*s2iWI,T/:`h"06EHpf<tbmK)1! %6c5O@cfKb$\k:ItSnXchSgsZ[O7ML[!8N"j*P\4-Y=k_$n-<mL1#buFMAMFGcJQa\i? *:`N_rlHVhQ;51#c!A_>uD3i(rT"<oHie %%EF8hGqg1AG]L>"peHMHlF]HH/ff.uk8nR%aj[fZdIR@:o@u3P1UjL0`jb.:n%f#SN8aj%E?7,iNFTo! GT4O]NfiLY+3'pt%h9-l %=")[k`7)cq?q=@<<hN="UWt[:0Mps[dC&)hkPk#,o:($rW:RSS3^2sqhPTc)k. (NlSj1YKhP^k9]_4HRgr+n1%*EG]o/#mGmbYCu %FL'Ua?qAm4cleGlDpY:A^TFriF^#=AP>3JghPN]QX'O:8F2Rq>3"GSshh! =Jq1QOj[GUmRM6GZPrkRPSF&i+^T6]Sbp7":Cn9$2R %p*-.-T"f$Tq/\ObFo0E*Gl2[CWqMoHk;-JShu"AY,Bt9]&:a9Io!MfoD]E7Xa-86T$dS %fT1>:1ICYl*r18uE)].^;YcVrVKGgfa %oJKq'D(#2W1nFDf*;M\mnDhu(^<6@XYD7`eFlD6Mp-E$6hS/8)IIn%qd&rFS=6.A?MDDVq/Ik? 5$t#kV5IRcd]C=_T!dA[k(OCIl %LBd$iR-F<:\&&TlZnM#Rrh&so)Bd9>Fe0]Is63s<(Ht=':Y<E2l5fd@A09Mmec61j?] +dE2j]29f2qLDd+e0><@oQ!28$,1-n#!) %O2K,3np1&HH8s\)I$f55%@jEhg_P'N-8<98OTnS`:0$[#Ra2e<<.);nO!b72BNP:/2lSd!pm^-C?tk"s7o>_-$d8u!@DdDh`,a@ %Y)IdBc00WoL0LV<Ip4l:'*=*@5lJeJbgIX,"94]YgF)Itm4X,*[4UdoSfip,F?W&*k@L:D %\2C4*iI8^PGGsoT<*tECVk);k>63+ %Fk?&HKPO4BS/8@g0\QLSk51(^-am2D6k.+Z<7aD_Eq2qH@pcDncN(+'Y=X9EghgpA*`m$Mfk %)aR**7bc]G&qG7_h7(8f@]E!_4q %JtHU=#Zr*^qJo[#Q\44_i,p0H`>[Db9CUlSiB<&>lLo.D]WJD[Bb/.liL?!N=:^$k_#'ZL$[)`lg'[Rj? fSitG!cE29']=-\e(eQ %VIs$'S_s9<s7[>LYPS^/HJk@0djXEh\KUb8#j$?E[MlGjr+Ees63"1m+T30;$%YQgbu<c)SKFLNCMGm'1!KO"HuZJ>=R27iCq>0 %$'u!UQFs>H1G>0!'6i<S_SoBX7bRY*6d8eur2pK"3BCg!"%;=IuesBmO8@lrCU:Kn]Te6k7T5j4!!:3NB?`MK6c0^%WE+Iq>pB%iGY9uWY63d-u9g*^`l'PNWeq^+?W-k/&q"Zrp>X$!]Ko3ek%)l*B`o"ikc>na@) [k5tWjfgOn^WYjPZ@1X-=q,sSO7;5j)"63h#) %7?@! I)I/Rt,*sOTrH0eNAQ8G`-/cXKgUKPZ90>hZ_B,MZB2gouk:@S'I>,>WJG]f+iD4nEUW"9S0g.jp[Ls@d>\ )#1T^J%`G6#[_ %D\V2&03&p7<dN2h6D8\E0]I!jXPa;1H_PAm$du5&^[CLnB*E5n4-"ChS4K78h&Sr7&pSX0;.#gIYruMn6m+%.C^/)hUlu,'uUaN %L&l>!M)(pnJC)=m_54dkSE0)9aP?6jY\MZH6R2g+fGqUgoqQ+]_cTE!3su!/%m%sqX41.6pK) %fdR0@2)S6^rCnhg^42oDde*og\ %ge7u'_>>3JHe3c&"ZS&%WrdDtK/0`O()Db[TSoNJAj_-dSX*K8hsSM5*iIQ% ["3MpM,Pllb,qgNFf'4&pX\FKY[4<UP+Ou1ZGBb. %:>Gsa:7b%bcM+eQqlTaH89ZnN\h+L)"396%]&tS,'.*Mr9? 2u.;aR#AFLh0q[)mGAnU8"*rtfdn9Q&l8O_=@B>sF/E2g9`2.p)o? %GX^ib8+$? 6'5/+5A3V?)Vi@V)?/K_TGPu]dOe6]LI<Z9!?"HTM&>.hT1ZQ,q@L,i>9W)duDU47oK`qKo'ZWZ]]C45^[] ]R0T[KfD %$K6\Yr-HMY^<6=+rpd\]p5A9WDL_WI`RHV(J7r"\_.d:_9rC)3ho'<?? 7cu]A9sBtRQF'd:.QZ.7#N1";o1\[IAWI.Kkb-mj.)e, %)"YGjl=3t"V]qQS'7gJEU-8j\&AK\^pZBpaHPqQ<0VZ%EcdJ9G/!LA&>1(k3Vq(;YVb;0'a'13GougW5\qV4qoVJXj_*b#?_bS2 %r]IoEMq5Z3baS2"L\G`DIj<jZ$i9:8Y<IF8XVfHailg5lLBh/#6Q=YKB>9#d`je+Co=+Y@LR2A_L,] $NpN*VVs3pDnro<[l=1^,Y %qW42R4FaeB9pX5Ff?^)fqt"HQrqjIgkGNaJX!M_9(.2/t/#b&PPtB+LV,4-nTZ&tYV&ZERTq&'OTj4fuUco%,sk15L,)&_Tp2fK %fg@d8U`RP9G_0rW0@\6$KFjiQOMaJ6AI16\_]^!%n-.bPh&kU1(fSXuMK:>R`dKtf@m!3<J`6if1o? @D8h$Yec+nn^Zqn^FN-DkK %+@D/LjXJNdjI-VTQr!MZK+:hMnha'PWmbB;:1orEnbKLOc?Z#D1@OBNm+"`H9.[WtV3XJ/Pm\! J<oCJRMETNH9MXC+rOh%VO8I+/ %4J]lBW/'ElEX^!9S<*R1cX=VedfH<sS]gg7P85e810s$8]c7$R!LWn*JdHtn1P,? &G'&F$42Y>AmZ$_SGT"enoD*bp+4#`6r`l/! %q)k3(Zl249):*hY:?U*jF?CR=qboWYec\r.!A-j?#jgi$)NL0Eq04qAO,)cp=H<X^2aK+G0g]g!,N,fDq/ CrB*tEW77=h^;LC@[M %LB(fdcimBihOe2W#8f2dKCaPDnL']X!/ith90Ll? bfg+MVq(q@1r3uSR'QcK#C*5<@2=nXQ[>)skTe=<"S8*jQ35>g+?i,^a8#]c %:gkAV=H,Ej=I0!f2,'A$4Ioln%auJ"Y"UXQ@@e+5AcSKV53>L %_\sV*XnT'Z"]g)p).4Qg/;tH7(k@PY5f`uaUnYd3E0C<O,/DTn %L3SPfJ?C+^fcHdqq?V%!!W46o_Z90cKF>TX$"3B*YZan&!mmD;MBfq.(l%P^&:O[_560J?fE3qrL($g_B'Rb_ud05Y`E27@<]Pp %^ttPg5JkTP>ECT&#pu6OiX$s'@,`4]O`itdo'h3UN6]$clnVn_\ %`#Gk0)"&&)ZVMlD[3Z5hh4[<aXmNLQh3u^gnmLFG4Kk^Amo] %=!*N$P/!Zl=a;4lCRScd7ES;8P*2g.-djaQ=pcn!hpAZ6LcN94i? cA@\56H(<2u0LAX5)Cai&3F>"nnqPD-XVni4RR%(*ed>%Cn# %'/;)KfXT_Hi*8h9":NO%$NT,bq"u#_jGA(IL'Rb\6%ZoS! JAQ]!/*ug5[e&gLtToR1]TFk,.^M0[ZPF$IN+hd)]`?+Xg_3hm0%5; %6JgC4WOAp@fN,YiG\b.XP-&kYX`^<([>4/22]20d\!bua8%71*G"Z\q\P:[6? DZ0S8]TC5l70m[oUA\/,Bm?h2re%Q*TgSh;G\/Q %/j`bOBedd$F5>16-E;[.]S<Mrd$5b*R*uGfW?Nl\=YQ1!VlTVU37Kh/%Z61TCaa*QH\(? X&Xf7a7:utf*kE)hUHl3'1<lcCAbYh' %G"Gj(OQ9T.f!r4J:Y`,?NkO0fKg_!Pm[t0u[>le$Yn08nQ4'?A&o`k/=R]0BW*1XQbcXXBLl_clnm? *.@TUEYfb!sqO(X!X#mf]& %OBBREC_)VQ!;JYXBfuKmT'M(kNmiWENJj<G1BKs?!7t[JB?qQJoE,Zk,EQd#)h<HGB^e! pJ^>`q'5hF_;'>W6lM*,B!;>KiEs.3t %U`:euQdFeZ:N<WOn^>tm^]cUt;%4Wnlm0:R=:G*2ZbN884Q0LU#=oS63Y^=VBc2hj5tkD"KVqSZjMc8*aa\`Z',_Q2&BF_":moA %&K%)BCemNr7@'Bo'7rTh:?'IB-_3mC'Lr`M'At8R(\]+StI5@)FkDZ'+'\Tq+u=kPPBBSf3ARe`]9+tR7NF0@CK=.C=rJTdKj+Y %BLVuJgh[;$`!"_e^_6'D8rnY/cQHg0!6bJ*>G?7pOjcA_)BW[9F_uc4l9sqeX"! @ZTbZ)MbHc/uC9ZR'B"2.lX]2#PRV7\\X:DDW %L#i5qeqDXbVKJiE%_)^US]`TNrMl66E.Y[Hs'k[&]5>mnHL>5(=7a.to`WM"HIb %;Ht0n"AfKkNp.dj,Mn,^Q?I/5o/CPS_C`Uaa %1u))e3o"&eXh^Hu(Zj/3j.[Npm&a598D/Ri-#1p:0a6Q%aK/S[)AS''ND-C/=s:R?'?rQE %fh;C_FB7Jql*YS@QQ1udIgXW-WbD7 %M+SPRRJ+KS$J?VT_u#Mh@D0Gd]eI_XBK=em"*"_S_9RDe*Us)&@S\.<j8[>!A7C-8L*uIdScKDg5/!Ju^\ %]mndI5!rg)Gi+bWP! %OpD+t:W/u`9bCn[$'YI1/n/2+!/(aR,Z^Y23to%.6r5N>is1,/RD_Z2,mP&/:U! &[LrB7T8VA(6qOCB(KN4bSiYbiajglEib.]C6 %_(EJSQ`5VhCCn\Y$J:4Y[DD-7A/Aq,GcaQ5'pV^`*1,j!Ae?"_h?]+u! hSWrN)!)kJ*)_g\l,ZGr#4K8U`?3BaX)rhE%;]tD'NKB %+L49WCn'ZHj:Y/AD)I3kfU"0I(Li^B#87jgg8B1? S,NFHL0Xe+_Jt\3/*AGEi_'CTg+d$2.m]&AOq[p(OV2pX=Ft't''>GBhLT>^ %;SNlB5a4hn`;$UE)Mf:e4j4$^1Ju+XOL-CF3\kg\Vui@8)0h7J@,!M'h16?T=hksZS2jup$m8">1BEjD! 4_T3![qR\+9MU8<[Zna %0;SMYom`\F2EBn!9)T9A$8]GmMVThSLk8lfP8IuB#3%#)m,]dG`D$0"0u0A?N.^&KPAhFB0$ %rJV`g3%a..^$#Ke2<Q_9iMEsoi> %(tX<<,>f&G.=fqqiudRCBH.Fk'&ND6quH7lJbZ@8GV-k:_!.R+:H7-dptM53>/\l[_<1A% $uZiqm@c='s2)9dNGI;0fc%m8o7h>P %3&ZssXt''%eTl?eo)N!;no<^HKmW;%D_[)-2%5FjORV^Q'E8F5"__]*",D;qD! E<O<T&-;?;ojC,\<Q9VJL!0(_fPr8S#T4166YU %BKJ-*m[S,qlCQebOfMc%qbm0c)X*(F;;S.^;g#:8`*A'YW=+_gb]Y3=k+ob$".g:bb?W\m=%L? 7['t=)o+"!.GZlf,i8[\=EK>f: %%VG&h3W*)TUSl<S@:<hH1%A+[1#lc[a]qLj=59nPR;k'5"I6bHWD7K"U3N/IpYKtoL66a-PHCY?=MKm %L>CR[%\$L$7E288T3`;q %e7MPM=LFPsc\>X1"2G=6d@@3&<b*6^JdWJ#o<^"UmD9a>L)ga1G)XRdJrppL2#3.dEPoU_OZQOfo<M[h[K cI)/DLUWc_Hj(i'6fY %a[q!W5sFAfAO%nqK+o/Zq3sHKd%iti5o-Nbf21_-hhu>!p68Et? s?-'`Tl[HBgii)PYlXdm[T$J"c"mnFEkI0e[l)>+-#HN*(Jg9 %VdXB&nN,.C[SFD',H]9>8`RT,p@A! e#,FiM8nFF!.Q(cD*9lWmZrUfp^8'bKE]6VH.!)0%4ef<3Dr0^l>qr"k>MV%m9!@nll3*Tb %Y]nI`:)]*JoDDa6mMa6I&NiC<c#McSRSMC\p=-rXN!?W! F6N[MbihN=:j`gi`I_halngcUN^bUn&8h+4U3?/qBSA6m?AP:8OVniB %TkFd%@q_]XKpbW/'<+,-)+Gh_([T:0#1AFO]HH59T@?NEKoDlb#sXhOVobajOgqTG-! i@&Sk'67+EQh>pp<A6b*gJRPGhFnR9(U> %-TF7?'44;O5*<)bc)h6!M,lCC(6Oj/oU:Uu9Vb;jA:tslHG5Iqp.Upf,FN'QUm%o+;kn&MG_<uJMn*3`(:-b78ke[g(t\(M%$h+ %Z9:0Q$>E/S"u;TQ7.h[s"2S]lB`jCa7(i! 9Bf[_XVe=IsjFnJ`)7$q)gPjh2SF$d>c(o2GD4'p,fG;rEX['1[+)K6Q]\O"Oc,<=G %DO@-(c0F0JF0_2B2M5c2DW^A!n9--sR%\-cDMIUlqVJ[821F4ubfhjF7Qln,:%LoHDfP>1PU7g>r.9AZeCsA$9F($Um]2k@@U$O %:X07G#gN]KM1`%>[mN)igX.S#CiAoG2l6^mGFP)pbt/ng"\u1=UKQQoroU;##Eb>%hPN'W,hB? 4OIX\k:sFlY1.$)k?mj8P/==[: %@qEK0ra3krgtX`DZbGb8Jk12of$jU7ZOLN/q3oelG5^#M4D[Zf:kk5]G43Gt7R:P"'t% %(3%<D$WQA@5D(X=K-uT%]&Qo&phW:Fh %:M9L9b$VRIM4\W+;#;m]X_(d:lQY!u(Db"Ue46X"hTf6Qed.cL>8tQ<B\IVpR`^(&H\AI_MkMOOU%4%? XqqS_,Q^UY%S3p>?DTt/ %_M4KeWE>Y6hIID"/_clNSXSZ>g%WG%7sp9Lpl90'Pr[4=B4kLMbGpM`7`T"31+ (p"ANY;X#EQ^t^U1'?:obLR9l5!cjjNL]1nmk> %Bfm:S$]d]r6)/u0:UDTg"PS@/RIkr$lFGFBQ_H!)FY^PV2@P-?@0S;2d9gTJ\DmIUQC^gq].'L<V4qG/)o[O$@=hAmFjD[BCgC0 %M<>Pr[:%O;oC&X'$VL@[R]"1Ort2hkl!\9]4AWQVBqddp&ju3[/]&tIjF;D)J=49g>=<nd=1&r0#Y4Kp$_-pcN,m$,q:-;irNcG %XNUj0Pe/=1__sGs-5jAW#A19uAFZB$cAUsY2K33bX*@M7]YW7j#Mt)J+uql7s!d%D@/Z,q@Z6cq76:#1d: %ZO6d?/:2WWR!nS?4J %%E,4hT8$TS7_.8SM>=J%]GY^$Z8R'8cC0e/O;m?%)D<G-(p3r0?HS+Al]=p'a``XK_c]3c#0FBZkKb %g#'57]I&r3-Z5k=$i5M.7 %Q.c%Bs#6Onr$!-AB.G%g)s!()j2necn+T5(I%QcFe$=1H:q\M]j2n1D01n6T,l6Jk6gHb?[F`okDtBQ! 8(0U@XR'5lMc(=%?51e= %&H?1q<G#rAT-s/T+p'QB^/%%Z_FZk_Z5>c<k6G#+H\Sq#lj\(_\X7f>RTIu];]`ldL:s@NJ(l,2g\,YT+oZ7^%k8@8>\M;a4-O= %GkRT#&j"@<,j+Jcr27Vg$MG6^;(4(]LbDd"VE,*[0SoJK.N]Qc`/PQ<>0XZc/`5#Sim:e9l')I7X[PIdUq#+qK/#JfH%ZG:[dmR %]q06*p![[p7Ft)eWG7]9qSqClVt0m48U=>$9:En`4D:3+;""_? qZ>UAHY&]TXFKi3X.<9OLim>cCOfRifFFQ4!7Ch9``TXfU$;G_ %[6?$il>F?fTKH:=ZQA7q,p!,WSllTqbC\R84L8'@nM^R.k1stY1JL(aVQ(Vj8=:qp9piR+nf4&F5CkcIqSrF>(7284dP8]D+ltK %A)f]1'bIPS^EPTSL:Qg&-+gWNYQ93"jSNn)YdXT4Gl'>UmE+(5LZWh[a#NHus6>A%h2`JI! Ii;kCU;J7N/.6l`Jm05g@Hn`To3rI %l*_E7pm1e>L5aBpI\L0uNk!AEV3T;M1%QEi:ZU3V[J[i'A\R;Y'0>^jCSKQlhr.a7j %'9K8`8c`T;k\8oFh<cIe3Pg^;R5bqG#Xi %>L8*:l:.#)6@L_8Y0@e6+tr"? Ru3n@&u`XB2iV'Zbnu0e<Q*VUjc7&8(1aE,=I*`7S(j@"]3=$*rCZt6in>Q(q2VQp\Mch"0QjiX %l91'1Eh!'0pFKTg`Kf[r-#OH2EE2$u?-NLW(+*EH!.,r>,N'Ld*(W"$nReq246\;!Y %qPf#s")eEKDqC]F]*@^u+S>hNN"-kidQW %SD8go2tQGq]@@16,OOXY#ND7.>sdP;9\5Hp@T&hWm4pUMB %Y';]4\mQZ0&BkO6Rp*5uhKkZ/*QA,GSO5Tla+RR<+/pI>EKc`Np1s %1H=@h1K,;H6PN^c_L=jpGj6<\RM85c]3/@-J)dQ)HPH#dLDC^*iro/[deT<Z(lU]7!46/9'%? *n"E^+FkaEA[$pd/F`"Za:cJtdq %/snY?b=H8`fd%WC9'CXe,Mc?5SLQ!8^hs_e[PZI07<kAlMc<R$X"#g=cAZlRjcF\JRnP,R]9BOhPa7? PI;mh>GZY@Al3"Xf2G^iu %4)\HZ]26Q$.4q"!A^c1ZKl8i6K3'cYq3AUe! 8AiVhH2K(SpJ(GOEq$MRQ$=Q=L8b[k0LI)jW]j1QFN5#_l(QE5-ergT\0(\R4">H %,p1C(bPNMCDe/<tb_\1/dkci9k5he %&rB09kaXcq6j*P4_*hU2/TjN*e;n9mDk9+C;#JbB#Ga:Dh<NTj<Ji[KY*si.gOue*B:1hG %O65[]MLoR\s0.N'kR&GFrO\cY[Dc`lXmrig]bU*JNeC0'^_[]jcp[BX`t93a2=Y<2bRGAZ7=5AoB_?\_";3d@PK=cU*j'FT*L8m %R>B>rM%hr^BuCjN`:5!=<Y%T5-dqGg(E$+Zh%T%3#L^O2-t3Fh`N1LP80i)+*R6CLWgsA/ %#>WS73ON:J8u6S@2q)'@L?i("(6Zn %.0O:6EBop)h1;MfA'l*!`0bYd`Q]TYA/gFN7?%^?dgf[<B+q%)>'r_`YVuRb+JM4+LT$20RYLbW_C1GP? hgq_jaD<sheXH6&3G=_ %^]1.&n\WJZo5S%4ra22H9(c6096F#prEM(f&1]ZGW'm@-%][WO_Q^DcmlMPr'>HTUMhuuY/@Z=>qrIG@\ +b4%nDV$@hrS%?>6o[' %1u9NhD[Y8lRtXY/[H3[ap<RR:\15b#U/C1"Hh4oDj';D$[^,m_#dUc,`)UfCTnO;)j*,ekp?VX:MSH1-34s0Z&T%REPf01F"j/n %pK6;dT@5pRQ+mVE?I,Y55&0/?71K&0n<p!RHS9LWP?C^_]simAWr#ia\*C^uM3oM.37+ItaLq.@G? 0S1I5];_dk%4U-43IHm_s2K %ZPdqWrq_'SYU4BuQ!n5UYMF#o?fl_L@)79_pO%SIT1OOWlJ2L6jebZeSaXAjb`'-] %;#ITT)V3Lk84/=fR<;\ot*H%rsPhjr?\%T %jtr_T1Tr+lkSQJ/mMTNgRG*qbo;pcV4*'NV$BH#90`n*1K8Bgg<D5NLF.$FAU$`OZA7Hr %81L!'N5f>oNQHcT##]C`dX["eV)f3? %T]A@p!L!R2"AB#Q#S7":oFIF-:Zt#!'1QE=M"jhJAQMBB@1Y@fG)p9PT9V>+c_sBEonTp>0F4Ybd0,fkIoaFm3IYB_'DP>HK]Ln %.lT@rMq?2M %k@<enZL1^0V$&&f<h;'@8iA37;G:Q@4Uf^e<S]ZYu3MR+]kr2bWf6grJk+MY$nTIS6.'<OUq=? B$g0fbF)SYRVE4b %-\LlKAFP!UQU,VgfLX!O:o?U2%!*B#l888q5tUfiEP; $dLQh*ggi,K_r$5KOL^pJU\j*^[h'0\Rf]a0@2m*/=8\L6<#,t$7EU8V' %,&'%ss'<jsiIQ2.PCkV1gX/g5`B@KfDeM%AAD.(iGeo*L5)DBa!jXpcgIp(H/%g`.GqjSd&R#!*c'? m[q7KI,=tjhk]m3-3<SNW# %9jNV",a$t92U$8YWXgpai%q[?I(@_c%H?PeT9D^G\VN-6/RFUN"d/bqTT&OZkp>R'1V+HsS#i]EmL1?n! dU8dZlO[u?%A_>0n"r< %F+];9a^b!3"H5,LR!or#HN\AS9ga=C1;uWg8Q;ORi=cg$+=WnE0JQ_aMFXeEYs&gMMPdRH![QK7+? `DCp(i2do*@_h8^:#j#)UTY %#Yh%(cp\3KOr#Gt]!FP.);UmO6nc0*EMoL:0Gm#;[/0N1n]0Grs%-CAdT6>l`9@.*$ %mR/A'5.d1+b*"l7F9L:mRN,/Ak^rPdi2E %F#H=B=20qaV!HkObq.D^P+(17Q?m[8k_ARMa&<c_mR+fFr)aiA,qIP=$RrET1?TJ%!iee_E9=R9! RGP6Jn**/KqtJmW.h'`B_pck %e>XiNd4"l^r7o_pZ;JbH*\FD,`V".;p63WB$5W6<i]Sp+L<3VP\7%-TX8uY0R#LPP@^4=^OgA.6;C=T94S)42,LG?<g$l\@'i=b %HAq>)WlGYQSL$1*-;.kl9-iMd.Oq^#&4? AIfEH8Q.`2gu!)B6S1Pes@USorLM#C1N@>I2\J#L$mE<ft``>^tk\.rX5Q\V2f[/*^7 %nNR*hoV8mo`8jLpoq^6O,oUsU4gqg3-3k=paS<ln`pJk-4)A_!`]Z*g")N?7>R4;N0QA[*\j;") $&&^.p[."tQ.6LZ93@M:IC58@ %Y@J!Mh&Uj-(LU?:GlL@WaA\! aP>eY=],TJ:,ucH9Un*7CA+=nEQ?.6;1+mh3PT$=8T9$92pi9W(dmdKsdhQQdf'i&YX7no<-d)t( %/s"2d5O``<MnL8(UqV(O?ZbRkQ2C5t3k]BCa#i=KDN.>YDC&NA$? >N>GpTKWhD&B\#d7$<l0aqD^5_NBh:da)_;_^^$"(^UhApZM %cC'T8XE?%iEslo`PMS10,lq9:H)BHZ-.q5X=JJq7Gg)k+j0>i.K5a;2'mpS<\:QFH? asWcI56auN,]kFBK@Y,VJ1lC)TK9?^+_KQ %;dUNhB?/GS.3*4o/e(T#l]]ET7Fko3B8PU>!&bN`bq=u\2f9rK\B!Fl!Eo$D;? p;d3lgXb(2psKgF<2+qBc#)>$UscgUd>Ikncdd %Ms'6$hOCM1d^<;tGP!d`;iElS[oY':Hp<\Ai=gT95M6_BpE/7Aqtd@[Dg&nmrnVe%5, (""Z3hMp4sp7PgrM)Fa;s'W(=g/_db,uc %^<=KDMndp&1%'jS^Q12LFp.\J,Q3:9NsPG@HaVDE#B:`mnJoDg! 69)"M/:dkLZ^dGhP5'4NW/tg"9<q[<5?_3/>H[>'Ci'MK(1)0 %Odmu=DghUY3"tFKQoeaUKK584-$uFE3uTQkZ*G9"Rj_2Ungm%p-#/_VVEA#Jm"$oL<K! N@j`Hu.OgLWf/P*=N5n`']-u/]3Z*br> %k%67Y[TrT8S9A:8qd`bZT-'m<96[<dmOHuH@&4%q9ZGCXp=^kC0;t]mT\7CALld2[:P8&Wd*srs(pQ+pHC3FjU]$QCc23]-^3Fa %GM_f['2oEZNp1K9`ueguH`4@<2W6s?#KhOGbP=Z!#gj"l9oK?A`edG7j0Ka9GK2\R#cBlXRS*hd8C*oSl/ S:/Hq"t#`-+2/58gP= %SI,S<aP!;Z#"ho5ls*6/d=rje>kh5LGmJ&!j3tk?6t/\mMhr=MN07"j:(X1pa0Y9_:[J_#fh8'5"+>o<lk;NAj2Y!H&CTJA+BWU %b@WZ&HY@t23hU=Bmk13rT%mMigYTnlhSn=I52M')^)q9=>?7H<bR(YM<rfV3ap<+X'T<JAoZ7oqX%YeQf. (V#'OVU3En'AAF:+Cs %f<Y<:L.6_Mq!@fQ2:Em'FU:]86Ea$YD8M/*$1T*A-grsgdZ9JAkK0%[O(ZX<&=$kf?:MU0%0J0F0h.8PLi@[9+l@VAT!]^om=/J %)tu\0c_#'gCKk(b06+Z]A8Dj<X]05J&kHbW*US>69C^j,l`q":NQ;MG-?=$q)Ueh,g3P)dTt5mVRR)i;8qpgU5D`R<&)"r1fZ)7 %2o/ZnPMlsC-d'dbZ78>i-8qcfbM:C851qBuHTO;mN='K&TVPSdppP7;rE6aZ\".qRQI28kfMYck1j, (#E(sXR/_g6fo!Ou6QbDOb %YD^n1E\7W1,GElr/SS3X=k.PUpp39+`VCEb92oK5YlQ2!Srt.lAG?$3id]Nl:<pa_3? E.8P=5$_Obj+iAL,q5jdJdS%5KR]0eUPS %<+8qSFJ<09ZNQCf5rRgM&O"@2nC_l1%fBHH'4aat.:GTa=jI&2W#j,HFd<G8d7*[IKE2tPA79(7C>CpX %N1>IG$MUP<:!n5OqZup %]blacCuM,`,aHD`-]9s.p?0c?bA-;dhV&hl-C]s?6M*D9P7kQfG'9cCX,NABl2sm4$"8HZ8fHVG1'N5k;TG@G&AZUl8d->IDN!\ %-?!UMa-P_i-$a>&[?G-:pW4I&h'9LN"3]+JZaZIk/K=Sg=kG=jj& %S8qm;DMZE<_4CQmm`GPTcnB(_)*W8;QoDl%suLOTXA\86E; %[=ErHak5S^7=DS"/JJDqb;r*+i*m.$JFO<%q8@Au9]n1BfM2F.r;R2;8&8.Cb[RIh\s! Tr9LCthn4Z$B$42&@a)J?Uoo^;!'DskF %Eg#Ba:,4rc)28,?c_"@'&iNd\ghABDU+bqdN\eXa/7IRYga(0eEqo#uYlte6LaX;_kR?`b! =_1CCn3\jclhi9c^k?nnE5p.6[t,_ %94.7bEYf8`Caio(EdTGZQ&ooMEe5FRlBbABO#-<? VKbCENZ&;B[7m<<3>1Ml]ZWi.UK>#HM2+*hQ=VQ3Go)]o\XfeUoWCpMEnEKO %Qd<3M*U?!NS22+im$qR]g9^!C=eg:`WY`smRH/JMim]VOVTbh\L#E%ap*l>.o=;@%<6e; (9:fC#DGOV[nRqC#LqOS+f<V`O1#/<R %eWO300WBbeAs_l,B:nYoNnZCi;'hr00K]9(h8=h&boLX.c@C? uHDK`hb,Ms]88kAI3E+P#VqXtqD("SVF*-.c\oNNXSO.L+R+L)< %ABhdD:*mNi^b/Th-)=j? r6;b.9^B#VrG#:BC/,#uiaRZ7URBN1):,3lF>:C)EKW6DG+eFU`m@tPL)W4@@c:%(s+g%$,S]hZi1%7" %o*lh0FC0Nkj^\%+Em"2iJk#4tkTg[0lg.)!dEUZ?QIJnb-('Qlem<!uhnF7KCYiE.]g8`J`Dp`&h^?! 2rScSEQZ$5Z^&(:!FsD<0 %D:I!E\?pQX1<Ym*dOE<Z8jS6E"i=qQ#bWDL[dU?X#D;KP%DUB7$a;21^EW`f<_;gQ#s*nE&CkrA5*Oeku-cU5<eqI"\&9`WL>/? %'?0iJnL[oA=^n%3DFqdn<2s\/e:aj.Y[5kN2<'h?T,.gpaT6r&5)`bkq(+-s1S$L%`! X8G_PcNNP:S<nE`1#pXpP0EbW#hf.S_!# %pnR#>YS.*T[d[M4i727X`NbBFZV_pC&_]F-:0:"/K&\?JX/amt)8]W%>Y+)<N0KO'H\H=_9"! cSFR7k'\R0T[B.!^;FU[AhSa;b9 %AgQ3Z\W)GFp#Sl8,FEo/'Lg5*p2$L7fC3t27@J[t$dts?GCG^84`"j%DbJQom3d'`od:)&X6coCZlIj+! h0aiA]DjKVfS!3^WSFt %'DS19q'NS`b^@^Wr]l%f)",(j)%p]oI8o?TOUT-QS;rWO<fb^n$2<1<:>>U.2U=eV&q?b'o68A;[nJ-`? R39JFfDJlSjNnoRTR;# %VG7aPhJf7pN,+mXK;G$G__g.g)ObbS;bTu=.5gq6a5]*Yo6oZBu$8hQnHi^HY9Fe^c6jcCd0Ha_"G`8XOERcUSFncQO3FL?s5c. %N=P)0XRSn%Wk(qFC5TSR9MjffHUTsHI#4+/.\/54FQ/>g5:^Y]3oIUV54,Elk>CRU@.rHqK<\&sg2\re=X=Y4EouLN10.p*FPT%aRh"Lh*[Sl;Q3oXc[$FL#8H?e#d&k9G<cnHY]gUhmU4@I@IG8q"X1>5C*\4n1U#>(bdQLV$pd^j0ctULA-V8*^et(4[+Z*RB=P1 %N^6QYZC]P%:2'CbZ4G6p%#E`b@+R3Ap"X[QDgcZhX6[=]c.78Fg7.>sh5qocg)8:](:p"? I1kl;6)K*>I>0%F?#[,8le0P-qQ)u( %m[,7e;<n2de_)?+@[W/#FjX1LLiOb;_9#gP8g<h9Q\rFm^O'f]fPK/NX,A,/^\r1? &k(t[D@=<.,^6]rE3A0bd9OrB@I%;RnSeJQ %Scs#,gR)4.[J-tnSMjpcc,J?;a3O'gGm[De&Ni+Vge? lCD)5OCUsHcH')Rtg$]ANV\i^B"[%mjS,_g:h]2rJLD[R<4?jLHfXl$1< %Xo1A.(=g&M"Gcd&=ra)F#kd9V:Ptjrk'9;'!3h:USMX$E(IVKo'V+j4BnQ2R/<<LecqS&d:quqS7MUIm>Ue!,LlRRgn-h&*\*XL %WGVN9AS)J)*`.b+mVTu8HFbP-L[Nede]kkF`tJ+hG_8F5ub3(9*epf;>e@rG_\6H"Rhi,Nh=gB^K#Waimtqm,[<?[ZC!Q-*Btuc %^\<LZ2ZEk]=m(:]%\J]SiE%%LT=7<JrBloX0O&k>ik,^'_oT!j/hA"q7qX2sZ3L7JX[1]=#u=a&`tj]f',cloV?VUdQ0O*SY!2` %:KjYDXj`Kbkt145Uih"33^%2JT!V6g>,NaMdpm-`aN$)7eiQHP-Q25f6:KKoR %rC+YOu4nTCc7KI2Od^"3c4`EW@f?>BCOL@Hm.F %iGp`id+@-AT@s:[rSAR?nYX;[4_1Yjk_$koIcu$o_oDSH<IG! o]XmKj=+@IoG>[2dn4`&1kr1*dE)&+\@Gmr:j0\gQjFRh7dc6K# %S#jPS`[=-k.?jh?jmqX>qQhkWK..A$;KL:-&lWA!16I`GGU95e/q^)TS'l=4V.Gp^5FhI<1]MF1['+ +NS<UsPOq!6=!GPsS-Atd%I5I'iO]"K8XBjL`3F"#RNT*\bJeh.10ac=#0<m]p^8\ZtC3HTr=]J=>;]:rQlT<k3oIX..SkadD'C#g2Ge ue,PA/`_ntL!en!2^' % [F8+3:$LIJhl?)V`AbS_Ie#f/Y,/YV/&[oT]To85YH==rXNpC"Ep[[V.F@(S7TN1tFNmdYa`;];`Kh]CeSo CX.5q3B-B#=(?5;(V %EQrHr4*S*8!!=%HPP_bIZ4+=YP8H*5>@CfK>@T\>Ek0Ws>5S! D2/fPPN#o@o0Yb.Kdq5#O^r/^9/7OO+/k5?=Zt\,%\_U6M\g0ql %S0Qea5"_a4m>YET9bd'[Q+j0(dap>8g1gQn9/SCg<>nTn1JUt_/&`4?e]_^/*#@X,k-^uC+(*<rps[3c: +I,Y3\P59T"cdRiolPb %[Rc6=<l.9u:lKd[Qj><VC.i,"FXl-c&LU">>Mr)R;r% (d;GD<"j.q'uP`M(B74uY`8N*3[9Xu]'B2S&:o[Hb/b#&Bh&Y+;^.2/O[ %f;L/n?CEF!WKuJb\5? K<),>G1f0$1fdu$;jfT3aUI@)47#Wn1\Ft=b4WcSp[(;JE\a$9)c&a\rc<#g)G@IKs=q0bgY.L-U)@+%k$ %)_ %EV9ccXqP9n$RG7@lCHuK``<6P`>;I3H0%152$n(>bBP3=u*mqo_j0pZhk*K]GYp6$,_bo`ehJ_hcoZ^3u5`<KgWdr0Vhkffr %(kW]b\P1"JcJDJ(fLX=j*f[.(16Y?8dL-F'EsVZ;0o!(L2q;j/\.AfZr\Fo_1kI^? Nil`$7W#[kCF98[Cme-u2Ja?E8?De7SaJfY %D[CQ5l[#&LQ<"gaOVm\bZ`UEolY^t=S5&MHWHD@j#,Fm9p8M!i"VI:Q9;m4$'S+(NeUpd#5(? %fN00,7]Nkib#p,B^^ui<Tb!.-[ %\jk+8mr>^.rOWjHI@:"7e,Lbm/naig=f24AMThsACh%2>fj""S9.WMgITaM?PajeS2Tk&PJY#Qk3VVf[%L'2BhD0$H_TM@hi^H3 %\g[8X@WhM'r0K%!H6Jj[iaIJ4Jm;5?SPEg."b7bPk/YDtn<4aBE5OS@SAdd9k_JbC8Qn#n>[J*"[aS'!! H#a?`ejA(+j>dNS`nT3 %?+oD10ErJ*<YMWrSIa$!M+cmO%nDjEV#4T"F& %IR0+M>GN01TRL8o(jH^o"GNDZ7WEU&LVgPIZYQ5G6M<`^B5jgj8A0-'G9Zh21M %^,VXcl0/%bWhmY$Y,9,s=\=Xd@m@pc#718h+i\fhSTBbo*Sj:#m-18,G %EnIP@=*_09=+`Y0WPe,t$S1VrVMUrBp`n$Ikgi?gk&G %P+eC-kDSV+5.1#1o0j;<T3UXp9mi+0dM#>tg6/"+9lqSWJ]R&en[BAak(9;5d,q %HKMQ7Gbka$mQH[jNT[nLeR^Z8fQTCKWIs*/d %1>ejAaHA9bF:@Fre\%fKs&AT_lB?rk9/!q$84>H39RpNm`&*SO-cM2n!u;os4C>?!Ieps?X=TU^-fH?,V,B)AM(=GmsuQ1]$/p7 %$WP$EOqV0)H+eC?j:r7:]FNX'$;eghZkOA"67:Rs%LY4BZUK^.C>ij`lr'&3P'].bD&7Q^=qBAbZ-mS.WulPhD1mtS27f]UOq0l %eG9;P':@B\(8c_heAeACD1-\%Kg2KP1TJ6j!jWA<<F+c(?67eFW2L)"O-@b=l>iP$hH=8g(! VGP<Gq[j&4iigdqa+W'h+TG3]e/= %l7=#lqe5\aUN]If(0r=Y#E_YpLhDq69ktP2*^Jt<K\!X^Z8N)F_AuHIJC5d?RWuCV:88XtqLFUSfgZJ\J! Abdi6Q56hA3,Cgfd*D %+mEf0'#>X)PRl30'EU=2_7%U]ZQE;[@QuP.=D("bf]"cYol-1C(m: (t)Z5g0I[745MN+HI_a+\r^tO7g_b7\GhUmDnZA#HT`5.9) %l54DZd*W*r#\9#UAIfSI($FtcS06g3=pW=%$-NMVP0;6\TMpp,<UN$Y^rk1p?u@K! H2@DCpq7,SBnopHigLFgBoSki>W[l!_A]lt %$,-;^#@gjq#!%Ds@Bd3B.r=tRr6Ae^IEW%$lrUn>0(3HA$`7&k#K&DNk9iUA"^+<HQRo[2%gi? Xp#iP/HRmW=YqerqTHbCB[L@pq %)0e$o_WTi?af>mqk#q+>b/cZ&P6M8$G_+3(5jX3=[FhC/+5k%Rd;P-NE>#Ng.JBkF1qN %/*U@Wqc>aSjOZIL&$TuB&_g426B,q>! %S(MdNn0*8'M*=]Hn,rbf&F]f'hYV9R%IVd"6.FR^Tj@#$KYuZ>l2'WS?,l)9kO,lZpGUap/a1k! qXi5%SJ:g1<hN^K_uoU6*CW`g %\<%R1:[#Uc3A+jLaO")66[a]o`k=f.g^uAdCWP.(WXZGW/k`G2#e"#ig$M5E[glR-mnj^TQ*Bd#(BVnSAebbmEWGK2Kc?tcXMGj %<LLqDm3l:(Nd'A$b$,WOo<naI[3X!H$nXqM< %&bG8dkF(gfEd/hdnf2[&cDa5P9;VPthL2)^aik0`):&h:YFXdZ\po.W28`SFe0_ %-,EPX'EFm3bZsL.VDJ&FZKb=`B4>,CV(Nr:MdKA36F+R%_LAn;8RGpC4h3-(D2"]6*`VRrO8<S0f! e*F'f.Y!KjoJ4C0"NeT<#r) %[shW;WjWXbX(a*+>-bSgDWP9ob%eV1[mI? ()aEr[R077O53H*EMrO\iQ_)0"p3iY+'"1EGZeX;^p!\f$02,mZm!Al:3s1K`.E8^2 %NlJ$CO]HZ:X#eWgBt0==>/*BS`d84tM0XaiS!epsnGL,V+OERRR7Z>t@Y!,<6qmb%n^h7LY!i>_6q;=&o? R'(aXQ;LU(P5UW#j?) %gST+P[hWRrqm4k"0$CqV>sGHYedWWj1l=ZH@;aI3f4)SA?(?Y5rs=ioU6k4B?-^-! 89a@iflW/>gh"oO0@'6j/oICD@5RrV+I"[L %Q9,H82-i.\FNi4YVY;]d)"QOKK9]qJ:43_Lg:CPW.U*-.DL:c!>'X</VtGIAhuDd'gR4? tN`R4R83E'AW>KU/s0.uiRq_;L]q>'B %S!;<]2R+E/J+4*lJPO;MIZ_$_numG^e+-i=n')Q3H,FWk!1ISh*liP0r! L&dce`44mK^2i5Yp@qK`@^cJ#JdKCnE3ZeI+21d#LBb %LP.PB;]eDVO"bT^6J.O\K?3Kn7_T3RB@DD9hDN7#LQVI!nii;N %jjLtZQgOH6cc'7KL8.I&CjE0BJ1#7R(oKn>$<o]o4Ns`4HFMn %fU6bqZi`G.5'A!*]m&GdTl"!\W9#bWKHJ:mgQst&bu!7>V*F_FF*W`dMp64Kp"/&sX]_+%r&DE.6`jZinpr]/_\N_6IVP3]eZe6 %[99WXE(4Our8DLB'2Q)mppum&)k_`I3O#[`]3S(JF"X@c3:Bj$]`R? SPV6f*Y]E_Gb@0#iTPLG42J'+KiQfKJH%MV=YF_W3Bg/4S %[pG\4cfP/d`&Hg+H9/N&eC\XN`'Aj;:1#qhe804;t_7Q2345POe1A0C[=dLN`fkadNTZ`HBr0*qP+0LOcLqVa!_g2/opk.kC,L8 %"q>LdBSMGe%LdIaMs&Ep9GV6In7IU-nfT]Piicn(kji!&EjBb-p"$I?B?H#s.4X#eS(tVqn9VMak!$ $`SRjSL5>Nb)D#81b4bJ[> %SH5j*!uGtl-Wb:TVFP[PC[T[l0QCtGFI236,e(L!;T$eG:3jI!/8LsZHTKRO5V@]AZ%4n %;1(a\UW@e3=Me-uR-m:D]P!?$Gk;:, %Z!9e!,>XmWi=f"d\p@*d-])*)Q(*,eaMF[8mbC(8SB]m#JSESBekQ]k<e3U %<L5U"GCJI>bhgm+4\]l$7,6epge!+s/A_;)7M8D$ %<VD>K>q+B_U]d^cn7t`-FE2*%`\+Zci^KKIdSbg&o!2gepSk[6*3(WnR$`,egR:pbJ7q[ue23I@S! +Gr(S/M+N1E18A1XO0XWfBt %W2M=94pjh?2_gQ)pn'\io6M14/XAeUP'jM4OUPlMgcBLjls-L0g5fbqb]9LB*GE2Kg@``.O]t3M(J[T`bZ=_]%tnMPL%]EgtC4s %rs]d>cI'^tp$9uR\Vh!.mAS5ra!VFr! 5*GtML9>#DVjqq>5=,\P4fVfcD0W7NVYiTDr1"((ZRX'NrNJsUi@QDMqIPDX,Ou[)UEIM %*D^]+8$_8I@FgfZgf7\2e&:J46Y3:oh,/&8ibf>XMc>6'8Z4`WHRq=Fm.XIJ[aD]!]\0Kh@(Ya;fHTt'?\ZXSjQ,2Q()3: WYBB5 %XEi4jPFpr\9&-R/\+>ed+3F0[BMmL.isen-pUX.H9\onC%J9a5P%[%OuT[lU7ejkL04IIO8WI+IbSYP:rmRulZ<sB\p*f$)Ri"j %fC@U<S9@OHl;"p,GcJa#>uiCmqSYfd5<h.hMOWYJ1_N/hEQIG%pdrTp0^@^kH9:TD\EVAm]/-If#9! Bic5ue)G7U?F8>S!Y1K!<0 %j5C'@GQp&G=;%"*$2F)mE(;o1@F>58-&e4mJBL]GUT'kp]7,pJ?%82.A=m8h#pu6OiX$t"JdLNhLL,CT! W]2&*!lUT!.ZHt"9U4P %">0%M;)@k2!m?Cf`=qn&!XlGlV96#9KDCU>oHJhi5X1Eao-CkOod-U"9sX77&Pj&1,9_Q6k!sH14j!B=IK %GbE7?GcQ3Ua&^h`B$ %54>i?Hg\1&b5u@kkMmc4ZWDpK@@c_pF %0>$\3)I[1R7BL2`(8oMtj34MqALQdO`tDX*st@1K`D*6CPGG=k;jf7gj%FC<fkN1fJO@ %`";Rg<)C]B;cbt+kCi]--^].1M'n[8Jr+ij`(G"qb+]?abP'P`b$!r6i2_M[[]_0mm"Y4UhselicOLeq2S6Mn,1pi]`.]kT6>uK %0>I?*W7U::I1E_6L! GlKk=MB=,cEj4mnYY-";=Qbn`U=Na6'jscRllDK27)f07WTmh<,kd^\dg&h)CsSk4pD)c1>S_q3JaQr8$Nh %5CS"Qi>o.'qu?WnLKD)@i1BD!ZgsHp&8j9'a@1Pc:VVC>^"!_onZUaFrs!uQIo-$/?/#7'p[A- 1fR6KgrUC9n^,>T7/ud57G\PF7 %9=j4Rs"%HiULq7PUE\G^q2?/[_*@AXg[Sn$]>)/;C!c#,j`HpK&ql'H$o]UEF[q_h')LoEC&fl-*P!NLQ])9\)Gk:TU@P%oT=FI %k3+J0:L?OJe>>F[3_22YVgWFr7[MW7n$@.^eRPT.-gXUo0X]k#]J]\ +DWlj>eaDie9Ku^9j3W"[X^lcZ4(&0<LJl_?Re!0@F+]Z7 %GPWehiHZGKT3Hs#k6?-K%IS=tl*5-qDIS@NUrcPnhU&+%Z9Hgi^VPZ=NG@[&IB)tFmrj<m] %!"RDHj;GS^rShOi;q!?b4V?8/JVZ %bn,"aT5#D5qqSu>D]eg>2t1V/C'Roior/,! o#qVm[iH0IA[gF4l;R(flZQJCl8C;dX>R+V2gu"7AMnC`48Rh+Gb@#%TmI]2khE%j %Ics_tm_7Eb6Kh=6gU_78??KHKD!7X$P9(J6OY17>Rj%'M51M^HpUNQqh`g[\DVNAVK`7'dEVf"HYcLuKIlha^9+Mf51TLCh>Y=` %ZVX\q`^3b98aZ'0g\9V*q9@*$?6Q.f=%)TA\APBPT"Kf)P?2SY/cPk=&=K?fm*Cgo)YFUfU; %G0,<j=g7(491e"NG,6)&<Xn4@Q7 %,ME(kP.T4b!;,E_h+QIK?"[=Os88C]I;0[EmEE&X5!^%Q`35sVRhu7GY8q %G;QB+qE\/q:e'2-,=C0_)gXE;5)Vi:47tlC%j:Gn= %>nlHI4W&b9+:"mTr\E<R,7L:&"O%5lDFteA?3/OUo?&a3<?jtN7=`:FO;A`'VTdH/*nJOoW:@g\:fk! 7%cbf1!LB.FC1XuMM1DIY %ZFkd'Qu]J;YRYhg*+mh72`V:lFZJ7d$!8e!TMej0jrqNTO"aZQhXVT`e++b;dCTcaO@MK&PRutqFfIQ+<\`nBjCd28.dn7G0e]M %JHf$!ISno(N8I#3`&,GQFdZ\/#+Jr %X#D7//N[62\;k&jFq*AM,T8H@V[<<#nBl$b+&L;adYYAEfD_=A.K+k;kk_:1h9`6$L*&2; %`>mL]IKm2XB,MU:A'4+Q[np8+M[@';6#Kk5H[r=m!Lb^u`1$8^\q<)FAC-!:+S1lKV2&oieus#5K/Ut^P/ae2An=Qnm,R-qb=)5 %ZAj!tAWQ0=aAC7qK#9%.?_s?&W<]VG87UZJ`Yl3EUQu%p"L,%:(:h;K,&VqA"::R0<:&'->3cTf! 26E,j1<,^=t+LuDZp_;XKK0h %YY&4Q!2(d+[(<'p()YFkL5?3;C7J^^YHC#r=X??Uh)&UulLNXrYgj&EV[Tn0Vq#q!<NK*l;aPL)! 3j'.Ro1aG_Z659V67!`PbXLq %,@m&SKug*"S6Q).E[+t<%C`5h<]o]5R\$3''p_t*0bAV`IPY<[b&C9LG\,/cjO3lC)@(N;LU8g8TIl+: (_GXY/n(]TaNSEGn5a&9 %+Tc=#VH[=.K/jG4*ih]O4(B@IR3RBS8U_K4Kk"^GW6gO))0/hL"1=EJBNmbC#t$)dl`5>ZuC:"n/)m1BdN6X;h6Nl"5j?YaNNlX %r6ci$=ljlA"1/J82Q(7o?-`KV;mtAV\p.0:ZI;fK]Og_5n;Ui_6T=c&63$WV]2sL\lM]I%+Ud!VOOLB:i+ [jGB#(VNZ=SR211;^n %L7U)+3pu_!DD?WbnYb*22ZHf's6cF2I&4KC.i5n`/%`jZ;(#/pd`Mpgl'6W&q`267(SNVbbT.FX>('X0$4G#9Wd78@/>g2_5m_W %N-1M@]p)-^#6SA5(UEo0oE_f_af_0In<:6=m67Z<)I1#QKh<6_]`7Kko_PVLYM[*Aq;JNh? XisuY:B5f5.m,p_sX.Hp$Ul.TCD=L %F8,:`]mB:R00_cJ;#0CoY>4!&XhWf_rGt3,^Y&MVmll2FrU-0J_l&hC?ht$ +GJAY'V`1f`8,=8*i,qk`iFRS2&s3MrbkUd]:tki' %a@"P\Ke--Y_3W0`RfUMZ+;)7$@R??a_1sf>F-g8B%5N&+0Jd/pJ"P; +KDi_9fV>2Ae+2$"?]FiE=Uj3'\k,)2G6I!4'+ssn!Sm6H %:+/8*#3Jd:9rUOZ#DqVtYb^nJm1,Or_!Pk(Dj)YcDXjO:pM"DjM(I?t(0a-V4ilsEq5k6;Flq1l %B\prhBq)tNTI5@0t,(([fk'Z %W?gUS9+Is*!B+RUY#NmlW0Kuc)O[?j6A3I_.Sdhh:N^ZT<`3^El6"V:raTc!LX?@* %Pu6p,B/H**k2]FNB&Pe%"pRtN+\P`i9r!. %<83sIWD.PsVs1(1,VB4oJ+nHW9`XP4"?_*%&$I*d!<eHE(1R('I%2"e&tllOj,j%M!;8,_J`dnrrd! jKe4OIr:>OCqmf1/9+iEpT %5k+i;+@HSedRo&\\W44mnX4YB;:@;lh;,#pg8'3:AEqeaYf46S95fSf&W'JAaf&h?R=Vg$ %pIY;\N\ke#fQFN\KS>cgCVQ;rtjN( %&OVSrf^B*Jli>l(*4Nj7'ETC>V-*RU[1_51%$`qMH_Mu[[<VR5`h%E#&Rn31@8=KA0u<MDWbdht!mN-WD? Jp2B12JTd4@"o2bIB%iptq*(d$bT`!B=@AgQ8:M2J8m/LE,L1k./7F>m+Z*3@82lA(j*LYN7Mh4=Sr2i)2n\dbCVV@K(Z@dMQK_Q"NqPN[UXmFbH^AVc( %QmScd,$NYc^.t9W,-#YJDUcf=n87Ih(0SBL+(:)_?Xs&l^45n%Ro_\!qmWcM7r_D4K4uCKUn8IkM>b:i$R='T@l22s6$>jD72Z+ %g\cK_NlY?q`QfhK:H2-d9;bB?6%Q59'1H? $"UuO4"r$OQ2u)S)aKR(;6^#c12AK2B,B>7*AOK<(IRCfD_*=$ur%HCL!VML\'56f_ %reoSSs6\:dl.<,QILUdUGkpdXbBLSU^OF(Y[8i34W!"M^*-"RP>4DZ/3&6m[q_c%$NFC5u>?<1()kZ9Lf %'#k0/hOj"]r1$c<jY$ %@d`3@$Hp?YI5@`m^/;4>6ss;U'"Lb?+B1>YU7nH_<?^*7,/-@)$p@eq9_!S67$!n4Ea: +pkMAj3IsN`,Ool9lA[hX="kh/AKr&#1 %Ze;*-h3:`-a&V/mlp>5HR[seC8pCl&/+)Rl3#^V\h.p19]=ta7\iuB]Q\g-YL>poTKapYWY\<Id! Honmc9lE]/2Ja2VK#j?id4W: %VZZ*j?!Tqdq/SOQ?CeU.7^l]!G4mphSPgaR0ruK\*#Fn4)H?gbj%r;fd`Tg'qpTTkl %Qdh#SW3aq(O"udu?(3'qK:qAXSg>;V`Z^ %g^,6a(9%cQU<=F%HeYhKi,7(^:4H?%YL<@lH_^]"em:a'P`<8VrT3AEr4FV?XS#f4=ITkI^ZMilpoR6::He*XWs3DX)>?4(0g=X %XOa$Dou"t^YJ2E9@Xg2rXluWcQ[oGRnslMa\B! ='^JmAqQ3ZNbd_fG`S##1hQGjds1PK]eH/n=@UGI_/,_R?TYlXQ6/kMQ]q7g`4 %*laI(_)LeIrZ.+\Mnf`ji"lljo?Q,X-i1#NrK^O[On`"R8lHK+F#D?9'#Q$mmtYo7S8HR/Va6kcO-? #<QVstdrnY83^$G+Q?$C)R %Y.HZm5H=$%s'!#%+tNT#Eo!iC]<-I)Z1c:`pW7XRa`mL$GP;P]-;3Pmk3'ip"`&gp#Na^jLb<M]DL[$qoHL`%gh\Wr8$>LpYYq) %[Is.K]_[QVX*Dk9YesCIG(9G5o4QrFB4FBV&h:d;J;*SG.l49!bolE2? uDe]k$^T0f2Vi$bA7lHC7'UT)KoXp[KKV!Sq$cfO=pKt %NpL4-2W]P'g^K>m@UZfVj[3KcA42nH,3&[Z+&Rn\72rlAcr*+VWr`h:r)+N2bHV$^X40F;-0QK$9p(*.W %*=pi)ZpHee;BBT)X\> %T)j"aaG';^h->J>d!51hXG]s]mf?"8n:Ro6W67UWBEmg$CVY6]p)3! #q_06W<NZ`J!"CIM9h<\t`#H6o:d&3&,Lr!e$s!E]Wfu3X %6C=T)TgF_g7g<Y.7`BBfH! gq9LJWhc=GOt_)6knl@2m&tFCl_)9cPPR((Zk/H]`Rl\LsWP*1%aZ3V(SuE?']W%7!(&^eltgZ++[& %K62:VjP^;-a\CdB_,YMscBF/3bNd2r$S)n7GR6-3]Qk0*TPK%+Ng:OqHR9F1e>NTm_i)aR! hIq4Yh4LE+k\!b8+T<Q1_'.Vo\ttk %i!]`,,ClN^Ul_U2k6RDJH4Af%Gpm`S0@TG/T]qp]n<>4_PCCV##Jh)Rj'(mL+1dXcn;thH4*,3.jIZW;0u?G52"3E^aS5sjU2,S %<L4"qLgbH,2"B4'+!N7rp:#^#Z2Qe?jne;1Qg=*P]raL-Nq!)"ZH;Z%!$Np!=u(Fos98IRW+@X^2+23c#q#ug[&)c)AKP)9Emt8 %\Ij]75_(a_#6`#=Ze0#dR@"R-n0h.7^iaJa9/m*(oC?Ke'df2cd)qGa[o9>pC(#2Na.Pm@0ha@[=Pa&9&qWC0S$1GaJA5Sh0:ui %m9Tl=4OemoX20\=_$Yp[W^o3*"ND*VZA7$iiTi@&%)N@? b\&=>L7LWW$>D7`G=-\9/I8*H>X;3@=.;;@g32<-gRD;QKe_/7Us7@8 %&8m*c2;$d@#[9B&F/H,nbJsC\Q?iW7h! Wh37,',*$bniXL_tpuLs"`3G0p*9`dnH.AWpESOIKHuH_54"Kh_3E68_CE1u?$T`>'=K %UVo1s@9E/5Kl:RHKm>ReeF5rF+!\*c:gX? (9Y1+0dcWUup(2c&asHPeRurPiRtKZ6LHoAU9CV2.lNRi6\B6DaC=*c@R(d*i*&`SH %;9i8%@pu-W,)FZk$V;roa<AZ"e9`i*/^Up4QWqA<2Y;? il*'NHbr_lB_[3o,Ra@a<K<SaqTg>Cl@=q_qM.Jb+#d61NORomq_AX4X %*T"9\9G;%(f[rlc&L>'tf+nL3W/M0O8*as_bU+GfmM9c/MMh"54(P(4)*M1/g>h7%5qHiaZa!udVjphH/B!k,p'4oF1M_+8=/)@ %D%5(^og=Q*)J:U&^S-T<4ELa<D5+L67(>RPbN8K)ZjAs$J9D)C2rSrgco3? Jg59^Lh.iK^bMNng9m"%)\2U\jK.*u,E4>Do?Eg:# %]>hpWhdMQ%FPCeuZ+VDA_1CTa*GAk.o3'_o"+Kd,NdD1PmnoU]/@of8S.S$WZGCI31Y52;JrC7Aap0U/4cfX:lA1P[#BBN^W\Hf %eai<fQbqO:Y*H<i4fYd;?S:%CU8//2[fHK88TJUJGm2*'@cL1q]u';TeDKD%'7_u,m2B5I!q@VIDp@j\ ("lj(eN.V"^S>P5'P*-O %C_3Eb+Ni"hF"NM?^Z%QdmN5]I$5VI[d4TS]/N.Ufm7J8ZErTk^I]m\2o!"t3+sA(jD6"+^m)+$I>O? 1o1@6GG&/sph8h!B>JYch8 %-A,!]kE=WlKR-STkGN,WQT0tYh_gG#Z35]5V(r),W]IAir<MTgiMUAc5R,'QZuumXZuQ=:e][M) $`PhJC`V8`Y8@-BZ4H$obm8<( %3^K.J&G=T;mXWasF.%n:'Sa?nOpo##TJpP!(B=LP(R#4]TMNJ<!2nM+TN.Er.AZQ2e^8\$8Rjr"cBY259:[k?o>2=c%lWm(3I'B %>&n]%CejWQ<J_3k"2OMcLr?!geN%kqM461QQE&Y'F>fr(ksV[Um>%tY,r+qTeSeYA)ai[E? SX\,pSjK"r16s&7)/U8kQ;D#hRCEF %f??%o*C^RS:mHGGL7n3nH+^uLXHYptl&[r1i1tda3ucLH;WBm*PP6K$>S,J$+W>7Q`.H_LEtc$#@c8'A? 7nWVgTYDA!1,+B;E5@\ %"bsQb,uD?#be<Af'%e#@BY!aD7[Br\M9</+f<;(Ig6)Gc2km?%]a`;<OM)P %n5u]\8*^54lZd^Zf>F@``I1Fjacee;AO2i@H%R-1 %=\Dm@O="22#NA$`3Kr,&D\fZXUb"mT<>qV>41t2EUY[+.+^a;o[S?!- L^D^c#CdGK#\925@+KUlHMC.>mc.o]bah)P<]N$_YJFS' %#!C-cR@&n>^gF+cMMgYAB[st&FZ*&>TZpdmpDJ0bVH"qMbl[3m\f'A9a.8?1@)C91Ja)=S9h]mm]UGY10VS#d^%GJQjYCg>\0j, %.i5_=h4"UQYJrIRfDC?]Y15Y:XP.Md2s1+^.W$d$`k&>rA.:NDlFLO@hmAt^1UV.hjgWJ.RmuRGasJ3b8.`K*,c[Yh4E8P^hm30 %JEqt`+`0[]1K89/]K0XS;5S06V9ZZLG]:4OLr;ut+Sa=;<Jf7YG94V9-fi* %WS]RRCL[baqIT3.]h"E;RamBc_8i3`X%o6nauY(7 %e>L3Z6\Dc-r;@bmgi>=0Y0_bo`n'cg>DfOobEEjph"jdC"`o=lN(c%,0#kR^6* %P$DWVF7c3XGkjqd+'_AI58[Fug+j$FFsZW@A5 %O9.kAR?T/;h'@:cq!o><h87!0nb!Z<h]r;>R^#.O*;jXTqpqq&g-?2@/eRIZH-hpC<g$/B4aMg:UG9C=]#rKdg)iG(J;neG+M-& %/\915Bc:K64m0%+N=0SMKqXR4K0JrO>'`^#Kd\F:7Ioo3%F? F&j/*Y"2f/n<)Fk1@BdpIODQi"MW/ea=83&DB2eiuf8bt?1;(Yfm %TOR#eA4?,r9CU=p2caIlk2W7$;U-(.X6sKHD[Q0rM5N:-;6:ub8#\nEFq\P<&0nK&! cniH98BcHf<SW9d$E%i$.bT`\Mj*Q%,Eh0 %98BolcaF99\0%AN/;b;FDM^iMIPD!IHG[28;>#k2M+RaPi6F`"2TX49!=q(_PNh&]IVP-bn'0'C0"5A&$! =WHE^!JqVj_[1Yt`e0 %Z44f132a7=f!N!.l,u,R&,h;GjcDNB%8DigmcLpPLK:Q9U^YpMot%2:; [!.41bV"I//HG&K/eb=8=*Y8DG]($\38N7$a[6mX2SEA %qK.1/Rsp-^*f=%3)7MaN[sTI1*:nInE)(dbmXAs/^_I9"n@]-!gE<s/T7;=(8P73A[&,pS'^? SsgSB7e<,tE)Qb0h]r(Y,6M*eA< %Rn_D>M8V<]cII?O[3O;XGI=4e(U6Q5\&nI^&+JcFIs>9W9?&'FPNVo?h:K?trVcZa<t>&\Y5%%c,CU6,*? M6)&2e+E%S&D[XadUW %+#2kCl2:'1WnPqgP`P8-]5O!P7EfODo\HH$i7`bco7bc8BdO! eEpCl.<aO_6DC;mgq.Jph0E=o&Emag_E7f[5eb=!sGlR:[hV;b3 %_)JS/!NR?fnUDl%qC:4HP3Sh`$5C"erLX?)ik9Tp1fj`c'R+q7X@3iATu'hnC'+UQ4OR?oSP4oS2J73QV\ uJp@#+#B$sl![9MK5_ %q@j5;WDO)&j_ho[f,i/i_GkSm4b2oG3`F`,fPDF`<^sB6d(@6I(>6:M>2]CSW&b(I_CYH$ +jEnVEK.&kS^Q./kU6>V<u(Qcb@p#m %Q+!]4S7J3V/0/rGe<BU=X_F/7krH^L*3BC'o&6)(SE8l^#&+*+QFP]7_X[0:3"(O3FJXmV8: [brPgQ9"L4U[qI51.Y.VmP=%(<es %;,:q&8t:uOo7`7>Cd8.nZ(GDgF@6sSYn8Rk,PNVi\H6>FbH['1<rn?"8Bf,l77_rg1JpP0TB2Ls3]F,k].ZKHg=n<+/W2F`DD:d %H;c0HIT>"dqB.4eMkGS7o]CoF9NU[/&SHpR9]n[^]]BHmSRjjF#*2k^sGssChKEjDGX8hmYikrgfq,oNCe?6*2G?V=Y2XIS?X+D %8^0OYAg9sqM`bZ9ElD8iInJ=iWRfnfoKN*Q?A6bY5a5c^GbVL<J2CuT7DGO]2Y^,AAu)c]C/uS:bdQiP! K?%/-m54q\"T(cTJX]" %'H2+#MJ[B5>OT.g8&l@[`>-9[80Hf)I58SDX:.D1BH*XK?,kAoN"W %!'RBs;<6Uoua=o]^_N@Dua@RjiI0;7gfF_nm@N%FB*bL&b %_F^_OLFAS[(/,Xnk1C`'O]eo_*X8DPDlpU.iAF)mVnt>oY+3O0.nc!/4RI[q&B)jEg(S4D.b8FgD0=dA7u 1U-=UFc&)g.;X1<b&$ %0V/K$RU@rR.oXq$'4)+g@#YKt1g2!/KeWo!$)eX$\m_$15Y<&a=fXJjD %;r@d1APHB$</2Z3HIX;QYmEn4cgm=DTUOfKpI]!-oUg %PU[g?.fDsc-COd8U+@b("52t9EE8YePm4`j>ImBNaO#8'7@GZq3D(M>$ +@"VEs<iIf&KTVBe,r.;&V,a/ojXI=&khuKXWqO(5u&8 %\hC,?N/:+Q?+28_:C6+k4"?bV\;?5U_@o7ILrp_H'D!#5M#%]+ [L<M4c/jlKX&K0YNXE)UbFqjLCUJ'@Yn8XD.@I,r#F"L.qPPeF %!!9E_9N[@5/R]'TNPYC`fs%hW3n/j3PFaHsekmAWGmo_ni(AlHkkeYWj&cC7D'q2f"r+*WOL-/*[@FVf3r9bM5&2CKkHpN[=I=3 %crJ&%.ea8NJ[a`$8S&nI7>sS9Z\Y$ZUj=S<mkg'eJg494USM)Idj;!FUNj^bT.&:ohod0&1YQ313nhr`[/ ncS&Y/>,(n)e'WsH8a %lD,h`loWW\`locaMDSG-mSD!MV(=#%ocu"jA=K_*gcYE;$L$KDJp?$7ZK? aAPCcE.F1YH1CfGS9r\E\o3&uBT>Xj?1*T9t/ns:AA %oFY\ToYa0,.Qq2,&4^$\0FAq]"s&qAi\p#A/9NWb[<kE_\2NWkq]C66QsrO1Y8BTB,6Y=4;8<RA2kit9r/ 1c[H@$]L]+bq7M;R'8 %iF<Ct,^)lA?&JFEXjr?X5dVe=M1XS8lSFI#Mdsh,E9*?%N<D+i5Z+(NX %'+i0Wuc_l,4`&B$Jk5E@t70c8MT;LS,,-Ueq;rS6ZqI %o.-X`D1_=+BpOe<Gd;5(VFs8"@n[8E'BNg>L??@W7m;N``m2_Bg?]VP$ji+c7jHcOdjfR&4FjpbD^9Zk3<M29KG6-)?u[/b#16Y %b1e1/&EqnS<K`^rApNNh$:8=$:f,3TJ^=8S4&MZ:rE %rp1;1SmNHA2KIn(+9d8rbLG7^>Pl4a=Cl7/phQq`FYNh9EF;N4@EMGaaI %ZjJskRb4lo0M/'PIMj1i31@^#ia.1d'XPG%$Z=mKp#V+`jrBPXuZp,RLT3"<`W<1Bss<4QE;OYN2=.dLq7ShS7?qZS`ba`e=@H. %<sZTP.d*[/^cR`TmPr/?>0+_).u[>al`>GMR'`#mer2Mfl#!+8ekZI@H-Gh?&:LkPlk6]]j]P`? _9Jcj=9EJ^!=%YNAU,tS/ZI$, %";k)d7DVFC.l:fGAFh3-FCKlIYK\Ka. %Cci/5fW0LIos2gBY3YEmX1NMHcg;,S3h9<":ZB_BIY4&UPUN_k8Tkob!$scE,.M=.q0[ %/We^=Nu??FN,:=c"8fuF%:MMnnmIaS?j^c*ertsb!Xs*bdch)iSBTu*,nLus! >#'L:]f[=VEE2;,mi7<AVu4KYs)-`_9$Sdb+KaR %>\C$PngfS$ej,XtdM(k^@1NQKL"<2DUn/K>WuBBf^a,1T<J&0';,fQ79'<3'[P5uL9?1LR]ct%sMiWoN?)(q;7CY,ZdBV3JXBG3 %D$E&>qdW!R88u)e<g&hL61.3+F0Y>dUTr:aEhlLORFO*@"NU1=#`ndL*767ngJ<QBsnjXG)T&*B`35FHK(h8:Z.1M>Zk(_1(0hl %&ZTkp(es1N\'?<MLSEk=[RN]7??79NcK?a6pf=G\A-OA,6F,W&E'4=A,Ds$jHc=Lekkc(E"Bfl-)BV %/QJM&D8YnN^$#PttdiT*0 %T>O:;E-O9J]XCF^1L@;E\rL6_,>4u0eYp-GQq+]-d^VJMd)96:L.A4:"s*CIsaf&*FDgnUF]Yg[D&*0Qmd\g:9%fn8lc)$af#ru %I]LP6@_>VDa6SXk9Aq[j16n0rCSPO'XW50%ZD8[-nl@[@Yo<#$7n(? r;2r))gdVU=&sa5X;JAa*M>LNOi6dlM)0:go[4O%X->+?[ %-p-t]W0KYolX["Tgh4WCc=efXRn&SEOD,!s\hI]2[dV+pJBf&K-)C'3-(\Z$3$O/39G4WGDP;\ %m6!;Je`=5HP(^?C24>:;Yr[jp %<Hejr5fB+Kb_94BM&c,5e5=c4M.mmcRg)m@Oa2k'N66R2,Hs>7r(jmAeIcW#".tRnm>Bo*'O1HFAt+DCQL =M.8A\%j-S`BTiMp!M %V]>9a*X?I'Qt&OcXo[O`\R*2ZW1:/V"GqMq$aPN0D.2U2$f\`i!n/Fh-IMdcr`mP7A? C_(<uRIUpl:PBQ",O5Z'_4WjEF:)X-sE2 %N:D-EWbWd^PYhKCRmQ6g<,H&C0hs`+\.ei(KW@B2O0k!e#&Rb(8Q?$jI5hU! O.hWG'ln>UVlUf`=d6#lh7eQC&jumJ*K$83;]@uc %iW;b_r-U5=04g\Wg47/d&(\O,bQ4\jChao!V%>PQfbNlZ6.`aX.]X-dAIY\+5-X\)J=oqLI %0=LAgUa[Y#7ap2-H3C7.";oIH/cc %*fK@=,`;2F0b=C.A7_*^$]E#FDm;#5o_']U&?@<OWJHL5o/j3_*\)52NRX'3[2_-k,[,4cfcP&E)aL? J&8sI%CDKWm*B8mp>7PEl %7YSrm@OA<g12GEiB>k=F?++=,7["7\a^Tfi;sBYUR7\o$jit`5U)QO-RK+fa)c<S39hJ5RZq'0Y;_? MH)Ff^"&el4<=n`H]2JOoX %0sE-7Se'uA(>-S*6BV"M`b@fHk25D_q\gIW2+3GR`qj;-) (g:;l_dSl\;Euqocg7G@Vo7B2eoE@J,5p<Rpf:/-_@Km/*eUKV#.A3 %7Wl1<]lZtdIFQ`>>##o$hRPd6#IRH1d9e %/Cn=qDP&q>_g;8n60Fo#oKr3^aL.@c*2G*50ZPg*u+]/B[gUe"c;_QO)P=CEZLacd1 %B$67kpY'mr9Q=+Q"0&UZVD>c+^1kI_aP&PNRnYgq8#$'L<$WgYZAQ!6cC9QE\ $Ve_iP'j\'5a5dS+UO(n2[5UQm)u>FC@'LX(Lt& %`N?f<!GY!-dJ.R[1iF]R7BM9sBhk$_W"i+A;KT!gW6PJ3'\h8l.D,au#KngjH(;iqB\WZ[ln! [)cDK*sR^'i<PZeW`DGoF4/"<\7 %h28#bOL1l())+^:C0n2Z#N8t=S0])G"P'jCeqL$"<i`3;'$&B/K5&_q+/kX6Af03D[$]qT.hMu-`KR3M)qe23Slf!$c/?WOtJ(^ %#%PF]lPHg(oa6NfTsZ"@)2@Kt?>6uPr;k!"b+5Zs-Y-@9TQZdK&!+j"Q#VfI%:dIRkr[Isni! a:onBQ03\"P6;?bOhj/_14:?ja' %fIOj_$LCT+(KpJK>!Jt]Uai4/=P5'l/G"DBnjJc,[J!Em/u!q#bgX1!c@7R%5s%S#*IKY! @FS_l>r7aD`FKa]$S0qf7\(88-\HhE %fus!?0l`qoK=Z>+4fb%'Te`(XS]3R!PPRL %k7[,\0HhShDJBMUkJ=i$Ru]06ArV<kiiV]NlR/OATt0^O5_H)?8XK#-8i&[u7o^:p %3$F6'[#?InMUEA(DgP:pG$%hqlrD6e@Di_A>9dVI)"6.p008UD6kVHH?j+*9_;MGh"S3KY.I2]=.juWp? []VM^HiIgLln#r<AR-f %Xl&p;A!0e8N)'\:<#PnI:d+W+18_56f9Z3))Qj3\=O9gL(*ZMu7[l5ueKDt)KJj.QMT23MUb0n;G@/Q%O! A)<175e,rSk$oW-6TJ %:"FsXQqe9T\WUWu?qEZ7-tk+nU6o[)3(6;r]4IPSj;YH#kj((#KhI,U#("7Y4^t0u`AY?59NX: [79.T2)saEME,aA49^a*,",>g: %7jR*IoBIJ1)HTf2Ue]k_!`*iJ&ZV3R6!D'O*_D@1'&kcnCKFN!?J+"nqZ'IG>,Y;^$rme5_91OAr %jCM`5#WK`j)K2+kAT48$)<4 %[dZ\-1YHh7g,QAM[A_qc)Ao"k:<[*JfpkeD94MOS@1)/L0(kF-E&-YeYQa^fCqL?[.\1J2Q82qG- tP0Q70"ijLp0Iq.p+7r)cZ-8 %/QC1)jrA$E\ID9^6][A+'>AO,%8:B_W%<@_&WqeC?a+Y_/'V$f]V76Ea;Ki,a$jL&M9#=WE %d'LTPcYX$&RO?Y/U4t&#N^LqE\51 %<+dV#"T0,gk9AELN.q'_klk]e(ot!<O/ft5C6d%lFBJpK.T,UeE+B\AS1Fprb!\),g$#mKe0hXKPrr_ %MFF8!*8,m]b-SN;LLNQp %"8aM`-cpE;`p^592r5F8RG7soEIIHXd7dnUi-=!c\cAn7dqD9WFX#<?F%[e?3ED/f3h)cd54U %Z:1PKTRC!Na>F'Ao0=8GC3YKt5 %$*namW$4SsfS7lu6CUrtfV0s$@e@I$.]/%46!>+FZO"u,[[7:^.+n`Zc*HX"=d@XY=]W&:ELhk#8)CF*Am %t`?;_7uV-9uI$-Q2> %=#CnaEBhr@ZP3B]>I@B(jMi,.VBAl2Yu"//F&lRB/QPFS,TXt6[:$$hZ$HE9eF?! 6YZ)B,6S8Ngm`VR"S>ZMQk$_SHq)Fe6'6>m= %_n7B#$mml,RTs?eYb>N8&u3`[$?: (.,I4'7'^7Rq>r$6s`C@QqRVMq><=$cu';R)rM:=&nK^kD__I2G>C-!jX93u;>]$<;24M,]W %\f,g+(rC#CnRf&FUIX=:/Z=@5R2B^?h$?l3f>R"A4P^:??>+a.RRU]97SH`O7o9V? `&UDg$e*m5WA#fRR"mCe"-$.i,7F0g1aEs%qSI7r'oRseb#p;W]#Mf@H!aXnVl3]F-XXZ[c09jkN\+#ld94$%1d$Ulf3>9l6WR) $'O'e'WXZq4=4_pW\s5*kQ^SXrfjn@(\dsib %aq`WYX4:rZJSN07ZeFld-P.etFl0)$8$:`'B!QcY\YBLQY_D`lG86GgK?6j<p6>tJ^+KbW?f*6Rn1ANYn\ Vb='aPRA$_@c5S6:+, %3b?AkUn5Vu,;O*MeaM-18K(U6e@a/n[_[gk^"@5aO]<2D+Ml4CFP7=^POjQIh>pSo$Aic`"Nsn-WY!? sN)d3F4hEG:1`eVScgoH%&in/7K.j=[!jq+4A/QjC_acL`DD_:D?-gc\,a)OektuhmXX$:_'HM!2!Y]'/4<rA.f]HR4odU!92;s8? 2W&;lWB_ia8.8V\p$uW+ %An(Fe[9FO^`A_#EA)h]"@*3T"P#Q2IW1;,W*c"]W+/kh2U(;2fjBpV*lN2O14tX_manPs#:5:3='30\BuG?ZP*<FWi=TMK4e*7D %M#&4Z_JC.NaQut<HnID)@5\u(e!,\!264+p^*_C6cunJ<0L]VQd[T($@!YN:VG?D]OLW3"#h#3b>PUd&O]`e5FJg1lC(;ao7Y\j %@BmC?=X<hkh3\QW<Wg[C/nPcp!RBhgL$=UDM^I_T/QIAdYq_`17\1lF,c5oiRP)bX33+_s9rU! 8LAn?,X[\LCUa9%if^gd;!Wn3g %9.?@)$Ytoi[%.PB2VeD2LWh(h9JVHe/cPkX]H:'oMBDs<BgI?(Kj>1W!9(/YTcOlXAll*ib`Qb$n>X8Mh^Cr&#Mc(UE)i[X3b1s %XWHeZ6W1ZB@DXa[]1OJMd-"\695NpMQEulUKOGaZh4BR1,sCS?$2k]X_[YNQfRk[&1>baNX %K.k4"&lE)`paM_Q=%i_9ScE9$QZG %15V7#MI30(S6?<)]2e28R@U'N16_kQ"\^Ib'$ST?1\)?_<f&tc$!&X-OYhXoTQ=lKi':> %Dk(&nM(ED&fUV\iSX7AEZX>&!g_K+> %>oVc97O1^I=)fV+7-&Be!_M=I,E0a`o9%XZ<*%1qTP6fhpVt)&rmnq?.fQ`TF"QNjZo"SY&<H0b-lfD:PQZ*@iV$tYf\kbK6)kp %)l'bo5^u`M'Os1(Atu3.n#0.QV!r;:@>(f0WpQ@/p-BqPRm7npCP#1I84X'C<G,/Tbnn*2;?a`! 6IWl8T9g!2(5393rX9N$HEC70 %!0sm%.#ESQDQV#SiM-hlcOC2UJH!p@6jf<dCbgtSX'n@R!?ml<*E$sCbCHE*R"s@QQWaQ'DSURYf4bbDX5U?*\\@$3C/tHkVVmG %_,QA\Jp/nbY"?+mU+NZ&#M'CCE(t[4@51m;J<,A?UWuTZWddl',u'b9V_"i]W2pn^8Fi'(! 7RmR5$6+DLA"W(7@!.8f$`C4Eb[G: %"=Urs/ZV*:;&*Fm<L0)/.1<>h+edrHm,:6A8/6LS\l"jPQ,<C5=tsn;:Tf7Xod.![o(Al@:_I`V]dXO_e? C6iYja6GcBaqe%9'e$ %K.0'^]+HK\aq0bJh4e1g*."TQP#bj/A!clDS3EZUgSTV(1b@g4G`fbV>/I^7,8K,@li`Ikk<M.B$HL;C!'t?\M>Ijq/HXAOdMle %52"4!c"j+rC^HB5Eg)%gF[r866OVpe9*7d=/^mq<0$Qqf/cNs?$d:O=Qt/QlSHW1fKK)u#DehTE>h1ReeXfi9-d/T2erM:>hd0# %>/LQ_6Q#-0*]1ZhrC=EG8Y)A'"qO:=o>Xdi9#N,Nh.7:jag>7M<oiHMUZ"oY;skNE,>P-2+7u5%;FfiY// nlOCT9\j.&H*Z2(G\4 %/?W20)`]7uD#ktPi3P1ri`Qt;#F/#Y'H:M5H9I$UHr]iO2'f0@)n@m"4Z5MHAFV3K>:27XK)qR5A65'1,d<h'2(C@LKO2J;SC)m %BFGrDHh@rWoR=mA"nPffZLWFc;V&pl5o)ED-7ud*pA@%5IQ+r:7XLXW&N`E'D)jf@L9o5fiMNS$#qeA_(:]/:\2HaQrtGPAq:PW %KTpdPiOffGaNA6Z!?ST-lTUFj>a3Q"2GqSJ6cc7TN;F==D%3G@/$][B=&O]#pU:K>5&m*qi(N[f_? 3jZmj+(Jli:ZpE1"1s674>q %.13(-@3DUS0GCVRQ0jf>496[qDTc];SiSU+[GK1S6C(te7i^<h1=#1Pf4"uh?C@K6rFJ[! T9]OaA]hmY.YI%SOdhh]+\M&f;LUns %ZEgI&/C`'lC1(!Q78KDm,;P4i/n26-m$,LT%S`h=<8oLC>U. %K)nd*NMlO36_*lp\<U\=NRN>[u"]49CA`AHQZXGG+U&q:Z%[elB %!p/WJ><T2:8e!YW1MW9#_+oq9lPKO+6X',e%4Nf.& %W:62-'FX6^4`j/_o/fC'&,#k^p`7;BMV?.P\Nj]q2sY<D?3mi'JgKRKd_i %VUMPkp:C,!`!52,Z_f+Jl'kDAdQBDBC<Lo9[;sZK8(YN$c8B`ZedEHn<#e?jhUJ('=fT^KFJGDI? B,mpRi9dRLVY"%"6YK6C/Qt' %d!GB19q$bEcQ:68.W=LMk7NEBaK6a3/$n;aUjCb(T2E1@o!kPh$,=AMNLn>;U`ZuPKB\Z%0NsjP>Jq:b %qe%e>8YWGq8]I[eL"%' %_*a\q[Rj6Op_b*K0U4r2P`e%j:28"Q-;Db\)UH22Yfa%3H_L+!`%l81cRAC/F0cXss$HP&ZHS^?EDX %]Vm:)][/:EUGX/>=,,$M/ %NEP#!HIOtCB>T`tm6`MDfGYf))&7k1_c2)KH>Z,Gi.[G2;,=j:Uh)U`65B.Pa,#T./] (BUS'muEVO3pCDZHUI<$Rl'5F<Uu6oXM* %d0Y3cFdN$J=dU?dWNZ#+kJWffX<\@N3pWcoP$o7n44oT-qd>s!->-<qA$3ulQ!DYt%cu,EU5^\fW56*.)Upd)I(kBFPtmlWmKjM %f``]!&W\*fQ6HmK3Dd7N0m.i:obtl59j<GfAt`Uq4d"??;FiLNCg%-\=hScfH<#/Q./*l5ZA<Q\^Bb6F=\ cB(9J%2VdejmaV<31p %rh'^H>Ae?gqOn@+=_T]tK!GG&K"YT!]s4S=cDK@b4UCd\48GXi:Fc_eoHE]]u_6Uad:F:ehWcZ)GMfk""'CEaa%V.bJa@b/k#;X %'%=o9bf)e\e/+Yt0W8\5>HS@8D\K*>mVS1%RR4/'HGjPik`;AM1s$B)Z='pXH=U[K]%-HIs) [om]sd"EQ.T?Wq[YP=cu&PYo:&F# %Uco]gOc=7oUP<aB&fT+s)hR\jrHm^b[3CubB:eCd\ciTQ5uL]^*c<`(#31&iH>.=TZBo[%KT#u! JD9p0KIn`Ip*q*0G69Ae,Z/UN %jAN06)<6me>f)8QAk:b8.Q:2E@)<Q^n3_gBNj+aK\I9%/C6nd;kVo<ONK*r`@^o(scF? 53VbkA8a_.jckN2Bi(:F^)#$?9I..fE4 %#eF"N(T,K5RA.;)ZGe67c<#KWT52rEJf_b/)N_ZhZ^7fNEb7G,'iI40QV=[eB=S#:g=c3Z>EW+! Ai$Z@5uaGt9bmK![5.AJ807W; %TYR5@6M="ubKBdBn)Y[/h?=FGDn7YTgsTlYUpt!NL(3=Kb#B'Yb"d? NcRXetFGD*h<U=3Z]A3j*NS+2QSl3-!o!l1oRXK^WbV;WK %8s=ZR7j2"/JpAT<lq.f5H-j-P=@\/N@#.U.=DL)%W'*0,j9_8:khI%"dK&mj*? o.R*72@q9CqjHCMs0%A(%Obf\Hi0eS7JWXR'[U %qruaF/,c55'("uDB5#o4"R%Z6BLN<VJP4G!o*+&JD6<-Vac)mj[I0LYpb`a5'15'g!OfYq4;p:^, [i0F&^@iH3pr-k$WuKJ7DA>; %T<IQ,=dOj[?![q]>7$,ub<En/+rTcbqci[IWM(#GZt>/hQW#=1BE-K)>FNHbJ9Wh(1A0:isj<H\\)`lGGA?9mVSb9K^;hj_jPR2 %"n_%#iL+%%HLs,h.fchBRX<q2eE(-fm+ +4j9CM<*.qG&(]]fj*F8.MoK\q\./p"(Y5:01#q*sD?/rdCteTNkP%dU_(<*U7)OrJS> %`:*.3hEI+b(\-N97F1m\6h=CJ_H5ff=M&c\):#a:,X("0QSa3%/BcFMYZl=o&7ln(!TjR! `t2J'Fut=\^ELcSE,pL]i;iLc2-&u$ %n6A$s^L&enD_q8X/cIsABW8Z)/EL7<qZ"RM4eXHuMWZeP&lLZ;0g&Gt45,=1+an7VlEj2JYCHC>]_jLhQ8 g`E0)Zh&_/_.1puSEf %o)A];X@7V]6Uf:lH4+qug"m0$s,-\"(g:]*d+KRbWM[(U)-ud`GD;CZBgS? 0M5tblf<+3a;<lDSaoH=DR=bH6+k5&gr4>&G)7@), %/@Ob-Fb+$jhG/34bR8M;npqXr2TN$lAL9cHL99,lqP&;l?EOoZdpJ6=%JS]C2+? ^qfbkTJkr[A/s#u*;prE2o_Rk`U84>$^d!"Q; %j)S0+[?4oF=2[7hI2'iTlCY6%d1fu?/`,RbR=X(<>gTXt9uItG+[c!F]-<F %C(#dp=8ZMq6XtB.`T89,V=,HX;0*_E:FN@klh+_4 %Zfd[')CjTkhnN6__S(F8Y3l0DkWi^I^9de8c[^>UXRqDMf/ss9Fr:IF)-NmnG%V&%g? 5R>:Nio#L(f-'PucQZg,c=g'WeU^PQHB\ %R$*'PZ;[*oq'C.BpQ,kG@/Jut$*_L(kSUsel1VUlc-BU2JaXg+E"m?H45SuThO3Mkk@>Wh@Eh,_8FBB3lC[o+3oYNXbhsThoFn# %Ip2)<CjBXN40p%&_"Qp!$(&j-FR:.<kjO[EER+KLKHO4:&uUpQkmL!_D0FaTO]M/A9\4#d@"?WVL %`SJlEY^]H@YGOb9k[G1mu7p %qGDIr48UZQ[h^'PI4t:7aOc72rGK:>J)@#LiNA-LER!2:H_?hrG<PZX/f,Q4aA(B9\?pP9RSP %#@36S8r+Vj3ETJhe6f7nF<r\3` %iD5:-H9!?SH"/cq?g.E)[0/9pF/#rqN*%]@FB&U^Ght`*`(fJDLCHEOj/0oR0]=k=&*&pVjkRBTbGCbB5qT6._^5B*1(g'(B%/U %qfXV[ADckFj(5tsL(>BaNO'c_*k($I_k%Y?'j%"&pWi*Z(.aVDp>@<ScmQ<2#BEK)lbR)noN1Hqnps*B)JCFD06+@b<m\jf#OuC %b8\+n0L^lkAVJ14Pjd^1epXR!GI5/bY/PH'fL? rWi'":D2VjFd&XBgup>ZOX>k0l2BCn1VpLQOi54>fNkPP-ue*f*lp_im]Hn$<^ %_mOVTZ!Q`nHB&nnmqN->Vfa?&'nGFpr_o %5[>fnhiceb/pJ/;I]Y4$:Z.SZ;pk#Cfm>@+nagu/ULki2U$EXX<Rbf:2.0XV_IE`iu %+hhjgjMr'q%0f#?B[8h3h! q]LoS'^slSN.m^4rHnca()efCoT$r(b(j4=)^M7LF(gfY3D>X/m?/2*3sIUj.o`!>ftbX"o9q[uJXS %!.N^Pr:;9=_#9f'E+Zi`CnsmFQtBn@]IlW-d+<F/@YO]QrcDM%-fjI3@!TI:? X9`dDW0&eI9Z:2493H3U,3Rna?&BmctA;EpK1Dg %r_)GECP@m=F7e2hh>6ei76lQhLt3QuKoU'Z'sttM,2^TrH-fiB&pjT_?j*l65:*l5G6t/^[9_j.7WRQt#? _`T2Lf`.9PMPdR<!9J %?! +b17>k4&b;LTA'49TY:5s)Bf7>/.rFPl2@TSFsqjmM1bF;@85OKg7X;&pWD>P2Tj2S(cFF7`d"7P^5'[`a9 ?Y"!1c#<F=hgBOh %]l)cIL\L$"]=A+f>_]\l2j`Lb'KhtRLU6[NhsVEi,;p4!O%_PKcJc>^eiD"EFs/m#>u$.[(Jt %@]>VMP^hdV1gc^]kRWe!b1&8gW %+5Q\2<^#?Xgl-<?r)(3M;e8>1*9j'_R_n18lTL);j*I\`q!n %tSRU@H=3Dgl2k#,dW,dU\o@)`GC'BL*\Bp,?FC`9Bb1-;Hr00Wl %j6."tk-!>L[J.[).D=^dHEHR9Ru6hDC6)E[XH4VU8M-aj](^BWM!^K@>1#9eTdhDFC..]WkPr! kS6K;p@)P+c#'j48d75+X(a4FO %HslHoj/"7/KW"NK-AFM;q=g=[$<]=D"7Z("4itIBAEBRcrDEb_b3MR>IX;8?Sqf7Al$hukm`-,Fl/C2V? I-[(r-*Ye[m'Kr>Ogg` %h08Ya,i"GT"=E"_J@N48Fl?K.pdtp>;Ha"Y'4jkL? c*t*<c<Tb=_'`'Q7o)]PJ"I7[g8>8h9WTdpWNJVlbAYqO5f4ln2s=Bhkc0! %0!RhNf>WH>Aru0lMcf+<,*\JKF0r)8P`tp5LiO79K"!!]k.u3U"%j4E?@N&q;NFd`Q%!j!NI8? a+a\S+q@D[`pWagoe0<D^%E.nA %9B+)Xfte_2]pMh^"R;gmC0kMG;MP+`N2niii'@oT>h_t0d!-hZa*ZkD:\h,2J`>>$HW9eirT#Tmh#3Yk(YpB57*B`k&I)%ETNU< %^VT8``;:]7rYS-)$-.2^Qf=69-N:o&Xdi8`>1Hqu6kNXi5tN5c-m.FJ %jPcmr^Rd#,DjW3lTKR6c/`#G+LW1#kNR8uI9fd_7e<P] %6>gOA1r:A*B"A%\0<t!\YM^^E5,0"ONj/7&ibU\glE6jHcM5sp/ABBa7i,q'5s4\EeLY=r8u=B5Klcnhn4Z()u!:2k&$s`M$I+j %4>H=5Aj:4XitgMF43kZH7REVtHhP<dR_s2=`+/Y^F/ $W@G/3DmfU2lg3=!"rL"e$fGMfODlVVshFH7f6MV@I2q;Ff^rGd.2`pRd% %LYqI-$iB2\Vp##e"eI!ZUNCdG6]Ym[X,HOrV/H%r[NkaqWVZ*.5<Rb_chu]!l&s`n0>HDcY5r@;`3LKQL$ZLGtBt_E+4$X;:UU+ %mMQVIi[m93qXWD\;t`Pk<15Sb!bV2^AN:E$?dp=rR<\:A^U/93En(C&D`3[p,'eUa9*l3iRW %d=(h6Y"bi[;fiA$+2W?)3kO#TI! %<gurc2tZ@gJA=RnjOCn*2q:[=^q#`.?D:M+7QhJn\/X=TVg^\R0=U/R64]:M<7MQr8JblB.e? 8Mb0W+:S#<*]=UF0Hi1WMm$@BLG %G29kE#]]q6Q4ArY(2?.>NK0q;MB):6+Fc-)oQ7BhU7EY4F#`Y0unei=)7`gMLR*JAX,W+npHumSA(FJV5dbn-sk"LRcE^aW".oV %2W]_KYA=t1"BH/SB^20NF(ERd-e:pIF&^kQBE%#.21+F,b.)&1gOj1)o"&%D9E(>lrdI]'"?rEWa7K %O<[0-[NN]V6a%^g6Y5:P8 %K.@K1].lD0p:<1;[>0+uG[m>JfC-"@-aasASK,bHXHl]#0XI8n<(2tfom'OZ>%FY$`lf! 5a"Ie,mjIem8DfI-`u"@Gr$bjFHX5/q %Cs_poD31%MkMbRU`c_"[.#:^2O!T(to;J! OmXKKA8W>3\=/Js9+4^W0i*3>9]pid2l2FA(prg@crCUUu4A>!Rm^I=.U>4L+M(Ge+ %\U$Ag[i,5&#k:fpi`q64'9R;'QBp2?T>We'0L&(IY2c1h/oZH0]e2#;)GT8#o0pt:.rU;LdYtS;.GYSAJkWs1NDORDa\""@7$"g %Ip6EarU%tPg>B*Sdj;S2\;r:Tqc!50M(@r*!0? 2YVU7:E=H<)5k3NM,hmpCZWdKW+bD.\AoWFXTfdf1koMma:;-Vru79+1b69IBV %)gCL0kKfbl$G$+-SGe3l6&kU_VjRDO8,/&Go:7\RJK>@G-!YWfMtV>85JENRkKbK/]N?Z9:\@S2STV\ (J]LP7+8l7ClU>IU&:8H@ %#f-!-n,6cPaQmc_j<*O5Y3c[Gju'`;^2@,8%^iL`+Zf0BE.LfglCR<o9=af^;9*n)Md,E5<On!'o`nZL0$4"Js_])AVi0cg2M/C %\HP%k;ck$MHesLM2-UTIU_R90mA2&KS3(`+I'6C/W]",G?aJtf_7.>T3265caHb+s1NGS*UrG(V(@aj> %bl9?gA/=`-ki+rh=gM> %2OOkhYE'RP6E7En;XSr4)%ZRlV*BQa2m.PI^)'hj %_N_UYlg$sJHsfC=+5n]G"Q#Ki9'?]WP*/nk8PqSKDbG'?fq(Z+$Z9)KuFh` %$W4jq=S?LD]At97Ch7Dlb?0;#U9-'GTf#?u4F-P^OeU_6;RdSCKXIT;>l2[3nMNGI9ah_]6p,n8)@AC! <.!opWp[TR63-JU7];>a %LdLlHG`hKEB,j]YD7m4,/*$FAD`?gAQI2E-'hXYRQ%: %FPSFuq)pTSh@BL[Gb75TM_I"@nib*)k$Wg+iL0O/bpLUTUYgrU:P_a-o %3aB]tebG,pose!0mksY9H*@m.We[cK`\K0F`.] %;;S$_cr)ZR<j(O+nhdl2RdiSbdUIbDWrnee*4=ddE7Z,2A\03W:`S`^tDQr=& %gf1HeR*fa0/ri:m^R`>'7Lfi'*,(pTkQannG7+>OlbG,"8/A/[q(@u,HccUSs)rYB? [lGUIX.PfUrJpSfumU+B>J0TWR4[q4L2[j %oR8p:696\,_4V?1OHNs7DQg/!*4g"9j*j1/^,,!KhECH*ECYINRb^BhUQGCGU=Il0*LrLGQ1N:4G]6b,P5p+ojI[E'*NXn^CrV[ %Wr5FA..)1&O^`r&g>TkT4ks`/e@H<9c\;K]Eoe;Ci<#MIe_R>V'$VNtddC[iIH529gOFY49=,Ucn_+@Iqs *'WT'c(a$u!6>(-!-P %3)Cg4Kbup:jGR[S0hC6L'Il(/*,-k?j9Ys5Sq$ZsSp-*qr:j`6GLY_g8l'O.C7.iuRPuf0/NJSa8]]*Q'"?PF1JDsg4^UA:T&PQ %B1<Cl[)QQ@03YpqG(%2VDr^7nJ=MPS1KULEiMsiX\8EMUCF,]p1T4&P\ %fEU3;\pjI1b7q6mXm<TbT[AqIeTEOGuYP7i_Nfq0rq% %6se>*QLdPl-U$_SGK.Y<O1V%bS+SG0XM)sT6SH8]^-k$<K.qV7=uQc^nU/P)Yl1df? gQh5VE^Z6kHf7lGVQTbOVjh]/jCE]m?:@q %#u(A(bEZ;XQ03$8q75*LNV8<]//Ze!eJ^2'l#W%ho]tC_*UffI+0sE(R]P/ +@VXl)dK=OhPJLJHj`:b^@NrV(jI)6_/[?>soTMN4 %LgU-=$ioQqrk&4"`SgdS3?%']Z3C\Z&#J`6ORTSRM4hZ=Wf@-oPlp37rRW_nAr<,:lG %WagOF=O#ON6L`1q'?rEU#B'6&c:UboKt %XOVfCX],RcQBbPL=7:cKf"/.:>#-SIp0)g3U3jpdlZ6/s4R_%0f@l/'!\JR-COI5XJ(.ZcZeoB)? DX<G'Mqjn;hGW<nQXQQ8`b*X %V>^]a&pq]Lp`luh83_6Nkk.rEc_Li/O3IU*7UcD4I/Q!PM+b.D-%0o=l4RW? 9DRl+W2Jok:g#@rU;D:&TTce&3!I`UAD!1g^_>i8 %4ge`C(4>k=fnZpU3LXg=V8;1gf5\sl,;9WZrM(FD?-<t&,Wr9c3.b@9t`CNkGj]@4knX:erU=:h9Q>Liiic.X,,MK^e(G)&W4o* %%rSD_qTd/8a6/3;[0%N%@h*TJ,5u2WgET![XiD"j:t?A0C3HB69;3lYId>BK1r-/3T^c_ZKEr)4P/-V@F5:hpYB=AB\[M.,QV7> %7pBrqi7Ek\/id:/;$Q46!F#%W6;3Asp6Y-9J9c!8\tDsVGS$9WYg":T)fULT%+m=U:Z?)XaboDEe:o]Zh; ("?claI?D,B)'SSeS# %R`#@8&LNSkG7Y49ihH*5X$s5c8h'0S'gD8*X">h#X<JuG\#9M3t8Ud^LoWQ/A[Fc3.\NJXq@>qD]B&&*:.UtJ6';dEsE=U1A\A` %!n,^-+!X0_$Ed1)g]slKe\mb-]s24V7(LmbH)8l%"s>6jdg_&42j-.Yp%cN+/QGRa,'"oWc0^#Q/[f[>8`Hf7W@5ff$K\MKa,h7 %AmiHUHDfq-*^gG@>1u5RZj`G$opr['fLeVO-! Cfm7_PX.G9=#IIb>_=7$>h8(#u./_rthFJ^*h9ge`/57mPg)(HSc<([jcL3nVs* %M-k&0PibT:POh*Sg$bUK>8L#8_-87HmaKE,0'/W32#^3[IktIZ!u8*`7:I[k&KrNBAVaOMZd0<\0o1g7t:70D1rica-s%V8.=gO %)T4kP=[?:Ubblq22:VQ1!JVKVo_Q!. ($N;M$q'MtZHmY\8GE&45KAC_m=q;S.np7<Y\*).fe05aq/^4B7\5n\lHrm(aIdc2_,C=" %3_niBH:(WF7`un^:NM3'2L]JH:UZ:GUEqd4>S%_-1XdnD[&4*cX@Q:o/'fNrG%_ebK)Xhfe@`1TK4YXqCj`6p"+,mD<Rqm?2jFI %a#*[M!;INS9BX?l#23s_N]!4oTNqVXNRf! 8oMHS=Nmapp<8cqaC<NgsP35Io"3goZH>&Ff&po/Y'Yo5;K23Xqp;JORTdS3hcN]6M %^i"B,j`iAF=Xc84Pb[Z@i"C.7+fT*eWN>p""hSF=c39ObH+63O&uS,qAj66^=<inCZl@>^Bah?U8p=>j7o"b4NYA5h$5>r6%L_T %I*<UsoA]&\kCc5[-(FhZ&>V-J<+_spJ1hHARTb5B,#Xr3pRR"?_UXPFP\5bm,)%Rla%hB9Pq$if6Eg\ +FJeJts-1lJ<U;HZ*.O*% %E6?23\N! F,3Qu1l(D5o<_]Hd4S[0%E)q3Tpa@T,d4KFKL^SpaD_)3EkBmLq*;Bd<A#0C_@E0m1'Hg\eINhI$d9@/S^P3qN1H[Fd %.NUV.]LeZK_>.Ff>l[2N7sC=hEZ7t[:RZeHnOtZ_5?UVr>Jia*6o0HU6TXAGisX1/k1f`[@IB")4*<Q$#1s4dS(m;T!"mCYBd0k %dmL%:D-d-i%Qc[1KK]2@9U)-e7ZI5+#JlrV>d]ObD_id-V`^^l4m#6+ceLn;VJ(1CCE,qVbY%md37H? l3=mJSge5h$"`8PV]po@@ %@t-]RjL(EM#?uOWht)*r7T`.?^VLL/,od\:\8<t9B`Qo+#!b7t#!UegdV^U\H`R=]'u.;E^_J+\Pq_NXD9ZOpp18B\g%.?Qb3tC %._!2e4*Po^1Y@P6k0.7nq90AXBX6`=$O_"&MSE'PliiP^=MJqZ-9)4-b"&Nuim3(C3h+5Yg[oh? B<dP.rp2RFoJu]4;CW"DI'QTP %^F`H3JG!8H%;CB1AE>%T)2qB1$5u.ULH&jujQ"k[;pqkA'NY27h30:.RtXk67^7-a6[:G!R;\<#MPf>E"W(?(C.!$IrP`=p:e6/ %cZD:t0=LbYIK!un^Y8@a[enDG+o]qTro;o8pqQgo00-fE+EiP"^Xs?B=p]EocL!`:1-! GiSM00<Z^AkAl(>0O0c$%:ce!0NU0ks7 %pYm^<`G*aC,OTrXcTO^@CBY8F3jRMdRqqYQaI@U)DR*-@>n4V9iT<^!N)LHD7^qeW7Y`_>^P6$ (Uf5Z`g41eh`89M")Z^>+ClYJj %V[picr`k$Q@79EiDtE8F@dIf3oTL5\$lQM`6c`;$2kqb9jVXQ:dYJg]3p"9U*c1<T^R1?:*W9s7:\N@Ut'`MYp:Dk)i.@T)VH$7 %UCs#^Ir7A)30NX8[fuQT+GT5mS)Ek.P_j8LRLYh=q*Ifc&4n_&9d=gP;^:#Xf6.G!oqVZm\ +n"AS2s1\Q#jhf%nk-&L1L)8kKmX) %)Z>3N:Ej`npoVA2)=9QXU_sG(r4TX*N(sNMP6eYDi+scUSN%l9#qi9W$*;MZ5L$S28BZdZ;':fa6[EKS=7CY/r9Cq>%.,?!d`t* %05?]C:2`6Rb<!Lu"OEI_Ltul8bH3JXGtb,3pcti6abE:Tl"! `I3"6P#7^Q6c".Nmj+t=Kk0I@P;_]<[VH17%ad,;l-M/ES<d;\$' %R#Vq<K.]:YEQ9*tFF)73rA:lNgEO/B8K:tjPZ/^$K.gVkS""Em8END"V[1rmWO:6G`e>Fho9EG1WD+r(j< 8IUrDm^0R1#7d_lh=J %#oak65P:kHh.]FDM'oR,$OD7>G]f8,E59PcloGL.-%@t(!<:a9h*ooj0sl*K %QJ2[0_3O]4EA&m]Xj;Z$*DhucsLc55%s(pL#X,% %T3<PO(@_P7K8!g``h],l7GlY\2\/Z=X?X1X-t;.AiL3ga.>.BZ5`S+pqsNQ\`tOJF7+t5>^4/UW=Gq(] (f&he*U"P@8_7P-9S!^d %3E&C.o_5=l[q8BU)u1r)\'aPUc1\ (so/W5+_Cr#A$P/Kd)L\1]6VLp&f\R,dT$O_)\fCa&[jd^JJqr#aI7>bNMrlD<Y%8p,N/SUh %/sXhRGBgRn9Tb;hr.0G-d0C_p\tnTG?9r+CJ"c8UXpGd!bD<K?a(XZRD8E>^HesKA=kPRmNG+#'Un5IT32#Nrk/.,BY!TH\"Gab %'37G/X$tX8_^d;_70tSKm;7oWQd!;kXltat<QuU9_r&_?j,l9p]a^XH!*@kG+'V6tOK%hjU4G4$EqSF$bIH8_"t/ZG.UR7#[9^V %d5=0Y[J4>XU)B-/X8BBTA/>CDa?BccQ#?-jiQmL; $2Imm=DJ9C/GL6r^LNs"TRDWGS6RR:9$Gh<;gCjY"iK!ReC#ZjXZ+5IOp*?O %an2MNnL/RFY/FdIT=!#+ia;kP?4[3R(9pTI+UgVtQk(cc@Agm;#aHbJDfP2/K?^U>9n2?AGNVZs2%I@&p. $O+h$**F@6nAG8TO4Z %p2nP<]<JVG&o)=G@giZQq04)1QQS=Kaag'1'iH)_O0Bm!JR;T="S);NP#bgiTb1JQIa)rgidJ[[j:lY+! NP!-i8mPm^N4r2#KTp. %`AQUF%,XEablLr%/H(SM+![p3Kf0[ESOT)?g9<sAEno5?$5brCb4"]Ob*U.fPbnt;9PVLr!)bUT)^G8DY.6l6AslC&dJP(J*YG] %FgUH7Y%^h23GF!Qj#Ji]JO@A>GEkRS(23d88sb^bLVlU3mAWcnG[t9fGIl"c)Z\4*k% (aWat$l<O`X_8T1C%Nf-H+S0?JUi9PN!O %Y_AmK9,4FlTFIGtU\Ap?(F08k(i`6sWi=\L0F#Tm34A6'aAp9oUk<W"3irM&*jbG*7/mTUB_J9ETTMG]9@+<I3bBc@n:CB,>DY0 %3CgF-,M%%bO)7ZZ7d:,5F7?$N!Wt.9Tb.:BaE/t<(?D(W&gQ:6fqS>7iW8F=b)DIhe6M!A4K\ $l+A,sX7k?MF1:i\d#Xo,Y(brFC %RbH`UUp5ko5Z*kc]Y<aKF*]=Og[Ibh[tcdlgOH,8>M\2DM>8p+&bMbD&YM/1dq"V\ag#e]3'e4=!,&YIj)N\ +kQnUhm@YL2%Mq2 %^s4G,?qfB\`)@36hluT0O($LmIJ(:b*9<k/B;Kb.U4iUI#DqX4\u#O)AZY<u=nHGiY=:LI(WF5/j]p7&FS(fF"#"N"$0O)>pgrj %G/c=_Z3QAb6M:1bhi2`f@T<9(XlGKI7;Ot/Q9n"UrZC7'o@NgO*BC*.3DDQ]r4^t[+Z'XMn)msrm,] %p7SWS9SFlE&_h?2!N.X'B %;$U/R->@8:&@O,",OYD&C*p!C>3%%Z^WNKP5YJIPVD%e.63FK)M+2-dKK6Onjhuu6rM[pJ2PNY<_Afp? nh_YLURoWj+K`H1-ZR64 %*m?7i;s9###(HNFmss&f&,XB$\/3'R4*\<Bgo<gr^$7A6ep2Yi;VuCP,/ANbNh0gTVn.r^?pp$0q];HX! GDg^aWeU%UR\CP1;J09 %21XBR&lPQ!@$aUR9sQ$JfY,[Hn(=SF3mgpJ-RN)_(jAdsN2Z[\-0499+rGGXic-4qNbt&@4`5?b+PcNg! Lg)53&+TZ,so*)*-S,) %U*WQT=K!/nK)=iYAOA<jOhq6Qfue@qC^g]bnn!JJ<>E11HE7Rg0fHSg?QT"S*(oWc)t[Wr6-5W#7] ([aBNDNY`&74\V6D3lb$dWW %8iUu>QSa)?7Bm8q?7hO.9o;1g,m7+hro1sP@hLSOiZ]Z? dfR8\apODS)R6DuMH0:l6Ks0+6X&n\`2R6L6FX*3Iin[ae;!Je?CGZj %SdoJ_`HU_i,Gi:(^@^.6`-f^;+MS0*oFM##%! o>5(A,K(C;boQ894g:R/Vikj/)NJ6&p:N0@Grrp_i^d4Qqm+\U\@W#0dKCSu1Wt %#e_!uD3e*!3,&N)<qG? LD6kS\5&@Q2DamagRQ;2>NM)Jq^&_6o*]i+*IAPXPfusK(Tf6IUhJ3#f#fl:BobNC<4qQr0jOr<@Dn'lL %SMp<a6`.HFo8u#rp+cf<&eN^4N!;u.k,qp=>hlDn"qCmr'4Z@7nc?s;7<Js3/k0N\\>/_iPeh`? Efj=7JUpq$"RC.g*>d\ol_nC5 %'O2gk\;rILg+Tt5-ut.F'XY]lMsB>%&f4P^4Uu-TX=lB(WF^"dOoW_Uq*'4Z$`ti@,*pJa`$JbrB) +ZP#X\Y1!'ZSW5@Jksnui[J %1[H#YHA8&rQ@/hs98^K.f.)qMS,ZMra`W*VM`?PiO+sO#HZ^br[o&=Qde_bk-N4_4>`N[F6/[VC;*,;s? O'%Y$^iV_'U:(fL':!* %arjGK^?fD>TJlu!pZ1YG<)opLKsuIRfe_mZQ$n&joEt48M4b03X6Ms2)7618JStAS+,IZ+Ve^1qa=FKZ(! OYf?%FK]JhO+eVY=S[ %4`&:;eq%dVdnZ=.)i/:F0?J'e+)B:!,ca7h@I5ml0<&HWYNuc;6rpC!^J@??IFHC17l$kU$n% [=)9\)Uk]=Qu;9+F1F``tK7Shuc %X%h=rirR:'/u=A>A_.crh\_; +pjaDX=YjN&ICL33\,&:DMkSiPAFP8\lnL;b4GXjl]pk'VFs7o[r7Kg;OLuj(X-H4#HCiin`QU.e %Amr'K0>:0=ZAIc?EE-d'^Q$9W("^Wd!ma"*EjI.%ADd$h4=+n6Q@m0<p?`)p.bu=ta? 6TM,f>^.FIXnN,@],c@ejc7AHc`0YGH/7 %Re0Q^Q[+'X%L,cX,A[n**n*GQ^`dhL15e^GY4/u>2oB9bZRfD:asEV067Y+=c%h"Mq73I5=)KT"7*9? XV'Y"HG+%p#i4/rc*dLP, %\6C/Z\pr,mi[D5XA2cX[U3MTcjd)(l&,bhX@NpWTLS][FO=! l\G/bbdp&cGS3d*k<?:^:u\CZ)P'XBX/O^V+@iZGYp^+F,)5[n2% %,FJV7^Gi4sOkgkZ8j7HdV*Vl@Zo[U6-i5ZM`98ibr8Ftn=pEiQf!?#o'(KG4Z22c1Fj %mcbX9)"fq/]Jl$N)9P642.?N)u0/ag5l %GEpNJjBe7.i>]LWr]$1$>#Rn(#q/Vk9?lQ2IP"3UL0A]Rhq7`:>W^K8<%bYj2[/:+6Fa%dYcQT"I;cl1K\]=pXs&L^rDk;j&5>. %3j[?XV\#%b*eT+n2@gUMj7%:6k_P%Y(iEh6,nOp=La:],EId!h3_Ld^YD"Y*jP\uR]$ $Bccg;t9%S8XiUp!&E\q<$cfh^_a&q"]_ %"d!:[=jEnq<foB"OnMD631=+#PQ\6iY+Rh!8Xhe2og=9OShr'-qDC"%!8^'12$PIg38N]Y) +XN]U7ln#d&Bq_=6%:$5KI?#(-9t& %B:i7*,Z:78q>B$7GnOo_GdJnB0u1k1;5Phj3d*=r_/&>S,KnVTOf-q-! 3:E6lIZlGk9bbkW\a0E+quGLM2ffX<Mq[bUQSskbP,@2 %%%uW0bss`mUh\Y^\ius%VleoBFa1"EG!+1JJDeVE*JaSu`>a#7JU$qmdQ$M5TeF_:E/77@:g*mC8^DfiCT%TJmOI#6=]B5,"N+^ %%>4Z,WB6Pno6tN94L`BN@9&<4F(7V/X>i')AtsH2FDNO3kls%M9rs-Fm`a&i0nP=$ff(faZ;W@'dKH'SOGW/5]J\KeUEs9X:'GX %BRZZqBmK>[AG6NK-@UA(\a&MrL-[`rFdUMR"6K#;-gpM9Hqtq@FaFY[4(XjROC(NJiR)QCOrG! 1VeudfIM=9@!KHB"?V+j@PF+3> %.g5_<!RA_^1MNEZ!rUdAF3EWtV^[#[anZSUbP`i9Eq4pQj,r).+ (p"LW\6`X,PauD=nFF1cYIeD5nVg<EG2!#eEn,(i[8D/EC?OX %YAYS-Z,DU?kYO5"<h(!e":")=) +W5R7r/Gfq7An^4tZM[P:d6fc86%rl5NY)`YG=>/X9\!;F6P@W(K_HVVCCb3lE^#GGKL&;.g,I %rI'`?+e6E)h%\@E:>["?.++p#ql$XH[7?<OZ#=k@,Oa\9<t"P6,ub2i"7[\nGfQKV[Kdksl112C4'I3:P? @$M2]..J02I;e1;[a) %B$qXUE.\=Ud_a]DdZ-]DZBbN<#"KGWqGG;Vi6sh?;oFJE8B:-&_6l#n'Hr_R;c%?V/BmC+mL]g-D! h0M*WX@#T-TZ*.fKP],gBY' %__44>Mnof7h)2VHJ@,oJ*&7c"AU#1bp/r6L08]+f46Q[#gQQdP&8p)K_;EWX]pR<cqj4WZVIk'e5ZVhuR6 qU/.@s26K<lEZ&ok81 %*JqKr0+N@DXNE8ON@Y!FSUO,j;]1GG,nFP?.Mb>VI]@`3B_Yh(L+4k'bk*f;eh'%B4nkBa$Q5$j)P+XU;1UO]ZQprgqWmE,C)DO %SZ<:_)=V6"'s\$Nn)).f[1kEg.(d91X;>WVVOdA?Xp9&r1&V\pM_8g,r?^Y[;9(#uNWIu#&A4OaWhKSK4T5mZkV0Ri;olP7U(Mj %<Rg9%94D)Lf[b6,3oJ&DlMkfFYPfBpHB2!\QRaig/X\*$C'HZZ5nlE? T2'n5rc=-"j"Q]'jItYIpQ2=730qgg,Gl7`C4M4?o7;Ac %hes+MpACFdXj_F;ie+s?i3L? if6&cKo7r6pe@WZ#<E[9Z4j;Q\/:E^hLP_iPZ8<b,GImI(U*SimePKrLZ0#@moOC:MF]ZR&5(!LJ %qj"_6,'MiGMl/\_+dQI[?JWl0Vo^+ZMfr$s8b_Ik2d8>&m%D*''<BFkI6SPpck! o(cda*LhW`)nLXnSMWag=\-P;ArUQB-uN4!um %Ed!V8r/KnWd2$G66F(g75$TBZA1,Y&ai]N-%l-3m'Boso[QD&[R&:a-G),QAHEhi/cqgP6% $]_3F`h$&3tn._!"4grWCQk%34mUG %QBG=/-p&I<R,uX4OWa`N=4H1F_] %bfPsWn@L#tE59*s3><7qU`[5i9ocuV:3,7`h=1b4@1X6mpg$ZY=sgOkN`nUu1N'C,@(J?86^ %!U<U7UifE,C'ZLN*>&fKj6((W=Q:g%=4<Es=G.Ln.%BY1(G4X3aKSNV%u@*?F"<<VfcVdT %R8+1G.8(OLhge\a;7IBUY(='@X,P] %*FU6[<T#;pNF/.69]%HLS-1j44=?H4b#O0Y(C%]o8*OK4=;b=S416h,bh`BRK90LeJEX`O'8guh= %badbp?Mi,Ke`qo``ehfje_: %!+qU&$nQW(>`<X?a)5&ipI0YsqFN2abQq#ScWn8u(0+l./7!&!UF;Se&2'tioUEK]cH8n57:ok<&3W8? NI>efU#gI^[50+qSC[CG %.L0^k#ZflJb@NM5i?J,8SBidUl$JsL8N=.h[_;l6XTr,Q]h/k?d@Oq_WKi#o;@BV71)p\LUaG19:AgVg]_,I^`cl@S%Bj180]VV %a.dcPF*3;hoL:Bkb/V7]a73i0=uCl8MjjQS[K9OMXW*G;[,*VoL %F,)iW54toJEtO&Rn8fGShoD;Gl7Dl3I7)*u1gf"1cO]h-KJ%U<FY5f??_c*jKZ$ZpP%aIB;V`DLCao:*u<p3%'&6"jqO\3D2XoR:?"Q;eSHJh;sGCF#'*B@:YOo%H%GU;IU#lUi<I=KL;FO@+0' %1WPPe4i6,+9T:CRN1T,Xonrq3MV8^>8F)u)'[XY<&-)N4AS$RVT2%'-]e,DTT]s9iXk2UO6Mfs;ep>kR9jgK:E5*=C>NG6*_L7X %0>2ThmGo%i:h`Yr\1XX-M,qL?V5MOnj2J1(G(OcC#I\(4\YNM)>6QT[XeF?h0rn#b97U*Qies)cQr%! [UL"cKdOTU3RAHutpLL#) %T'@;'9gme:rk0B[1o[h@8(5?eMpY):VOc/=\f;`(Q0oR>P&mZ=^9O?U(*<<Qjc)3)DG&Y4euul&/3>T? OenTPoV7P(q'/RM<"9-[ %Q+MLhF#`S<Le.Lt8*c,H/!>rE(H3]=nO'%g9O81VS<Vf+B_ak7rqGA-4&>P! [k4,fm]].L=>;D<djZN'eecUgc]^Z(bos9]+5hht %jcsbp7*'CkeQ''!H!WiK4["'S@eJ_HF3qs7O4D*1Vkf"fH2B`mbXkK#a(]Y!`sA9rh>+('fHM %L&I#lmlc&MNSui_NDn$UJ,`^T< %jc7bW^Rt2Np;3<5r!bq\7h6-D1;Qf!*PmN*Cag(6'Xrci*:=\D,t>LbGuYA6%6A7s9=! f:"dAW_==XHYicFmAB'[>F-c[SaZ&>Mf %g[c"%biYK^O6\@GP'Bi06+5@3<O]HHnF;$76`r:jc(TSU('-6V] $P83WGkK&r:"cpjK/Ve)bhFp:6s]U7p'Ah"u2os\(!'4U!,Rr %@m5m^+5)ME7#@:9a#90B(h*3C=`$!//)6h6cYJ7#<S?=Li4'UM*f@:EZQ^r`;kASf<q3k1',LN)5cJ(G;uULb._6[l'c^c`=/+K %"^dg,'?mnsY:`k`lcR5]NA)3<+2jOqpr[YmcIFjfk&RV.T3a0E5X)TIFm'0,:[M %p$U/0-)8ntp<6JCk_g\D;%b0nY)aVSn#$JQE %fJu4h(*O9"f_OuNe:?&`K4u09.5j;\cmf\#>NOI-k#9-sFgnKAl`? =c'nqf<X#e+aFHTXUL7#+XCU>ok*YMMU>"'=0@_^Kk55q-F %47KkXikNfY]/aaW:9&7`N+`s!1&W@rhO7j^s"2g06%3IXr+`d\9l#eD+D)2%hAjJ+5gMo[)`A9+.29nkR5cYGb*glR%$Tfi.%Nj %^kVM`ct,0`]Oj^]8Cjm)WsT(DD9H+X]0ME4#AijKM*UCqiSi5NBFeDhR$?EXkXh %>h1[0G)3@"<4jl):e,7*RkY\B$0Ht[.PM\7, %"R;#Q!.;,nI>F>7o5fEVjZ-[-m05Yd),XPo3$h6q\DP$Id].>DO?[B\WunJ`EC5_gP/;qX>@fRn/l? 5hW^ru6NpRm>=_*C5>*?EZ %5q"tGZ4nWJ0j0.k*B.e7[/cNGVkh4boA#W!B8P-!C\ZPNUTYk? b(o,H(HpA19Yj2/<26u`"`5e&YGu)p)ZY:nHRO/emd8b#UXP<O %%f`4_h#]+.7fh:`7Ps7"rp>NVIp9_o]4Q=e+8h2-oJq+52%r?G[AE*cE4S+t-Te#NIe! C"*rDd>OI[jmfh&4e`4+DCI"R.q^ug*Z %6*m?SpNg";eipip<[P^rqX]$CG#=h(qWko4KYjUG4R+^L>*u``Ef[<:\oVALA)h(HRZ=uH@A$gru3MARWPJRbGp8F3*d88SXJgf %B6*P]Yd?4*n&'gXS@np,YXd(OT6g'C6a(P8Xm/i/j4EWN#8<Ik_Rj>/l=Rt1,OJ&0g[3TW0%3^ %8YlYmo0R'Ji<>,iZMa1K?PfZt %.]O&@'m^HuMn6*\U7/>UXV6L:Ot4P`XO=-eQ1C`I^SOTRkRl2p-)!3.7iW:mG8BT<#EO8h(Z8! 01X]u7MAj=H*+;:7LQXtaimu2" %;\0d?ief,+2gB$r3RF`06YfVR,BrTlYnZ15d2PfIGnU;@jGE\,AS8P(?O7V.nn7%G8h%m=t_Zcl]N>[hAF>AGfAY"H\YpZMueR@ %pcdk1pSFl$_C'pWeB^jcT]5G7T.g696Zkg&c.)O[28*<nM@LsZo-4! G#mTSs:#thV9GBVce]9n,CN=E=dZd!YG4p5Ol::G4S+rfq %75Ck;+!8U_C+ZFtIt+7]l*$\eK?YIor5aeHd8kC9EI-@WfJl@FPMA=#,3*[!, %0Z=Gt,XY$KNESQ59p83+5f+TgNbg`*RY_jM_AP %;JHg4qX+HEQpR'J2L>GZ2FaqU&D=J1Wt] %NeN8;k$OkLY"BdhAEPGp(gVq5r+ZLPq5pfiqiKNneCq'pQO^HZ;(a)lRbVj\l_oHGf %YL,Mte3G-gFjI-1\UtVE***E7kgFBqGaL4eWHgst9Bj.r?XB-- Og)\O*,c#>H9XYA2*[Z2p3k$>E*0tCf#$rXh-FI]'r<KYF:\+o %"`uchWlIYF!@Y([%j-0Yna.-&e#Lj:nR!gji.l+8b>+;LGCEn9*d:n`mo4JVV&rM;)O7!:I]G<[qepn! Nhk#,XX#i;0a_PjQm8pZ %Du&ZO?>F5_8KV0.R\##n`\2&Ack_idU'+%#/SWC-A#549VG(tK[2g;U#5qXLHg:[Ybb23)*mJO?josJm_? YdClL\@o-6Qu-\OeB4 %-h,-GGjR&M;?\VP\jc\YX86\L@I0=)H*q/l:$=LXjdbmQ0m,V)[a/ZFWR#')GJM`[Y,UT5nI<jj1gZc0=@0FT[^jM?j;tFXmNs& %dp"Z7N0XZDj':0nGGh`jm_3Ir#IH7*H+RkghFFkqelrfVYNL\IDg2kpV>FMhjd4:XpTBe.0J$`I"4^3pbX W`OUO4]@93d)G3:RC, %UWc@32>mSS8A&/8<k1(ODI0JB'G^gk\[$6qPp!f']RQ2:p9VA+D,aOdh5>3P[-f52$j"B==$0PIKc9! O79.8Ja#/2m:>$Ejho]Gn %,-h;[GMSuC;>i\2O38S?mp3@H_b`Iqf;na@!@:+eEYa</osr8<LPesj/BLbC#R)T5M&&1J,WqrW2m*'7G\t%[A%5F+l9uK*'X=T %(!`(b3Q:>;"bgg3h)4"B)E,A]*V?'!/W!:,6%9h<DINoD>d#/ (Wn/Ljl[C@`>NGN:UAHSOm2I:=dqS]hMYfef%f]a9>ud#h]AMpk %$5_`[Ffa_CM/46>;egP]_@:b"B;Te9AY:>L>C$GdajYYt1)Xh->=X$N`q2KFrV=XLf"nj6_Ngs)R$RM$ [RfO;,FY3ek5!M/EoiJ= %2*opNP=9$Di7d')rE.@i:#*2qI-_=88,/pV&`,r*@7Cb,aP7%`hmJ[F':3X0A7S,an6M(.oNEuFnp)/q)N_i_e""u.PS;R6B'U6 %:?,.D)<X<ua2pFurSHU.0X'#0pOOu@obpHM1c4:\,=tl;R=#DFSa#H0hmF<1@4pTd`q4f'4R:0"9)8q=b) Co6X?P*\>^kUJ*<1_5 %KISnu6B[@UTK"?c^k\[3oqsQG.L62%;uY9HjMRN&/Ea6gj[@+l*?*E@lL-P(fXcYRr@ %2pB61QT7e@h4^3'L$0UK$3Oi/30@P'N, %g;[!dWLpKF-]Lf-ob>PFeqQA#+PMW,q<rC:]QS$QTOb&6[pI=)Cr\h?>,"I8(>VQ:gJL*2GMoj;6c8F(h#n#IP1:1p2p]s\)^^. %U6$hLPP*X/?MUFM!'X1"fQs=-%eFs5X@iO*I;/ (trr<#pVnX/IP<Y_Dr6N2H^@oT#aJ1TURV7Ah8Yr\8nBrHZJ[Ft8e1^gis!0-= %_CP!qHQdh:V'LgY[)2['=:)g@+hKUf-M\2a;J125,PE\d+ShHbn[ngi&.i/4?J46hY/=#714'?Ms-? [@(@Waehfd]dJ,dJH>,9r' %###B]9ajTu/L)pCo2n1O'$N]U>5)Uu,0&W!_/oQu3[CV_8e?sLfMnAl6epR %''k&*h\Vf3hNl2FI,=3KSp^mu(QmUiJ**BU=re\* %4bB\+8F5s%LZ?q:ph`[t2.H#k^<YSlhh*T#! 4mWlORBW+=@*8onCGqt3JZi9ju8$EqS3W2o<aE_mJ,`3GW\Oc9G:dfWCJsUD[[&o %<hf,Yh9PhlqWqA-I$-SCqAI20/ioJb#mAKG'hp,hWc.eN1&,U>6a%T(X>Tpul`_d!+tg.F@0F=U\udjO! 5Q;::XC1Ao5WO"3[9[j %lLF)ofW;4=o3C/05I4BPOUU:.,X_6rN`16M$hhVSSL_iLOrt@,1L`2-Z_,Ep.kR']_mru<ge"hMkk2B1&\ gF-.WKqj+!VMh?qiQE %'TSo5Kf&s8S#!7PZR,J';!:pF,4td@d<M;bDC8l]q!H]r+0_qDj5\O84QPtCVN%CP:t8G$NoE`Gi8;E[X>K:M+J\ACi'3XDaZF9 %>P7ns,f^Na(aUE[^rj],O?!feW!3ig<Xuq?k.KWgY[92orcJYo`ZYm#f(J(@qN#DgU'b%3T] (gBc2dOg*8%,mI)@O:c@r[VIe+C> %*4a+rq08"+<uCJA=*^9)?h!-=H!bV2+XP$@*g=+(?0H]+9S0W=mX'8VZ#[PYeTst*BttEM)&YEr8(aid6bL?L$S'&`h`;dk))U$ %T?*>#<]9b/;j96%]O'4^eNQ3gM<DeJFOL0V:\P=H6:-OAZf7*[?a5rE#"5]^b`s/<A&HkUG? _cmK>$M'bjF`:PE;08_`m\dE@[XS %lsY7'I^$5UAAE1r0L[V(@p/0eb!50b;3JW-&%0p"nO=m8%J:4K=p/\A=&mM5[tu7m?cf*H"i9Mt[i'ZXlsW9Z42SE#sHN1[`klN %-542V+L$0rV%YPe*/%R?Fk.,S5\tSVX^B"Ks"O)WlaP.3%3%2%EGSBcUKl+))d>Y4IH9@XfhWRYY#F5Ds! &5QDX_N4+<^q*RVV&c %i5]O\Y%n]1+<8uTG@GNfg3(/Z>?r8H\'c?u_<9J[;V5^Pg^:2HE;!uR^=oa1]mW!H2kE1re2R@1? h6$t8bdjt&t=2,Ch6VjG:TWJ %*Z]q2[Wo00Pn=>&o>5GY^H92*h7^IL>Ss8c*B)A6W&`qDT.R,A\BXiX6e`0^Ds,T`Is"5PcI:gi]5dX4V7 psCLT:gs*`I\NoSE6' %SX;A^%TB=k@9rXrlh4e\.VPiRe:+WjU/iYBSN(uUT@S)L(6M3BWu!KKbRtFm5L'=^[6Xu/I(8HS'+h#Ml %Fko8)U+FAX@,;QY!iA %N<`Y(m3Gq[r,ult&(js]naYg,*qJ("4_WA)('Zu#S_Xh2o$nLBJXJD]".Bk=? =@R;a''f02+KMfSKnI$Z1TYI7,"9b2&r7&T^'IE %X%]7[?PXbnS:N`MGl&=tC@`!ALIK3elaJ;gp\riV]5RF0%1^Q2[!'2F78G<!q.Ms_j*db[a*O(#GsVhmuc!&d:uHt3?LZk8d!d( %)(;G[.MJ_kceoh$;3#-Ns#_`$gmuCn6MUKG[q;halQVl:cPbVqlaN.UG-? Oa=OcX>$59:DB5@IGL9F6N`>:W7GUac\cdQ=7B[sR< %L:d3*N[M8``Ss21a-5A5gIZOHiZnG[JL*'U,k#rX9[k`EFjKqf3uGRo&H#umG65TDrhm/Vp2)%'B(dcs5)gR8;un4?rg6VRm1X= %<b;KJd^)!9^tn-Od?V %qG`$&[G+Ob7Yh7sIO"b:9*6\p9c.\H9/BefSSFTstY(`3XW6l.m<ND$h9\tFk7<7gifb?^Z>:Pi,%8jV. %oY[s-LKQeokGtFDo'):3DsWOaST622^_GO4d8DdEV?<JYk90j%R+@MuJR<W7qYgl=;nXa"$:<NRKl! PVB^"l'h$["h[p'9!12ESC %%9nd90t40?XZ0)_G>qTh2i0+XOi11k2mOpZ0K<tI(fPe:o@qs.1Z`EGh:[0cfNkJj0E$ [T+8GKLd2VsmksmP_Ks$Fba+<GN-#N@D %h8Y%1c'Um<a\33cl4]80C1FIZh2"S-B686i]SS4*2CQ9R7(#<caMep%ega.*.6JG_f0jZ? gpMtr`GXKi2s:c"iUP,S*O%K!qS'$Q %:4M3<'=2S8rG]If#eM7E7tR27L0e2J9:96j6GY1/\N(1_nn#1Jlj]O[/3eV;#n;nZ7]AQ#[1u)\ $L0$==3I9mN@))Ec2a+qBum&N %jg)]AFc^-rAguhT"Qk0IGr0:*Q#03SaOCeHU0e!U;@Z49r>YrQmYBs#GWhV:2i[[JqB)sqG?j^ons8E"Ju[WX`6.H9m7;#Z:[-/ %*WY#&HP"4UCD'8D:HB*uP(, $lN\q43A8AWVUGg^]h*6\>P2FQshV,DKI1+iJ9Nqh"Vm_>2rh\RbDJ1_jh&VmH@q_FXer@`RU+aj. %j)K?(=-%"`9r3;GjH%Q])aD'pgbYF.F"aH795@fCr;P@Yk<ZMW<,VBmH^0JXFA#F(Rr[f! K1BJen[YrIdjBtdXc9@KM*XX?RfBKG %^X[";;So=jUt'/`kY5d=!:'W5'Ra4)`>\<lb&;1ij/I8c5PLq]2<rrmIQ2s$Gk&k_00%aSb %KVobiit43]Hg)#^*RuFt_iNV&jiS %'=?"r(7*ldb@Dih>4cb)pi/ZmG4&e&[mH(IBsi0C4HF+=O@Lh3M]DJ$ZHjQ*#98Kak6JFRkdgGghG.Mu91 /h6g+QVQW=c6onop^_ %q3ktOj$=u29Y9i)/qm':qjd*n2:-/5S&*? @OfO"5n.<6%cZJ=PCksugF)8^WB\pfrU'HSuJ,@^ZNtZqHde!;WRIp_fhtB<VS$qK: %aPqW:a?+2nE'6I(!)9"@,1f#_m&j@'s+6UF1c,lTG/lsA""_ln,G;*"SIr!jbJkAU"9IZCMV?)6i0fqS;kf^lB@%L)-&;EQCX<j %*PnR^\3bW$`(rT$%m0c<1i=l?ML/^7q1W1"Q28e<i2OOH(u8AtC?fJ9`4]M>J'mItNDF\[2.B(0ep2N&@4'Yfle\/<.^O#4YL]" %:(.[]HI8b@i6*tkQ$d(7c,IXGO;X4fqkC1L[qDo+[Zuo#rl+\X3_EbL\Mkkmh:-YWr:!9AnFg'^MV5N1H&Hh$Gt+N,mLGV;tO+h %O?(/_M/qEJiT$(\e(b%dAnbc=jH[<;cjoneet-f#GEb88h7[I!M,MHs`ibDr=Z\^UE:!6"&KO38*+DDE8+ $7'm)@f,c/T+W3f\,N %nU:6ur)XrjqT+pT=GT5P*pq,,FWeR$BdU/Di@@W==iDFppp+X=H\=eRI*^AFJ[@a^$9H$E4N(`T:.R0O,e %QD\R;uIe`hE&ei$+V %\\g4BJ5+:hd<?*tUK^64HKX?'"pBH7V@pM[7^_Fl2^O._o=hc-5p$.n8MnZO4Tl4Hscj`kMHBFSs]B)"sC\<mNT)9m]=glkLg5) %/WhIS*sk-fou'=u_rM)P9ugQ%)dN*ZWWK+tdUB`jbJ;X`,n#Gir<"ZL>6)7(/t-RQU*d-QTt? 22+2G4I@jCV0+DD8U0:7p(AUS\( %*m`$Y_0S.q>@G7LnV>Scq!lY;YP?iXDJ!6N3Nr]p7&-#@eS)bh[_S<=-4KqG5]IedQ:!OejP! Hff4hW1^VSpMrHR,.Vet;eo$6NT %NIo`1mg7oAci.8Njn-U0s0M:)iNo(BG<@q9)1Bo\_KDs!IC[Sd4)("58Qq28A/1'XQO?J;^6a.bi6);mNK*F5(XO*n3D`t\Bjt( %?f4NR5JnfG]"EAjpQmG0XE#WqdWYRj5G) %tY3qNJdgUTu''aL]kfW$E1Lob93jj]s7\@'Y:mn,KL+4(O>Y6D(PHD,SI*/WDgVJXm %p-*B4=1e15_iI=HNG0JY=8@i,iCiP%:c-7NB#=:gFNpE(T12as/REtDB*#-"-M982C^jI<X`0_lC! h,l@Ul-5>BE/oW(\^08Oj5& %erAW#5BttSVeph<o#L@l`CYC9g4R0<`kgU"RP(bHdoVHLMXe),/k/2EV'q\>+ +65O<cGQYIk&8HqG<feg;>;o>^R27fSIf#/3<CN %7;>9FB=UEn)G;OHgC/kZVpjP3-g6V<q690l*K`##e,A4\=F=3;Dd:sJeN4#.=FJqi %sK[dOo/I_qO;SBCd@jNY*lZhEH1^aSu"eI %W[5X*L!l*8_pIYl@<h4Wdbuf^5MB#"`@WK"M5:RKL[V8R4^@_.NY %ej/pfKA4"Q'jU":&4\9\]=bij_q1npDc,duYVa9Fm2W2#a. %j.&e8oaC!4dja&Dqgj,S\.=AmmR;Wc8pG";/:; ('=$'p]8MX@Bn`p*g:KJFt[cdY84Bt>n1g#]546Ji',c:qUcPG%9F'%<,VI#'p %OqNWA-iK8g@URVQJ2:o.'nAuj-H@oO"Xa3Xb:!2<^r'.<>qtOdRKkFTYL8RprsU)nLQgD\u,XVGGW&+1`Wn6>^>Df=3M^^4Z,R" %Q3ekL$lph$.fcj'eT3F%&8kP73+m=l,[+]m3h%eWT[RPE3nJ8+`o0UXX.Yf8a?^Zi#DapgY%4aP>\G&nM$ ((j$hl&(o+%>iHIEA0 %KC*SppVY\ZiY:40gr5ud^;_6iIc/6kkItEs0O\`!=J?mOZd:W)rdYD/N%2`J,22bH#I(LJ>)*H'2>f#i_g'Y9/]$&alDePm.@^t %()gY/E;a80/i[t:Rob<RLdt<;Im3'/=X@O`!<%aeGXY%gjDq>2D<? d^Ed.ml;.e'\fTr>MmBH@5mE,61^Ye\OgJ@`dGBL$Z/UskO %G9C:h.=.=N"j#!FM/K'j^3P"T^nmc@&^8qLC%8D/r0m:gUXQL<9ehO).+-! YE9CSIjcS5WgN)K#D_U^4frmNMCYa46>p:!%;Zc4o %]M/1"\1$:bOOtC;KJd)s!hEY'd2B!@prY$0mG#YQ&e^I5$np%B*k!cmDo<VjL-*"3Sc6,X:RhhiK'nsX)mpQZj2ZgNIg%c2rlCl %KkjXdc;Tn/.f-^8365jqc\.Z*@A/oZJJ_ZU*0!KB59([mZu2pJCWa8fQ! q[r=IUVXN<1Qg@0Yu>,LN*@J<&59+c@_g=a8hs+?sc+ %_mY&77(tWU%gVRCj9LbBNNqI4ZSo?`DnE.RR<uhEFU3\5mbq+2[U0^TAlPV<b7NWDS:ZP5jm'*pCB? %r;,l+6mh7*M[XJo9mOZ?S %5"*'IERPu;pPYg9G\eE3fSsSeGB`h!rBEDtETbjc;sug;iBGuEe8e]:6kR? k,b)b=/5PRNrN9*L`n4U<S=AY4?`U=m1@s0h^P4TS %5EuNUb)o!JJE\RDni]AD3l1CcK1facVr.>q=`iLmj#F&)q:a[0c68r: $l5P^].ri((5"4oR`,<Kh0bUZp+#SCkPEr,#ruui@#l]* %l.E^a_RJY,LbR#3<DPaUP5j`d)[B<a*\P229&Oo1nuAE[<RF[Q[N4<OpRI(4)iuks%! psoeND,3lVnXPmE^eMV4u.E=eY]%%;k'G %2t2+`8b'(gXgX]9!_fBk)MjDddC_m?2\*X@C&-anh9Ort7t+\"&#VWGj,n1cn[SH&1XPUC,Es&!"HT7^M, (-1Z4^KDmh*W3;`QC$ %Yq^dNUh,Tano&OC@5#@K[G)Jsh4O]0J,.Q#j^8#L:Oi%@s3i2-%Ns33Eq!IPcqXOPrd2i) [hXQhIM7he'11YE034;112:l$M<bkG %a8ljL(bNLOg^_s+p8Ae]b7$#q4l&9dARTd8aCt>fB@=VR;Nrg&MV:D4?tBK2Ges\UItcjcWHgo>CC\WH[\T[7VkaF'UH^_+i'hJ %-CDn>jaB/`2X2fYo"nhg.5)[/D$P"-3PS!E+")Vh%jst/<)*@7V7q5tT##PN/^$l+)[gnfrmRM=l>j %6CQBN>p,)L'/A@_GI<A>% %pl]2ar-dFYa%^p;hoCrMaKdd(#P,j"(3i5^$'&cZ] [u#')4@/E`hWHX.DuH&^CcaMeL(I1T:k1AZS*N4I'_fL`MU?J=!M)b<BcCM %#81[H3.E@n26[71$eOg^JdgD2O,KX(_ikD<2ZeBd_pc_R/XC_[alpe90YbYnI'r<2*^+Q8/ (QrQe)QHP/c/0^4`^.Noe/'nogX\n %Q_UEo`)r"^O?_Z+)5rcP?;o"Z*Wu3Za'PNENEAdPo_pMhO;T3ZE/=c38f6$b.a2&,#TW>.Fct<N#MR %7Gj2OK!:1D!LcFCpB"??! %>?`fBeD9`eSU+d5*3V=un*BoAs-Im-oQIulIf#\Lghs7LroHrUVKQk?</Uj,>@ZLMXnRu9? HsA`k:7QiOA,oTHl_B#qK3c7HeTac %]"T=4U&U:3MZnm`H1M]]d3R11Y5_Q?(Wi[2ea(XK^! rHg"d[9H^<#35dJ+p^@+r9slO8G;J;nHJU+8AFLX'RS\sV,9iXg&T11<,Q %LdUAD32dt6lMB%&AZ0H'3b]R#)n! =CrB8:uLLsr86Ji3JnC7=^M1PJhBob0HVRHp;cC/M,akGm@eh8$n>BS/!ml*G6f],O")r?\* %qFQ=l"@,I.ocXI.*$%)$N<Ok]7WWCo<2LlS>1[2'[QD?7'e8l#1r+;W^d@e8S! G'BB<&`2&Km7&lFd<b5AU#]is:nAii'&44YU.3 %6Q_B5B#ge*-8k\-mMB-GBlSB=cp_$U2mi<J1u-A5'HQmL"YQ@^!5q1d#_:^:#+L2=9>!Dbg)q$F!p %#e1e3&=djEt%5&,-Yi^VQ* %I!jQZE]l"KlGQ.O>4a\t_gC%]0'lItj15\0mpfkmgG^>6-MHV>` %*,Q/amLDF'E(%,G/pgK[L/1BFTcBkaJoVqX=N_+O2LC$]*Gm %=-gn(1B/FaaA;K&+"`l4ECLK3Tg,!m5Sjkc2(,S17.Yu9n*gK;(:^c-pF,G1]c>kQ8]aB0k! XP=i.4Wce5QOp*CLq&b3:o@BiTp$ %:.835iMs&n6TNdgZmQ&GP\$3C`"E//a)!LJ&l8dVfgqE9$DQS!)KE7H7CHY!VSu%L"3nh+Rai %:,)F,I_=AX>kOGjLhM]6OpeZ]3 %`0Ru-%d]K8_;b75(=W,aQb\>s\7RXN3/Q3q6,:ds3RDGN\2Z1IXoZ,/D^Xjq=7e3Zo^$\[b\DeBSp! S4"9M%i,1ZI5F:$+=@$r`9 %<ek#IC\OAE+PCE6pu86jq*Ce-+c]](2:/W/AZ`62T`gF?T)9]2j,?6EBRQMAc4%m2%*_U#JlUs-D5;8N8??6K+6+:3con4([s6k %G0<V`>i5lXG=[H^?\tnBi0B&<!,9FNWl;fhN#;HUmD1S#ThhTP3bOk<h"1;!ASkS.QT^..gA29.UYGZ)NZqQZ*.^]OD#q?,j#ZG %LBA?9mMVgm\rRNWWfg_.E/l7ng#6P#M(a %^2Di9.ojjMC8XR,BcNS&*dfs4fN$,e01LQlahOr02I6[VugBe)Wr(0DWWRblTLh9\f %9]Ap=,GbjDnR;]4(+69#G&%o(FiWe6R;'XbJ5BNPc[_6d/>rF6P4D.DF9eBjN^U8o-6qi!C1@[r<g! Yqki$rSRu>fq"]ENUQZQo* %GR/-IJijKtX`ntq;@q4SKnp.mQ'bD`;4eUF!q9A55S&bu!1*%DMu_mWe.ZmP6R<_',EeEVn_Nk.+nDY)! ONJ9a#0ZpU%/VC)f4Ti %'Ne;L4<V(H;APW`V'<10Bf+p(`A&=ZXhHdK\!>t<j3\ibHr4`7d6E;Z2KE3>k'TI6VGJL<;Kar:E!;V: [AA?HTcE>G<e2P_WWc"' %7dh<g.W_q;,O0B-FL9\U6bp]pKQ3r9?9G"Yd7dh!qaL;`^62t-9EH:Z_e#qBq?S>#_D %7W`P3e9f_odb$e49OYOBa$@15o5^E..%T02fC,U^V0,j>+UW.t7Qjb!jkZES%i@u@ZPdH]Q+^b! DY4Ar$@A#l[T0cs&u94`c5^`t^PpGqI#QA\n`hcuVeRiu=YZiB:)r.i&d %Vgn]8s7ZD`s4`&'a1qSNJ,SJY4\a*!o'a9ncJpa8o=t=e5PuW'r(m@[+92>,J+k&bj'R<9r\$M8p] (6=IuBBfr@e0Y55jC.IpeuK %%5g]Z<fqnjh[JnS#o#&<$)pl\.qT<V*s?Rs^s#8pN44/7-PHtSQNcMHVF$gU[f#&^$](o6fVUY^B]! A9JHn&`D.eX4:K]F.V\T-' %N.UNY)tC#aEj4I?mHbXP_l=8eS!5T@<jofo'b8/M7<Xdn.'<Uh4f.E!qE+3jVB$.(lRuNAgmG.1?*_2b! 8X.;$\TNbFqb0i9/J@7 %qNZ<O]0hoZ2h]O4[4*!e\cWG?iMb[hk<j5ho*#p--qVWkAeFc@9RrWBP:6)VU;^QY,]_+O33!.W? <QF:3TT8>[uL1^7rC6rF;8>/ %VP_J;*lIOAedQ(B=>>`4Eg%O1,jC+N%t#Q`/7JG`[`Efp<? UQ"ef9iC02l#6ZYmj=ag\jS>NZR_NCcSNX3M&;_(4V^6.#!1An+SE %HCjcF=+;g&=WrcL>XZEf1PcR"J@'-b^AHf[GAkVMe>Q+W_mq*g'!2uXf[Y*i&Y@XloOYFD.8U? N1t@8B4:H-%;Z.%\Za"2PVIjg` %`'f5dmk0ts&g#B;\c;*P43\0fqBYh?Lk7c`@69,*GK;V:%j,2<jIf!&n,WrBN<i"-e %20I5?'K(oF.kL*,C-N:@O1"hY!bS1:0:s %f@SJgi-<2Jlkej#aa;F31II!DIOu&54? r*V^qYXqP@7Z8PjI$nHuQ\'Qp"B[rFV@0lcs#/7q:UD2q5ngqUY:b_@<C1VQC$A.+?$p %@H?i[QlG5O!0*FldD+GPP*DOlU\F*\^T['Z_$,Y^Wpq:\i..;>+5:3"suhb=WU5Dg[BCYRC1i=f72^4IJCh5'c<;_Ye5ZnS<QK4 %g8Zbi[ZASFFYp*:h\'O`J>IWCDF`oOQD^%D@TmD>F?9AV;pq,)G(!9U)2m2'Er47cR0M\ZDQnbc(4smSP+M$::@eiQWXrbd%?dS %ITG(:mlj#&jq>b#\D/>Fs40Wg<6mLP=@*cGPCj@qSEOYJ_MELBU+>NMb/rcKb7E0>oTrIK78L>P.)/N#at@]<PhT6G%QD=!rDJ+ %X#rT02+tV$4J-Ysh)=8RhWiVngnthRj+lrP93+YdHB(S;F*&;I6JigGdhP'PAN"u3gUiW1m? >_G(3i6</Rs'#!IV_u=,e'=D*$Ug %gY3sZj.d4`,jSfnV1].9[ND2L7hE==]aBWc:o:hq1X(SKCDNi>fs0s"4VYja3S@JXNH/5fTF9M`d`Fj[V+ e!bcLh^;#.6-enA'U# %9A!D`nT)uog!K5c:FW=+3n6MP,_=or4U^b9FV.b[,GGlP/,'KSbTV4U..VI? @+85X^Auq7Ye#MaH#^m=.n?*.XUK+6_;SS&+pplj %Q%Pt;c6;FT:In?F]b0ShikEq)`%G;q6HL@4P:UH7rH374jrN<h1;i=F),RK<=#4X+];jYMc? EsEldo()'OH'Me(IJ<)%1(epAka< %%E+[`4+&0FQ#sZs2-;^Hi#oT[!5r;laPSFJ"6m$7j;ArV?"2rK4GbbaVa^s4ogrM4GhR!mF<p76T!/";R<_q@ASEl/=*_mNrUA" %ntL>Z1js$=r[%IJT1qE&j,6ck$@:,P&VWURatLc882JjL#B7l9VOF;dW5&UQRL6S7j7%)Un^7U049+`EB@ m!@V@GWZ395HtU5nVK %c;PP4=rGFb$i(kMo#ZqXd@GtB<(Q4":&e%8rVo#S=hTU!s(s`,eK2U9Hrs3a#@T]p@(R! QqeLM.E*^M3`@Sq,`8po`IrDk*!^JNe %o+.`D4&L+-KE\V`63E%!Wl@-\!_1DQdj8j=V[d;sK/U%)Sh)hmE<[L7X1t_fd80_Yf0%a.AgN! qgG$K(0k*:pHYt<$`_U3T4=G07 %fr4E3A>WhmV\#'XT#UlEU:Dn8;b'Wa",Q*tn6dl<$MmL<"J#Ru<WOc!;u&9@jYpfrb0<T<,j:MKj4Ic"7R (!QKC;YK'D/bR!eCil %E`To`.US3d=Ao/E!0HTL`cCjp<^s#@o+7ePMGh4d_"!WAl[BVt<I:MKApOrHmTnsMiXe.S^*\M6=_`lB)h?47^!^RncCQ4n;i:& %FJ"2l*,ag)&8__&a==2g`N.C-na"g;ms/E8c_g%q<ITJN4HK/P>lR7bU$PgaZSDPTUF^ggX*n=:$Lt! YSa"Y&F&G@PPj/m8#o-<Y %?$`4tD.<%L/YI7b(o?lR%")qhmFg'.G#mQj;OIUtFggiIQk3$g,VKo)K#Xta(dmuJpOPR&nSlE! 2Lpb8iM-e_ArAWb;c#!mL3F#l %,b+A(`9As/0Bm`c$<67bF:&tC@SE_L++"(@H22`'Ml*+dffDXf`1TZpEbD*ZW59l:/pm7Lm^)8=oR@^#jfR>0+-mro#flj#c4UW %Rahu(a%DT19eEj`kPfRb/i8Iq5`RTNKc3B8Fa=F@2?AH*4Ep6d?eOlOIO!K$+#-#*<`+cYB(e47#i:j5)#=JOLj?<W7gNZ%Z;k\ %N0eI(1lU<6mab_f\)tQG(P9<\Hlqtg!MdqO-;-Znq'2;]1]=\6O"G@X<=7c2c)=_-8aV'o<b8=g<md; +@C5XY*1)!`nlE'Lg?Eb+ %9ih]^F.=n%SGtX$s.LR(<2V/r]mg/mJ":FHo-P;7]DV?YlM@qLf8#9Xj7'0aRE+B(3E5^nM;#? Y_YIu0H=D:H85e!Wg0JsHUm5]5 %^n'ZGCRYr0qXe:Hb'PfDRpFesi)@Nl=G\n>#S%JnS_CK(^,tk85*KlfG:Nj %#Ecu0pOW8jdDq?:cf]d<[[mVJEIcI_Gc]$H'"hBt %.RIG">lHRhBK#h[kC-V$\!FdUW]7Obi57'?^0)=TlIdiaga/T34&&f^^uZ$gQ;BG7/MC< %ANj"bGnAlslM3QmD_#Ql)uH^?,]AVL %SP;:[B?>SKeRf<OV!7Q%l6(]q8KB]ChBJ7/Af#;S+U=>uBudBElsB5f3HqI>7UMF`M4! 9:FJ<_t7?"=.dG3@g^iOdhlCi40=^IQ: %n18%LVN%J9pmf#jmH<!t']l&6R#uf@>qgK>JB(Lm`n:_=-*?DkoK(Y %9k&WD3X"M312A<kNHW(f_n3oS+K5_eb)"`$aXTLGXtB() %F&p$j,FAY=3no+0$W]pViZ+%d-R-0\R%R[^15CKe"8',RBFi.; [0#+AF$OXf'$'Eq$mU@m4iC.i'rsS<r(nG!4rc<Y9I@g;X"?F< %.)jN;RiFo$W[]`S`?F#W60\-l>W6IR;W0%U-R"-<AS-EsgRR6@dq$gc? 2AP.C">@1j:j>C;TI06<u#Z#;n>Yoh6I'e5f[cIKSMs< %DODFUEYV&#N9KrW)E5UA0jqHtQu8F? 0qTmf9940q(%4_alik'8oCZU([S29DB7FR81P4Ym&jD4eq/8#`F5;>L<e$521+ee522;m" %3:0Z0ece;&0$3id+Q?kF,D1NlqU.3GI?n-#4Dg@tLL"u4En;oSN7tXDe3bdQ? %Kd7FY(RBAY,Y"G&K`jBH<%c.`rT2C/p1l'K@2e %P8fq(.[Sg0M&(qeC?'8L7tije23t:53TMZ+#[kTJqIXOD>F<:*PcfZ$g@Y9.rC16>lGMma3sdEp65tb! qq6TF`*9\nj.e7IkedlZ %<\`5C%`Cb6X%.qC)hGWPJ)0ePp6=;p?!H=BArDsinbs6>DE5p)h5#fXfLgkP.gQ.g"(K/Te4gVr/Q5M^r"ZLNb=<s^l#_Xj[n/q %XMk^%-$&Dc\e"-bn^_*"r'JH^i=.,S+$Ni?UESnrbgU,Wnte!r$E%i!OgZk[>'0+7RGMtr;Hi*3[W.GhD? SK?g7F.m.=0D.i0e#+ %3b)05@NgE/X#hCe6=iM.;f2[7"K`W+md$$^0HGia#8oGT=3?ZSMsfmFZk\DbP#HE#8OW*p3bV3H13;Z5(1]!k@!\/Ghpmq@Sj71 %/=?ra6/DKZ&[ShcZoE1mLs->W"[uV)J\T.\O5aJ*LZSZ#e[;o.no`m8V[^.B3fhZ^__:`@SjP>NB#MJ6ruh-e0d_IaNNot8fDU^ %Hs=rUWM#ep:k,*\Rsq;3g7(dh(gR7+Z,E,2Ba$gJln2\6UeB]fVp*3uNGpsp%VK<^jT=%,-k+I;dL>u`r`>JboAK"(`_*m8i?6P %54^`f_:a(i$HifJ42O^RjK4mt6l"K#@A3cM3rEDaWjWbI]*!M%:gr.2r>*YVZGr<e\?Q]6e=T,UQ*AK)O? 0lXLUT0KH5m8*Cd*5s %<S_nibM,O*^9$[L"u;[=iSd!Z'_^LA_^e7+.<O?IqL-p+Z-BX67L<iK?sV'UG8mef#B&# %>)#oG\@TIc"SWg"8eu?r5h4\f9?DaV %"iG929\0:J$B6jj":N!>GC'7(1ng#/]Nelnd0o4.kMPh65%As[5[VC`#T8\:r#^G#uf+E,s&0HaJ8UQ*]L<n!`sW0*;7s2.>qhN %j(O)`:B[h'JAS!gnhK5)E_$Y[K'(H0h-2D5(u`o_%"4sQo8gT6nPI8BHO6%J8li,! 9VKG_GA7h^0s9')doA>CMCEHJ3de.Ldb6Zu %,J]/@F$=D]Qmi<nh1/Yd']sN,Y2SeP7u$TSj(tu9];Io3)Vq=i+7O3$O4YQ6jpR<]eV<r7Pt<SR>Hc3G"_AFf<-b4E%si/.u1#B %]-H/HmmD_M*7W$UVl0DHZU29Bl2i*Z=MlQsSAT9.g"hn2A(4>aeQi>"n0Rdq2&[]=SIqi? +JN4t7u$.l&Vl6mH6f^XC&<4;bH$rZ %]*GGHiXU5AE"m8N+n_Yu`uZHVGMQ;B/N=^[#1*#Lf\Gh%"ac]tn)`tDSf(uY;rQWd1$,h.l_;! oDisFCbs_X<e,;4Y12V7a80p>9 %l]Q9e6T;:0B%J,'hJg!RnWV2$klH=IrCY/JQ(rhs_h&Eed<o>KW26/?L9[FEmCrD? Np?)u`H0i2m;YWDR`"#u<\\T*BmK&AY8D4Z %V4])W*f^i$CE;9Qfg6]CWk/Z8LjP+lhiNQsOR9VdQZiKWhTjl_H_;@3%)obk-,O9Xff&fVD%=c=Hemb&@! TAo_81uZl6kD)J\m(0 %NPHm3G5nKcobU>5Rgg3CH5uA"l\N])Je),\Ts4j%DIo1EkXJ2i`Q\5<Wt:q^WQ! `#UCIf2RDap_4EQa1&UUG79j&gL&=kk>?Yf!( %)B7YDcONHT,;S(oOBLBa;5lVHl;6s;_LdTf1J70b4WaouH[`;qIFkG2lRt(]NC/lGomr11#Ba:7+^:4/ (S'8j>Xf8I[G@eC65JHk %IuNbT-W(nTm91S1F7.5S^KtPRVgF+0O,dY4Jl@pN*lPpY'n.]ZN;b3QYN=&iJQ"t17d_(/oJLEO,f9lO@? 8Vt\L3E7^%k/l\6R6' %QOH=]Z>e>dmdDu2.cSbX6XslVFO57+*u2B'86! 2U]>4#i9C,N067E]qG^Qp=#fnCF?/&Ys&Y*_k1;#C\3dG8F;i6)F^Q)VL<!fh= %>FV"`>*<]I8F$t3*j"!0>gF5>:`LQ<Ku>G!ID&/>02_ZsWFO7IKY]h,AQ@TRnG %n0h5QEq'eg:<g:)k4qM,TSNkom<"0_gbo[l9E %^gm0,c)mAN;;ho[Z?a5IJu\sJZIA")"-DQ=GgAhUf(DSCUjtt? Hon'aoc]\A"'^'OKn6%7ZSi9,\k,&[9lEC0#A*Wg59DJ#r4mSX %eAA94GQcPPCIY=Te:]tMF1l6!5Gh0Dphn55O"_KVY;"[VGS'@a? GVE1);SMTS(p""KmpNuclFB25%i]Ik08Tq.sh$9Q*4OW-2(Re %K__&K5fIkt-<A!5kc^B\gCKpon0ttR*o2[^-`0=bAA^0*DaoC'&%I+Cot*[-MOusf8JEqa]k1^2TN67a! _@X28TWbW[+\Ec=Djrs %7O,8W5nQ0kec"=r$L`:hg=WPCCd;?Ll'B<ei[r&! HK_`mOW,mcV[cneh6<*X7-;^RJ^qKfU'KD1k"SUq&$As\eT3V'iOYq18=@Y8 %9+GJ<2l/(E7GQbO9\K9e)PsX?EQaBi)&/peoj@u]E/U3Y71FlH4h=n3ZE+ $8OMYfelIWlp,>uK1]16.IoQJ[f,@(:ONQ'-J_c@.Q %M&!n.aK:?Nm`"oaE.JNM[us58!m(Se6uGT*k!6V"d$IWD5W`^ohcKGQIuZ=SWl;mj0#D3+:? k"KQf]W6k0pf+9IrDUm.j57m</72 %He:;';.%;VpEe;jQgF5:,Y<"Ap.=8KUI$DW;*YpCn<#$a+$O*r^[nu'Ii:`WCN>*=I`@*[%SnpQGV23;]4Q:G1I+uH=Xd]oN^I9 %_EWjio@tp!@-,^%)1?NGU=DLB.=Uh[CDSg@29,n;d,-4jF_RYX9O`1!h0YXi7Y4+Y]fOKKZKs:"P/N&(e\ ZitX1YR$ohJ:U6fD]%NjeAR$jF/o'0gYd`k8Bi>XEpGEGoC"&^pN=b@)i=mO9k"=sJ\6#?.+CA$b'M?nY? 04o*$23A^ep5lJ*1."^0#e$cRei$jctdQB1O %"+*(dRem.TIc\'6B<;[*L+cU7)"]:f(QjeS];_*@7-,-DLEe@O92l&`nlbd\jt[&K6(D15r&T\r#`!UJE/ #!7No3tG>kAi,*XU3' %Ntu@=++K84VLpHB86_4YWop$eJs.lOG3u&lPX^TcN8d/.`ft#.%2j5;D.4kmHQ^0.WQA(#!TDa[! curTZss:0:q6?7rPS]sU"]BW %<Re_EZ5PlH5hSb3_01N6Ue20Bp(HaE8BF#*4!&^Pb7X8,4F^%\-u5_Y?c3RLC'goEK_+EbC*US+e&F/PeS&@WYa`e)Te9/;A;bc %4POS-K-pHTccbn.AM&#2YX%W-hpBiYVo@=Xb9DA"KN35^\2q!K\;G>8d4c3&=FSVln_H^f)-aYu6!d$Z/; [e/&kBIa8*H?E^a,a< %B>Uf#_bIBMn"Jj%Kkj!MXI*ns9cr+)Jr^F<$X"+e(mXY1q_JbTY"W3o6]AHD:hl@`&i]hNRa+Gtl,e-t_cru22,o5Ia627%S4)m %Mj"!3bF+0.PM,kmmYd6,G\QO2AgPkFoG2sX1bn`SJ[R[JVJQtTY\?]0? +_SM$dpr;ZkSm9k:)]rYcQ=cfU3RULfm'+#M>QjC>@b\ %+U+(A=df!3C]PnQ7iGj1,NL>7t@OPc'K55l+<T=6k/.<[-/2:SlQshHuce`GPT0H6m(dKn_IHP"kK.53Tnr'>ud%T!N?L->'8LP %J;bI!Tt,R,mWAU6o2FZE;g%9*XYA7$<D/t-["j#ne4T68eo#UYX&;)@gHf/>]C(XFdB? AIL[n4]fEI/1;OU'c04Ous^BXTUBlDPM %"I(jS`o/t'V]gsc-=m9I?0ebB3`3;W^(&ZNo:,(P:B=s<&*fO('PkeXkVFGoX"#NkV+ZU2VmINqB1(oYJ#_]p[W9,$<VQH>#["[ %g_R%Q=?]`W>J+s>=_V9krQ"tT`A='I$6VnNoUP$5G>Rq_fN$gb2Y-Sr3E'an>-YtMUq2Iu-p,(qQ5oQRS+K@1X<S0b.sHX&qT]W %C$oo<I;&?aQp%PN3)uOph!g@rR>%Di6*G#<gWqioL+o"%@b[_TVn8&,+@d9>P?AkFk;YRc? f=g,:*.m5mH6O#D0>m<;A\XJ+@E%q %Q%FC=+>Nq)RrM\rrk3ttUX-db`kVk93tqOXa";?*'MA[F6Yl#Lo,9c^I%+e_p+aFu\/*:5EO.! >S]Uh3i:">>U@3lR4>!1#5CsK= %KEfr'_iKl'LW$B238tj@n@-^&'apmnICm)(Yn%dO"HIC`dj%g,32_s]ltFe?f9MnHNML %eWLZ0\$97^BDs$W=V913?I9F![!0J5o %`&I4oIH2t>gmQS(o]7Nl?##<G7siom(N><Fc/.)=N9#&aUhg[G<b>XdT=[-RE44jHb8IGZ! 5kR=H5mkeAc0gd3K;[8eklr7le2"( %iF(.8T"0^)=nAHNMsC`BQ1T'_8qKUZg/IJp>9`VOQ;oPen*qEOo8<kH)KYdfV`RPd`)uFA[estH\CA\dQ< OnJC"$ChU1+*'1ftnk %^kEp?an2jk"7frW@e"5+qg5E0+hc5lG<@/aFV_P,!ZOj9FG>Wn%CjjE7*!+l1.A-GY7hNc,! NB.Ju\EYa61TH1Bp\s7720rJrKc# %h^mJ5kW@PCaLN8SE_[i"-@;?&,W[es$Kj_mVi<*qj&tTi=c %5'95>>rVPbZg6W^lN^=/j':`CkPgGg(i,J*Y9q&t`"]iIBj.M<P4 %;'eRsqX_T1jNULtjWl:SnJeeqFJ=jg)la+j18`OVF#Btq9?j#_C0r=Tr8f4o(5P't/`+_! 4:l5Q>0OhEDIWdQaFm-r)Mf:nDMgq_ %G;0*O0?.K^GEV>1loCdR($MFDc=#q5R4btbmZ2UF*+J)MS7M,;?"I,Oegm;eT3OgFL)iT<\JuYR#1suZZDUebZ)8tA#LqkB'%mY %NI[jm*2Q>g7+YRt"LR%N[6\G]gGh5W[8+Nl30fBYhTKLpG-RW! ^W:,""mf\]/KJQNrGk^4G]bq9PmEMngo8jI7N(>g"o*E)>uBY8 %FI8YXX6rP$D\N*mB$]AEVbYo-YTXPmMi-,t2=M1qm1nX5brLCZdi_PQAn4?[i@.&h&D"F;(Zba?[9=g %oa7E0f\YcanUe'N]R[uW %J[#rBMB=tG3>D"t/m/=D^rq-G0.02g;^BJRj7\7$\GZeFf9:cgGZn]M.Hk\!;k*bIIf+43=? oGOLMr)n)t0IP#;Xi4`s%KRB[r`X %=ipn>8QTmc*.8c*5/$h%6@,HdG$L.?'V]*I/gqA<aaMA"+U^fZ!',DbP'b9*i=#NE0_5-^$G;(a1^]) (U,p`DY!m]S\UfeVXj/EH %85p/<A7N=6M@n+QoYKMh-rb-)F,a&[l5)q0!'Sup+\M[$Q96@&iWpiI]VPHFegfBU3V=MDor,Xri+&,? Nj(Q<onei;p[OoZlA-uJ %"=g]al+'NAgGkNp"o^WY9jth\(mIg^n)>#peI<jkXI<qhnFV5Nrh`>c&*S:l,Zu+\Cecl7#1tuP[cRT8%f],c59psP0!X5/]&B] %k"8NMX0RLE:#ptY;V?"IduD&lfV*8QtjQIf",NKFh2XlTX\L47QTdlQR_3JLF,*tmI(q"J0VAK@>O0YQYO'SFBaV U&r?c8Z]>e2 %)=2@_]s0A1HD5pM`"sA+[#HUW9fpiS<HNrh<n %PcEJ[;u[F\r8MR\:f,>&X$mc6&GHF(f`m]3k#:W;"FVX=uh/%@ckli`L9.$Wk8 %mS6`ShPqG;$b`OdH)f9'5!@[YjU"`fS'f1OX'9!nE&a6L;!ZU-7bEdhN0)Y*"b5C[p3D)81"PpUDOcT\O! n&QVcp`=/W,,6:!ha! %:N=X"88P`j;.*^Y!P^@p$bdMAe1`hAnA@+ZP^/bib?GL,R@H:$n';NBYNh^G=j&+&_;-/B_e,[1T=^HC! VU6g%j.LaaYIOb(jUgr %,grXVXo``9nDh;HRPW_cPH&k44_8tL(hB:pMp+>?F'km1OMN7miuGdm*5@>p%sNhuYn7CDnc, +@(TMbXf3Ao'!Ds'dH2i2Mj4kX( %c-CupK5Xh.GQr(bnB'3/YOeuSPgDtCZ`luEMkjr\AXeEX&]+4r3<!C'J\F65Bb0qK=+B''I*a5=FLo %0=aVeX[ei$;2\4RVFa.Lc %NfGtSOMrd;Rb]Ere3GOWA%]$8m[]&0\(5qOQlA\!Bt*2@\-.! T6mSBu[0>Ch<)8j'IrUI44q'+hHf_:W\6XUN*.l(l1p&fXqRi&a %DtD[s!J*jXJWT.=.ut:Z/Gg>j)Qml.'*Ar`HkBXeOW^&9f,WHd&I:GK2;P,eJ)1TEp_u"<6>o^ZSu %DdI`?!3Um(H;TfT@]Vuepi %(Nuh'lX>T<.+&F]e/!Ge0j;,0li5/b]Cfj#**7a\!r*l&70*(UHMr;<Co0J!0Y%9oV%JGX!a0>rZ`%[Q]_ %rurPgQRB'p9$A[.[t %eoF3!0VE+@l(<aA]=D4.Gu.;2VHuM>>Nle<#fs`FL2lm*$(FmG?FUk0cM:pk7Wf7_[QM028PR$Dcrt:R0@/'.U)O!bVkc\BaMs\ %1FrIs9_C+8"K!eFpWDFG4A%Y9Rb_aP@'Mi.JN;bXeuHRqPj6NsQ^KJZ"CfB];b_7rb4r=inBG>SM3?r! QRepCI#USg,c8As_ihoM %ksO:4ii_T,=n'HoeJ"`FgfE+&YHk;f_s/PcLo6NJkiZXqfoj$:bP!;429YaJD! XZuC_f*;rjIB5*pi:nZ59Z4a,Hr'mDCIoOVP<f %I-t^PD<tEe_f@\.R[05aOL,](GbV^TLJhRh>?8:G#HUTVr*6\SXhBX0[2Gd6nleDeP:1<q,t^6ArFF) $8"Oh`[;9]]$#9%lS?NtI %ag)ulj+6kAfkaqcIA"LS`o,<CWI7-5&F[0=>I4_bL!s-fna>HAH?GkB[**Ct-45gOP.)NIX(Eln;@d=*? mWJ0^1_R6ObT.X$@M7# %.=3dQor+^JKs.SpmJ?]-*h]ui1fOeg/JA^DHYlX4]q=P'X0u_G4@(XT(A)UPnOi-"q(sE*5gHC5;tQ@nW+IGI9@ph%I5TGI]"U: %%Pu%lETREgqf'hME3/5(VKlK-7Zt-P\W?6Iq[[rJUVT+e]sp]X%$ar-Hl^*(ao;8pmn$rnCfQ/FdaZ_bO`#dkqV,#/.5:LTAWm* %o@Sg)R$:Tq8jM-\_2>[W[6e=ZW%a,Xb$2[g>2.C<ii4a].\jYsQHa(a!eIMZ'@a?=1EpIV+Jo"+d($s&X`8?-(p5j/KPDLA3Ws. %<6ludW*'%blC@RI^$c4l)Z>nHiT@18L'A69Zl(,R<8$]-'B"g=F9I]JEGgT2,<=QDdlb"(0bSo %)clq(FpGT<n"Mtn+qe/]<'qlD %kCmK;;5Job\#"EAiXPpBTLS:39ouZsOmPGmiKlL/6&$ $N6_rMqdE6jriar,uV86F$p<HcK(K=bR_ihdmIrBNJOGh%N)B*-!VMf-I %-ZlC0fhn)j"e@6gSkF%Dcd$oeW5HQ/9rn#eY//<0bo5hVK0t`"7t+m[;R3,i[Rm033J#]9o1&jN"=AE&;uG@f3)T3&Q,q<&p'dX %[G#b3GbD4jkI*<M1E%Ok8o?L:`O7&A7shkD[@F%1.`N)\FMGt0Lcj7j=:1jhH/kfdVfd@Y? BiUkWOm;j`eheYBtBmj_b*Ku[*#)c %Wm7eWYR<(,D)_@%>="$T5mN$dYc@3N@FuVpo714"? 7?,4o59;B7$BdRGGoVLgmj44(EEEei<]2A0Gd#l2pRBJB;U;M/MKOH1b8/L %h*:<G7l'V7"lLo*B/<]! BH;i[HE</U,h5b00`1:YO'WC6e2doh=Y56WpK`:JWj8n&p$B[$4dj&]>c116[ZY$pQ!G+=,q^a.g)]j/ %8g@Bbppu3FNRFq^++2@ZX9m,63W4o1mQ4Xm[hYiLg1WPo!J\"8i-8kE[.>3S:JoR_q1rO)RrQJ! at9&G]I*$ka3tnkY[(U!r:>5( %RY!Mu,7KWcUJ>>gLlc7Y\6o4nN<f*q=3X&:>JroP4"LXl?2l3)N]=VF/%(*[f2jX@jQPIs&Ij"r&? g"#8eHPE;9.b&Efha--_-k) %hm5GXdp)C7fIN820@.]8Hfi6)F;IGH+i*'Rf)ESpg,''s_kh(b&8umhSF[EAqnD@A,m,? E$doVeN";)f4r4+0(TmmB71C?1BLXG, %Cc72R)dFVL_Qs7J)U=CF1J1R-H<2Sg0T"=oiY;NUPk3Ma6kH;8H\UIk]U26&s()Sr7$ZP#dB3^A1,X\f)0+h7@Wds/?@TGaHs'c %RT7?u2+"Z1R.8b\@T&"5Q0H`4aepF-f>_Dt5t>J7Rj]B:d"H'Ia<P?-[Z$[O][U+2_O'WDW#pn45M9L! h"kuqW@Xr%\`:j5IruV3 %(dc`=Yc(Pb-;%MDj;kn4Ba<7`R>0/pB?q)'0A#m[cau:sms6r]ZWkcl>@uLBB;<Xnb&?_4"Y// [k@Zrm1;03-ZmK%Z;>7V9NgmT4 %$l(C?5&9lq?9uEeU\tPbfn/Z@7.Cp[7PbSb\*`nd*o(X>/9Sg_YC9SN4W=i*U)V7oaA.$b/;/J.ACc? C$C^3@)pp`b5OSu\?3(A" %T'9)JeY1j*#B)l/2/\%<Hj,:9B#=o:,? _]@/h[K`l>RO*nZr/n]J>[p>I@7+UVrjrh8s8hX<]I2R;akt4L7F38Bc>o!BhE=aIuK0 %Ae159$q1V"YNDoT2&$i39NNad1AhInelX5nV8X^)n4dQ_>/Yed30B*Zb[%,BeSL,0B'h.>]g;Q5nS:cd7%muQ1%l,ASS=]^O9j> %?&Md,+Uf*^^,>B#f"g:R#*5\$c,V>s-&/+fq)H>-MH3Nni.kD_LLgCP%:6H^?@X#]cU.$=*#:l\E;L[A2rqH-O;O6*K*rrH!BQh %'bi4<eg1L^*Ych8,bo.N,^HM? nAHC[Zdi'qA_CPp4$VkOaiV@UJrB$n$FYIrO+qU$>k59oU5Wsro6iD[JYj0sYtdHcXSAck+MPA5 %4<Qs!r.AYmS=mqBYH<h;(H*OYL9Y-i1"DRbO1rIU+2QHOJbg4T5nNr\AG51!,2iR@$`(X5Lr"bideQc.; [jI-pA<P,/A)#ckZ0," %#Y]6']3j.OX%j/&"]RPo,8X=#RqI@5F_IB#bfs_FNXRa`&NL"j5!egQ"c.t\C!YlG9sUK1a@g"g? [te[Q6:J?O;6;'LJ\1o(cJ`= %2tnes-_')cK>*S_]jlK62S^PGc\fXJ4Mej%=C/Nh=hte_&sGr^R=-HYCqu[Kk/g%Weh[I+hH)\9HA! f@6Y)Ntr1f]jd3L=C>M2Zg %J=!(sg(R=!mYAU!HQ;?,NuMogdH&_Ie_Xe9/C/*GpY+&6dF&YdiZdt.YQ[!ph0b<;mdePQ %/1K!/NZCcHMs2uNM@b%fj(^pYu`XH %%HOj,9qYF8Hp]eGkg/#-nscP#? %7=dY52dRma@\DdP)./1Sq:M2MR0]NU*,6I&8hgL/\7fS)tIV4psDs^#$q*Rb.p[U%\<+I'(a: %jJsCThBN,Rg+fc'^]pSLn>T$EX=3>gREb->rcCRjQtdMo6&Q'Y#QPgNPj@[3-Re*1V`s[ea^EM_Zq %bsc*bAn9I-Y(?UbN><[l;Z %/M8JomE,^G(-#EO^#Obc#7B=_SSoZeU94IkclVjOYsD/B<*Je[!P;@/rk4[(++D4H]f$l'.A7JM$61T0)MQ@H$m(KET_0EMRB.r %0r9S=LmiN3]-TK6:4#$?@\C>92d?^3ABn/^D]jk(^Mf%,n!\CY"Nf4A^Xfb#7DTO'"de=Soa"Q$@)WP7Hb)e,=H7!Y$DCR#S:In %?Je6ME'BoB'+qJHg8/ahRoZ5KKd^5D(6NBG>)k-i-to%\is=66E3T-]cCaeBD %"TSki2S@\p,Mr7*6PsZ8M1;8B"q/lq8c<[C2MT %g0=JAA@"dJ(<F3%Js'eq3$Ys6@le/d"PjEA[HD<'^-gdiR$A,D %n/sSRuq(%<m"m^.1uA2g2bm;kG;PJN.Hth7=dNr!/%gQa3&qL %iQU/Kig90QZF07fqD4sNa2b!EL_<),hN48X-`C<T?:M%)4qA.qGFta$##a]$L4IcUD %f(bh@eJGNGY]7QROcb\K8rtiWN+)KQ9A; %314nH`GGT6d(Z9M:?rhPRe?%V;GXH+l'e_2OUp0U<'k(]$rGW!UrBRbc0Mk]EO(F>Qi==a=V"r#C^@Q2B.sd2ud-'-?qub0Mf'H %lD+F$"R/.,<E$T=+Y,ZsS=upOF^(tARt;,f@R;M\1i6XTFXgb82HK<djO^IbGpC261_6EpT(GrA6D6\:=_V8&r1YBm:r#'9A%#a %if"Ok!an8='nVR=Qlud!oZRfmgQbPo=Hj(JZtb#FYo[W6/4)R9a'S*h"g3D;$W/Z! A>BojEeYbZ)gP$gq[cDUe!bApOq+_%KVi%a %EA\14?T1^UC[VqPD&V/_BM8DG[Q;u'f\jm`S8t<arINKTUQfSF.6@o?m\4>hHaO3cBFj#-5C'I/^_aAnNDtcA"bjGIj2ga**j^_ %p4Zd:[Fl$VNj&XSSP[Cne#[u*&]WRf\e8e>Grl5k%%b&`cQ).:,<m3$c6/p3DNI?rIm,<-@-PgWj/Ghl, [+'Q"eF6sfh_JS='=lU %(I&TU/9WU8#0oR^mDC;Thu]J<&A.aZ45bj;VA\Cn5qbVFgq9Vo-[cOD.j6N&0r! `u:#:5m0'^cncneN4*_c2'jr^lZ\7b26>Hg%g %;6l6\n`R%-B4sE&Jq/7jgpG'5`1[oql\OkL5R\j+Au^CHdf*G-+V:Kl.YnA"[(K,V):7rK?g`O\ $0g,MB3\-or?Lqo,$rYsd]CoV %Cu64''TM2t)kOe=JQdA5Qh("i,A67#Nod/&k@onks5TZOPJ$! s@ZTlK(;spLVUim6ZeG0:iVP*CZb5fXTolDS_K4b<6nD9X;L7\2 %:n1HN(GLO*a0WGW.bF+r0%><;M;5WO:Tl<6E;=FbkDaC6hn,5U0uf.OHll])F5tY1Dp; +.'d.KIlDmtl5e&:cEgZ0u/Gcg%q`J4f %.&427^7nWN&QC(f^oNiW@1m]*Y;:591lY6+`b3$]-O",kL$KPd! ^^XcGpoWV/Wc'p9KSq"WSTJ0c[bMT;EM98FT*2iXJKC"S(TJs %K-^7Vfr#^9>:pKFF$"//2^WolM&`?j=2+$Rdap\PHsF_H!Im)TRiZt1PYt1t(2! Gpl,bh\NkokB<[J*WEf"?r0n_1EeQTNsdg4uS %MQ2#3b/,9L1rHZID3C_sA$EST9EDnXh-6HR?$]9uDbG@1HL!;'TCcslP\`XCN[2PGY+L?4$Xpf>:H$ %`DhIH/:;k?(hYQ!=qteT. %Vjk/9]BK.EC:gh5cfT"B3rO@nZd#Y*2>.!s'&NC&@;f#gB?_lN\_:7jEE/6*HAbC[_Y! 08BeV;7+0BAO)j0^`^4nTF86*LsN19e5 %g4X`<bq@m9Np`T(krWtj5M[^6cVaE`+H+G22ngs(XZ$l<+FRVVMpY&\qeD_kFFdeK^<cBhh<'"CP@t/H3X kDg%O0eo\A/,?mKg0. %fVi)8*MK)(5&"lcURul0kOXlu9Mu!HEBZqqh2@Brom?7O-,<RuokA+dVpJ%8O*4Y8)\.0/+Q;EM,`N:! F#P..PWi/0lb&)(5sK70 %/+afs':XWAgt`bl_,"cFK1]Wg^(2S^>5fdh!GN/"5W7881+P(Zo?KrH]pc>8Qr]2!?>Xh4&.o>Cf=U51mBPl[uW.R>s]ObKi"*d %Y%Jn%/UoctpMedoX'S3VSO:*,k.9,8F$)HlAZ[-A2ZTJqCjUP58.5n8BmV;!9m!0dmo6b^i)eD7=^@(^W %V+_DJ,VIL^c@!6Bo.' %7gJ8d]6a*@5_)k#+M]@kpS1FbXqdZ6VXth %DWI5<;dAe3A`bX^BhU@1*;;*R6A_9;UbNS^#TmhJ+/)]S'mQAH@9G'hKUaKQf$M]C %3tHf?$S2#hhtsbp/"m3]rf^/C]0h#$Df^TS3:$:@6%O;#N$GD)21G#3'msFeIG2W1"k'NNDP-Y#b4moE-? I_#]G6UW"_CUS+eke$ %&;W\oQ'\"*B[T!g;Y5:YX(*^No7^KS`^C$_1-&J,4D!TX+PO,M!HBeC"f`^C.oB,"jR8qjp9^j0d,Op@N0]C)IFRo<)CZ=p^o3Z %)/A<7a;LA\Zbffe,&a;\%'.R0!Y"L,X)s[2IXi*)mu9M](?lRnR.^A.hfn%]eN#'I)qt_ugkAZ'OrhrQ %"E'[D#NedfL^lZc7K\' %?pS3ZPDE(gV]H%l2"OqX;Q?l;([M@"-hQQ%C"q(4kNt.j$-g@4pehbJ7#?DrO*n5NB! 1qLhaBE2Er#@^b22pB)`4^h\!XjXH39VG %W0N-),WDGhV(Y#Y$jN&O.-8e\Z$Yo.dabDK`ZaCG:@aJk! f`p2a`@OnSVX&h*;\qCGKgO4\l>j`0e+s`nKC0I>^RD;2*dZsORI/" %i*%QZQ>2+H3%7_cJ.cY)O]$;d1C,PFr0h.5/$W_!'p@VqgUm&d8`U<Lg5?r9r`t^tHd8EY[[GLB-3n5CM/2<*:F^p'5Doh8V:1U %.g][f80=XfYB]9>Wh:arcaKjJfe-0Q3Q@ekXM5V-HW2< %)NtGiK'N&0&A=<oK*T4i_&#OI(>'dqj<tD;1+PuJ7^,T/@a6p3bZ^Y* %T-E5I'a]eVNki'/;<h'B`\\_K5QXK>P]AMe_r63^7f\kB<Yh]T0Q5UKV#374+ZBpA+t&">*e(O^S4=i1'FBqAi(R6A#m3S'q/K! %b#p`\A[U)Q%7^BYAgb&6d^5)&I[UG=[VZ]I5Qdg,E6eO&CP+uTD[h#J9&TBXMnD6TeOOm\lM9.nT`lr&iJ!-V\Rkp-jVZ5<so7M %*Q:0u%ori+K,A]#%Uq2]=3RoO=qC&q6n:XLe*:)ZWBip4Kc[nDg2%WEO<LJ0DqV3K$s! g:!;JEJ.=&1HgGGbS83?9NJ\^B>gJH)A %B[TO!^Y=NdmE<I5/nQ?&*0'+m:$AUQ[7QLS\cpJ]Y&d3jG`lc^m/ $h8V3\s`YH:WcKArkLRG]'TC)eD#<<\A47CGPAPD9`k(mJ>> %dJ[GdFB-Npq%q.;5Za8X8-J.K\;<Im>_e<j&?B*MkCC$?'m(,)`GGU2n=I\S5o[Jn!9! An*F.:Rn$LTU>40P2,np$e"99kS/m#3e %*_lJrn?"+anoJVm>?QN)5Xb1IjM]^VK*WQ4.Q9!<MC%qJ=K;Y>Tq1MtL'kOP(i>OKS_bn#Pt'c@'ATJV6\ ^OD5.T,3K\s#".t(;F %^S,E)g)r_R&lh(ZB_&0E!]W1ddr#S;/WsZK:!o1*=D_[_@8<F*`e5Pa? q`J`Q<C30>HXWXb;I\0j=S/j*c,.1WBmjq_+\k0Djq3s %!_i394uLi7DX8/f7'6$/U^k)C^884PA<E4"*HW]eRJnu<`<r'6)W)=4W\1qs&dk0nLOn76BS/f6Y? %C+EF6OdX-Cjn"oB?GV;1;B %9-M5S`Df5e??JF=A?oOh/9iVn.0X%)T%'_D^"fDgdgS70^c,3(Uk(#q^.<[Tbc7f;K\!bNpJbYJ<ne\=A$:<pA6kLp;O`_8sI4@ %6n.G$i^h=I_,.>)ITVIbSeY@lk8'Q<`6"R*?ei$kFos'ZQB:7_6quFlUaKj+oQ %Y[^rPSA<O<(PPPtGLDo7/3!kuoLBNF_iS7YO) %j7G8IB=Kh:FEQ2cEB$:um8l5Y;^o5*ka1ub=[^,f+H9/iIV`=6UN)-RWOt1d.QkhXm5U<!_p-9k[igYY8"Man:fr7.6F,d>-eZ= %O@N#F:%Csp:A4Q:J(=40?UCcm1j4R2nlSa?2S@J%BA1UuQJ82R'UO+k:=M$W9>TfQ*)"1Q*^]+UfIRDr %`Z1"fpQKp`ceIb^Clro %I("XF2/.0=R$It]\cc&0NMS,BElOABXi/)P"&c3gnpG-G\"6$hnQ4(MbEg$aW? S4)f]qc]EHqKUUbtC"hqAQLf>7qt0<aWudPJSM %47/<_]:ZWp1<7i3M:e;VhM?&)YOl_uG(%K- D?:e\k368FcgTT5pAbq7d'TFj#?-/nMWHA;R4Yga_^=KeQ4iAfV6epp;%q4"/;Tbd %67-C*qeZWJ%pAc4r@fseFKhSRqu)b^bAKY<\0*DTB;:f%1H51B^\iZaeVol*V)(A5D1#qBn_<U+R=b_ %"D0IAGLs[YK[ii)S.*b%2ui61R,ojsDHo!03>HLgqsE!d.8ZfSpVBPqY>nMe#+?#:L]#8jJ<?"!jdq>eK@8#*_B77ZU? NNMUUJ9ahbK%_J&<P?(!fLmr>GD1 %il*ja-&Z[>E`E7,r-TknCB/UIjY])sH/nOO5s(<;\.sm!Y5u&QX8K4Rk#Jf5e[K%8&^KuskpW=! (5cK!/pfcW;Ot"Pai-%@-p+Sc %1V7&(#OjTZ.=QnL1.%"l#1%bl45@R.09Fj"N"nF4p2rkP+[6tHp07C6!iJ],EbR1.6#(Y5-P= %^_&*K#jkKC3"RPBL=G)gPTpI'Q %H-M\%Q*']?!Bk`tQk;9spq]#e^2U;6TXXN.5OI3R\Lc^AO6.)@Huf0)>:I#rRdq/LbC(F6K#]fD:#! %F,nEa=S+:qtR.GD\,LY_8 %7o,8h+0GS1n*WX!n[iT5e^d.R6C7Q:kPIBFd;>I.Ib.5-F]6FiXtkN#^?Th1Y+nF&Bm)A\c@[nTFj!L,? c-+:j/rFN+3D+4MtT!V %\1DTo7;FN(;@?8BA('_^\B=rf]K"qGjd5g<?aj4Qm#mucM9k"TH0[L%+R7YKM@5!7Y)% +pNIB,BNZ'=Xcu7CG]fm6Eg<:2E1its@ %TOfKC*/mo',(".k3;Mc>Ae"F%dUb+L2UHRIDgZ'+-XNNP&@p[O7[FnL-gLo6lFkQ)d=+.^0j=]!r%k[H? A;S9]2K!B'DZm`4-[h%bmqH5oU>BjDX2TB4H[TrH9(hU7pKmN(Rn=\pBmgh1kP0iGfp4Yls`;Y/#1XHg>Q`pRQIt^kU*Rd`"1GCh\ G?DPeOfRc4B%Hp.i.b %%)mgYg<)TT394T4%,TB0kY33>'IN=_'GJaECfU,Q %5]/)'6`_"j'H9'T+_OYG];N>.uo)iK1t];3RZFDWj<ZS$43DD_lRuYP/ih/ %p]EX>A\WI]5p=S2Y1l.Qog[\Y[DVo_H2e&?2oVU0S;4kepbLC,UVB[_&gM\2YT02kJtKT]Ts0]P$njF(SaV>lr+)n/qq;NG*aV' %T[_e!j&a4`gHi4]_>XA8=\85l(;1N66%RApl(3&ooX_p]UL1!'B/quI"XAuoq-=&%jh;ufX+ %^<@&uZ-)R"S0k)0Q^V/R]ddml5\ %fJm5(G&R!ZQ?_XX[&<M[P/;*T`V-j#jimfT5YH`&%2tFoi2oBgCsnfg3jJ!EVqBe#hCHMub5/7XCONE1j6m^f8d&#/VK6Loh@]C %R4u:6BQ;tkZc?1)%,u78^+ZotPZQJK:u]Vchs'R*">6TXok_$4[p/RG=p9Mhnat8E(d3W! O0g=VnM#pL/o&3gm+nl2!XM(plnIl) %%(Dl+fb`5N;/R!+[Wub7cu? f"UU\PHa_Hmh7m+OAc!.7)VI&$G^:5(eqdl&UdDJSX*_c.EYJc&P_9V`#NfGdE[t=7qjn.3[]%OuZ %g<L=ko]N8#=PIfn_$=%`/9mZ=P5hh:FNV@+? S3/7YFJ1g;ipQ6riL;RJ#KN^Al$ZJkb+,O[r:AS(f)@62Xq_>*,15ZK_DkFAUJ<P %4;2ueH8^GRF)'rrhUZ#'-F'AsdkWKMm_6-=cU':NdOHd>,]lsS(=O?7J*XCbA_4FgPaNJ@XE)A#1l5ngTUkM#>.2.q:]9ZKmqcY %I[[Z^QHsD^Dh!=aS(kf`o`,f-[1.V>/@0_<+H2+AinWV@Mp_F7?=Th\V.6"ir5q-/hDbPoYe:F! 9l_BrMpDb1Q%#=e9CGFBluFso %?AqRZaid&V&!u5I"$5hC2tl@]0l=\;FK.at6j)NB2>GMZS8$a4I %0k)7B#E?/QkjILgfml)T.qXn+r8'^+Ad$K;]8aS)iPPDk._[ %8Lir`JdR)G,>S=`BasIO(%DHHc'f6nLnCe;l)l2J4K><RHT2$$E11TJb!FL]`A:-fUFC(_>lA$4<4W8,%tqtfb-r9<kKTU5<Le\ %Brr$aYd/H\5iou8ZEG%#\AJ(%HNfl1rLUrR&>a9%CWL0^JaI7:^XYI:Sk1'g5<:Bas3/G@Fu$md=1E! Za$os&)33mb9.=W,Q68gZ %rTqQ%@WWs=`X>@!G)*&kCT]fea%ahDCXie;QQ!bmm]gV_Ir5G^bN3M(V*qF`8#I3^NV_Ng2VQOIVVloX_U9Z,te,mE1gb9nSG60 %@"1pa%SV%,Geh/)gn>B22kH/lqj.;Ks8M,@riWp\M"ghR5eQtZrm9/dOQG+[WgpkH(.n^5@;Lani49*W6b#QI80>#-P3qO?U0+o %`-t/'qXMPg"!U_/;>\-7ghF5e5u[Y4#3eq(OjWa'Ke@ml3^`STB+$1T'%%eiE1:OY,ZFPm/s-; (Y9\R2+h!e0/4gu?++1r'A2Tg1 %N8E9$97^U+d5kt#$Wf.7K:]L<B^Z._&)+CagA`eDSO$:rW:\cqY0'p2LU_bkPbsO %.N?/B.^Ml(lF;hu_qI>ol:\X7_-=5o.8U;> %Kitkg?nV>nX[+h+S>15?dM`uHL).jhS==YG!,RRsgcF%sg00XOUJ6)A_V:[aM5ocjN1m=OcpP/%? qjk.K37MVin@RBAm?cC%6@Fq %8V-5P06c-f1XJe%H`DJr!D,GVT9m@@I>Yl-n''V7-:3:ZV/1B7lk! G>nDuV\M1sX`Y8Dn5ZXZ2Md?!?"]PPmOm+bDS!oCW9Y?&a0 %0CaV6*ba.jl'7gj/J2JpRqi!\S]'%1.7qo?KNPV/V_f"ZIa_sn0S6_(c.[FSOBgX^(]"2H"c_oM&Y! pt!]F9Leh!6VJH3pWX`j%; %5\6rI90/G\JnFm'NLdF2+Ri*@B+Gn\.1YA&NK %U\DRN>@Di_>ld9]4+34@,@&rbp8mtIBqX7ol<mWjH]fnR1BKqoWa]cegpCE_U! %e3E/9Na&"$..r?^Une$2`^4-,`HitY %jKBP$J7l`58RpCCEk9<dMH]'$^.`B]pQo&[L2Z&ITGBe"YCF9FHGAQTL/+O%\nFi<bOVs %<-a@=.BO@h/t%\M,L5/lF=]2XS&p+r8.$PF.'J! LOk/TQ/>YWfq$DJTEoJ9k]0MSN<He0P*e>0+F@I$a;Xb,EhJ@47f,5`pb<n?? %EJ@jCHl0PFc&a=Zd3L_qIW7rM6tt\Z/7X0;N""Ck!+!9Z%B8F,_7"@D3+FAl#4>;E[m=pM26+;B:IR_9qf-t=n6>BpZ.O1=D&uX %"ltM.^/qg3_jT#VafBLjo,.o#h`/N\-)>;!;W4l2`+*S@XE8C;WiZHtHYohai&p#8>Kcf=G. $c4C>]<o>W*9;RZcEd4]Y_/ZdD5( %Tqb??H&8qrLl^!a_V3`[mF!#=[K.P8[J+Yd=:TUU[i'qn!g]E<8t/"q!8)fmP^+QY*tb2F[jCOWd\P! C&pqhJc<>$poepKg-tEko %X"9/WPE5FR6+]BN?m/Y0?-1sr),dS3+4CJh@5g4uicMGi#+q<>>btbdkK2;:HfBYK>\iPPK%Z! <$Z;4c8<\1F>-l%Noe<V$Wu@No %m5d",(M/;beN*L`Oj`Ci,7>onR^ci<C7tO/k/1%8J&W[lFa+\8##cOe0_E.F0Vn6VBnAlX4aX[R]\JVCpG9$7koIp?/LIAXIqVd %XP'IufBejApkb2"[<m.*:"bsT0;l'ka4W-oFCfW1poSGEc)M+E6nOj1+#C"Af^o9tF.l"l2KK(?97o4XT! f.fJ`$q"=%+_U8RR80 %TCOgJj7VWi7[$J)r`?EPoVVTc,'78BFVQZ!LuO/aqRd['%6A?<'!#aGR`_Nrm>kj/oU:? R^^-/q8BJ*nC>'C7Ztce8f<#@m3d7tt %e3RXAKdu'JM&`FnDq*"#c[^*QA%A^"/MG(N.YeSgE>&b!^4m=Yi2Ig7<o>E?g78^@]9<AK*Cq1gWhFJ8Fm9C(=g,id`nlKIkL#J %omZ/4_ZtD>\6,-m38[m\-Fd&B<@(N$.$Y<\`6mKVT%V)N_7S2\)Z+L%:TWKjEZ]b_lWc.C %e2]7G._akTh8N-Oe\`Y>ok\n$UbUT %mHu[nl>-15$6F$;_sP..Khie\b:3=V%DEq+LPPW3PE)'sYeK,:Z\X9B;mC+?N9hN5%Hhlkdm+W^gM^j\ ["F-an7X)-VXIQBMYePb %$#o/<Kq5#mY'$*:EM,IKXJ's4d2KLVi?FD,#%0p"0`tN%G0Onn$U\KEVLdS4bt.SaWB"NJ5A(%f1\R[3J^&m?A,7'[!f_&f(X_J %;J"o;qWl]B<n]g-NBk4P@`Vo8g>'V7$#=%G8Hg-$h\M,;NBVKW@! X^E9rgV\TQephe81&CY4^joa]r-;VfWK:#r7ts*Rr"%NnP%I %HY$YLS\;3A@RD&@ZRL"4cC!</Lf!rW`V#gklu8$F?\H\QB*e8BA_=+8=^`Qd3hArd.-,7]iBZ-gofT%L; %]A8eNYnCepapD%.*!U %fV=:D9l!CmBcg"HiQUWA$_!C./(I-pg=!)^3KQ/l(/;1aKU?'>!hu,@"]neWH&IG!.<D+[os&(l<qEuie:jTi/;:U'#isUpD@]Q %6OhS.1b8ET^EG&tj(?eIfm*/Ah%sX(KsN+:1t'^TZuA.^FHb(!"g*a)VPu"`;SZpcc=rruWfaeeAi/! 87d8LHPqDDKCgoK.kr:2_ %ioCKrWdQ$#p6TCG<[G1l4btJFXnQQefZH6t^P%UQf&++VZXct %k536c'B!/eFOc>DZ57@3eZFdA/IRJt*OsXhYJB$RHs<>:&e:lu %3&m<mKKEe+Z!?*dK@J>h$,fM9,"8S70+!ab(4N7Il5-,QJQkL&=g5_*(Ach1aoeoZKKtXFB./t,^]*o9'[UB9sG@Y5Z4:uGo&(3 %KDkasm,L*5qu);.IJ?s+H%:!r`1QYr5W`R32jgt#IP9PD=eZJhKmYYZ+g%'0? jB/"c$oL8%0VDc@`gl#;g`/IR#R`7g8Wd7=Zarb %V/ZUaE4Y@6r8q6OBUkcchESDl[aH]n0c/-;cqP+E"P4:;"S35:pNEJGOt'b\CP#I/*+Q&YhpA.Oe`&+Af> bn($FR:\`]!5')n)$9 %rles$!P\922E1rjE_L1dB/.P"<&Jocjic=8]btog\0g<3=2R3Qs4pqi+Zb0iDZbDQhEQ%nHn%#L: [m^9mM5>WX\buf\SPT3'\jZ] %1V56nc+l3Ekj7%Qp&aX4+A+V1ZX(f+_`SlMoql:0f$+Y&B! =3f1,O4W>UEgli_pHb+3LH>DOE*;GGP8LO`qjAnVsO.;Z[,Gc%Z.E %VAIafi8?is'G!b3?[p7$3uZrd$b(VNh>q<XOG]>Pp4$Mlbf?OgYk7JS'-\?7"8n3Ip^Et;*? #Z+jg_Vr';)Ffo`+)En72_t1DpoJ %Y0G;FJIpI%pQPk\ia<#DDA*7:>'L<H`'MV/`4/3k-KK&a&:m6.ntjC+8a=P(!2RP!at+m"3cl)>@Yu>o\M %"!c45.IDRd]+9B33I %0o<WH<*SGJc.hQcZ4AEU8LAk"B0]h!cUrNALu<nhFVm"%?(jMO<sXd38Rj2X%!4QL#rk)<eb\scYY*ZZ-'mBria,gp>Uo1l/9A< %Ks$mBU+8YOL_$A^8m]fJ/k#&*_PO9G)b/*3Fd5OZs"hf]:lZc!RRt#ZeQ[4DMh %"A#(6ps(J'tZg.=P<`kL"Hf`qB7BHC.WqiibY %E7Bbu05+%Z0+uJn3PgJg03r$I6.$<KTpm26K_$JP%D\i>TA%M\?<jDI>YEXIrF98u0KdB!`"Bd42>F%J; (mG1;MPu"q-?in;j#uJ %qO.Cie#V\lLE5'08FaBoP=*j&_tK3@Uh[ZOcNSXcd.%%bFN9\9;@;utHElS.POJSQI0D?'U3)P8GS%.? @;KAd/3_<gk1HC4/%X5u %*&OJ1OWoj;n3AhN%i/'C9l/a^eRH0HC+PUJ33FAJHW:P'N%Aa3XT>LQM)?1M9L^mp'NjVP=Y+[I<- QRe:GqfJeuD=s_":Ve5u<Kr %#Rja`,%M*FZ8b$bHFtS<UM->o8,?knM^"BgWN7B8c3c9_ %>pk]9A,So3Xq<45RMG8BaO"ein/gTnp;muUXI(j.Del4NYGeugR\[V %H>+?U392U1AsAcIP+K\qIdtQ2(uG5[s7l!Mhu3? 9IuN@BLL7gok1>+Xp6Y5spT'qdk*pQJ^]*=RQb6]CnHDhf33\MEfXiTY^nCj1 %4opd4*6+?_Wj-t`n=UC#%T-,VEb*_3(kf2@3B3#too,9C4QccsmLEhO&ndULfTKOZV.=Me[K/KNBl;:js/ 9/VKK]s5c9b$^3GHZW %r6heL6\DM=([$ko8H_j_)J\:)bs2lFqnuTg#DJ8c)OPQmb]Au; [b^'lJW,p1UuHr;KL<\:M5XP.3$jH"+DC:I#s?#npHSUR&>K68 %k$U0U<T-.t&Rc71Bl1p7cm1S10r0Sc#YZs?F;mh/ZN[;=;F2fB04A;.UT/]1)X8%.]qKk=)d%er? p_'@&<iXss'3ag>a\>$@F;@b %KmXhpb(*uV`nVBO?e'8QED*f)OPosN[%Kf'`QTR+BU-`V8Kh/(P3/o"[t;8BGrD[7(i]W4Bbd"/'% +V4S@4kC03$W'[TJsORdPfJ %Q\md'WKW3PYWPSl/`Ls2LC^TTcU[3#<3qM$0+e__`M0KTD/,M"''E0-) +PJ,EgZ(QoSl_.27u]2BD`(F_2ZNp#8,+b^?a7ulm0-L %9nh8oVcZ8YlIol=,c\^oX(s7`FuO`ZL2o_9^S!9l_c@m:j_[. %iQ`P2Z>l]sa&Z5@eU&QSdsVq0d*2V3DoNL=8kR(-A<eP>Jl"Oc %d?Tf'lsYe\,u;dk_r$5Y$^_@*_"q^a#gB[ep@hNT$_"L\><m*NY`PhJ1jTL<;;&b'I %R+3Dc@F8Btl"jmKX?'k!g#6MsrD9:F\uU %*.E,_;piEPC<h5,/FcVI&u+t_-%jfaKhEhNnA.D]6>3'pg0JJ8KT9&#?G+:IUZa%%92K: +c=r'BFUMJ]:@a9DTBSK8Gd0+->4A2; %,;8c'UQ6GZ^l2$S3L4<Trgi^n'rt]ZV4hXlV)sF;"M!FLOXB_cO/NZu`q!%dUVBe*\u#C_0-DaP %9MEM\4;@M-e$sY:!_!Q$<)D0 %3Y^hLGq\Duip)QIFUh?EMG=Q*#W@jL#F'[cgjqq"<0on$6U]Mq\k3&c<P2p!@j`94MTq6Y`K-17Ac6<! R]p"R^)u_Cs8GKS?$gX^ %pg(O9`BVEj7XQSal`.(Ap?EtSRO(>to9g*;:-=BZkBUC/n+.YF4hgdu/FHqI\m!-eo%+et8F"hfmV %`YcPIg%eJaMG/5^^>"q@8^ %UfHkqPu`8H#D5I98f.NW6(dF(<8q=P9I8CK9@/'kf>JoQkXthH4aVrTRX>UGffK?b0:MIImMUW'2)8[P15<e'L<N8nYXlKl"n20 %YI"dmG@r?3d9M=.^"Th0I23,k'rGm5X?DI+%$T.J462qk+WcK5+Ra^0863"PV[!g9GP#<peK!s$E])H %(7@-L[_QGqlh/Si*!TmE %!*`b\5NiklMONEF7#O!:?j^I_YN2Xl^_b=s.[3U95GX3,?]Si/<5'4F.ubhu<`HDNUf0'$ (SRF'],Bj3oT+XG>W-OeC)CK9P[&HF %Uo@&9B9##tU0`S/9jj@Yi:tgk/_Xi<J+sE0!2F9S(=>HS<XV:F&c":18p6J5akfrc %uuBc;H7[A,tbdF+dtiM_pDAVC&1kLL2&_Z %WOqI-C4q>5%ds3&h6`DOZnRn(%'/:,BHjG]ZAQ@WooTuIo[0d)\F>\L7R9AVmM=t&4CIZ6%IoIt@pahb! DE)6ZGWZb<u+kp.O!Xr %lLIk`Q;h,#/O!4K2-!g>IrG0qe]bibf8&? 70i^Q5s1^KnjjIh>A&(U$#^QnWB1j3B<4u$db/f83c3>'oXboJ6cO@`q9"`T->aQB+ %e(6^imfa`j\0mnS^M4f[2-7IBQ[Cp@Sn))^CJ?#.b/]0+? DeFl]1+lBo6VmC8IqQf=T.)oA(31O7&\dt=bd7r,__anDjp>KRpg#J %a/=ul%ONae\Co/Mk+(FG_9;f)"DLf\*TR8AjJ7^_X&1Jl7a#Y#U[+>'lqB7>p**1KN#UkHeG.:#"D2CJt#a:Us\4HVR[0knfmI! %@qd2]-,9=o2Y>$SfnTD\g_)jIps$:_4Bu@rSp,pR/cmFR"+r22`DPmTMHJ`<_sSj9F:JLiouE#4HLhV@93nP4*+6NRA2Q0M#r_D %IF')`&I1!iTNo&)5Y;;M.YXc!"8nOt)Bk:=2IJ01>/=AlH'qt^RHI4Nk#@5!gdsX#s3/A/ %<^`:#_^rr*Cf:,,NirZ6Eu?n+[O2^ %JiY<U/LfAB[AQZn@aC@Kr?8F9,9Dp7pHH*V[UKW!nK0($%BTc,)C=tML'Xd %:S>9NA5f3uTk`4U"B1BR*Pc0%dRnE(#J3bYRC^F4 %9/Z_ST)>6r%5);:4)]P%>Y-iM+%<g,4#fWT%bZY<1K!*..kA<3>2IBk]\'^U,'H3iC0a]cdJAuY?:JGR? SoG60,]u^V'WN7+d^[[ %c:IO=n)n\b`"MoS4!%#UWAPQ`7:=T*d$nD<+A.OT'e? toU$RXIIkJ*ERmoA[Y^$Z(#E"]t7gn0gH&CX$k8`oD(a?J!1&49%Z7F#7 %CRQ"IT3"DX)^O3<I2EL6$(a\@T%:"IR(^$r,_P0sDV\_D,umI:EY&jg9.Os1N<*q4FSVJjfA,J7B8+_&(A0cC+_%j!3n@P)o?/U %O!qcQ9f&ScZCH>?!4/9,r"YE"i/cH^.rOk!&]-gKN@4o#?2`\mrB8G9>NubQ7u"V:W`,*?8B;\q;; +eChT)Y6%!RHKEKS0tHf9an %@6*rJ3t,>;c#m@hY&=RF^?`WSJZgs(C>)*E<gul-IPr@-g.S1:=lFP0hq)WHf=i37i\Ddc! J_EFO/UY<9"J`:R1=e<Fup^:.6fAf %%UP^'>oX$iX(.h&Z;_V:SPie:Emk/4gfe;WA_>U;:JhS$]jb=R?OCLen\O3qp@g8bRebU5H6o5Y,UTHJ'? AI4Jd9Kg_WV/g,Y_RI %Gf^jE'@UYEd!sH'l`h<I.^dV:Smf1Hr&%%Ym<4Vf;H7WU6RfOQ<MK^"WE=I^Ms@t<>774WF8`52uJSj4^)M31TV@m)gX+L9<VcY %F\t\Me1sfT:iJOTDP8=']GJnhM:gdJ?U@i.A/5Fh$s^Jn\GglPE9YotLj)'qpJ\(n!K! kjD,.Z/JO],Rl2[\_oh<CHZ;mgneM'E@ %@l80`A[Ygj&$)80;9mY=?0Tt&*M1Q1mc(0j6:jY3??"FKR7Sud %`69boo$nE@AKtW"29f;4gQCgBU:UJ/rN$^[kY9VeURZ[Z1'Sj %O2n[VP@p5WnDTWWo'mBm*Bug(r;*Pgb6LQ@&H0fq`9Qlq^UOeV? 25\mVd2b]ECJVA,a,4aH:"pkF!"+"SZQt?\>MOEMl0([W%(2M %YW!Y@`M(74h-:FmIoD14JEO#QrSO$t3,*mUkCgR=\7YdE"IqK^>1(;DfUNF"c/RZ[V'Fm.6^diXSimfF$2h,WVk&Y+GX&:Q\c:c %1c&H3.N_?n_dnrF9bs#`I%jg0CmOk!0\!Hu#RIt.)+C-P;#]mJI=7S`\Iu6/Mot*.aEo$V\nI %ZWgCDZ=aW)klt1n76T!SfK>%%n %A>Y$sjZi-g+<[N&'G7%EkelA#db,5o+(`h;Z9V/#(J'\Z4E,ueU/gbNg(6>WT\sJ7:+on9\AgX@<T`_XRs?93BRG52B,bc_nl!2 %M-o.\Xg@n^@RQa3$s9H3C1&:@[d,.BV6#h,[^o8YFF\urhB3QK1Q*:uK1fL? 4q;&0D,E/nS9TmI4P_[1I:qI0ll>&J,9Xemd$))Q %QP)>PqD1g_2Ze]ihVt>4=ra)r1\tSQWqD@uN#:&L;Ao<P2#K:Uj7FP#DLoo"d]Q^?PfmYh\'Y2#ON/95,!p1Df:K89gG/q%qRYT %=FlXX#i@K(5(.K'+(=Ah8+V3([Mr7T4U3C4fXIj7GK?K_CI^/HTSSK'!XX*EH(rB4S]b&8C,/g%:%/lQ3Z%uc8ISkKRgM'bX6<k %HF76eWZ&t%-`ApM!huBX'.R1[Y@MV5p;u2Z%XMapQl(2r[`j-"m08m?57!14>!&`0')1D4e)qXn'[Xj0fKl]n]"-Y9TZ7iiOYZ( %Y'7)5\J<`,m2Bd#eM1lB^Z*D49mm;=_XoZEVq&J?f,P+Vhq98CE.GSY?[0! 439X`]]upl&E,i6%T/\R2Wq0M/pth=Q['PE4di(]i %YPJ(1L>*3F#.4d3^_qB,d2"7-6e"b]313#PFAWjnY?%dA*+INFs! hou[%j6me3q,u0jh,pc4[agb2B#EZ,beiOs#c=)I6G,H`G0u %=kCYUhqR&sdl[miBm""3`W"@?7]dD(2[9^m.V`*A_^JshQQ^Bb?j<3J`k%H^aHAu$HtV? m>+eIEkf14jl)j\Thb>.nr@bF?@:r1h %-V=5*UH,c*6.%$D@:?e<<PaS]/a6;]W9PD)\tr(Fd)1Nrl1P/k:b"X)JhQYb5Be"YA#o3^`a %ZDjP[SSkZb5Z7l]h0C]]=p>tB^& %U>uoAmLIVIGI((oQjN[Yl+[&Y]AI]dO;2_'?,[$7BR0'cou,Q_,g//0;)&msSF'WW?XkNuhSQ)X&=Dp %/m!?b\VL!nLIRurERN>M %f\YccM2G(Z6ua6X="rnQRC?ASAAo]_0Ol:[&l(9&7j5hsRV7O%Ge>USh%N,: [9'[L+,PbH&s=Qcel,c9d*V![jE4+7Y'$K;CVl<< %@1>N.3jr^TH9gf52*c=eS'7N5:#.-/U6&WnW5)[\9[b2MNeXUi/#h4K&ldeQJ)*Gg6O": $a,d9m.rR.LNN$'Cn6&#H;NA&!iP3[Y %hno26S8iUA-%[KV8^%-V%fUO@K7EmJs*1jd#O1V7r7)GjkoYD50%h"daPb\!GWgH0XD1F-! =cE3U'EKJ&9<\pBhdJCMIW#9>r5%4 %k$?@Cm+NG0!`kj=E?K`22,YFL^634C3!(ot:sd"*Z@ZS8A\`8J_@"p^r()SfDb05o\UYOI^&bHgZ$TKrlT+:;-"ge@BmOk1fAb% %d$G&).B,:ZT(,*G.[6C$eHl[,K %;_1>fjHO(0Ib(cbtDhA_^+\!/Xg5\cO8_Z]N7S[4FI1H/hNX_@0V7&bB?'<jZRs(1/h#hG?V0 %Ume[$_V^*TrKMWNPWb6W'rL3D`scgXH4R.5*"+Hs=g](R@B.Aq>-YAHPU,j)!=,>&6B[;04sqe-;[>L[Pe5kK_n!]`.J"hUKp=[ %eK/Vd)_7?VFZfXZ*fhBoU]9Wsr22U\IpFPdbmE`:J$^CrRAGT]i\$.C8Q3a%5<raW^jU0ng,W=_W(. +c_SL[?S2Bh(_nYh;_*s`m %!`CN4gh@RmQiRUFc/L.3?Y"lBm`-MHUD@Cr5OD0&beH<\rBT? 72o_N*\:45iW13YT$E$uGD1RE2("&#B:s(4=BV^&D$[FuU?5R5T %m*j)P\*76`A,=MXkeI-G^AEu7pn1(! g[>tnruL1lk&gL*=3,.YWT@DYWV;IRG;a&mrE[1u'lr+on,7h='OWcsO=L@FBnqB9!r4dQ %JYYcTMu[)CSNEW">[L!8s6IbL9VE%$6t-mr)"#/*;Ah(!:XN'rmr[..7Bm#OpIJ/MA1/jtj%t,r %KfR*&"?$F51g!m0NA#*n8"Km %#tD/YWtQXGTc5$&jT1oF6e:rRH=O"5SqhL(71n@V<E0$f8fO7UiG/q0&KL8IYh9[fA0&QC>8Ae %qmuI;Ok:U#a<pfF,8Cc.A8dP3 %&.I(pFjCX,c`32/g1;+$<=?WM9VP,rSR3KiB_a/:[&JpuVdd4ei.U`Knq'.!^="K\Hksm9gJBjFr@I)G[] (s.qH_R84Q'EZ`S(h@ %=41C$ACIuK\'T:i_)*&2mJSk6DMl"HZi1l9MJAeKZ=H,E! 1=gZdn1g[ZSlKUYRpk/M6)YLe'gL82k[rqUZ^g#A-Y&<H7ps,obHi7 %B$aH4JbGC`]-n#CIfuf&!/[,nWsnuCD%]ZT#/BNWIGM-%[2IbUGq_iF0*M0RF! K\KSh9YBU.:O3>mVLUK9irTfhEF@[K&HMhQ:7X %$m7)8")mS[/VZV"0a2FsDljQ_3SXL4B5M5&['$htMF7&O3nuYt/b3u9Y0J:I\&c/`N.bocQB;g;oF@*QL`CshD!d\aq*pq#W=8V %mW8U]QW$r+aVfbAEl^6'[)?uFA=bg9K;F=G+]Ch#F2>PA@cP>=I#Br1.MZ7ki4DaOJs'a>;FI5P=&C,SDptIo6T^M:n5#ZAIC(m %mAum61-F4,+VBaB3Bcl7(CCOdYGQa@AJD70-jjN1@d#HOReAA2X.g9bIJk,6?.3H;M:Z %h3U7CU^T'L'p]&bP(eoMS1K<U`/181/ %^ZD.)9Me\D]^.lPQ2H<fPAe=7r;UgjPm`qu?\D)6M^cp@VDH9%;jlZ?@t$E5k:Z>_+/Du:B %)CFM21(51@4*h#Mq.^.m!8FF;6Fj %'sc*Tr6"B;P#$-"\=phYWqrs6>j,h.rg5c]l-sKjS*0U4q+p]PQ^g$!dT^dW %d_KOe+Mt7(1/ae[<c:,2FSj24i->LQZer9c[c:%[l'9B_%g35cJ&Q$XoFGX]85W-/Gcg52=:*O2a5kE^&A374&l,`3Fqd28#'X.]9&n3_7Qs"(a.hX*Ald(Z3-+M)Xj=K@^@3=e0_B %^`rYRIEMMPDVoB&JU4"Us"e;\2,F<Ve$Ng\=oNI]Bj]L:YA[NADBHK>s3nkTMJ:>hZjrbT\3q"g3E^Wlq@"#pJ8AKs.(rhEaPt" %>:4`$ffIM"nT:KaqE!$Y[-L+uCKMt\bfXeliqYM",+dDjkhC^@[+hM7q!d5H](>(L<P?;um] +0;5)hh./>;J"j!%LBl$bO[N87`F %+o=oTRaW4llI$B@[cD*/#/JXP_URLb+]ArU=R`^6#"84b:8"r;AK"i8'/Zo-RYL`c, %GeuA:fr(P/r]FJ+Y%Wf:)!*\YQNEII#JU %-@_HIn(E6h:]NCj!N<07r6PQ:BpL8odi[.U,#DDNb?*UC#B6nK=kcbXEr? o(4FP&jkUl/3Vhi:PEi8Y**niFmbth3L?._WM_-kGo %ei(Rh5cVVPiV-?$2UCKO$6*i<g$GO\V>;hkX.hrc7#qlB[qQm<rJr&R;/XESi0g_-hf`7/ [+qtY\a7K[Eh]''BKN5l?i+Z*a^nJC %mW;.],1@KX5*2Y<m\JSOGCZqWQZ_[iA6nTRFoZciSj)@Ka>MIKDu052P5XqBj#R,rH$Ab@(t%NSD=jc %9&G>q:<c-LIRrorCYV+B %)clLd#GGru^@JV&I? ^NVd6&A>g"Q0k1Ka\INP9l'3lR_7l(%]qVdJ5$Tl]jJf;60[U7)8ideW+L6B[V(l"g-oYZ+]pRf,$R<jroj %@jS1&I>\m7?%fN^dKB&SRP/Udqu%/A_)6'!d5?"je8O<6@Xn7<&h<_3SK"K]p_d_VdG<@b:2"\tr)ou\ejJNE8"8#W*UPfcb`WO %):Do=qjOt;0Z$A_LO#$WT(qVLMBqW4&!*t;Rf&8K@&k<Y,0?b9(\,BQGh/u.Lq %;CfmlIQk\eW]"cL*2kV,udh>Lb-cM[V8#G;#_ %GaIGBg-D1!FR\0301*AU0[m? G2Y'63Gj'sh@kHCV!.pX>B]W"(cp^;.'%c+m!,7m87gj_*8(.\e_gt,Fg&9"22WgH_!hO)4)PB\M %m/b6+)H]aaWfDj`W"Gcrn/f9qnOpt*4*A5=h#L@2P`M;!lj@cR9X7.Fk-c@#"N.-??9(tilArgZ5@! %mc*ULNqg'9cPM#5"%p/S5 %h2BC:nQrQ@WgkN[4$*&GQ26iT2f3'iD/T6u]L'+o^krmMFmm=?s! 5B1EO5pBSZEC:BC]nWqbbipN85*+4bmm:6/!"91]c-f2LFq! %$>WFq9LA=B4l+4NEsm[P:Q'U+M(LICD3kg4Hgt<?Y:"UjDT<O.`aRR2Xe38NI$Tr;ZC=[3jEjF5X0(&g)@)_d5q'49\cjdZg-br %UHCK$6:u<3!'XoshmM1n#]omGQZZcl2G"+qX1?O,pAm?F=+Zdb[jsTg8+^'.(<cB96pJ\.^R6h/9$eNm=EKu_V*u$48YVA7NXN7 %%l%lp+'ng):SOU2^OBb+:j!fSI=\g&2KZQDqI2&I>)>-F@0h)5iS,,t1^NJ`_,#p(G/$! @Te/@b^D_i4KejT3#fX`I/KHE'"?TS, %)-F_NhgUdp2MjnT=(^r)n&/Rtc3:iMaIZLslaiet`BJ^Pc+8]@9tT''X)6P>#d)9m4+^rU;ls. [7+3KN^1WZ`L^BDGf?Wu^@ea4# %ChpuB>fUTjV?ERii5</k"8dG"[+&P>"t>>s1Qd'poH*^E1-]j9";m;6I? 2;B<U5D`=X,"1ZeU7_h:RPKoG>+eMnH2gg0_mC21_%S %0?dlXMFi'2e+QJkIaZOtnrknQ?uEOZ;N1F %mfEl)B1lY.9j&lUI;Z\i_;E8H$Pd:tdO=Ih!.K>M@=mFQUpmJ@mS8OLAM'ON42Hn? %[5!9J"6V?!rD@ZEg`X^SI>8l)a'&ob_6eMf!AY'[4:M?$3f4(GQDRZg2B(,d %p9*c#.56\G1*pF9Yu0q\<,8mf:R-gANI<JiM,!# %WEI&*oE3^K!ZY>*8$CTgnc;qMNP:D[TP(#gRFWk*,XNY,k?=\RS?W2-^MW9cL2fCh]TMM4$ (F)1V]1P;>_Bbj3rKk)[a/;N=jQ"e %Co;o(>L><Ai/d,VM8ilJ*-B_,.:\\G.gS#@HN<<N=*/olHeoj[V %f.-,:"=X*8Me5'^?-.1G_DifZerH&&u>p]J$%iA1X5B`hQ'_ %kM9GEXK\u93D7afg9t/=jGSmajJB[eZgd64)2dT%+665:ZEN0M>S_I\'TnK0Ceb`VenbQ=FA2]4&P]iK<nUn);U)"&"sfLDZ=GK %DQ^ZBNsaFsig-Z8nmUG&)Yb=#nnH>js$EUNr.4:eY$#.n]fh.NU&F`(`&D&G,)`^1ilU)!-h37i+4'bqa;r4SknY0g'S4ZL$YuI %H6Bg1Z,K:3.mR:ap=_;W*B#4>S'u"\bVQ'%-S-MN=\8':V[&:OgP8@'p1+:u5kFfffNUjkPt&):Cg@Z1op%h`957^f&r`@_ZtZK %f]*D/7rc"NRmujL<<O+5KH*BPm&1m %32U\4PA>n1c#Ft06_&gr(>r4WM^]&7ipKRVIac@!:loKWeR+cg@+]?r8E*^!e&Ij<nF]M( %p"_1QNgSm>]7prqZ$EW.5A?$i?/US3V*Wt>F.W!MZ? EKg49,fDdW_Tse#AqrQONM5+A^1O\j)<JX_\F594>SRp3D3jU%13>b''6t %@TW'9bS,Z9W]N\.2ZH^4T)BWP:(Y$-Tj$16g*@8E!R!!EoR94=lg3+`eVc/T-,"5h:fC9];cdiRBfLs8N1kiW0Tgp;!Mg#m3dVm %C4IL7a-QPHKZtjYfk,q6V9cpDgAVXj3G[em'7j$> %Td[T0'r/C7l$a=F=)9iNlU5aX5H>IGBS70H5dKk7)qYWf1teb/oP!G-hMjd %gX83pr7u8('ct_ESt['tfC(l;_Y<Mqmet2^ShPaj:a#Ys`=?=!^I6bnMR;DAfn[sJ9"4t>qeW7:i! BO>LeA&3-GXNf_W/!7QOsAR %(C=0P-rt?b/1TJ$D<&OJoYi'FBe<E+U::*b2A^dA;8iEd;Y8LFhR:^**GH>9:$n%C0TXG)3)c#h&/,#<S %3_II/G.JM=(18Sr&H` %pX^)q/6M(XafBpbX-q2u'>?Z"*+Oa]OXtJs(\)gDK,;eE:u(9Wf0QX-X"n1cJ,[WiFgm$t59kR':U(f9? g!<JqD_IE0Y@+<B3d_%Ac=[r`R:"4*3F7E$KQ2(Dm(Ercm\t_q8G`H4Pi=(>9rj8@P1]tMCmP561>4_,]52"9#Q.c/>TA9*MoqDMb 9(9>hCiG(j\Ct/1:g# %p6:5>O11kIDBqS_4T:e:^PL_Vmr2RO@Ai2H):EgDpf.ZJa\&8F_t?6^]F<NI7[JX?N>Ie:'^= %ce18LAYRZ1BqIQ72qh='iN2#>W %Qoa$;G+o?[5F$DGcpQMQ<N,O*Xi6S<T1fXY>46>b^H1aS>`C/12[5uV8>5+DdCF@6e`AV;7h7s.PSD\gsc+9i_;iFUL2+Lg.]il %^jhL^GW+FCk@q(#c.h`Y"9E;Pa/)r\VfZ)dVmK4mqB9:td %8*#YmRH8c+#7[f`FiIHnT0)JCf(XX<582*bG-,'_)doJ/O>+qD:_$ %[[W-=,6F`11k6o0R2fZadus3sb<!?AS*#3=5;on[4b#$J#@$jCS! tBR8qPc\W<[6qKh8DqEX(O9]J=0n`3eAfa<7u*TQrct"/a[f % +'[:bOMNfZr#;c=bS_SCOAGRZG3o<]H97iV+@N8<e<9T*XmiHX5^cPug63IB6X&R<K;VurkSi5FJNL1f"c< E41a;lDCC.5:P_J>[ %*O=5[fuU6eXOk1L4!Z=N]s8l-q]P[laI/h0RpMc!kYeaf7+7@+8_NM``F+OElQ7BT,B[8*f! 6pKJl`aaYjFb^*UfdV2ChoKa6Qh7 %Ds6kIfKBGmc6S*rnd1J*jRsHb[70/]G[5sqF[q%MG;9aP]^?r)<kDGmW\T:pPgZ[O? rSWGeJhO4&>02`)Zp9c2)PI]K_8[<4Z4[3 %@>I.p-@jINEjMcDA#Oj/dd3bFmHNsNf[t=EUaC2TH&)(F*>0.XmoPqNe7V$2W %6:GX@XodSCS=Q1L9qTp$ab[/Js.&?$2i8ZJ[-E %;[(9)oB);V)Wo9A?>-Rn.`Ld83;o'Uk5#47@6m`mPQ`cFQ5A;h`(k&eU^9`oIC*TG-k^+E^p_s32ZV: $>,6Y[`8]ceH(r->Tdmcf %.hYX,"=Wj!Q>nplr>&QX:"s^=1iU:a%W`X6fQjNQfCi]Ocg?(]jc3Af@dRG`Ka %.e:Zba*qe'FlPh@Sbn3c^W:\aj&aoB=Vq#1$@ %5[\itUTfXs %&RhfjcWmoRRfHYL033ppe&c;3h1_l&NG0(15CLJj:,eIU$&l#:"an@<cqj+AgmY9^kF/Heu^Og1TfW`Gll JM1S\(4 %nk';D3>E'n?)up6:=f-,/q<Z-9"0.R2h3Gn80WC$4=kHRLDDO\FTH/r%5o+TV5eAre:]dj;M! 1aVI[4;Ab1J].Y/&`i1uK$L8u:L %<R2a!C? <eR$^Vh"0uk329DCS^"8sB#`A76<Ct#um+cI)0e[nX5,C+BfZ6lm"_UW>@ToZa4nVMK1/)+BT[p:#I1e&1> 1;?h9#n_h0 %X6aK]q\!-YZ&*U(1JX%3aI4H2K<^'t8eKBDG>gmZWm..fp[,$c%rEf*'_KM1Ck5jCZ"3Z4Fl#l_Y! aen&3>F;hh71f@D^s0k#j`o %k]etQfe7='^&T3Z"(HLng3qPgNp>PpJ>b-X?(ZZP$/AQ<Vj?#_M.^fSAqV+O#$Y=*4lasJW&oSGVI,SZe7n-"nq59X:meNM#.DT %KRKt'.\Bo4bK%gJ^..:BWLfJGTa(<nko>o<Skk[ZN4t@lJSEe4SGgm_a22btd?FTt5a'W:K:Gqp@u_9XoWLGd9e10qhE]Li&dg> %J:1Pi&)3C8;s8kU?m:\! #s$;@$/qlHCG)#3%:*;s;SRI$#.2DOSuQ[39Qur4X>m=tUjWQ1#="UK[1ts=.AfUJ!ng/Z6DbeTI0WMP %\1QZ'pu/T`XoXA_<2:%R7T4UJ-Y=oKA?]4+&]s2.[(dkepKVHP@j5Wc3V`S_X8*@dnTct&3U*^,on>n2u<4#M!9"]VU$7V]>c'U %f2ZfogK1ghbJ*t)h7p5_?eMhgN-+=,M9C@OD:Wi,mc*6jo:;lre:7Aa^]*r!If$morVccmp-7EKXAinqnN'mn,E3&jPOFnJ,JKu %?[hP2O$EKQ+91E^+23$p00fL159<g!]S[L"K=m:e=t>U>[teN/:$>_pH3.PE<VJL"n*Qbk]h[t:M.Au! _kuQLlReLK>/j?PM5=^O %S]_nYYG02$@uf:(,0XRFIYM51E3m,I,C]rf\ck?"3Xj3:TIK[I/KcU6:#2*.DkPW\2Vpm=RIDLZ2kT %2'f)'l]h2?ljX+Hc_[ahR %bSkjEi7P`%RW%#e&dcYDq9cG)6)$sY2[g9)TU`/O@iuD_a/(kVb_[aXlq5bYH-hZ6ZZ %Y`)EI"t3so7s&_0DC<^RKSoWUrKgC.Lk %ejaI>S(n'`0u<SQEbXC#aJY,$Oo,7q3`o>VL8EZ2.Pu]&s"dT_kr+6N/C7WT(@-bAKKWim`!?6VGr; +^\FT@f^$Cdm'q)?RB!m;h %UbgG4n(g'TXqM-E5AD)1"M"IS',o6%rIjl4-k1(u5@F\K\a>HP%N\ +jjMnkmfI)G_Z:U/iXoICF*4O4-]kACr\(\0&^o!2GosbNt %7h!*^5mf[^n`(;fH5+Bhb39<jhuV+;p/C)F%-VMh.As"A;b*-f5^,!uT:p/-e_'NGMW\ZgR4kE?Ks0IE8kP7J)6$h3P?l^)(M/L %l(qBh#W=uQ],,M?(;P%.=j<dt*?NqB%JrrcIhQ6d59tq(5=DI+):beZ@Q\0omGl(e)2jGRUp'%%sQ*C"A$iGahJsd>n$eh*dl/= %3tHR<[EIDrKH9Aa]f18HO9uJL\hC9B7Z2qtK,^NP.q#DBpb<K>:3K[-^"Sl7E>p\V/X8++ %6ht=eMK$W>uRPDO`o0^p]2>E%8C%U %<TY'6NKfNek35;>5H@n'1Fe^[Md97BZ0#eJ27k3VaOZ`^#GSh!DM.Ql,88JC! d)'WdN)1R:!\ZW6QYmpHG@Z1)pP)??r5">m94^' %"\H=*im\TnXa@M.Z%B+$19BlA:RUn[<]OKo6R<f&ma"73GSah$IibU>d3qgI`4'Wh*Q`S(3u?7RP]h! i$qD1&A*umsT/Ddqih&fq %bV0\-,LpNBo'e!Dd*.)mCbSU,hAgS?L.KTj_dX@b2[==B5Ys7q%?V=VRqur@+NF)27>4%:!. +>Co<\<-)`84`#=2))JIZV0Js0`3 %PNWXOm9Cc7Zg,oCVi<7"e".!A,op85V^7\1hV??KP'@fLLW#2VI%(hiD@3g=1D')WNN2E9Aq*K=Y;AAj[H@p="bqXOUmKFKLH+N %`LN(B`WWeb+4VF+*)31K7?XW>pMMJ*?X7=O>V1)e&/dMN-(.BA%^aS(#SPi2/UM0!"t)ZCl:.+fcGO*(6/ =V!eammd*fWS[gNB<2 %,Y^cY%i3T`=WfEKY>.=:rPa2j%:b`^dA?RfBg!/?@dj[@I5i'bm%mF,4]-! k)3j=V>#u[g<BY<0N_<.`*)"CH9joW:"GS*XRR>-W %3ukj"!YuUmVm/:3,FndGCStS6(7W/#/e`S/4AEX#`8LA*m^-XN08mt__pk)s>al:f.>Fj,96B2j)OBm? DF:_?jp0=^^EK`A43q>k %`W:X+?)fJp841k=@L%2R<ReKX:@][#gp'i! 8;/'".N+hTlaDSj8)72Q;fmb'<Nc19I;jsF9,oKkE"[r*f)hA7`2R^O\;nYG=^T"D %'+-Fg/_K^]U$2m5UK%:)Kc9W4kffTe4$pXqD9LB@;QQ,*8_Yr:7]Cj1-! (T>:2HPu+Vkn_JdH]BZkcj(%FJuP;*0LS75T.Qq[@h+ %bm0nG.7V_gI]L%;-X?Y7H="Pkp$3mO;! 94*Pmek[2l=Hjnif'2cLmBXi1W\JYSNFK6*YOF:s^0pQ0X*^6#'biRGuNuS)*,N-l5<K %W3Wt*B\3:lO90\K>UVl*,^[i`RpO&HeQk`<36Y#j0j[hb\dKa\aQHfk8p)Y:L7`)$@(BKSH+#nlT,@]J0L"\LYp0>FWf9#EVT.[ %@%^YlGo]nl^::i@O]mu02dgrFOho9=%cuQH/VQPr?Z4`9eY7q\Tj(7fZ^WB? _."Xde4eMdm_a[IJu8sr<&P[/=B8-`q/3$#"?VhE %,<<L;cpqqu7[9(-:s@!7(p,k5Sj(tS1.9p++4-MUDEGQLP>X?I_^*YMFS\X^T@67gUJ3ejI5(E<Tl-? c7GM&dP0*>m3GuuN6b.*g %C"^%E4?`=G[HZFf4K.gQ5j0PAR:8h_>-qS-lFC)]a3=MlTpdi@RcudJ0)RFf[hML8lt3;O<s2Id %df]Rr'HcdX=C55/Bp5e=_J9] %$k"XTg*S94Xfp=0$<EYkX5m+#\%7Pkm1&VfgD#/t'rVp-TSH8diK\C2[i)1mL[2A"n1KYH1Y%uW-*^0R3nNT%d+8V'07+0>(2KH %"0.EGR@]W>-%_2-^K^bVlKe8O*trqaVq.*&&2pebb`*e&%uQ.1b[&&lVE#'l*>?3onC&? lEXX"ZOpXq36K,?J.hLEYQZk>T=1o0e %Cf9YK#\&hVjH'-iW)_+RPIJF'Ti9-lBh[rHGr?d8/fOn\BUof&5?>j<C! Ohs:5YsN;19Q3q/nfs0N*<0R4o/"cd*RQHlPQIfOIgf %9:moJQa6eI`58T)5.aAresn.t$-8/`+16gLET!WscB9U"O]PqmMDW.aK;h/^"fH^K`QP*9b:Z.qeda'`]DOLN/@.`Y,R&u791F( %':3^e09JD)5\cu*`?u['!i8\XiHTrRVn=\@l@JuQO)bNp^AdL4,<`)"WYu=5S!IpXf,?\V0eh+=>g)? Q65Ld`h^*!kc$1-pd,8>& %;&RHX5cs6p<h!pB,rmp/@8,qli^qU%Mi)q]4J>s*5#p!)6! R1.D7s]kW"KDG]YHtaVC=><2EY,V;_[m>CHq2&G>]\9g"ilAOcr`. %LeJSs9*i^>af\j7L90lFFCoju!d,gd2%lrq6\2?0W)IVGf:D_[WfY$>C5Ef7nFL8"(Y9- m$hcF\.u,,J;0p.a@F*k?d]&6/_*-S" %GTd/cluF>7GLWAW$L"hL4d-_p]ok2RD'p`3FJRj(7ck1!Q>CS! 886@\\lZ>6"hiO`6]$TNBnsJhD3=^HP`2))RpO_gh1sC:-m!L' %nZ=W$`;%ReC<],(Ak>_c0mb+e-Mn%0%]+,*;K:7$Aij(447HZ!iA59J#Tnr;q-? lS,sH&dEX$GhE$F`:EB5:9Ze7B+<Qu#ilnm#B %@mn)*FO?VuNm`3U9`]a/_8s8,I!Nt;m?23U8$Jh2/cHU75JjST)VdHA:Vosc=r-Y87uKQ`hg5X4OmJMlm2,bOT2p/qED\0DZiF( %Rg:\*bEY9*lG55p[:2umiGiH#?BaT#TB<p,>I*Y#&6o`I)LpY*-0aQugF%\4AN`S3! Cg<hhO;`"f10\AhDt'k?f:tR,8b6FE+Q`< %aLQPMZCePHj?stg<>ph[P-JaYj#hRdbC#q)-cudD#1AQnak\!Dc78A2o)b0;gsMt$EV;]QCtDJ_E6! $IrF@)K>q883&ja?W!7aG] %cr@<L,)FHD7:$p)3HXBk81C$Ti+D=L`qR=*r1HUJaMHAk?7a&^P0?+W^;FoDpu\"GLeIT<&t,!dhbe#6eZq^F&];#"j]MGgHp$g %R'i;b-8BFCf1c8(6jHNK2%rkK0KKlm9RO,qn^!0SoYDeOA18RGeC#3D?)0(p_QY^?1;-o$ %*`)qPo.I\'6&U/"8QemfCnK50>]]n %T0B#e]jC2Kd_6F:5uVAH^.%NPNb"0_FISbhL;TT?? kXIr2/R'&+#\ugko<"YW/&&0d'S0MB`^YE\l`Z<A7Xc@`_Y:CYR0TgGC7-H %rCG[=DD0CWo3u&ibMX_((IgVc$A8$HFh8;A7`uoA`eNqeCt0HU0V.al@%<OO>?:KA0M</f@m^ldgX^`g.J]E_&UiH;UlG_C9:/? %lID@iiTHB[XNmOW_<U<O-Y:t)e\04hkUS=Q@"_P@f[^Sr$t?6cdd+KADb6C8gDp%6b#;k=Q"(6naF.(K!? rseb,bIR2mc!4Y?>$0 %NiH=`Xa,Q-b>*N_nDogKr+pl-CB1WC_T'TG>UW6[HC3mfLL9u=j#<$^SGrNFnGcL\q"oQ)KW! kFNr'oRo`"2Xdu2Af5q.J<kKHe" %*i2/RN^Th\s0q_@4\uBA31.uJ!?cH9,[&hUErkV'T-*ip;o/"4@H'F(jMFG@M3518)?+[(`YVDD3M@M;UBmArho^l/SuHh+0[*H %^Jk.&eYDYum7dHLYC?J?Dgq9IRr<fP:I"mXYQ"&6GUS %=hd.>p0Alfl)]SJCoCKk>s6%^Xs5@&Zo';oqoC'Hnm5O3L-G+MJk&k=c %H#'C`ArF//qSOud1+I$HZb<]EHN_V?;O_B<6t7`6HF;#hn1h%^o/?+_g,aVAoe0#Ieb=nHU_@3! Xi$"0]sd9Uq"Erfi]B@g^!U2: %WK$oRhgb[NDm0%sri7uFjTjVCUlP9"=9"jIrlONIbE`*+0DqGgh>c! Jrhj)q^Wqb_*N*Lpg=auVF`h$f>7g?h-h_3F&>b^B,459h %6C1<7C>K<k^hT<'o3Tms8rjq=GEm0:2->7NRSUY0h2&Lmjd9*F<5!II'q6#-Ui %\:g=k]?:*\@\XVpR9:n&*fZZP.TPTl@#*\,1L %;b4<3Ysbf9R(Tdl-QB?#Pn8*0,!D7VZ_No@AOOk#?mY@^$jSnYIFkhFd? `_IHHQ^<<pSkR*d/<G55G=O>#p0TFUdt=>1;:khUm[l %Z84Sir=h4aa'9QF&\bl_o+8ubAlMaj]NjYu.R)'79Js'VWMaP[,cPp#6t^1Bd?Y:IO!;3bpp;!ff&r_I5:b?T,*C.I,8ZG7U&!W %BqC'^n(Qp:1P'p*!aQ?2Y45M<Zf:@5m')JQ23f+f)'G3gku\^./TBE$^2;SEA\j]i\9tLTW9SmlU? >1r_Hqj,W*tSARW]q0)Eb%+ %nd0A=jkQbN'$t,sYcY`uMmK_IIIR*?D;%&nN4"Q?TujO]>*TBrs0/d%Y^12gAaSI? gAgm.6APLp9W7)9%,!+4>?s^c8TVU8/bJ_0 %86#7[NQNBDOmL-1;^4q-5W+kmN8RT,0qNjMM9]")krs??dPgLkqi.G@=M1uI-[DX5>;qkB)X>OE^s! O>,Qm$^0,M4,j2oTq&]m77 %*qcjA6X`B'2,!r04r+1;hU?2e7C*/ZX[Yd+*6TRD8heD4i]lnM`Dp(,5'VM+2X? n;jJlV(S[]"\XoY`T`_opS=-f0/kW"m$oZMq@ %.<NNk4,&Zmd%`O%M0@$]UH(h30'P2nW`"Sf_K".dBM8,.q$EiAdqE@:?dreZ,\$YRaqC5Q@O8>8IIg7D:UcbN2u6=;eRuK.[;K> %gl8QE5@5:DkS'&-Nr?<Jn/td+AsR$_HID! O]bKDK'9.s)]<RsJ8mH_oo;inYQJd]J*=5O&Mba^m'gcTd&tHBIg\PLJqQOhf3u<j\ %dPD>4d+&t+bmGB*@VgcNG@iC((c8W:77\JN?$(=r9(t<J(0#LTNTaGdidpO.,Y.p@^?o_*,S&LAgrA+GT$VIa:G#Oc_grUUb2>T %"t)HIFi!t5okE0fG<QjZWFZBO'o#T\92u@^^l?)fA&*6\0f8F[j[r&C$"Ik\1?n&e%[% +U1hSDpWi_uA(H(+-BA?&UnWd.qdK!b1 %mrLCO=_&l0g[@4Dn[5CP=G,3aD:@>Z5ea*Zb/RL4>Hgo!+V2)sn[726D::<D7! YOpU2KUrW4#su1r.X2,lnn<.AVqojoiZX3"<kJ %<1&AVg5X02GVU6&W(.i/*4'@qZ#'*^[K\*3p<&!]_<]RYC% $F'p/9@;q.f@86:/dj,rbPKIQt<^Or5'p87I"Xd\DBqlZ1Zp%o-RV %&%n6ffAdP87WeVVlVD>,OmpB6[q=HP>_9;+?!g6!Zrn? 2QWQE1.raL*SB,aF_<]"I=moTLmS`:)mS6).WoeF@K_oPN%n#<mh,XA2 %2[%I8f>LZ>U</-o$I;G'<c[%'"[f#5g0e(\BeWe3[?U9i)f]ei]?$p_aho*T3bspgXc[UE8omFaHsa/bI2,'>Te*_+@&#0q5/T% %]g4U&C9,];B3,^s@(3dRl0/c=eXeR/M02i*k]a:PX.Muhj9-<!O:=[6SQD*/Zl>-CE8-b %WS0n_>FcPr8dmlY)P$$(eHPDof;EK7 %hYCR'eXkn^k3Du4]#9TC.:+U]Y2WdMmAoRK7Si05`+j#YZW\/:V-tth3BO<6XUc,X<1O+Th+ $F#Dl.MeET\=1mppJ``Hr0b_g^EU %MlE&*lYEpXn"4JK`H>N@RBojMYR+s\`_uSYc7DBj!-`0)ml%Jma:Om8O:A6a10?;i+"s@0<Q]hfKq:)Ain>M&\.tP3CoK/$/-ab %/bgWg&GmB9\FNbO'OG;J]=(:L/0JS&oY7@2Pd3YV0>Z"@N(pWcmG!1cI]Mp>3/`\I#%XqsCfhQR%)Y90C\ kIOakEmD\>R/@kb<"7 %RWT3Z$-l_L,Jd7+*IM%p/$aWDfAOTdg=jh^[gufOhRR%<2)gl[9Y6$5WIWqVgUK? 1e^Och6=[Gug,hnV'j`0/@7;cuA@@/V)&jL8 %,!'e5fX_N`K!'KmeS4mWDU+@M`Fp)qF[j2WY\9C%]Fu)gAZbjfm9A2L<sBLGG8JlZCF9iMKG?DRirKpFXYi)KI8Oa`E:RI9"+?l %A4&bNVcG/>+\dWUmbIBM#7;qrC?NF3Dbal8Vd2\pK:<lNDsQiGZr4PA*L/##e0WMQ42(RF#&g-hFtn! qKCRP%Ys*>XCf9qXq7Q56 %2Y*9N':DVn2X*$qEhNkgHaArV-9EA&b+T@U4\'5IDRH;92&,:dXD1mZ/tsr5ojXZuCn8&mAjqf(G% +5#$CnVn46gDHp:Y7q3tjf* %.T>mRk'm>&OS_HGP="'ns6Ka[RJs+;\+^(+Bu02Ob0]k^+<l(&B_2JDm)NK5o %1YO#*@iZH7*e4mXLG:LL'R;s65oG+:CAuGaOou %T0o-&-i$R<LKKcV>PS%B&`n=Sh!sRdd=7>Y=,@If2>i^=H19uCh1q'\PFl1]'W^5c56PhdJV<NpOZkjaplp(]bm;S:.QO>0a,Wr %>IQ06R2fRdTlFqTktW*W,4UDA21bJP5i#4L?@OpjlYNDEXj7Om5nJd$eMSOMUQA$%eiKN/-qj3<8Ee$4E$l,+r;Op:=+Vg4ob-? %AS.qBHS9_6`;II84m$aaW5t/n8(IaZ#E8T1`H_ulE'6VQk8hOB7n_DBC"UcC=1pma!;*E:7=<b[Y]:J:n;,Gbu.EPG)D+i^^kKf %:fTf"MO0PJ8!^ALa.e]22GNQB*,?mZ%P:FkYlJWM`IGujZ(Pb=kJ0H1_+XX+_CHLLD2N`1s1XUT40K*_rE<ZIr=9%B;O6DrV"jX %qq\ma"/>'XT&$FiMEdo16.T_F.*+9WNsM]2"r1edh#AT"9K^*)<U983rjs6X@ikg0bOS#ZFgAF:^SM*$6Hg**oB7OAZJX4-SR&o %\e<\"#Sjt!oe+0_\XjM/;h*(tl_rIC@[piQ]@0T>nGMHW/mp-pNg9ta$-CpI2+Vt%!!(qeSKt@s+>HJ>jQm[oC$#=$YpH/J"a;& %.6$+uO/76hlQea[9\.B!<<FeGR#WaO0nAA=:%"NG?J0B2.uQAp-YO>lLlFg%T71ft=(Uji<"-! p"hc>WU)K2_VN-]KLt9Niq$<\G %BYcQa9aZX+I.r^3CPFY$)2DNhK=ZjEjVLjeRT@0ua/5,PEAUY6K1tC$TUPZfuo$#Xh>=qqk8T,)^;DA'MJs0M$EAm-gSmf3UA@8 %1`;iPFe0a43+SMPHR2#5!_5Q29BiE7oQ7kq%*")3\oY+AY<Jf=_s2k[CUGp[D^k6GWg3.! F)@e.pEd&WS,hAo9\$If8.#s(/14!: %I31GbNUG'H%_8</YfW!AGKK8X?? BHR=Rjp&moVXT<"l9=7R3s/G:W@Baa5[/)pH"]_b/9A,h*chET+'5I43S`[#Ii%*AB(7b`qsg %`p_(YRRA&QoO3]"jAu[TJ[DKBh*XC$$l?KpDHcL:HrKPN-@h$\E?gZ:'`GF@+=cN0&YFFPh5e_,%CklU? <?%drClo"="Wd)-b,jn %j2FCo\KpH02\RPOP6u0TKBM4s\+%)IJ<3uAA3DGp=Jl0bjqn@T)`. %DaG7TdKGkKe`GdPDFd+3kkMil"]pD"ZPIn+Vm74d^-mCVE %X>Kd$aFKO&G,@@EOuj]ErbdWVk9!6c)P?"u1*O\H7e_#W*V%sg:F<__eS9TG8sOj;Wa3M) +Y)nlEM:0uQ.#Q6_*(Meg.d@P\(:87 %@&\%(6h@Z#mC]Q.Q5j:P)TYLuh@2:Sb'MS`(JVDLkmkQc.g! (i(O&'GGO\Aa3$2$C#g67Y/9!?;I(4[>4#SAps(ZL,*6AM*Xp[VZ %@i1d-/fJ^`E=D'MC24(_j'2Z!&3I+2UgM_][qGdk+j*K,5cSWYQ[hgR0850l[9-&jI>4^,7.13P6! i2H8Wf='?JPe,.gP(GLJ1s& %I]!!852@1uMWX/>-bdu5*=!kWj.0A+SI-:8\@A*KdGY5bapO^ZZ^l&cLEZMZeh#Z81h.3&l`HAhj]j[I:V*ji"1uN^+>6e.*H@0 %:@`#*0/*Qf/`2N7iuf1^os%<2i>gR2Hj/;[_FXe.UDYW-ig*TGhc[Ilr0ctHDk9? 0(#m*4"6iOS^WF?'kZ$7r"T!B6N0C9/`40nL %DZ*d-SN^iJBfg$<=+=l'R]U[OIS?T: $5Tf/.C&Y(DQ^[Xi/,81@"-\B>6mKP8t(=ChEQ8L$toF6@2]XH:_]-13u=VqW+nN`%&ID% %W7G%G:I@rG8gKK@r./M0?$VOf*?Y'N'F14[(R^48H9qLCg<ZIl_Q_[%jU>X5\]G=? E*:*6,a,.F;d0tbZ#r_$SuYT-Kag5`L$f<) %19CgK9Z@6iO\cM<9J0_L8%pF*e:Ruk0eH4MLNE&tmnXtTaD6#5FCVI#hX'H0,Pu? N]ojEtoOMiu+`'o/UDVj/XLkVE%($bWOrDt> %]&Sq_"`r5?D8R<^S9_mfDKP%[;Cr6@Z]r.;[C:uY<36f8^T*!hQ-% %figNbC,L'S4:5kY30oTs+TM[NeZPa$[7dH(e3/$moZ5Yp7 %qi:rpKosm%=0X^MQ%90U_bGfE>cdI*Qk"@5$mc2S<H!.pK?nM146*>a`"3DqR %;<',Re6hV'XfYRo$e(XYWk`[N1h@NB^?5f&LL( %'Nol1/.*HKDr-4pHU3f$E.ll!2r1_GjgJ:-G&Nfh>gla@:<0'8-Q'iI!DD#TlR^Vh?Nk6"<rLR6Smd? jmWG\_^gk1i/!R_eOYbeV %/g%-j2i??t4X!ro.ccogh!CJPG/*>-9]BdNek#b$inJ/rQIX/\j2*U8#1191SnFi2-W)a6>13l4g"o! I:<*N)*^nkL-b`_nL%Xr< %mcRFtc7*F?eu*)D2lQnRn&:b% $99%cR)s'_0e"<f6QWC<g6o[i8u`]fL;gT3.t(cWDiHNh"E)^if=I[<(Q*N-T5:8-&^`k9A2#[N %+BCSUP;Zs9m(EQK"1Xf<^40k1?tO%OF^CK!4)&W1Xm9"C4A*t'(+q.s#&e6gbEWJ$9feECXHcA[#3%_jl&*_=+EjZF;FO5Bg'R\ %/]e?70`Bc*\ekE/eAgaDql8VUNnCf'Uh,0gb/O6o$(dY<22l:2YiY9XWR? %&#T+^disjg$;#aSf[gN:C`a.f[B(8+@\c(!<5C`Lk %GH^nO=(guNC@DZ74XBcE_sI8JG;g3]m>H\"*H)c(F_k/VaV-%jiV/-db'^usF^OLuAYqD'Z8%"/K+N&Hoa"$],))/g]E:C@7t5+ %%M]Zm0BF%mJ8!.1.Ze;.@%i1@pLFr)2N0]5BPB?dl42\"$H-JieQ^mr5ei3O4KJE#eV^V:*EgSOL+pR#n-4C&;EX,EQDM(VnjP( %-K0[AjrfQ4r(Xi!C&.'.=`0<KP%)h;+QX=XN51/njJZ:Td3B@E'o;+6"6#:iCFb#U&<G^f*[S=3U7*S9e^T4UPRpSH88t[BiQXG %Ml[6He.*ei#%Ts-iU@V7MOX@S.*<P]c(4oIgWN)(&tW3aAdugsjYIledKPo"1B\m.Mt;H4,`Aa#</9jJ7b!/kGf::0Tn>.;4<ak %,],`OZBGuO9AtHHM3JrrE-'1;?mCh@&7GA_HeH9?]4\'_.$E%/<,pV>Zh-+!M#cj>%`U?MFlIOf(? d>+.n:seLjP!?`irZpN;Y)a %5)CdYo,plj`t&`i+pD7MTD`UK,r8o97fV*Z/LaM4-k^0$L=KPee!P@o-4GUZN!2qldH=L %:5QLsH2tt-,*Mp=X:Y&K&tSk3a"I#a %:3\f.>Qt5ZHj"K7$W=&E!9*?,c(h:pmBY0bBSNG84uX)A)pT2G22*b#4_(*n/X'9fsLhU28b\dCKe+-/P!.U&Oe:PBU/SDk8IHZ %mEmjlULYMLIQ\TH"5>E-c1bcFP-e/LZ$pTn%2,(Z8h+pN<eL&S2HgGT-: +#s[jUR^MJtt51SRq<(6)r'":D5`A)&*nWE208efmX= %=S9HqC*\j?+A1)(>I.S2)hV-n%#^I>8-CYa##:iW(-aad-Ef.*h-649CPF)?\3>J>=fM#2HE8G"\r3=q%o[\]FA?Y_FBHk$.*fP %>:<YeN<<SuK74b1n_,gJ>?9,1%pbF2dm2+b#=r.=P'<8kFbPt!I10:ZWl,N*qc\iYacVQlB_DrJAT4B08nDFFKD1mU',n-D9<:o %$-p^c?^5crZFiu8c`#^u<*E2C`ia!M20.-MSL"r? JKBe0-\lW")MF,K9'XFI+e`b\L'\2Wr88o(@gPG]Z5u??DL0(#5^d"U%KX2M %6RuT%R=nrdrUd.X9/)gYPN[6hCY$-Z^`rf5hI]p,PC8%rWsL*B"p`\2l,M;S"rAg.\E6mBn0/? sCHfuM4Gl!W#YW15BoSM"8iF_P %@=Rk`%Y/VT$1h;rO:kbgFG9'PSAQDqd8n<U@=:B1BXD;<CC#HF./R.VVo%C',A>m?I"].1D<J+'J72J'$U_r.^fH_+VSWo6S3JI %,_:+uGkF*kNa'\n76B#GF(9Vr\qb$/lDDt\2rnY/7&J06n8KTo#K'gH07.WgCMS)5M7j;TJ%.-7ipfajoKp?*OXU9>X8guA]lb9 %K"<KB2D6M`ad2Vg]e_Ggf %T;Wi`*:XLM!;]ACbtUrl/2'6q0lJE$X+L0^gPhaF7OS,K):A)GDbG^a@[nCV,u$+>i1"?AU[\OP%*[ %k!C,KAsgD3a8,T^,aHmo'(\WVDi_56Q*CSY>U7P\E0GDf8?MBI.,>(mLiq! ((Ee8r^KWREC6ea&9U'eYcaSXtbQ]@6Q!sJ3kA/N% %f[1b$$fdc5CeBWO@%Gg%)5lhc=RP@"J4\9E65"=:G4NKOf$NeCs(?<6>GSo"KinWV5sUF8;<b)ES'\097#+G#PdTjq]%H&&#F;3 %E%T<qo&l'F),+0aEs;r27Y>6D,*m;J3$mH@$$!:Cd))3>ZD]$8El0%U9&!B!]c_+ $&384F,aNd(,WCj7L-)UiW>u<#.!/[40fE%$ %Glspq[aF%ip60afkSIS`Hc7>91.3d!+I[=WX/G+1j(a^,G]@qkR2NJASKr"kT3T6UIb$<r@\Kt,`VV:OV, (i-MnF#*5d+mQ2CZ^> %OFaYA5^%F,Vgo?o_gmQ>]PK,LPpH02'q'L0m8bYN830YQ0:g^Fq32#V)tQi4d50&RLlRZs2ei&'a=t(GAnd^%DHVL)Ni.EK'Eml %Fa=j9B_0ln<1b4b>IqgQPTX5aI?74cE/BVVn\BDgZ$%[R1*Oj! UWrnkE>]02SMm5^$?\h2eF;Tb2PI]9*RBVG$^hfkbb'G2HUn"S %ndS'LO>&)qa^RmqK+sSX4ND8JInhHq'f.W]2Fdud'>j9]d!=CMl%ZBP>WgLoR1O`qlO[At<8m5T?d/sgW? `q>W07L]'V2.1o/T0! %`c2/=W[&%LLYFn3oVgj)Y7X6lLaf[>X=@ef!_T4.!X^RGK<qR>8HUSO=?G&tDI0(=%]!C++? NU*=3i,W+DA:S<Z,ceJ%fD`/++sO %_hShDL`JTukU\! M^q'e:>Y[+Xh2MDJ=45N)=7iP.irbFZHjXp8=bdV/Q_+@JfGo)TiJm@JO2PT3;.\KQ3c$aCi! e@t,.MTpQ<;\I %W'g4&NT&>[a1]`UfO]S7UW2L-ILRC>j14X^#_e-E5Z\Ls$>2/S-gn_a@>+ %F<GE8)I]\@.SN6$C"BU[1ne7sb$BM_8a'KSSr4G=O %"WFFL:)?TK4)jr>@bc&9-Xi,9-TZkkp\!SZ:FrhQjFAI<K[XT'(:A$HjMNT'6KFO1sCQfkW(Ycf$7)CnXmZ"6_$*#g4q;8g8SN%U6tC!RZ5O$(R%NkLppXg%^r;S>4c*O?Z1=YSVmGP6As! KgNO4#\1q`o4%6=dH86&eFE2;Ql@*T`UEP01V&d3^6W_pfremd$LLD@E %89kY)U_8)N@1uE@m"VR78;sb.;EKfBNbJs9al!SOX=:kr;OsS&F? Dlt)sd\u107:gn]Ms"19DCSG.";LcP`AUD3?LPbHs3BDcXM1 %"^kn*KM=ACnA=p]g9LN'aqTje=D9<tSeN]81UNNh!`dAgj/<FO)>'k,i#)Y9DBgjd! g&=U$j/hpVa,S0[CttsklSqS5#YY^e?@\l %_gQDlWHDuYKn]*51un<D.X%uPM_30(4Ms$'8J=S[i0NE4?-WaApWkIYb! oT&59jJI(f=n4_>CAM7OBWc6DX#3&5Pb4^J1W?&Jq%j %BG264WYB.lQF]Ls2fhnRHJ:nN>NE(r/Eoa4p,ShJ6:rHj0a4[fMer=QoU\+dFp'AL$D"g6WHW*>k+ +2"i:qYi6PRDM2M2(>[2CmF %a3L1r=2nsfo-o?u-L50J9X^qa3i;cC[O-s1hPbcTV64W;!gPX4\eRQ %:4a6e968sS0BaqY_f`==bb+`:enF/L?[BD?[f?R%Z'!0& %%Us'WfbkEZ?.9@ii/T<i)(>JjDbVVY_=C5m+N0\73.hUp@io@Hj8eI.>D]to:6@u&\aK8M(h8`"$R9)C*NHPq>Ed<enbd_'W4G+ %(m?8Y<J1kh6>>i*ClMSWSVGPGldpLM\,L#q77-5r)Lnq0V4W7^:t2-9TuJr]0$Br8ddVbu2>OZ&@Qr_YSh5N3l1F4(h/*$U#"@k %V)i*@-"LaiNO4?6HFG<i_Y^$B<<J.1YK2kn$)Pd`bG9;2`/FL$+Bh`):bl[;L3? Z'VkHt5Z1(:mj2L/d6WE[M25c.FSGGD*s(N$* %Jl]Jo8"u?9A)9Q\E5Th\N+,e'D)j'TnL8;`Bs$)l>n#Zg<6Hn/_#G(]8VrbCldd3hu3Tt,6qg=d<G:f&g'@2JbGI5d,2/0doAcE %-_2Y*=FbgBh+GP;]nc+Q3+W`uGZb\e<5;B/"Hs*A,P2@([WU@dJoEsG`'")+@.TGpj4RXj=4(BBj %h'q:44k/)Ci[?JnnW:f+4*1 %6[E<V6C&(%8-s3OXeOQEG_hprC/`f!iS&'$q-sc93"9BV$\ [@,e_RJ>Z`u./E>lU6e=B`9)@(RX*fX2XH]M4(]uo-ck7s+kF?7*^ %hD%.O,.G,f5UG!9</o^b8NERNIUh8PH!3t\W+Wp%-H? 6)rV'^P1to"Kf3o4LPp\qk.hWEC_J]/`N=7(,/4r"S<3pekBaq'Cf'DH" %46-kh+9$uRNm]=&>?Q:./Go[(_3s!@S:U'_@*$<A;9n!?0KaUHP/p@R0"6mR:dEj[3a)N;Y`fq!D%%,a\ (VcU,fD`<lMt0+6-bmD %^Ac8cdT[J88\fgCGjpE:NkI:m&1V%'8o*ff=:/K9o+L1B4387MI+D_2L%>;UJqBn.-pE8r]k@G^gWU*0p@<pm"'OQWFZY42GR-% %C?1h^dUU@bEg^$e1';TIlgn9;i?s0P+Z2n@I8Op#iu:Pm1R6UDYX"A+S)'+K6-(W@i\MR"Jh_ %cT]NficD_%m]G8!tLm:V2j86@, %$MRUA%4EVI4!k7t$8!Xo4q0KN,M-EW47"hR,BU$\\r?*nN7c^C8o"SQNa:csEs6YY$qo+]b7ga? m0T_S\5#95dZ@1j#$ZCXBIk[Z %<O>dH\q+'F68:K`oMg)CA5L7`HPje4GV\a`<:l_D'e;D4KHFJP`]f:! *lp58B#pR'hQCouit=CEa#gk[laZEN;:u<n5UC:ioq'.F %Vr]+FF$>F_T,C#"3Wl60(:#kOYV>UK'ZBj;90r*Z*^W4AUT$? Bh\8RP((0riEC>;U>odRI-,lA'@k'0k_'iu*#!kdc%X#c^+Vna; %6P&Ld9>Yan7dk@.NBt=7NtgeEpp);&4,9"d?IckM*/nc:-9Lsim'/k,^_W1k#ur+6j<,cZM %p^H/8=eI,WnMrPiP04M5Y7NdJ=4; %YkI'IM_EdaPBKs)^f1;I@79"Dk_g$qV.4V+5qU[q;\BjMS_@l'.O(^9]65Z-/_AXF".2@EdL0PHcGOdFb^DPG^DF%@%DS;bSOVR %1[NUcWUor$Hq-$GB=^A-F<?-p=Y!0@naGs5S4i(>Nhuu'Wu.qu`:+qXF#!'n4AG.dt)RC_48rn*^[nAFOfu=.1$^48c`BZr\NF7 %:)W_WAJ/J$_UHp>"6(HUM"gK%S,ugo'"t$uBNZf-l_^egl)<)P39YK\F? >'#`1V2Rg3a5/BA-.mi])G9'i*W$3Z-@>"Eq*^jSanf %%LNKFiBjkq0n#J4Igf/JMnC&#>f)DBc21_G%HXU5SNNpo^/<2AliA-`72R.cAWk8hU[/:IUa9d]KU! 9q*Za:;9!%E%*8*o-_V%_o %IGao<6@ckF1XO/[f[P8Eh! Pjdh:e6]A=H6ZXeLc@7BsD61#)DHnJ*<1A09F,`3QX7Cr1du""]tg^Q]Ton<].H&aG")lma9LEr[bA %qbt,p5`/]CQcmD@_\UG>.;mjl"bXgNb,&tV"XHlkl,Jb_JM7=efnXEi66mHt#LM^\,T.tp$Z43''! 1DC`*D6LD[U-"U7J1N7tq,F %11nCl*!Yo#$fjb518`&i9kauH#LPoS+PUD*pFnrkf%1f$oWo`\LWg&smG0"iCB7Cjc)CfPi;Aap;eB! ^KUD4cZ'9E?nIhEf<Y/c& %Ud\EP<q(L@Km_(iK$4f7)tjZMSrZP7'_lEbj[h=Og[Y#D!gXV/Bf(`hDGTk)#^<AXHcZG8_Uj2C5O %@n_S+cUK=J2FomFCX(]&mi %-6o*H/m*bLM/;lkaG]kIC$[3heX,#9`4."p$R8-:pK\'4=YpnuY"KUJCP[GL1Ej %dWZ9I`7U8d4`HnE`pHc/><(INFW!-bRl1\\( %j)Nf"l7fclJme\1gh0Msh-tX,Kmu;uTN6'>\r:6T8!`.Td85@%=jP]i^? QUN7GW9+^.9&6EQI`2NJAWUA+=WGaH`2"L)hNK-]qig %k=>%Gb*uLA;XE5.#$JGH`qf33:CjmK/[VeZfF(bORq'IG5V_>Wa]Zu6/B?i=;B^+_aG(mE4B/&O2;ElqQ! &`?oo16jH%jfT0I+Df %):8mLhIaQ9QI;LLFklrYia),nW<mpGjsNO!EDV6C3jDk>ZR\B^Tj8SLj\W1!NsGI %Ia>D>H6n/BqpohcNd4'e`9R$DmiDdPm&SHF %)WI%#)nd7PlcgkTN457XPO?@f1S'(_jhq))! 0N/HJ2_gJD`Z^MPZ.6ugXm+d\q98Q(uYD=U;gph^$Z8%FbGr?OtQVlg$7^D!r<M\ %K,2hd5*\`,B29X7!dH#A'feKQFX?OGQJrr.d\LZ#oV^oj6,f(W4e"kU@t^S]t6Ib6,95^U\K3`pF+p7_DD"fE?HSJF:'E#:?O7J %Z2"=Bb9@\m"Tn!u9uV3+5`h6s9;4"OT1$[! nfoXDXi3,`\\k,\]A7L$GpgjGq&AIbE<*>"c"Z#:20B'qR9ms@pnMj;Lqe@p:i%iT %M?#h!lFkY2gNQU##tBWq+\%[36E>ba*>j[Ol/r6l8Y_Jqlsno#bm8X_2V1$$6tg'93u! 5t4q2rNIfVs^JDR.@:X@<?%ac_Lqd@Yn %qL*P$m.t<`)g8Nfg]B5#,TQa&P2lXijfDoGMZ+):4i;uE>EXWHUip^-Bg=+QjI5L7qpg-C>%BkYQ;=qArNFDmDBn]IpZEp!)8i1 %Esu4r$j<heSQ6O6"1(Pd^F*G,p>5GGU*8NG5N9'i9>CrMEX\hA:rBOY&TGu&#? 19ZA.Cs3U^Ea8kVitUKk9#]9:>XaR.;o(15N8g %>#kMNX`>1"^R19Y4&KQgX(jr"7r1d;fn)=cpM`W*GBT!J`\gSH!D/t0gD2rs)/4/V&=i@Q7$leM)'QE^D3B?Vaoo.A/5>3D_"d7 %WuuOYA?0\QR5EVf.J^Q;5ZMA')gE+A3)'pV&CV?PTc]YT.(\*.K]fV/<Q7-dilbHCrqP,YNGVY(! H5,>a9W5G$L</UN%:)WeFE=F %#kg:@=,H,_6qio52;o$Bb?8e#HCHF>lR/JJr7FFi^mZ#ND_ %gYYl")5GS:Kfh$N60#i7.K80U`e(tD6;H^Ade31<\haTi)edRYdn %'urSWfq)A)7il%lE:dHqBi<=)p%'(QVjDg[;OI9h&`/m,G*0#K? KS7%'RSBJIj)eAMfF]k$=!\meWhHa$S]os7*9AcBCmAZ."+rc %*T`A&4JFO(a6_lu1i`e4Is(&UcG7pI798sr:PG+)rNZc.VY$@5[q>`S) +t)A(5$,`B\X.>[QJ1:5h(etCrP8+XhH5LrD$`Cg^o"" %<mEbNA8hu/.@XLCNrbCG %C_Ls$9*/6D1G=S&9.Ce4drgLddZN^7;]22YLup'nfS[^V'2tA`JhBdFYOVS30o?EjP;`Kn\cGNpT(Se %Hq*@K#<RoEop(2DWkuaja#AaTK@[+l)Qtb=Ym*,\$>;mtoDc'BT1\3%JCVc %n<1+5iqJX.V1l$QOo_dVicIt2<2F`4Y`VNDUTERI %Elci9pLp'E[eK/cA8FTcf@5VVB:+s,!2:YuAq)ZNG>=hg\2[NdXn%l[Q.eqXgHfA\J6@B\ $E,/PU\VG^km^-V)Ma:gL<5%rNSZ3p %EU;3&<sbdd:i`skPRZV5muD__,W_UD\#*@FG/c3WDf?.N]6q`"R(dGX?^(md+7jfqG1["PS*4Fu=Hr %&_i]#2JSjcjUnH_n!E4-1 %*j#_#.uODY[9KPo>dZ9sJt1it?rGa7A6kqjDFMoF34`k&lpmMK@]J-T;F@Ae5/eRqkILiHkjF!-%HA<%\\ idLL.[b$!j@nP+61]j %rB=GiZ.p*53O[V5?qNlF;\(Q+<WG@0e"E!G8^-D%LX%%rD5(_")U8H7^eLXAo0m%*CVc?b?ibtW2<BWV,uGB*89UZ,PT^F'.6!T %+*UccH6&_mNE/#G6G9?Q2"'OC6Xdp;Y5.TSo"h.HMm"d=^d>uDfmh]!6EF$Z1=j^3e:W>=4b1-;\2#OKV3@$gI6K/2+FLF2L3"a %kK@arNSs,N3`muZXY4/>okuo:'gjolKKRmqm)RE(\r\1-2UQ\E7ZJb\G";kYMV/\_]`#Y#] [&a269rd<E5ca,Joj8CmjBDDOB5'" %4ijgo3>Nc^@(O3HA\s\o`=k2<C_bOPE=`+=EQ<0/%fiOlIA7/mIrcpSd2=ZSR)F;6"V7fAM<ags\s"FTJ2 eus<KokmE%7G>Qk-P* %iN?>BN&sCA08Kt@EuVj8`lEe^'$'96f=#?DgO'Z,_,i+r]Q$9b %0+&JSn<2)HjK\&CH+^c$P:5&`OOcY9C'H3R\rDu0Oh+f,mbVT %:Y/WI(lL>B>4Uau>lg(;;,]^#KM<ePb$dSA3(ZOibZ2P[mfI6TO6Re=ZXG1=5I'*VKOmCO#\<9eO+O[,Bij,QX??;!%^teRa\D( %a9.?GZ1VS!g"4a"<t,Yk=;=; [I:=^PfVCFp\1dG)^tE@q>83hf123@rOg,U`[l`8omK!.SL@WY7;uj(<horE?h"nt8]"'i[V;"m8 %R#Q=U!Zu<C9JDWBS,3#-cA\Q_KgW-UCDJ=mo4c_oQ,-qB*Qm:)Pqm/lYqBnE(@#6cZ*5! ^(ImiMbX#9"2eLLE&>#<X$"b]F"4rYG %[8U,7E#MA"1&CS4jfj`9'e2iehEkRo'.B%/*-Vc>^]bHG*:Mc$T#WHriIXL"RKE*m? N//RY&nN]*Wa5o0jNAO9kV$i^rpj6Au5<L %'7`VohPVr/b=1&o]b#6V&g!.F#pY?B-^Q^EPm$L\S+D,<Q'Hpk'[N]ki0*SV*c_hS)^[4a0LA?G=? U9&EQ8&BD:+(#$4Oo!KTO)% %aOEqog-r)?3OS)\ItTp[K->CM;2_bY$RTk@a>u%tA?0ooB/6repB?ZB! (`(,q5$s;n8M>338ub;\XXCZcUT\*KTV436^%`")4D0' %3^W]D%++Y3Vld!sF:4&$r%b1K8:!+I<-0LO7opF:C@]Dle!!6VGp0Z4WXCo<6Y/hKAb`;WM3(V&7RDalTSQrIu6q^5thM^U_:nt %0Fi9n^!ro8^h[+?`$cC426XsNpW".&X.9rpr?CE,^fcm(Eu;jRqY"(BccF0OE^ %q&6UfN@KF'>!,eUAfiARPVf;t@G%cHdd`<o6r %?)-Hs:M11E)uY1ai]P-<cPJhQ7d-D`Q"$!+e+\,FDhe1F`%8L4d\-qgJeMStcEQ! gD"b#SfL63UEg3F+q+6J7L"S))&[oO)/Hn_g %%3(Z"SFK)[Cd51R>HM70`oBO)*/lQ)"6dV9(2$B_PX/WcJf=P$ $F@H3-)'9_K5qa$57IHhf>/<.ZMiR!.ikF2Ua<A(*+k7PLtel% %R]r,Y&@Pa9%[pj,FK7cCO@;4.TP"/P!)9#7h-*! ^<`VusorU+9AcigbM\n,6N+67u#[lbr_Msabk6aIsi&;ui/R]-^RUSc!)+X%u %?K2(fR,libSJdm$nHKM&4LY!^Vug5V$8*d.ei>B(-_k\$M"`mT/F1:BkOlp5D7-% %f*_HJI8gcT7=e`2b3aae"Mj#:Z^,G>@9@Tc %2W@>28LYjURUgg3Uo$=7+ee-R$F$>01b"uc_Je-4qKSJ? >(sqc'NHh(0q",tqA)OgL:5iCN'W<954>QC/s'Rj3G&CPoU4k?7;)D& %GuUUK$kYRp0h?kC`O^O2`gUo/lWoOUCP*$<i\U_)BR6$XYN"3O0n9f%1Z)cfP5$J:_,B9mFUh^9L:9MZ;<3Yb[,,<m0ci*3N[?[ %PpKp/]AJ6]SH@_bVS5Wr(>DCo?iXREnXnNCQZ+,i/V"J4]k^=BM9(&aQVe&&+_='Q#m'FCTn31KRYG]? l5f"@d*b*r\9Es/YU+i/ %]2.3glID6aMpt/X0lP=@ku_Bd^PQQnl=`.&8N96LmoT[A9DQJWU.EMJ32D-622eM85;@F=`Y2AN% [JCsZQcml#]P_\LW-*kM]/9M %J'q]^%E9".-;0sK+-/dQ41L&AS3^JGoE`;"or8)rXe=A,7caZ_/NI+@!7X<)F"27\'CiK*?j$i[K? F[O(r68--tG!mij:6,ICH0p %%,$MX;2jF6:Ndtq,o@%6rW\1)"X@iD!\ %lY<hE_/GY(pP(;2X'JFi#E=46c#H+5:1YKGWh^`l*<14eWm:a81XI%Q2efrb%,^qCIU %%X^a5Y`B9@,'G)gWtc,oY'lqKEWtMYp,PP)Hc$Y;f);8Ca<5dpdM$.M";QHO/=N\nTRmQ;:^M8'G8.I2! +ob$\ViYKdDqeZ+I`=/ %">G]))?<VcNWAs-&^EDdVHjR[pg]2)g4(\dj"(9O3X'%@#!PQogC9e-Nfac[6`? eC$Cg;@)CnVP6"Y>gON)DU!Pr0Y*jV4;'T0lu %(L'XDNQ3c";ZoNEp+=Wb-2?/+i*NoYO"h%J7;l(GS7')8*MN5JOel6FnE.bV6tlE=S1s$FhU6A!J"C? R+Qg1O!]:<QG.qInESX5n %etUHcX)rM=SAMp<XX]ePA8/Gn'KjfjMoKB61ekG6EHp"1#Ou:D+u=P<9(&WZmJE4tc#_J^Yt2c0!! W_mJIN/5T[25GJ>)%C6n.HF %l"1UZ$.t869I&XR7[M@HG>dk#Vl2(t8,NJS'kb)r\8\-br'3[HrCJlM'8tng@&K1q)28pl(h(?:M! ZhV+>muT4[LtuZdfQJ"DnZK %72RIoeSih>? XXO=1IQO$=RCfcF4^s,V6#$Z)Vd57<2Y_4+))N8dYnf.^Z+F)OQBcXIkq/X+<DOZ<_he'PbA7_SpBJN&>'V 42^(^R %;-`XBPLIfW2jAPpYOrMQ1sU2`iW;cXT,ig)r4lFJMkMrJ;t)t#-)PJ %]q1aaeL3N4#aKgsGgXSZ@__4Qeo=MPm*Zb"5tttJ#Mjnd %Gj^:VEAqut(i5>UfWqG+<cV(in:j?Ak$jm[\d:7,n40jM(VQ02&e`uBN?n6ecS=DIeMMC99qs';H8LPd="5rrP>fd0=p%oL5O@r %^/(6Y6FTiZ;:Dh)$kM4tI!][c=IZnNhd6uj(A43N3K3>npDiEGSLY6kd=N]GY>WguG^'K=8pC!3-SFm\#-4*cHij$iu!`BMeNE? %;M5^!O^XiiI,X4n0HjiuT]q1sLM/49=^X_G$Hsj_!D?! *hUQ`q=/^hrhK2:7FI:mCKY_9Wck3It&.p'BdHU^=^9At[6jnfn_FTBM %HI,F_]Zfc)O8:[<ds>%r]SY?6fSfRuTO'oDZ.2"i@[;/TSN?Nkjt01\IFqmFf@PYr/C,kpZ6-b1:M/H! HSg\EQb9!N>=52:-??u3 %`#4MUcoXQ7)q5`'r-9[,A#II60.Pe9"X-HF"Pq-8/qEb9i\kap->5aKqjSJj_I/:*g8JY0+'! srB.kK;h[5$p]ABjs,$Q1WQ\)Kk %86-:W/o]:N2Hf@f?utNM$9Pg@$\W2%X=TE>$mHLnTSK%_(bo7`n4fGT+*eAhdMH=".d[k5g/hN7cAc? FA6K%2mrR.F_g"0].s-Aq %pc>u-#oPu\]lQoY\nZ@7]R]nDV,\cr"(rTYj]k3iLhNLWo[8ES5"ZZM`BqUnh!->Ycad]oQM1<S;QrCo %Wt;YmD'Ll[;Pg$#l7Fk %j%tEO'eX+d6\o]dWB6!4B:`2$GR.qtG*#-#@mC[o,=Tj3^9))r1M/s9ntdHb=='jjGoQBoaa(QX@On5DJ!a7b>Gd@Mf8_k=`CN& %N/r<N(9,aum:=ahI<[mGY%U!hD)7,]$V=4fcmb&D/fh?c/m>Op0CG%O5/MU!_e1$2*@^$OREd*u7R%T*dtD:&Y\^PE$=)D6a=?n %S*md?nZuJ&PHN^3Q<Pf+Wn*(qf=,aalOlGkm0rj(MaZG78S[Dk<7#ThdIYuLe5*`29d&nRc6! *=_NV#m"_ARlU*Rmp*;JCAU27T) %i;#JCLa@i%VidS%hELMBZl?r_OP.jHUZQBcm:kc"%lN?o5*l#\-2uksRg,23a0$? 3m@n@(X^/P3f)B8#1SB(^J>n0/`2(Yu)'Z(K %A: %HY0F(A':"<HRK<C=iQ'eVH@D<Znp'9a\amp$;66Bj=V'qani#N'PmFKj.5ROGNHZCUXeoVhR&2uNm6IR"B ,WZ+s%+eg1cF4mi %S?1FoO*[? n"p'VT#4Og_qj^D@;cMIk`DgbmKYa&cZ1"Kh8*YL0(o[r&nFqPGBM=eM_RG,6B@'FW(E6h_)U@cKTt(>bXO 1A_,<q8. %SU;7n.lVpd[0#MI>A/>9Ol'h^c1<.X[QL\aX1_;#NY_")(m/Ynd424J,4[dW(>q8h4>Np_KCmpdj$\TVc4,)eSgD`@O%M?CM$8A %rNsIn5^A6ulIB%P17&*!3,),:@a\q[l,d!ko7Rs9XO@>j.?Zub3@W?,^qica^N0DWKR>20JNS)#>Rr<',R:CX\d+W_;S"eIs)_j %Bkub$%/]M8o:`^d.N,EMY-_*5ZU<$54gh-lR]?A<%-hdabmG!'q2bfm3AlHgS=F7e4:lJUdrrYN$B#:ee@B-P`D,Z\Q]Cl(io50 %>F0Kf]sCpVL#^ZRr*oX'i&l/+riS"s'#:1j#@^LiF-UARK7IpMdZNc1_Y0F,EZtaKgJD?f2MIVnK"f^R2\ amk_:-Z3'o;"Bon"f8 %Y2>?HN#V2fC6]H9<4+N1!K^Qf6P`V^CJ6a'h\_!bk'#n)/CLHDGc$P_, (kN:f]d8ucInBIn4**U56EXJVh+/$2eQ)K>nFh4#J7bO %j<(DmBHE=m/m2KR1m`o)DPnF\"@]5[j4)k]5N.7J;4#:0'0S:7eX<p(\r)SfYda6k]MoAXH\AdtBT_hFF` !;J>sA-taK]Z'iH#eY %"B[l/7B&^[]H0kaAGbsj!M\("O0(-Cm79Oba22M+61s1")Cq&g@Dq^$6M4fi>0$p/6iHDh3@m&Up$QH %<WF``7Y[H,`,D.I-*ECU %r*[DmSo4>B_kU[lHt5M?-,k[SCB?qt4+1R]l``f0dpQ_b_?d@LG<j7K*_CR0bUA<%CA3,9Jt! 0`,)G&$1%d8F7XCCHFd2FHP6qWi %=D)@4m%m(M^5EQL"[t0VFHXBT/calLlhocl?F0o2c#"98Ql %aLV^OA;o1Bt3a/kV9(S\6<KTNPCd4EMX[X8k+BX9E]hunQ@ROJG] %itd.de/GL]4N&MqPU-[Y.C(Ynj>O[UT]rn>oAs(+5kYhV9t2"Rad>i1p,7bZ`*PUH'5GVb/[TTK_CQOF`9pKb35[pQ%)_8/@Gc, %NpV5#7q4;G</A@<kf-9^c!sf3b=l,q&DVponISW^FXSJ=+*V#8!ji^&nNA#F+/:mFg %>$,k)V5PK_oMo]RJCEOjFr8!F"Pg.Ke_0 %ITahs4:)S$<UYe"%aLOBdG''$KoBOBFBb5&BMQ=(0@kR.6Gid=[P/4n"0UtT_7K.XF@J^pR3SAC)SL,_Q %T>3K;Ei,ZNH7G5T]6H %(@k2X_71(q`X[\=Fi_D10ncKLA&Ku(V+ZH=KsmZAEMHl#!E>[s5Y;(h@,@@k; [o\CJ:`n.hTlPu<0qi'Tr-IAa7_tPP\Vc#qr*_E %JojK-n`%-WbTqQ9DV;b4e1[m(KO,QcM1)lRXnNTr.(%ZoYY6tZ"9q1a;h]sPoSeVYjUCs:"! 6LfZ>ZELUkU)aOZ?POE9!V]*nsJ\ %\X8Hu5b!0'IS`S,^H&Q:hf(b8FD!!QBhHELg]=T]Vq>UE'UbHF--<b88)r0sf!(P5k! N=b'R/_RK>):*VI`m4*a<U-'s]i.@is67 %2fIFF:aN=ZkXUR<`Pm4.bY+?&*09o#!l4+N!*.tm_!\fE%A6Dr-(X? cj2o1fS(CBcjucS-):9GPQ9]Ap"\\lH)@3)jiq[R[1i&8C %a/crR1K:"MKtt.N>mdPW_[B.2\VM'CcVOYGXA%D8mfJ!4SaSk1:6nu!5[pEZ0NIkkG-rGR-*r$B@^=JeD %*HhBcMo=ICZV>:-AsB %W9? c.0tBK7;dN1mXE&lC]^eAebREUK\ZaR:LG6AQJP(audYmB0,-/>cEnFY]r@'O[(p>PH_)lM.\p'*52;IB*0 'N\aA(^6fR&-X\ %?9Q#OEp3&4k^a1/X?G4E]%EdT`km,!Y:uBE":Ad>+VeuocD]nV)lpgX#\7:BFREKJ#2['<KD7HF<Qp3=iOH)mM7(JKQ3PLoB4cq %YehZdJ7T=.8`3U]>[UZRA(5oRK[n?T;)e5Ial'6)i'#OXcjt7ErO6F-0>*0e`NB%l(D6'@kWE5c>p! i:Q:7=6[^&lpHr#SA=$h=n %QoLt?N!tGfWXB`u[chF?efmk)J-n#;780tR1?'e8P\>_L7lB %U&k2\NEhR@2aRp"9\qp9."Z5RiL"`+N=9N0k5'e)7iu0Oo5OitD %i8k+1m)gU^fUNu5&m8uVGq#F,NiX,;SXo! (&6]FC188(9+1k"%/O,RhU8kFTlVQf[7]K3@$04*"C1Dg)ZM>7P2CbAbi:VKLVgeV& %E\ma[%kfjTatidT;g`PtMXnT'@b)DNU%:e$@"H*<? *Gn(*X'O1;K*`Y0@j*l8F]R:#(uM(*QUk7k31pd,@M^+"(SCN%&dYaORBHr %jCf(hQ<mnQ7:lhi=4An34g0-D2Y;h[Zu)Ppr;@a3-tbYeOm(DEd)*H^jLD/7hR74@S**V]aU0! T69-'>WHk'JD%J;7JoX$fp[]mE %)W].%Dl&/6769/BNn.tKKp!le8h$p^N1jhY<]Am;_a5m;@/VB(GY?R$[4O'ISnYr2b8]IpaUhG! r`DkuVA";:E(IV:A2HT&T9#?S %KF[Ec@Z(K3SU[LAODq3XG(c;?-Q[dTSW?>PGR>P-=3lTe[7)B]BBDs6%4_-u]IY>tBG9u,E'nZ"c>: %4k2h^lWEV+1Ek**uY)H,o %8fjn+%X:]0]C@!L`A6+FlB_RTKas? &D\l<(9H&qV*i'ZVEe9VE#_ea[@YL2'kGhF;c`8os!]juZWC&LkAM]0GR'XFcM@OW;-YY!, %$%2-G4'F?uGYkSfBYY14!DZ.QY#7?M!*9-XXFlE'p>=.PiPd0g're0<BD+%r97T]/B+.^lEKEq5ca,k[#/ o.8;;S_O'f*HJ/N'S6 %B4gm5[<Eh$!4%QdNPjma;'.bg\oi+BgKi(.mj$7\ZVsg*ZDsZkS(:nHmeo*9`BY$`bY=0K6j2>XZ*?/c %@iAE)SJ"1lO8tWq5`^* %_=/*]"\UC1m]MWQm8b_>6s(0R@MM0t/hG&9.5@I)IU/,0j8ImFYWr;e=gA=Gh;(7>CU+%I4khm5q08kY@ %BHEH8lE&NoM=2F[`kp %g,1,/is^'HKIAhcD*4juI,F92;'Xi7Pm.WO<Ra<I/!Ycg;7XKJp2i %Z*<#3F#ogt<GfPnj4XtKUTV9>sg\/b+3uK6N3e+T5AqH<S %0lUUK$_rD&762&495r^/W&N#WGD\dT/!Ouno8q0J+/@g97u"7d)eUe_%&usA`\4HWs.h(*BBHQh! ^G;]@5F^O]`^?=\.7uO+@=5> %b_nRN);c'R`rsTP8)R9'[rSkT]Q_S(Ha1B@Y.L&[AF`]!ej97?Y,!ouX=f5!L\=emH_>Qo7L7_[>8AK9nl %P0f"uQobSWe$'[u^6 %^<J7QBpo:-4so59=@O)?I3k(M()!K8"5A/OY['*g^T.[')E#:,g'Xl#G53FFI[e2kf;/=VB$#n? 5t)7ODK#6B;.[5LZm\tfB#;a9 %d>KK^a$bX;l+8Z,Y>.! U&T^S^lIrMOiY8$HCj;R*^M`b4K_'JaaqI78Hd:)]''l2P`g^ZZQY]/72RQ:SJ8+.E0nJRm^Y.nL&GPe5 %G%;3'G58b<=_P7OX@0,/=c_CrrYsMk&gtGqO&?a+fMNU[R6h(j(261b4KR^J-r5C*IC+Wo]66/hAY! aKErj+b.OVk5"pkmt7VecQ %/@7MI5Ze,. (u2/]*N;/2)DV?:ZAq;e))S*N3@'=;j(.GnJ4\HRaZq8$hrmtNAlb/l5/sZI9%mij3,50+m;6;14Q8,CIfL 1*MBfc> %#^tRtE7uJE99n5CjU=111.g@Q0p6'YnZ9EEEm2A?NuuP\nd'U3S=Jg9R@T0uW!6':Do@;? dL/uN`4cn@L"Im.1fu$NE:Ucdc`4"$ %j0H38_HR7P:X8SR>gHg]=PEoFXIsL(R6MqFC.*5tYg%dL4peWWpt[Q=W=7j@2Va].&RP?<? uLY1JL[B0MDiWk&Q?cd3S5)W/n_MD %Y_l)DoG\9F'K`)c]r5.M[[fCjM\/'UonbA^Zfq**RC8htmmJCu/f\ [UrcH,tDEI1Hj5!,9ifff:1W"rkT,A1+bRej:AQS)>`5W-U %6KbijYVLIUC^XD? DI'bVZR"ea+:Q2#4&f>i9g$LHiGOYDD]a4Q-'%=e`[aP9I4lGt/:^lJc]"`gVSjCT;`O^'l'^NZZ4bo*O3S >I %Lb,?Q2g.1Ok_6ukV`jF39pcu;DqW%FfP!S>RA7d(au9&l;t)K]k)7o7]<gftTljYY^7i2lV[*KIhl?3p9\ k:\=MD%))>i-$1#h75 %Ag3oUL/hi9?9]Wt?.e0i:04K"'#RP+i!TbZk7O>0@Y0HIj<@mNWAu"Aoj=fX:4NtuhIt"RS85Z*"0? p.r,!O/*M9G#,>_%$6=X6" %GcCdC)c;kf3soT[P#)gUh5GP!@MK,aVM<IOKJ'#N4e??MfY+Ic')bLb#0Q[;-.l[%FchS)=)BZ<Z1X^2e\ B!LiXucU_poaF+7(fZ %%Ttg7^Q\cP(*"jDY0p"qo6GMp^D6uc$Jf+9%07Bci,*s[0o(R/kn+7g"]nNPBiX^GE5=$q]<ENMgmR9Rp_^BNu=(j[iYe^ Y!175 %nStQZ<"6]V!<\[#U6p>.aRhG0ej5=2dSf/WQT>sg_4]e^X"lBOEmJY-N?d4V#lZ5F? qTK"p&\Pc`_AGVW;HoshD.]^hT&ne6-Kg< %Bk3E,c/(=85np1#c;;>VIl+kOl(IdPV&PD6i\rQDO2;$TcR\S+!PQCsI%LrXmXQ+*HQV5uRCo]=9X'(M3&-Xfn\'J%F34Ca]]qI %!%$\hNrushJ$=ag&MQip^s]cZgLR:7,R,bUV:@)QrGd^(.Cb7S:0rR0j7kpiBORI#!pBu-Naf9S %K]W@0`s)s'_7u!8G<Nt&-KEN %bf$4&c?1Ln_MkAdXf6S.CJ`pJmtm[F %Mh6fEC`saHq1rSe+1C@I&Fs1]rE3#H/ajFiuc28nG)Ki[f`T;7S(8_S"]h;Q/4E_*K\8Z %jD#_k`Y^J8h-fB'q[o%5O(:]THR2P/B]99k3cU`R;QL7aFT5B(,aKXj]8gmN0e8IV0lI=h&4eR0ZuaKA4!p3cs"8BI99M1MSYnC %E_'RN==d60i\"_@o^T&tRefJ)&(b;SlCQ'L!9UXkQ.4Q%J*0IF@fqpSm>(QXj5Xkf`;<H@8"e$SlQj^e@hE[mV#P>F1635rAt1` %SO78UoCW[OBf(g-B`dnj-CStEmm=tCST7]e%kA#>3oMbjLIJ%NWI&q%TNnkJ4PP$Y9F%<uq^RB`jUUQ4?! O69,A=7)dM[cR[f$h%@l%c?>rPF3!%u2Mn70-b;D_hua0)ICmVOMbe6nsLbjYtoHDl0&BoM$+0i_/! qb;*8J,6`^nKdt0V4<$/gI1gZmm(?o10#!P7]N>? %fqZP3eQ8m!%n+3*QaY=+F4lSG-HqY5&Q[[;fTBIi2=<M?H_We[,S.bn$pLmqVM4cP*P]]jj5"e,VL? ^#K=#MiFV`8Q]PYGW.=%-R %eX7V(]&HF:UU`rf&:slt,H!n7!.LX"8,LM)M')8ebk]&#"Fh9PqKOsqB8M[L@0JHLMr]*j>h;=)$Mt?c5K %&POMIU77aRd*hhAiO %TRa^,?GM7OlFo`VOj9@2fMf\t;GsN20#L%<"THJDT*fb*@"`1R)&u<I.b62Ik/*7t0OTRgI7r_8mRZinT^[eBa@hLV@ot^%FAN" %Ju`A<Yl&? p\J^Ar.n3:=FLf=GZ/AO_Apgu*rfAO=M[a[WH]slG4u&i^<8[%tJQ^k"p:TuO.TZ$2_nekl<Y'P0bTf11KGmCfsq,* %-a0^7a;0B5:KN."CcZU-hM=ZYSM#"&#"Q[@WS6<k%5qOIZ[0DI[3M*NR(Z[tGgWZ!1sF+%C]_h]! I5'`9aTN:?GNtfh%.K2Gq(P, %Wi^FpO!L<Vh1q%4Q[ln])8]A`/!n5NN_^nToC\c2Yk$r-X,@pd&,#H,.opi,n^I?NgK:h`3cQ[bF65rMGWaJ6Mhf8QWJ=fHtF1$ %"o4g44>_AQ-FM2&POuD^_3&?\hof)*h\\16m"\?,ghU8\^OM9_,Xs*ES/[+#dYsLPCB8qr3?3^]"%C1$ []MuS;n/8hLdK#%rr%[8 %^+ZuW:C#pT#/Q*'j,U1e:3U97L;e`#VY$%1\OVU*L)ueH<qcEr>_k<q.;3p&O[">S0E+rRe! g78n[gr+E[C3h?W__dJ#*F[Fuj]Q %3?5>R9Wm$[Hk_Q@<J!:X-L'/`l5`bua<</<hc%9rgnXppC,[u)'nonR#p_\E!.oK\F;$R,qK:G"/Ujob59?<gkK1&,/*o*;l%2, %?6G7a&BBenrlOp6BRKTk++O'ts4n1;kJ)KGLOYH8O8dVSIe#Gtp>tamrmSn#DYX'tJ,JK %dI`(kr6::Pn]/)d&+0Dph7nF-O+-c8 %?[_B=IV&QFY?iHDdtdtopi$3,_tL8Ug5! H@n:1FEl,-:<kO`tJD?'#GUYoRep(^<:LHFLR10ftBSO]\XNop8e?An%R@P'[B`'o$c %&>,i)KN:!!S^@!Bm=>*O>B%M#_l'SU/Ea9d7\cW-lU"r\fHb#6F'(:u5o0(k2? Q3.>Rq9F1p$"3I9Z7h.Z_fHkpn"r>C<'g0KW.F %S_"1lBZ7u_T0"]BL:`>-W(-$lGs2POBkWPH\hk/s*1qZUbSA]$W3nZF@,*C? XWgi1L@jN@Yt@k'l[4`6gjdW2jZ]YK]9XY-bo2te %qni[H?1Z"*.^iYR<)`E$flFlfF/:a-(udmUiH`ZVT)(Urk[e`n=q&if!,*NRb;?YqE5d!P3WgM&;P: [FBfg=IN<Rqd:F]kKq0]J+ %.PqmmH:gbK>;GpKdt0M&op!p?DN#)D\bV.UdA+O2o@"l3ph13o&cPUfn&81*YnGSrUgMqS.2/Akd?\qalFtVR(`JU;Z>;e&T]F> %3"`@17WE/\5UZGD35W%Qg@LkhT%:qZp%OOE-6D'"#Q@-gS;>@#,>tRss0X&rY,? u;;8cnj3&VB+e=sIZ7,$V(nYgh2Q@C!7+KE&, %^`6e"#OI[@T2#j+JEN:,f/?^7)4C>3EZ!PsNpJgN9?+Go"i_#`Q;^WiN_h'bn<EE0:6@]BI'Y]EW)pBNT\ PY>.FeEtkJT3@&tPIM %"6hW[aYNfjj;%?$Z1G5c/.^hN6sXkZSShhl[DK6+/rd*Z+i8Cn^E-TC2u.Wa)uWK#GD"c,<>7FskW; $L\bF%ok+!d`,PR/,`W_>c %adbo<.p-mojf+'ohcSi@5qlIO(obAhS(R^sn8R;fKlN6] [&TL/o5hdiH9[tZR1l`N$kRYpR4:u]/b7EmWS7dgE0"AGa6fWLT83l" %I.PDZI$3fj=8((bm+mW:l)b9L)>pik%G!Gr8d&_Xi7+,:(6$"XC`&+d]-d)-FD0KWqtGN0=b;'B %)MK^<4*&^7V>8>]?stM/Na5m %4!`36,O)N]3IJDH6#&kthV"-#e,i8HHYghCR+k"j&Ar.e$>?aB^bYanKlO#U^hqb#[*P"7L30)41c! (NW6:lQCE8H\0sB!rO=%+5 %=)]-W"%?1V5pmrjoB<."(Ni'Ei8JbIbS'LY&!o+7g"HM;3YN6lK)IX*5'gOJiDIO5>S>#!+ $V@2:%ABJ-'d4IYrHCIWL?aU+u#pV %IqQtLlK1Lk(O'$fR"KDY*^FIFS'1JdWMW&/Gm*\T8K\8X9%r)R@TU&569a?;d9q<4^Z+keA7V6:"RpCnPc%=b".5!VTm5gnY;&6 %b(:5Y]&0#ErX>_(d7k"Z!U":b7/Y?hBH(#? em/L^eLK@CUPK.>+HqpJ3h3_ORfa)c\7;=D1`fV]=J0]Yc*]gGmX!o!-Q=NR_j_il %(g6>Q,N!Z9f7%l@n-q>to$e4ne2$c+P3$Pq8Y](T][/s\GM:2?jo %TZZa,<K+"%d8Xl6<.]ci2:X^SIE89e"jE/8CN3s47DUX.#: %cTsd7@r%9\lEOXi#]!iRL!!p^7]Wd\1h??,nsp^&*Q)U((#KlT[hhYlJ*N;J.UJ`Uj6gkCAI::.e@hkC1jj3`CM1'O6akD-B7(u %pTh5ZIhj\P3b>@QfdSn8i=kP%eu+K`-?QEpX^E"#!GqYIi!UO2X>D&8YjFT5,)OjAmAL`Jh/sEAo]HKBqilmk+8BR)?V6sgkQP% %E\tP8UQApgDl\AJe:Sn('@#8Zf?GoPmXcfKdPrZE)7O0HS>d_-*apX)XXS2Dp`D/N=o0T'8f4*":DI\! $e_<FkjsuFGs1>pqe*mp %//:9;lse.rO>tZo[j&PB"\(Q5\n^]F&M6T;@-)t:0Ptu$8q%,G,!./d? 9$h@Sr;sZN8CR95Wrjs\;N6aTRb`X:k%$/+cE;S$eu8b %)JmY1lNa2c)tT%Wc+U<bF+>g:De5tML:B.j&Pmhn;"tD[5X"Z*N2]DNLU?'8Q%]@ %MnMrJ]>a,K3ehpiI`0(.)'V#u@-Li4J0SB, %E%m&%!\f+"ZQ>VIgK(u%jKtOP(KZWmdrGKHpo/D?A2[MPrR_nYlVFlP[`T>'\qY;lgZ:mR&% +sub]\Mko6f3hBO_2d[f;Y+$Xn*u %TARSa+Me(fCVjBPLOg-)W,e8rbtU]ld1miNn]@dOlB+0b.'6b5rjSV14,r3q&*%$tnB,OE'cqX,nE^cJa? C71(>kIO/mX7sVh>8Y %)a+X."_hnGY'Kk>Zoap7]HR-S<YUqjV53\U,%k^bqrSX#[c*U`2"Kp6[:eMFEnstWHaID^:HbYf'Io9"VX\UdtWhk'D5KMZO5s% %G0=dR$/$s"VOVdU68Xdc4:^:16R8a5(>XAZ.-/=,K<^#,O.0I-"=&jh(?%`WjfGsiiu1Mi+g=;bc^! FCrC"7nre9QJJ.<$.SfP5K %:GV)J8a<V+1K%j#bd]Z) +,,:.nRG.CKneG&'\@GH*nBl5QL(ut'<5%&pa,kYb@WQ@MCHL3MFcfQF)oi1"3n[,4q6e$<[])p999W; %A*KX)kbl7*9rCDq:_(OuM+*`oq?c+Dm4&ftH`9L/4\'e? WPZ",YUs1XR&B:J#;Ri7+u;4sQf"*bIn^OR:L>(?QOc=UiD4q%pYYo4 %LOZRYo_='Rq;oBioU?qnURk-@q83aC`W#=uWP()j/9WSj(NhZ;! jYnk;hM//AjDQYhM3H_0Btu.DcPX<>37\&Xb//DD"P"2i@Z!h %r=[MhcWsCLG2TF0f4p&-F0Yfa7Ms3o9d[NCkg)<\'T2GNQB-PB+?'usr7*BDr;"roDtiH#J,? RErV4Pp5Paf0^\I=prqW%UrUN>O %it!4@#l6MEIJESn!3HNjG-lG+na"FNr"IY:B<cgYYWpu@/'#(/? iT0\rhs&,CL'o[8_K#'q]h</ZRV"fnu1+uKDIc<&ke`9H/mdF %*`5Y!<;BXO1Oe]brd'hD>/? 7"Gm+Mlf:RQm+9),Gro(m*K*d..Dcm)3F`b\hI/UIf`IIYAqbR4b[pJiRI9_9ufAHN$VgnO&?iK&W %s'PZp%mP=7iEuLq]G(>4++F3I0CeLU5/5idHY_ll:;c;_qtu/U`O@N#qk)!>I8fT^J+ %ib^ZMSGirS"Z(%6TNms]`SI\lL^df7'B %`'7a3q6?9L0SPrb<Xih!rfU9rRj`:$,WWUHR2)M(T=Lj)/p^lPa$!U8Onk!U,(,HU-q5F\ $P$c#$Ya\JijoIo/&T$_bXs0RA9NT( %^VK$nd>,g'8'b*IYmQNjH0=1:UC4I"3Bc:S,*q-,"4i-5X*Re2E@LU"IJTtR$INDls6MHEXSmQo74e68EPYqNK+p=o'P>;m(BFn %p`ACUq7>j/kkG&3YCFaQSWER5nU;!J=?U!jTC20WGCO#:T/!qNKk>#B&SVL=(Q<P7N:[=6ILi2$>k3?jL: $6fTcZdsbTO,hMVWG$ %'`qFLk*d?R,Q/\k;G6(B5!MnD"Ba`in.b4SP/+SF@Q'E&n0f82SUGPurZ++oNU%@G\?Cmi? 8Pl_GLcdu,7F<8g!=kmMBMfUqK2ic %Z:#5?8ILpdS6Mn,YW^]>Y/X?-0m\^:A#_D>8m!i\]'UKa]Q((\WB9!Y#2<8ag!C? bLl73>6D7`AL>TieAr!'ZF,-p%r;4"AO4dim %LY'UJom:L4fo!V,5V:`>T8=7Tj,B3d0#O4<a3kE2qUg.113E5"O+ $o7UKGXUML3;BI.e8u.K+_1qXne(X$0&&-hB@q*<2oer,#`u %%Si8@eucaZKlq7qY_r9>\D=faRi74C=bEJ,U5aPaRlJGMX6;r+>'2/$oJsk2SO09(KuDoZ!:Z%? #LeoH$^sBN)K"!,2Eq#B<i?_o %Y6gh:b$qVKQD0Nar7bs\^:FdR0"qn!4XVt/S?sVWb$(<@kbmb`?l18!!5QrRkmKFfT)fG"iu9Dq[(4-bki %l;E<j#WX>S&Xgq*(1 %>.jfL@GcSLnK8@WO.P:LBnU>S?g':M2C3.+(I0HC'f;j[nFYJin/Hda1Cu6gU$EV-TI9.,\t? $h6U&@erj0+TjNp-e-@'I7f3h-h %5F3r&H+5R-o:<Y_<`JWl\@)rHFt`T:rT;_Hh/D^4[.B%MidW3qpU`$T]0dqFf,t%`o04+! o5B*RMkC#6hn2BR-EfGG[Jb6`1bU!5 %&&/QSBi?bT+=mE(A5dEGA-JcacceUKlYjN3]3i[XJ,[K<qW6W7lDK.3p)<9Irp%b^Yuj(FbnCh`<&23V,I39^Uu<4odOb-[Pnsu %-HCGJ84TEdc>ScoRT"9:a(?Qel!crD=bQfYE_C<DqY>R2^2;gOBG]eZ]&D6Zk%8X\riOpuS^oNf.l^1n/ %pE2l)q[GXO]LXqUk:6 %?N5C7bfa1qMV%CpGo0ogr,o*l]Oh=Y.i0T!Z0'\DSlSO9@t"?!(^4d;Z\&/)X&nDaEM! 4+X^euhl<)C.T,#[p?GHJ]:Yn68CS(G$ %ju[R,Rc-cnLZ>9VY(8T/*F!5.+n#c'Xqm\**ieZo;R:2Ki(+Mi:WsM3'S#ZSM`MujjinQSrAGsmN)2&fCl'Zdrk6pEI:#aeh.C" %FWFoi6o2%B/>.?2rQslbq""F?rFCs6T(?4b`g1N>PM&$N*s4hKa@,q!3&tI^^uM`b[UWDVB&.Wj"Jp@=;YO`f8i'4f6u8Cc(A=3 %N<F`n^%[[g3-(aY",q+rUO/g6:n`,Za_-Irk+!N?F!G&KhT3YT+8]bHO+7/GkJTXt&[Q,n5i=hJB%9? I8$e/oRV%=qd&Y%LO\!M( %e/.6d6)/6]K!L*hg4=6W?\q#m9RUCV9@,AS-s;J\aN9+VA*_dXcA:Ih-hbo"=_g'l#?oQ0%t`#s6!Q$g! GFCQY>@>@[L&XOJR.bB %G]e)0K6AEZ59GKq/4H!Tp0WfB]'VK19rPPUj^^/4RqE2nWgW2Kf:6t1NU,'s>AumEF"*_fg!=56d %cPOpW&B?_5-pL0?4hbm+h:X %C7b$II#MTrEBR#R9UU:fl$n#fa,@ej$am,.63ZMeO5nE]Pgi:P+8.1l(*ict^L]9)M2J1/"c_<0<""8'Er .=a\nhkq*-n'BeeZct %Z@/%BpC[&pfNeUImq4o=`j[%Omn\jKjI78(5(#?,G(>bO$O]nSDBG:)B&Nsd.f0nr(scBoc`GEgjYR\D!!_"]dVDPGlfYVEakXb %^&HRBs3o(lV*p!6c9nq?8In-d^W,aB-uPB4Tg#(C%]ZT`r&9kiF[XY'kW.L3a%D%Bb\a_,nT]1dM$ ['_.tHPnj1gtX!,a2oL'^:9 %6Ul[;bhhdm-q$#:b*R0m-0Y::R0SU&TCkt/_45R1)_IG^,)Xr21EIcq[6L43dl.M_NpM! _*7p=EV@g60gW7@YeI7TipqPeI#(2:h %_6m*]VoI1=RKG$f?0A-)-Z0;Fl-nsJESUWT`/"`plW#C`i/@]=`\c&c$);U+0cZd*glcG6o<;GQ]3k#W8jCLimZY3;oAXR:PQmZ %or>P0gpg_8cWn>#q!]jG9W!*iDn=?Y)A]5<I9,&A<.ib^YMf2dn.@O2dLh?3Y350s'#QY9IV%"IL+ZWrq/ G@_8E&i+:i!cAM>8(I %3ct2j+*d#?q`frtr;/]^:X/td<AF::KC3,/?H52g2c_*seq!-phYs! d6qJ=F'Fb6N*0(IJ`!/rrkOZ.M\R$;in[[AbRU.cjMqSKP %N?',_"$u"qMWNd/cY#^Y22QUE`YrTMfA")jF,;:mD#THS/J=h<n3P([8eN8UfAQg``Ju(;*a?YjRmUm5cS4doZq\%gsrU_gu:tQ %pSn)e2sLpuFS,MRrU&XC<30N=kc2BGf(Bs*Dq^ %sVio9944\W4YJ+SWqQ>1qGMfC6D4g[M]@==W;;ZYSqNh*E47>r%I;etjS`r6) %9AaknqX/^YGMeP^h=dUdjhX`1+ZW.Jp)r7a(l9oG*ZGBtBd2FG! $Q.:eCTO.Eb(%^[7:tfaOP)&M;r3F)s"c!U.sX;^5KAd,3&h' %CGUhiXl)$J1#\CoA/*:^lJntQ&;Qe0WPf: ('-"ZR/8Kn)L,NSP`LM[F>oOqBnjIaTYYqu:ZTi\'>`eN40cf:3UhP"t59,Eo@'K>` %s3-<8(jCqZX2-[6b41MB>Y3;o>/g@iP,SfEJhTf<gt6Lm5C8bFR;OclZcq&&U%\Tt=2! j*Q`HLn>Mc.m*`P(ioFVVj+OsoP0_Zk& %bUKB6B(;'`#5NZj-UP"q9s-L(,Pfgl5X&L'!8BDMT20c=_fe>fI4C[I9V"TdS'`#+iu'J(_hrKdWmK^;1_0j)Sq*E:Ve6DVQk_c %QblG^i9Y=[P6(t!d0X<RjJ%sgpI$J_UK/Lih@'HClku2<*ZCO=B1967QODA#/8N! =Z^iTN[mVX"&93e5,+8)_g!9.6d63>a=+"(X %bT\rkj\]>jBn3]`>.^?(36g#-O$k#j]13BU,EMKL,10r)*4E+a8r %CR0YiU3',7&8e<.u3&HZbs,OH1LMe`^M6*`b5s!6293`Tp6 %8K3R(g(96CI87C$<SRcIJ<BF\GlrEJ=BhM7r-%4/]V2-1[_QKbjJ/9V.5sa9Hn-ZaTJIJM#_TXli+m?>2D %`UL2mna_T]QVK'uWd %(e6@XVsM6TglW7V\hi8(_4"%J*f`U&'GUaVDOf=+<f?K92ff\VUP5Xi;-kUNL$AL3d>+<`K? PW`UZmab]MSmpWQV3CKhFu-W##Cm %",C0b#dk<o:]8;o`3Nf"P75`6+.n]HS37Hhe)tX0B[l..B(3Dn/+("OBWGD<Zr#j&<:om-PXa_ %``s2<+lns)5A8E+,7XmGJ&eGm %:'#MNbIc1RQWn3qk0?F4aWOUur*c[ke8b1K/O4#X8+PWk0hJ8rhT3fI*,fDF8>59_)L4+dm3DtR&aGZNf*DI1Lr)uPTF2ZU0[aG %07$ZkTRGFk]^M*/&()i^Z@-NZM`.JIar)[2noQ1TAW@*7T<2fe-c=m0p4E$QmeDPUG)^Yb&\H*\_aK@4N>]fY5fAP[%U(F%V[6% %*YWb;N>R#>5A3k)hCd'jpk6_5:;FJjA5F=m3T9%ASTT=d6ep->P]u7H+3MN-kc5C2A6PZC<6D %Qg`Q^ZTBK1b3FoA\HZgkW<N9QD %Z&bO:YlVCgpIT&Y>5^P)fL0<:W7?pL.7$(^nnR-5Yh^/\JcbpEnU7^uT?E@7*T/ +^3<^^/3$i)ZFqOOD:_m,qpZlCBP7X^JY6JEu %3KE;qGo*>"LD#iiDGSF(G%4WI=K3;rJgXX\;u2iBknuELV;t=j/DrM8=.tYGabnS(?! 9d(C:i>QI#nr3(5OJ63d(#*or6YfGne3O %S@/kOJi1=?Q^2!QL8EuDa!VVDClQol0/tk,7<#'e2Q'U-nOYH"*#_nH?%!@PXdH'uirY:tMV6M>PR:\_S! q<f:`<Q,c$SbUhKMSc %"TtZ5&H1XR+FS)a4M(eXV'La'HQ)C(O.QH8fd.@;<o[RN4/:u %U8[<cRgeXnBSs[8(R,<jWV/:rd,H;pPshHml[06L^Zn6#EH`iR %c6/8G_52k&#\HYp(`,=FLA1)L*OW<[*aZ<7E&k:eW<o@J#TPd*kfoESLo$L?+[,G?<\a-uM1;IX5SSAq^5[1S?`lai.>u?dtD'8 %_KYScoC.cpm%><hXYf/f@+HOeXc;hLfKbC[M#2(KM:NClXVf/=cNke-\>:0_8MNQL8?#mI59%-ZYAFHN_iXnUDhmIYKGL#r5KXC %p,Ed`%2b&6ja2RBR?h>UW+.o3U)&7bp^WGKYX(+q3QN.4>rBW:D>QBKMlT`tCkU4CZ&KC/0? PALGeFiTUZq=t_,tPd:;K_c`+Ej' %?@\eoKU9ig!*Dp"^.cL/0>4nnMBo(Z13ZW<9m<+9;PdO8XXWk<6-"QWg4<S>iWjfcJ>I/@33iKMGW/2X[PT&cS"=-QfL9bF@eA( %GLSO@;Eo&Nbu0%bWu;VV9-iJ%+dEjrEQCUcAg(#]hI4n(8J%@Hqq,/I8cSI'P<&:9PsJo? 3:mNT\a8+`K7"^b.(:`f__?c^4]X@n %Re&"rZbkXS`Q<gf)ohhL>\d@i=Iec&c>ftj%_G@L2>:V0_o/#\'PV@k`mV#2#c0D&9B8.%]cs.I;Fb; (qkBXSpp4ji&-p_EnU-Ym %MsKMYpPBm/NCF#F@d8hu1LD.F'D7kD;n7QVpnc=<[boeOprM=`-rf:ql>XA3DH8*\BPKi=*Z)MF+tCSNJ]E.?ur8:PRfR/:BDT8 %@Zk-Xnd,oI<Yra@F:(I+eYdeNJim %kE#;gj@9gX[DcK#$jm64a3;5eDjI5dRPH'F\NCJ(,]CENk'nL@M7'ACR<#utuUaUB+NQm(W %NZ"Yn0,\?LI3";i:[9uhoiP=FWA*p_e3k.Q`bojHlh3sogTmKX0ioSO=7Ra`CdZo[f1ds]2,7[[lbSaO? K!LqnG$qXb%nKYT!%GH %QWn3`?/3'5.mZ)(Ll?aSB!iU%O@cQ)X(l1AckaFY$? EKS#Ul:8QNdaGooXknUOBmt8\)bAgM1S/U6A#m7BtSe`01di*s!11D2$2c %pX07+&g<0M`R$0D^9k*ZpNZh:qA#)af't4(#)L`K8u3_%QS[H^#BeW"hM?0kY=WQ6a_/R/HFd`[! *<]Onjjo<iHZ&4d)MCiae%+P %1gN9BolfA_f.c5]/*IRm88l-Ue:dT<q=[=R:ZBPBbn9@o9.dqb;E265D&fR"pf4D=`1Uqii"[op! F;,"&I&GgF.WXTn4GkeF*pU7 %kdFQeOY[h7]_m20V7><F?IA<:&5D&4X+_.rgAD<5eP;anj%V!r>a]a=L# %p#RCtK+O3B.8<]HZd6]&i,<K=5'FFH!&^P4&Z(a@^P %'TK&XE!DiaU?K4(9K"'9Bn4<F/,sL.^2&?AYo5Xf8VQ6"\@FD=)C]59:Q]uD/@kj'(bCao>jXJ=jIS3rlAE0j,Zl7:B'Gm3Z&QP %F6R*C<*@b'HmfW!RA>CU?H#[797t4!kraflnQX+q&'qjV)$DRVWEPB123S? 0l0gonn&=_5":*Y'"p9CJ1n!Z/_19#D+\"=ai;q^a %n!5[ZXG#l$ (e"fHC;".t=G36jNI1(SrhTCr5.a=R;"'4VFsQ5se88Pu_mX+=)r]9P)4ci(0*da\FNi8$NN.c38:uL);,H jh.LeG7 %i)b)3]2`AI[*6@f*tG8e,\*W'EnRE]m,U4aA4AV>g<gWZ20P;-3F`2\! O/h"6j&.l3(YW&jX(+,Xll96E]:",=ut1HSc.+/a`nWW %%S:Fl196uo8;]$]Qc&!rP!9`sO#Gf8U]Cu5]^D5)i8Z:2FG(jE>g`areMpS)&WHZSdP2O+bmN_Hj! 2^H,Ii'X^n`c/D_.`C3eGVD %6V,d4HF_JVTAUIk+/M`bb"NZpV:QU%34`^uca`Zt24;>a'qe2$<u`b3Q %ecq(tH$N&f'fpr9KS:=NF.lF"HeVV;[(BiKgM*R<2*X %!q&[idb=4aJ]Ltg$+DG4#$4b?SV@;dPN3f%=0W-:<SFG*3e1(NC8tSCp5NC0)5i_1edU+? pIpfD['BDJX_d#tE(U6\q=Tbd5E71$ %_VY'o)P\cIK2%dIqHl_cZWId][q?)"BXcHsfaaY4K+P=M]C_c@"q]&]UE`-7e(lDK46)&eSYOk!+se %9P@"[XNd6>i1\km84>U5u %fECbqkpeGM8q*ug71q! S#l:1"Qsq/gJFO83oBoAIA*d8_WQoHUnhaB1lYoMrOif80hOn/W</EAdZTWn.<p\KRH!ic2Q<.472L9fI %YQ4HZTGsb8$D66GlO@W`5j3Fr*5VrE4TI,l%4,qq4b\hI?^Q@4T%L&N&YQP-ihi!/Jn!S#QGZ>_c74+6d!VO=umGrd`Y%VdS9\? %P#J?iLEcXd<1+BOP?4T_.jhmiGUF/)Mq(?Z\N!^N`#D^1mp%W-it<Ye4M-=_1-2k76<)8#3B$*0'.MB'T-gJ8JX3)Q^$5+-(VMG %38oag3&<M<ed$j#3,6opPecEH:3G1T_11H)i2.>gM\fkDnjG9#^NoW"ecK6"E;J0Yi5#NsnPi<7N$DiQ>: *i.3!#o>/R0B]cAON\ %NlL$/?-rCoAmfp'>%,Vb8&Oaga<-!EPS>ZdN*]DmKafpO"6#CC!O3;U"ec$Dln(lb47e(g2<r"1HVQ:0+ $Rfo$gp1s+i6=e:7!^h %)QkoaGbrD(pBc;7q"?10<)+'RGpG%4Rn!TMY</N]LZE,)3$_-^r;=aG5R$#`/sc=:#:XYtB? nJTJ4W$#7*Zp+0K'Tf<!";#_G`IE %:\kBQ=.R)rg9sd7bIBnhq$q_7KZ\+=QZ`j5Xft`.%%eG:2lFl[%?j+SVI5]eq0%WiH)-:E@S2$t92? GDB<F9+T2]L9(7<]d8kIM] %5uQ#a"9niF[KS@>gH6Wt-dC]Pi6Z37j.#Jr"1AP8n9(2i<&,e32f/TD)E5qn)B0R^j'/-"T2b^(m>i7J %H3LE=dhOr8:EVR>7RNn %:F^*0E0ce(B4`,]#_A_7_%KN&Z62:Lp8sNa4#W"Fa*nTr0k2;ljre:'S1Imk! tqb$*)P)uD$iQ6g[AsR4_TEq!'1e(`bRs(fddP: %[`NsMlNLI":&#tDR[\.97e&<GXDh.aY':^q`$c);a=P_%Rg+gL=AY_Z`9T3t,C3nB3>e`OM?\? $5t`$>B12@<N8p4!I)P[H5a0uj %.D#!\r(NBc$]]<("MMuUM$^)iW8UJN@=? #8BnP&/SZ^[;QfOG>+@a7>T_SJ@BW3Af-.DX6:J$MSp/PPH&Jq==S]"Q"XF.(=<.Ic' %D<17;NWP8n3(G;P-#/]6N-1WiR@2EQh(M#Y%-]d4[W=h=jmX8NfPtPu.d&PoLJ2k$k_"6N3q6<c0<_? UQK+S/Oc?tskOF\h.iRB, %NK\]AH9Ef`7X#QT$J']GVg>I;!.@A[;&C3%GD:*nrfab&nS@>C)6eLk7Hc+O7KGDl7QucO4;B:*KL=DEUS_ FH&:;mEZoUV3a=:i %<P;DE8D:j7BnO`EgARm'QM)V9)-gmg_q6XL$ad\JSuI,Q]oMdCnjK]6:MG8++ [K>1BBEsO7.sC4YcV)"3oB]ZA1-L&(E>EO<0B^/ %W"$t[F/5"SD$)fW`_-ba@l(MG%hILlQR3o3Z%P1_'D`&6#l1:-6R6*4dU!+$/#&@U0"I? 2cfp9<01#I^)J#E3,=Y\t<&-?7C#/Y+ %+Lq/hLcs`Kers0-e/iCqG"=DSjml$O%s$fF$ +i()jsuoL&:"[bqV*;qs.\<*1oB8f6qTs#@j)M3%QVkacc:9aI1H\0_!SM4LsI9W %M+XR"\%a?N"/p^Le(>D1QUBtSD#)^n*Bu$W1fhI06(U2o3Ajj[R06`nZ"+d%%<Fl7C#2fOs<n.#P_uBaRF@R9s$?G9dl5e"aFHa %I0D1YF^5s83heiO./1kANF5[4*>US*V)k'PIcXbiG>3:\]3.$^f47&>NH1SR`6'rG? >4m8@8QH^>Of6uH,e3,h!(]h0mg86/Vbc[ %@)^'@eTJ<$`T1/37MY_F=2>@D/=Cf3Z7h9M8YS2t/? gnl*1'"aiUnjE$&'f0)p;"J9@\c4KD*r9,:.u&R6Q"T3B/quN>^W4pZ^!* %OXE:U4O*Xs22m:Lc%/_Ks.$9tW5kOhF5EU9):'f\`^Hdt@J4^j8O9u=ZpT_elq!nL,=/^=e$m<HgNkZ.t7qhD"iihTTi87d_ph? %<B"0G\"_rH0^i-Zi]Q"3AsH(=C<mt! (A;n$Q^s$ubi_NoDA6+Eiu0kB['.t4,hTcH"=Sq)hDpb2JYtGQi;q/$3WW!0(nLonXF#'s %DJeWs(bhV*^$P.W6pXmkk+!;3U#r`44n1#s/2Z2p!7q_e(RGloT\-j[ZEm47Y%7i+j_Q@O-+3sB*%o$, (&]b!E,A+j*B++P1<`D2 %/(i59hZo24`fIe$LXP:=$ugCF:n=Q2?,EoP)]DS,8PuOJmihqCX`]Um+p2il"Qp8#m$HbPU<hT8d9Mlegs+;$=cV">%VqI69OgS %^o^IkA-K^WK'_<(iuWFC^;Z"D]bEN4#2J]VYZ`hr9-W %e1"Emd"4Q&.LeJU_0q:Z=*W(0nq`8cg/<IC;DcXM5DMJaC*V=<\ThaPg %n6p9@9t6ar+[<kNTR=D+9eea9H? dF4<1`a<(CjbC_PQd>pq^e'F,hA46M_GZ40<ItAm*4:j+d2K2#pKYT]h1p9c#ZQ)8C-\X2np2 %lE.UDTJXu"l#(VeROeJ;Ks?WRZCRKt6*-C)NI-B1OP;pA+bj%!\#4:YPre%kW_tKo"SR0-h6+\L %Jna95*4ie!/Pe:[XQ1bKHOgI %Fdkl.`D2c<3Xr^:KtHlJ!(Ql>\'LpK\"!\UJ120tJXTjOc,4<il(h5Fi_U$U1H-XlICh4gW+U/ $B2IenCJPS5d_QX^IH+=6(Ur3J %24M@V;sLee*MTt_[:SZcO#-'%<>mK9PRDe06'YUkYRNuTjW6U0iUoZ%\S!Ehh*1S(3"iL97XB6;314! oPgWLQ1l0r>5'(b')ZdKB %26.G1DHB"-ScQ3p$eA%3C<VY2q%5Pj-2LG!N\@4C*?<Ui)Jo+0El2<G!a@1"5<GCa'!c1HVD+6OBHc-p? aYsGI+E-;7)<)JD#-Yn %lH\CFIdt'o^jG.3*a(5g^;_Yh^4IDL:TVTpHJ/jk1;1t,NjaK)c@3$L6E4#;DYBk;+rR[^Y%]M_2g\pOmuN]7gWgZS?#%Djj\8W %T9(bVa0V"L+ts3DK'XUmKq,-if-CQd#-gnP3VF/.@[lru7D? l>/Wr+DA4JQC1JU=$!:Ob#Rm4mrQgD]'eRiDNCnSB"C4TI]6k'_U %+$>!$1,2/+E/n%bl*gCdVHeY&SaVoeF1I9_HS+6(/-/u$)SiXH/rJ4l4O]od3`8"?=Mg^>]&JXanWdU0H %hRna5ip-*Ks39*QLRG %?N[&M$H^<m5sgFRKH\:J^_7\7idG!pAE9%KB`R0DfVsDpR#t,)<UXRilL!42k)go:h? 0PhEc@or<Jbmh#>&>MG,Se\9kddf*?G/( %*gj`2,@]B)QIIon@=_5k3/IR/8gDiH/0r1pP::Y^!L5RR8a*l?aP;PT,!N! JBQ74dgeqi;I(,M7berns=FS2/(12]h^ro%3DW0&g %`"6@93DX!jDq5Fie$0",F50Z)5A`"fB2_uQ9+5'"__2UnSr^IlM=;Z`*N/I-R2!+T6tg8`E%3`nd$ $Vh:3k!Wig8-PDShL7MRW,T %XQNo/+_4bmqI9^i2Qkk\%M'Y:9[=`D<f$II2fYO(DDXc/#dWDYn;eN)Bi6p7>]omoaP?0h1-=>.^Q1E\E96+]_qHf7(_T'`]'<K %*)e1WjP`ALW5P"b%OuqLmM?7&MDVt1JcI8+lHM:!\H-<tipQnqY]g]IUR[><NDFiO-WPdkd3fAjCgF- ND:250UW?:dJ)tiOPEqTu %GN7D8B+XGO#Mn!aH7[Q3G;+L/p]KGS`n*L:PsQUZ) %Z)>b2pqTLHhMR`T_Bl);R1_']fF^Eu'W.r#U0PINVSI32IKiaKR=/?*2!i %X]HlYjM>B[i08L<Mm$idnX??)kX]q2*YS,\CjHkPK#_n$Qh%KN@X(p`nf$lkGE?N%]ED4%D:!RuaH\ $QBIOl;^oT14mUXut\O.-Y %$?!4+SR1C`S'?D1GG3^J`NRL+D[M#mTg;I3UF@VV.L,Ya?BN0#G.&j;m^IP? V[R>#k)ujcNQgB];Q:^2JNi0uTF&;_mF6TeAN&b< %P.3+s[rm:/ZO_.N$4G6eKAQlF/n@e2fQ@QSTAtt>[CjU5A)Yld/=$WN0KJNI]nt$*f-g=f7Fq]? 7jh@M&g1*bb]B$7.<[1ZXJQ3X %k[\,d_DdH?QYK0#5,luZCnd,L`V8s*AFlp!H/C!W6_6,N)OE'*7hrkrJJ[(Td(W<Wnm4da9;LV&Q$q1@bfVhM?GiEO`ZhA7SG&D %Lc]**Gq0nd+T$tGjQ"agU*7e'$4/P=B6NSr&skB!I$!rU'c*`N+`D$!qR`8]i'*O+W\O=! P/og!.udNm(;6-KJdcI2KheK/IAWN8 %"Co4qm'a;J;lIb7.I"';5+oO]d@Fa9Pe5SFkD:b`KR3*8<"J"RY[r_3)5>*b]Np()r/SUYQ/cn&b26l36? @_2et+mI1k[WV,>T" %T/4FH(f&1#8,OEI'&(K&Sc$?gbp#LqPI]&`h'Y[C(\dH2(8N0ln;ZMI8PLu"q18[t! 7\tg6o76l'M;D^;.G%u"PV2'R[l%r#,;b) %!-"'O"3R@-.>VqhN24Uo0Qo3G_8[>VN6kQj^IF=Q\a9\p&63`)iObt;,? a]flVnN,i[$a&fB4mNKa#o@6@h\aN+Y*r=q,@c=.q_( %GW-kW2XhZI3W7lFhDc8G,c<Js:J)FZHe;qQS5KhRKu5P:3)1n6F:Mn'm-F-^?<eosP>aY$1t;;BQ*plR/X77G*$BdUg=2f#/WT3 %]_TB_k/\`m0A?]aDGf1e28E)e@oeiE0WJ/K3)`i0[Xq>NMsr//2m.7sUoMhCqA %A/DX6L&jhe;ApsmTsocAE[$8PQ-c'/3HY,M8) %3hVrUWn6;_B?)Ps*!A>u^hhSIZaQ<)/ (jUWNM>S"p/U=$<`"%1EG4\fWh=5\l.TG76N,VJFLi^&)YaaKGD&SKeT?"!mO20Wg`9f%H=B\Dqo+t!b@W(BN"`R)c9QO_50.`rdqI`10<4<>FY1u'l&j7m7-_3`1$kkO\GOJ2EM? J>TV.R;LbEU'e./_2>`CZH8F&D?jEpe: %'Z3H17Nl_;-8]0_!=h[.V9e26&-%AN7U;JUNS8t'M]`"FRsLcFQIAbF;=M\`8;9_Ve.3Lm=bKMj1HK7[;N*/3Aq2$NH"rOD`in> %d`li<bXKu*4bCmV9hO^00;#TL68Rb5/4;KXiIK4"TaufmlVNeJ82B:hnd:_(M@_u5cqm"r5"m#]Y`3b8Zo L3?O;[;dCGC"H2Osds %i#W37cuFq3N?;+@?poTU)BfGb0RIP^51a=<+]4[gS$$:I1q&EZWtZfsQ+Oc^NO8i! dlh6bi.96@)f_)*f`<Qbr/AqB0Ym^c/.\9^ %2boMgDhE"_D3]G5Rkr,h>p.sRo=D3+QrMZg>i8'PA.6f0P@G'7pd+eY9EpI*p=\d_8-4t>E=5a %D.JG[YI)f8?P*)jk/h`@K[j2V %F'L2RKk[+]NiO:/<B1/p%AR<G$+m8&fZHSr:a*[6qqDt^.<()sD'thA6Rd/ +,tF.L3I0cgUfd7G#"QL*OOGmB4p,#Gcmb=jbrG/0 %hB:'_4#rrf"Q2`^DclAU#%E-q8oT*>C%9hCDHmN2.mNVJ7A8+<9DPB6\@N^0G2>XOLaY+1qV %p]muokGU/-+%KpPSm(rL]'`qCRR %e>2;JM/79c?3reR`!(M[lV,;Lc=H_4!kp0Hf=I*F-PHNOX+Z::pmeg05H_7a+0PWU+oT,^+=)#PR&s=DO[3qoGgK"n^]Y0>)NmS %A(KaA=3l\Y)?;=Dotu+/jD)eD@E,[nXQ]2S5na"g)ZAb',O6bqlFHOBS&6&;>c8hg/atFn+su%h2Jjf$0o#3:jFkc1Z'D!Y=qYA %qp>(JlQ4lGGlUpscgUUT]JDpL3T"l&Mp9=.s0+MMO?A[rG^^1%7;o_AisjbpU]1F97jmV)HB0s\H[D.bT*Yd:99VmQtKbP!4-=G %-.mIGQmW/]LN5C@nNC2=$WK%JOFE\""VteW%ik"r"//&QF'aDqlp=!u,Ihqd_0Q8V%9ue>+oSPs %nn@_^$/qVD[drd/KEiiE8hbj %&`fVQ6&F3`n]cc8J.'WPnh-]ECu5*2@>SU+;=;oU[aOsj]#P=WOC\8$\8Q\7MOk8rqf5Q`798@5mY'7hcgTMg&Cl)6/Ymp#:Y J= %A`#o^inmH7ibuRJ_@9Yb%?H#<jElA5k$\CVB>0.5PR;>rK$nbUNZ[@O#;mki8K!'b";V9WMLF2cht+>_"I>l<mQ8Fr-<VW56Zi) %GQ2OVF8X)X]Y%F]]KLY=YQ+M4Ma.0>SJ?VPSSP)>`a?D,HtY!Jm? 5'Ukj7W2Qp>._EYb,XHPOs0#)_)]];6d#H6#!Q;XkNj*PT(? %C;l-k%Qfkm^4K2+KC`Bg=b1BMR.C1]jpEn]PntEB<.M2)$<O@3+)KZQDZ2Z6hXOTC)`R6,2VFMCtV1/U&@O-)%I-r.?hNUp[Hd_ %"s9C/pp!V%YPQjXs7#XC?[_b9TE"K&G4>*M*ktNaK>2D=s+U0'@AUL+\8>b0>qt+S7YZLV5bGX.r74f*? [Mu8'%?LEOH/HBQ(@I7 %->RmZ2eh31H:hP*JcOH`kEBfK"@J!+7T!Z<#W\K;o')XUnE]MKKoD)&-2k9]q+:S[G?"_Db9cVRu`'uc'QI8hJ*(\:jW[0A!`qs %??`,aF"hX*R7`7O=WK6s*pPR<8Bp-SGC@a7Q217Ib*k,sN&? Q4^;YO25(1j.K``,WGqri_rUsWcJ8>[kZEi(t@h#3:E8*/ZFpZ5K %=8)J;r0l4_IJD:+pt7;br4nogLX/3bnh36-e^&^8iP4-uoARm=J+CjR:XNei3^uZAW% [Fap6bDZI5dNX&HS-48Gmi#a;s].UdP#\ %8#Z48pube0541Y]3csW5EnRs5I:`<"pL@i:M0N_*I,i=*o]&_sD&G[0c\JZ)LPCQHZgEImp$JI7c1UF&hn *td^V3A0gY/\IO12.& %GtO<,^@=5[diXnj3NJj*BJ;bf&$5opO@VA[jQYW=^V+gY._JhU@6i]mHOGm1XI22opG+KJ<=GO*']B&AEc+Y1 jX<f^@sRj[PnH# %OT$ror3fNP(j_!;bAKPif&H&:U&W06pB9WN^+t`Y/H0LEg\!d;+$Qk1.Is34*k<8eoHtIRABAckqU>"+0<Mb<H$X)^Q`6bJVJS. %qY4KF[D7_3i:R.mIs$EeT\jd0=kg*j6S<.=?%G9ph`83ZZYFdc"H#t*gIb8]@?Uh4N3@80c.'GCk3\p^7re`FOtL=1h)1$'uB'C %lZKs<+S>(XOEoutD@s)'^X9#FS#$2q7XlMoO];4H+CB.Gec3Wr9-=VHVIeoC&isn6-7o3! 9R_2C@u&uTc4u.B9>nS;W9+$$Y=GHC %D]STM^?t]_ld&/.n*UJ:#\Os+4,^`DNf.sjco6aF-#d,b) $53I@/hpmp7M8brUUQ(cEAEV:28l:0==:Q0\.b\f`kVlQ5L5@HPp$) %j$m>JUK0S07EUc)c'r=fZOrUPH10[gmO>B<cc-_ijo2WRF)ZDOAT)J'+#:hS-/N@? *HVd>*;_ot7$eL&Ve9Lt'jb4M0Vm2UMR9RB %3"W5;kL0bQo:0.;>#F&om4r_KA+\AB4D09N:ier.gLu)9YDc]Kn? depF"K//n6d1XkU`fPNJ'LM:p''P*,9?CKJb1^kK)7A!iFL# %p_\\MCb2oMY7G-i[NgpEiYYl2I&[*=H\ncqZdFY[rRD7u6#5N*$9%V`C1PBbDt%pMp8AI0? Fsp_D/QEIf*?N)IS.V3VKk*iA[Qfn %eo`)_[KT'^d2ZtNrqhF0MdldbC>KeT8N! UT1[Hirr9`m^kC]7CK]S#&*b,Z]ibO7*=Rf]@hRX;/Pg;8f,*0@/ffp)h$80j`:5=ed %1E#j4H[tm=E2)R:Qj8%_N9dVZ*W&Nc;ES6j+_7R#19Ph&fO9PnS`JEMF=Nu[7@X:j]Q7b7DpA,1-U>9e:/ Z@[n0NQ,j-uN7FiWVQ %KT(VPhI!O79.Gh(6?)?0jco>jK*S8(Hs)CM?,dUb$>j.S4"j%R_;N+'O_[&uo1c$ $fh\DR7e'68KjbOQ,9tL-'@D(GgT`1gr#Rff %1?N6Q? OLu$Mdorj(bJ5Y;"QNgd.Vn$Jdng*W*55,H0<_<GAj[ET=IIo[g/NWEJh7)m6:=f/nR^Qp\O45Z0q9PXijP&*:^DId\Kn %CsZ,MMq8LgW38]$53td3pc%+-h91$BouI+1\>2@dn__)5hP"Q5@U-=PG-lhN%;4m\S"TYis6oD] [<(KD1UC*Dl"C7#?1s?C3&6/t %N8u7:;8%/)eVRaS%Q.@HY=D,2:9e9p(8#'#P)mJ?%>Rn\WV7S31+,t[;VVkW:1F='fU&%9L1Q %HET*.l'f9/F->M[QZUj'h&?f-e %$%/NBcY[10fS")uHQ\oeD.D'dD*Qhu1HO+($UWcR\rZIg^gGiJ9Js+d>#!%-5/,9D@pB'c*4mQ!bXeG3_n/LO7@oSd#JIVdttV1 %9-2EgJ]?$>DStI1a#5f<QlPkB4"jKLf8aZUo5P-8I1%f,pHj/8gUqF![7,^:aI\EuQH!O+p,[BufAJ21VYtqK^?mgZ![D`pBmHJ %[+B_JnWUPUhAhjj(Pg8A>mE<_J.-:FMl7ek,26arVkQ4ps1'lIN.)XA>r$_b=^N1s)hDY3NR5R)\2i_U]6W\J/J)E]8s:,3(Na( %Z1CsZhm$hk]*H)d/>ClQ7g!b?KAc5geU;e^? ``2TGe/WBqg6At[FLae`aPZLMOA+)6I+h"ND;L2cJPlC.Ydj*@gN.+$L6Rmbtc)X %HIA\pN\M#kH1ngQpU;j-Rp<`i2BbY2s&oU>qe64#YBUDSgI2"e`pc#,,&?[r=m:lUJQBldqt6R# %Qi[YEsF8_m64m&S^V`>dpmbd %Qqtp[gF]fl7e!q9-n'aE`&o,(6SA#qopjY`Nq%erTrmH"S&gX[%5,8j(&A=i\:&Q;B! SUja567PET:l*#dVt0Wu*jYP38_S']8V. %%^lDAKjZUgA$dDJ1u)`uQZnI'5GS:>B=?#lKYs]'&Jj"uI60XMN%GU! cM<m,]]m'0a8#5j/m\dD9``3\gT+=s$HGmIc"5*rM"s!, %PX.Y4Ul\_HLsM'%8CA#WQOQ7B1I?'86#Cr$C,Dad#IF3G$XPL`:W#AJIQeTnTk8"GbmO9! Y0k40,B0<Y=_;L#QYck=k`sCiCO1't %/7AMBC\nO3R%L[1$*lMD,L(61dq>F^Ii;\hUA654o>*"d,Yp<C61<q&!k01MWQV`e9d%ET/7)[N<7`! m#OA_+<e[(8X-i/J0TAaB %aOKP6/T.0O!BS'[GuIAco8ik7Nnm1]R9'c$B#d^Ho[Tf*UD!CpA&M]DlfF8$? hoft;;Nf;0h[LX&KpOu)U(_'`g)J?5M*2:`Y)/# %;cNY,178BM9=n6OF6AZ5]<5u0-Es;9f@8.q9;QhN9cI2ekiYCDV@Qe4oFW5YG]G#E:Q0DG?@>A`duN3? If(\oH8hmGW8m?1Sc6ek %^\I<_a$9I_2o#.@gC.(BC/0nC)Q/KPTl/Cu)a$EHRS<V=G>D+R5i*YPUBEROM`1FuQhf;#=NTA))BQm=N/ eJQk2=ME$>KmY!o(WL %6G2n'Ih@W=DsX[QjJPlKpsnF)VjM$CGgo7d!o@f#dc?bnr?'_%5!mcD)t-6IqrRLcE*]\6a. %sAgS8HAgHkc8hk/r44YWM-4<:u= %ToA0`P/kT"k6h&%>=pY`eI];=dD>Ljn^lqtmiusHB?@X7mjic9Rd03''R93S5Q(0<h;eM*a1qQM:]KhF? [qYX5QA^',1?48'_l'c %]"\Opm'gC]Ek;+W7+'Jsr^@DLZA"ap9cYa_Kg5EA2),(bnfF:@p>M85E!&HN9KEPg`] +DZTmpLWg+A$fcalRugGS_"`Ch&Y`]<AN %n8j$0_Jek^YCG,Q0VIiPHIb=YLPJBHrMUf5nONI6SFpoIE-B"d/,u01gO%f8]D.!Hl3Y1_+8E! Fi'4(L31p*g<f,Wj4c(O-HX&=B %k[Ah!esP&/D790HDp0P(0GW`]:%&g9@8,SdO3shkZY6%mI3-p5Y1cB/K#)3IdAYXuFh)Rte_lgrCXpW'F: +B5SF9VS^9Y4liA2gr %if7U1%l5@6O>"39X;A=)aR?^*TXFsAnX%]_,:,@\!W#i,=K0cS;6F*M2XDco! *pSHC:At>_`@r=<ETMd^cC%_PTf+i<KHP3%$(.R %XHpN&lKp1ur'[WUNNgj<FeLs+fEgM)Yr__55S1f`5$_'>*&VTKc#G]HUfjPY**d/Q7V@e1E9XXR, +Z9NltGC"39NQ%E,@$LIF#`9 %PuRtmb?i2dF1CSg$(ke497)"-5!LcRk %M#E*sagS54$>7[*IlX1E.L8:'LZO#ac`ChM38'PTZLeN+fp[3WW0jOrW-;Tle\^(5JW_ %HHq&\'?gY>`AuRceu@2t7?? j#"HN:=fsBg`=`85pkPpUVpPuP[\FN)q@tQMA)1r52Larc<aWTi$HP4t@K)cip"pW`tg[J=I<[5"d %F_eQm@/S&LDpA19>&QO\kF$7[B9mDMK0c0#F14Ida&^JGU7?;k[pttM4%nB:L0M5GpXZHF[n`LJ[<M$gR5i>;+?9]4:iY)1Km\. %j>:'*q1><'I8n"B_r2n?)D2GAnl;m'bXssbDE+dh>Hh`AIAL$&1W_90&SS"<_:jhe)`L7,:s/C$lo %_/0ns4e4Q*a(ps*VJ6FD(I %_DIt\7l$-f*4'Ub9Vab5\71MOY%%R*aV[_EI"l2L6HXQbLcQZ][$%,.EBU1AE/ijL\j[E+44"[A'diCMREW8K#Wcp66#LE);QVh %1WGNXNs?YKS%,kpo2'9VfuBL.K'(0#2W!,nU+eTqS<8Ll=^4DH,W? Pf;;I'CR0"[eDMC@P5pe(DPo263\=R`a>O$4G^&!PG+.A,q %49DWA[SQuaNuOiS8:i>O?5&SA6V,eKj,LZFgf_m)aN_Z55o^V=9t=kA,1Dhd3:Tt*J %*>3^O9'ABhQCC@h=)TLlmXO(cj-]0!-?E %^Te*ceW*3G(AEZ7N+*_[^TVdjC7B1piXiSY/5)P]j'Iq7aUof`';LQ!:#&d/.B#.ar'-N-3):deOK8i8ku.7_IAC%95t\$f$^t] %7(l,Fkt!YGRb9[',^"rP]SUq8`5q/n%h*Q"49hpP\O;HElBanK6jk0&WarSqb)A'non`^ih'R$Ajuh^: +ptP6jM^V"6m>JTe4H+" %!('F!j*C0*7L]9souq^1&W[Aa;Zf+f16B_0\]XiXhI1+DUK]t@/DM+Qcq9]545i]+N?\NnPNXo %R5'H+4u)!*gVg5ES;5lMLkMq) %j_25cUWFF7VX$10XPLB0FW4CF@+fkkWWk#dR:"J^Yj>t.MPI15?l>O#=j*!;O_! W/=>$Q'OeclN"<A+E$#S$1lN(6b(6GNa@8WVd %\]KJeljf`l:adsgDcN*acD)@88<aX5^1-.V_EK2S01tB_e?CI6]n8;<W#&"! %Z_78=DA_>'ZH:Pc_S)AHoY/6bRKG%h6^@YjfmTO %Ik)%HiLY/M`@d*8+GO;d:B-$B$%%h6_E#r$=RppG#GL@`BZ-3IcVddbO-gR'))Q %\0Ujcu]"fc.S(;qV$jQ#$Pm;/?lirDOlWiKG %.G;eiJf,mD`/OO^aFBTQV4/MN#f_NCF&*>mn>OZi=RfK=_'<W&F#@HqlhXIp'(dIa1o.&ne$1PTY<nH3&1 3WL0";EH6j:"rBOFY+ %Pe_6LHo$@,`piS;b/InW&_mSQCqJr'9F3#DF-GS>1"j'!:8@cF9"KSHCj>In'UMBpct"S"=XWd]:i'14'% [RgZM\8johEGb['=+= %-CdUShDUI$JY7H*HCH,Pq4.JPDTtM4rEj5J7G!j4H@3oGG[*m<)C_:`2jOA! 6)M[Nf6kMJr,ITIGM._+OU,de_#UaI8M3cKTIe@3 %.OeR99:)4U4JuO7,;M:M4PuD8/rCr5GY)U"E3p[Wf-<:Tqn+W(?VD(LKaP!$:1Uqh6KA&5a3M&(L`t;a2m %9LhakOCOJtk#ZNQ/X %:#VH':emd=-"VJ_)"3(jGj:9]9:mT0ElfY\F`b];M`#QoC1p7R! bEnHWn2ln'/>olN0o'2,ogI1%VsX3[GTpS(r)NpnUr4cN$rP_ %lPZj!Y'$UOnW1[8BVA:SMkpsCNdNM08l<s&Hsg&*\K(*(JG? 2$ZsL&*;sFo8)eqt_lSJn-,=O^KT4bjWJ:7-!P6^8ADE3beZ*ZEN %oLm81N%..MJ7GEd!Jq*Fhig)1,GG`Z!X,B,3O'R,.J=W&ms]NUMOqSXcqtD+(=,i.+i4l%eLN,"aqfoIgnU$l;Y-53PBMn,nMF: %c(DjZ&W2u&k;LHqpkk4!\80D5.oE;e7hdh&D!=?]JE1uC]on\]X)84ZLX/$*=Ce?!`QJn%Dhs5&9fEiS! 4?deOrG?!)d@H)eFP3E %"_F%\H7R@,&V3'U7%WJH&VSVtr^?HRMjFlS/'a2oi`j&T9=_o,iTqgJ:%\?-/1K$F8SUYHl/<nNW:! 0#P[A*6S+4@PTD=4;fTL'8 %i\1EIF,GlG*imV3?/8JX@566Jj.@'%QrnYF9MQX9F)"N.C`!C_\E4#@c.cE#EdEGbGpo?U1[kP\*5T! KP=cY-4rdF&KW_E_q[+S0 %1@A/*D+U!)q%^FcDMjh-9U<3)COD0pk[ihZ&]C8Q[Ub^M:QRgdoLTMij=LR0/i:oN4I]n*$HUNb)6og,6jJb!?&=V!Xa@H,HS7G %F>AQY\l,`QCmlo>)bUr4b*X,^AKm<jWm]?O2G5g:j1::NARgLhL='%K&EI9:Ia=0<eE6raI<7kB`#0Y>CfsRO1i22%^>!">+-$H %0R6CZ5(iM@1M:ct6`q,s-\t]0@ARYld]=uRbZen`-FsB$V$kT;Cl*YVh?$ba$.qK3oZqN)0_S$Uhho$^eB`aOp8K!H&>.RokE)F %6H'5,?'[:9i^#P][*E*^<lbUEN:40q46T<$X-DO_$3>aTF&\.$]E?3?2D!]s`(t-LM7ZUbF2Wja %0A>nFspOh6tuj(FA$;5+I\b4 %T9H\3VW,d=?83i+5a,-s1,gt(FEX!L"er->-rD1]d4nt!#!*Y! lFN>uU_h@eechSeeaPlJ<gUF['0Kb8kt"a:":Xlie#QmtjS<BB %brL%Q_3)pT9b7=L.]_/Q](A"F"Dbp^clrrVA\+%h".3?Fdfef6W-&skTG)qunAtb="\7! 2WE@$r6H;LX,=f)!<EU:KBIDb0$R\E\ %`_D6@.TU;Y%>Tr8oNRbqN$9o"E@N8!fWN@7dL73nGn*MX:+/EBd@SpGECqA:b[)3,1gZ8?]`l! a#gbUhq,/L%JFhsc.Q^IXb)LHs %"Srh:;V6)%X@7"X,#Pa=MB4p,R;J8R&-Ps2cI@(Ak2D]+C1PlYAS<-Fa,>\:VL`X*>_ct+a>91f[]TQ<oD"',Y9jc\L&mk@<n/@ %Si('[c&F$\3'q.7O&s$&*L"2NXb2#JTL8s7Z761@,RE9mpJI.oq2gCqgT7Fa1iWWb6,Ftqm9! mG9L]tR2L:N#OL>>=TJfC`!0e<E %c2M9YJ\lIfAWUdVsJZ"Z)/]Ej/M_I(2J=.oRnp>;"^BGmCXj1Qt4jT)/\':,gquS#:n&c(0M'.c3H$N:c0lk.8:=BNQ^& hj%+O% %kFoa*f;Qt37fhqp*EM0GHuEIR[)iaBj*`'4RR:gr]^<XC8\A;sWOu%"HBd)VnoDi;&uX>KGD4Cf'9u&! mA)V!8W\a9Yr(-i-DO.3 %HGkm)=g8["ef4\L?=Cr)3-RIfWAMe)L)[Trgm9+8$.P=F2DrQj8^#&0pD5hoUtNJaZ'h[>,c?6I[@8? [m51kaqS_BpQ`+N-%rJIk %@TBh8`.Y\+)bQhgLbg<Wcq)gjCeseT>ui"bM6Xe6<odR"V9B5oE\p49`j+Rdjk;K!F9KafbT*+OLP %O>FY_d-PX,rNc6Q">ZQjV@ %!D41p[AGEcB67l<X,S7)%lrGf=,*$;2\qe1@=Dl=-?5QH,uK`%99,0@(^ %VuQq*s/B*=;4"TuMC?,jrZFn-DCjE]m&W4m4kCH-?A %Y"s99]RT3JPb1le]Q&VE%<9ra]n$j9#u)sGU;8H'QgO'/EV^9>mB"s"4-$X;<OaU]k! %c@b<\t\\5=Ur>&K6#.?/PdA.V$#6dZ%0 %,JWUPUU2>@#I5sd/S^,5@6]o;XMbgD(]c"G(f1e]OD2%Q$UL^BUDH=tQOhgrhCqks22Eh.:KkQ9&? eO08=8j,846fUp`p"c"c>Pf %68:*(J[kHrV-gl1.-J&/0o/.tj+IQQS&XbUHGW9)L4O"h_@5NXnm^1@iAMU*r'g9bS"m/8tHp@'@E5D>[p]5gKS3K%&d6H2-,Ci %VHD\_eJ(;6Ko&d9N[4KhAY"rX>ZUt^JDsQM<AhA*Bp3S&;gH)HBp_jEP$jXqCSE7? 0+*enU]o"C27d:spM1s#P\mD2gIS-=[W5A" %me@)6,<N$,M_*[(Hq&*')*fbgPY':=)hF9)2tm_[G+;$V&pgf,37c7XIOOLM9UpPbYQ[! ioa[osE]A$pU'/Cs#E8IF@+'&CG0IGT %q\!FX=XG@I3D>)Q@>e(lTY87r`QWD],t@+\Ej?5*s,JimB\IY@T:\(OgJL'@IV78CXV'q5! e^B]*LiSdBER7iU-=4eRq^q/!/*J: %(>I2H>srh,Vs,m7\-S&2$hqG#7?fZ'oC9olKdppi2!O]X*\Cts0p! C9Rc=+bJNQY3U\WEVfM098P_0PRb4/WYQ]qkA"i/mh-okp% %Yn,GdcubV$YT6Jo'2O6n'<cCc]RJ6a:o-b$*m/N?b2e*s6>0dtR#pAU %jJpIdkR"aUu&+0k*8[%0X3c5G@LHSqjiArdo*/j>[4]l %661Y>)=JrqPtC>n%b^N=.g(\p`#U@O1PNdZ;&1N@io! 6MN3G2ClN9__Kb/LA`b\Fns/8q``F/Q\l6fj/QJ>[]fc&Db7N8G)0QRh! %A\Pg1>p@rhRY.=0k;YOP<Z4q)QlDB4CtYPi1K#n/*23"7#)nSY>\T&."RA1r't!6KmH` %_Ljle07ou7ACGN/MX@M]sHAo5.Qm!Lo %4i!pCBc9=[AqR<%BhKpUH&@tnOX3"+#a3@jWMXN,/.Cm_?t6fBPoaiU4B? `<.#493cNFKT8`lehJ2W1Gp)PrjWq20]0R"ARa>f!c %N[DVA5AQ5B$doAR*/^?1mVF=GET6bOb9g,g&5<KI\Xb %QZ,Q82Hs8j*@MbhMPF4eCAg7YO0Sh,one+HoVW(o,POO6UnkBXb[[GLi %HkVPo$@/_['h[(9bQMQ6SclGZ"t$<$r`U`./=%F.7:bMD?pkX5\s`_hJu_>&Wq@&q12V2(ZuSf_oYW90hSXm8klIA#:cf]PO+s> %0<dkl+M3:E5o<.+CZHq9WG&+q@kOTd.7snl3uFM;@tLI;,\O#! XBXickhF/Bc`g<lT,r@T);eE46p\tT'HP*#"M2MZeYM<*>?2I$ %KgLeQZ5ji!WF_k9OA_^J=<D74Wc^q/ITq7@X\(.E=fSYK,S@JUj6l9G3[.H'OML++Z'?$.&`W# %8'QPkk_dXoJLZXF*YgOQ@=R>V %]<Ic*/R+lu*s/E:q0E2k?c#fGPng2^5neQXn/I%9T]Ma5$nWZnT8#2`Y56bdVNC9XQ@('Y1Z[? %B_HPdBI_4\P)Ou9KATkP'^@1C %[#aRtEF]P=M[MQ07%Q_)gQ"8]&:2)G#m?3"k_CW$+YJco3F_H?"LAg3_/_ahVdaEm._U6"OX;"]=5&tB %b78Rem,J"@AV'O7.n8G %.PfnDB81+q[5$?3AR[d@\g<AQ*i.iM&f;l3d0P6Ap!jLX/L.^$.4=$JfHjRi,Q=&\)b21,5d3! a3K=Y1B.lS=-05ar])h4N0s&ra %$uE93M/CgbKgHfG;n:>bK(qo0$;_-=kDX0:4jJ7ZYm5rbQq5)H*@(,a4_9Y/HK8/9;I;Zr4DT:3C+La71KXp!Z&ofB8\0637auB %7p#b*d,iDC/'tt'N$g&pNJJ3F1("T5iiM? XL3TN6P]X&A)2pkqn>0^_O@pdj,s<+>1.SGIT$,]n:3>9VW,ZKBl'ucoZV)baXO^q7 %\?^rEi<[@/l>$_D]N9-XM9hi2^@tGACK3I(HZ<duXQ4%FW!q]h^iM`4!&:?TA8WY12Di4u<NdT-? *eDdV&cnCpmMASQABK]$4G7+ %/Pl'dlp2U)d]<j24c$3C%It.Zk$uEm+OHr8SoAH3d5oa-R+Vb:eP\@4p7u3m3K41Lfs? ROqb5.Xh_E8qhmd),i.8(s)QopP]B"p% %3""(9U.@bJ$mu-o-h<3@J49!Wk9WUSH+[Piln4L&4bU(<`F1tuS3;dp% (MMtDN)c+eE_3f*H]69BeEoGaX7udBp'<s%sFp3:^r+l %b.ZanSD)NW8^in9^isULi9J6aF`Llf6U>Cdi+oZLCC;+n6Hr(WY+7Im'G8'68AhIQ6u@IP\Y^gH\r_34^d,'b;Hij,!!7R!!:cF %X[Oeg)qeFXNDR8#J7F8YcidO04,N)dp54nVjeK)+OR".gB6iLi*3%BrSg5Qn,C-Jte;'DIQAJnO=WbI.,? CJKjWIOh&p72?m7CJ%+XbQ6L#.F03,S"M=NLRgP^#i!\Y.EE,Dn,*=Dl2"bJD;Ocb=cNAMQe,V18s`/@f>M$8@:"X5_c6;E!*D&i %81=N_`:<nUD38AGOS %bVXR]i?`u6R)XiA>fP,(]==]2G-U??Gr'[`(@%ju*7C(tqba:C([Zu7O']as#VujOBd/0,@t`o;M$_CRNN^3hc(IdJFne;>8^St %8Dn2`2UAaV6hkE?`18e]bDE,11@Ch`Y2oI(J/4LGHI^`&Ea\%C5#0[_(';LMa).@f!6LtZgW`MEd`o`$tN/S6(?)m+ecnGbb-2? %0LOE%92KsPj!Y/@8gpt7K!MA\B9CBEb1i^>&Z%B9PdiJh>cCDiV;YGsWd.EgON=OVOtB\% (b.'==&dMf7"C:GP]/u8SE`kFHIc%! %kdehT$Q?fpCEf*1hoH8fEQ:g.QALu!^gCuYBkn=Z`=j@Dic_m/qlU5Z2@; $hHWGB*g+tdHb*7r"4rr=8V@MflUE(Tr/V5=-5Eoa+ %GrT*0<"cpOd1uoj:n,,Gpt9DlULPFW;.7]`NMkTSCsB@6IkQ/?g7%NWQhW#JWt#P=\? AJ#.DiQpd;lddb7K[kC/L+g%os%KEJQ6I %<iF<T7Sea@p;Q<0b:Z?]\647CW*05pQ&_^pLS\pZ(*Z>ZJ;T>nXcY8Nc2DL<VPI! 6%8J)tVodAFaubUSNJ-kj_-(O'YJqbpps0f\ %)OHFB4pNo;>b8i1b\7P7AHpB;B*Pbsb^Hq`VT<+E@7qeb8RNTRnk_iV;m[1rDNVc(inRhMg,Jj4YmXaRLH ")F4[g3,Fi28L]Rn*o %"rlq1<<T!?m\q]3:k"<f8D4aQKJ[>;DXc)5-#`W6a_<lE()]Q1$MZO>YVApsHnm[+ (=,Ee4A2@f&hKg:^fZAJ3,go6&hCMq&Xp:d %%u#Ep\IT>ompTmJT\<cCYtRZHP/aQKiC'-+D,r.HYGb24j`F^i\_to1Kus4>W %hro9233(StG@9%^[B(4RaPZBMd2_gIB+Yco"np %fD.lUboCQ+HNW/qf\B#SQ.G$%^*B(31@HNd6;u:OnlKL?:P.q8XY.>j@+f$*I:/B*dl3YCQfAu`$`U2<$s2Q;%r9M2$_HND`i6o %!CmR.%/GDbD.76Fgctt6P9T#_pLAF[$>#/&dp\[fNOm/J7/R5b! df;^KM]YZ"NM7L[h1"TCD^eI,U3g$o8:YR]0KZ)jf/-0M,.Zi %YA9kQ-q?QKb"W6C:A/(0ge+5#HseY6a"%E><dGaVNQ?ol.b!.6P@tg)3`M]UQ_? _TE2ArV64'SEIDBQ`[0jG&MMVrl&RY'A?(3Q, %W)D"Dm'Q(+=->u+plQ.];;in#7c.aWVj,%JT*0U`'PukrBdW<q2marIE0Q,'WWOdI0p,W>'i9`N7T:NpqZeOURZXEZh[J5jM;5% %H7R4,$dW7\bVAAQE/S2qg9]%q'2f<'g#c6peu.f<DA7:OIB'A@nO364V&? eGm"S)r.YKkA^fUG#c6T@:A:5h+.TDD0Sn(sfgDS`k %+/3`SPU%&Y7rmf!m9-NIjo%c`bH[3b>dXeeiqp%k?m"+M72WHj#)'E)HD7"KdTU)kZ49%L\@? #p>O"@.cGX$8^/i*&3Q]ACn]Flm %>Jt&BNR+2a@7U:m0GG]&1H&En3V!@J=<7a?5YrScPWb^;#2nVpWbUq=jh/L@(*)? nUG8mEOa1n$3:n@,]YWZFUt#aR)%,kg+q60Q %1`E(2XFZ<R[M:&hQJ,kSj&1qI>2TdqPim^sdSp%*C*iLQ4PX^CWcA9*R6[PLE<1+!3_(e5R\&%? gl,NoZ[/Ae9e\0`(L?Pi;Ss-m %)ab(f&rK[Rhe;FO_i4jH])oh;Z@$k2'bHia*]@"XCq=<4FMY3G@U[`>_Bt1o9bdr'.Ln@:(i6K+Gg@W;HbCQQ,Cg7(RjJ?F%9'g %Ot]+R^`E!=ERKhU'NTk02s:MaM:'/d":5&bLCUOeK1I![d!SUb:=h"gN+;m7<QmmF[NO'Hc45]&uQIBN_35Nb?=qg$sMhPd6B>Q %@T`$'>`#2LiBJ=*k$&Hc.4lEk$6<Gi0=b[Og-X8Fi;-nW%E42tYGeBo95G=(a%Jp[PRMU,BeP>c>`ml'TE/[o8(oG(BhiBep-WG %fOV@r6mhWQiNs63W"?I:P*>b%(8#Bt[3UhDLMgl<'(S_#R'2NB^3IQM8L,&Q!YN,>L*d %sDN#uf34?]^MboB'AJh?6$Pda%963]T %WO0(]YtUlK<F!*T#&8I7j,([cBI)HGL`*u_D7I!R5q:5,6_9\1N!^p<A9.pB=WNB-[7V`V&!LXl<_8GUZ6r*\UXiLj(0M+UtA`= %U4j;+(ha/ooc>FS8-N2'Scdfd4=d;+80p``XU2j:/Cd(^80+12:8afm)aBI(kt'VQ:Z@3M]FVt]OP4q'5eYW/\Z)sB\^s->gLL= %aPs9d9d13,L<imA! `lT^d_jEPP=c5KKoKL4Q_bqr4c4926]<NB7'nL)WnF6l@FG;u,o)ZoG;N:N<n&g):r=JID.`m>D=0AW^Eo' %hCi;jV`6^`#'u;,.**^\$ikHnnUaTr%S]*[-f,Vrs,F<Sj9n5"g,2Y,6Z:VkMU*nlP(_!(OX!M&?1! 7mPW3tP:MP;'TFd!kJ-K?' %f!I^UoKngW1%rs=93?hsq+0PBE7oN&fV#=md^u_O;@Y_L2XV_2mA"MQY)%&8JA'^ao]YU<3V#Ln6QkQMY/ h2pCF#->T-;^;=%OU9 %1oi>N7L:9'[?t%#Q&/HRFrZi\J1Ku2PJP-gD;iF$oTYZ-c%J4@dXK&@&<HtrGp5^5HA;Y? P3"8k:CeFK9`As:@Y]cflFWHZS)XbN %-R6O'V'hN/:F[9_:"I+A$pP?1/B>#<"K_#=Q5,'b=KZ8DN',id1J^C.En*41o`'$"&VC2CuUKBfWh<B12@35OdFW^&a2ba;YUk9 %,s!F)Mkji[b@:>nYq4$na]kl!Jokh*7mmG<'%RacZ%I!@3OFU-\L.;A#`j?e!]B.3=>TM&f1YboKlR0j<? ZMEPn4K`J8bLKjb8\O %_PI^VMOY2Bf,r9E)Rk\^@'Ll)FH[)Vl_WRnjLb3[+21MMO:OmPtGCCGHRG=aL/LXG*#HLZgbouJTi5Q`=(0s_rkSr MMu(^MX7ZM %N2qg/5K?iCkGaan@L##sN.(*8Z4dR\<,]I3El(=ekRbc:%)h,R&@;iYDRh/HUugdXLQAZ%R'G;66^B5+? @^<@FqUi+mH>NNY(gjn %6;nX2iWqNo#c3^d*(:"7_9k%V?Du9[ooXTMNCqOfU1=cs%=q++MIYSSEeH(Qm4`Si^6S=(O%aFc+ +6X2jVLde?jIIoa.,TX1so)G %%RuCn%:ce+?rFKuMl`;2e2&dhjMT5>,,$07LdF;D\>Sbb\?ChN@_/nc]7ucM2&%jUg$? c5N_a#5$8)B<Ktb(*UC$]>p<TMH=Cs8k %!rikS;-*!,E@7U[Q:f14P?J#D%0n"aA2a=FF!W?-aCW4GX-$[lps>*tYY;<o+kTFqkuj! N/_G>S[l$8TH8]hqJDkF&>7#\OE%CWC %@<b4GAV:RbR$F)pb/9FFE%>t0l_F,<#f:@VkeY8Q6M`ujI+ghXKWH6(aiuMJ;1tbh*r1r:hU! u;jL_d8bHM>2Z_])W@X6H8:`&i6 %%NX#L3`%@+Us[&A"1@Z@i#O+?P]i=*&STf0X(F[)VnOi%h3C*t8c%45!bQ! 7&fj2O;9cXEA9E"2GJXKln_$VNr;ZuB,W);b*7\!4 %6DXA`EJ@VtA\&>0G9X;r:lu=5K0Zu>I@_F1gksF&!po<A^c\^*712FX? 0g"8N5CK^L22\PL*g[G/_3TMY7`fp$HQX][)Y17@V-F] %!1d.l7ZO/27'I1jfT-n&9)Fp@3+]DBi&LiC&Ls"lmE2+Dn04XtZ2"qMgQsql[qD,rm4QS4WL:eS2/Pfr5MJ_"Q+E^Wnsi>FBZ;! %9e<+Xq6=?>YCj3Tc69q0D$;$n7g7sTY(8(l3L7s#i!$GQ^_UDFX][,;9C?a]84B]L4/&&o3Y*0aVoLS %Ke`,+Ng1AG_@#>Uqacah %:)posoo._dH,`X2.W)HDR&r$p6\HecGR0EmdjPV38aq,)L<"5#OC(^bK51889f/ %.,@jlUSr"_YL:gV$Q0CQlFbgX!%LCXU]rq=@ %hQ`k\kLAR=b-d1d3(4.A-c&Zb'S.)c2$MG!37fNZP/ou$ (b<TeV\=hunh$aS`.2HWnMF5:6RjWq396$.30qNiMs/o(ZHHFQ!C2-D %hk1%,].LUHg%"0_k.k/taGe]IYT%]=@_XTpYrNd,Q? 3t@*Wf"0'kIU1>@:S8=b3hSGqr>[pGe[cN#3<kXQ/_>&`jTc6CK\HUFW*p %LJp!pS/kJs2otHmO4KMb9%B46L?E%I*LPWh.\Qs]HD!'%_?&?O-? M`bgC]l&*/lMUND.L1A7U:KOqHF_1!)p7j+Kd>ZLLMD/%sT' %1-Sdd!ABV?6'-s=C!a0]/EV%Tpt.P[gWC(\0Q=lBgdZA%,C=E&>`h/! 6JINfSI$abD"V73UuZ`c[S<YW=,E]>KXO1-'n'&/^2p$%'X+mA19(alq5>[%blSTaV$,:,ehb[/00X#Pao'F=cD+L`RSI=$DINl.9&<@^EsaGNL! C'"Hr4RO&j1`[1t*S0!iTI(EuHZ$(;X9> %EeO_+#IdY_EOo)DVdo;V@6XNE$iB]ab_\p,j? +pp",=Hd<V*+Ze2U]C5*8NZ'H4)sjY3YCP]RsKT@Uu_G45nT+lb^^AW3OG)KSsS %A6O+DX@J![],IpCNVj-iU6lsQ%2Gu?e*RPh*mk0]'$lD=Vl(:Y3WUTr@]l %/AZ<'4*YMpF[M054]6<akO[djs6^J&;HXPU%@k*nM %q2G4i*t&o]$0*,UNnNV6mgp4`P(](8nQ>+4;3&aY+?s@ZV>'Wm,V0$BGI8di"fX0r-6XYefo>WQTfH+T! ^Yq;]EBW=Y]i9':iT<Z %(^S,(8L8*2"=!Wd(mLTBB4uRNKWYtPL=$<_)LNU;HG'O?H$l"@8e(V,1QdLg^d'W"q? VNB'LCALI0PKM^h5>p9,fB+;/7M;8e78^ %##F0KWZ\Usd$7N4`B>J-#_c.?\I-oES7>r9D>!J)Hrf!u=^S+DMD:2KrK^^)5\?W8! DUjI;sHZo0s$Dt8O:gPPkNZ*AgnG'D"2bq %P>net?;rF<Kr#YNAOh;21m+iBP'1$^ZiYk>FE8FSC<)5V53nkKZ);pNm,Z$H_R+=*@/"M=\/Mj_A4`kq,W @/^<ZkC)o-mOlOSX^P %Kp-*_mGr.7@?hbD5]3fl5S@bk5AkE+AJ9pd9meL$M+qJ!ACG%a+gdE4*ml\RJ@5d<i`i_l %F:,jD6PQY`VX1WWj!PuE+2l6325V\ %`T*45]sJisN/reVR.-Xp0`k3UTY#QPN:f:r<a!F:74]j$f'k! rL+9aSS/13lfeUIt7>S8MURir)IDh>Km7TSk+-af6Z>6L&!3s7/ %NDlbmmV5LOSuU.rK9.C?SBX\r>_"].a/:&Z#8GNjnnF7=%Ml"<[P13WaY<?=ne3V">*Q6qjATr"?-LBuc? q*Y/+XB$GiH+s@Z*es %rLUhI_h^0G-HB/*+,n23`Oh'Q,>8WA+6ZkYZZVai2(UpgAdgjE<C1:TFG,^ %i$/Z9+Rrs>8lqbE4@So52($64flP('+ScPpeP;9R %iN6gI6/$Oi"$qM3SRg`P(hK/Q(gZ7Tb\d;HrhD_9L5=GnV\AFFF#DL\_FrpR8^? b>+L((,cI'8g"LEq9[8JH4Rj.IP6,YRX5aLQn %V3"ItZEU5L`ZU+g75/ZfW1?tY$fNBCX.e]nI\%&C*1*h+"ja")^t;d;16n!oO>P%*kel>8J! Zq2Nhbj[0j`[00o!g`?mL'fE<cN: %Q#)2qOkU3GXFg'm_?;jV*k>:dEGs('0$h^A2TY/I[epe5n?<W6nr!B]jn^M$Y*Ji1pt! ToCP$3$emGC`X__NBn>_cM/,#s-l6^c* %lBGYD5HP8I=7/d5]]Y0#Bt8'o4D@6gBn@G/Lf%7?74\%*n=et?VKgJ1%:?[G/?bhGGgB! 1'7=GhrlRB:YF4;7ePCGM?-S$]-@nkn %$#cg[**(f$Do>X8Pl+:H`]2uU:6a;QfBd"73A(pliKjib:onC'SKJ&u^S)CS)&&%qX& %8b/FFLRhEa\;_FAZ9ECgdSSFb-'bK7p< %N8B\J*f/4`RT*;pnUW=BkW*1<Bb`@3\6qO!A5##*TT^q;MI<FmcVGq^2qO<n?DqO>^.? UqRPPi44:/)98>$f&*&5Nd5TkW:D8MJJ %Hm3(:bp)8#0-3I`>\@q?2Lik>@VN3EJ-@1M9cON[\tQ&E9R7&oY"<4<N,VRn1T1!M7-RfN@+ +cl@Sda@;TF(mgYc4u/huEJhdBWF %lNB5&`@_lX,J\<4W&:g-iVcVl!3m:CAKLAPimc?sgV+P!3N]i&XcWK;/Oe_,rQo(Z$Q<D3q1[L,)Ecji<'GpUbCG$`$l6k*0B]" %miK+m;W.=@C`"Y1MmlBY%Qg-O_e%0C=C#I\TfNU@Ar4jUj;q\Zo4+(+Ye<5%QOt*! WS1)de3'3p>_p<A/k6&%aiPRMoPaN#6.n`` %RXgkO#)+WW(RF-R`2ggD?;0rrc1Sg5afko>$U`N+iJ_]CFNNUO(J:6:N\KsA2&W0#bkN%>079V_Xu2cZgEf0>'Ys9,Yj;LZ!$ja %Ah3L?j%tL=.;dS#Yob@EMrUgM1'36&)M_2[W@Ahh'TNOG^ea1<,lSZ%8Gl#tI*t#r\@Pjks*u.5%Agd5.7GU:0$eWalhZh.psau %#miF_7lgk77(B?a";sfO/\hNb.&p@R3DhsW554mhUQs13#e#S2VrD\s"8im`QPP35FeBtJr)UT^04Y>@8! Gg6LViV,N-WDm+pBN< %&_U)X_usD/b@>KP1K$SJdN]ka"%-T&BsSR!?]Wk@$g'2Ep %K[j.bR#83(U&Ub8)XC=&:0a)A=3,nU)=$U&\5q76D/a`p$\<0W;2' %8cfCgWY@%s,&Yek22I@SddhI>V-"=Q-urfY17>l(I8_i=dUlQK9JcK! T2TaNNB(2,R>b'.\qNaa7495$#`Z[@Di8`h37(2A2?G`. %SHP=.j9[<*im(A`6sl/[-G7;4nWFl@SCgEV0o_s\dgYd%dg@Y(>?tX`aH8fZF?G45.;Wu)L\bM38QI0oN\ nOBd)3a<p]P#i6M@U) %)+Bg_D! 9LQLoqkf#e_(T?'3nCU^&_i.`/)M3`+N_C$Ra=U;,&9%2nln:O"1tr+i_UTA(T&Ifdn5lGToY$ROl\YnH:o a9[XQWgej0 %j-#KKIPd1D[I?.?Qs%P$:<`EkZ4pfHka*^C`M@\I/HNFVbTV:m"b^gPfWk;W3d/oh3j*J; $Pdq)&I.6K9G.]%N?-&i_GURV4qGSV %5cC1B6\4Rq&lqF0fC6`1fBg]AS>Bg&`d=aT<.l<=[#!g?p-BH[PZ*g8KY%)P_ %j7EqK.t("9B1L8=u4EF:b0fA5_'8@SK`>)^RUd %6tp9]JE8r&iG`*A=3&W<)uXf0fO2q#C##G7KZ.-!6HK,H\@@B&,__efN?htU&GiQ`DF-uAg%kWe5=Iga)prf[>fMGq[K;Ua*//i %A"IUqP/ii()(5IkOC)C+WL@mq/*S[6Ea_gm/_&19fi8]nb@#$H]8EfR`p!sRe^Pq@b"/E%"lUa=Qf,6%X %SrL)r4QM5a%0g#&&d" %KLI$qZQR]d]CKI#VCE8]7>;`bI_lXJGrWnC@8cuCX:"*o&u?BCP%l&"MW<gW3%@dn\/*kG*-%5ZJ"7Et"\ kr0Z*PRY+^;h*KA'>i %bE'$8Wal[D-B_^[l.!drm%6fn'1F6oYd2duVa,i\I($qK.)L:ck9ST:A8jpg473.sRu(hQaRe %^IgsGT,h8d>-_M-3-Ikh:)L.-c %8'.Zf2)hfu25hV[cj:\oo/$/gW7>TnU]S.EL;lJL0M!/a-KYfkQdZ;QKZ[&4s!?cm2"h)? W9,Ad$I2eL&'%/s9I=M7H,/L8`e0%F %6W1FgB<2h5LB:B?L$Fj)<2!u;?EC(=l(8rTeDTd5jg:LVTQ6WBJpNHPBi-* %W6U4*,hl@uhF;49KaZEKRl']=PB<f84RH2)\gT(< %>&;GLPZHtdOE+?a&$I'%Ho2(_(V-1+([+'I94_L%R/J[X%MQH/)?;!jPA/,P6FXbA/DhF^CI=+)Q=GiPu$B%^%:e%EdR!1(T3kI %c-7afWL6n_TB=^j$k)FdQ0)W=oT,!up>s>+@mj@n3sfJrm8L,.:N(i/(d %'ABh*1t@8]&A92s((+Y^>`WL*7@O[9]$SP[U,%SS^o %QDi8pEQ=rJKHBbnm8gna/T+nbNtLTaPBKjGOdShpkO_MC]d,)WgJ2i'cVOISaZ:;Bf/i'()_RD)RM. $u$`+941BSTU;gaptMYG,3 %q#u%>aEq)J0B\RajqYe66#GY_5A5&WYN0-`Z%B)PWRk(Q;5#\-HF7sf9sBMEn_Z%^@[? _<>,U=$C'*/;Y<J.KRe&os+KaS&cehUM %M":L4Bh\Ed/`3b,>k\8(ZXM?JJ86it`XLd?&#8Z)\9c'6NZgK=^YLVLV#`E%(fth[N>]_n(dS %0\2FH1NhJ1;\<b%E&Vb::@qa_%AB/Z.^YW4*a:@,Hs'-3BE&EArPm5V1@9h=`1iaGb? ju]=UVR>AmhhLAQEG$:RWfTM2@7uC(md>H.sR^Gi#$3PhCJc=Z=/-q&SqA\ %&&A*8Fq!8H^;k64"8H(<6Xtkui8os_]^_c1gtT$IjV:SRjYj:8.p)2-2J)rK/D#:MbrCZZ% %paXdI[GrE>ZqXJ1D[1o+']!LN,2# %]odq]Y5W?3PaeB%e>REZXgb]OESIUTBmn0AGIIstG'Dhe9>aK=g:D(gJ,,Gf?/+. [CI836XnC$>IF<ufAcMXo*U[a:kF96[SUXqP %s4"%HbQ%-kf!j0ok$.9QnUOp./mZ&-FQri'cIWtJHd>@&pKrS64MU42++L'b6! RGp(rL"LWu<i"\@;LGm+D-_NO_!8ZX<C_G];-m %7a0O[\ (oZIGk0:67F*gg/8i&`miM9"VkZl>HQ)F5@4#=Y9E3Tcrc4dbcJ:_]e)7\V]tH.;DuSI7IlI4Jhecc8V! [Q1rd)q`IsfT" %h86#FAUj"J5Psb:^M88e4]K/c[4g-QPAkSm*W&'-Hgq7j5P_! sIm(7IO85u;V@EIHqsQiHo=qtMhcWb0YQ)MT/Qt(#UP@M)A`!*) %iRj"epTIn>BFMB*p5OhLmI[H?5(<IXHQ0K(>OQD,e1Z= %oiHY=nE2C<<<&KEH=r"7s53SMa325FDpY[,G]L:Mg$uI7N;Vn1B7BKV %UOW"KGMRR<>cROIbFKY[qnqnfk'sRWVmhEYpT*]BBjeLKCRNB6k1eV&qM4&0q0JsNn+bJ[qN(GbSd9chcT dioC9mB3G<c&<Oahbl %@uFQ0^&(=g=,c)EIdauEhgbZY5Q<r49iBKc\$tf`@,P7[>20HX/U6Hl %mT!\msjiYrh#2fr@^t(I;>S3B7<)=pWqUs2)g$\J`(hP %rKgjX?!R"dL(3@shFu/<\$bNZFL\FB>JC$CDoc44Z_dP&iQkm.O"nD!`cMV^r:^s)? bVRchgDb*eu`9ihu/W6*u>D\F:>59_i!@O %_q1qRd$n6ms#fp\? [V\,&fokMcO1g)0<"]NQqUhHncr"32bVm9qS3$VQYJY,00St(a7$e8k]=K\oD<1hrQ=M7]")_LKmqntr21X G %m*KP+TKY[=G5&cZ(%SI]hHR]hom_J;1V]RWd;Rn>AX=/ke$oV^jWErl^+nGih`lQDpt+nOs %</p_e5&1pn,<Ff.BD)rG170Fn#KS %!A!)8`XMlGZ.IuIRC*!=p7BKgDh[)GU"t*#l@hDb?ORu@MLqDnG>guXH:Tl0dHRca"5[i! lfOKp*phPA5,Ka\H%5A)Z%'W5AtJn% %/NUWFa-"-sATQ%]^[gJjDrL/(WW+?Khg97]Wgdq;p %E_n^&FYAs6sbB=cS>C+VG^mVmi7GoY.Ndrh\AaIc$pH]_0>(IsA*H%3?Jg %kL^CH;=O-@4SmF"hu1T&s*inI5J5RPp'i&^s)I=_0q\BXi:XR.pQr^k#Q4#?%X%:C+SoICmZTBS.u*d? 4F6L(IeW!RXm9R<YaKn% %jauB>pu)I-rnXdXn[nIP#.N@lp[m8`^$rn"^=3(qY; [SEi*:]tDVPkBf@d77q9ASNrpAE&>M'U;OBUH0l4:iQ$>S',l8eEsj$5tO %I'`'Ebud;k6jV9.d#GkWJL?#P&]-m-d9m&G$c110KI87rfWN#$m4jr*XX`+LnPY6$o*XHg6^"j*2X@Y=Pl9ZO"YRUkdZEITe;B9 %!Jr(`!/''S2pU'Koe$Y$<(DCuirCXBZT-0,aFYF6R?3qp1CD,2dAbB514)\ob0QPR$EXh57Lmlr_A>`[[/ #!LbLO_"OXAd/mO@S2 %johmr5><9^qQS4c,a:jn!(KK_aXe+jF2Z^$a5dBdLbFd-%PoUa1IE.0'\?REZ+'g- Ad6,V0_8*.Ybj1qa9d8ZZSB#)#O0HM':$Zo %,jUF?1U[PkEUGd-('6n$OY?e1@IcSJ?:VN4Q0Rpf@;2_DHD@?XMu*&tl;uUo<IusQWBNa6X2RD<&<4p7'&:Y\d%QQK'/S_'(rWe %1V@.3Hcp[^l_6jCs&amp3<`i.'M7337[*a=D,f3V%@efC9UqRgq1$qo'3"B,I;1OXRM8s(S'. [+bu]2P<6@?\KhcdERmO+AhWTLs %7:f@+^$;r,8[81fP@t`DBI_PIMQiu)XX;,*!p0!ACc^slHc&[`ai7M:IefRNUL5._c[]kTpfV$6:7o1jW? >(_`ogJ,,G7@&G@KBH %]MMT&;K7.oBmsKo:7[OXcH1!.h!m^<qC^jt?7P.DIp_R4lb)"NK>? tuEPI[nWLr5ck4HeH:;'cb1U";u6XQ_cgTEO?"o5ihF8GUU %c]t@l/Li76P&aKL92dM(`-/,XBu^pH]E;Htis!aDjHQP,]7??e;hMM3^7A2aCs%1VIY"711u,Y%6! Nc8a5?A4Su#rKVVQ<78jT\U %<ns%MI2XH<0IPC&0B^U6)Jc[GF*d! 3^`)THRT#_ia*lKOrPO)4EXGakjlP#R!,_C6_7L!.nME'Qa@gZ<H`XjXo7_+Z](`&tqRXXX %gt+@$7=DQiOPPhK%.00jqbga/DLOnMD7HdP]lT'PMfK_Lqcpn-H1eT'^:L,3!RcaCf&,kEXHi9o5:+9&o4n%DK/N>!T$Q9Q(6k3 %S/sAVh=:o"Q1ie0?_VfqXQ<N6F?@V@.d@-Y;U=EgoS-)6HYIKI>BpZbs'j8XR>n_[g7#`T<:Fd6? 3r0YL:chVOAf&?c[FopdpDbP %h/iE,6,t!ESRm;%Hcb&KY/3q6F8b'(Pb9K'BW&H*:<W%c-@eoI(_!0-*1J(BJ[?lqLBC %_H>C]<LSk3L(CsH3!Umi1l6pWHlhYPs %no#\82X@u5Pg/s]7;rnWAaB0V^nP3`pqIWe4bXs5M;1O402*P3"U;2=EZ4^\3V4JJ3t,7]C\F6T[jASY(\ 6E;\)CP5+7uap8;WY# %IJao/bIST:_`\BOX*QSO9&7T[7n#SgP(q$9K.s@Zd0;U:*Js2ca&VX";VIS3HiPhYKe+82X+s8j705A5^f!Wc09Z1QTqHEZnPmP %3&XkB]GtmP`#>(mYXtuuD7$ahldcAj&2SHTATf)CK>WsX>pBdeZ+9V$3^`tZ(F,16S\ [Nm*$2duMuIc91ZU(bq,kSoh[_CN/a_L) %J+[RU2Mk*O/BQ.@WAND:`W'62hiD>CSU/W[2D/\+lMc/^rpe=PSbn_m#/[E</+j7!4l>s[o4GF^9,"[U[Gb)WMEQd/0WIKl)0d> %h(C/Ta#fTc%#j39b,;DFTnks9I3_R.,`"58@Ub"+0d)]kX,eU=p@HVE:ne7p9btK*u/lC8]fq;N2CKL^U=_8M00NU3%=TB7bQQb %=dLC0KLs%1DGA9T-@+<fIZpr6%>te>n)MNO7qOX),HL:Qkce(10rt<NoQ[T_go?S. %GtghHah"pCbkU]mhXkE==]MUWP0_('0tbH %:)SpSbq;@nG_k %S3e;)<E8onl"3W<uk@m>1>E#5s2dg1gCNC_J'Q2hU]K3e6)PA*8IWBVi@oaJ*dRW!'X'F4-? HK>_nTV2pFt\9Q %+KqT[*F4,!=S,?3I6rp.#J1YlT)D8SnpBLJKu%I6D@&2"?(T1jc$qh$2"/jm<3FR/(Z61i#o4! @$WGi6X#omT.;^-0rA$?'jM#d4 %QSmpWT$Dm-0l[Z8/SO(*Un/HA^Sped]\K7@T($"T>O4W;+B=d$ZI,m$"EDg&Il$Q<e<? jIGGI9er^hMI,C:>pB<&kq9(JR%40S.m %Sis(PaV51?od!ejje\L,dTURTi-:`5\(!cm]2g0F.rddn%s8Dqrk %*R=T<4toV(3^@VOWeST2RBer7l/4M)LiEuXQ"L-'Qn\RU4] %c?te3?au&-f!VH\B>=Am\o.-qk,m=/IO5JFF$>#^k1SYQjn?Tsn<_Wnbq85F!o,6YVgdJa^D)u %@Eqm+U8lNbo8]HWP@%S1f[bo! %*MC!>PaG#)SG^)T)W%S.YXZ[PD;_Iek+c7e_21\[^*j'.pMsRMd!e_uYBlP^(%/$PREk*k:! pB1_qO[#D$?o>6"r:%^1(ct]8dh' %rO:=eT4hj!g3>5R@u?_j7I._-Qb#E31T)mRHD<-Uq&:t% +D"X3'OE73Q`SJ@O#Lk3&Yq_QpB8eSF*Gs#d[]b$^Z@QCnoVUSJ#[kI %kFW9uBAf5Me6fi=:tgTYMnf5cDnG.]fBn*\]dM_(oLaT1\S^t:pdb\X*e0((76en@^!m#W%lcN?9:)p! C.uk_5jYU52*WLD%Ckh_ %Ts(Z9[/@<0cej\ZiHbHiSQkh^9N+cXs5Vrm/bBPQr92;#Kpfu&rI4XuG>g`J.= %uVN6ldp^A0*HpN<g(kORQLE]FNI;>,S+HF.$d %5I%JuKR?c'LOONJ*u#IG3!Yo<_iC1iVd=dsp6qN&0)'2UFH9O5H+Gpu"60F3Wu+AX %sFSlmYGI,QXD^#iD5j+KUI28;9Hl]1P%h5 %Ui(KeQVThoD-.Ql5\MN>FmkmMZfmsK4&Fq[\p'g+*ZDWu)'QG4;=SQdB%4Ja='S? T[VXnc$4;,l2X+)cYF(e]QIb`Q.=OoCj-l^V %3Or>2PL_Z?^\G+DBXW;2/LiBs.k[e]7i>[c4\O=OBsbtMl.m %d\*H+:r33+Rn(lcn5!;g"o*aEdEAm2r4]&lfk*mZBV3F!>k&O+B %=ncCKkb57SXcnkUMV]mm$;>50T7Zu)*JMrR:&_`.[-nHLVS_-55m"in4b: [G+pcX#@ZMD*l99#Aj&t]&R1kqWqZR`q,3:SWa$FVm %f+$L>%\Wf\U=d%s[Cu+UeC!J6@_M!/&mYG/<8Z$*.QG(u9]BtU*ir'?[/H$G=b]+D,lH>0O/NU7! j80fpN_u5T$PYS4l*</<3"P> %pIeX%;g_'<75gsF)`kf6UW0Y)%aPn)jS(7J9B9i8-GQ?p6-d+?0nW1nhn4&uPs<foUo9qn.G). [UAF'K4],Oa?N%dSr*I'01HTkB %Y97_RXA(O3[$l^*#1X1-FC&k5_=AN8A<on7[7*]1_0%QmFE94rju %Z'k7j5p=]F1S(*eWaQ$P>9[iU)Xd7%R0_!HcOHEERa9/7;p %T;&gdIe^oUV6s:;P,p!V.I>ZaCJj!e]Fks/WO?_oiCcW8Kr(2a0`5b5U->S\1`[AKQ0+=n^%"d&YN!4P$5V17p5YjZT7!0jQ7/l %:nPqQ/M5slWb5?/m\RSUgq;nSU$oSS(Zs9)j"'fppe'p:(? `A6!.3:t[FY?:Z;8h#odbD?"gaJ?\tCIL2Q_5=gpc4DBi4UcOd>CB %Vad:q0]=<)n5<i6)fN`;Ea=V@Osnn&'?#BKh#t#F7!=@,mLW+F+gPn>XED:l`K'cD!iMV)DqD\Z'+3X? =R^LibIr4W=*qVf%5q[j %G:,m6iW%!`;r`>4/ELqHAo>:EV6f@'#IuBqq:fI3=(BR\>ar+ZG!sJ$d[#gBnoMBP>VEF@+c5>? X72,I1;DFZF*cBL-`Bi>18e40 %pEL,"C\uT:"J/4/VIIcJc4Slqq8TN4S3Cm\BkCXj?GTQ[[2j0cq)s)d? &kcQC8cV<>k;hIK)"?)FFi##o8?64F&OaTpZPIRGg/(W %Ik+S"B%!.!+,X7^p?QBopI*ND+?:CcB)8@6VoZ?a,YtJu\;@3)Y=u? m$k9@8);jN\0D>26bL"KIWJjIgRe/5Sp`:8>#FW'EA.O1E %%lL%#X%tfpF\ZSAif3gL0AG2HO=d*NkBS:t52M*uoUeW.k %,)kHD7%mb<L7J`pm6U\f+q`,NmT:P$FuAZL.FX]u\2!A(QR-3k^gG %W+1G6?9Q>nX%i-@<M]E9pI_F2QT];nX5eqT;)=9S?pNMoY(p@LVI.iV=)YUH]Y&hL3mYR2B\0>lnMT"X? RU4^LSC!\JO@gVC"E\i %S^Lj-FG*JBSR'jX\dk`!7\lsh%dI'4Aub!M*:7#`EqKC1$&Xg.uPBak.NO@'pl(RRVE<+]3Z[ZQ>j.,PFCK$^CmoC]TdUtN$d.8 %:@<iM>-;UnPaJZOPnrEs`W07FB#1Y$8RlK51?2qmou9F%Mp2[FW7P4m=#P5(Y43pfmDbOEH^<e.<PH<g8s[&D:YR_\@^X)l$4VV %jSe(T\D;4ao6^*XGW5;#c9'Y-:joIec)XJ[T+9[M/QLgd`XRjaW0H*8(LJnaigXe(St`5H@i3)D0t[;Z>\;:'UY=7635tZ:18&/ %bSl_A1-V&g:bq?pqNYB8li&aN^F"^k-Zm_KbU$1MKjP')OR6KGnMQ2E]&AdqJf@22ED9[JSUaU[n-\ [u:<U".!f&<@Id#ZK%Td!G %^/af;BrYrD8SO.CEe>>JZ3JJ;6`H42Yd]? W,T0dmQNo^'Z3WQZC&.T,gYT_,V2TKUN<K52\9#W7H)YHI91k,"C[m9XITm?T>Xffp %<Z?TXTOMGOXsF,3:-)PR2TnXbQ)M'*CM?GbN'88"l$,t/ZF2sQg02)C13,F&JSk8N=]-_ZFkiq %ST^Rb2q!!4!gVD]iZ#MTCMF>" %.VfM7.r,P6.VfM7/)P6-d]c6XbI&`-F8D.EML4XQJq!@m=(X;$E[@HD^+q"oPL'9? pKPC\.a7io)t+l\k2p&_lPi1(DGs<*X05q2 %ilNdoKUZ,$jU3TDgkb6tl\_fXf?ddT[:q6KYn]tHK<5t-I><AS,d6!Xd1tu5LYcd? +B4M.:n09>>[Z49Df=fcEN\agpa`;hkuU^X %H?'hgT&6Ga6+dTVR?=5cNZ%DD?@j3*1h2o;>3+ARSr(B0%;.)7.An;lZo!gKohpk9KBr$Q_@DNBlOX.b3L)4X&je/P>LY)QZ?lR %h[Ykm+SfkP7-?*&nni$+cThtL[DMr'PE+c%W5S8OIrsKWMK@Y)b9RkX-:dgU#lJGs;W@`?Wc! WWPY,7d.i_*8Vi.Mt+r-TPKkY;S %fodjn,c6"!)U04[&+>&?SoKTu"Va<kPE=34&(L<<r$$AVeJe:[eDZ.Qe!WS&Foe3TD2'=s1!s! 0`aGfP<.D8iLL9*W']9b+5J[kg %Vqot%0Wr?mWa2>`^mUC"E,q59(ff]e:.U4#"+Jf&X(ZSHOjD-_oaqt576mFK2t2'?"]c<e.O?_Ym*! 4J9g6g4#;Q[$T(t3MYA,m) %;qdXDjl`)F\;if_?N0KdpI.Z/.;,Ul%EgldkAkN+XC[CES@HWq90M<eR`he(Lb6:+jh.2T6DN)sb? a]`[`uT#PEie:_*HIsX[Cd, %jIr"IqidP!DjpbrN/">+i9NY".k8gp6#+Zf1K,16RYTjWr'hd %U\dBP23.e8Uch+Z2Y0LO>eo'[KHj'/2oo[sCY&So_@N[#XOMD: %-OM(L:t\?Pq,C_oh.g9\nhQ-_a6h&;kKE]:pFS(_RO5__mDLTU9&&JCkJ*3fpf9]R[D^&e=X,].IU`?$! >u@<eRrbNAn6(>HJ(F& %(Q3>AHf\8^.V(L/@^Odlg7tWj=bGH4cWQ6#`H@"3d,QQ`3:V_FZ_Z5dW*3]u7>Y+ $q<6SR,lnLL4;9X)ENRh<7bP2JDdScklKLd%-*DXk#>_6Ok+r<#Q47)jdC,(I@qWab3oWVc;>_-(B? Y^ilJA_K"IVg`*Rnb`I<G<V?;Hr\@X*]S3JFH)Jp:VM-qEUW0;L4-HFGl3 %:O^VZp(Op4M_>TT2VFTQs%u!S)h]7Tq0a3/-e5DoNk/[ns-j0P\?m4(8[:L %nC2CR'uRTb+g@*HaLD5^Gj4HpW&17/jlO,?##\rc %&Da'aZrW+=ZV.\s_Mu"&,uD:06U6PJnDu57q'Tp`_mH@*pKibOfCDU:YF:&%hr,;^#IH)^ZMV7^H5%* %=#]BBIgWe+h*O?3C?#s[ %/h/;Ar@k-+ [l7s5LXSd#jdjZVN8X=C`ad#46Mk;SIK_kq&h>TUlh"FgT,d9[%i*FOo\^7aaeZN0'EUkrm,n7F^S:XrNjM 0j7-+&r %o4R?fgg"s^dD<^@B+4`r;m5cNr!120rVA]bph! B]7-;SI.6>nBR+P:8R,Uc3[Tiac>"M6_L:]"=2&TsTZ[l_We=SJKD&`'k[ALf8 %`EtO&o/_M:li,c=:jqlW%K(#oC$AR(IV!u0jq[Rh%Sjg/q'^@cO.`8DhN=`E;hDMP/Y>\CCs;Z_ %mndGGg<;^ftt5i$B"]B`V$)4 %*FO>f;r"iZP=&lB?d^<nP=1CUhjCQsY_s14To]'Mq"hSc9K(gAMK8UeaX\oj-DqR=V06d! d0eB)i5^KhL+6O.8[fL4k>.^2[-]<e %'1(Kiku1Ca/NVi4<"5%?V;3)u2g@E>c6:[]&oCP;qpK]clIT=5![_7N0`'jqk-09l(bJdGSG'hdd$7G#VC4PN9%tqaL.V#-f\7C %l3_hQk7qa4l74pC'QtW2(&F1&lk+^@G\oD46qImRooNdg_m@(9H`K&D]W;^?mEiSOjGdCUAr?FI=\%f=d %0Ll=S,X/HT^rN'5oi# %5%0/2gt6iH`7p[porZ^o?Q1[0Ya/XhfkGEbH2pTl#54$;DonKJD2Ar@jh? H6W<R:J&<7)Vl:pP<>lD'M3W$gU:JZtBZ"h`ao&`$c %Q^a9TjQD!+==N''pS*,U\TpuGi-kdc>d]^/g[Ia>b=u)RD^[qs[gq!Bn4hSEf_NP"Vr-!Q: [`7WP_SVL8_Z2b?+j_\][XHthNHus %_-=7I)g*1pNYBsm\@iqPV'(>4bBpSf`Su8+j#4D*eHb)g]#U96EFX!)? u)ANL>BMTWqgNWTdHH_ht()Kk4>S8UJt!.Bof!Yih!.) %U4T-!Pas9^JmF"'Ha,l@EK,=`cdQs`:0;^E-S^>[RjQ2&@,i:c3H`SieJ9/`+L(US3Ud`'hh>F]n! Pp3E:)L9?=VWn0.Ekno)&&0 % +AW]hO,`HX[X,2cC#=B9WL#'aHi@r_Aa8A>MF3@VZFu3TIZdd\]:hl4X:Fp#Kfda&$VZq:hu(dMmieSO^SH 0]+%f;RpL,bEqr[NE %)uuRV54qmidNUJ01Wu(qVU;hMD\f"S[1HrKQl:o3tIJ#;a#..EXHl'RF$n.MBmAU2"*B"NGMcbAqlKDRFg.R[iiF=4F:&/r!(_Y %0:9NnP>LY0^;Y@DH,X^bV2F-T/+/>lc'[Y),lP]^4d-f`A/V/";M@PZO/`%D)HBX+IVEDH]8LJ^/id+WpS10O]U7tD&?a>ka(gX %?86eE,n6P6Pd5jdfR^iUg29'pa:>=NE89k^.!ofFD%,?8cTd%ARah0CB`04&fGi0W^? QOGoF3XcP)J"omp(mJ)3#_D,G.N`$a2Lr %4?`5gCO5RuU_\a_7\+VBCTm[rn*U$>pc>V>XjWrXYJ! tuQQ*X.ApuDFo<8&b6Gqia5A5&WY8D8D*>IFk@sP%q(o:P73J!H9dcdt+ %C@D#Q@?n:Os+`&TQo3@^cbbISg2D4&:S_gYFi/<Z4'm@7NiHp;Q>F[/CrquZad-bbQ>F[/CrquZadbbQ>F[/CrquZad-c=_N[][ %/mZ,7&cV@u=rU^4T?6iij8&<0q9>m;Vtg4E$PuL+RK^DdIf-_?lLa>ik)sQ&Q>9`gPgYM=-Jp18*^+i! d*&t@kK]Y^$Z@XqWAt/0 %P9WSXE&7K_V3Gf,AgOu7@>VkTX.NLoXnKs'^D\Di3,t[M<r9.3a5G4aP:-1$)+1\`C %*7GrQUXE\HX@jP$s3a-I3(MXB8E2VP[2> %q#1^K<ft`4UiG>.!WIr_!OrQN!WI,2$8\,,B?m`_[:dgWA62c4,Rn?Y[TlriM[eP4i\V %.WQ#XT0naVePeuJc7+&\ppVVaso2kDn %aC5,JrBN[<L?U!U.I`[L&A0r3\-hhi/_O$K0e4+W*Y? 1k.^2>,i[L`]njHCmc[q3:h/lR1*C,,XJ.T3k]E_ns0pl<,7*:KtCe"'> %ns!t$B#Ui1GQWln$l)mCFn$/Ehak2=jB8>n5)DMtfOO&7Id#-%? mo$n111*:GsMNL$qjqX<ii7>8$ZqW>HV*`$_GtGTbR)F.0]5[ %D@35EBZIdGhL"_Q)J1D">IW`QL7>t[E0^O@%-Ru"lI)M%Q)Y"<mo3jI-!RNhJORXZ!:T`> %4`+kmb"e^BUh?SiV2,j(OY9)+/Z$5 %-j;j*^]P)a)[^]^nA>e.b3(L$mbIWPqsJ7QZK:N1]A_eTA&jrAnLlYo^fAWD*SHT[1s6hpf,*Pp[$Q86ij>&f'Tr]rU"LY]"r(^ %G5LCEQc$:Zp[0n/rl-$ [WbS:Ci$f1"oFR2jZSV@k1ShHrgB&r,2h@#c55F9JD;/.mK1f=7>Xc(9@ueZsCq4-](*7DV[V]s>]G[%' %_1Mu$%6sF),?;++n(P1M8hG[Tf6s&r.)clC%3oH#ca@K9VFo2$r4\&u#&k?N#e59Jeu^KR<@QP#8k>#f2\ Xl-/[^q_LCa!:c$uc, %g\!/-glcKq'&&Tc_c@2>!TRSAiM0!pQ/\*K["fk71][*"pV>Tm?q_KS;l\@B! ek>KWs$V3CJ]9G+/K$W2Jq.N2/HLmg=O&>7<DKt %H[?E-@l9IHi@.6a!)rs5!pg=67o9EL@G)'Xn^rBR_.f`EVbSp(2S2qNjHcX,Cq2ICR/_]%<7+/EJ %tQ>Y>cs;@?Y&>'rD[ImD),K %nd9'k_$;&=9FVJ%7`"bo07A\\iaLVfkFJ5np0! [/GZO[`Q>9FO`lBHQV@b66pr57#mI@bFmTA9>Z<UPt.Bp[WVsm4?^K%=8]_I%% %^@RoaCtZ+jMYP8:^\_=1V$)Oi$9's))hhBm`fMe*deL\:<o1NjLqe?7gY_/f5WD"USND%u;R8p%K16N2L! M4G*kDEi@@DnVa]H7R %<V)t;>IHA1b3^9rj:PuS=Y4X %>g("(E@C_Xm0eLG<p!\3h/tZA(LMQ0mFnuGXmp">Xoahs#S<p7IMW9U<FHn/FF_2,OndP5A&kAS %jadXX?o"_0'7KSQOtG:Yn7gVCm4?eT_Vu$j_$o48QGV'Odd%= %/^-;,;YKJ1"2)jdm;IIFRoRVS5R)iqJ<3f#8#i+AG?/:$kr7Yl %Z6`_T("Tm$d\&p/EpV6_CXor/2t)U['Z3l-7q!6^U1^Sp'lc9rr=!uB)=#SB6hfGa0A!EAISq)s)M? 8"CuN6dBKilVj[NfT+jIV; %%Ad#9CG7l)M8ak]1]l]j!AKG2;Pi0f7)2k[%P1hiV64:QotWtSWn'.$Z<pZ(rZZ-7PMs394nb7g&! Y7G.6JHuK0b'`;j&c=-i.Yi %Ad-ar[:jXl<+12kc,S$$]<L#DZtX%*L>h;tBabUs+--Jp[6jQIM@INmskB7Ck[Q=,QL9AABQh\m,),L,NKWk/K5%dr>.cr19N/n %"o$o(59G^V!!6MEh7C"OLn]bD>fVjF2f79efCF0Tia%a"flFWWUJ@h2q3a$]P(UOShRpeDb%Q+I_0djpd[@:P,X0>5A!(GgUF@1 %`uFI*65Gq7>J:s9O[gI$+#Apu";1_"\6)8CC4ikSMcjH("/W5^R^pG;;lA:H^=JIDP\g/) (0L0I:.\W1=IQ7JVe#0Ag%**58P1]p %osE'!9sWl==ZDSF-;VaLCrquR8Y/kJS$6et;B=j[%l[^ujZ8[<c7.G0/_Q:<2:!`)OtG?bCIt@#*(4/! `OO*WCoP$W.4&3(V(j8h %.G9k9N@A"&ad-aW9Z^1)[U`$@8sWA\-!M9dZBUM(g!Z7NV3Gfl,*YaeGQRoKMGYVn %3`<Q]l`MuKa[&s.0Ws9:FYHZ>WR!?6fZLa %3S2"$USgnYiQ@oc#VPAsL%FKRE`Sq+kKZuOpn$B1)S"eng!fj'qlf/I6Jr]X-+toV? J1Jnf=2Za/6^'VcZ'CjLM9&><I=K,!tmS7 %qCMR+H?]sM>Gp0p3II%t#KjjbSESq[WDb133e5^TT0<R2'/Xaoi5,BSrL).-5`fP+-! P8K,2bqL^reM;ZA3/#NZUIi0<@c<<L8e^ %Wg$Dqnb76/&OV,15Vhj.`:9&3NZGf4>nRgBEUr1I1T+#UdN/o>3lq9;lf&(sd;YIrZ]pV)2b[)9@SFtH0$XsL-j7O-s7QPM?k]p %cGkeI`%ZG,4E7BLq[W,cpotL#I0q.aftI8>Ymfi;hnHcO:'_I?#^6+>,J! 3t9>D8)5q9JPrLZ5orp8<ZkKfRO`*#^SQ5c]+@`Y;P %kK`$9jZ;GoGj<fCD;2Lk5;+!bp[3Hb%jRF/2fA_FHT%.(]5QSX'.6PI5CX9Z3d0l.R5=#W+i %**aiTaE:7OT!M_f"McQbr@_%.PG %+FsAT&-ROeDa;O!f;8'TC9XHAHJqr6ABQh`5UdL%&t.ZM#1Cl"nL"eg5! m*S\2$jP5.>AJ@L2GV[>1qIIf'mV`-qB.WsXQZ,<+G# %b6p!$A)"HZ>I@(OmsEsL]EQ-0%N[_8"9Qi.*K+pN/eZk)h2=DWkg<m*8*A0'U)+4?c:Yn%YY?=3,tf]? Ed^PL9[tHAcf&\\*Y'*m %RDT(i7qZuiCE5EUCu>605X<Zoi5]3<o<'I4r.hoQ\c;X6*djnd)p@qm^?&!RpmhZ(e`t6'P@MU>eOae`(<m>cC,\9nXV>jG"91< %*F$!efCk=s4*P\YH1(iL0Ds78?YRutrJ?^de,]js3Jq;#a]%@uS\B(>m"Mc20B_R'`-_LC$/Ec24_IarJY=2(UMU`.Aot64alT( %90S+A+5OOFdnHiH[3c6Q\G*_'Yi+,OfE*<SDgpfrAZPMH33m)J8uMc"=h&,O&u7Pa/RO"_YTiYF3^N&V=7[&EqQFilR,K-QnYdm %h>0iUa%omLHJRpJo7;LDA:SXW-hcplFQVpYOSd<Z.l$t^;H9#\ZDDh>1@R1>LMKS7"qWEoPQqGN'? <n>5".sSm9nD_/a(5h!cleC %%mKpimle?pnZpDDGAc*BC[:]?[Vjt3D`2LiZ#7J1[HfcT>-m2(<c-d`MH/tCYMBJ6TlShD[B %nqK"h[DQd;($3GZo,pq'q]ZH=ID %kK[EsFkZ12dq6j3\9-SZ-%C70_lh>bkbai`oPjinG=S.SND95)&e\C]K(B+34o:f&,tu[Yb157<5m3m=]hJ9\ZA[FV,V#h#1Er$ %4jI]AX.;=+l-Jn[-dSEsR!Q9eUQ9m$^3^q]Eod#0I0WiU>]]8a8Y?QjPV(WR"01%aH2IGt>M!`E!n? be_efjZ/75r2c+6VBQ`jQ+ %@boIDCDJL.Z!cNGTEoee?a(6CA+%"Kdq? lTT/'pIe="cuc3#8B^[SsXaf;teEI[;_*P0lE&.9&hB7#anJ7K044eC^ca%r8-@A:DF %ZA`(Saj$-t;5m#6Areeu'MSW[D1d<K*Pu`=Itgj%ldkIW4jr;_#?0g2?JMr0%t(d)_q)elb>4Zk] +l1*p,uWgn(t_EZV=YJD;;F< %_r`!*2f2p2ESHrT>96DE?aY(Knl6W0Y1^1(`B*e+GhMB)*&P_Y(7D1AIC"ic<If+cMXNFjt<6)5'+a1716&+g5Pi=;eAb+Qof(Y %jiB0?-;C'dA+mbGAJM2Q*?Ih\lXZp&mFoIUpCh2b*]\3QhOGbN_TB,s1@O=f+dT/jbLuHq?]pYjP)3="Vg0cU=Xqu#>?&/[;.[" %+d]0#4o@j;0(-<YS+c81E;nXhrVI+t3.>Jo[TuB5T@gJss15TW2fIEaFiRf2(8)@/-N%&ZE>uTea#,s=:LM#EQO*Gn7L(2Q&?E] %"raIG_N_>5k[O7u,r=^`!jTNKhGh^(0R;BBM<-P59pdhNr"OB?C2=cL8]ApLj!RPA2&6IqU?0:0mVgeDn? J0HiH;m"d]l`K/eSFG %E(5J&S/&`CV3.T$V2u-`*#B,+3WoT&Lr%m/ll!qXT5)uTFo.@McL0M0kh*/hQS)<Uft?@O? 2KsA>CGr+V=j/_Cu;\ueB)bn[dW(a %F75D8HT#`q]j]*eop^0.gU)T?CH$LeY^7LoimcdhREWsamuk/B&SnQPtT^\>.Sn9i\g<X=3Y$\@a9SeZfa!22/aAFR5T+`fp"MY %;s-oJ]birMCZaCu'?Xt3?+>:1PaTEY9pf0? H[OMRM3BI4VTpTnR.:,fIsBGEJ+qX1""2Ec5B6DP)7VcN&Hd6qP`d>VCh\8gXqnCP %T,/I@hS"9p4b! i4MpnAO89X.fKng^cIJD0/&A<8Sgp^qB_.,u2"%DS3Z1n$ue*nseh6[":VN'>eG4ks)Cu12:Z>o2CL0/t"Q r6te %gVT0V4G>4qnZqgQ.17V,".@B)O(8<q3V/S5R6H,sXNK5fi8aAGZPSs(RlbN9N7$ [`cBtqOaGBBJdq6p/Y]N5-oRXnLNu0qjC-VQ: %d"%h-B?ZqHk[U192U@Th1f>n_9GUDT>8gGa,%3[P3JNop*'Sb[MI\D!/4*pkQ7YD^!k,Cahr1>#:7aXl! T'>/H1'2(o*5dG"WBCG %i7R<p)h=WP4'Ml1Zu,,A5U2c,,I,%"j4<&P2t$ed=gMNU]H1hdW)Ce#,qIOI]e!? uHI:16$^UjiXI6P:eXQe6/AP)<VlZ8t?mWIR %14?ulZ<7j`B2+l##\nl`<j1C=CAd-ij!FkbN%_4K2JW0"ZDf(h:7O %O_10/mrZD.3hIDk"Dp&C[*'AJ+PS-54eIEp/9$*A'9/T?# %/Jm8o4Fd;(EKcLVVOMJgfWcYTQU;"=!Dug%We*/7p)cG<p`pCYn;^d9pX7rIVb^Y"H<Isu %IfgG)n'T/@bJC7A?`b:[d=+(!gEaQ %(VCf*rTMCH>F#;dXPLO"ja-]+\STNB`G=]AdMEM=r"V$N/t4S.8]AorMHQ2eG>4^;(rWX-'ar0^cC6Y %cLfeT_ag%fS%/MIV/5Fu %Bf"q5SMXpMq!u8=7t!FCpoO9!-V^!eAE9]`55]3N%NS`]DN.CIVhJ5AV'W^jU)@DMb1a(o&NA;YQuTjpt2TH/"i>:]6;$fUW6.M %3HcBKLQ<K<FQD)j_ab4Y3d0H.dCoDfmlPK!hgqPLp)`)`fte[jpZ$&@J^)qno4o!ZlF638!7D[@? JAM^hY=lRD0G>-#]CJ3?NYco %/QoK'`O\Jgeh:4@DSaaYo+nNuZY7=Z"j:N%?TM]RP3I$(=28THjj_tAVT`3tH,fdQ)=u"KcPo) [rkrLYb:;XKS2pmWad@pKa%\%Q %:d00CR'H-!5'f>qQm!\%%3@6Dd.$Tl_opbWkX\=MF6l8>kU7qNNh;OFi=`]ES3)(XNC9[% +s:*q`Q7GZa+!a8B?Wl+*'")hT7$4O %[Vab#iGe3^fSuAY;V#a<#*]0HMjCNG>det/]$8E!XTs0?^L[#M-*-/0R8g>V]l5u.b"SImq+L %MPQ`onARm-a$irs<JX#`ii$%hZ %plOn=HOh*,43J3[Q;a^-,UK\Ta,ZcU=\nN[[X<X`3Q].q6\d@QMA9A]12K='jH2t+m/q(f1p@T8+9^bR,;/5Z@:8_QE;3ZdgApo %ZBab-XPX@q;Rpm,E"aL_`N/-%Y)Ff`Gfk-&P\EB31Po#,,Ge)&1;@WT8RdnHN%^YYDW9/cPKLq49cc$4r: $uOL5hTTFS(7&UWNe# %S2>1qq7mSRK8,@&1U6;arguC(]'\>VLR>E<L>;noP:lqq0i$+4c8C)dbA?tn.b-663SSlq.>6[Kp? gl0m^b%6[Q\Zg!2ilYO3L*B %X4M9(ebW-f%g91ah3O=A2Z^V9T"fO?apjUdeh:::(?e2_0-ufc.A^k'!d`+^3-k4NnqqFNV?*O/ $Rc0b_o>@i3bH7ed:Ir#&Z(F; %+#SN,J%bTmT]%,GRTd+:H^n20P+)HJn-3nS %fY.fbSRc7>r\L]/Y80H<G=AJ(+i_VhS$NnoC`5C5m*4h5Yc+7F%Y_[NkeRoXP!l_ %--OmA]e!F$Em_2#$^\#!!,SKPjd_#TAckhs[rgcF,r:'Ljt*[&>rccQU8]pb9URVbo(74sRQ>#rPf`O? bNG+Tc(8$$@m\l@YonZn %RPJ^7,^9b9=#P<iUd8M5#*(;T0Y2YIW3W+l`XNeG%YV2RIdl<P1#j@#-j?+E#ik"11]']aj %0gWrMu#73EuJ`$Bp<d&HnE9\feGr %_o_k[]C)[s)IYE/S5\?M+=6g;Cm;5;;k*KA03bgbNq5L_5U4VU.d&Ef!AC+.3=D2"?3%0? Zf^;K:.gqc&1@_'A5_)3TG2VOV2V!* %H._m`n,c3"Js9.s&;d5'Lh4s&d=[17q09]:M3BIhld$YHY*dnVj'tCuB@$&(It2/\leh7:08?/;dtpZ\^2 )=Qi%M39[AosDZ>J>S %Xp6^jH3*Q;),KmDKQ#J9o9'jSJ65jSh$g3H%9n#$>I:JPft,>&CDSTh)uVn+d4^tPDs8fpBN[HcJn)p.k>3`RPo6'e/@kU!2WZ= %Rm(E"eFIlrP@g.URRI;1XO6.Y7nfF2AA[CNj!P?Y5C(Vcnpt<@2.hh9%dPV$jYbYPJJJ.r+,#Eaj^:^_8lTTLHi4^h/;P=?$Ka; %HhK96O%u4`,MTK`8$C6[b*M@!C/PBM!\fPMLC^<3l,Olq*7""<,B/a"YCLTMX.;=rEW`bS1tt$ %h3LPQZTn]s!nk/+03TDuD]CQA %o"%OWf50*EEm9mr.lJq`]UE)+J3Xn#8L[RS&uEg@7$Ia+U6MWE-;4GL5tW"ZGp! b.;9Ge(`rM*`<Qt9sUHtL^)*)N_KE4G0N#4A0 %YteR7;agX'ddeDCEP/!Uba-RfiDf:D*eYq"],SN]/mZ%.U;A#2#S1P]BEhPCmL0"\A"]&rVa`J0YJGiH5qb&d,F!i%j0PUi97oR %8+u@4Z?u&6cZUDa\a'5lb4ZkQ\*VbZH/%a]><h0"`\"gRD;)^9rDknmJ#cRRGe\M!gA.#Wi@M`bcU!Z/ [dMd4C@($+>PB[U[AdWt %_Pu#IY?8J`g5H26/*>*E^MN.l%HAg1+#gH6cFd^%b@a.onk$11-I,l'Ghok91WG[*Si1fGVdh%a(cHijB4jnAdfY<V*CL38!aZ& %5BY&7nkY%% +#&'d^4qXIFQb]WRSSZsrabL(GRYKNr8G*OcX+,#pt.<[E4L5m_PQi]TZ".t$W1<>o/Ri6rr) %7%uVO^#Oi,EZIj"2 %5-h6nA-+lI9p!.bQr8HRRYt)%c+OWMh"K.9><^j194.MKMqrmQl/3.=.;Lm/=LrlIg#Q<-(TgrVEYGu! Y5sN2)A'eUO..nKrj%6C %X32j9#*(L9@c!g_X/8Zu0R!BdET<r-*`W\L0Rh$YZ8kP^:TPBgC&6`odlrIQ$;emT.6o<a7SKb=;EcUBZQ!,pU=t<_(6rd<a@\+ %r_,KHR4Y'._Yu%)S\qmQi#ki&IuT0P,Sg$cKlW%Xe2.u</>uhDGSb;[RSD7D/_GF>f_Dadhtd8X&#S(:p %R@t\G<HG.lY^[Y[YSO %:"(TS:RO7fg%+f41T>b6jl/RB2q]u3bRlnAJ6CcT.t-/n53aq/*;nb12$1%7>&WVYGb^t_=3:'O."^Om'M<WB+CIlF3rQR6Um=O %)a/K-W3ThVJ5"*M*<r]=T+%:caj>&+LQ(UbGU0p+Nu7h&n,6h]aH7"1;FaJ%]uY.2<>Vt?P@(ZuP1?e#`W<G$D6!UZtKIcZYnU1 %.eRKV\c?UL&f7ke6RH',NMgUK[:7D#q]BXfD<JXT'sguFhm.FcG*'OPcWTgHX7iODhd3a=_h(<VbW_jC<`&9AMY,T=p7QIbLX@' %")jJX>;prJ`/<deB$@7p5&+!Wb"Wt,3ca5]`P]i1NL@>eI,X? $J\OmG0t_<<OO)9Nj[5/.b"%D\<"Gi'jl9/:qT1+(CACo2Q9ZmG %&+0U1aegckJs:#2Qo/.hblht!q9<hYWQc%#-L<k=l=+-RL0+kP+;$IEV(>reB%>V[&%-;iIaa;tT,h %CBa5XFk:U"#A*0M.laDir %5:q2UldtTO@+MF%KaUu-S%j@AjOr"Zbpt<63H*b0GZ@_eT0%6G<mFqId?%48/*9h_=ugaSDb1jrkAJD`m.faiM``J:7+1Rdd3[f %ArIR(5'#`FE?iWG%\NCXn0st>S+=\*E]DYE+$..9OR`8SO7#5We>GZ(]`6A,UF2"Ms0! ODq8;s_coZ^=fYo=MGIj0<Pg=>@=r=:s %(*8JZ9G)-r[KWDX\J(+8TE0sWHo<^^P1:tWH$RQ$%9m&FH=Z0.78$^b! ub=$Nl3GKXkM"&ET<qafQlu67kLBo7>k2`fs58dndRiM %^f,c,J4@])B?d$]Gf\OC`G7AkR5T9ebQ[aJlgh0u]YBJr5&o!(O2k!;0QGD-$*shsXT1s22$tdDo[! ne;9FB<12uI@E?BT+;?+Ib %-;L!$Q*9#KH2AqAEQqrkHiZjfa9_6oULP%0jmTnW?@EE_GkP3iisE*R#fkD^V:d;O?,,+ %IsfH54\uYgZYJ=Yb%7W_D;,:pY\)/2 %eZ6.Zj-ViJd1];t^&@Z>+#.56A``3rMq<n.3sD"po]Za<%3#ftBAAG+USc<R>W2PX0=T% $bs26pf;5scHL+EP-4cJ'GMo9B_oBtA %1ih<K@HCuh:74(Xdb$kG4rli[P@<sLgja!_s.L)i*\maEjl=1PJM.%"q.RRA",79`TE"e< %3.RAlOTUOEUJJdfZCFacZ)NS8ek2+ %qpGRNC"KL.+5=8B7DMAV_Q^_fMCeF%qaA2Jo8]XtepXT!gU/!/c!.O`c7-P3OL`S@\o[&NA]rY#KEM+1L %,)Vs*Gmd^&S)_5XA3K %0An8m<'uq$lqBHm`Mq)-;NtGIK)gPb/nr+s*E\D=1o]j$C!;jnq'/=o7r9m5%)<n;8^PrNg^<>14%m2\gZ[X! J:Ue+#S<(Ld1k4 %?\XO]5&f/Is*F^[g3..nV3K;ETq!>6+F5:LK#Koo"GJHfdCZQfGOJk"XagJ5T0.I'YCf>@am4bq %NIJ8YIt1%m5]-%p\lD0m6/+' %cTsO:Ctl?>:?t.l81`M>__G]>Q<b>(^Nh32%sS*sq:7oM=0LAq4tZ7.GY5q;I*H!HJR/#o+rtt1VS7WcHc\'*8J*24a$&^MMc\C %-dPu%Cs2=1;l@rJ1SLnUs7iuhVf)HPeC%B'? KgoTs4[A;J,ee^O3OWYhLA)lTTKta`_IU=DW[nF;t6eAI+"r*j[4c^)_uNji1XWc %%iI0:n<ecZ7Lp=mC;@V^s8Cn!p^$O7Ikn,*-c:]L)\:1WqKV3KO1'a`rUH)l? rm*lq=Ee/bSM'Kd7YYYZ4<.L9BD<`kdb5%2F-4@ %%Ek %hmFnruq[^RV"Gl0Xag7?,3dg9&]FGrDIH]m/VO&g.'U6<imt;AQ\rGHGY/T<5GQV2_iJMKQ2]nDFBBbA#b CK[g.%<,@bd\B< %<`N0QIJDbZX&a/-5(3E#rC>2%]6`>Nc''J*\i(5H0+#Ddl./MaF^TZi835VH[cniA\uYK"%Gs'4DO_K0bkqR9HQ-,$;em$iKN2" %(SsCqa8LdAe:6]?+_.5:rP*aVkP+iQoqNZtL(F:+S[Y4PHh+L+]6%qk-mG8j;b@['/6i+n9%%;G! ^BgOf=,Sl/NBm!fWh"3ji"-> %Qh<Cco%_V+kDgNPP!NPc8i_:PPQDg-jK<F/H3E<3jbBZa>n %c`dE9^,=)Y7/ZZndtZDB)&9Udqgq=9dcdq6mm0rIHuqj&hg=>=;s %q332e;caDG5'uqo,C^W9qKkHkpRNE)e&\NSs*sb!4%ugC^(R6n)H!6I#U2,ESHBcJ+<h*rOesCZ8>a31uGAtZSPp7B@a]$St/+4 %?*EXXf9Ts*R>@E7/*EFDcFKus6Ka;FTQAt2hsE$R&L;t*LMRn'qgJ.npZbcBY2=NfS/XnOZn9p20=JrD %]S#3;je4kq_4+@O\&8V %R8/EsC5#QF5bd4qeU4WZ#I$`Uoc+9r.hscTYdb;cioH*a)e[Hg=^#+*+IJ^hao4Lr'CtGB-;l`C+_@R;m7 9O:?1"ObSJiCbU-CI[ %`;',[_]iZ(IeD"a$Le, $J6>,fJB@T(,GhBI)fB6e_'2k"Uu5c^VPPd_cbu;kL=9FbVCkXmATrE(41_37\5$]+q*JAX2tuboZ.X^4 %7;%SAW)=:P\D)+s40SS-?_2`658Bdff4mg2cJ<@-2ff^/[E1eO_T[1&.*YA9'XLbJHk93@fO>g-V:lFPg,Od'F(PR^_&!i,!c[= %2E*jEFa`r61i5u8Xlslfh!3>1)Hd`Arl6*(AS7<O1+Sm2al^fS)"aPs@T<4$qI.\t-Z? iM5HIZVXH:laf`tH*Yb2EKdb%5o`WNce %Vh@smc/&>d[a*I,Ru(*JX#G\u&U[Tn0.N0c?[V+IoC@q/g3m5&M2J*k+9(^.Q!a'r*P_)n+ $'(fIe<O+l($S;69eggYm+)EX&X$k %8lZe7;C*\u1!+!-WPg>akQGoH?`rM61d %al.oC@6.ZRWM'$,b64^Y(giJ=NQKFL6Oc<RR52=S+5XSOa9c]bcR(<Nqe"m1s8KsA"p %['I&4QmGBUO3.q`E:O,Y/*,hO3]^;F>)G,R_]r)Ye#:V'a#c'b%i(_%qLY8n0fb=ke5n-K %ZGp:,4S@(Ze+:/41p,X.[/"3)9eCW %12XGQ$jPJ*$a2\dfMf<cNug@[qWkohDu\qfrR\^f/q3i@f=q4$&'@]H&\u7`6kMmar!! Cpb7(2f1g6kN/Q3Ju5`/6MGn<jRPBssM %Q7LocECO6Y(0,EDW!K44Ne%/=5Po0:U%5&1Q"ajigZ[9l(+IF0UcdY$*EpO==_--='aOrJ-h#dRdk;+? N@Z`bbfn:^9ub4$7tsO3 %n'"!qHrc8V;gmaC0agO\KO^"W9/)Oo*Z3C2m/nRXiHRHr$CWO.md?RlBIjp9ZC! f<cMr&rdFeVIQZtj3f$s@S5Ph^Dj*uOMoO%Oc %a7#V2n>CS&VoIHQ#UO!cS(sZ'..q>c<[gu2V/i,#AsLR,I"dT9ODDCI%7d: (9@[jXW^3Ar@5UhYbnHk($gNH:#-h(#28An5<M<C. %'h\%T95ica5m/!,5G(W\B/V!P?"i7qe+&GN+%Jq+=o %IL3s,RPpi19p(n"k,m@CgOpJCB_[1^r[a5$Sj1'54i*F>?6'NZE%n^Z6_ %h7\0ehS%l=UpmO'Y;;P>Are>! o>^]Zp4IXg$AuT0F`^e,"*W#[KpR;_``jON+8b*M^@Tr]=\,Pc$e5Gl]0n09),r)<<hTVnkTqu9 %OJ5]6*e]c(Ob0ddj('H+FFu/QM%qSHnci=>(X";o=@0"bUMDdu+$6a;\i(#1/? LTfHuIALQI#GpIT/LZR@iBlCpBn9%l_/sq8JM[ %ZJ3SM<ggtigX@qdo1PjR'=dD[o^'K7D8IWQ;^ebAcblQ;hjSsqUqjkfff6(PK`<SrPK;_:]eq=TVPP"11scod[A=1gg%2)S5*X5 %p@Q1aqu'*q\'8GYb1,ZTe%Af9o(mS1bE3J<k=`#VeSkKW^Qfl>2d1":k\)\tr6A\LVGel[:6DR<;Pd^2COeJM:D/?Ujta5S"Tgs %l:#a?$::UJnANJ<#!RqmXuLT>Htm8&l4-r'*9q<n/EcSDS30-_N[ZL %CCjPd9^h$./Er9=*#pCV0"ZD8Iq&?,f]WGj=Bo+Iaf27$ %do1IfVIpu#(d_AuGTh6Z)KpT';]pd>m+Hlm\>sg%'MX?lBa?E+fhldgU8+X<(C3',maJ(0;l%L1MS? e2MqP#Y7p=ZF>eWLq./`WT %Irb2Rs!1Z?X7^Nb?KT;CrsPMETJ<?[GX?a"nl[-th2e_j1^I2g;,ocG/!Lg9+.6D:?=&8r? WpPUietXq,Co-n68tm8T3GK%-M>oS %N<;3:35ipqn`a8A[rH#!@!$dTY$!URYXi30(8JL?8KeOMZXXN,'Jbrf[C`[(0H@bZ(agi@1j<8Pm7j) +e(iC)daB1n-9Q27d3H]5 %Ak-'@Vab1jGiF9nO&?Xu\8HUZUT].05MLSGDZ@5og1t\OM<#8\YGjg$I.]SYYN %ocBp<qW;Q#;F#?'VtK3VuNaRg!`oPBY1.hiFZ %KUd`-aKJWc">UufUo^Z\?`g=]/3A`=nA<>fm)%3+ipn9riu#_?^%_ %ofbro&,dSs4*GrXjDFY0Y*uQ+A)B9b7(`=53S"!]RSQY=J %)oB^^jn4C/?_@op!s#%gA:fqMA%-%k(+JLFNomdA]V7c4ueh&jSHU2reJN=YuIa.,lgL.oYk<sZI3d*c.14um;R`2_8]<YcYCdZ %&lYVs^3Ahds';F81"lDJij_[GE;KEQQ7,gN3D`\X0fqQLUaU?Yb'F(qWZbcLj&X_ %G39jX1V^T,]LpsBBdm1hh<]Zfj'!Lh*E2C] %StDY0*16BJPL%Lu/pDO4"$p_')cO4XqKdp/B9mL2J)Bb^m*[-shtRa;3]SuS3CE<l^-sG0o-lX&(4Q#Wr %tbDKZb/9`>gmXB(+T. %@n4l4H>\4@IX05Q]KOU0O+rj9LVKs.JAm\)j*aO:nFVY=q@EShDa(1Dg4SFG5h$OgUpt.c!/AR=Bsh_P2cbI?`(7[FZ-)I,#oO> %OeUE`jf/RY4E?.uX\`s>#W[YnBCk4Dl@_dCo3)T1AT.uf]"`ahlF4M+]iD@\d0<kSb/X;#qDs_D8p3!;nb N1VO3/h'b=h/:A6K-[ %Pf\d:04'$KI!g6OARfOmC2S2$-\mJsqg+$kc#AK]puLgtMNNbMUD%hO %00q/#nY7W5Y>5sl$;'N>6m`[B>a8Z7(Teud..+L$+&;@ %cp-["qZFQ'H0O9]\kO?sGeFEu5@ngk[WG36Hfau^P+Xrp@I]<ols?FhiO=*L@\qK3$9b^C?`()W<_/? fCd3:0RT+-Ls(Ygk7r5DU %s6=NOp>g:A2o5&XUcdY$*Eh;s`lH/nMoQn9(O5<2*k4?rT85FdND9L*do3RTr?K!7LHn"tj&6I'^r"0; (+_6U-D(>gYU;"C2[`5%Or:QEG>J601=Pr^a.LSOHMlW!HV7^e@s9Jo.a0E$L/R8HMc=G)C$iC?1<3aHo>gn&? PjdMNlX1MSd6TI.^MOCQ!1k%PJaNL)>E3V %Kjnn>PuFZ).l@g9dR''?;ldkE`IgWNnc_W(4Fr+)8'&4HT)<UD:Lj)U#h5+jE@j\,V2EM581T_8Ydh9L\@ TDa]!A]S]!B'@8:BmD %!bFeN[r9TZQQ;Kd>OLkE"a4MG/-7%:m6*ghj,4;G!6aTIjN,uULPk&qB`aTW4&grO&^!HcV<d9*2\6'hq? G"!kYk4CYUsE$-^lj) %4^DPeSMLjp$2NV:b>5X=JYmP$eJ;t;loop`#;<gf,IYPZ#km">UO74<kZ409>)UF9Eg^_b5EN2F5e0eYr2 c".+G?(9]^o"&g??(R %bHGN71e(\UnY+XTjk7V<\YVa#'AhI6)JNu7KTmKRZLd0Z=)a5Tr4S+34jhk?&<!G_*u^P8%$'1R@VT&\po[o6I$)B(Lto]@oGAR %+.b_u!sKs)8^M5im+h"JR_YsP;K*N#EO1.ZJd%E?ZK9FU:3Md@KEiH#\pt18b.[t3F:\gnV6f5]rV1<Y<8-89W)&t_l7`dkrGe# %j`L6!D! dAKUs[\@k5;t&70f$E5,luuM^2SZW$dg/kcFbSUYb"8Hbu'@r#bn4hq#*P16!.p<L]d6UI8f-.h*\V*[d6&-A8#+Ot;1 %@\i"@<A<d/+]PZX!dOk]F^/&i<sf13_\Ui\#c_$Zl?[>j4m0q"StiViL<%='mp04+A&_;.CA[k %Qb-:a=BZuVJG8KfO8E3is);%` %n)3[p@UOE^d6BbhCBGtMjtgD5_W)t@L4GLm=eq^R]o2rH5n+<T'EXJL0u>IDA$G6CD!UEiXl*>%U4P0TE#/'(f.Q8Rl[:cAh],r %'`Z"1^Me33)V`sTG/mP-'a:@<M:AXmBSaRtrSG<cZ_Jn^lOWZF'fKF/<MD5oRQ<"&TZUYdqI3(1c/oLM9[ :+3]\s>IE(E<.<G8LT %Xb?`[W)9$*(+C5cMCh4E)?bp%^6HU#Ydbkm=*UsRGaW7aLAI? GU`0q4KIq\&.Ia9`U9YdgM[PGb"A;<Xq9[LP`8kccV13FuJK-!k %7%tK34>a<gk+5tjit_g8+G1...2/1A@DK`fC4aGPX;K%N0iUJI2*BRB3s=0meCI"GPA"dG3A? cAZj.dH#d>\JgkF?X:''h!h0Yp2 %Y<DLMgnN5\k:Qf_7Vg3akVns"s5;f5jcO'1F1Bu;JKC^B/_;r_'95V$Y^)3dYLscn&*AC!"^7Vk`B`1MI_WG`!XE",,ISu"@cL@ %3K#Nm9^91JHB&R,h!VlIbJ;3Ym)$UpdjRGq34HQ3oQ_h$U[i3Ca,r];YB+@&GBSg2n'5+NK&lkDBWR"5t'+$4:!B0rblc]7Doao %]?Usa%#uM,LDV1)*QmM+0Gah&+Hae1Gpk0k/t;qp?s)o=D_QY.`E1mp#Qu! 4b`sB9\JtW_HXCEk\IIE7i^a,%J^@d]0m<KU&+mm( %Y+(=fIE_&6RdEtC`T<#RJ/"3bYHtaH-7:JKIR,!aTF=/_Qccfe^#Y[2l_0D<cU/6E7Y2kfj,!!Q! [bDW$gh_7>$7<*4h^inkA_l6 %/5e_Z9\93rf,jtgeC:&2am#eZZe[eCrI\T*L601nP_j63Ic'Ahpp1Y]e>d$i#r+.mUo/AJB5(=^7gB8cJ!Xt:]O&k_bMg**!9u8 %9\aOQm)/YHadFNJH6+a3LD!EmKMsXCM<8Doq(Oqn:fScgW/X5QIfICrU9^C5FF&s;Pgj@B\DfFUmh.U.YHGg2`!-2d`W:.C/D1H %JfkasHJ)\7[Zen4:g]Gc:][[`I? EHER1PT&3kW&<dGEDBItGZ$Kh"]0ig22oVJ_N-,oY7#1G>7%_kbaUWH@b0il]0=Y<GQ>"(NS^ %'/A\fT'Y\`\N)?9c4#\2Pm*OspC>Y5aCXs8`hD<>E(s"&9n3;8!\==e0b?fU+%X? 4oUgL3&h=D!"#^0^d`ifk<!m#)1j+Ndbm$hJ %]5RBJ5PgR^^\*@cIF@NKZ.L!GCK.Q<\'Z)s9H_,UJ[h:;$4Mj/l2`_l*M_F\m0Rn`=`OPpHn %l7[).KlIab3NY#\Si<ZINqT3l6t %r7o0ef"r)]aqqX*='rE`Vr%:<D[63Vf%,#k8kWr4ccq$TJIt:'P'g[0Bllm3e.CV(F0i2:c6dKEsT9`g9nr/,GglT6ll&sg'j@# %Euu<iR[BNG9PuUe![,8^";me_2^I,_%o5ZY:!l@-.$f %&6@i6;,h;&N2u4aNl/iSSepm87><5\F'(<<ARlbqn6a:NgdGsjF^#:5e %i:P&`$oG>'QeGgPAAB<KZ\pT[VF+2tZE7FDMj.D*PR.YjN[mTKF+oDh20B/p$^nE:kO35)+gHK3HLgZ %K1G%TQ7PqrB'3gpbi\(' %gn)4^aYc1C2DR>@g!tGUD[=b>LLb#&R`$W--GFEZ^;1?`fgHm(M@5<+NpZpuKjM!? P^^9q0PUO"3=)k]19CRB$L.TpC%Yq9;?^/. %oaHhDotHf9n6eqI8rl5W_;N5SOJRdqH5g(84i(*t\^0M5q*H)dp`KP"Xmc:F<+] +,o(bZ/8tF;qD`6:$2L!C3oRf>8:B2'd7;[-[ %9eMq:1f,R%?DQQGDH_<fUp,QqCu?`F="$EA`6t[>qL\qTM_! <&0<@=rPV72'I42.sb=l'lg6]#d^MoiqYe@_kChs_2"\8ZfFE[D& %FSChlc)-tM@Mh%LGQ]cYZ(i,DK#,`OVR6gNsbHmZ+1MJ)'5CS3oDl7AnZ"L[e,.un1(qj]N'<&5A_AbYNd(Colu]L[/^!ss8DBa %GmEn5&30uRpDta8PEV&"@HinA7o"L2S'ScermG;;IC8(ul%=\ $qf@Z&MC\D^(@F>)lp1QLK&Uj`p/_+:O8eXmKt!Xu.R,<L6rDXj %"8U"/MGH@L^Vh'`RiOd3'>;ouUtFHGJ-@@:R7O?cN[qA],7nA+FrUPt!)>+9/<jkb42:no",ta670!BrU? 7>t4>D+LS]-or:tKJB %\:B]J;ANU?o`_D5'rtb@Wp4l[/2! DF(.s)nn[#iNASqA9lI$._p[ujC`P6b^1,1t<md0bXf(Pu<erc(L8?]k'0d*<pUM"E6:+F^N %3',U;1H7-E'2:A0kE4Cr-GaR %)Dguc:e.n)"NfOs5W"E]59'pl+<5;&;CG&N=hOarpQ4c\I-:BREXHgp8e:!J4SsL9')qbmr)^,9 %5S0b;TWIJA&73X5o@8m_e<_NoHhEBeJk?+'A?)W(RG!$;d5VC]R@`(c=CU1drkC6mj,dJ!/E(i? 9]_3Y3oZ,^:[cT`[BK)Lq,a0F %?[/gME,JNAEQ-$IT%R=ojRf)Bl(<+lNJ`u*!5T[He? VLc'[R1<$r0j."@*DE6`)aBAO&saK2<]@6CX[o"rp#\0Fe*"-M4!BN4]5W %X,[S/aQpBGJs:Qk&RZS"?S!cW.\>DKrf:b;hKeqjX'tR1>3,]9UeFRH'o&@Yk#3MBUI.DDD/Gi=A!=%^?TLB'=[Bd[rjVfGCUUC %HABB-bh0&NOn%1_``BkXMJ-IF%d/J,eE$"B81B&mmMh;qOMS9=97-EKd? A3O/cZ6s$g1m*fY+eSRdD.YKaVQ9$6H0e"%M"c)Ctu] %4bJ!TS'I3%Y/]&Wfd2+rnbg+RTJ2`IIlL"8>]";8-c_G88Vu7&r?)$Zo.U&CCE/0%gSkH8t@3[gk/9Y=M<XQA9/Q-gD`bY%]4cU %#EL#'^\-t9m)^hKPT>22WTOcl8&VrO/JJ8rVQues2E9W+J/Z'&-j^0j?HWNFJ5ZHWd4]eLpemfM)Z\Z*EQ:ZL-q*?c3&C#%K(O4 %i'qi@OA^Dgd.GQE5'JMm4)#5/:BH+7/&6W@n8]=C<gJRBJ5:`kT:K8tH*]`ae<2.eC$'24H:u[+VLgpdOUJoL?$@^FFbZMT-+0R %n0BcT2!8K):rfmb#c&K:&\-ln\X26g7jm`Om7onX#b7;eg*! KE3s<:5Gm5;f5R4fO<i@_<Ad3\B=h6;F5Ffg:.nM[DJ>'ib7R.8N %$&/Zul&"$Kq#.\9s1e?HS^$O8(+8?3EV^;#IkhS[R-]9?32O*/XKIZ0*<o %/,&)QrU,70_`8a(S;b.j_c&TRE=)//dNpSi'FS,4E %]t)*Bq.6cU0JBXX[;7Q=!L<r(*7n9Cn\?A/UG4bp0qad^Pq3\Hb*Qi^"A6\Z9A'@a5Qp>jiejc %=DY]jDb^ekp9h4CBA("Jp"Hj[ %ro!?mJ)sI)mR#(ogqr!b:g%N.m*)!O)h=]%D<lcRK=VC[;kk#8>M=F%:$kbaZ]"QUV2R^`\#uoi@gj[5UG?NZGS$j&DZdL*@SQV %[t6E_;)8T\%SmXX"("7.mkhIp:>T:oS\0TAP>:hs? @[ah"i5;d&DWCV_sKC6%Z2f:E(H>gL84JIj02'>'0ZS?Y+p&D,`_lT\,Xh8 %mg[<Tg>*X!eXpaD[CQIS85aAKU#PQrI1ZMrLG)9$MV7)#$<f9'N\4[n,BstQkZS_eA.Cs1*(lLkQBs9D6O*MB3tMe@paZTeMk5R %3'`j:WG94[TGt*D??2g$GI`lZq$%5H#7(C_E'tfe"k3&k_3H"&K$BX4;d`L<l5Q=DmQ%0EL@H^ddiFRm>c;+XfTlD5dH5gf1$Ta %!ckj'V]7dEXL"ZPR7R#E%Wlf7GBD[EXn3']G*B %TqjY^_OFHs+&B_+:Mn"`k99YceZMm3d50W\R9<SRE8_B5/WYmM\"JSV-h72X3 %L8gJ6VGXf? 08F9d$`^RW+m4C[#W^6=*DTBL"N[Y'NAm95mK(NA7YB+MmSQK59\bB=O/H4OEA/h:D[7HmL;mSMj,^tHefV Ld4ZZLu %SfUEZob_KG=!6Yt7m`&+U8_Fm18kU>ZSMl9JII2.#%#0g(9P[^aTP@)SmS\[ij#'dJK,Dp#F0g`J-@XS? iSs:a%jATKpH(l'Ro5K %s7R7n;"1PYDhErKVgNHcemS)M2i)/u0bIe5&Qkp%,D9&/aV:#Jor$-+9r(Z;CTCu$p;Zsa_VF=F %\KUpU];b5oCI(]S9r*C-.k`M %/u4"irl%sQ]!f0[Y^fPXl9QhTA7MLII;jET*(rYI27<+aFS)#<*^Ia, $^Xm6LVDKU5ECh7ZoEH[@n:NgW.0'/jUID3Z'I#X"KqkI %d-_N92%;;Cl,e)ZcsSg81sm>NS!cE8JL4V4Z%o5B3e.qHFeZ19.DGK,f24jMT[.<CbGaa9E3spJ+*Cl=k[>Aa[i/PA:rlVMBpr( %OgrtOGD@A34$_8.o)p;[<jO"V.KL=c.8mP[[KWh0UuEZF=I_[81B9bH\O.RO%_fj!d"KF&! 0t@de8ZbKGlJ\7-:pMfdILd[hS37S % %`I8:;@P)VDu_L]ZE)O2)Rb=<Q]Wm8[ZGU1YkaQ,Cn=0q_d`Yr:O_kQrnn;F(g=aO_0"/pN,i".dhDjcZJ2 S?\*W>71%+.f_\G\1 %1<n_kW3>IM)7LtII=!l?DUoc/6_h,`Y6'j9ki<0AEoMe2+; $kHBQOU:&I9b(X1pg0m.Nk7Yr!.28-/FsWO3\\!>ZmL%)>;4H>Mi' %,b!pp>stonRbPINBnLI7'4;TgD(="p$=6KY_<\U&<>k?"/Y/]\^9`$%:'#<e3q*E-o?CVq:=m3dI/0<,pkag^0n;Q@<%$l^:;u< %n4+-%?dRkQ]7VhO0V-m6o0dQP#9k/E#eW19(c$TmrW5L"YbMlJ5mtMU9d0M6)R"jZ$<QhQ9]#cgHFLVNqccea6AYuqbcI;PNSRk %EtF?907W_k.bK"Hn4FE7dL3d\`L#WEHEsic!1Zs-k-?s/]@6H*Du@TZC%rlCJRSAee)? K+ReGEfVce\:'F!!pA9T^qq/RThqqnfe %\s?Dof[87*ecAh9#tACAj0oq2g=+=6,88O#mG603F'e+iMA'XFNh3Pd"/ (9kWWaealfpj1JjZ'(p]#SmqMop_6.\''FgQ74[<?`& %G2fp#3$aI6hV3I"Wj-9r5jl2FQJ5a?n=A;QRFKq`(]NXk2ub#V1iBUqP) [BDk2B.<>A*M^ip@4obiXpfh*.;Ui:I8EJUl#20tWr: %M]61mN<sG55&o_]l38EW""&O#c@A_^+2*VT33jB&,*M8+4#!6-)=bWpGS@D>+BI\j\6? 4'^[1&@IeuA0f=t-$*)L!]oZR^)>`jUA %M5Ic3Ydcqj4TPrR5[GN1+W-U5R/G(ocF-$)kip:A!=HCc! aWu1]33l`KZ7<Z/u6]E/=nkKY,Srh(/Krd:AI99T"[Kt.%4l;ckn;e %^@kdgG]pRH'D-qkO`X6+>7])CBPaLI'G7;%&1>:4pQ#P%i^)1oRTblB(-H24gAmY%e*+e\uE$8AZ2A>ipbnc%>ON%^kTlmr2j'" %jNTX_eEuSg)d5sJ7PojU`K;u\@nl>XAk0cUDY+'qc9U%H&%dEZ=!22NGq<j#)q]P!6tlY! ^kok8go0>2>.QpVjIQZ,!t&uVc=b1J %ECi*H*2in&+M&]/5YQFfm14-Jq!,=S0paED&sX?]K6)U7YNLdG4:td?g$)$nU"b"@c-=Z4Zd1g^p? YqX&7pj)J,S\?qqBY.Iei)k %QBmL`7E<R,S?fT;Dh!elmMm7>E4W^r;n&OD`h*1'7&K(ul*GqCar? 3KNo(nH]]5'L48VMdOj'6eFAiFp8>tGX-YW\7]`FI>hg!N@ %RFZPs,gk8of[A@%"Td0^Ur636M,[8\o0D`[ZNGhqD65=l]_q5*](h%%f;QmE@WeR'JX6;oKkRbR&8? 1jdc!SU&R_1Y7$klHn<ohR %(`'fMoSe;a4MaE.QJmXa)J8>!K\8$AUbG*F6`)d%=b0PqQY>FgNgM8! E_m'U"d]6"^rt8C2P_/A#A;>ppr6gYnH@^:i951r>6kZb %pukoS:.NId<eoqV_?'nad*U.lfN<,JfaVBI^3u5?E7rIZ%%. +/XjQobr7_1<EYhVmVYj90i:)QMCiOh#4h^gn;"VkBG4""-+;dap %%u`K\_7#qdBOe*ZmRam1dh067L'WB1RQJS^k4%5X0tD3bk^(=PF>J0A.FloV?Gg2$dh,6]N)UP1O[U:3mu`*gZKT'op(%,jr==j %.^@@L5MJ7Zn+&DA*!rqrf$f+QC\#%6!-m329JJ,,;:(3<++e.1qZ;=^,H-99#;Po1PWP6Db-XD:]Et9s? d;GukTYYnkkHdm:sTl= %6!kf?.DQ`@iC"g@9QiXJ%4L@.SY2Q%5P*n#!h$2W+M3#r:1pk4f! 9K\;J;a.K[qRTo(2IrbKFTDNK9.X@Fk/0hUV1n6->adg"a7< %f(P.'_4fVioC+16$];Q6p,BF%f\O9%hSJ?7Rmt";%O^*tiXI90a_'Ti/9\>(NEII8PKq^TqifkU@ %@,6K<>GKif0@.W\Kr97hUfd %<$ouuA9AeaJ`bOWZLUZf5hB5trEi?kr';SjJI"Z5*PQc"s+K7gM`5gjr! B\c'T0AoZ:QRLYfRJ2gAM;@4eU6XeHU@CRSb"1^G+,f %/[R0/@ru7hf&g(DR21i=#$(^-8#W)5,XE^uh5CR+DUe3,+F*f7Q)kM!eN1@*G<W%XQs>.? =$Oq_4a*Kk9WBk\GPO:X/)'5YT`Ccu %"D)[sPWBUGj7)$FFCX)8As6K2G? `YDmp**Pb:,rB*ET2hn0q1@\bUsL'G<8:9u9TZKPh)D1X2K(NU8m.eugj9Yr0dUi_\(*2!8kA %R$[[R"k:6UT^./k6t6Fn8Ka478iFPjoX&c7&! &=G_lZ]u<V#Ej5Q8Pbr,7Ge6p*AmBq2MV@LA[>GA&IpmP$`\8!:-s:9-GX6:!U0 %EN;/0N9IBMK@P_a*R+Z5"[mT%8K>TG+QibI<L[o\J5*t=r:'B#_c$5Ur+Nfs(g72@&gN(O(YXq2;ij&(E1M.Y^(esT>1!FYno%l %jJW##<uZ<D;J6(`B\LqZJH,dAcC[=^7pmThg&1dG?#<r@gGf+%Pe3#40mW*SO^eKG_r5:qefnfND4__F^TGF(ek&\<k#h^GTrBn %KTf,ek)Ngn6\\d@=pQr%UnE<,E\cHks%#9q*cQN_e&4XqWjsG39Uam;)=U]t+P[Td[@_p,bmP? &Q[A5Gf:OHRR!8PVTl9<O.*=2) %PZqD$5JQF!.rQhXAsd[N\1<Y[#Ek0Wi'WDYMQhGHfVm;^=n=lcHp)9O]Ep-71u1V+ [+oH^H"+/]beg`>JR9Zp,F)p2-L`QG$/8A, %+Je&h03>HZ)oV2PXco\WF^-Aur5JP7:Ruq(h%-]<$'7I["dFQP!]0lj*0unV55*W=PZ %bj#4N<1;77G'97mqK3HFbZa6,*./MibG %n0r;]JT)%?7rPiFFS5q!ku_FGe5mpO'$IYuQ-bO(MA0$'+6%na&PY+<2]d'h,*Rk\TY")1\ [6n@4T;kDk3F,%P>(]j4oX/rIeSmj %iSI[aTY5cnDJtB-19P"Eg"b]s7\CAi?[2CWIJF[cH#n1)n_W'LI0U9;;/m`YBL1nId_k6`fcn$U! X0<t2aMs;]tl7mPte'QM=dMu %\S+6h!@A@`7$>Z7ojib#0it0hH$FMF*2E\L!$c_a:eV=&XOK>i=fPRj>ZSlW? *CCa5B:eB,DBkaf_LN/DF[\"n)$o<!36/(?+P,, %SPE*KD=>!l\ObE1o=2B?^1ZoKdk@5J`o;hs7W1,=j2lCa>>n`B&iCM! q4l&>]J5Xe$H*msiFF3rq2D$s*7';uNMsm\bm798Z#mX` %0q$,dU[aW[d[2#5VRgZ*Q;sH8-9B#K[W<8!IJW<rra:Z9hpg+:mI=c!#7#kNGe1<-)i=?aW,u.t! EUB^C[<`8r6\IK35siJWXYP= %]Mg)^]_'p%*e3bVP/F2T.o,5n*'$hl%VSDEIN+,iA5fjSpfjG[QpOm\B,B=63Z3H#a0)Mk5p7R$GCsmSQd5e!]%P3XotE500fa` %=a\2Df3.#GT]Z:Qaj2N@!(S0bPEX$'8Zl)p?a$O^/h<]<*gpm2B5$^M0RXM>1;aMYVO` %Jich1OUlD`#>:)E.<qNflWK$e_fk)no %Sf$38\Ef5S6e8I`4F$@`B:d4omG5Bu+$4WShjhD4D()/<jQq*CrdArX\U,mtl<8X&;/o1,_s(q %k\=jL:GatV"6!'-jU9%4JVZ6! %#>>b)m8.0[9KSZ1qcO'C-ld"2`>ZW&.j7^q7alOA-^m_`@L5#?0C4"3O$KeG3-mIsBsG9ZXmI>OSL9in/ [)Zl[RO/SID0A?e'Sb! %Vjk<0gqefh@#h*gJ.R2e_\K5;3bKSh@eV.lN^u"WUXFE=Xro!UdI%*h+L+<(VCIl3"s4fch=]b"\l7cuH/ b7*'dq:l<1Ng-'@-_G %3<eOAo?3`[S$scSpuU,bqQ%C0"WRl.$,[l0<;;Em#?")+RDJq)LAKXH<dK?(_!3S&nl)s4;L7PGASjS++? 4],`&\e+2*Z51MK0&e %NM[JS5AQHA[b1V_DK0tK<Bde*']:bC6G+$Cl$;!!qiAj_qa*1;[eReO\N("! I,XVcEV_.iJ>]^$ANMqr(:i3^RO'?UT\JdJDJ]KD %"@<]Ua+mk[A5=nF"AF4%37n?t"aC'Y+MC"?#Y!48%.FO!6O> %M8Hr\PWL4X1h<FV<;b\:7SUGkY(C)0Z*SmJKB-c<_'8a2Er/!tW %fkgEBJmCD6%<br8Q&7IXR[ie>8!h?VM)D`?%(><D^/2J]j\I:I%ZSl<\+nJX\'a=AAKZA_2! bDTb6o+mKoU3L@n?B>@g@-&Uo.O5 %YW.9n'I(QXA0<W!eR/@4gTQ&&GFmZ^>>TJo\+! 43;+4@Xn\XkW\V1cD`J7*ISDKH6W\M&W_;J\Wrp]dG)g,o/\Xk<&-n5&_b-gNg %g96"tS+rW5ScKVXBBRB2R,VS-aZ]P_FQZe1mRf:8Q>$jP&4+c#HU3s_:q"-\?%jWp? 28Hk#Mh>8ZgW_]U@0d!:"HTk)&].2kni+, %)G!OrrQaDbmH#sri6V2\P>=WAEN@n-M'nLH9dZ>cLg$Z5R`YcK/<PT=6C)D+#NJR/`"u$n-39&*(P-N\ (a38f\Y.pm-"?,'hI6u6 %P.cJm%X7E`nM?kPPKat#R!h,GPGq6b0:6q[@bs?oh:*="2MP.%7"/:,_s_M[mgR/)<T=32HCH8bN7aoiG %`S14)/qlS\?An4'cfj %o[Kq#\.!`ckCT1Q<BVF9TCgr,EA>@`!=b\.VB5(kqcqVT3uJ@EQQbY)A0`Fq\7C\0%=B%PbW?nH(KUSi-u#(.k!QdCL>qT(G7i? %e8mWq"\2@Y.Olkrn8ET=JmAhRF,B;N/iqH$C+q>Lrf;K\2<`a,@uK^f<g]@@Pl!/d)4U9^Hg\0rpI/ZO?/3! >pXpG9NHY+G$Vb< %NZt>G8.P_CH:SX=*BEql6-@((dZL<F03inPA?eUsH/_D7$4O<q*:noZSm]bUMKpF<7aIlYd? HR$qb4jK:,7ofqni_JKYSk'n-3CZ %?m$#?,W! [LMll"&$OX;@UO+uRfTffcoWd<KL,YLh"V^'*I/3:%;eEYtl1G)uZ,UCFQV;\XSXY,ie/>DkSo3ourBW0\1 a]QXYLHcN %%Ne4EpN`-M1.'D*KmC.QJ=S)dRNj)A)'R5^nUV9W!sE=s:,6sM)'fWJJMD^N]3`AU, %OA70o&H$=5b(GER0uF%N84_SF@u3o75TM % +'_`XbuZE275EDQR_$Aansk=;n''&<j;p:,r)djnJV'VJS=H+4P*2S1O$`P)qs:ZHpr56F>dscR"it4ElI+ IbLU8eEVl,;^+;JD> %%WqWY</ (EAoZDLoQ+eVd4$/HW404R9\^uIHhf`M1I5q+toFUI\=XMnjo&W6]b1c^`]D$d7Rnn0Lht6[GC7QN>DM%G! q*T%LfH"A8 %JfKdrI?>5*K&$?A+rI5>5m8)kT]5K3h#[Q6k_MX+5(*:(g#hr3io+!t_<e` %d[N:MX0K5$bkY>ZEg8R#.4Qt]-P?ji&WD*"dunNb %dp!ia:ipA[qPiZPSN(snD7&Q0Y4e?;iFK:2joJf:Xkf[=F0`=a%Y? 3/RN9abG).QQ1B;m_MH#om=k(M@R*ilfVCrQQJM72(cimWm %=Ud0gMa]s %*D.n$2Cr_'bIM*,eS5S2qi[q<mp3(/ajjXioP]3To+NdI4`^H[9gNB'$<`O2]4@X-"df9@qtKP4/1`>*0/ "h+.jufr %K.\W'Wi2jUE8WuqBdnHFjA7ac+b=<QB>"CrA\`/0)\gP'8g<p,:[*McS8>_d]sD0!/ (a;'UJ.AJ6%aaNTEDNNV4@<,6d#>DifU"V %G44,Io*<.;\AoD!mHdm>9ct-0H70Xanb$EnP_4h=$7War_1b,5!Eb^FSj:fe_ts\X$JFsuB>H%e<%F %3@rgqsM`(1%J`5?AVuO$B %^?Q"-d`p#f*rGG`UP%T*C89;oL_ss2[[qrI>-B\b6&K9P(\d[hdm1l19CQe7j(k:@S*QA"G2.tJjXM_&s-#'p(m]U%W><bEGLLC %=;%P]@dmAeZ7:u%cBi:ep_LCMk+,9*,/[TiCDdEnP[DMc/6n$2D8'8sQBMWoReNsaffc %_#$uF8p[#kchS4HGm*Hp:%:*^k@;0cl %8a82&]AUtn"O7LtV<qI]Z*n]\/d#H#4*GGdSim'KEH1LiV>sGr^]$8B#q(9T._tO#%oQ? Z*8YSHWGnR;g7C"O_sP?r2mrq"cs^<$ %%"d[d+T1>BoWrW1\#-%KSia.+)j9HEe)Q)WMC-bH?P&ae#nfuV83n/XIG[SAIl7l]0SDsh&D;O6?.:g_,qrsNtms$JuNt(_gR0$ %C7SkdT#/M0Rqf&GG37$EQW)/R,.[X&bg^]\G6&gO0uTah/=:)ZSopQ#jP&mZ2lrX4CLA$\j*q8#T=PLXDZt5T"qAQ3Ppk[<d3cG %fh4R2oGBt4oGFg-2E8cG'r_t-PO2SJK3QEs?P5636=Iaf>i/ioL'"nbf(6(E! @HC`[9OJS/s**jq=(slWWH(AmFbQD>Q;W#T3Po/ %J8u!E9"("P<iFU'hI/oQNcG/3OR-)fljl]=SXl=YJm=#"Hi3ES_*3<a_(ql"Ccu8_te,\0hmC=UGSP2HS89qJHGK-GJcqtO/$&r %MCBKKlALrKg.K#kZ&qXWHM=(FpZENP`=mE]gZEIO1+d[YfBEa[Wo.4NoS9.9V.p)h$tPaK+ +nZT"l`'&"=iKZ&(5ae#fW;'Ef2a+ %gsK3@(,^=0_b.jFRD$.ViHP\::hqli[]/E?]].@AWmTgFq*G[lI=+1R+G@dmj! Vad(20UF9/i"U_C=0fM>MQ@g)*Pl;,BYYX[]8! %E!ee'il!jH4+qE_Q<1KH]b)@gecTh7@n$sW>u\*moq2qp.?(Wg;4(lK6I6lV6%+k%/BkG:Ar41c3f+<&;^!7V3T;*]`$[rRlt`h %#-58p0UF:=/h3X<ZMsBYaVo=p+-]Uc&%#V(iNchFUR/Z^;fFm52I^QAmK'0b6,cO6)0"'pj2Z01baC9? Aq@D![dEOEDb)m"N7eI@ %D? q)QCpG)8['?'gIJUhJ/Ru/N[6.fpngfeW2DLVhQZ'2lCehIiiH"aGaMU8"+]IW1:e.2rO9/1.8PtuD\G&=s +N*T<#Qb_\ioGaM %J>_fS-G'eVlj]cs=Br[1;l@q-63?<bQ'gqk^/t_UZut3S(ein5ErWt'S]Me+`.=Aj#7`(!S"79D6DM^UmHi)KZT_A*U&(fNGUTT %%IcffYoPcNRi=JTJR/D*!"H7ZE9R)MS:Ycg3/p$*f^ZMnrs'_/DF3%9'Hi2_?3DZJ2'6) (]irCp`HWP5UhenfhYXNX/2K/&A9t$6 %B0UnGoF%"g?*>!"PpI`3TV5DPf4JZO@\J-2D'(Wd>P\D"<pqIo_f<N+o@EBt1!Cj'hY3^t?? 91h0dRN5`lH+c4b1aproS.5p"!>%3B?S'38D2opVi%,T7-E9SCq9gfk:oAFrI*)$[`W%5^"gu`= %A(3,rPG.4:Y=maSrVj^+b0s7Y51+oT+OEXE/3U5;i#O`L7!%^uts %bM`aQ12Se+_.`SQ6ZIb'*JgPSGfYB$5E;g4TRoP$Hk7K,jPp%>? 563lK1(fVmU.6)DDsTRKk8<THK2s9N7MYC?K>iAciK)UBV'J6 %R<Z<bic%-Rr#UX6Dg2)9b7>s=RtC/WHj>;KM_F)s,n3lc^k.d3a3Kni3W70nK*>i,.ZU.? H)iHOKEhO/"As_#3Ig9&:]k"ckWqb5 %9<IcPV'@ue,o'UZgT^d6h8En0IGnY*\Q[7t;qJ&Q<_&B-df04"f>UYdQ#!J-k? duRUFMBs;,tTXcRYHPft>?8oFGbSlTNQ,!R:-$ %5?tY9poZ(2gY7hYqQ7*m[e>5<5mKs/(0t\?BdY6Us6R? pUQdp;4cHlNA5lZ5R+6>dTFS5NnDHS4MR(Z9%H(B*Jqh",6c/9VlHS1M %DU6O%1<\MBhQs[._T(iK3B]h^]R(WZ:1)Z4%0@Yko.nrCNe,tkf@h&'Z(dF#YrgcHc,B(^c`bW#]q2i29]7?(LI(mS])&K`=[o" %2J;3tI_[+i8=OFUA>[?2oTU=V%)t;h?\CCbnhfEqhJ@h*!73jP<^H^uA'_qMp]]nf:jOt %j@JOo;hpC(_&9Z.iJ(/;-1O9?+(-g* %G\.h%`TuF[+^$ks!D&nliCc#_/b9J%J6B7@D7//f"qeXk\WYLYQfB_C? 1pVPj_O2eY*(#+.o_hIK#@&kGHHE@&W.9Jq5#%+rH<L4 %Bep9d(73So;"";X*n2?XfC-?AEH(m1XLRRZ.7P`XZ? Q1^G>.^_BX@26PdJ+7#fKS@<X(QS)]t([3<B=HrUeR*/mW4/D5AnZf\H7R %afrC=E`WY*bj8SS8X\?!ccOFa*C.1?+pj1FA$UGH.lrTP-W/U1+lL>Xlq\(rTK\'1a@UU>^&bW_hrs8E! MQG#G!(?[%MY.#PX]21 %@nSnn%"n\@!!l3$$]ZHO"fT]2XQKkLSN7E[2rCR5%n73DMKVcT&BcJD<i@I,d6XZ\Jl%? IO+62X]t4dhjVCjHEF;lk^jo7S"rDn[ %+M+p,(Jsi)eXC#if7T//f8s]R+?m)EUf9]O'T3_&pF]O0nR++(Matbqf5W+P$X*+ +DA#PN[4I0kjE^UTS6D4LTeq.=\Z27?h6T&, %rkG@K9i7Og]X7;RF?Jp7p>2.nb;K$Be\*nbh#+K3KSZB%Ju6f4a!]C:M?:Z[l04maq@<.O*?? 0m$uI_o^td4<T6o8jhoK9!ZqN(b %300#XT>1/q_sN.Rq<AXN4TEjQ="A'5#=gWu)b2;t"esDa<c98JVFY\?N%iHSOCb\:Lm- 1DpCDK3^4Db6DUe13G,AF#aJfPhF[pBU %7$fP@77F6+%$"'_0-Zek!XocaF("(phgEFOE<N%.J-`63QN/JU=J,XCrPF9?c<P`kB807,!/:`:._pB"1/ saZ*!$sgM&!/rLLfp! %VRM][Tfgu*&5J@&R/&1'3p.*^;TBAVX_PYXJ7fnO=YFA6Wa**[(/"3`qhN@Ap6UT3\ndRI %TfA`fWSSa3E1"reud\_ljpA4e])`= %UcaH$*f>\9?+/+]cJIhf[uJ)VfJ4IH:!kkSV6.%OPgfod2ajc?p)W? q=h)jV"J>*TrY(QDOcmDG$k/<XG+Dpp-Vp@S\30:\7O1p( %^\"NoWI^UqWOMcAKN=nK`qCJ#!D.DM=Y:bHMNo=p#dF112?*?.E)T7KEk %D[c7_20ZohH<pk`YWQBWISG3W==@G/!!F,J/%f!>O^ %S\7Ln9<C">Ci5Y5T6%6XmLC3tEq1/Fm5fRam.:)^^A?)[0>@.NVg %=l4'3\gC16Llk>53]h1Irn6rAbbR2A=.g^4`pWhioFf>7./ %&]-NLN46Pd;L$sMK]r[PFS?$?io!Q1iOu9l/-0V_;X/ +8^@KBYEaF.T4&Ud;Wg7G.qg\V>n$1N^P0s^6cUTn@at+Q1r8:P(d-pbO %EUbR9F*h]<G5hVb6'I`5oW/%frV.=9p]'TaiEom!O/p*diuQ^[-A#f5\Mq7$l>,G? %GgU`RpUD_D54&*9Q)cR9iemL$`WaAoD;,i %+.'#"eB8ft*jJTR7ndj?O>LM8/;?$$nj,PBF`/B5aauhhs2f=81PcG0`2_Ck!K4iG&1bDhj! Gt7Wa9uL4-)VrFE,tG!+\l#rh6*b %nqtR_.uju_b&gQDM^&WbblViFGW4-g*KWO4Ml3CeTX'R_#!pOeZfE#\(_G$QgHp! J1u]1J56AC"QiS]2pF1u,/jhpk2PSH'A>Z/! %!O.*h!&r73c<RF/S2br]H8SKt[Cu/tAT]#cK6LA["<r+_=iK=Gki1SWIY[a0\O@k&n2l#<K)! l2l<tRkf3Wj^$g:,;g-iBSV:2l& %o_Q!+a6Z'XD#5og:lO>$/3lBVp\f:geBoqQY3jrL=0>LM)k3r>2ma$)O#J%3.'4mXI %m2[::585S3G:)'UOOl-&(DjA/IT8E_i[@ %+n;6*EJ=fAdcIUXP;uPG#Ao`Hq;Y"+=DqFaN+M_D(@/CUY]of$P!N5o0>_8k(bIA(eSRe3lIMFE7]W! _3GJ(e*'UFPDfZ*G&:,h# %'O! $&Mm#P#KV\1"TG=-.HAsg)JE[OhE"2De]XS0,&8=`WGp0m=fagMgJrp)u:jXBqg:liCkIX=&9QdEA\ME1jY Ld_YWRWQ9Q)]R+ %a3GA@3`/^s9P\`VYNFE?KP\B8QGlp?bTC0*_.!dYIe?ohQrYk$rcVjaC$2YWrCP.TK:c_XmHo$X"Wc: %ZpH`oFI\0/$SPffVZ8&_ %"TE@6Dmh`TTfT@'iX1)-LVNT9D`n$a\%d^*6-]_0NQ=S-.#H\-CcaBWfYL-YJ.!e!8?,[d-RVcbqto=& %0Su+`#@BMpP&[#h'UTq %RH@s(,k;U-IhMnhK@pQQ(b@:Cf,F%lNer;n.Y&%k@WVD5Y(2bifu2*BPO=l6I1r9/1X %#iLH#Aei(>4]KfCnNr#01*#NS"sQcA7%(C&`9#%&!R!F4!*,u&Qt5cVXB"ec4Ci#R:?cK4B">c>0)r9W8;d\GtX]g8-DU!s##YCGsL96I!"&F*8]&Cg)3keEoG3E%<L9,ta %4#])[7se-Q:L9T]]CYjtqYt[!/u3<".@KQtgcGlsC[7GkCh\.u? Q&u>U/3p6I[;_+iX&O8*Hk4TU=(RbQ;FjnGLM/lUSlGQJil?E %J/!g,0tVDjFu,['</Db5+_H,\1u7PiCjP2odr@>9AMDj+5TBi;?X>2P$<U4^6V=. (Z:ZegctiBDX<*#5D7"O]883$o"^l>47oF>> %T>Hj/Ar%[K:G@rkk'ck0i%'@*Lq$nZ! @(BKU:7WUQ3ad`Qf'<M1,'`_$qQKX>oYTTPD_*Ai3*^6od]*"^_qN"ioR]`I*Z!)\?PmU %d@h3Rq_(.C:8d0&GeHkP1^YLs^\dp&CE%p^V,!epeC:bH %NX51\9hh'LW9k0FWHGpD7Rh"YA``u=S_a7/NX+hoNNq!0&N,3;c$Gf %dMeVs^X_SNWae]PHBTAKjl/p55%\UG&g"Mb39\f.VfI\FA;jQ?"N$]IM(7,=V+R#sljoV^@hs>h+1M=9H-X6OiAT/o=9;FTGRpo %)K5e&qI@#JrW9QNZcr_[k`Fj6*%4J\&=q4jKS'Rb%QTA]n3P_J:(^<$>%ZS*jM-O&al9#SJa'o?J.+L64)iF:$B`Eb^s-7pT@Io %@g2JLHmK;/WVGikDoe;/+TD'V5'Z\.Irq?Vr9<%JYZL:@</Ei*/PqOsoh<[V`*6e)%r>^^H:1ZU[E? &kY>hMYqQG;>$/C?8b2"2g %*V+Z)FVXWD'=G@<d'EZ@3F_^iYQqT5I::=9imPmb1UV:6j3Zb[7]Tgtf!,D<?n? #8HFY61bmX4(eQSKQ9nFCI9@.(>"pgL,OsB)/ %c9/]tn)W.p3(u5m4Vtme7'!Q2:1V'p5fOd!D,:36mauJ,!8@<OCZ(,m(p-mE0-Pb(9J`lglr! (b.]l]`";X+'K0uECUCLr[:grkQ %U.@"@4?<Zh?l"II!mKYVLge\6#uVV_d!Qf^Uc3tk-,F/#*85Q@_]i_o? H#k4l#\dF@&1*"%p9/hT/_13It$'T5PS<0nmDA9J""sL %Wb%*=$`L?M[9PKG90o?lRFoKFM<2;f2=.>(/mfn$`Od3q*Njeq %W2h*8=#X1SXWbcJcK#ET>(iMnp191s+KLj<f!<c+Es)T;q#O+ %(SADtZadY/2K<MNc9\emQ"k3#X!- D\HE35]P]=Z7G:9UN=K*T4o"[ZFF/AD##P&#.qZ$Nmq]uuTTW+U=kn&u!CX7u$*c`!?WF:^t %@3VlDLhgCU_oWYsE;.2V>,3S'(AD\$ah]EV#/F]THHe?4K+99(_ %7YqLB)u1/3hNoPY)3C(nH=YCgPgVLWfu=LbZ13J-\<S'Vq(R %[R)Ym1BV1$DN,O4@0Xi;nLA('<K.mBJhMulSLcl!!cA1>cG'GEeMIPO&h]+pOOGLYE.):< %kq'>HP1aG[0B1\$K4gW/?Y?f;Ddl2 %p`JYZk1uG2=B]%&R@RVe?C[LWV7LG[%S58CYaJtZ@5TYk)L9Or2\#rr5.aQqW^,8Q(l\o.\2\PP0298S_7Foq>F0rCalHCg148( %*-E5mU8a@#1"TT;fRX*"0[\]@:@e_$$7#0'Y+2D^5Hm)UpgEW#=<! dC>fhT9ase_Tb&k]`8:'>Q9JisUo`F/=GI[cQ(f%=:"W"]l %oDp\f82@[2jCUA_1N8-MRqS5/]*q_l"UZ#i&1Ra4$R9.ZFH#! A9&h.8&mppj1aaGOk4HUmNGI)21Dde0=a9T276I/enQR-##%hl_ %Y5.n*=29P;7[O3Ts7$"F5QcfE^YnRTCOZ@3G^j+sQ7\=LFF[([4\'Fr4n6dpn6]I/]&gBS]2h3Je'm>aDG Jlphg-rJj-TR3(>+f[ %17EnR?iog2\#.aoYa?GK[m+]9\_.%`=J[t14a`V4X'<TFJ;lYo0-F9ornXVGFbhb_3s^EH=I*N62BI<m#O&f*c81IiiCsc5,XM9 %/]%dg6<8):qCJRC+u7:$`5QJ^>pRr,-!GgfUNaeDE4k<PGmN(JqsWrjC2_"3M\&):59<=_:rR=#SC[m>$_1=eR1Uiq]j`&Qn/NC %i^5(iq<#$\0"ga%&g!i<LIC,BJ0UOF%#K5*WW@SuSQV$J_4:U6(r1^+;)'RsP%J6b"EhKh887! R5.FLe2;7?Kr5ZSBoK(ZRIX-q> %/$ust^9Y>Y4?n=N@?]4p[nk\%^rf3?V#TWd=;L(f(&sSU%%uD.f0Aj&)rIctBeUB4&4j %8&nl24jLs7mesRh1X3>6UQlJ_Od8&9, %f%WFs$B<$`$4/!sQTHB(CD7+cD(QjP`tq<sGc__s(g.<K!X_386.P$3*eG$">PFkD6_)q[TP/g]l$ %U>pHUbDVHEo&U92-?'aG'V %h)E(AeF(r'qa6`mZ@aj;4Tno5QssoJ[FOWT`.3A'X9DR78rHe`'M6PYR>!0@=4bR48h3uEYN*c? 3RW5)KI)l5$&$hKSldPHYHM$, %<-XX"V1jVW8;$0kl"haB:.^C7jh>;;R=OADS[ht68.0pEWVsc7F&KQ'^6,=B!]`tYdg4[W5`53kUcod"pQWg>oW,e1SLArrM\0+ %M*NhEn6qU:'D6UE5$ts_.m_=C*]_I\.#a+YL8oe-JoZJKQZ!7@agG/) [DZJQa\UeSqpOfBp(tO;'N^fPG&JGir!sO`q>1B1!'Z5' %=RjdQO4<XI$GHMHgqDs=bM>g65`/NL(.es%M$[Pj;JK;@WQHiTRMl<$Q9`8%/ %AJ'>9^0cMV)`'O2n<&X>Cb&?hqiG2R\?T4@72W %UX4id)e9P5c1--V5I9,4o_O.oV8h^,-"'\f=9?>j"=Y+cNeC)=OmB+P.0dE#iZUJ@9QR@ABp? d5@YmRW+:Z'cdBV.:JI^lZMCGJ? %ZDrQ&$J,B;d1VH"T_ENU)W:+sr%SYe'+hq_GCt7Sr8Y$X[6aK<]jYu;aM-;I]g/TOr$0*eQj*SC,OOXA` %kq9M9R&@j9CIX#XT+o %oE)90@,VG%oc,hs_@c(uH#h8(K2BQ'b8Wj4H@\U>Qa9eqWi@P>:3ZL&iN]XB3j)t*.?jZ6"PL_F4`8Of[@q=pr#!?IR.CF<@ru[ %gsqiN#+O<6'.\0X;fie[eg/\2,T;l2Bq&*@D"+lR[@&[G=WIOV_&88F^ao\b'35o%*Z9d'3@k9sSTKSD>\ In)l&K3)";Ns2"K8$k %?HJV;9L)0C0=`_t,3onsP]!LD:Z1&^1,;a]17FI'>d;/]1kKSXS6=3f1R'5kgaJC*pgP7NN(5*gA75"OJh.3###RZJJ;L+&;l#Q %E/Hn'&;`f95Q:H#a*1F+<-E@dR,>d%._405XK2FOMbE+R-b$m%FbO=>Sk(JsC%u/6enCC`c! lZ(X>Yr87PX>B)R@j!=_Ni[A?;lo %Z2$-b?X@$]:H*FdKrY'6UKY[;9,P"=A_Lj,s0iM/r+2g`?XRd?KG;p0dkM+30*`+3.NX6c-!A:s6q287? (`5mq%troTqYs2b4U.= %N^o1?jG==NOTDi+'BoN5[SXpTWjlLA:SNNuk=K31]cMh.LJh!3*B_",KpmM]W-lan^?q%V**? ES4Nkt(ddlZm@EB[d7*-$3FXDGU %>:A)?7;=/K"p@4!P>oW=lSVoaE2D+m)&A&dMko(9hn=4'dVk7k,\CUJn[1W0Z&cnpMFfa^aL0*.Wg/<daTgFPEG7V<i!M=m8&46 %osL(JG6_9`MclU? bA9C5rR'b&N`j?//V"Q5ofTLF&+q5+nH_h\4HYaXd#qdu_@anXO<WP,k8ai4B:aC'c@u92oH67Gfs82pZF[ ?1 %"j>^!iglJtg@#"9'2OHr._@(T^_^dG2M"7FA6**2;[^&>3!FM<Uc4J+kO2Za]>Neb^ %'t@.Qg-\]Ba^;IC2@SpI=Xm#Wa:[J%>R\ %.QF5p+K,BjF>I:<6j!J0/7bc1\5:sFL`96].52VIDo##J80uqIZlUl5QC&eq9L/GoV8m].t@hf>I\,E#=oFG=^4r/:X/#PR?08p %&4-MYHu<gSrD1l'[^JuMGZ8j*feSqQ$]DKkVUj<W+M@-dcEEEhWKq2ZQOb*"!SkZPoE&hb3JV9:6,QVeAgkh"*(pgOnn-SAk'$) %5XG5=C6$1N!KZ.?kU;!]6`g]/Kio0q^Ua(e':\`8KcYn6/H]:5NqSE^=i;Dsec4? J&5q^i_[PcHkuMn:M,_0:)bfHN/6ZX,MFOBu %E[2PG7Aqns'NQ?1/^SK+7S#0<0\el(:o>96D@p?\:ibU9N? ^rR9MA.,dIlg0.l;^X^[\)iR1tB=QjEnrCZ(MDjd"AmQ'K1Jd9F*K %d*]"CEXp7BOA&E`=DkSEX6TN%jNBLI %9>.Mp:pj&hfQDlQ"]GNL4=0EG&L\9RGX^fds6X/2g><=6>k`(oN[68.q*g_M"hZ"=3VOq %"<pQW4c_7\M^/W>:K1Fu#i0Xheh&r"SGnEgq33O$q&! #N\7ih'lLNXi*?'Cmp.SmtKh/?\b*5,;q`Qp$lSTZ$LXR22"_-_"2&h4# %S$:#nLST4iEn,kFh\=.S+5Wrk;ki\!Uf21Z"BVbdaKuqdN[)qk`-Sit/m]&lJbi8Yh3BjF7!0O %mL$W*c3NGG8%27uggDIfJ"`aR %4t?SgZ8kckI=7B>M-aCh=T_c,m`Z9D1,;%EkO@4J4+4!3NYP-_Y?\84CTUcmUV9$qf %V]jH).!'DeJTO:eGYU<-donhn%2X&?AN/ %S#;,gHB8L1g`c.nK;6eUOQkFR*Euu\MtQQg"=uYm?YjE6a:p*3LF`2aUIp`lp@QhGn.-N\*o? nr]kdSL7qK`,D+J*NZGONu1E@*h %A%/=9R8HSkn^Xfl[!I9oATn?hHj,EQ&P+_c2;+oH?N,7&(ZPI_I<g4. [R$u/.LeX8%8ZO;a8NQlW_XIZQ'$huRWo/a:Bl#]j@N$%M3018eMbME6FBd)<3&`[Y>h,Rn\Y5%10k-6K4u=NDU%dO\+**g<jMfc&$W-%L97Z, []_dao0e*`RsE40YIni5,)7\LWof*_)O&iQ %cP@JDmQ-@F[Tt$-Q6&'2PA.2MEMY](>H2:lPu><g5oKG?Y5+dq=(NKT?a"u[0l[IsN*NWM_q,14`gU(^7& %GFXmYthZ]c'3f=(Mm %Z^pY+>AO4#.QbC]7g]4tH+f6J1H1eo_M[O==%H,.B5_-[q+7hZ.p! W(8eX&6od[CBBB+hKLJONAft1='Yk['g\rnWZ..mY,!I,2I %2><*VSLcs51s!'MA3-"j>cD@mF:A9a>_,YMYVr^seMVqg7pj(3Z)>2E8-,WiDX@Zs96Sd;7qIIB'db>2(` >d]Nn9Vc55XTtRG2e( %&D;tWCK%Q\\Dm#:(H<CK<AbS;OiVVR*%?9Xhu*-&_Xc`!=5[g6FI>nmo% +4Z>c"T(,cBs>h&CaQ)YOt2l=EX[[<3*V]gu?Te?\ip %oHsV"CE0T]GOj7[_1D-QKoOWZc.V+Khb#g3I5I2M92lsc'X@_XmC? @TC$#&*qXj9q`8]cGEUcnaeb9Th\88Hqp``^$7oF?n/F<;" %WWnb[;9P<W$0>EGp,ZD#esYc_4?GK($8"oRASpTE+lO-/`;'=%ol@Sl^Ym3*/S56@V=ipRZD %EV=G6*_ZFXo)kssi.?a_UXF0i'" %ASi[,YZRUIn:ZrC(Al10dit4N^!##e2V6Jo<eEXe;X,3SZ<EhfW\N%\< %Nl\/LAY3>cF;>d;hVn[SY3`C(NK.#sK"(-9*4B6\b0j %67f`eY_>uh9Z<8Fl?L/MTiA,A$KUIjN^+jKf/C]"CP?nI=WL_@e6&nSeoM!M^/#9.JN5U_*;LG)U<bZAT\=Z._=^Bh(@iQOoOTF %kY;/J/(.7l5<$>is+0o.]Q3H",rT-&iRJl0M8JWK85snq81ms-lhOGGr[ZM. %2*Nk=C!:ReVdCCZ'HT16(ke";YVLs6M878B7pu% %7*ZRi&0.qpJI9[&/0(@L-e>?*:;,=^<Qc1NF]Y`tl3oS%89uu)BPEn./Zp`Z/^2Jq=^GF4,mj]>54V;\OYbrDn0Y#r9g/G1NR*: %bJ"&`SK?[JRX-k&[p4A6Rt%uS%UchuS$$#6QYADl-!LFfYH$R'C\\='&7?Z7_W!)VKN?Sb!=:q! 5)Fc0Ukf`Z%A#sfc]^0kA4!hm %.oB?R"Y@AeXu0Rs_$-RPEoYpC=3=MiSkuE7Qp/)ZFnXV0`T8tg[Dq8Q=kRD$BqFRQg+<! S#3\q[EgQ1jXjDc,n5+;lnGL_WZd8(P %8ehE4$nsD<*<r!k`Kt8_cHDLG*3lfL5u8q*edGJ/OdZD&!`]=9*.]$EAV.rMZ %WnB6\aToJh</C2ZOUYK.W>ZV.u#m;9KR%n\dPh %$<.)&E;1oV<"D`4o40t7XL.oX#2.19lLrd9eLN.\BZ'cGk'GY4"ahB-jI]4NBD1iK^=kdsa5^P(q?H! [k8'B+%j(mOjD'*SD*qkT %kB[T<Q6Y<\Q.Ke34GgA$/S9i=!eio_2m>`N3jLK7Jh'a*"\JoQ#ql7E_%rsj/so)i+! R)u]f0%u);4OGUi,,4f`D=QXCh!5f;cA2 %XmJS8:T?+ue-e9!l(7kL7uj,])kXi%71B&#ZW?J[bamM;;p:o-? `jJ)Le[lZQ1^4,$b<LO";P6lW+'XnJIX]3]KMH[=L'=;i0DG' %PMIgP.YVofNB.-)l3;\P8(,0qKeJ5+-V.qO;P:iS;Y\"c/YkLFa<*2*s$ $)q.8R#G;IJ5[(84D4]Ni1enc_sbP.Cip"'9g4n>WBK %Mj%'qpoDF_VWR'.H>iM;NfI]N<Qe#CO"g.N[SWbN15-Xs2rAurO+W(;)e<BjWS. (Ng./\hcb:@+XQk*A:Fs7XgAp=Z,mI_qXG%t( %kEBb+)[*[U/"-@8(&*[lJassOr_Tj?Rs,#PRZO^hi$m<+-',<.CnBX)J+cVhMf6&8T7)/Q! t[dF,GUIPXKQM&q@24Pk%=$tr8[MF %GuSs/_=(.n[&$;B.5(&Tm %h1BA,)A/ASC`/T"`$pjgF+=,:ou_+Ai+foj$J;)`;*$&c$^INd&1&=3$SFrr;\p4Z9Gm]gpdS+YO%i %-ufk]aX$Qs-RQ)-0sDV&&@u(s7+mIcC6A>tEbRq(\mZQ+G#>;X7>4"=&2:A!O$.F-_k%a,*BR %&BXcetWr<$th3Gi%,_4qM4gsN: %F!(@OqtV:NB#[SR+lgN(kGtY)n!n`Qm`bL_mr?)5*N%d8EVV5:chkH/MT$9:i2G*<`ocS-! bL`d&BHVOr7<RB^Z24N=)F3:24\:t %X\><[VPDO`19T_1K2P<5Whfcg@D5(&^pQJB=Js',gc/YNjtXRc$n][+^/S'2.'f(3Vc(V>G3At, (0Cmd"e$:pgU*cFC[6:6rP(DG %Er=1+I"?7;`=X(LI]10#ekuerH_]C\E;XgEbAVCq?p6s5fK924^X(FD7Y.D#GDDh! =WBSn;KS_X(%Ci*3PCMHKf=cGjCB07QmNO%d+05A\pJEIp5p]CW/b)O&_u+.%/$67\,ri$54!WK8)#V5\#7R044Ij9%h-2&Ab.po6iOk4C>r0IbHksV>! 2f&e4`J=acro?Wi.X7 %E'07SV3S-`NRk-$Tg/ZP!!Tu_62Gs\9Hj:]G'92&+KMWHALB9JE(/0K_cYhO`(c[<05Nm<)J90K1NS %do='5A`*`QAM_EhsIGOnl %bHJ@grL<h)3G\d`r1P99qG(tM',]pP3^ntC^"1d-7Yg$Fa`k>O4cCgQ7lh[(/ft`E>u!(bd,F5!A1>19e %qmJETlnF(em+YNBoUL %>Wn_j>M3HKFM"C(iuddeO'&L?DK#:Q$hXq:FgqX:^28&uClTQl.gW!\*d_O*L&(G-CZrD-nDj,m? Q'q42C.;(<&-%V23ak:0P)\a %GC*hsr>[G;=f*`J*us6T/oTIN.2%J&as:G;;C4j(^E?l=be?l*03Zf[q.[h#rc%SK`guk*? <cCYp[n^qU$<_IUSE>&<2\R$L>G.6 %bi893hJ]a2:`)1b[]b2EPr=ON&@Qe<+@I>E>aiatEqX\N$sMK'"du(u7,,cs@N$8h;Gp@Va_Gk`ft@:^ut0%4`'faKH2[p+>ha% %DX4U=]o[$t*iHWjhqJZ/CN]H-b)Os!3.(S&l00p>/HD5O&s"dSRn^6:'Xm.rX=o>q6)F]V!*nM^_5[B'RZE$B3C*B8eWHHprri. %A.aejTmD8F-Bj99a(?Qq6qi^u.Wl=lk)!A!=V`JF1D_:AUa5Zek,N9(2NQT/3r.? Fg+3^qN:pb"rl<1e:V?:+/a_-Icq.$s85#j$ %9QB]Xg7;Oho0FD)\j27Z_\;H[p6(6J@DND!([5! 2:#3Z0j^#.DI1RSrXQWh*A.A6fg,]HC:P'pAiM6D/0W=O<)]aQ$ht6\qDGQq# %doj0YY*qG\O,hPjB:2Kb&X2aA#n#RIa0aK,-:&'.D %sgNV$.2W_94F.HfqR7H^.3inL@9p)J#Yn,1nh32)/g.8;rLdA<QJ),)2(K %('@8RECeMhV>5q6a;cbfF>BuJDQDYm]r_s]5<S$##%%5h_-d61It %BT(Z,/Y).ub/oaYc(\#7L0Fp>i9<X3C8Jk'\GTY7rJnceRh %1<!_k!G`$[]#GK71p.D3&Pql2@;C(b_Zq>Oaqt8=<SN7gSTq9uOO`LWZJ&T%%gp-Lpu#p>a%r4?D/6nH[S#=c:A:9P#sgaR@26/ %e"^E>VPg?U0k6Z).is]8?_>'SHB>,AdJtTi0J9r*,<LkTjm()(,? ZF67Fd\pL.m/D67^'-.Eo/S"eSA;02aif13F;`.k5TFbt$!T %ZSJLgoPl^R\MQ4XUZ%fAqnDgabHDuPYkiqR7o#ZTLS+V4WW2m%B=I>p_]<[pp<3oJ^(/:NI! @NG^gOu"`.9[UZ27t0']-JG`tqF; %\)NeenV!:-MmP,Z8B7$g_rbud5n1HTh:I/;[FYr^#5_N2M#P5ulRM>$h %ktr+VXAOZZ@l#h9amVh`B.1D+l%fBd/pBCuk53njbtT %aQ_?)3O#^"etc06j7fXTWhP>@O<uf.:W]K<WDZob1Q3c?6oeO$rCBWRRZ:*9-BdW`am#TZ_&+-O90>! g0j@l6:quTcO<ll2bT@mR %iE$8d^>@4n;m3Q4/080eYnJ9T/SG,Jll;4_\lf(@N\StYA'\)kD3cB04^4W:"[5jZW$_1/'Mb;SN(nhmI9(PYK,u'F`^f1hU>GM %gT;r0iZo77ZM"fi>`:&_;kO*^68UTYY<4j)URPkaiMIu.\P/G_2tjP:9-"2(Jo4/8K,B7#/B`/X@BMRYbn:PBYrS4p_SdtLm3e_ %h#b06Q?4enF83dQBJ&HW.$E*dP"]T(CR/p8U0$g9FL82ZkDF3Vl1U\B=hQu#2CE/nnCH>G2MWg4J %3Z0+TdZhmfHXbJGDRQ/<0n% %_Ue>GSsLc6N@%p`#UY%Vc!tbg3h=J8D6\Gm\%6OB@!J?ZXo337TQe;NNR]oKRbBjKIe\KF63S]=16nBXGQIb4@b(+XmiB%1.a** %,a.Ef1_EDa)BdQ<Un@_u<D*E\SXEgZe'lcndLa_9Z?Y^poIJo8?bCp[,a=U\d[AM1;,oD>aRaI19LK%@"&h?>AP$gEiGI#-7F,@ %XfYX)e`Cgs[AdScnF=C3QbsgLL6'+'@^3IiSIc[p6+]4/1,]hc`oZUREd6s,4l-*$4)FMs:? Zh;SIUrM\c8VQj`btP(0e8ejrQX) %qULmTV`1hkbEgn$^]"0/n%Wi#!]>T;p]=$MdQ<3e1iqt#7.s^U[gQGN.!f8ISIK<LPLZTMrU]_;Ofgmc>5Djf@PNEd7;3W5c)Fu %:(csA):5Y1KLbih#9LYi3?q(P_-jelVAL1&/HFRCEcR?2M+a;+RNTHs.k;Q^hZ#7DGR5o,p7LgZ#! nI(%d1XTdi\fhJfn*,:RAuV %C%laYF8/$4E1tJ6"YVp<DG]@i]</KYmL'I$o!R'*^*.=%X]i3InXf %"*AuU:M=7gL[gLt#G[6sg`"%Y.V$G--&567'aSBP[mn;20 %)8MKHpYL8CT0JAlhNfu^Lo^#Z<-Q_(N2GOJqraT$DENuLDr/. [R'[4h>KRtTj(_eobnR,&hoY]PO2Lu$M4r&E_ukM_aL?(lD5uI( %Wk>XcA:ESm*ri\c?@p[Gq]S?/Nc#,e*kU0&S$t?+Ek%mp@L\!OKSPT$oZG"j*rkbfDr"B!\S;#^c.04E- +B2&E\oO8KfpK1U-8%] %5Z415KmuP`FN+R]@h`*t,(cm&lH(I4k=3K]2^A1#>.&+.c$!`<bCZH6B7uDMK# %p/J@gA>TGuE,3MIF(#9,>2@QX0OG)W(Z1)042 %N-Tk!,-eMV7['"$&4TAclM,ICa'JGBgTX-$Wn)+,<aDu0)C2=>eWa-QX>EpWe^gj*^Z!aDCVK\Z4n&C=+! cL3OB1Mm"FPZ4>`77G %m(G\3*bXn-:E]k`oaCb?6Z><F7q[JB<*!$h4t-@$Pjs93UeK(<$dM!Yn[h'p_R6lm/dLEU2r6^K_i8F<Xde+Fq>C!I2eZESrL'm %@l)O-eEgF4P1-_"Ok$OrCI=:]!F%CKph]"8$F+\n-5IVmS<-mrZFF_\XfNnBRhX.cPt)RO[JWApDX[R2LmWXc3?910#4b8G)VKC %)scR`?HVA^qrBJ125P*Mb*<VR/8W5F12&,d6b\Di<R`pUBCt&j[X?8pM9.;kr^;Xg(JA=ue<%%R1(Y! 7/X@ZJ8u@uRNDTnma=&h6 %"U-rJ$5/77aKgEsD3/n[Kr00A"<DuO#_H<*aH6Yu)FQdp=Z1*KTPAkJRNI%W0tP%q"E5$>ho %Lk#[G#eZ*(6)eTqMc66HXb8B)Vo %MeFPt2`i,HjX(hHY,c</f1Y/!qC)B&X=@A,`J@nTkummo2NT0D9Ld=)j]!E+G,2H:-D$636&I54hdg7! qm;U)IP*gR<ATJR>gXBr %<;+*DmOcXkM?oK^:19@je>XQPka1,5CY+FY.rt!#oK? NEs608PM/0ms2r/Qh)*;BuWeP*:aD7do(q4`OYN@uAXdpQY1fQsEQaOpV %BaK3Wbn5j[j5:+73)$Tm`%8/?b@ZAt6k)_Am#[C`":iJM`_o]tnmR+jn^JBI!HIm9AGiA$Nc_% %06#a`k]Gh!j(G!47PY.Irq,jT %,4BKN6NqR\;UY%Hm#epK^0B,t\&_KO4R]53d`;.BaV]>KJdlfOa`N,0d\3a2as>V2:`q9fRB-I59/CWfN! B]risTbVl6ujn#pWBq %LIXj)6'I'GITY.&@sV,j"SlHi4toJ$9gB%fn`S2gj8T:[%Jc`V_N].#Q'Tj7ieO$IC<XY/WA$ (cU+IP.638nn%3>3fcc.0V`!hP6 %@#J)W<6iQV_3F$i=c^%i6W1/3b0$C!5_GfIoS&[L'dqGJE! YHNqWXn>G3klDdhFp'R\U`7CE,Xko>Sc0d<$]m2Ej/c_.6n`AmQB& %PDQ:'8]-sAT2m]^P80Mo+=E=,@qP;T2h;nfMEVA:H<3O("cS8kg=h.eK97B`jTYmI6^B]G2Od]6em.2? 3PLA.NY#")nkW01HWJ9a %:/ +>9`At7oC11<+OdX=:#I)'GhFhJoQcESBVCXC]0Vu(\Empm[O9.6knA,>\bg5LB1=?:B*Ze@)P8r]nZo) (uS,L3X$P5e_"iOn% %$^s*-#3b@coY.EF,-[6pOc(HrG25A@3^,G_7MUCPJ%s#f1*,%agTFK09r(%BOrtVGbcmp$/Cp+]p+mN.8Ppm4X:DZHPU-!+'tkm %E"X.MNK"Wk7=ZB:pYh%e?=SS+`1lk@/$_:pJBEbl6m? @CFD>hW(5m+e\o$LPHNVL96tUT79M\G3R'OAt(d.`Ob#\.Z/KUu$KdpF= %1GXZ!P5BH>Ci%@b2)%gF\+Ae/dh%.O]^dS3RsaUR]b6`"pQ %pLV.)T/mL=Y(P"A4qb>qPqWQE6#iCaUhNPhA!o;eU,d<&!^5e7r? %&5s\TW8$nbT&75&A."G&KPG16^j1APWmO?&m..WbD,3u9sPJ/V<r$dfG:#fnnq`YKt7$i'ZS1j,1Fb80ishXnUrI8.0DjM=icV7 %#GW&&A:^1;9;E;E9G&^5CU=fpkJn#VOU0$Nb:U2B&OVm`i]AATMEX/I,=tER/1W6Go6? erno@0WX/*bQcJ#sY2d^or&nM>"6Q!@! %V@(Rkj=.J_I9nVj'ZtfVOjCId$po0Lo?KGnSS@YNU<e*>MPQsW:E*XNfPfQT&WJ09*%WXU.KurJY[YQYe\ Dc,kbGra6&sIQG(%Xi %3bJd1DF?/;$+h<G:p$n'Nq>%GP+\MYGIj8@NYIU)3WGNXc"=;VB/s20H8RRI/! H3+8_(Npi_Fr=YeU^/Jj-,%r3tIL9S\jh#U`8< %91MH@<8CE11HafW]@;cuq<"8^E>\^5`W)]ARl>7dFa!uO"cn7)qe:cpl!QUf6"! jSX*JJPX[4tA^4\gO;j4690?3g98te+^MT?JV %d!-H\V8+tr\QQ=T'j=8EDT];=_YWrkq,K6r^.:s6=E9K4a;6RU_+ma#dc$TMBBngKTtQX$6. [<i0_ks23,Wb*OFE!KlkHb<Y_T2H %@Z_(_GWZH^Z_jUS.q@k-@Ce^$O@'7a!>l&BGl0Z1&TffM\ADlsjo:Z_p-agh2hQc.A.$Egd! t0"Q)^E+L1O@W,dqRE7[5DpL\nmj %Q6DL*`2\_pjtkJs-;UgP=rR`qN'>LY_mjgL$TFNqCJeDEY%f2` %mKdHg9k^sWi@0cELojelKW*ko&LRD=T;[b.U``sU!<l("9cgY %,";51k<gst#G;,h!HuhfGR>Y)U?>R'pYC$4)]S#eT?C:nPb#)"o1ic1dUqYlAO30`IY0e/10t9qtBD6I@(5%.%uNu0n%B>4X<Y0 %Heatk5X=7b:bL'F_+.ghh6&8Y:ID#!;f"8c^;r"%C-3oUUngE/AtRIr5(6Iq`X?%4i*n!F9)-gh7LFb>mCNkH\dWMDn_X[jJWt_ %GZp%H4*JtB<8]36(XJKu+CITt:FuNn&_j`"GePq5(Q19EfOKt:9MA8@$pO[ihL"_YhRsk^:HnSBN&D %@n]9n4&gn&o+9jDC$G?E< %qaPcF-OWWdTJD04TA"Rm>:aaR@O[Lp-a([]"TU1%9EA9h2TrXPp?Yr)+^g8%^=J8Z\5A>D,@3+KY? t1(ZoBmBisUp"2GOpYC?,L" %G;q\ZF;ls%,-W&k;!`bG!%?5@793c89NFF:L;B3f9$TO>_ %_H3JhP<3S1r?"2d\hCaB46a`GV#m^s[gBML^5-JA=)Q+^Y?TXp2b; %(D %,h&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa&.fBa &.fBa&.fBa&.fBa %&.fBa&.fBa&.fBa&.fBa&.l?tR*@kJpUB$u51!P<o#/GB-0@@O1d-[OO#K:I@.4*CP/g2>:Y,! fJ)L4M4E]SMBD4:PJ)9g'e9\F/ %@7Ps)Xets03jAXPI8?>I+*qVH;c!AP:EP)[5VoIQeT<1>\VoiI9>4o9h.h8q-`&,KVEIo/SQp;OR;88;>Y^7R@SV.5M\=!i=gRP %W/.5391sHboc;N;%JQ6=MOWEl`CHo[e? G,O=Tq04^;Acl55NVB&,9i0o6^4Mhi8B4^MJ@FmuR0$5P+X9JY.Coq4IALReQ2Z:U0Y, %prN+"rk6VuG]s*ndrU$5lp%g4llplZ^;(iiH"kD#"5=])Yl~> %AI9_PrivateDataEnd %%EndDocument @endspecial 28778 46559 a currentpoint grestore moveto 28778 46559 a 2000 46559 a currentpoint currentpoint translate 1 0.971 div 1 0.971 div scale neg exch neg exch translate 2000 46559 a Black 25455 49172 a Fw(Figure)g(1:)30242 49172 y SDict begin H.S end 30242 49172 a Black Black 30242 49172 a SDict begin H.R end 30242 49172 a 30242 49172 a SDict begin [ /View [/XYZ H.V] /Dest (figure.1) cvn H.B /DEST pdfmark end 30242 49172 a Black Black 2000 51640 a Fs(q)567 b Fw(and)429 b Fs(f)564 b Fw(are)428 b(the)h(usual)f(spherical)g(coordinates.)752 b(Ev)-18 b(ery)428 b(point)g(on)h(the)f(sphere)g(represents)g(a)g(possible)g (qubit.)752 b(All)2000 53145 y(possible)471 b(qubits)g(\(within)g(an)g (o)-18 b(v)g(erall)471 b(multiplicati)-30 b(v)-18 b(e)471 b(phase)h(f)-12 b(actor\))470 b(can)i(be)f(thought)h(of)f(as)g(v)-18 b(ectors)471 b(on)g(this)g(unit)2000 54651 y(sphere.)375 b(A)304 b(v)-18 b(ector)302 b(on)i(the)f(Bloch)h(Sphere)f(represents)f (this)g(qubit:)5030 59626 y Fn(j)p Fs(y)369 b Fr(>)p Ft(=)266 b Fv(cos)10469 58805 y Fs(q)p 10469 59347 771 49 v 10551 60457 a Fw(2)11373 59626 y Fn(j)p Fw(0)i Fr(>)g Ft(+)p Fv(e)15276 59125 y Fo(i)p Fq(f)16137 59626 y Fv(sin)17685 58805 y Fs(q)p 17685 59347 V 17767 60457 a Fw(2)18588 59626 y Fn(j)p Fw(1)g Fr(>)2000 63099 y Fw(The)305 b(action)g(of)g(a)g (\224g)-6 b(ate\224)305 b(can)h(be)f(thought)g(of)g(as)f(a)i(rotation)e (on)h(the)h(Bloch)f(Sphere.)382 b(Let')-67 b(s)304 b(tak)-12 b(e)305 b(the)g(Hadamard)h(g)-6 b(ate)305 b Fb(H)2000 64604 y Fw(that)e(has)g(been)g(discussed)f(in)h(the)h(past.)375 b(\(Note)303 b(that)g Fb(H)g Fw(is)g(not)g(equal)g(to)h(the)f (Hamiltonian)g(in)g(this)g(case!\))5030 69580 y Fb(H)p Fn(j)p Fb(0)268 b Fr(>)p Ft(=)9975 68759 y Fb(1)p 9470 69301 1616 49 v 9470 69541 a Fn(p)p 10480 69541 607 48 v 1030 x Fb(2)11219 69580 y Fn(j)p Fb(0)g Fr(>)g Ft(+)15221 68759 y Fb(1)p 14717 69301 1616 49 v 14717 69541 a Fn(p)p 15726 69541 607 48 v 15726 70571 a Fb(2)16464 69580 y Fn(j)p Fb(1)h Fr(>)p Black 2000 73417 a Fg(C/CS/Ph)-5 b(ys)248 b(191,)h(Spring)g(2005,)h(Lecture)g(9)35704 b(3)p Black eop end %%Page: 4 4 TeXDict begin 4 3 bop 0 0 a SDict begin /product where{pop product(Distiller)search{pop pop pop version(.)search{exch pop exch pop(3011)eq{gsave newpath 0 0 moveto closepath clip/Courier findfont 10 scalefont setfont 72 72 moveto(.)show grestore}if}{pop}ifelse}{pop}ifelse}if end 0 0 a Black 2000 -4672 a SDict begin H.S end 2000 -4672 a Black Black 2000 -4672 a SDict begin H.R end 2000 -4672 a 2000 -4672 a SDict begin [ /View [/XYZ H.V] /Dest (page.4) cvn H.B /DEST pdfmark end 2000 -4672 a Black 3985 x Fw(Gi)-30 b(v)-18 b(en)273 b(our)g(generalized)h(e)-18 b(xpression)273 b(for)g(a)g(quantum)h (state)f(on)h(the)f(Bloch)h(sphere)f(\()p Fn(j)p Fs(y)341 b Fr(>)p Ft(=)239 b Fv(cos)43519 -1164 y Fq(q)p 43519 -965 564 49 v 43579 -268 a Fl(2)44215 -687 y Fn(j)p Fw(0)i Fr(>)f Ft(+)p Fv(e)48063 -1127 y Fo(i)p Fq(f)48924 -687 y Fv(sin)50472 -1164 y Fq(q)p 50472 -965 V 50532 -268 a Fl(2)51168 -687 y Fn(j)p Fw(1)h Fr(>)p Fw(\),)2000 819 y(we)303 b(see)g(that)g(the)h(action)f(of)g(the)g(Hadamard)g(g)-6 b(ate)304 b(is)e(to)h(rotate)g(the)h(qubit)f(by)35151 341 y Fq(p)p 35151 540 558 49 v 35209 1237 a Fl(2)36144 819 y Fw(about)h(the)f(y-axis:)5030 5838 y Fv(R)5771 6020 y Fo(y)6354 4492 y Fd(\263)7211 5017 y Fs(p)p 7211 5559 764 49 v 7290 6669 a Fw(2)8107 4492 y Fd(\264)8965 5838 y Fn(j)p Fw(0)269 b Fr(>)p Ft(=)d Fv(cos)14078 5017 y Fs(p)p 14078 5559 V 14157 6669 a Fw(4)14975 5838 y Fn(j)p Fw(0)i Fr(>)g Ft(+)p Fv(e)18878 5337 y Fo(i)p Fk(\()o Fl(0)p Fk(\))20308 5838 y Fv(sin)21856 5017 y Fs(p)p 21856 5559 V 21935 6669 a Fw(4)22752 5838 y Fn(j)p Fw(0)g Fr(>)p Ft(=)26754 5017 y Fw(1)p 26249 5559 1616 49 v 26249 5799 a Fn(p)p 27259 5799 607 48 v 1017 x Fw(2)27998 5838 y Fn(j)p Fw(0)g Fr(>)g Ft(+)31999 5017 y Fw(1)p 31496 5559 1616 49 v 31496 5799 a Fn(p)p 32504 5799 607 48 v 32504 6816 a Fw(2)33243 5838 y Fn(j)p Fw(1)g Fr(>)p Ft(=)f Fb(H)p Fn(j)p Fb(0)i Fr(>)2000 9896 y Fw(But)308 b(you)g(might)g(ask)g(where)g(the)g(states)f Fn(j)p Fw(0)271 b Fr(>)307 b Fw(and)h Fn(j)p Fw(1)271 b Fr(>)307 b Fw(and)h(Unitary)g (T)-42 b(ransformations)40960 9655 y(\210)40576 9896 y Fv(U)422 b(actually)308 b(come)g(fr)-55 b(om)p Fw(?)391 b(The)2000 11402 y(answer)343 b(is)g(that)g Fn(j)p Fw(0)291 b Fr(>)342 b Fw(and)h Fn(j)p Fw(1)291 b Fr(>)342 b Fw(are)h(the)g (quantum)h(eigenstates)f(of)g(real)g(systems)f(and)40226 11161 y(\210)39843 11402 y Fv(U)456 b Fw(arises)342 b(from)h(time)g(e) -30 b(v)-24 b(olution)2000 13024 y(via)291 b(the)h(application)g(of)e (a)i(Hamiltonian:)20443 12783 y(\210)20059 13024 y Fv(U)113 b Ft(\()-30 b Fv(t)82 b Ft(\))257 b(=)h Fv(e)24374 12584 y Fh(\241)p Fo(i)25578 12408 y Fl(\210)25309 12584 y Fo(H)39 b(t)60 b Fp(=)26790 12611 y Fl(\257)26736 12584 y Fo(h)27235 13024 y Fw(,)293 b(if)29232 12783 y(\210)28863 13024 y Fv(H)376 b Fw(is)291 b(applied)g(for)g(time)261 b Fv(t)82 b Fw(.)372 b(The)291 b(Hamiltonian)h(transforms)2000 14530 y Fn(j)p Fs(y)368 b Fr(>)302 b Fw(in)h(the)g(follo)-30 b(wing)303 b(w)-12 b(ay:)5030 19312 y Fn(j)p Fs(y)6300 18811 y Fh(0)6866 19312 y Fr(>)p Ft(=)267 b Fv(e)9557 18811 y Fh(\241)p Fo(i)10761 18635 y Fl(\210)10492 18811 y Fo(H)40 b(t)60 b Fp(=)11974 18838 y Fl(\257)11920 18811 y Fo(h)12418 19312 y Fn(j)p Fs(y)369 b Fr(>)2000 22588 y Fw(So,)302 b(to)f(understand)g(qubits)g(we)h(must)e(understand)h(the) h(quantum)g(le)-30 b(v)-18 b(els)300 b(of)h(real)g(ph)-6 b(ysical)302 b(systems)e(and)h(what)h(happens)2000 24094 y(to)h(them)g(when)h(the)-18 b(y)303 b(are)g(acted)g(upon)h(by)f(the)g (Hamiltonian)28677 23853 y(\210)28308 24094 y Fv(H)85 b Fw(.)2000 26153 y(The)323 b(\002rst)f(ph)-6 b(ysical)324 b(quantum)f(system)g(that)g(we)h(will)f(in)-48 b(v)-18 b(estig)-6 b(ate)323 b(is)f Fv(SPIN)p Fw(.)i(W)-97 b(e)323 b(will)h(spend)f(a)g(b)-24 b(unch)324 b(of)f(time)g(on)g(spin,)2000 27658 y(since)303 b(all)g(other)g(qubit)g(systems)f(can)h(be)g(mapped)h (onto)f(an)g(ef)-30 b(fecti)g(v)-18 b(e)303 b(spin)f(system.)p Black 2000 48362 a currentpoint currentpoint translate 0.9832 0.9832 scale neg exch neg exch translate 2000 48362 a 2000 48362 a gsave currentpoint currentpoint translate 0 neg rotate neg exch neg exch translate 2000 48362 a @beginspecial 0 @llx 0 @lly 238 @urx 178 @ury 2380 @rwi @setspecial %%BeginDocument: lec9_fig2.eps %!PS-Adobe-3.1 EPSF-3.0 %%Title: lec9_fig2.eps %%Creator: Adobe Illustrator(R) X %%AI8_CreatorVersion: 10.0 %AI9_PrintingDataBegin %%For: Dan Stamper-Kurn %%CreationDate: 2/15/2005 %%BoundingBox: 0 0 238 178 %%HiResBoundingBox: 0 0 238 178 %%CropBox: 0 0 238 178 %%LanguageLevel: 2 %%DocumentData: Clean7Bit %ADOBeginClientInjection: DocumentHeader "AI10" %ADOEndClientInjection: DocumentHeader "AI10" %%Pages: 1 %%DocumentNeededResources: %%DocumentSuppliedResources: procset Adobe_AGM_Image (1.0 0) %%+ procset Adobe_CoolType_Utility_MAKEOCF (1.13 0) %%+ procset Adobe_CoolType_Core (2.12 0) %%+ procset Adobe_AGM_Core (2.0 0) %%+ procset Adobe_AGM_Utils (1.0 0) %%DocumentFonts: %%DocumentNeededFonts: %%DocumentNeededFeatures: %%DocumentSuppliedFeatures: %%DocumentCustomColors: %%CMYKCustomColor: %%RGBCustomColor: %AI7_Thumbnail: 128 96 8 %%BeginData: 10994 Hex Bytes %0000330000660000990000CC0033000033330033660033990033CC0033FF %0066000066330066660066990066CC0066FF009900009933009966009999 %0099CC0099FF00CC0000CC3300CC6600CC9900CCCC00CCFF00FF3300FF66 %00FF9900FFCC3300003300333300663300993300CC3300FF333300333333 %3333663333993333CC3333FF3366003366333366663366993366CC3366FF %3399003399333399663399993399CC3399FF33CC0033CC3333CC6633CC99 %33CCCC33CCFF33FF0033FF3333FF6633FF9933FFCC33FFFF660000660033 %6600666600996600CC6600FF6633006633336633666633996633CC6633FF %6666006666336666666666996666CC6666FF669900669933669966669999 %6699CC6699FF66CC0066CC3366CC6666CC9966CCCC66CCFF66FF0066FF33 %66FF6666FF9966FFCC66FFFF9900009900339900669900999900CC9900FF %9933009933339933669933999933CC9933FF996600996633996666996699 %9966CC9966FF9999009999339999669999999999CC9999FF99CC0099CC33 %99CC6699CC9999CCCC99CCFF99FF0099FF3399FF6699FF9999FFCC99FFFF %CC0000CC0033CC0066CC0099CC00CCCC00FFCC3300CC3333CC3366CC3399 %CC33CCCC33FFCC6600CC6633CC6666CC6699CC66CCCC66FFCC9900CC9933 %CC9966CC9999CC99CCCC99FFCCCC00CCCC33CCCC66CCCC99CCCCCCCCCCFF %CCFF00CCFF33CCFF66CCFF99CCFFCCCCFFFFFF0033FF0066FF0099FF00CC %FF3300FF3333FF3366FF3399FF33CCFF33FFFF6600FF6633FF6666FF6699 %FF66CCFF66FFFF9900FF9933FF9966FF9999FF99CCFF99FFFFCC00FFCC33 %FFCC66FFCC99FFCCCCFFCCFFFFFF33FFFF66FFFF99FFFFCC110000001100 %000011111111220000002200000022222222440000004400000044444444 %550000005500000055555555770000007700000077777777880000008800 %000088888888AA000000AA000000AAAAAAAABB000000BB000000BBBBBBBB %DD000000DD000000DDDDDDDDEE000000EE000000EEEEEEEE0000000000FF %00FF0000FFFFFF0000FF00FFFFFF00FFFFFF %524C45FDFCFFFDFCFFFDFCFFFD98FFA8FFFFFFA8FFFFFFA8FFAFFFA8FFFF %FFA8FFFFFFA8FFA9FFA8FFAFFFA8FFFFFFA8FFFFFFAFFFFFFFA9FFFFFFA9 %FFFFFFA8FFFFFFA9FFA9FFA9FFA9FFA9FFFFFFA8FFAFFFAFFFFFFFA9FFAF %FFA8FFFFFFA8FFFFFFAFFFAFFFA8FFFFFFA8FFFFFFAFFFAFFFA8FFFFFFA9 %FD97FFA9FFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFA8FFFF %FFAFFFFFFFAFFFFFFFA9FFFFFFAFFFFFFFAFFFFFFFAFFFFFFFA8FFFFFFA9 %FFFFFFAFFFFFFFAFFFFFFFA9FFFFFFA8FFFFFFAFFFFFFFA8FFFFFFAFFFFF %FFAFFD0FFFAFFD95FFA9FFFFFFA8FFAFFFA8FFFFFFA8FFFFFFA9FFAFFFA8 %FFFFFFA8FFFFFFA9FFAFFFA8FFAFFFAFFFAFFFA9FFAFFFA8FFFFFFA8FFAF %FFA8FFFFFFA8FFFFFFA8FFFFFFA8FFFFFFA8FFAFFFA8FFAFFFA8FFAFFFA8 %FFFFFFA9FFFFFFA9FFFFFFA8FFFFFFA8FFFFFFAFFFFFFFAFFD97FFAFFFFF %FFAFFFFFFFAFFD07FFA9FFFFFFAFFFAFFD05FFAFFFFFFFAFFFFFFFA9FFFF %FFAFFFFFFFAFFFFFFFAFFD0FFFAFFFFFFFAFFFFFFFAFFFFFFFAFFD07FFAF %FFFFFFAFFD0BFFAFFD9DFFA8FFFFFFA8FFFFFFA9FFFFFFA8FFA9FFA8FFFF %FFA8FFA9FFA8FFFFFFA8FFFFFFA8FFFFFFA8FFFFFFA8FFAFFFA8FFFFFFA9 %FFFFFFA8FFFFFFA9FFFFFFA8FFFFFFA8FFFFFFAFFFFFFFA8FFA9FFA8FFFF %FFA8FFFFFFA8FFAFFFA8FFFFFFA8FFA9FFA8FFAFFFA8FFFFFFA8FD97FFAF %FFFFFFA9FFFFFFAFFFFFFFAFFFA8FFA9FFFFFFA8FFFFFFA9FFFFFFAFFFAF %FFA9FFFFFFA9FFFFFFA8FFFFFFAFFFFFFFA9FFA8FFA9A97EFFA8FFFFFFAF %FD07FFAFFFFFFFAFFFFFFFAFFD07FFAFFFFFFFAFFFFFFFA9FD56FFA8A8FF %FFA8A8A8FD44FFA9FFAFFFA8FFAFFFA8FFFFFFA8FFAFFFA8FFAFFFA8FFAF %FFA8FFFFFFA9FFA8FFA8FFFFFFA9FFFFFFA8FFAFFFA8FFAFFFA8FFA97DA8 %FFA8FFA8FF52AFA8FFFFFFA8FFFFFFA8FFFFFFA8FFFFFFA9FFFFFFA8FFFF %FFA8FFFFFFA8FFAFFFA8FFFFFFA9FFFFFFAFFFFFFFA8FD42FFA87DFFFFAF %FFFFFF7DFD05FF84FFAFFD44FFA8FFAFFFAFFFFFFFA8FFFFFFA8FFFFFFAF %FFFFFFAFFFAFFFFFFFAFFFA9FFFFFFAFFD07FFA9FFFFFFA8FFA8FFA9FFFF %A8AF7DA8FFA9FFFFFFA9FFFFFFAFFD07FFA9FFFFFFAFFFFFFFAFFFFFFFAF %FD0BFFA9FFFFFFAFFFFFFFAFFD41FFA87DA84BA8FFFF77FD13FFA8FD3AFF %AFFFA8FFAFFFA9FFAFFFA8FFFFFFA8FFFFFFA8FFAFFFA9FFFFFFA8FFAFFF %A9FFAFFFA8FFFFFFA8FFFFFFA8FF7DFFA8FFCB7DA8FFFFFFA8FFA9FFA8FF %FFFFA8FFAFFFA8FFFFFFA9FFAFFFA9FFFFFFA8FFAFFFA8FFFFFFA9FFFFFF %A8FFFFFFA9FFFFFFA9FFFFFFA8FFFFFF7DFD40FFA2AECFFFFFFF7DFD38FF %A8FD17FFAFFFFFFFA8FFFFFFA9FFFFFFAFFFFFFFA9FFAFFD09FFA9FFFFFF %AFFFFFFFA8FFFFFFAFFFAFFFAEFFFF7DA8FFAFFFA9FFFFFFAFFFA8FFA8FF %FFFFCBFD07FFAFFFFFFFA9FFFFFFAFFD07FFAFFFFFFFAFFFFFFFA9FD07FF %CAFD28FFAFFD1DFF7DFD05FFA8FD48FFA8FFFFFFA8FFAFFFA8FFAFFFA8FF %FFFFA8FFAFFFA8FFFFFFA9FFFFFFA8FFAFFFA8FFFFFFA8FFAFFFA8FFFFFF %A8FFFFFFA87DA8A8A8FFAEAFA8FFFFFFA8FFA8FFA8FFA9FFA9FFFFFFA9FF %AFFFA8FFFFFFA8FFAFFFA9FFFFFFAFFFFFFFA9FFFFFFA9FFFFFFA8FFFFFF %A8FFCFFD45FFA8A8FD0DFFAFFD29FFCFFD16FFA8FFFFFFA8FFFFFFA8FFFF %FFA9FFFFFFA8FFAFFFA8FFFFFFA8FFA8A8AFFFFFAFA8FFA8FFA8FFA8FFA8 %FFA8FFA8FFFFFF58A8AFFFCBFFA9FFA8FFA8FFA8FFAFFFA8A8FFFFA8FFFF %FFA9FD07FFA8FFFFFFAFFFFFFFAFFFFFFFA8FFFFFFAFFFFFFFAFFFFFFFA8 %FFAFFD26FFAFFD1EFFCFA8FD37FF7EA8FD15FFAFFFA8FFAFFFA8FFA9FFA8 %FFFFFFA8FFFFFFA8FFA9FFA8FFA8FFA8FFFFFFA8FFFFFFA8FFCFFFA8FFA8 %FFA8FFA8FFA8FF52A8A8FFAFFFA8FFFFFFA9FFFFFFA8FFAEFFA8FFFFFFA9 %FFFFFFA8FFAFFFA8FFFFFFA8FFAFFFAFFFFFFFA9FFFFFFA9FFFFFFA9FFAF %FFA8FFCFFFA8FD3BFFA8FF7DCAFD05FFA8FFFF7DFD1CFFA9FD30FFAFFFA9 %FFA8FFAFFFFFFFA8FFFFFFAFFFAFFFAFFD07FFA9FFFFFFA9FD07FFA87D7D %FFA8FFA8FFA853FFFFA8FFAFFFA8FFFFFFA9FFFFFFAFFFFFFFCBFFA8FFA9 %FFFFFFA8A8FFFFA9FFFFFFAFFFFFFFAFFFFFFFAFFD07FFAFFFFFFFA8FD3C %FFCFFFCFFFA8A8FFFF7DFD07FFA8FD15FF7DFD36FFA8FFAFFFA8FFA9FFA8 %FFA9FFA8FFAFFFAFFFA8FFA9FFFFFFA9FFA8FFA9FFFFFFA8FFA97DA8A8A8 %FFA8FF58FFA8FFFFFFA8FFFFFFA9FFAFFFA8FFFFFFAFFFAFFFA9FFFFFFA8 %FFA9A8A8FFA9FFA8FFFFFFA8FFFFFFA8FFFFFFAFFFAFFFA9FFFFFFA8FFFF %FFA9FFAFFFA9FD36FFA8FF7DFD07FFA8FD1BFF7DFD3AFFA8FFFFFFAFFFFF %FFA8FFFFFFAFFFFFFFA9FFAFFFA9FFFFFFA9FFFFFFA8FFA97DCBFFCBFFCB %FFFF7DA9FFFFFFA8FD07FFAFFD07FFAFFFFFFFA9FFFFA8A8FFFFFFA9FFFF %FFAFFD07FFAFFD0BFFAFFD07FFA9FD36FF52CFA7CFCFFD04FFA8AFFD18FF %A8FD3DFFAFFFA8FFA9FFA8FFFFFFA8FFAFFFA8FFA8FFA8FFFFFFA9FFFFFF %A8FFA9FFA87DA8FFA8FFAFFFA8FFAFFFA8FFFFFFA8FFA8FFA8FFA9FFA9FF %FFFFA8FFAFFFA8FF7DFFA8FFFFFFA8FFFFFFA8FFFFFFA8FFAFFFA8FFFFFF %A9FFFFFFA8FFAFFFA9FFFFFFA9FFFFFFA8FFFFFFA9FD34FFA8FF7DFD05FF %A8FD08FFA8FD0EFFA8FD42FFA8FFFFFFAFFD0BFFA8FFFFFFA9FFA8FFAFFF %FFFFAFFFAFFFA9FFFFFF7DFFA9FFA9FFFFFFA8FF7DFFA8FD07FFA8FFFF7D %A8FFFFFFA8FFA8FFA8FFFFFFAFFFFFFFAFFD0FFFAFFD2CFFA9FD05FFA8FF %A8FFFFFFA8FFFFFFAFFD09FFA8FD05FFAFFFFFFFA852AFFFA8FD07FFA87D %AFFFA9FFFFFFA8A8FFFFA8FD38FFA9FFFFFFA8FFA8FFA8FFA9FFCBFFFFFF %A8FFFFFFA9FFFFFFA8FFA9FFA8FFAFFFA8FFAFFFA8A8FFFFA8FFAFFFA8FF %CBFF52FFAFFFA8FFFFFFA8FFA8FFA8FFFFFFA8FFCFFF7DFFFFFFA8FFFFFF %A8FFFFFFA8FFAEFFAEFFFFFFA9FFFFFFAFFFFFFFA9FFA9FFA87D52FFA8FD %47FF7DFD07FFA8FD47FFA9FFFFFFAFFFFFFFA8FFFFFFA8FFAFFFA9FFFFFF %A8FFA9FFA8FFFFFFA8FFFFFFAFFFFFFFA8FFFFFFA9FFFFFFA9FFFFFF52FF %FFFFCAFFCBA8A9FFFFFFCBFD07FFA8FFFFFF52524CFFCFFFFFFFA8FFFFFF %CBFFFFFFCBFD0BFFA8FFFFFFAFFD3BFF7DA8FD0AFF7DFD04FFA8FD0DFF7D %FFCAFFA8FFFFFFA8FD36FFA9FFAFFFA8FFA9FFA8FFFFFFA8FFAFFFA8FFA9 %FFA8FFCBFFA8FFFFFFA8FFAFFFA9FFA8FFA8FFCFFFA8FFCBFFA8FF7DFFA8 %FFCFA8A8FFFFFFA8FFFFFFA8FFA9FFA9A9A8FF52FFA9FFA8FFFFFFA8FFA8 %FFA8FFFFFFA8FFA8FFA8FFFFFFA9FFFFFFA8A8A8FFA7FFAFFFA8FD38FFA8 %FFFFFFCFFD05FFAFFFFFA8FFFF7DFD11FFAF7DFFFFFFC9CA847DA87DCBA8 %FFAFAFFD04FFA8FFA8FD08FFA87DFD1CFFA9FFFFFFA8FFFFFFA9FFFFFFA8 %FFFFFFCBFD07FFA8FFCFFFAEFFFFFFA87DCFFFAFFFFFFFCBFFAFFFAFFFA8 %FF7DFFFFFFA8FFA9FFAEFFFD04A77C7D527DA8A9A8FFAEFFC9A7AFFFA8FF %AEFFA8FFCBFFA8FFFFFFA8FFAFFFA9FFFFFFA8FF7DFFA8FD20FFAFFD0BFF %AFFFFFFFA9FFFFFFAEFD07FF7DFD05FFCFFFA8CAA7A17CFD047D847E84AF %FD07FFCFFD05FF2EFF7DFFFFA7A8FD34FFA8FFAFFFA9FFAFFFA8FFFFFFA8 %FFFFFFA8FFCAFFA8FFA8A87D7D7D7E7E7D7D7D598484A97DFFAFFFA8FFFF %FFA8FFA87DA8FFA9FFA8FFAEFFA8FFAFFFA8FFFFFFA8A8FFFFA8FF28A884 %7DA8FFA9FFFFFFA9FFAEFFA8FFFFFFA8FFFFFFA8FFFFFFA8FFA852A8FFCF %FFA8FD24FFCBA8A17DA8FFAEFD19FFA8FFAFFD10FF7DFD05FF52FD39FFAF %FFFFFFA8FFFFFFAFFFFFFFA9FFFFFFA8FFA8FFA9FFFFFFCBFFFFFFA8FFFF %FFA8FFFFFFA9FFFFFFA9FFA9FF52FFFFA9AFFFFFFFA8FD07FFA9FFFFA8FD %06FFAFFFA9FFFFFFA9FFFFFFAFFFFFFFAFFFFFFFA8FD0FFFAFFD38FF52FF %FFFFCFFD05FFA8FFFFFF7DFFAFFD0DFFA8FD40FFAFFFA8FFFFFFA8FFAFFF %A8FFA8FFA8FFA8FFA8FFCBFFA8FFA8FFA9FFAFFFA8FFFF7D52FF7DA8A8FF %A87DA8FFA8FFA87DA9FFA8FFA9FFA8FFFFFFA8FFFFFF83FFA9FFA8FFFFFF %A8FFCBFFA8FFA8FFA8FFA9FFA8FFA8FFA8FFFFFFA9FFAFFFAFFFA8FFA8FF %FFFFA8FFA8FFA8FD36FFA8A8FFFF59FFFFA8FD06FF7DFD0DFFA8FD44FFA8 %FFAFFFA9FFFFFFA9FFFFFFA9FFFFFFA8FFFFFFA9FFAFFFA8FFFFFFA9FFFF %FFA87DA8FF7DA9FFFFAFFFCBFFA877FFFFA8FFFFFFA8FFFFFFA8FF7EFFA8 %FFAFFFAFFFFFFFA9FFFFFFA9FD07FFAFFFFFFFAFFFFFFFA9FD07FFAFFFFF %FFAFFD3BFF52FF53A1A177FD07FF52FD0BFFA8FD44FFA8FFA9FFA8FFA9FF %A8FFAFFFA8FFAFFFA8FFA8FFA8FFFFFFA9FFFFFFA8FFA9FFA8FF7DA8A8FF %A87DA8FFA9FFA8FFA87DA8FFFFFFA9FFFFFFA8FFA8FFA8FFFFFFA8FFAFFF %A8FFAFFFA9FFFFFFA8FFFFFFA8FFFFFFA8FFFFFFA9FFAFFFA9FFFFFFA8FF %FFFFA9FFAFFFA8FD2AFFA8FD0EFF7D7DFFFFFF2DFFA8A8FFFFA8A87DFD07 %FFCFFFAFFD46FFAFFFFFFFAFFFFFFFA8FFFFFFA9FFFFFFA9FFAFFFA8FFFF %FFA8FFFFFFA9FFFFFFA8A827FFA9CB7DA77DFFFFFFA8FFA2A9A9FFFFFFCB %FFCFA8A8FFFFFFAFFFFFFFA9FFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFF %FFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFA8FD2CFFA8FFFFFFA9 %FD07FFAFFFFFFF52FF7D7DFFA8FFA8A9A2CBFD06FFCFCFFD48FFAFFFA8FF %A8FFA9FFA9FFA8FFFFFFA8FFA8FFA8FFFFFFA8FFA8FFA8FFA9FFA8FFFFFF %A9FFA8FF527DA8FFA8FFA9A9A8FFFFFFA8FFA9A8A8FFAFFFA8FFA9FFA8FF %FFFFA8FFFFFFA8FFAFFFA8FFAFFFA8FFA9FFA9FFFFFFA8FFFFFFA8FFFFFF %A8FFFFFFA8FFAFFFAFFFAFFFA8FD32FF7DFD08FFA8FD0CFFCFA8FD4DFFA8 %FFFFFFA9FFFFFFAFFFAFFFAFFFAFFFA8FFFFFFA9FFA8FFA8FF7DFFCBFFAF %FFA8FFFFFFA8FFFFFFA9FFFFFFA8FFFFFF7DFFFFFFA8FFFFFFAFFFFFFFAF %FFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFD07 %FFA9FFFFFFA9FD33FFA8A8FD12FFA8FFA8A8FD4EFFA8FFFFFFA8FFA8FFA8 %FFFFFFA9FFA9FFA8FFA8FFA8FFCBFFFFFFA87EA8FFA9FFA8FFA8FFA8FFA9 %FFA8FFFFFFA8FF7DA8A8FFFFFFA8FFA8FFA8FFAFFFA8FFAFFFA8FFFFFFA8 %FFFFFFA9FFFFFFA8FFAFFFA9FFFFFFA8FFFFFFA8FFAFFFA8FFAFFFA8FFFF %FFA9FFAFFFA9FD44FFA87DFD55FFA9FFFFFFAFFFAFFFA8FFFFFFA8FFA8FF %A8FFFFFFA8A8A8FFA8FFFFFFA8FFA8A8A2A87DA87DFFA8FFA8FF51FFA8FF %FFFFA8FFAFFFA8FFA8FFA8FFA8FFA8FFFFAFA8FFA9FFA8FFFFFFA9FFFFFF %A8FFA9FFAFFFAFFFA9FFFFFFA8FFFFFFAFFFA8FFA8FFFFFFA9FFA8FD2DFF %A8FD15FFA8FD51FFAFFFA8FFAFFFA8FFAFFFA8FFAFFFA8FFA8FFA8FFA9FF %A8A8A8FFA8FFA9FFA8FFAFFFA8FFFFFFA8FFA9FFA8FFFFFF7DFFA9FFA8FF %AFFFA8FFFFFFA8FFFFFFA9FFAFFFA9FFFFFFA9FFFFFFA8FFFFFFA9FFFFFF %A8FFFFFFA8FFFFFFA8FFFFFFA8FFAFFFA8FFFFFFA8FFFFFFA8FD43FFA8FD %53FFA8FFFFFFA9FFFFFFA8FFFFFFA9FF2DFFA8FFFFFFA8FFFFFFA8FFFFFF %A8FFFFFFAFFFFFFFA9FFFFFFAFFFFFFFA8FFFFFFAFFFFFFFA9FFFFFFAFFF %FFFFA9FFFFFFAFFFFFFFA9FFAFFFA9FFFFFFAFFD07FFAFFD07FFAFFFFFFF %A9FFFFFFAFFFFFFFAFFD24FFAFFD37FFA9FD38FFA9FFA9FFA8FFFFFFA8FF %AFFFA8FFAFFFA8FFA8FFA8FFAFFFA8FFA9FFA8FFFFFFA8FFAFFFA8FFAFFF %A8FFFFFFA8FFA8FFA8FFAFFFA8FFAFFFA9FFFFFFA8FFAFFFA8FFFFFFA8FF %AFFFA9FFFFFFA8FFAFFFA9FFFFFFA8FFFFFFA9FFFFFFA8FFAFFFA8FFAFFF %A9FFFFFFA9FD29FF277DFD6CFFAFFFFFFFAFFFFFFFAFFFFFFFCBFD04FFA8 %CBFFAFFFFFFFA9FFA9FFA9FFFFFFA9FFFFFFAFFFFFFFA9FFFFFFA8FFCFFF %A9FFFFFFAFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFA9FFFFFFA9FFFFFFAFFF %FFFFA9FFFFFFAFFFFFFFAFFFFFFFA9FFFFFFAFFFFFFFAFFFFFFFA9FD1CFF %AFFD0BFF527DA8FD19FFA8FFFFFFAFFD4EFFAFFFA8FFAFFFA8FFAFFFA8FF %FFFFA8FFA8A8A8FFAFFFA8FFA9FFA8FFA9FFA8FFFFFFA8FFFFFFA8FFFFFF %A8FFA8FFA8FFAFFFA8FFAFFFA8FFFFFFA8FFAFFFA9FFAFFFA8FFAFFFA9FF %FFFFA9FFFFFFA9FFAFFFA8FFFFFFA8FFFFFFA8FFFFFFA8FFFFFFAFFFAFFF %A8FFAFFFA9FD25FFA8FD71FFA9FFFFFFA8FFFFFFA9FFFFFFA9FF7DFFAFFF %FFFFA9FD07FFA9FFFFFFA9FFFFFFA8FFFFFFA9FD07FFA9FFFFFFA9FFFFFF %AFFFFFFFAFFFFFFFAFFFFFFFAFFFFFFFA8FFFFFFA8FFFFFFA9FFFFFFA9FD %0BFFAFFFFFFFAFFFFFFFAFFD1CFFA8FD07FFA9FFAFFFA8FD07FFA8FFA9FD %07FFA8FFFFFFA9FFA8FFA8FFA8FFAFFD1DFFA8FD05FFAFFD2AFFA8FFA9FF %A8FFAFFFA8FFA8FFA8FFAFFFA8FFAFFFA9FFAFFFA9FFFFFFA8FFAFFFA8FF %AFFFA8FFA9FFA8FFFFFFA8FFFFFFAFFFAFFFA8FFFFFFA8FFFFFFA8FFAFFF %A8FFFFFFAFFFAFFFA8FFFFFFA8FFA9FFA8FFFFFFA9FFAFFFA9FFFFFFA9FF %FFFFA9FFAFFFA8FFFFFFA8FD1CFFAFFD7AFFAFFFFFFFA8FFFFFFA8FFFFFF %AFFD07FFAFFFFFFFA9FD07FFA8FFFFFFA8FFFFFFAFFFFFFFA8FFFFFFA9FF %FFFFA9FFAFFFA9FFFFFFAFFFFFFFAFFFFFFFAFFFFFFFA9FFFFFFA9FFFFFF %A9FFCBFFA8FFFFFFA9FFFFFFAFFFFFFFA9FFFFFFAFFFFFFFA9FD38FFCFFD %31FFA2FDFCFFFDFCFFFDFCFFFDFCFFFDB1FFFF %%EndData %%EndComments %%BeginDefaults %%ViewingOrientation: 1 0 0 1 %%EndDefaults %%BeginProlog %ADOBeginClientInjection: DocumentProlog Start "AI10" %ADOEndClientInjection: DocumentProlog Start "AI10" %%BeginResource: procset Adobe_AGM_Utils 1.0 0 %%Version: 1.0 0 %%Copyright: Copyright (C) 2000-2000 Adobe Systems, Inc. All Rights Reserved. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Utils 60 dict dup begin put /bdf { bind def } bind def /nd{ null def }bdf /xdf { exch def }bdf /ldf { load def }bdf /ddf { put } }bdf /xddf { 3 -1 roll put } }bdf /xpt { exch put }bdf /ndf { exch dup where{ pop pop pop }{ xdf }ifelse }def /cdndf { }def /bdict { mark }bdf /edict { counttomark 2 idiv dup dict begin {def} repeat pop currentdict end } }def /ps_level /languagelevel where{ pop systemdict /languagelevel get exec }{ 1 }ifelse def /level2 ps_level 2 ge def /level3 ps_level 3 ge def /ps_version {version cvr} stopped { -1 }if def /makereadonlyarray { /packedarray where{ pop packedarray }{ array astore readonly }ifelse }bdf /map_reserved_ink_name { dup type /stringtype eq{ dup /Red eq{ pop (_Red_) }{ dup /Green eq{ pop (_Green_) }{ dup /Blue eq{ pop (_Blue_) }{ dup /Cyan eq{ pop (_Cyan_) }{ dup /Magenta eq{ pop (_Magenta_) }{ exch dup currentdict exch known{ pop pop }{ exch def }ifelse dup /Yellow eq{ pop (_Yellow_) }{ dup /Black eq{ pop (_Black_) }{ dup () cvn eq{ pop (Process) }if }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse }if }bdf /AGMUTIL_GSTATE 22 dict def /get_gstate { AGMUTIL_GSTATE begin /AGMUTIL_GSTATE_clr_spc currentcolorspace def /AGMUTIL_GSTATE_clr_indx 0 def /AGMUTIL_GSTATE_clr_comps 12 array def mark currentcolor counttomark {AGMUTIL_GSTATE_clr_comps AGMUTIL_GSTATE_clr_indx 3 -1 roll put /AGMUTIL_GSTATE_clr_indx AGMUTIL_GSTATE_clr_indx 1 add def} repeat pop /AGMUTIL_GSTATE_fnt rootfont def /AGMUTIL_GSTATE_lw currentlinewidth def /AGMUTIL_GSTATE_lc currentlinecap def /AGMUTIL_GSTATE_lj currentlinejoin def /AGMUTIL_GSTATE_ml currentmiterlimit def currentdash /AGMUTIL_GSTATE_do xdf /AGMUTIL_GSTATE_da xdf / /AGMUTIL_GSTATE_sa currentstrokeadjust def /AGMUTIL_GSTATE_clr_rnd currentcolorrendering def /AGMUTIL_GSTATE_op currentoverprint def /AGMUTIL_GSTATE_bg currentblackgeneration cvlit def /AGMUTIL_GSTATE_ucr currentundercolorremoval cvlit def currentcolortransfer cvlit /AGMUTIL_GSTATE_gy_xfer xdf cvlit /AGMUTIL_GSTATE_b_xfer xdf cvlit /AGMUTIL_GSTATE_g_xfer xdf cvlit /AGMUTIL_GSTATE_r_xfer xdf /AGMUTIL_GSTATE_ht currenthalftone def /AGMUTIL_GSTATE_flt currentflat def end }def /set_gstate { AGMUTIL_GSTATE begin AGMUTIL_GSTATE_clr_spc setcolorspace AGMUTIL_GSTATE_clr_indx {AGMUTIL_GSTATE_clr_comps AGMUTIL_GSTATE_clr_indx 1 sub get /AGMUTIL_GSTATE_clr_indx AGMUTIL_GSTATE_clr_indx 1 sub def} repeat setcolor AGMUTIL_GSTATE_fnt setfont AGMUTIL_GSTATE_lw setlinewidth AGMUTIL_GSTATE_lc setlinecap AGMUTIL_GSTATE_lj setlinejoin AGMUTIL_GSTATE_ml setmiterlimit AGMUTIL_GSTATE_da AGMUTIL_GSTATE_do setdash A AGMUTIL_GSTATE_sa setstrokeadjust AGMUTIL_GSTATE_clr_rnd setcolorrendering AGMUTIL_GSTATE_op setoverprint AGMUTIL_GSTATE_bg cvx setblackgeneration AGMUTIL_GSTATE_ucr cvx setundercolorremoval AGMUTIL_GSTATE_r_xfer cvx AGMUTIL_GSTATE_g_xfer cvx AGMUTIL_GSTATE_b_xfer cvx A AGMUTIL_GSTATE_gy_xfer cvx setcolortransfer AGMUTIL_GSTATE_ht /HalftoneType get dup 9 eq exch 100 eq or { currenthalftone /HalftoneType get AGMUTIL_GSTATE_ht /HalftoneType get { mark AGMUTIL_GSTATE_ht {sethalftone} stopped cleartomark } if ne }{ AGMUTIL_GSTATE_ht sethalftone } ifelse AGMUTIL_GSTATE_flt setflat end }def /AGMUTIL_str256 256 string def /AGMUTIL_src256 256 string def /AGMUTIL_dst64 64 string def /AGMUTIL_srcLen nd /AGMUTIL_ndx nd /rdline { currentfile AGMUTIL_str256 readline pop } bdf /rdcmntline { currentfile AGMUTIL_str256 readline pop (%) anchorsearch {pop} if } bdf /filter_cmyk { dup type /filetype ne{ 0 () /SubFileDecode filter }if [ exch { AGMUTIL_src256 readstring pop dup length /AGMUTIL_srcLen exch def / /AGMUTIL_ndx 0 def AGMCORE_plate_ndx 4 AGMUTIL_srcLen 1 sub{ 1 index exch get AGMUTIL_dst64 AGMUTIL_ndx 3 -1 roll put /AGMUTIL_ndx AGMUTIL_ndx 1 add def }for pop AGMUTIL_dst64 0 AGMUTIL_ndx getinterval } bind /exec cvx ] cvx } bdf /AGMUTIL_imagefile nd /AGMUTIL_imbuf nd /read_image_file { AGMUTIL_imagefile 0 setfileposition dup /DataSource {AGMUTIL_imagefile AGMUTIL_imbuf readstring pop} put exch load exec }def /write_image_file { begin { (AGMUTIL_imagefile) (w+) file } stopped{ false }{ Adobe_AGM_Utils/AGMUTIL_imagefile xddf Adobe_AGM_Utils/AGMUTIL_imbuf Width BitsPerComponent mul 7 add 8 idiv string ddf 1 1 Height { pop DataSource dup type /filetype eq{ AGMUTIL_imbuf readstring pop }{ exec } ifelse AGMUTIL_imagefile exch writestring }for true }ifelse end }def /close_image_file { AGMUTIL_imagefile closefile (AGMUTIL_imagefile) deletefile }def /consumeimagedata { begin currentdict /MultipleDataSources known not {/MultipleDataSources false def} if MultipleDataSources { 1 dict begin /flushbuffer Width cvi string def 1 1 Height cvi { pop 0 1 DataSource length 1 sub { DataSource exch get dup type dup /filetype eq { exch flushbuffer readstring pop pop }if /arraytype eq }for }for { exec pop }if end }bdf /addprocs { 2{/exec load}repeat 3 1 roll [ 5 1 roll ] bind cvx }def /modify_halftone_xfer { currenthalftone dup length dict copy begin currentdict 2 index known{ 1 index load dup length dict copy begin currentdict/TransferFunction known{ /TransferFunction load }{ currenttransfer }ifelse addprocs /TransferFunction xdf currentdict end def currentdict end sethalftone }{ currentdict/TransferFunction known{ /TransferFunction load }{ currenttransfer }ifelse addprocs /TransferFunction xdf c currentdict end sethalftone pop }ifelse }def /doc_setup{ Adobe_AGM_Utils begin }bdf /doc_trailer{ currentdict Adobe_AGM_Utils eq{ end end } { /DataSource load type dup /filetype eq { 1 dict begin /flushbuffer Width Decode length 2 div mul cvi string def 1 1 Height { pop DataSource flushbuffer readstring pop pop} for end }if /arraytype eq { 1 1 Height { pop DataSource pop } for }if }ifelse }if }bdf systemdict /setpacking known { setpacking } if %%EndResource %%BeginResource: procset Adobe_AGM_Core 2.0 0 %%Version: 2.0 0 %%Copyright: Copyright (C) 1997-1999 Adobe Systems, Inc. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Core 205 dict dup begin put /nd{ null def }bind def /Adobe_AGM_Core_Id /Adobe_AGM_Core_2.0_0 def /AGMCORE_str256 256 string def /AGMCORE_src256 256 string def /AGMCORE_save nd /AGMCORE_graphicsave nd /AGMCORE_c 0 def /AGMCORE_m 0 def /AGMCORE_y 0 def /AGMCORE_k 0 def /AGMCORE_cmykbuf 4 array def /AGMCORE_screen [currentscreen] cvx def /AGMCORE_tmp 0 def /AGMCORE_&setgray nd /AGMCORE_&setcolor nd /AGMCORE_&setcolorspace nd /AGMCORE_&setcmykcolor nd /AGMCORE_cyan_plate nd /AGMCORE_magenta_plate nd /AGMCORE_yellow_plate nd /AGMCORE_black_plate nd /AGMCORE_plate_ndx nd /AGMCORE_get_ink_data nd /AGMCORE_is_cmyk_sep nd /AGMCORE_host_sep nd /AGMCORE_will_host_sep nd /AGMCORE_avoid_L2_sep_space nd /AGMCORE_distilling nd /AGMCORE_composite_job nd /AGMCORE_producing_seps nd /AGMCORE_ps_level -1 def /AGMCORE_ps_version -1 def /AGMCORE_environ_ok nd /AGMCORE_CSA_cache 0 dict def /AGMCORE_CSD_cache 0 dict def /AGMCORE_pattern_cache 0 dict def /AGMCORE_currentoverprint false def /AGMCORE_deltaX nd /AGMCORE_deltaY nd /AGMCORE_name nd /AGMCORE_sep_special nd All Rights Reserved. /AGMCORE_err_strings 4 dict def /AGMCORE_cur_err nd /AGMCORE_ovp nd /AGMCORE_current_spot_alias false def /AGMCORE_inverting false def /AGMCORE_feature_dictCount nd /AGMCORE_feature_opCount nd /AGMCORE_feature_ctm nd /AGMCORE_ConvertToProcess false def /AGMCORE_Default_CTM matrix def /knockout_unitsq nd /AGMCORE_CRD_cache where{ pop }{ /AGMCORE_CRD_cache 0 dict def }ifelse /AGMCORE_key_known { where{ /Adobe_AGM_Core_Id known }{ false }ifelse }ndf /flushinput { save /CompareBuffer 3 -1 roll def /readbuffer 256 string def mark { currentfile readbuffer {readline} stopped {cleartomark mark} { not {pop exit} if CompareBuffer eq {exit} if }ifelse }loop cleartomark restore }bdf /getspotfunction { AGMCORE_screen exch pop exch pop dup type /dicttype eq{ dup /HalftoneType get 1 eq{ /SpotFunction get }{ dup /HalftoneType get 2 eq{ /GraySpotFunction get }{ pop { abs exch abs 2 copy add 1 gt{ 1 sub dup mul exch 1 sub dup mul add 1 sub }{ }bind }ifelse }ifelse dup mul exch dup mul add 1 exch sub }ifelse }if } def /clp_npth { clip newpath } def /eoclp_npth { eoclip newpath } def /stkpath_clp_npth { strokepath clip newpath } def /stk_n_clp_npth { gsave stroke grestore clip newpath } def /npth_clp { newpath clip } def /graphic_setup { /AGMCORE_graphicsave save def concat 0 setgray 0 setlinecap 0 setlinejoin 1 setlinewidth [] 0 setdash 10 setmiterlimit newpath false setoverprint false setstrokeadjust Adobe_AGM_Core/spot_alias get exec /Adobe_AGM_Image where { pop Adobe_AGM_Image/spot_alias 2 copy known{ get exec }{ pop pop }ifelse } if 100 dict begin /showpage {} def mark } def /graphic_cleanup { cleartomark end AGMCORE_graphicsave restore } def /compose_error_msg { g grestoreall initgraphics / /Helvetica findfont 10 scalefont setfont /AGMCORE_deltaY 100 def / /AGMCORE_deltaX 310 def clippath pathbbox newpath pop pop 36 add exch 36 add exch moveto 0 AGMCORE_deltaY rlineto AGMCORE_deltaX 0 rlineto 0 AGMCORE_deltaY neg rlineto AGMCORE_deltaX neg 0 rlineto closepath 0 AGMCORE_&setgray gsave 1 AGMCORE_&setgray fill grestore 1 setlinewidth gsave stroke grestore c currentpoint AGMCORE_deltaY 15 sub add exch 8 add exch moveto /AGMCORE_deltaY 12 def /AGMCORE_tmp 0 def AGMCORE_err_strings exch get { dup 32 eq { pop AGMCORE_str256 0 AGMCORE_tmp getinterval stringwidth pop currentpoint pop add AGMCORE_deltaX 28 add gt { currentpoint AGMCORE_deltaY sub exch pop clippath pathbbox pop pop pop 44 add exch moveto } if A AGMCORE_str256 0 AGMCORE_tmp getinterval show ( ) show 0 1 AGMCORE_str256 length 1 sub { AGMCORE_str256 exch 0 put }for /AGMCORE_tmp 0 def } { AGMCORE_str256 exch AGMCORE_tmp exch put /AGMCORE_tmp AGMCORE_tmp 1 add def } ifelse } forall } bdf /doc_setup{ A Adobe_AGM_Core begin /AGMCORE_will_host_separate xdf /AGMCORE_ps_version xdf / /AGMCORE_ps_level xdf errordict /AGM_handleerror known not{ errordict /AGM_handleerror errordict /handleerror get put errordict /handleerror { Adobe_AGM_Core begin $error /newerror get AGMCORE_cur_err null ne and{ $error /newerror false put AGMCORE_cur_err compose_error_msg } }if }if $error /newerror true put end errordict /AGM_handleerror get exec } bind put /AGMCORE_environ_ok ps_level AGMCORE_ps_level ge ps_version AGMCORE_ps_version ge and AGMCORE_ps_level -1 eq or d def AGMCORE_environ_ok not { {/AGMCORE_cur_err /AGMCORE_bad_environ def} if /AGMCORE_&setgray systemdict/setgray get def level2{ /AGMCORE_&setcolor systemdict/setcolor get def /AGMCORE_&setcolorspace systemdict/setcolorspace get def }if /AGMCORE_distilling /product where{ pop systemdict/setdistillerparams known product (Adobe PostScript Parser) ne and }{ false }ifelse def /AGMCORE_in_rip_sep /AGMCORE_in_rip_sep where{ pop AGMCORE_in_rip_sep }{ AGMCORE_distilling { false }{ userdict/Adobe_AGM_OnHost_Seps known{ false }{ level2{ currentpagedevice/Separations 2 copy known{ get }{ pop pop false }ifelse }{ false }ifelse }ifelse }ifelse }ifelse def level2 not{ /xput{ dup load dup length exch maxlength eq{ dup dup load dup length dup 0 eq {pop 1} if 2 mul dict copy def }if }def }{ load begin def end /xput{ load 3 1 roll put }def }ifelse /AGMCORE_GSTATE AGMCORE_key_known not{ /AGMCORE_GSTATE 21 dict def /AGMCORE_gstack 32 array def /AGMCORE_gstackptr 0 def /AGMCORE_gstacksaveptr 0 def / /AGMCORE_gstackframekeys 8 def /AGMCORE_&gsave /gsave ldf /AGMCORE_&grestore /grestore ldf /AGMCORE_&grestoreall /grestoreall ldf /AGMCORE_&save /save ldf /AGMCORE_gdictcopy { begin { def } forall end }def /AGMCORE_gput { AGMCORE_gstack AGMCORE_gstackptr get 3 1 roll put }def /AGMCORE_gget { AGMCORE_gstack AGMCORE_gstackptr get exch get }def /gsave { AGMCORE_&gsave AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gstackptr 1 add dup 32 ge {limitcheck} if Adobe_AGM_Core exch /AGMCORE_gstackptr exch put AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gdictcopy }def /grestore { AGMCORE_&grestore AGMCORE_gstackptr 1 sub dup AGMCORE_gstacksaveptr lt {1 add} if Adobe_AGM_Core exch /AGMCORE_gstackptr exch put }def /grestoreall { AGMCORE_&grestoreall Adobe_AGM_Core /AGMCORE_gstackptr AGMCORE_gstacksaveptr put }def /save { AGMCORE_&save }def /page_setup { /setcmykcolor where{ pop Adobe_AGM_Core/AGMCORE_&setcmykcolor /setcmykcolor load put }if Adobe_AGM_Core begin /setcmykcolor { 4 copy AGMCORE_cmykbuf astore /currentcmykcolor exch AGMCORE_gput 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor pop }ndf /currentcmykcolor { /currentcmykcolor AGMCORE_gget aload pop }ndf /setoverprint { pop }ndf /currentoverprint { false }ndf /AGMCORE_deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt def /AGMCORE_cyan_plate 1 0 0 0 test_cmyk_color_plate def /AGMCORE_magenta_plate 0 1 0 0 test_cmyk_color_plate def }if /currentcmykcolor [0 0 0 0] AGMCORE_gput /currentstrokeadjust false AGMCORE_gput /currentcolorspace [/DeviceGray] AGMCORE_gput /sep_tint 0 AGMCORE_gput /sep_colorspace_dict null AGMCORE_gput /indexed_colorspace_dict null AGMCORE_gput /currentcolor_intent () AGMCORE_gput /customcolor_tint 1 AGMCORE_gput end }def 0 1 AGMCORE_gstack length 1 sub { AGMCORE_gstack exch AGMCORE_gstackframekeys dict put } for AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gstackptr 1 add dup 32 ge {limitcheck} if Adobe_AGM_Core begin /AGMCORE_gstackptr exch def /AGMCORE_gstacksaveptr AGMCORE_gstackptr def end AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gdictcopy /AGMCORE_yellow_plate 0 0 1 0 test_cmyk_color_plate def /AGMCORE_black_plate 0 0 0 1 test_cmyk_color_plate def /AGMCORE_plate_ndx AGMCORE_cyan_plate{ 0 }{ AGMCORE_magenta_plate{ 1 }{ AGMCORE_yellow_plate{ 2 }{ AGMCORE_black_plate{ 3 }{ 4 }ifelse }ifelse }ifelse }ifelse def /AGMCORE_composite_job AGMCORE_cyan_plate AGMCORE_magenta_plate and AGMCORE_yellow_plate and AGMCORE_black_plate and def A / /AGMCORE_producing_seps AGMCORE_composite_job not AGMCORE_in_rip_sep or def / /AGMCORE_host_sep AGMCORE_producing_seps AGMCORE_in_rip_sep not and def /AGM_preserve_spots /AGM_preserve_spots where{ pop AGM_preserve_spots }{ AGMCORE_distilling AGMCORE_producing_seps or }ifelse def /AGM_is_distiller_preserving_spotimages { currentdistillerparams/PreserveOverprintSettings known { currentdistillerparams/PreserveOverprintSettings get { currentdistillerparams/ColorConversionStrategy known { currentdistillerparams/ColorConversionStrategy }{ }{ }{ false }ifelse }def /convert_spot_to_process where {pop}{ /convert_spot_to_process /LeaveColorUnchanged eq get true }ifelse false }ifelse { dup dup (None) eq exch (All) eq or { pop false }{ AGMCORE_host_sep { gsave 1 0 0 0 setcmykcolor currentgray 1 exch sub 0 1 0 0 setcmykcolor currentgray 1 exch sub 0 0 1 0 setcmykcolor currentgray 1 exch sub 0 0 0 1 setcmykcolor currentgray 1 exch sub add add add 0 eq { pop false }{ false setoverprint 1 1 1 1 5 -1 roll findcmykcustomcolor 1 currentgray 0 eq }ifelse grestore }{ setcustomcolor AGMCORE_distilling { pop AGM_is_distiller_preserving_spotimages not }{ Adobe_AGM_Core/AGMCORE_name xddf false currentpagedevice/OverrideSeparations known { currentpagedevice/OverrideSeparations get { /HqnSpots /ProcSet resourcestatus { pop pop pop true }if }if } }if { AGMCORE_name /HqnSpots /ProcSet findresource /TestSpot get exec not }{ gsave [/Separation AGMCORE_name /DeviceGray {}]setcolorspace false currentpagedevice/SeparationColorNames 2 copy known { get { AGMCORE_name eq or}forall not }{ pop pop pop true }ifelse grestore }ifelse }ifelse }ifelse }ifelse }def }ifelse /convert_to_process where {pop}{ /convert_to_process { dup length 0 eq { pop false }{ AGMCORE_host_sep { true exch { convert_spot_to_process and } forall }{ false exch { convert_spot_to_process or } forall }ifelse }ifelse }def } }ifelse AGMCORE_host_sep AGMCORE_will_host_separate not and { /AGMCORE_cur_err /AGMCORE_color_space_onhost_seps def AGMCORE_color_space_onhost_seps }if /AGMCORE_avoid_L2_sep_space version cvr 2012 lt level2 and AGMCORE_producing_seps not and def /AGMCORE_is_cmyk_sep AGMCORE_cyan_plate AGMCORE_magenta_plate or AGMCORE_yellow_plate or AGMCORE_black_plate or def /AGM_avoid_0_cmyk where{ pop AGM_avoid_0_cmyk }{ AGM_preserve_spots userdict/Adobe_AGM_OnHost_Seps known userdict/Adobe_AGM_InRip_Seps known or not and }ifelse { /setcmykcolor[ { 4 copy add add add 0 eq currentoverprint and{ pop 0.0005 }if }/exec cvx /AGMCORE_&setcmykcolor load dup type/operatortype ne{ /exec cvx }if ]cvx def }if AGMCORE_host_sep{ /AGMCORE_get_ink_data AGMCORE_cyan_plate{ {pop pop pop} }{ AGMCORE_magenta_plate{ {4 3 roll pop pop pop} }{ AGMCORE_yellow_plate{ {4 2 roll pop pop pop} }{ {4 1 roll pop pop pop} }ifelse }ifelse }ifelse def /clip AGMCORE_key_known not{ Adobe_AGM_Core/AGMCORE_&clip /clip load put /clip { current_spot_alias{ currentdict/InksUsed known{ [ InksUsed{ dup map_alias{ /Name get exch pop }if }forall ] /InksUsed xdf }if }if AGMCORE_&clip }def }if /eoclip AGMCORE_key_known not{ Adobe_AGM_Core/AGMCORE_&eoclip /eoclip load put /eoclip { current_spot_alias{ currentdict/InksUsed known{ [ InksUsed{ dup map_alias{ /Name get exch pop }if }forall ] /InksUsed xdf }if }if AGMCORE_&eoclip }def }if }if AGMCORE_in_rip_sep{ /setcustomcolor { exch aload pop dup 7 1 roll inRip_spot_has_ink not { 4 {4 index mul 4 1 roll} repeat /DeviceCMYK setcolorspace 6 -2 roll pop pop }{ Adobe_AGM_Core begin /AGMCORE_k xdf /AGMCORE_y xdf /AGMCORE_m xdf /AGMCORE_c xdf end [/Separation 4 -1 roll /DeviceCMYK {dup AGMCORE_c mul exch dup AGMCORE_m mul exch dup AGMCORE_y mul exch AGMCORE_k mul} ] setcolorspace }ifelse setcolor }ndf /setseparationgray { [/Separation (All) /DeviceGray {}] setcolorspace_opt 1 exch sub setcolor }ndf }{ /setseparationgray { AGMCORE_&setgray }ndf }ifelse /findcmykcustomcolor { 5 makereadonlyarray }ndf /setcustomcolor { exch aload pop pop 4 {4 index mul 4 1 roll} repeat setcmykcolor pop } }ndf /has_color /colorimage where{ AGMCORE_producing_seps{ pop true }{ systemdict eq }ifelse }{ false }ifelse d def /map_index { 1 index mul exch getinterval {255 div} forall } }def level2{ /mo /moveto ldf /li /lineto ldf /cv /curveto ldf /knockout_unitsq { 1 setgray 0 0 1 1 rectfill }def /level2ScreenFreq{ begin 60 HalftoneType 1 eq{ pop Frequency }if HalftoneType 2 eq{ pop GrayFrequency }if HalftoneType 5 eq{ pop Default level2ScreenFreq }if end }def /currentScreenFreq{ currenthalftone level2ScreenFreq }def l level2 /setcolorspace AGMCORE_key_known not and{ /AGMCORE_&&&setcolorspace /setcolorspace ldf /AGMCORE_ReplaceMappedColor { dup type dup /arraytype eq exch /packedarraytype eq or { dup 0 get dup /Separation eq { pop dup length array copy dup dup 1 get current_spot_alias { dup map_alias { begin /sep_colorspace_dict currentdict AGMCORE_gput pop pop [ /Separation Name CSA map_csa dup /MappedCSA xdf /sep_colorspace_proc load ] dup Name end p pop }if }if map_reserved_ink_name 1 exch put }{ } }if } }{ /adj { }if }def /setcolorspace { dup type dup /arraytype eq exch /packedarraytype eq or { dup 0 get /Indexed eq { AGMCORE_distilling { /PhotoshopDuotoneList where { pop false }{ true }ifelse }{ true }ifelse { aload pop 3 -1 roll AGMCORE_ReplaceMappedColor 3 1 roll 4 array astore }if }{ AGMCORE_ReplaceMappedColor }ifelse }if AGMCORE_&&&setcolorspace }def /DeviceN eq { dup length array copy dup dup 1 get [ exch { current_spot_alias{ dup map_alias{ /Name get exch pop }if }if map_reserved_ink_name } forall ] 1 exch put }if }ifelse currentstrokeadjust{ transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform }if }def /mo{ adj moveto }def /li{ }def /cv{ adj lineto 6 2 roll adj 6 2 roll adj 6 2 roll adj curveto }def /knockout_unitsq { 1 setgray 8 8 1 [8 0 0 8 0 0] {<ffffffffffffffff>} image }def /currentstrokeadjust{ /currentstrokeadjust AGMCORE_gget }def /setstrokeadjust{ /currentstrokeadjust exch AGMCORE_gput }def /currentScreenFreq{ currentscreen pop pop }def /setcolorspace { /currentcolorspace exch AGMCORE_gput } def /currentcolorspace { /currentcolorspace AGMCORE_gget } def /n_color_components { dup type /arraytype eq{ 0 get }if dup /DeviceGray eq{ pop 1 }{ /DeviceCMYK eq{ 4 }{ 3 }ifelse }ifelse } def /setcolor_devicecolor { dup type /arraytype eq{ 0 get }if dup /DeviceGray eq{ pop setgray }{ /DeviceCMYK eq{ setcmykcolor setrgbcolor }ifelse }ifelse } }def /setcolor { currentcolorspace 0 get dup /DeviceGray ne{ dup /DeviceCMYK ne{ dup /DeviceRGB ne{ dup /Separation eq{ pop currentcolorspace 3 get exec currentcolorspace 2 get }{ dup /Indexed eq{ pop currentcolorspace 3 get dup type /stringtype eq{ currentcolorspace 1 get n_color_components 3 -1 roll map_index }{ exec }ifelse currentcolorspace 1 get }{ /AGMCORE_cur_err /AGMCORE_invalid_color_space def AGMCORE_invalid_color_space }ifelse }ifelse }if }if }if setcolor_devicecolor } def } }ifelse /sop /setoverprint ldf /lw /setlinewidth ldf /lc /setlinecap ldf /lj /setlinejoin ldf /ml /setmiterlimit ldf /dsh /setdash ldf /sadj /setstrokeadjust ldf /gry /setgray ldf /rgb /setrgbcolor ldf /cmyk /setcmykcolor ldf /sep /setsepcolor ldf /idx /setindexedcolor ldf /colr /setcolor ldf /csacrd /set_csa_crd ldf /sepcs /setsepcolorspace ldf /idxcs /setindexedcolorspace ldf /cp /closepath ldf /clp /clp_npth ldf }{ /eclp /eoclp_npth ldf /spclp /stkpath_clp_npth ldf /f /fill ldf /ef /eofill ldf /s /stroke ldf /sclp /stk_n_clp_npth ldf /nclp /npth_clp ldf /gset /graphic_setup ldf / /gcln /graphic_cleanup ldf currentdict{ dup xcheck 1 index type dup /arraytype eq exch /packedarraytype eq or and { }if def }forall bind }def /page_trailer { end }def /doc_trailer{ }def systemdict /findcolorrendering known{ /findcolorrendering systemdict /findcolorrendering get def }if systemdict /setcolorrendering known{ /setcolorrendering systemdict /setcolorrendering get def }if /test_cmyk_color_plate { gsave setcmykcolor currentgray 1 ne grestore }def /inRip_spot_has_ink { dup Adobe_AGM_Core/AGMCORE_name xddf convert_spot_to_process not }def /current_ink { dup length 0 eq{ pop true }{ Adobe_AGM_Core/ink_result false put { dup /ProcessCyan eq{ AGMCORE_cyan_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessMagenta eq{ AGMCORE_magenta_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessYellow eq{ AGMCORE_yellow_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ Adobe_AGM_Core/ink_result xddf null eq{ Adobe_AGM_Core/ink_result xddf dup /ProcessBlack eq{ AGMCORE_black_plate ink_result or }{ dup /sep_colorspace_dict AGMCORE_gget dup pop false ink_result or }{ /Name get eq{ 1 setsepcolor currentgray 1 ne ink_result }{ false ink_result or or Adobe_AGM_Core/ink_result xddf Adobe_AGM_Core/ink_result xddf }def /map255_to_range { 1 index sub 3 -1 roll 255 div mul add }def /set_csa_crd { /sep_colorspace_dict null AGMCORE_gput begin CSA map_csa setcolorspace_opt set_crd end } def /setsepcolor { }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse pop } forall ink_result }ifelse } def /sep_colorspace_proc { Adobe_AGM_Core/AGMCORE_tmp xddf /sep_colorspace_dict AGMCORE_gget begin currentdict/Components known{ Components aload pop TintMethod/Lab eq{ 2 {AGMCORE_tmp mul NComponents 1 roll} repeat LMax sub AGMCORE_tmp mul LMax add NComponents 1 roll /sep_colorspace_dict AGMCORE_gget begin dup /sep_tint exch AGMCORE_gput TintProc end }{ }{ TintMethod/Subtractive eq{ NComponents{ AGMCORE_tmp mul NComponents 1 roll }repeat }{ NComponents{ 1 sub AGMCORE_tmp mul 1 add NComponents 1 roll } repeat }ifelse }ifelse ColorLookup AGMCORE_tmp ColorLookup length 1 sub mul round cvi get aload pop }ifelse end } def /sep_colorspace_gray_proc { Adobe_AGM_Core/AGMCORE_tmp xddf /sep_colorspace_dict AGMCORE_gget begin GrayLookup AGMCORE_tmp GrayLookup length 1 sub mul round cvi get end } def /sep_proc_name { dup 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or level2 not and has_color not and{ pop [/DeviceGray] /sep_colorspace_gray_proc }{ /sep_colorspace_proc }ifelse } def /setsepcolorspace { current_spot_alias{ dup begin Name map_alias{ exch pop }if end }if dup /sep_colorspace_dict exch AGMCORE_gput begin /MappedCSA CSA map_csa def A Adobe_AGM_Core/AGMCORE_sep_special Name dup () eq exch (All) eq or ddf AGMCORE_avoid_L2_sep_space{ [/Indexed MappedCSA sep_proc_name 255 exch { 255 div } /exec cvx 3 -1 roll [ 4 1 roll load /exec cvx ] cvx ] setcolorspace_opt /TintProc { 255 mul round cvi setcolor }bdf }{ MappedCSA 0 get /DeviceCMYK eq currentdict/Components known and AGMCORE_sep_special not and{ /TintProc [ Components aload pop Name findcmykcustomcolor /exch cvx /setcustomcolor cvx ] cvx bdf }{ AGMCORE_host_sep Name (All) eq and{ /TintProc { 1 exch sub setseparationgray }bdf }{ AGMCORE_in_rip_sep MappedCSA 0 get /DeviceCMYK eq and AGMCORE_host_sep or Name () eq and{ /TintProc [ MappedCSA sep_proc_name exch 0 get /DeviceCMYK eq{ }{ cvx /setcmykcolor cvx cvx /setgray cvx }ifelse ] cvx bdf AGMCORE_producing_seps MappedCSA 0 get dup /DeviceCMYK eq exch /DeviceGray eq or and AGMCORE_sep_special not and{ /TintProc [ /dup cvx MappedCSA sep_proc_name cvx exch 0 get /DeviceGray eq{ 1 /exch cvx /sub cvx 0 0 0 4 -1 /roll cvx }if /Name cvx /findcmykcustomcolor cvx /exch c cvx AGMCORE_host_sep{ AGMCORE_is_cmyk_sep }{ Name inRip_spot_has_ink not }ifelse { /pop cvx 1 }if /setcustomcolor cvx ] cvx bdf / /TintProc /setcolor ldf load ] setcolorspace_opt [/Separation Name MappedCSA sep_proc_name }{ }{ }ifelse }ifelse }ifelse }ifelse }ifelse set_crd setsepcolor end } def /setindexedcolorspace { dup /indexed_colorspace_dict exch AGMCORE_gput begin /MappedCSA CSA map_csa def AGMCORE_host_sep level2 not and{ 0 0 0 0 setcmykcolor }{ [/Indexed MappedCSA level2 not has_color not and{ dup 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or{ pop [/DeviceGray] }if HiVal GrayLookup }{ HiVal currentdict/RangeArray known{ { /indexed_colorspace_dict AGMCORE_gget begin Lookup exch dup HiVal gt{ pop HiVal }if NComponents mul NComponents getinterval {} forall NComponents 1 sub -1 0{ RangeArray exch 2 mul 2 getinterval aload pop map255_to_range NComponents 1 roll }for end } bind }{ Lookup }ifelse }ifelse ] setcolorspace_opt set_crd }ifelse end }def /setindexedcolor { AGMCORE_host_sep{ /indexed_colorspace_dict AGMCORE_gget/Lookup get 4 3 -1 roll map_index setcmykcolor }{ setcolor }ifelse } def /ignoreimagedata { currentoverprint not{ gsave dup begin 1 setgray 0 0 ImageMatrix itransform Width Height ImageMatrix idtransform rectfill end grestore }if consumeimagedata }def /add_csa { Adobe_AGM_Core begin /AGMCORE_CSA_cache xput end }def /map_csa { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_CSA_cache get exch get }if }def /add_csd { Adobe_AGM_Core begin /AGMCORE_CSD_cache xput end }def /get_csd { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_CSD_cache get exch get }if }def /get_csd_by_name { dup type dup /nametype eq exch /stringtype eq or{ Adobe_AGM_Core begin /AGMCORE_CSD_Name xdf AGMCORE_CSD_cache { dup /Name get AGMCORE_CSD_Name eq { exch pop exit }{ pop }ifelse pop }forall end }if }def /cachepattern_level2 { 4 dict begin /comparebuffer exch def /holdbuffer exch def /readbuffer 1024 string def /LZWFilter holdbuffer /LZWEncode filter def { currentfile readbuffer readline not {pop exit} if dup LZWFilter exch writestring LZWFilter (\n) writestring comparebuffer eq {exit} if }loop LZWFilter closefile end }def /cachepattern_level3 { 3 dict begin /comparebuffer exch def /readbuffer 1024 string def /DoEOL false def { DoEOL { (\n) /DoEOL false def } { currentfile readbuffer readline not {pop ()} { dup length 0 eq { pop(\n)} { dup comparebuffer eq {pop ()} {/DoEOL true def} ifelse } ifelse } ifelse } ifelse } /ReusableStreamDecode filter end }def /add_pattern { Adobe_AGM_Core begin /AGMCORE_pattern_cache xput end }def /get_pattern { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_pattern_cache get exch get }if }def /make_pattern { dup matrix currentmatrix matrix concatmatrix 0 0 3 2 roll itransform exch 3 index /XStep get 1 index exch 2 copy div cvi mul sub sub exch 3 index /YStep get 1 index exch 2 copy div cvi mul sub sub matrix translate exch matrix concatmatrix makepattern }def /exec_file statusdict /currentfilenameextend known{ { 0 () /SubFileDecode filter cvx exec } } }{ {cvx exec} }ifelse def /set_pattern { dup /PatternType get 1 eq{ dup /PaintType get 1 eq{ false sop [/DeviceGray] setcolorspace 0 setgray }if }if setpattern }def /setcolorspace_opt { dup currentcolorspace eq{ pop }{ setcolorspace }ifelse }def /updatecolorrendering { currentcolorrendering/Intent known{ currentcolorrendering/Intent get }{ null } }ifelse Intent ne{ false Intent AGMCORE_CRD_cache { exch pop begin dup Intent eq{ currentdict setcolorrendering_opt end e exch pop true exch exit }if end } forall pop not{ systemdict /findcolorrendering known{ Intent findcolorrendering pop /ColorRendering findresource dup length dict copy setcolorrendering_opt }if }if }if } def /add_crd { AGMCORE_CRD_cache 3 1 roll put }def /set_crd { AGMCORE_host_sep not level2 and{ currentdict/CRD known{ AGMCORE_CRD_cache CRD get dup null ne{ setcolorrendering_opt }{ pop }ifelse }{ currentdict/Intent known{ updatecolorrendering }if }ifelse }if }def /setcolorrendering_opt { dup currentcolorrendering eq{ pop }{ begin /Intent Intent def currentdict end setcolorrendering }ifelse }def /cdndf { exch dup currentdict exch known{ pop pop }{ exch def }ifelse }def /cpaint_gcomp { convert_to_process Adobe_AGM_Core/AGMCORE_ConvertToProcess xddf Adobe_AGM_Core/AGMCORE_ConvertToProcess get not { (%end_cpaint_gcomp) flushinput }if }def /cpaint_gsep { Adobe_AGM_Core/AGMCORE_ConvertToProcess get { (%end_cpaint_gsep) flushinput }if }def /cpaint_gend { newpath }def /AGMCORE_ctm_stack bdict /push_ctm { stack length size le{ stack dup length 2 mul array dup /stack exch def copy pop }if stack size 3 -1 roll put /size size 1 add def } /pop_ctm { /size size 1 sub def size 0 lt{ /size 0 def }if stack size get } /stack 1 array /size 0 edict def /save_ctm { matrix currentmatrix AGMCORE_ctm_stack begin push_ctm end }def /restore_ctm { AGMCORE_ctm_stack begin pop_ctm end setmatrix }def /path_rez { dup 0 ne{ AGMCORE_deviceDPI exch div dup 1 lt{ pop 1 }if setflat }{ pop } }ifelse }def /rdcmntline { currentfile AGMCORE_str256 readline pop (%) anchorsearch {pop} if } def /set_spot_alias_ary { /AGMCORE_SpotAliasAry where{ pop pop }{ Adobe_AGM_Core/AGMCORE_SpotAliasAry xddf true set_spot_alias }ifelse }def /set_spot_alias { /AGMCORE_SpotAliasAry where{ /AGMCORE_current_spot_alias 3 -1 roll put }{ pop }ifelse }def /current_spot_alias { /AGMCORE_SpotAliasAry where{ /AGMCORE_current_spot_alias get }{ false }ifelse }def /map_alias { /AGMCORE_SpotAliasAry where{ begin /AGMCORE_name xdf f false AGMCORE_SpotAliasAry{ dup/Name get AGMCORE_name eq{ save exch /Adobe_AGM_Core currentdict def /CSD get get_csd exch restore exch pop true exit }{ pop }ifelse }forall end }{ pop false }ifelse }bdf /spot_alias { t true set_spot_alias /AGMCORE_&setcustomcolor AGMCORE_key_known not { Adobe_AGM_Core/AGMCORE_&setcustomcolor /setcustomcolor load put } if / /customcolor_tint 1 AGMCORE_gput Adobe_AGM_Core begin /setcustomcolor { d dup /customcolor_tint exch AGMCORE_gput current_spot_alias{ 1 index 4 get map_alias{ }{ }{ }bdf end mark 3 1 roll setsepcolorspace counttomark 0 ne{ setsepcolor }if pop pop AGMCORE_&setcustomcolor }ifelse AGMCORE_&setcustomcolor }ifelse }def /begin_feature { Adobe_AGM_Core/AGMCORE_feature_dictCount countdictstack put count Adobe_AGM_Core/AGMCORE_feature_opCount 3 -1 roll put {Adobe_AGM_Core/AGMCORE_feature_ctm matrix currentmatrix put}if }def /end_feature { 2 dict begin /spd /setpagedevice load def /setpagedevice { get_gstate spd set_gstate } def stopped{$error/newerror false put}if end count Adobe_AGM_Core/AGMCORE_feature_opCount get sub dup 0 gt{{pop}repeat} {pop}ifelse countdictstack Adobe_AGM_Core/AGMCORE_feature_dictCount get sub dup 0 gt{{end}repeat}{pop}ifelse {Adobe_AGM_Core/AGMCORE_feature_ctm get setmatrix}if }def /set_negative { Adobe_AGM_Core begin /AGMCORE_inverting exch def level2{ currentpagedevice/NegativePrint known{ currentpagedevice/NegativePrint get Adobe_AGM_Core/AGMCORE_inverting get ne{ true begin_feature true{ bdict /NegativePrint Adobe_AGM_Core/AGMCORE_inverting get edict setpagedevice }end_feature }if /AGMCORE_inverting false def }if }if AGMCORE_inverting{ [{1 exch sub}/exec load dup currenttransfer exch]cvx bind settransfer gsave newpath clippath 1 /setseparationgray where{pop setseparationgray}{setgray}ifelse fill grestore }if end }def /lw_save_restore_override { /md where { pop md begin currentdict /lw_initializepage known not { /lw_initializepage /initializepage load def /initializepage { lw_initializepage /initializepage {} def }def }if /pmSVsetup{} def /endp{}def /pse{}def /psb{}def /orig_showpage where {pop} {/orig_showpage /showpage load def} ifelse /showpage {orig_showpage gR} def end }if }def /pscript_showpage_override { /NTPSOct95 where { begin showpage save /showpage /restore load def /restore {exch pop}def end }if }def /driver_media_override { /md where { pop md /initializepage known { md /initializepage {} put } if md /rC known { md /rC {4{pop}repeat} put } if } }if Adobe_AGM_Core /AGMCORE_Default_CTM matrix currentmatrix put }def /driver_check_media_override { Adobe_AGM_Core /AGMCORE_Default_CTM get matrix currentmatrix ne { Adobe_AGM_Core /AGMCORE_Default_CTM get setmatrix }if }def AGMCORE_err_strings begin /AGMCORE_bad_environ (Environment not satisfactory for this job. Ensure that the PPD is correct or that the PostScript level requested is supported by this printer. ) def /AGMCORE_color_space_onhost_seps (This job contains colors that will not separate with on-host methods. ) def /AGMCORE_invalid_color_space (This job contains an invalid color space. ) def end end systemdict /setpacking known { setpacking } if %%EndResource %%BeginResource: procset Adobe_CoolType_Core 2.12 0 %%Copyright: Copyright 1997-2001 Adobe Systems Incorporated. All Rights Reserved. %%Version: 2.12 0 userdict/Adobe_CoolType_Core 60 dict dup begin put/Level2? systemdict /languagelevel known dup{pop systemdict/languagelevel get 2 ge}if def Level2? not{/currentglobal false def/setglobal/pop load def/gcheck{pop false}bind def /currentpacking false def/setpacking/pop load def/SharedFontDirectory 0 dict def}if currentpacking true setpacking/@_SaveStackLevels{Adobe_CoolType_Data begin @opStackCountByLevel @opStackLevel 2 copy known not{2 copy 3 dict dup /args 7 index 5 add array put put get}{get dup/args get dup length 3 index lt{ dup length 5 add array exch 1 index exch 0 exch putinterval 1 index exch/args exch put}{pop}ifelse}ifelse begin count 2 sub 1 index lt{pop count 1 sub}if dup/argCount exch def dup 0 gt{exch 1 index 2 add 1 roll args exch 0 exch getinterval astore pop}{pop}ifelse count 1 sub/restCount exch def end /@opStackLevel @opStackLevel 1 add def countdictstack 1 sub @dictStackCountByLevel exch @dictStackLevel exch put/@dictStackLevel @dictStackLevel 1 add def end}bind def/@_RestoreStackLevels{ Adobe_CoolType_Data begin/@opStackLevel @opStackLevel 1 sub def @opStackCountByLevel @opStackLevel get begin count restCount sub dup 0 gt{{pop }repeat}{pop}ifelse args 0 argCount getinterval{}forall end/@dictStackLevel @dictStackLevel 1 sub def @dictStackCountByLevel @dictStackLevel get end countdictstack exch sub dup 0 gt{{end}repeat}{pop}ifelse}bind def /@_PopStackLevels{Adobe_CoolType_Data begin/@opStackLevel @opStackLevel 1 sub def/@dictStackLevel @dictStackLevel 1 sub def end}bind def/@Raise{exch cvx exch errordict exch get exec stop}bind def/@ReRaise{cvx $error/errorname get errordict exch get exec stop}bind def/@Stopped{0 @#Stopped}bind def/@#Stopped{ @_SaveStackLevels stopped{@_RestoreStackLevels true}{@_PopStackLevels false} ifelse}bind def/@Arg{Adobe_CoolType_Data begin @opStackCountByLevel @opStackLevel 1 sub get/args get exch get end}bind def/doc_setup{ Adobe_CoolType_Core begin/mov/moveto load def/nfnt/newencodedfont load def /mfnt/makefont load def/sfnt/setfont load def/ufnt/undefinefont load def/chp /charpath load def/awsh/awidthshow load def/wsh/widthshow load def/ash/ashow load def/sh/show load def end userdict/Adobe_CoolType_Data 6 dict dup begin /AddWidths? false def/CC 0 def/charcode 2 string def/@opStackCountByLevel 32 dict def/@opStackLevel 0 def/@dictStackCountByLevel 32 dict def /@dictStackLevel 0 def end put}bind def/doc_trailer{currentdict Adobe_CoolType_Core eq{end}if}bind def/page_setup{Adobe_CoolType_Core begin} bind def/page_trailer{end}bind def/unload{systemdict/languagelevel known{ systemdict/languagelevel get 2 ge{userdict/Adobe_CoolType_Core 2 copy known{ undef}{pop pop}ifelse}if}if}bind def/ndf{1 index where{pop pop pop}{dup xcheck {bind}if def}ifelse}def/findfont dup systemdict begin userdict begin /globaldict where{/globaldict get begin}if dup where pop exch get/globaldict where{pop end}if end end def/systemfindfont/findfont load def/undefinefont{pop }ndf/copyfont{currentglobal 3 1 roll 1 index gcheck setglobal dup null eq{0}{ dup length}ifelse 2 index length add 1 add dict begin exch{1 index/FID eq{pop pop}{def}ifelse}forall dup null eq{pop}{{def}forall}ifelse currentdict end exch setglobal}bind def/copyarray{currentglobal exch dup gcheck setglobal dup length array copy exch setglobal}bind def/newencodedfont{currentglobal{ SharedFontDirectory 3 index known{SharedFontDirectory 3 index get /FontReferenced known}{false}ifelse}{FontDirectory 3 index known{FontDirectory 3 index get/FontReferenced known}{SharedFontDirectory 3 index known{ SharedFontDirectory 3 index get/FontReferenced known}{false}ifelse}ifelse} ifelse dup{3 index findfont/FontReferenced get 2 index findfont ne{pop false} if}if{pop 1 index findfont/Encoding get exch 0 1 255{2 copy get 3 index 3 1 roll put}for pop pop pop}{findfont dup dup maxlength 2 add dict begin exch{1 index/FID ne{def}{pop pop}ifelse}forall/FontReferenced exch def/Encoding exch dup length array copy def/FontName 1 index dup type/stringtype eq{cvn}if def currentdict end definefont pop}ifelse}bind def/SetSubstituteStrategy{ $SubstituteFont begin dup type/dicttype ne{0 dict}if currentdict/$Strategies known{exch $Strategies exch 2 copy known{get 2 copy maxlength exch maxlength add dict begin{def}forall{def}forall currentdict dup/$Init known{dup/$Init get exec}if end/$Strategy exch def}{pop pop pop}ifelse}{pop pop}ifelse end}bind def/scff{$SubstituteFont begin dup type/stringtype eq{dup length exch}{null} ifelse/$sname exch def/$slen exch def end{findfont}@Stopped{dup length dup 21 add string dup 4 3 roll 0 exch 128 string cvs putinterval exch 1 index exch (_was-malformed-so-was)putinterval cvn{findfont}@Stopped{pop/Courier findfont} if}if $SubstituteFont begin/$sname null def/$slen 0 def end}bind def /isWidthsOnlyFont{dup/WidthsOnly known{pop pop true}{dup/FDepVector known{ /FDepVector get{isWidthsOnlyFont dup{exit}if}forall}{dup/FDArray known{ /FDArray get{isWidthsOnlyFont dup{exit}if}forall}{pop}ifelse}ifelse}ifelse} bind def/?set{$SubstituteFont begin/$substituteFound false def/$fontname 4 index def/$doSmartSub false def end 3 index findfont $SubstituteFont begin $substituteFound{false}{dup/FontName known{dup/FontName get $fontname eq 1 index/DistillerFauxFont known not and/currentdistillerparams where{pop false 2 index isWidthsOnlyFont not and}if}{false}ifelse}ifelse exch pop/$doSmartSub true def end{exch pop exch pop exch 2 dict dup/Found 3 index put exch findfont exch}{exch exec exch findfont 2 dict dup/Downloaded 6 5 roll put}ifelse dup /FontName 4 index put copyfont definefont pop}bind def/?str1 256 string def /?str2 256 string def/?add{1 index type/integertype eq{exch true 4 2}{false 3 1}ifelse roll 1 index findfont dup/Widths known{Adobe_CoolType_Data/AddWidths? true put gsave dup 1000 scalefont setfont}if/Downloaded known{exec exch{exch ?str2 cvs exch findfont/Downloaded get 1 dict begin/Downloaded 1 index def ?str1 cvs length ?str1 1 index 1 add 3 index putinterval exch length 1 add 1 index add ?str1 2 index(*)putinterval ?str1 0 2 index getinterval cvn findfont ?str1 3 index(+)putinterval 2 dict dup/FontName ?str1 0 6 index getinterval cvn put dup/Downloaded Downloaded put end copyfont dup/FontName get exch definefont pop pop pop}{pop}ifelse}{pop exch{findfont dup/Found get dup length exch ?str1 cvs pop ?str1 1 index(+)putinterval ?str1 1 index 1 add 4 index ?str2 cvs putinterval ?str1 exch 0 exch 5 4 roll ?str2 cvs length 1 add add getinterval cvn 1 dict exch 1 index exch/FontName exch put copyfont dup /FontName get exch definefont pop}{pop}ifelse}ifelse Adobe_CoolType_Data /AddWidths? get{grestore Adobe_CoolType_Data/AddWidths? false put}if}bind def /?sh{currentfont/Downloaded known{exch}if pop}bind def/?chp{currentfont /Downloaded known{pop}{false chp}ifelse}bind def/?mv{currentfont/Downloaded known{moveto pop pop}{pop pop moveto}ifelse}bind def setpacking userdict /$SubstituteFont 25 dict put 1 dict begin/SubstituteFont dup $error exch 2 copy known{get}{pop pop{pop/Courier}bind}ifelse def/currentdistillerparams where dup{pop pop currentdistillerparams/CannotEmbedFontPolicy 2 copy known{ get/Error eq}{pop pop false}ifelse}if not{countdictstack array dictstack 0 get begin userdict begin $SubstituteFont begin/$str 128 string def/$fontpat 128 string def/$slen 0 def/$sname null def/$match false def/$fontname null def /$substituteFound false def/$doSmartSub true def/$depth 0 def/$fontname null def/$italicangle 26.5 def/$dstack null def/$Strategies 10 dict dup begin /$Type3Underprint{currentglobal exch false setglobal 11 dict begin/UseFont exch $WMode 0 ne{dup length dict copy dup/WMode $WMode put/UseFont exch definefont}if def/FontName $fontname dup type/stringtype eq{cvn}if def /FontType 3 def/FontMatrix[.001 0 0 .001 0 0]def/Encoding 256 array dup 0 1 255{/.notdef put dup}for pop def/FontBBox[0 0 0 0]def/CCInfo 7 dict dup begin /cc null def/x 0 def/y 0 def end def/BuildChar{exch begin CCInfo begin 1 string dup 0 3 index put exch pop/cc exch def UseFont 1000 scalefont setfont cc stringwidth/y exch def/x exch def x y setcharwidth $SubstituteFont /$Strategy get/$Underprint get exec 0 0 moveto cc show x y moveto end end}bind def currentdict end exch setglobal}bind def/$GetaTint 2 dict dup begin /$BuildFont{dup/WMode known{dup/WMode get}{0}ifelse/$WMode exch def $fontname exch dup/FontName known{dup/FontName get dup type/stringtype eq{cvn}if}{ /unnamedfont}ifelse exch $deepcopyfont exch 1 index exch/FontBasedOn exch put dup/FontName $fontname dup type/stringtype eq{cvn}if put definefont}bind def /$Underprint{gsave x abs y abs gt{/y 1000 def}{/x -1000 def 500 120 translate} ifelse Level2?{[/Separation(All)/DeviceCMYK{0 0 0 1 pop}]setcolorspace}{0 setgray}ifelse 10 setlinewidth x .8 mul[7 3]{y mul 8 div 120 sub x 10 div exch moveto 0 y 4 div neg rlineto dup 0 rlineto 0 y 4 div rlineto closepath gsave Level2?{.2 setcolor}{.8 setgray}ifelse fill grestore stroke}forall pop grestore}bind def end def/$Oblique 1 dict dup begin/$BuildFont{currentglobal exch dup gcheck setglobal null copyfont begin/FontBasedOn currentdict/FontName known{FontName dup type/stringtype eq{cvn}if}{/unnamedfont}ifelse def/FontName $fontname dup type/stringtype eq{cvn}if def/currentdistillerparams where{pop}{ /FontInfo currentdict/FontInfo known{FontInfo null copyfont}{2 dict}ifelse dup begin/ItalicAngle $italicangle def/FontMatrix FontMatrix[1 0 ItalicAngle dup sin exch cos div 1 0 0]matrix concatmatrix readonly end 4 2 roll def def} ifelse FontName currentdict end definefont exch setglobal}bind def end def /$None 1 dict dup begin/$BuildFont{}bind def end def end def/$Oblique SetSubstituteStrategy/$findfontByEnum{dup type/stringtype eq{cvn}if dup /$fontname exch def $sname null eq{$str cvs dup length $slen sub $slen getinterval}{pop $sname}ifelse $fontpat dup 0(fonts/*)putinterval exch 7 exch putinterval/$match false def $SubstituteFont/$dstack countdictstack array dictstack put mark{$fontpat 0 $slen 7 add getinterval{/$match exch def exit} $str filenameforall}stopped{cleardictstack currentdict true $SubstituteFont /$dstack get{exch{1 index eq{pop false}{true}ifelse}{begin false}ifelse}forall pop}if cleartomark/$slen 0 def $match false ne{$match(fonts/)anchorsearch pop pop cvn}{/Courier}ifelse}bind def/$ROS 1 dict dup begin/Adobe 4 dict dup begin /Japan1[/Ryumin-Light/HeiseiMin-W3/GothicBBB-Medium/HeiseiKakuGo-W5 /HeiseiMaruGo-W4/Jun101-Light]def/Korea1[/HYSMyeongJo-Medium/HYGoThic-Medium] def/GB1[/STSong-Light/STHeiti-Regular]def/CNS1[/MKai-Medium/MHei-Medium]def end def end def/$cmapname null def/$deepcopyfont{dup/FontType get 0 eq{1 dict dup/FontName/copied put copyfont begin/FDepVector FDepVector copyarray 0 1 2 index length 1 sub{2 copy get $deepcopyfont dup/FontName/copied put/copied exch definefont 3 copy put pop pop}for def currentdict end}{$Strategies /$Type3Underprint get exec}ifelse}bind def/$buildfontname{length $str 1 index (-)putinterval 1 add $str 1 index $cmapname $fontpat cvs putinterval $cmapname length add $str exch 0 exch getinterval cvn}bind def/$findfontByROS{/$fontname exch def $ROS Registry 2 copy known{get Ordering 2 copy known{get}{pop pop[]} ifelse}{pop pop[]}ifelse false exch{dup/CIDFont resourcestatus{pop pop save 1 index/CIDFont findresource dup/WidthsOnly known{dup/WidthsOnly get}{false} ifelse exch pop exch restore{pop}{exch pop true exit}ifelse}{pop}ifelse}forall {$str cvs $buildfontname}{false(*){save exch dup/CIDFont findresource dup /WidthsOnly known{dup/WidthsOnly get not}{true}ifelse exch/CIDSystemInfo get dup/Registry get Registry eq exch/Ordering get Ordering eq and and{exch restore exch pop true exit}{pop restore}ifelse}$str/CIDFont resourceforall{ $buildfontname}{$fontname $findfontByEnum}ifelse}ifelse}bind def end end currentdict/$error known currentdict/languagelevel known and dup{pop $error /SubstituteFont known}if dup{$error}{Adobe_CoolType_Core}ifelse begin{ /SubstituteFont/CMap/Category resourcestatus{pop pop{$SubstituteFont begin /$substituteFound true def dup length $slen gt $sname null ne or $slen 0 gt and{$sname null eq{dup $str cvs dup length $slen sub $slen getinterval cvn}{ $sname}ifelse dup/CMap resourcestatus{pop pop dup/$cmapname exch def/CMap findresource/CIDSystemInfo get{def}forall $findfontByROS}{128 string cvs dup (-)search{3 1 roll search{3 1 roll pop{dup cvi}stopped{pop pop pop pop pop $findfontByEnum}{4 2 roll pop pop exch length exch 2 index length 2 index sub exch 1 sub -1 0{$str cvs dup length 4 index 0 4 index 4 3 roll add getinterval exch 1 index exch 3 index exch putinterval dup/CMap resourcestatus{pop pop 4 1 roll pop pop pop dup/$cmapname exch def/CMap findresource/CIDSystemInfo get{ def}forall $findfontByROS true exit}{pop}ifelse}for dup type/booleantype eq{ pop}{pop pop $findfontByEnum}ifelse}ifelse}{pop pop pop $findfontByEnum}ifelse }{pop pop $findfontByEnum}ifelse}ifelse}{//SubstituteFont exec}ifelse/$slen 0 def end}}{{$SubstituteFont begin/$substituteFound true def dup length $slen gt $sname null ne or $slen 0 gt and{$findfontByEnum}{//SubstituteFont exec}ifelse end}}ifelse bind readonly def Adobe_CoolType_Core/scfindfont/systemfindfont load put}{/scfindfont{$SubstituteFont begin dup systemfindfont dup/FontName known{dup/FontName get dup 3 index ne}{/noname true}ifelse dup{ /$origfontnamefound 2 index def/$origfontname 4 index def/$substituteFound true def}if exch pop{$slen 0 gt $sname null ne 3 index length $slen gt or and{ pop dup $findfontByEnum findfont dup maxlength 1 add dict begin{1 index/FID eq {pop pop}{def}ifelse}forall currentdict end definefont dup/FontName known{dup /FontName get}{null}ifelse $origfontnamefound ne{$origfontname $str cvs print ( substitution revised, using )print dup/FontName known{dup/FontName get}{ (unspecified font)}ifelse $str cvs print(. )print}if}{exch pop}ifelse}{exch pop}ifelse end}bind def}ifelse end end Adobe_CoolType_Core/findfont{$SubstituteFont begin $depth 0 eq{/$fontname 1 index dup type/stringtype ne{$str cvs}if def/$substituteFound false def}if /$depth $depth 1 add def end scfindfont $SubstituteFont begin/$depth $depth 1 sub def $substituteFound $depth 0 eq and $doSmartSub and{currentdict/$Strategy known{$Strategy/$BuildFont get exec}if}if end}bind put}if end end %%EndResource %%BeginResource: procset Adobe_CoolType_Utility_MAKEOCF 1.13 0 %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. %%Version: 1.13 0 systemdict/languagelevel known dup{currentglobal false setglobal}{false}ifelse exch userdict/Adobe_CoolType_Utility 2 copy known{2 copy get dup maxlength 25 add dict copy}{25 dict}ifelse put Adobe_CoolType_Utility begin/ct_Level2? exch def/ct_Clone? 1183615869 internaldict dup/CCRun known not exch/eCCRun known not ct_Level2? and or def/ct_UseNativeCapability? systemdict/composefont known def/ct_MakeOCF 35 dict def/ct_Vars 25 dict def/ct_GlyphDirProcs 6 dict def /ct_BuildCharDict 15 dict dup begin/charcode 2 string def/dst_string 1500 string def/nullstring()def/usewidths? true def end def ct_Level2?{setglobal}{ pop}ifelse ct_GlyphDirProcs begin/GetGlyphDirectory{systemdict/languagelevel known{pop/CIDFont findresource/GlyphDirectory get}{1 index/CIDFont findresource/GlyphDirectory get dup type/dicttype eq{dup dup maxlength exch length sub 2 index lt{dup length 2 index add dict copy 2 index/CIDFont findresource/GlyphDirectory 2 index put}if}if exch pop exch pop}ifelse +}def/+ {systemdict/languagelevel known{currentglobal false setglobal 3 dict begin/vm exch def}{1 dict begin}ifelse/$ exch def systemdict/languagelevel known{vm setglobal/gvm currentglobal def $ gcheck setglobal}if ?{$ begin}if}def/?{$ type/dicttype eq}def/|{userdict/Adobe_CoolType_Data known{Adobe_CoolType_Data /AddWidths? known{currentdict Adobe_CoolType_Data begin begin AddWidths?{ Adobe_CoolType_Data/CC 3 index put ?{def}{$ 3 1 roll put}ifelse CC charcode exch 1 index 0 2 index 256 idiv put 1 index exch 1 exch 256 mod put stringwidth 2 array astore currentfont/Widths get exch CC exch put}{?{def}{$ 3 1 roll put}ifelse}ifelse end end}{?{def}{$ 3 1 roll put}ifelse}ifelse}{?{def}{ $ 3 1 roll put}ifelse}ifelse}def/!{?{end}if systemdict/languagelevel known{gvm setglobal}if end}def/:{string currentfile exch readstring pop}executeonly def end ct_MakeOCF begin/ct_cHexEncoding[/c00/c01/c02/c03/c04/c05/c06/c07/c08/c09 /c0A/c0B/c0C/c0D/c0E/c0F/c10/c11/c12/c13/c14/c15/c16/c17/c18/c19/c1A/c1B/c1C /c1D/c1E/c1F/c20/c21/c22/c23/c24/c25/c26/c27/c28/c29/c2A/c2B/c2C/c2D/c2E/c2F /c30/c31/c32/c33/c34/c35/c36/c37/c38/c39/c3A/c3B/c3C/c3D/c3E/c3F/c40/c41/c42 /c43/c44/c45/c46/c47/c48/c49/c4A/c4B/c4C/c4D/c4E/c4F/c50/c51/c52/c53/c54/c55 /c56/c57/c58/c59/c5A/c5B/c5C/c5D/c5E/c5F/c60/c61/c62/c63/c64/c65/c66/c67/c68 /c69/c6A/c6B/c6C/c6D/c6E/c6F/c70/c71/c72/c73/c74/c75/c76/c77/c78/c79/c7A/c7B /c7C/c7D/c7E/c7F/c80/c81/c82/c83/c84/c85/c86/c87/c88/c89/c8A/c8B/c8C/c8D/c8E /c8F/c90/c91/c92/c93/c94/c95/c96/c97/c98/c99/c9A/c9B/c9C/c9D/c9E/c9F/cA0/cA1 /cA2/cA3/cA4/cA5/cA6/cA7/cA8/cA9/cAA/cAB/cAC/cAD/cAE/cAF/cB0/cB1/cB2/cB3/cB4 /cB5/cB6/cB7/cB8/cB9/cBA/cBB/cBC/cBD/cBE/cBF/cC0/cC1/cC2/cC3/cC4/cC5/cC6/cC7 /cC8/cC9/cCA/cCB/cCC/cCD/cCE/cCF/cD0/cD1/cD2/cD3/cD4/cD5/cD6/cD7/cD8/cD9/cDA /cDB/cDC/cDD/cDE/cDF/cE0/cE1/cE2/cE3/cE4/cE5/cE6/cE7/cE8/cE9/cEA/cEB/cEC/cED /cEE/cEF/cF0/cF1/cF2/cF3/cF4/cF5/cF6/cF7/cF8/cF9/cFA/cFB/cFC/cFD/cFE/cFF]def /ct_CID_STR_SIZE 8000 def/ct_mkocfStr100 100 string def/ct_defaultFontMtx[.001 0 0 .001 0 0]def/ct_1000Mtx[1000 0 0 1000 0 0]def/ct_raise{exch cvx exch errordict exch get exec stop}bind def/ct_reraise{cvx $error/errorname get (Error: )print dup( )cvs print errordict exch get exec stop }bind def/ct_cvnsi{1 index add 1 sub 1 exch 0 4 1 roll{2 index exch get exch 8 bitshift add}for exch pop}bind def/ct_GetInterval{Adobe_CoolType_Utility /ct_BuildCharDict get begin/dst_index 0 def dup dst_string length gt{dup string/dst_string exch def}if 1 index ct_CID_STR_SIZE idiv/arrayIndex exch def 2 index arrayIndex get 2 index arrayIndex ct_CID_STR_SIZE mul sub{dup 3 index add 2 index length le{2 index getinterval dst_string dst_index 2 index putinterval length dst_index add/dst_index exch def exit}{1 index length 1 index sub dup 4 1 roll getinterval dst_string dst_index 2 index putinterval pop dup dst_index add/dst_index exch def sub/arrayIndex arrayIndex 1 add def 2 index dup length arrayIndex gt{arrayIndex get}{pop exit}ifelse 0}ifelse}loop pop pop pop dst_string 0 dst_index getinterval end}bind def ct_Level2?{ /ct_resourcestatus currentglobal mark true setglobal{/unknowninstancename /Category resourcestatus}stopped{cleartomark setglobal true}{cleartomark currentglobal not exch setglobal}ifelse{{mark 3 1 roll/Category findresource begin ct_Vars/vm currentglobal put({ResourceStatus} stopped)0()/SubFileDecode filter cvx exec{cleartomark false}{{3 2 roll pop true}{cleartomark false} ifelse}ifelse ct_Vars/vm get setglobal end}}{{resourcestatus}}ifelse bind def /CIDFont/Category ct_resourcestatus{pop pop}{currentglobal true setglobal /Generic/Category findresource dup length dict copy dup/InstanceType/dicttype put/CIDFont exch/Category defineresource pop setglobal}ifelse ct_UseNativeCapability?{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering(Identity) def/Supplement 0 def end def/CMapName/Identity-H def/CMapVersion 1 def /CMapType 1 def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end}if}{/ct_Category 2 dict begin/CIDFont 10 dict def /ProcSet 2 dict def currentdict end def/defineresource{ct_Category 1 index 2 copy known{get dup dup maxlength exch length eq{dup length 10 add dict copy ct_Category 2 index 2 index put}if 3 index 3 index put pop exch pop}{pop pop /defineresource/undefined ct_raise}ifelse}bind def/findresource{ct_Category 1 index 2 copy known{get 2 index 2 copy known{get 3 1 roll pop pop}{pop pop /findresource/undefinedresource ct_raise}ifelse}{pop pop/findresource /undefined ct_raise}ifelse}bind def/resourcestatus{ct_Category 1 index 2 copy known{get 2 index known exch pop exch pop{0 -1 true}{false}ifelse}{pop pop /findresource/undefined ct_raise}ifelse}bind def/ct_resourcestatus /resourcestatus load def}ifelse/ct_CIDInit 2 dict begin/ct_cidfont_stream_init {{dup(Binary)eq{pop null currentfile ct_Level2?{{cid_BYTE_COUNT() /SubFileDecode filter}stopped{pop pop pop}if}if/readstring load exit}if dup (Hex)eq{pop currentfile ct_Level2?{{null exch/ASCIIHexDecode filter/readstring }stopped{pop exch pop(>)exch/readhexstring}if}{(>)exch/readhexstring}ifelse load exit}if/StartData/typecheck ct_raise}loop cid_BYTE_COUNT ct_CID_STR_SIZE le{2 copy cid_BYTE_COUNT string exch exec pop 1 array dup 3 -1 roll 0 exch put }{cid_BYTE_COUNT ct_CID_STR_SIZE div ceiling cvi dup array exch 2 sub 0 exch 1 exch{2 copy 5 index ct_CID_STR_SIZE string 6 index exec pop put pop}for 2 index cid_BYTE_COUNT ct_CID_STR_SIZE mod string 3 index exec pop 1 index exch 1 index length 1 sub exch put}ifelse cid_CIDFONT exch/GlyphData exch put 2 index null eq{pop pop pop}{pop/readstring load 1 string exch{3 copy exec pop dup length 0 eq{pop pop pop pop pop true exit}if 4 index eq{pop pop pop pop false exit}if}loop pop}ifelse}bind def/StartData{mark{currentdict dup/FDArray get 0 get/FontMatrix get 0 get .001 eq{dup/CDevProc known not{/CDevProc 1183615869 internaldict/stdCDevProc 2 copy known{get}{pop pop{pop pop pop pop pop 0 -1000 7 index 2 div 880}}ifelse def}if}{/CDevProc{pop pop pop pop pop 0 1 cid_temp/cid_CIDFONT get/FDArray get 0 get/FontMatrix get 0 get div 7 index 2 div 1 index .88 mul}def}ifelse/cid_temp 15 dict def cid_temp begin /cid_CIDFONT exch def 3 copy pop dup/cid_BYTE_COUNT exch def 0 gt{ ct_cidfont_stream_init FDArray{/Private get dup/SubrMapOffset known{begin /Subrs SubrCount array def Subrs SubrMapOffset SubrCount SDBytes ct_Level2?{ currentdict dup/SubrMapOffset undef dup/SubrCount undef/SDBytes undef}if end /cid_SD_BYTES exch def/cid_SUBR_COUNT exch def/cid_SUBR_MAP_OFFSET exch def /cid_SUBRS exch def cid_SUBR_COUNT 0 gt{GlyphData cid_SUBR_MAP_OFFSET cid_SD_BYTES ct_GetInterval 0 cid_SD_BYTES ct_cvnsi 0 1 cid_SUBR_COUNT 1 sub{ exch 1 index 1 add cid_SD_BYTES mul cid_SUBR_MAP_OFFSET add GlyphData exch cid_SD_BYTES ct_GetInterval 0 cid_SD_BYTES ct_cvnsi cid_SUBRS 4 2 roll GlyphData exch 4 index 1 index sub ct_GetInterval dup length string copy put} for pop}if}{pop}ifelse}forall}if cleartomark pop pop end CIDFontName currentdict/CIDFont defineresource pop end end}stopped{cleartomark/StartData ct_reraise}if}bind def currentdict end def/ct_saveCIDInit{/CIDInit/ProcSet ct_resourcestatus{true}{/CIDInitC/ProcSet ct_resourcestatus}ifelse{pop pop /CIDInit/ProcSet findresource ct_UseNativeCapability?{pop null}{/CIDInit ct_CIDInit/ProcSet defineresource pop}ifelse}{/CIDInit ct_CIDInit/ProcSet defineresource pop null}ifelse ct_Vars exch/ct_oldCIDInit exch put}bind def /ct_restoreCIDInit{ct_Vars/ct_oldCIDInit get dup null ne{/CIDInit exch/ProcSet defineresource pop}{pop}ifelse}bind def/ct_BuildCharSetUp{1 index begin CIDFont begin Adobe_CoolType_Utility/ct_BuildCharDict get begin/ct_dfCharCode exch def/ct_dfDict exch def CIDFirstByte ct_dfCharCode add dup CIDCount ge{pop 0}if/cid exch def{GlyphDirectory cid 2 copy known{get}{pop pop nullstring} ifelse dup length FDBytes sub 0 gt{dup FDBytes 0 ne{0 FDBytes ct_cvnsi}{pop 0} ifelse/fdIndex exch def dup length FDBytes sub FDBytes exch getinterval /charstring exch def exit}{pop cid 0 eq{/charstring nullstring def exit}if/cid 0 def}ifelse}loop}def/ct_SetCacheDevice{0 0 moveto dup stringwidth 3 -1 roll true charpath pathbbox 0 -1000 7 index 2 div 880 setcachedevice2 0 0 moveto} def/ct_CloneSetCacheProc{1 eq{stringwidth pop -2 div -880 0 -1000 setcharwidth moveto}{usewidths?{currentfont/Widths get cid 2 copy known{get exch pop aload pop}{pop pop stringwidth}ifelse}{stringwidth}ifelse setcharwidth 0 0 moveto} ifelse}def/ct_Type3ShowCharString{ct_FDDict fdIndex 2 copy known{get}{ currentglobal 3 1 roll 1 index gcheck setglobal ct_Type1FontTemplate dup maxlength dict copy begin FDArray fdIndex get dup/FontMatrix 2 copy known{get} {pop pop ct_defaultFontMtx}ifelse/FontMatrix exch dup length array copy def /Private get/Private exch def/Widths rootfont/Widths get def/CharStrings 1 dict dup/.notdef<d841272cf18f54fc13>dup length string copy put def currentdict end/ct_Type1Font exch definefont dup 5 1 roll put setglobal}ifelse dup /CharStrings get 1 index/Encoding get ct_dfCharCode get charstring put rootfont/WMode 2 copy known{get}{pop pop 0}ifelse exch 1000 scalefont setfont ct_str1 0 ct_dfCharCode put ct_str1 exch ct_dfSetCacheProc ct_SyntheticBold{ currentpoint ct_str1 show newpath moveto ct_str1 true charpath ct_StrokeWidth setlinewidth stroke}{ct_str1 show}ifelse}def/ct_Type4ShowCharString{ct_dfDict ct_dfCharCode charstring FDArray fdIndex get dup/FontMatrix get dup ct_defaultFontMtx ct_matrixeq not{ct_1000Mtx matrix concatmatrix concat}{pop} ifelse/Private get Adobe_CoolType_Utility/ct_Level2? get not{ct_dfDict/Private 3 -1 roll{put}1183615869 internaldict/superexec get exec}if 1183615869 internaldict Adobe_CoolType_Utility/ct_Level2? get{1 index}{3 index/Private get mark 6 1 roll}ifelse dup/RunInt known{/RunInt get}{pop/CCRun}ifelse get exec Adobe_CoolType_Utility/ct_Level2? get not{cleartomark}if}bind def /ct_BuildCharIncremental{{Adobe_CoolType_Utility/ct_MakeOCF get begin ct_BuildCharSetUp ct_ShowCharString}stopped{stop}if end end end end}bind def /BaseFontNameStr(BF00)def/ct_Type1FontTemplate 14 dict begin/FontType 1 def /FontMatrix[.001 0 0 .001 0 0]def/FontBBox[-250 -250 1250 1250]def/Encoding ct_cHexEncoding def/PaintType 0 def currentdict end def/BaseFontTemplate 11 dict begin/FontMatrix[.001 0 0 .001 0 0]def/FontBBox[-250 -250 1250 1250]def /Encoding ct_cHexEncoding def/BuildChar/ct_BuildCharIncremental load def ct_Clone?{/FontType 3 def/ct_ShowCharString/ct_Type3ShowCharString load def /ct_dfSetCacheProc/ct_CloneSetCacheProc load def/ct_SyntheticBold false def /ct_StrokeWidth 1 def}{/FontType 4 def/Private 1 dict dup/lenIV 4 put def /CharStrings 1 dict dup/.notdef<d841272cf18f54fc13>put def/PaintType 0 def /ct_ShowCharString/ct_Type4ShowCharString load def}ifelse/ct_str1 1 string def currentdict end def/BaseFontDictSize BaseFontTemplate length 5 add def /ct_matrixeq{true 0 1 5{dup 4 index exch get exch 3 index exch get eq and dup not{exit}if}for exch pop exch pop}bind def/ct_makeocf{15 dict begin exch/WMode exch def exch/FontName exch def/FontType 0 def/FMapType 2 def/FontMatrix matrix def/bfCount 1 index/CIDCount get 256 idiv 1 add dup 256 gt{pop 256}if def/Encoding 256 array 0 1 bfCount 1 sub{2 copy dup put pop}for bfCount 1 255{ 2 copy bfCount put pop}for def/FDepVector bfCount dup 256 lt{1 add}if array def BaseFontTemplate BaseFontDictSize dict copy begin/CIDFont exch def CIDFont /FontBBox known{CIDFont/FontBBox get/FontBBox exch def}if CIDFont/CDevProc known{CIDFont/CDevProc get/CDevProc exch def}if currentdict end BaseFontNameStr 3(0)putinterval 0 1 bfCount dup 256 eq{1 sub}if{FDepVector exch 2 index BaseFontDictSize dict copy begin dup/CIDFirstByte exch 256 mul def FontType 3 eq{/ct_FDDict 2 dict def}if currentdict end 1 index 16 BaseFontNameStr 2 2 getinterval cvrs pop BaseFontNameStr exch definefont put} for ct_Clone?{/Widths 1 index/CIDFont get/GlyphDirectory get length dict def} if FontName currentdict end definefont ct_Clone?{gsave dup 1000 scalefont setfont ct_BuildCharDict begin/usewidths? false def currentfont/Widths get begin exch/CIDFont get/GlyphDirectory get{pop dup charcode exch 1 index 0 2 index 256 idiv put 1 index exch 1 exch 256 mod put stringwidth 2 array astore def}forall end/usewidths? true def end grestore}{exch pop}ifelse}bind def /ct_ComposeFont{ct_UseNativeCapability?{2 index/CMap ct_resourcestatus{pop pop exch pop}{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CMapName 3 index def/CMapVersion 1 def/CMapType 1 def exch/WMode exch def/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering CMapName ct_mkocfStr100 cvs (Adobe-)search{pop pop(-)search{dup length string copy exch pop exch pop}{pop (Identity)}ifelse}{pop(Identity)}ifelse def/Supplement 0 def end def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end} ifelse composefont}{3 2 roll pop 0 get/CIDFont findresource ct_makeocf}ifelse} bind def/ct_MakeIdentity{ct_UseNativeCapability?{1 index/CMap ct_resourcestatus{pop pop}{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CMapName 2 index def/CMapVersion 1 def/CMapType 1 def/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering CMapName ct_mkocfStr100 cvs (Adobe-)search{pop pop(-)search{dup length string copy exch pop exch pop}{pop (Identity)}ifelse}{pop(Identity)}ifelse def/Supplement 0 def end def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end} ifelse composefont}{exch pop 0 get/CIDFont findresource ct_makeocf}ifelse}bind def currentdict readonly pop end end %%EndResource Adobe_CoolType_Core begin /$Oblique SetSubstituteStrategy end %%BeginResource: procset Adobe_AGM_Image 1.0 0 %%Version: 1.0 0 %%Copyright: Copyright (C) 2000-2000 Adobe Systems, Inc. All Rights Reserved. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Image 65 dict dup begin put /Adobe_AGM_Image_Id /Adobe_AGM_Image_1.0_0 def /nd{ null def }bind def /AGMIMG_&image nd /AGMIMG_&colorimage nd %%don't initialize AGMIMG_&customcolorimage, it wrecks havoc in a nested environment %%AGMIMG_ccimage_exists not {/AGMIMG_&customcolorimage nd} if /AGMIMG_&imagemask nd /AGMIMG_mbuf () def /AGMIMG_ybuf () def /AGMIMG_kbuf () def /AGMIMG_c 0 def /AGMIMG_m 0 def /AGMIMG_y 0 def /AGMIMG_k 0 def /AGMIMG_tmp nd /AGMIMG_imagestring0 nd /AGMIMG_imagestring1 nd /AGMIMG_imagestring2 nd /AGMIMG_imagestring3 nd /AGMIMG_imagestring4 nd /AGMIMG_imagestring5 nd /AGMIMG_cnt nd /AGMIMG_fsave nd /AGMIMG_colorAry nd /AGMIMG_override nd /AGMIMG_name nd /invert_image_samples nd /knockout_image_samples nd /img nd /sepimg nd /idximg nd /doc_setup { Adobe_AGM_Core begin Adobe_AGM_Image begin /AGMIMG_&image systemdict/image get def /AGMIMG_&imagemask systemdict/imagemask get def /colorimage where{ pop /AGMIMG_&colorimage /colorimage ldf }if end end }def /page_setup { Adobe_AGM_Image begin /AGMIMG_ccimage_exists {/customcolorimage where { pop /Adobe_AGM_OnHost_Seps where { pop false }{ /Adobe_AGM_InRip_Seps where { pop false }{ true }ifelse }ifelse }{ false }ifelse }bdf level2{ /invert_image_samples { Adobe_AGM_Image/AGMIMG_tmp Decode length ddf /Decode [ Decode 1 get Decode 0 get] def }def /knockout_image_samples { Operator/imagemask ne{ /Decode [1 1] def }if }def } }{ /invert_image_samples { {1 exch sub} currenttransfer addprocs settransfer }def /knockout_image_samples { { pop 1 } currenttransfer addprocs settransfer }def }ifelse /img /imageormask ldf /sepimg /sep_imageormask ldf /idximg /indexed_imageormask ldf currentdict{ dup xcheck 1 index type dup /arraytype eq exch /packedarraytype eq or and{ }if def }forall bind }def /page_trailer { end }def /doc_trailer { }def /imageormask_sys { begin save mark level2{ currentdict Operator /imagemask eq{ AGMIMG_&imagemask }{ }{ AGMIMG_&image }ifelse end }def /overprint_plate { currentoverprint{ 0 get dup /DeviceGray eq{ pop AGMCORE_black_plate not }{ /DeviceCMYK eq{ AGMCORE_is_cmyk_sep not }if }ifelse }{ false }ifelse }def /imageormask { begin SkipImageProc not{ save mark level2 AGMCORE_host_sep not and{ currentdict Operator /imagemask eq{ imagemask }{ AGMCORE_in_rip_sep currentoverprint and currentcolorspace 0 get /DeviceGray eq and{ [/Separation /Black /DeviceGray {}] setcolorspace /Decode [ Decode 1 get Decode 0 get ] def }if image }ifelse }{ Width Height Operator /imagemask eq{ Decode 0 get 1 eq Decode 1 get 0 eq and ImageMatrix /DataSource load AGMCORE_host_sep{ currentgray 1 ne{ currentdict imageormask_sys }{ Width Height Operator /imagemask eq{ Decode 0 get 1 eq Decode 1 get 0 eq and ImageMatrix /DataSource load AGMIMG_&imagemask }{ BitsPerComponent ImageMatrix /DataSource load AGMIMG_&image }ifelse }ifelse cleartomark restore currentoverprint not{ 1 AGMCORE_&setgray knockout_image_samples currentdict imageormask_sys }{ currentdict ignoreimagedata }ifelse }ifelse }{ }{ imagemask }ifelse BitsPerComponent ImageMatrix MultipleDataSources{ 0 1 NComponents 1 sub{ DataSource exch get }for }{ /DataSource load }ifelse Operator /colorimage eq{ AGMCORE_host_sep{ MultipleDataSources level2 or NComponents MultipleDataSources{ 4 {pop} repeat /DataSource [ DataSource 0 get /exec cvx cvx cvx cvx cvx }{ filter_cmyk 0 () /SubFileDecode filter def DataSource 1 get /exec DataSource 2 get /exec DataSource 3 get /exec /AGMCORE_get_ink_data ] cvx def /DataSource /DataSource load 4 eq and{ } }ifelse /Decode [ Decode 0 get Decode 1 get ] def /MultipleDataSources false def /NComponents 1 def /Operator /image def AGMCORE_is_cmyk_sep{ currentoverprint InksUsed currentdict }{ invert_image_samples 1 AGMCORE_&setgray currentdict }ifelse current_ink not and{ consumeimagedata imageormask_sys }{ ignoreimagedata } }{ A AGMIMG_&colorimage }{ }{ }ifelse currentdict MultipleDataSources NComponents }ifelse true NComponents colorimage }ifelse Operator /image eq{ AGMCORE_host_sep{ /DoImage true def HostSepColorImage{ invert_image_samples }{ AGMCORE_black_plate not{ /DoImage false def currentdict }if }ifelse 1 AGMCORE_&setgray DoImage {currentdict imageormask_sys} }{ image }ifelse }{ Operator/knockout eq{ pop pop pop pop pop currentoverprint InksUsed }{ currentcolorspace }if }ifelse knockout_unitsq ignoreimagedata if current_ink not and{ overprint_plate not{ }if end }if }ifelse }ifelse }ifelse }ifelse cleartomark restore }def /sep_imageormask { /sep_colorspace_dict AGMCORE_gget begin /MappedCSA CSA map_csa def begin SkipImageProc not{ save mark AGMCORE_avoid_L2_sep_space{ /Decode [ Decode 0 get 255 mul Decode 1 get 255 mul ] def }if AGMIMG_ccimage_exists MappedCSA 0 get /DeviceCMYK eq and currentdict/Components known and Name () ne and Name (All) ne and Operator /image eq and AGMCORE_producing_seps not and level2 not and { Width Height BitsPerComponent ImageMatrix [ /DataSource load /exec cvx { 0 1 2 index length 1 sub{ 1 index exch 2 copy get 255 xor put }for } /exec cvx ] cvx bind MappedCSA 0 get /DeviceCMYK eq{ Components aload pop }{ 0 0 0 Components aload pop 1 exch sub }ifelse Name findcmykcustomcolor customcolorimage }{ AGMCORE_producing_seps not{ level2{ AGMCORE_avoid_L2_sep_space not currentcolorspace 0 get /Separation ne and{ [/Separation Name MappedCSA sep_proc_name exch 0 get exch load ] setcolorspace_opt /sep_tint AGMCORE_gget setcolor }if currentdict imageormask }{ currentdict Operator /imagemask eq{ imageormask }{ sep_imageormask_lev1 }ifelse }ifelse }{ AGMCORE_host_sep{ Operator/knockout eq{ currentoverprint InksUsed current_ink not and{ }{ currentdict/ImageMatrix get concat knockout_unitsq }ifelse }{ currentgray 1 ne{ s AGMCORE_is_cmyk_sep Name (All) ne and{ level2{ [ /Separation Name [/DeviceGray] AGMCORE_get_ink_data { sep_colorspace_proc 1 exch sub } bind ] AGMCORE_&setcolorspace /sep_tint AGMCORE_gget AGMCORE_&setcolor }{ currentdict imageormask_sys currentdict Operator /imagemask eq{ imageormask_sys }{ sep_image_lev1_sep }ifelse }ifelse }{ Operator/imagemask ne{ invert_image_samples }if currentdict imageormask_sys }ifelse currentdict consumeimagedata currentoverprint not Name (All) eq or{ gsave knockout_unitsq grestore }if }ifelse }ifelse }{ }{ currentcolorspace 0 get /Separation ne{ [/Separation Name MappedCSA sep_proc_name exch 0 get exch load ] setcolorspace_opt /sep_tint AGMCORE_gget setcolor }if currentoverprint MappedCSA 0 get /DeviceCMYK eq and Name inRip_spot_has_ink not and Name (All) ne and { imageormask_l2_overprint }{ currentdict imageormask }ifelse }ifelse }ifelse }ifelse cleartomark restore }if end end }def /imageormask_l2_overprint { currentdict currentcmykcolor add add add 0 eq{ currentdict consumeimagedata }{ l level3{ currentcmykcolor /AGMIMG_k xdf /AGMIMG_y xdf /AGMIMG_m xdf /AGMIMG_c xdf Operator/imagemask eq{ [/DeviceN [ AGMIMG_c 0 ne {/Cyan} if AGMIMG_m 0 ne {/Magenta} if AGMIMG_y 0 ne {/Yellow} if AGMIMG_k 0 ne {/Black} if ] /DeviceCMYK {}] setcolorspace AGMIMG_c AGMIMG_m AGMIMG_y AGMIMG_k s setcolor 0 0 0 0 ne ne ne ne {AGMIMG_c} {AGMIMG_m} {AGMIMG_y} {AGMIMG_k} if if if if mul Decode 1 get 255 mul ] def } }{ /Decode [ Decode 0 get 255 [ [/Indexed [ /DeviceN [ AGMIMG_c AGMIMG_m AGMIMG_y AGMIMG_k ] /DeviceCMYK { AGMIMG_k AGMIMG_y AGMIMG_m A AGMIMG_c } ] 255 { 0 0 0 0 0 0 0 0 ne ne ne ne eq eq eq eq {/Cyan} if {/Magenta} if {/Yellow} if {/Black} if {0} if {0 exch} if {0 3 1 roll} if {0 4 1 roll} if 2 255 div mark exch dup d dup dup AGMIMG_k 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 1 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse { AGMIMG_y 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 2 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_m 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 3 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_c 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec pop pop pop s counttomark 1 roll }{ pop }ifelse counttomark 1 add -1 roll pop } ] setcolorspace }ifelse } imageormask_sys }{ write_image_file{ currentcmykcolor 0 ne{ [/Separation /Black /DeviceGray {}] setcolorspace gsave /Black [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 1 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Yellow /DeviceGray {}] setcolorspace gsave /Yellow [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 2 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Magenta /DeviceGray {}] setcolorspace gsave /Magenta [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 3 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Cyan /DeviceGray {}] setcolorspace gsave /Cyan [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore } if close_image_file }{ imageormask }ifelse }ifelse }ifelse } def /indexed_imageormask { begin s save mark currentdict AGMCORE_host_sep{ Operator/knockout eq{ /indexed_colorspace_dict AGMCORE_gget /CSA get map_csa overprint_plate not{ knockout_unitsq }if }{ AGMCORE_is_cmyk_sep{ Operator /imagemask eq{ imageormask_sys }{ level2{ indexed_image_lev2_sep }{ indexed_image_lev1_sep }ifelse }ifelse }{ currentoverprint not{ knockout_image_samples imageormask_sys }{ currentdict consumeimagedata }ifelse }ifelse }ifelse }{ level2{ imageormask }{ Operator /imagemask eq{ imageormask indexed_imageormask_lev1 }ifelse }ifelse }ifelse cleartomark restore end }def /indexed_image_lev2_sep { /indexed_colorspace_dict AGMCORE_gget begin b begin currentcolorspace dup 1 /DeviceGray put dup 3 [ currentcolorspace 3 get { exch 4 mul 4 getinterval {} forall AGMCORE_get_ink_data 255 div 1 exch sub } /exec cvx ] cvx put s setcolorspace currentdict Operator /imagemask eq{ AGMIMG_&imagemask }{ AGMIMG_&image } }ifelse end end }def /OPIimage { dup type /dicttype ne{ 10 dict begin /DataSource xdf /ImageMatrix xdf /BitsPerComponent xdf /Height xdf /Width xdf /ImageType 1 def /Decode [0 1 def] currentdict end }if dup begin /NComponents 1 cdndf /MultipleDataSources false cdndf /SkipImageProc {false} cdndf /HostSepColorImage false cdndf /Decode [ 0 currentcolorspace 0 get /Indexed eq{ 2 BitsPerComponent exp 1 sub }{ 1 }ifelse }{ ] cdndf /Operator /image cdndf end /sep_colorspace_dict AGMCORE_gget null eq{ imageormask }{ gsave dup begin invert_image_samples end sep_imageormask grestore }ifelse }def /spot_alias { /mapto_sep_imageormask { dup type /dicttype ne{ 12 dict begin /ImageType 1 def /DataSource xdf /ImageMatrix xdf /BitsPerComponent xdf /Height xdf /Width xdf /MultipleDataSources false def }{ begin }ifelse /Decode [/customcolor_tint AGMCORE_gget 0] def /Operator /image def /HostSepColorImage false def /InksUsed [] def /SkipImageProc {false} def currentdict end sep_imageormask }bdf /customcolorimage { Adobe_AGM_Image/AGMIMG_colorAry xddf /customcolor_tint AGMCORE_gget bdict /Name AGMIMG_colorAry 4 get /CSA [ /DeviceCMYK ] /TintMethod /Subtractive /TintProc null /MappedCSA null /NComponents 4 /Components [ AGMIMG_colorAry aload pop pop ] edict setsepcolorspace mapto_sep_imageormask }ndf Adobe_AGM_Image/AGMIMG_&customcolorimage /customcolorimage load put /customcolorimage { Adobe_AGM_Image/AGMIMG_override false put dup 4 get map_alias{ /customcolor_tint AGMCORE_gget exch setsepcolorspace pop mapto_sep_imageormask }{ AGMIMG_&customcolorimage } }ifelse }bdf }def level2 not{ /colorbuf { 0 1 2 index length 1 sub{ dup 2 index exch get 255 exch sub 2 index 3 1 roll put }for }def /tint_image_to_color { begin Width Height BitsPerComponent ImageMatrix /DataSource load end Adobe_AGM_Image begin /AGMIMG_mbuf 0 string def /AGMIMG_ybuf 0 string def /AGMIMG_kbuf 0 string def { colorbuf dup length AGMIMG_mbuf length ne { dup length dup dup /AGMIMG_mbuf exch string def /AGMIMG_ybuf exch string def /AGMIMG_kbuf exch string def } if dup AGMIMG_mbuf copy AGMIMG_ybuf copy AGMIMG_kbuf copy pop } addprocs { {AGMIMG_mbuf}{AGMIMG_ybuf}{AGMIMG_kbuf} true 4 colorimage end } def /sep_imageormask_lev1 { begin MappedCSA 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or h has_color not and{ { 255 mul round cvi GrayLookup exch get } currenttransfer addprocs settransfer currentdict imageormask }{ /sep_colorspace_dict AGMCORE_gget/Components known{ MappedCSA 0 get /DeviceCMYK eq{ Components aload pop }{ 0 0 0 Components aload pop 1 exch sub }ifelse Adobe_AGM_Image/AGMIMG_k Adobe_AGM_Image/AGMIMG_y Adobe_AGM_Image/AGMIMG_m A Adobe_AGM_Image/AGMIMG_c and{ addprocs settransfer } }{ xddf xddf xddf xddf AGMIMG_y 0.0 eq AGMIMG_m 0.0 eq and AGMIMG_c 0.0 eq {AGMIMG_k mul 1 exch sub} currenttransfer currentdict imageormask currentcolortransfer {AGMIMG_k mul 1 exch sub} exch addprocs 4 1 {AGMIMG_y mul 1 exch sub} exch addprocs 4 1 {AGMIMG_m mul 1 exch sub} exch addprocs 4 1 {AGMIMG_c mul 1 exch sub} exch addprocs 4 1 setcolortransfer currentdict tint_image_to_color }ifelse roll roll roll roll } }{ MappedCSA 0 get /DeviceGray eq { {255 mul round cvi ColorLookup exch get 0 currenttransfer addprocs settransfer currentdict imageormask }{ MappedCSA 0 get /DeviceCMYK eq { currentcolortransfer {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll setcolortransfer currentdict tint_image_to_color }{ currentcolortransfer {pop 1} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll setcolortransfer currentdict tint_image_to_color }ifelse }ifelse }ifelse }ifelse } get} get 3 get 2 get 1 get 0 get 2 get 1 get 0 end }def /sep_image_lev1_sep { begin /sep_colorspace_dict AGMCORE_gget/Components known{ C Components aload pop Adobe_AGM_Image/AGMIMG_k Adobe_AGM_Image/AGMIMG_y Adobe_AGM_Image/AGMIMG_m A Adobe_AGM_Image/AGMIMG_c {AGMIMG_c {AGMIMG_m {AGMIMG_y {AGMIMG_k mul mul mul mul mul mul mul mul round round round round 1 1 1 1 exch exch exch exch cvi cvi cvi cvi sub} sub} sub} sub} exch exch exch exch get get get get 0 1 2 3 get get get get 1 1 1 1 exch exch exch exch sub} sub} sub} sub} xddf xddf xddf xddf }{ {255 {255 {255 {255 }ifelse } ColorLookup ColorLookup ColorLookup ColorLookup A AGMCORE_get_ink_data currenttransfer addprocs settransfer c currentdict imageormask_sys end }def /indexed_imageormask_lev1 { /indexed_colorspace_dict AGMCORE_gget begin begin currentdict MappedCSA 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or has_color not and{ h {HiVal mul round cvi GrayLookup exch get HiVal div} currenttransfer addprocs settransfer imageormask } }{ MappedCSA 0 get /DeviceGray eq { {HiVal mul round cvi Lookup exch addprocs settransfer imageormask }{ MappedCSA 0 get /DeviceCMYK eq { currentcolortransfer {4 mul HiVal mul round cvi exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi exch sub} exch addprocs 4 1 roll setcolortransfer get HiVal div} currenttransfer get HiVal div 1 get HiVal div 1 get HiVal div 1 get HiVal div 1 3 add Lookup exch 2 add Lookup exch 1 add Lookup exch Lookup exch }{ tint_image_to_color currentcolortransfer {pop 1} exch addprocs 4 1 roll {3 mul HiVal mul round cvi 2 add Lookup exch get HiVal div} exch addprocs 4 1 roll {3 mul HiVal mul round cvi 1 add Lookup exch get HiVal div} exch addprocs 4 1 roll {3 mul HiVal mul round cvi Lookup exch get HiVal div} exch addprocs 4 1 roll setcolortransfer tint_image_to_color }ifelse }ifelse }ifelse end end }def /indexed_image_lev1_sep { /indexed_colorspace_dict AGMCORE_gget begin begin {4 mul HiVal mul round cvi Lookup exch get HiVal div 1 exch sub} {4 mul HiVal mul round cvi 1 add Lookup exch get HiVal div 1 exch sub} {4 mul HiVal mul round cvi 2 add Lookup exch get HiVal div 1 exch sub} {4 mul HiVal mul round cvi 3 add Lookup exch get HiVal div 1 exch s sub} A AGMCORE_get_ink_data currenttransfer addprocs settransfer c currentdict imageormask_sys }def end end }if end systemdict /setpacking known { setpacking } if %%EndResource %ADOBeginClientInjection: DocumentProlog End "AI10" %ADOEndClientInjection: DocumentProlog End "AI10" currentdict Adobe_AGM_Utils eq {end} if %%EndProlog %%BeginSetup %ADOBeginClientInjection: DocumentSetup Start "AI10" %ADOEndClientInjection: DocumentSetup Start "AI10" Adobe_AGM_Utils begin 2 2010 true Adobe_AGM_Core/doc_setup get exec Adobe_CoolType_Core/doc_setup get exec Adobe_AGM_Image/doc_setup get exec %ADOBeginClientInjection: DocumentSetup End "AI10" %ADOEndClientInjection: DocumentSetup End "AI10" currentdict Adobe_AGM_Utils eq {end} if %%EndSetup %%Page: lec9_fig2.jpg 1 %%EndPageComments %%BeginPageSetup %ADOBeginClientInjection: PageSetup Start "AI10" %ADOEndClientInjection: PageSetup Start "AI10" Adobe_AGM_Utils begin Adobe_AGM_Core/page_setup get exec Adobe_CoolType_Core/page_setup get exec Adobe_AGM_Image/page_setup get exec %ADOBeginClientInjection: PageSetup End "AI10" %ADOEndClientInjection: PageSetup End "AI10" %%EndPageSetup Adobe_AGM_Core/AGMCORE_save save ddf 1 -1 scale 0 -178 translate [1 0 0 1 0 0 ] concat mark /0 [/DeviceGray] add_csa /CSA /0 /1 [/DeviceCMYK] add_csa /CSA /1 /2 [/DeviceRGB] add_csa /CSA /2 cleartomark 800 path_rez % page clip gsave newpath gsave % PSGState 0 0 mo 0 178 li 238 178 li 238 0 li clp [1 0 0 1 0 0 ] concat %ADOBeginClientInjection: BeginPageContent "AI10" %ADOEndClientInjection: BeginPageContent "AI10" .999 177.003 mo .999 .999 li 236.997 .999 li 236.997 177.003 li .999 177.003 li 16.497 161.793 mo 216.288 161.793 li 216.288 13.5 li 16.497 13.5 li 16.497 161.793 li false sop 1 1 1 rgb f 16.497 161.793 mo 16.497 13.5 li 216.288 13.5 li 216.288 161.793 li 16.497 161.793 li save_ctm gsave % PSGState clp gsave [1 0 0 -1 0 178 ] concat << /CSA /2 >> csacrd [201.219 0 0 149.722 15.7351 15.404 ] concat << /Width 422 /Height 314 /BitsPerComponent 8 /Decode [0 1 0 1 0 1 ] /ImageMatrix [422 0 0 -314 0 314 ] Adobe_AGM_Image/AGMIMG_imagestring0 422 string ddf Adobe_AGM_Image/AGMIMG_imagestring1 422 string ddf Adobe_AGM_Image/AGMIMG_imagestring2 422 string ddf Adobe_AGM_Image/AGMIMG_filter Adobe_AGM_Utils/rdcmntline get /ASCII85Decode filter /RunLengthDecode filter ddf /DataSource [ {AGMIMG_filter AGMIMG_imagestring0 readstring pop} {AGMIMG_filter AGMIMG_imagestring1 readstring pop} {AGMIMG_filter AGMIMG_imagestring2 readstring pop} ] /ImageType 1 /NComponents 3 /Operator /colorimage /MultipleDataSources true /HostSepColorImage false /InksUsed [ ] /SkipImageProc {false} >> %%BeginDataCountAtEnd: NoCount % 1 img %K)^H&K)^H&K)^H&K)^H&K)^Q)!r2Qe.Js&?q"F@Ro^qnTrVQB[n+->Pp%.nNq"ad`q=s^Zp@\.Sq"=1M %p%J+XpF#e5qYBmXnaH,Cp\FUYo^hnMmI'WAq"=CUq"ad`qtg'_qt]pWp%\@U"8DN_qYpL4r;Z]ip%7tQ %qYL$_p\"1Mo(2M?q#'g^q"Y6mqtp6cq"O[^p\j\;o_eXaqYL$_q![qSr:fmYqtpBlrV#mYrV69gqtKdX %q=s[Vp\Ogbq>C0fqY9gYp%eCgp%\F\p\4L]q=tQrqu$?eq"jpZo(2PJq"aabr<rMup@IkMq>:*fqtg*` %"8r&mq>L'uqY0[Vq>0jXq"XUXq"ag^qYpHnr;QTmqA/o&q"XUVq"jg[o_81YqYL$`q"OO[rVlg-rV?3d %rr<#tr;$*aqu$Bjrr*0"qY9gZq"jmeq?Qilq"XUWp\=^`&,H/$qtp6cq"Xgcr;6?dp]1*br=AVqp\=U^ %r;?B`pAFmcqu6<c/H>bIqu$HnrqlNcq"OOZrr;upo^_\RrqQ0]q>1$frVZQhqt^!^qtp0\q"XjarqcTk %,Pq0,o(VqUr;6?bpAFXRnb;qXq"jjar;HWorVHHkr:p!\qtTn7p%J4\s8MopqtTgUp%S:[r;6?cp\+:R %p[A"Zp\t'frVc`or;-6grVHKd&bl>)rr)fnqtos[s8VriqYpKnru:e.qu?Qms8MliqY^6dq"jshrqufr %rquZiq=sd`#Pe2prVHBgs8)X)r;6HmrquZls7Q'Yq"agbr;Q^(rquTco_\Rcs8W)sq"tp,rr)`kqYL*e %qY9marVH9cqtg0dr;QKir;ZfrrV[N0qtp6dq"jsdq"OU^rr)fnqtp6dqu-No%/p"rrVlisrquTdrr2lr %#ljr'r;6?equ$Hls8;ln"8_iiqu-Hnr;Q]srr)iorr3-#rVZTjq>V!$q>1$frr<#sq"asirVlimrr2lr %s8W)srs&K"q>:!`r;Q^(rV#mYs8Vrjqu$Elrr3?(r;HNhqu6QjpA4dcrqmc7rr<#tr;$'Yq>1$grquWf %rqQ'Uq>U?hr;?NmrVm-#s8W)qq>1'bq?$KgrVQU1qtTp\qu-QorVZNfq"OU[nbrLas8DrqrrrE#r;Zfp %rqQNhr;R*&rr)Kds8W#nr;?Qtqt^3jrVlftr;$Tps8Dlmr;Q]rrr)j!rVZQhq>LWqrVuorr;Q`lrW)or %rsSi)s8Vigq>1!err2lr"oeDop\k*hs7lTmrrE&sr=/f)qY^?mr;$<ir;?Nmm/R+b$N9r$qYgHnqtg6i %rr33%rr)cmqu-No$N9eprVlisrquTdp\t?or;?Nks8W)tr;ulorVccqrXJi)r;6Bfs8N#rr;6Bfq>V!# %q"agbrVlfop\=afr;HZkrVZ]qq>L'gq%<H!nF,i:p@n7Nn*]`AqtTs`r:^Nmq>'gZp%J1Up&=M*oCVbN %q"a^\q=s^Wo'uAFp\FXZp%/.Vo(2YSr;#sUo_&1V#P\&jq=aIRq"aUjrqlHaqY^9gq=s^_pAOabp'^Qd %q"X:Qr:BaWo^r.U"n_BUqY9g`oE+^^qYg4&q"XFSr;63[p\XOTq=jLPq#:*gq@35oq"ag_p\=U^q=ja^ %rqZQgq=t9hq>0s^p\=X]q%3>tqtp0_q>9jYp@n@XqYL$dq?crkpA"I[qu$?fp\=meqtr8Iq=jUZp\"7T %q=s[Zq=s^Zq>0m]q>1!cqYBp`qtg0bq=sa_qtg-`p\+=TqYU-ap\F^bqYg3jr;HWp#Q4Dls8W)rr:^!l %qYBp\p\=R_q?Qilq"XUXq"apc#5S&kqtg0brqQEfqtp<g&,,blq>1!dr;$'\r;HKhrq?3gs8)U)r;?0W %o(DhTq"=4Io_e^cqu6Tk0_tSBqu$?eq"agaq"47Pp@nCZqu$?hr;6?cp%8"RqY^9fq"Faap%A4^rquK` %p\=^_#Q"Asr;$*^qYg3fp_!K$p\4O^r;69`p@e1Pp@e@ZrV6irq"ssYr;QEfq"OO^p]^Bao_n[_rV$Bg %rVc`nrqd9"qYpHhp\Om^q>C*_pA=merr!9&qYU3ir;-<hrVZKirVZZlq>:Knqu-Kiq>:0equZ`nrXJi' %qY^?fq>'mar;HTlrVZosqYC$drVlfir&4NQs8Mrmq>L0bq"t!dq>C0fqYU3hqtp<irr2loqu6TnrVZTj %qu?Zor;6?dq>1'hrVQHhrr2lnquH]prs/Jtp](9mr;?Qkq>LEnqulonqYU3irVufpqZH]kqu$Hl!W;io %rWN2tr;6BjrUg("q>1!drVlisrV?<is8Drsq>UBls8W,urV[E/rr;Z`o_87\qY9aTpAY*jrVuipr!E?$ %rr)`jr;QZkrq?]nqYU3hrr)iq)#jI0p\+FZr;Q]nqY:*gp\=^es8Mfhq>1'e#Q4T$rqlNgrV?<ts8Mlk %rVuosqtp6fq>U<jq\/i)rUg*hq#:-cqYL*cq=jU_rqucks8)`prVdE-p\b'kqt^0ip\Xsfq"Xgfrr2p$ %rVZWns8E9$rVuosr;Zfrrr2llrWi?"s8W#prr;fn!<)os%/p,'s8)Wjr;HWps8Mus"TA8qrVl`pp\t*j %'E%b-r;-<hrr)`nrr)cnrr;rqrr)itrr)fqrr)orrVm$!r;6Bhrr3&ur;QWorVciqrVlg%r;$*es8Mro %rqlHi"9&/qrVZ]qrr2itr;HWorrE&sr<3&qqtg0fr:U"!q"ad`r;HWor:p*es8;iqq>L9l1B7.Ep\"4Q %q#(-ao_%tTqt^!Yo(2YQq"am_p@RtKpA+U\p\+@Vq"=7Jnac>Gq"ad\rqI3%p@\(Mp%S:Xq"F@Yq"+.Q %r;6<]rU^Ehp@e7Vq=s[VpA"A%s8VogpA"I[p@nCZqtg-`p%A%Pp\4IXrVZ3^q[N)ioD&.WqYBp[p%S4S %rq6<brV-9c'DD8!q=O:PqssFTp@IqOrV?6_q#:*qq>L3cq"aa[o`"Xcq>U6dq$-ThqYBmZp\=Ohp\F[] %p\+CYr;$?g&,#YkqYU0dqYBs`qtp6cq#1$eq)J-Er;Q]mq"=LYp%7tQq=sj`q=s^Zq=aOVq>0s`p\+FY %q"XUXp@eF]qt^$]p@e@[r;?Eequ$9gqYp@&r;HWprqlKbs8Mrmq>:-jrV?Ee!W)Wjp]1-gq?Hckq"XUY %q>U3lq=s^`q>U-lp\4IXq#pQkr;HTiq%*5oq"ad`r;?Bbq"t!cqu6<c9E5%hqtg*_q>:0kq"OR[rVl`k %p\"7WrVQNmqY9gYp\Facqtg-bqtp0]oCV_Mq>:*gqYL*dqYBp\pA"L^r;6<as82Naqu?ZnpAFXgq"ad` %r;-Qkq"a^]$NL,$p%J.Uq=aRXrqcTgs7uZj$2ac&o_nd]qY'gbqulomq"jgbq#C0gqYg:)q>C6hp\+F] %p%\CZp@eC`r;6?frr!0#s8Momr;?EcqYpBlr;Z`kr!*#qrVZNfqYg?ir!3&qrVZNfqu-Ei&cM\'q>:-h %rr)fnr;HWnrVZQgquQZlrr4hSqY:$cq"OU]r;6Klr;6?fr;$0br;HTlqYC'eqtp6dq>('irVZQhq>'sf %s8W&qrVufnrV[E/rqu`os8Mojp](6jqYC$es8;cpr;?EmrVZWk!;uips8;ln!rDflrr!'!qtg9ir;?Hh %!rW#rrr;fl&,Q2#r;HWps8Dfks8W)ts7uZnr@S'Lrr2imqYU9ls8)Qfr;Zfrr;$*^rVuiqs8;ciq"agd %s8Dlmr;QZkq"=@T"o8&orr;oqr?M7;qYBs`rVlfpqt^9jq"aphs8MfhqYL$aqu$Bks8Molqu-?g&HDe. %q>'pcrV?<frVlcnqtg<h(B"+/rVuoks8Vfjq#13ks8MuoqY^9grqZWlrVZTl&c;S-rqZ?ds7cBgqtU!c %s8Mrtr;HWp#lal(rVccrr;-Eks8N#tq>LTrrr;uqqu-<h#Q4T$s8;cms8DrqrrW&orVZZqrqucsrr)Zl %!;ucp,5qB<rVHBfrVlcqs8MuprVl]krVlisrr)`nrr)fnr;6Bkrr3*!r;6B]rt#&+rr;upq"Ogfr;-6d %rVufprr!'$rr2lprr2lrs8Muq!<2ut"9/8sr;QTmq?ZonqYU3hrr<#oq[`N!qYU3hrr2fjqYgElrVu]l %r;Qinq"Od]%f#ntp\=R]r;?Hgqtg*_rq?Efrpp6ao_/%Vp]:-^rq$Bep\=R\qYBk&oC_nSqYBmYq=X=L %p%S4Rp\=RZp@e:Yp\ssdp\FRps8Vujp@n@Wq>1!drVlisq=b0or:0X\nb;\P#5e>rqtg-`rq69a.JNW0 %p%A%Qp\=OZqYKsXoCi%Wr;?EcpA"R]p\":XrVQBfqY9j^qY9dSq#gEeq=sp_q=t]tq"jg[p%S:YqYBs^ %q"OOUpA"L`qu$<jq>^6cq%``%qu$Bhq=sd[p%7qOq>:*eq=s^YrV6?cs7lThs7lTfq=t9lqYU-cq>0se %q#^Eiqu6L/rVc`nqtTpbrVZQir;Q`hp%J+Rp\=O_q>^6hq>U3oq>'g\p\Fda!r2N`rV6?crqQZmqtp9k %r;$-rq"aa^qYU3gq=sd^rqc]opA,^-s82]iq=sd_r;QQir;Q`rrr)ioqtp6cqYU6b"o%ihqtg0gqZ6Qg %rq?Tkq>:*grV?:,pA"L^rVZNeqtTgVq"jg]qYU3fq>'peqYp?oqYC!aq>1U#rqcB_p@n=Wq>1$frr2`i %&-)\%r;H9ap\k*js8MuoqYp9hq'l1:p\=OZqYL*dr;HTjp@e=\rVuorq>'pfr;-3brr;ups8DfkrVcWg %nbi@_"8_iiqYL+(r;$6fr;$-ar;HTlr;6BfqY0g_r;Q]nrVufqqtU('rVlisrquZkqY9g[qY^<lrquZi %qYg<iqZ$HlqulooqYL$_r;HR4r;HTkr;?Nmrr<#rrVc`nqtTpbrVZQir;Q`qp]C9fqZ$Hlr;ZZnr;Z`q %r;QQoqY^<j!rMiiqYLHmr;?Nlrr2rnrVl]trVlfrs8Mp!rr;uts7uZnr<30#rVcZnqZZrus8;ipqZ$Qn %!rVuqrqHTkqYU3fr<`E!q>'m`r;HWp!<<&rs8Drp)#=%,s8W)rqu6Hdp\OgcqY^?lrVQKks8;lprquQi %$NL/)qYC!aqu$Elr;ZTj#QOhts8Vfjq>:0mrr)im"T/)or;HWk$iBl"rVc`qs8;Zequ$I#r;6Kns8;`k %s8NE*rVuorrVuorqsjXfrVlfprVZKj')VY-rqlTjrr<#trr)fnr;-<hq#CBns8D`lr;R$$rVuimq>1$f %rr`9!r;?NlrVZ]orr2rrrqu]nrr2`nrr2iq'`@q.rquZgp\t-hqtp<js8)Thqu$Hlq>UBns8N#r!<2rs %!r`&oqtg?gs82ios8Dusq>C6h"T85srr2oorqulss7uWkrs&5lq"aa\pBL<_o(2PJpAX_%qtp6bp\=RZ %n+-/Gq"F@Np\=R[q"OLTqtg0epDWi%q=F:SqYU-ap\=ISo_%tPp%S:Yp[n+Pqu-9gp]1'aq>U77qYBp\ %p\O^[p\=Xcs8)Tfq"OLTp&"RQq"jRXp[n.Pp@SU]oCDMFp&=[tq"XLRp%A%Qp\=U]q=aIQpA+^a*;T@' %q>:!^p%S@^qtU!]p@nF]qYC'dqYBp\p@e=X!;QNe!r2Naq=tZsq"jg[p%S:Wq"OOVp%7nNq"apc#5S&k %qYBs^rqH6a"8hrjp`'#(qu$3_p@\+QqY^9gq=s^Yq#('cp@InLq>C6h!;c]j%/BMhp\=U^r;HEcp\4[^ %$MX>jq>'maqu$?grqmH,qYC!crVlfpr;6$ToC_kRqYU'bq#L3hq??]jq"XUZrV?Tjp\+R[rV-Nnr;6Bf %rqZQjr;6Hhrqc`oq>L-kqu$?bqZ$Tpq?m,tqtg*^p%J1Vq>U-lrr2lnqYp@&o(DeSqt^!ZqYU3gqtg-` %qY^Elr;$Toqu$0_qu6O/qtg3cp\4IYq=sgarVH9_qYp?fq>1*f!;cZlrVQfpqYU-arq@u>q"OLWqu6Wo %rVZQhq=saar:0[_p&+[\q"aa\p\+:Rp\=R[qYL*`p\=OZrqZlurVZKcp\Fadr>bb3q>C6iqY9pds8Mon %qYC!ds8Diprr)clqYBs_quZ`kq>L-iq>'piq>:(#r;$-ar;6Bfq>'g[p\Odbrr!'!qu6QlqtpBhq>;<5 %rVZQir;Q`mqYBp]qY^?mrquZiqYU9kr;$'[q>C6k%fQA(r;6Bdq>1!drr<#qrqcWk$MsYsr;?Nmrr;lm %rqmK-qYC!crVlfpr;6-ZpA"L]rVcWkr;6]prVcZlrqc`mr;HQrqtg-bqYU9l"TJAur;?Bjrr)lrrr33# %rVlcos8Vlnrr!!"s8;fnrr*0#qYBm\qYU0hqYpL/rVZWnrUop]r;HQhp\b!is8DlmqYC0jr!3/urVlfk %qYgEn')hb,qt^'br;6?hrr;rmq>L?lrquco!;uZl%K6;*rVZQhqYg?gqYU9jrt#,-r;6?es8MWgs7cQk %qYL3g"o7rfq"adcr"8o+q>'m`qu$Bjs8W)qq>'sfrr39'r;?Qos8;`krr3&urqlfor;Q]rrr)j!rVZQi %q>LBmrVQ`qr;?Bi#Q+K"rqlTjrr2j$r;6?dq>C3jrr3#urVlg"rr)fnr;$=$s8W)srVlisr;?Hgqu$Em %%0$5'r;HZqrqlNequ6Km#6+W#qYU3hrVllr!r`&prqursrVc`ns8Vuqr"Ao'q>1$frr2loqtBdZqY^?m %s7uZns8W)tr;ciqrri;uqt^'bqZ$QprVufqqt^3ir;QWrrr2fnr;ZckrVcaPs7Z0]q>0p\oC;MJq>0m\ %p\==Qq"OR^rql3Vp\Oa[o'c>Kqtp0^p@nOar;6?dq=sd\rq?irq>0^Uq"jmbq=smbrV@-%q=F=RoBu&; %p\4CSpA"IZp\FV)pA+U_q=s^Zp\".JoCi(\r;?Eep\+:Pq"F(Ip]U0aq"OO^p]^Bao^h_Jr:g6arUq!# %p\FUZp\+=Tq!dhEoCVbPqt^$]q#:+$q=s[Vp\XmcqYg?hqY9gXp%eCgp@\(Nq"a^Zq=tWsq>0p]pA"LY %p\+=Ro^qbMq>U3tq=s^^qt^!\p@e7Zq>L+2qt]sXp%\F`o_%tRp\4L\qtg-`p\=R^r;-0[o_84[rql`l %rqR)sp%J1Wqu-Kgp@\.Sq"OI[q"smeqYg:-qY^?ms8Dijo(2MIq"jmcq"X[]qYBp]rqZipq=saZq"apc %!VuNip\sseq#^Nnqulonq=sa\r;$3pq>:*cq>C0dpA-9=s7uKer;HQhp@S+Ur;?HfqYTs]qtg3is8MT^ %qYgBgp%%tWrr)`iq>1*j#6+T!r;6Ehrq['#r;?9`qu-Nmr;6NnrV[3'r:]s^p@7\GqYL$_q#gNlqtg-d %"SVWfqt^3b)"mIio(MqYs8MupqYBp\qt][Tqt9pbqYL3g"o7rfp@n@[qYp9gq#L9jq[iW"q>1![o_%nO %q>C6iqtg3hr=Jl'q=sgbs8Muss8Mrnq=sa\r!3&mp\=X`qtg<ir;70&r;HQiq>:-eqYBp]p\4CYr;QX! %r;-9hrVZNjq>'q1rquTdq"k!ipA"L]qYL-hrr)clqYU3js8Dfgp\Ojgrr2rrrqm<$q"agcrr<#qq=sd^ %qtg*dqu-Hmq>^<iq[*,srr<#sqt]pY&bl+urVlioqu$Ekr;6BirVZTmqZ?Wkr;QWrr;6?hqu?TorVlg" %rr)clqt^9jrr)j%r;Zfpr;Zfqq>UBl(]XO4qu-NorqlKaqY^?mrVZTlq"t$frr2p.p%\Ibs8;W`r;Q`r %rVQKirr;ut%0$5)rVcZlrVlilqYgEn!WN&ort,2*qtp0\oCr1]qtg3hs8MrlrXSc%rr2imqYU-ap@S(S %rr)j,rquZiq>L6]qYp6hrqu]nr<<,qq=sd^r;?Tkrql]m&cVe.r;6BhrV#sZq"agds8Mrtr;HWp"TJAs %qY^0h"9&/pqYC*qqtg-brVlcnq>Lg#rr<#rqu-Qmr;6BfrqQTnrr2p)rr)cps8Mupqtp<erXSu-qtg0f %s8VolrVcZlrr2p#rr)cnrr2p"r;$0dqZ$Qo!;Q]mqu-Kn#Q=Ssqu-Kkqu6Qlrr;foqYg:"qY^?ms8Dij %p\=R]rVlg%rVlfrs8N#rrr<#trVZ`qrr3*"rVZKjqYp?tr;ZfrrVZQhqYC-grVld$qu6Tlqu6Tlq>L6k %rq??c,51^&q>C6kr;-<gme$;Kq>UBio_/(Uq"=4Hp\Ogbq"FFVrV?Ee&,Z4up\4IYqXaCTqu$?fq>U9m %qtg<f&+fMhoBko8q"XOSpA+R\p\FRpq>:'bp@\1Uq"OLUp\F^arqZZkq#:!nq"F"Ep@.nPqZ-Nmr!N>s %q"+.Oq"XUWp&+R^p'(3cq=saZrpU*^o_81Yq>U4(q"ORZqY9dZqYU-aqtg0bq"XUXq=t9fo()GJqtg*` %q$Himqtp0_q>9s^rqHEc!r)KcrqZrsq#($bp\+:RpA+Lbq"Od\&bl+unFZPQq=sa]q>'g[q"adcq>L0f %q>^6gp]($gq>L-oq"FIYqt]sbq#:$ep'(3cq>1$fr;Hfsr;6?hp^?onqYKs]q>0s`q"Oda#Pn2jq"OOX %q>U3jq>L'iq>0scqu-BdqYg?jqZloprV60cr:p!^s8W)o#5\2lq=sa_rVmf7rr;N_qYL-is8;Wequ$?d %p%%tWs8Mokq>:0hrVH]nrVZQlq?d)tpA"O`s8Muprr3#urVl^*pA+RXnF-#GqY9g\r;HQiq>2?1qYU*] %o_/+Tp\+:Rq"jperVZTjqYL$bq<dnOoDJIarr2p$rVZQdp\Fgb!VuNhqYU'gqYpBlqYp'ip%S=\rql]n %'DqY'r;HNgqYgElqYpHlr;6BfqYC$op\"4Rqu-KjqYU]uqYgElqtg6iqtpBhrqR*$qu$Ekr;6BkrquWf %q"aa]quQZirqI*%r;Q<^r;HQjqu-Hjqtg3frVcZorVQNmqu$<jqu?Tnr<W;rqYgEkq>:'fq?Zomp@n@X %qY^<irWN2tqtg0gqu?R'rVcTir;HTlqtg9ir;?Qk"8_lkr;QWpr;QQpr;?Nhrq?<drs/K%s8;fps82Wk %rr)lsrql]m"8hulrqcWtoD/@_rr2p'q>:-irVH9\r;Q]urVQKjrVlfp$iU,*rVZTlrr;cirVc`rrql^%rr2`jr:ojQp\k'fq>:0krquTj%fH;)r;$-ar;6?dq>1$grVm<*rVcZlrVQ'Zqt9sdqu7$&rV?<erVcZk %qYgBjr;-ZqrVlcor;Q?mp\Fads8N#t!WDp"rVliqr;HWp!<)os"TJE!r;?Bi#Pn/hq>L?nrV?EmrVlg! %rVZZprr)io"T/)orVlfr$3'o's8MrnqYU0crW2uqrq[6)rr;Zerr;urrr;usrVZWns8N#rrs&K%s8N#r %rVl`orVulqrs&H!r;Zfrr;QZnr!3,mp\=R\r;HQm"9&/pqYpHnrr2our;HTo!WDrqs8W)tr;uoqrr2p% %rr)]iqtp<frUp*brWrK"s8Vumrr2cirVZ["p@e1OoCV`'q>9gYqYKpXp%RqKqY9mbqXaOYq"OLSo'uJN %rVZHapA":Pp%A%XpB(9iq>U*uq"aOSq"t!eqYBp]q=s^`oa^`mqtBOJp&+UXo_&%Wq=s[krVcWfo()MN %r;HWms8Mflq$m2rp?M8Bme6;Gp@n=T1A1;2o_%qQq"OIRq>'g\p\+=Ro_%tSqYL!\q=s[Wp\=R\q"t$e %p\":VrVH<aqYKsZrqQKgs8)Qe#4qBSoD&4[q"Y0iqu$?eq"jpaq$Zlhq"jmbqYL0fq=ag\!;?6a"8)6Y %pAO_<mdp;QqtTs^q"XUXq"ag[p%\IarquQap\4CTp%@tLqtp6cq"XUXrVH<br;HNlp^?iip@\+Np%A%R %qYgBm(&e%*qYU3hr;?Hgq=s^Yq"jmbqY9gaq?Qilq"XUWp\=^`&Gc+rq>1!cr;??bq>1!dr;HWhr:g-e %rqcrqrVcNdr;?<_qDJ<Qq>'gZp@nC\rqH9frV?3_qXXI\qu$KmpAFjcqY9gXo_JIcs82WfqtKj[q"aa^ %qZ$NlrqZrur:]p_rr<#sr;HKmq>U.!qYgEhoCD\VqtTm[r;QWlqYg6trVcWeo'uDLqu$HlrrE&squ$@U %q<dkMnbMqSq>0s`q"OLVq"agaqY9g_r;6?eq>'g[q"jperVQEgqYBs`qu$Eirr;uoq"jpgrVQKir;-3f %qu-EmrV??qp@RtMqu6TiquZcorri?!qu-Qjr!W;qqu-KmrVccqqt^6d!;ZHg"8;Kaq>L.%nFlh\rqlTj %qtp6dqu$Hgq"t$i%f?%tqYBs^q"OO^rVcZkrqZj!rVQNms8N#p$i9\pq"OOUp%J1WrVca,rVQEequ$Ko %rr)clqtg0d$2jc#r;6?hrVZTmqZH]jqYU6irVQ]prr2p#qu$Bjrr2rnqt^6sr;Zfoqu?]nq>UBl,QIf@ %qtg-`q>:0kq>C9mr;$3eo_eafrr<#orr2loqt^![r;Q^%rVQNkq>'m`qu6Kps8W)tqulutq"jserri<! %rr)coq@EQ)s82K]qZ$Njq>:0ks8;]k#QOi'q=XFVrV?KmrVld(s8W)qn+cbNr;-<frqm<'q=sd^r;HTl %qYC-irVcZnq[iT"r;Q`rrVQTmqtp<jrr;rrrrW,pr;Q^"rVccrr;-Ekrr2rtq>LTnp@e=]s8Vln!<)os %"9/9!s7uWqqYU6frrN,rrqZWlq>L]rq>1$erVcZcq#::%rVc`orVZTlrr;ikrVc`srVHNk"T/)mqYC-j %"oeN"r;?Qrs8Drrs8Ms)r;?HgqYBgWpA"L_rVm'"qt^*cr;?Qtrr)cmrVc`srVZZps8N#r!rMoorVmH. %qYU0frVc`pqYU0frVlfrq>'pe$2si"s8Vrls8VrkrVcaBs7lBbq=s^Zq"aX[qY'XYq"+@So_SIXp&"U[ %p%A(Tq"F4Io_AC]$hsDjq"ad_qtg-`p\je%p%A%RqY^?lr;HTlqY0XQqtKaWr;QQdq=c0+pA4aerquWk %qt^*drVQEeq=sa\qu-N_q"XRYp%/(Vmd9fF,4P'qq"F@Pp%J.To(MqSp\+CYrq,^WqssCYrVQB`p@nC[ %q>0j]%J]_mp\+=Tq>C3iq=X@Yqu?Nlq#^9bqYpC4qtg0^oCi.^rV5jPo^qbIpA+RYp%\Lap@%_Lq>U6j %q>U3rq>'g\p\=OZq>L+/pA"L]qtg*]p%A%Rq>1!drVZQhq"OLVp\=OZq>U4$q"OLTo^hYDp\Od_o^VMF %q=u-*pA"L]qtg-frVQHfqu-NmrVZTjqYL$dr;$*]q>C3epBU<aqtp3`q>C6c&,5koq>'g]qYU3gqtg<j %r=&W$qtg0bqYL*erVlfdq>g?iqYp@@o_\Ocs82]kr;6?equ$9grV?6dqtC!_p\k'bq#:6gq"X^`qt]jU %p\XpfrqZZmr;HQqr;6?hq#pHeq>1'drsSf%p\"O^p\OpirV6?frV?Thq>L9l,5qH9q"ajdqt^*aq"OR[ %r;H3`qt^0bpAY![nG<(RnbW.Yrq@?,qYTs]rVHBdqu-QhoD\a^p](9mqt^$`r;QNjq#(-g!;cZi#5nK# %s8;Zcrr2rrrqlinqu-No"TJAuq"4X_rr3Z/o(;\Np@nC\rV?6cs8Vocq>1!frVufqrVufpqZ-Klqu$@% %q>:-irr)`ip\=R\r;HWorri?!qtg-fq?$Qkr;QX*qYL$_p\"4OqYgEjp[n.Rq>;-*q>:-irr)corVQHf %qu-NmrVZTjqYL$frWW5rqY^?mq>(`tqYpKkqY^Bgq>'maqu$Bhr;HWps8Mrrs8N#r!<2ornc&OdrVd!# %p\k'js8Drrr>kn:qu?]nqu6Qis7uKjs8)Tls8;`ir;QZmp%J4[rVlrsr;?ZprqucsrVZWk"8_lkrV6Bs %r;$*er;$9irrDrqrVZQoq"spf2?*OPs8W)rrVZQir;HZqo_nacrqlKjs7>g[rq5p]rVQHeqYU3hp\Y!g %r;6Hms7u?fs7c?grr`5squ$3gs8Min#Q=W!r;6Bhrr)itqtU*hrr)rrrVHNqqtU'frtGD(p\F[]q>:0k %r;-Bls82Hcr;QZp!<2uts8N#rq>LElrVca#rVQHfqu-Njrs8T$qu$BjrVlfqrs8T$qtg-`p\+Lhs8W)o %p@nFZrrW&prr)j6rr2lnqYL*frr)fnr;6?eq>^Kor;?Qos7uU%q#(0lrr)lsqtp<hrVlctqYU3irr;rr %rsA](rVZTjr;HTnrr;WhqY^<j!;ZTn!r;Zg!rDfkrq[T-qYKpYq=sUWp@e=Xp@e=Wp@\.Tq=jRMnFH5M %p)*Puq"X[\qYKmYq"ad]p\+1Lp%S7Up@\4[q$Qlho'uPPr;-0]pAOdbpF5h0p\=OZq=sa`qt^*drVQEb %p@\+Pp\F[\rqlNjqt^6hrVlfnp\Fgb%J]\jp%J+Ro_/+Uq"OO^p^Qojqt]mVqY9gYpA+XcnbW7\s7lTf %#l+5mr;6<`p%nO\,5:m/qu$BhqY9^Qo_SO`p[e+Sq=sa]rVlWao(W"Vp@e7VrqcZjrqZcnq=saZr;$?e %rqZThqYC*d#5e;oq=s^Yrq7'#q"ad`r;-6bq"OLUp%\@Zq"FCRp\#9pq>1!bqYC!`q"OOXq>1'gr;?Hk %q?Qurq=jXZqu-?c#PRrgq=sa]r;HBfp]gQjqu$BhqYg?kqZcrrrVZTjqtKsdqu-@(q>C0fqtg-aq"FOZ %s8W#prVc`or>YS2rV?6cqtL!`q>:*cq>C-cq"agbqY9UPp%SF\rq[l:r;?Nlq"agbr;6?do_/(Vqtg-` %qu$BhqY9aUqu-NmqY9mbqu6Hlq#pNiqYU3iq[*2sq"ajdqt]sZrq-Tlq"jmfrqufqqu$HurqcQmrVQHj %p_io(p\Faaqtg0dqtg*`rquNbrVQEcq>C6lnbrIb%/]quqYC$drr;uqq=sjb&GuA$qu-Norr2lnp[n4Y %s8E]-pA+U`qYU6ks8;T`qYg<eq>1!frVufqrVufpqZ-Kjr;QTnr;HKor;?Hjr;QX!rr2loqtg0gq%W]& %r;HWprVZTjqYBs^qu$Eiq=j[Yq%NW%rVlcnr;-6ap\4IYqYgBjr;6Ki"onT"qYL*jrr;fk#Pn8pr;6Bi %s8DflqZ6Wnrr<#tr;Zcqr;Qitrr)Zl!<<#srr)ir#QF]#r;?Bgr:^.0r;ZfoqYpHhrVQKkrqlTlrquWi %rr2iloC_kSrVHfsr;HTns8NZ1qYU6js8Mrnp\=U_rVZQhrVcrtqY9d`rr3&tqu$BjrVR`6r;HTnrr)fq %rqu`ps8Mrmq=sa\qY^<js8W)us8Moq&cDY.s8MrnqYU0fq>C6jrVZTmr<rK"s8Mijs8Dlmqu6-cs8W)t %s8Drp!WE#srri?!qZ$TmrW2rqqu6csq=aX`rs&Drqu6TnrVlg'rqQ6cs8Momr;QZp!<2uts8N#r!<;ur %$2si&rr2lprr2rrrqcWsrr)fnrqc`orVZ['rr2loqtp6hrr;ros8)Ke!W;rqrseu(q=s^Yq"adbrVZTj %rqZm"s8Muqrr<#or<N9!rr2lqs8W)rrVZitqYU3irr;rprr2lqrri?"rVZTdrVcZnrW2uqrVHs$rr<#o %q>1!erVRi8q"O[^p%A+To_/+Vp@e:Vp@e1Pq"jj\oCDPHp%J.Sp&=^cq#:("nalMPr;-3^oC_nTq=aCJ %r:M?,o'uGPrr)HVoDA@Zq"XUWp@\=Zq"OLVq"amcq>1$fqt^$^rq@6(q>1*iq=adbq>Tp\rqZ*Sp%\C[ %q=sXep@n=Vp\4[_$MO,[rq>XMrUoaUrq6HgqYgEhqYC$gqZ$Bkq#C*gqYp<iq#0scp`fJ-q>1!cqYKsX %nalPQq=XCSq>'g\qYgEio^hhRq=jUWq>U6jq>U4%q>'g\p\Xjaq=saZp\am_p':<dqY^6fqYL3e!;QEd %rq6Niq"agar;?Hjq?Hcjq"ad^p\FLap\4L_q?-Qhqtg9e"8_onrVl`oqZm)sq=sa\qu-?c$2aPlp@nF\ %qt^'dp^$Wgq"ad`r;?HkqYpBiquHWlqt^(*r;?HhqYBs^rr2lnqY9gYq=jX`s8;fnrr2p@rVQHirV60b %qtKpar;$0cqt^'_q"t$fq=XFTq"X[]qY:'ds82fn&G5\mrr;roq=aU\rVZKao(W.Y"S_W_o_JLd&,,Pe %rVZTjqtg-aq#:6hqBu+8qu$Bgq"ajdqt^!\p@e7Uq>1-kr;$Bmr;ZEfs82H\q"t$gr;-Eg"8_okqYpC) %q=jFZq<dtWq"=LZq"adbs8Vomq>UEms8;oos8)corqucmrVHKi')MM'rVlfprV?0ZpA=jeq"OX_&,c>% %rVuorp\+I]r;-6cqu6Qor;Z`qr;QQsqYpHlr;6Ki&-)V)q>'mcs8N#rrVZTjqu$Blqu6BpqYU3hrr;rr %r;?isqYU3gqtg-a$2XMqr;HTlr;6?hq#gKjrVc`nrqd$%rquZjr;Q`nqtp6srqlNeqYgEmr;?QkrqZ]n %r;HWpqu6Ekp&=sj"TJAur;?Qo#QF]!qYL-dqY1"6rqufrqYL3iq>:0jqtpBkqtp6erVuopq"OU\qYU3g %qY^9jrVlctpA+[drsAZ$q"jshrqlH^r;$Njp\+L`rs8Dlq#C?mrVcZnqZ?ftrr2g&rVlirr;HZqrquZl %qAoJ2rVuosqu?]qs7ZKmrq?'^rr<#trVQKirVcZlrr*9&q=O^an,!(]q#(-g!;u3`!WW/ur;ccps8W)t %rVl`krVQU(r:p!]rr;upq>C6krVc]p#l48ns8Mrnr;QZp!<2uts8N#rrr3?)rr)cms8W&pqu-Bkp\t0h %!W;ogrs/Q%rVlirr;6?f!rW#rrr3*"rqlQjq#gKjrVc`nrqcs#s8Muqrr<#or<30"qtp?ks8N#rr<)uo %qu$HmqYg<jo_ndg"TA8rqtpBm#lX\tq>($fr;QcsrqIf8qu-Hfp%\F\p%8%Tp%A4Zo^r"VoCV\Kq>:$] %nbN+\q>'sdq#:$cp_!/kp\F[]q"OU\qu$?ep\"1NrUgcpo_/4^qt'=Lqtg-aq"OLTp&=jfq?d&rrVQEe %r;HNgrquiprr!<*qtopOp@n1Qp%\F\pC6ilrV--aq=jXZqtg*]rq[6#o()eLhX:76qtTpZp\=U_rV?9b %r;QQmq>U-pqtg*^p\=R\p&4U`pAk!fq#L9jq&9&$o_/+Xq=jIPp@e.NpA+OZq"jsep[\%Pq>U6jq>U3r %q>'g\p\asdq$Zulp@e@Zq"OOXqYL3dqtL-cs7u]kq"a^^#5Ioer;QWiq>:3eqt^9lrVlisrr)`l#5e8m %q>1!dq=t6oq=O:QqYU6f&,H"qp\4IYqYU3gqtg-aq>pHirqm#pp\=U_rVlflqE=fTr;6?dq"Xgdr;6?d %q"O^Zp&G'hqtg3hs8Vukqu6Qhp\Xj_q#:9ep\k$`p\4I[rr)Waqu?]or;ZforVHKi&bl(sr;HQjqY^<k %s8Mrmq"OO]p^Qulq>^Kop@@tWr;?Hh"oA&iq#:9kr<`K&r;-3ar;HNgqtqH4rVlfgnG2nQqY9serVH?f %s8)Zlr;-9frVcWhrr!H)p%8:UiUQj@rqcKeq>:-js7uTgrr2irr;QR#qYpHjqYL*erV60eq>U6jqtp9m %qtTn%q#(-hqXjOXq=jXZqu$?grVuonp%eI]rr)lps8Duqrqd9's8Mupqtg-`rVZQhqYU3hp\G$iqu$Bj %q"t-jq>LHmq>:0k!;uZks82]ks8W&ss8W)sr;6Tqrr)`qrr;fk#64VqpA4aerquorr;6Ki!rMoorr33% %rqu]mrr2os"8VfjrVcclrr2p#rr)cmqu6U%rr)clqu?Hds8W)s!<2ut+oV99s8VrkrVlZis8Vrks8Vli %q>:0ks8)Hgs8W)ts8W)tr;?L!q>1$gs8Muprr)j"rquWgq>C'iq>:0k$i'Djs8W)trVZQiqY:'prqu`p %s8MrjrttJ$qu$6eqYgHor;6Knr;Q`qrVZZps8DiorsJYtp]'pHo`+ggrVl]prVlimrr<#ns8W)tr<NB& %rVZTlrr;rorVQZorr*]5s8N#rqYC$fs8W#kq>:'bq>:0jrVc`q"T8#kr;QZp!<2uts8N#rrVm9(r;6Bk %s8DlnrVuoprVufprVulss7lTgrrW/rrVlfsrqZTorVQTos8Drss8Mupr;Q`rrr2rnrWN9$q>'scrs/Q% %rVZTiqu$Hm%fQA'qu$Bjrr2rmq>1$grr;fm(]XL6rVZQiqZ$TprVZQhqZ$His8VfdoHj/'q>'^Rq"smZ %oD&.TpAFg\o_J=Ro^qhOqYBdQqYpKhq#10dq=bEsq=jUUp@n@Yq=s^Yq>:*fpBgWiq>'gZp%A(SrqR<( %q"OOVp@@nOqu$?fq#1*cqY^<hq>:+'r;?Bcmd'K:nFZD>lLk#Io_S.cpA+R[q"t'eq"F^`$hj/brp8Y8 %p@A4Zq>L'hq>0p_q>:d"qYBs^q"OO[qY0^Wq"jpapAXmdp`'&+q=sd_r;6?^p%S4Ro_/(Uq>1$fqtK^U %p\Fgbs7uZj%/K_oq"O^aqt^$]p@\O]q#1$oq"O@MoCV_LrV$crq"ad`rVcZkqY9gYp&"OkqYL*apA"Rb %rVH?e!;c]js7lWis8Mus!ri2sqY^Zrqtg-aqYU0cq&]P3p%8"Tqtg3eqYBs^q"ORZqYU3gqtg*`q>0sb %r!<5op\=R]r;HWjqZ$Knqu?Nmq>'k=r:]jas7uKbp\Fabq"4I_r:fp^r:p*frqH0br:TgXq"t$fp[e=_ %s82]ns82Wg!ri,orqHfrqu-HiqYL-hs8;^(qtp<hqYBp]q>:*fqtp6drqR0!q"t'jrquZkqY9marVQEg %r;QZor#5J0na?,FoCr%Im.gPSp\jg]r;HNirr;roq>U=#q=XO_n)a6<p&G!grVHWnrV??drWN2tr;6Bj %q?R#tqYBsarVu]hs8;ck#6"Jsr;Q`q#lXJlqYBm[q>:0h#QFc&qY'a]qu6Qor;Z`qr;QR8qZ$Qnr;6?d %q"jmcrVcZkqXsOTp\=R\qYC!aqu$Elrr30$r;6?dq"jmkrVl]iqu6TqrV?Hlr;QTnr;ZcprrW3!r;-?q %rr2lor;HZpq>:m*rV-$^rVcZnrVcZlqtg0dr;HWps8N#q$2sl&s8Vrlqu-Nns7uZos8W)urVufkr[%U? %q>^Klqt^'brr2cgrVuonq#13hqu?]mq>^Hhq>'mcs8Mlfrr<#ss8W,tqtq$'s8W#oqYU3hs8MuprVlis %r;6m"rVlfpqtg3frVld%rVcZlqtp0brVca%rVulprVuosr;$@-rr2QZq"aUYqXEtMs82Zmq"t*krVc`q %!WDoprs\f!qu?3Lp\X^bs8N#sr;lotq>U9krVm?+rr)fnr;Zfqqtp?ls7uQkrr)curr;urrr)j'q"jpd %qYC$err2lr"T8&lr;QZp!<2uts8N#rrVm'"r;6BhrVca+rVZEaq"ad`r;HQkrVlfmrr`5tqtg6irVluu %qu-Qfs7lTlrrW3!r;-Bks8W)ts7uWss8Vrkr;-Etrr)fnqYU3irXo,-qYU0frVc`pq"adarVlisq>L?m %s8Duqs82fnr;@$'qtpEnp\4:Ko(Mf%o^VbSq=F4Qq=aX]qY0^Xp@S%Mo_/(To^VVOqXX4QqXjR^p\sk! %p&=j_o^h_Lq=aIOnacDMrVHBhq$Hopr:TRLp\Xg\r:g3c&FAlXq"a^Yo_n[_qY^<hq=spa(\mauq"s[P %p\+4Rn_r?lp@.J@nFcYSp]^EgrV6-]rqR#so_%tInbi+Kq>0s`q=XOYqu6Bjp\sjeqYC-b%Jfo!q"OOV %p@\+NqYBpcpB(-br;QTmr"Ju&qY^6dq"jpfr;$'\q"jm]p\Fgbs7uZj&Gc.sq"O[_qYBp]p\4CVqYV!( %qY9dRnFH2Dp@n@Vp\=OZqYL3i#Q+Amp@\(Rq>C!np\FUZq>:*fqt^!gqtg-eq#:'qqYU0dq>'sdrVc]o %!;lZi!;lTg#Q=Mnp@n@Xq>L0gq$6]jqYU3gqtg9erV?Tnr;-Wnq=s^Yo_SRas7u]krqdc7qtTsds8)Tc %oCVkTp[nC_r:]j\r;$6hrV?6bq=ag^%/Ketp[n7[rUoj]rV-9e,Ph01q#C?ip\+@Xr;$*[o_&"Xs8Doo %qu$Bjrr;cbo_SRbq>0pjqsX+Mq_%gDq=jg`q"ajdqt^$^q>'g[p@\=^p@J.VpA=LCi:-R6nFcDJrVcTg %r;ZZjqYpC%q=j[\o(2nWnbi@ar;?6bq>UBjs8)`j')hb)q>1!es82Zhq>'g[p\k$erV?Qls8N#srr`8t %rVm!!r;6Hlrs8Mtq>:-iq>1!frVufqrVufpqZZiqrVcZkrq[E+qYgHorVH?]oCVbOq>1!bqYU0frVc`q %#6+Suq=s^^r;-fsqY^6fr;Q`rrqZC(rr)clqYU0fq>'maqtg-ar;?NlrVlWks8;cl#QOc!q>1!dr;HTm %quZcnrVlisrr2ipr<`K&s8W)sr;6Bfq>UBlr;H]orr"_Rrr<#tqtpEnr;??_p\XmbpAY*kq"Xgequ6Wq %r;6Eiq>0p_qu6QjpA4ghp\4[eq>L9ir;HKos8W!(q=sd`rqlNcp@nI_s8N#rrs&AnpAFsjqu-Hkr=SSl %q>L<kqt^9kr;HZqrquZjrqmf6qYC*iq=X[`q#0pKj7<-@o(_qTs8W&qs8W&qr;Q[$r;$6fo_/=^o_ndi %rq66crrN,t!r`&prqc`rrr2g)rr<#srVZQiqYL$fs8Drps8Dcn!<)os!WN&rrs8W%r;HZqqu$HlrrE&t %s8W)trVlg$rr2lor;6Hkrso#)p%J.TqYU3hr;?NmrqcWsrVQHerr2io"9/8trr)isrVHHos8W)sr=&]$ %q>1!cqYBsbr;HTmrpTjgr;6EkrqufqrW;rnr;Q]qrVl]mr!<9$rr)clqYBs_rVcZmr<rN"r;?Nlrr2rr %rVnMMqtp'TnFZMLoD8C\oCDYOp\aj^q=sURp@e.Mo_/%PoCMhSnF6;Oo_A4Up@eLY9`"SZp%A%Rq=XCO %oCVbOqYU0cq"X[]qYp6Znb2eQo_%nNp\=R[qXaCSq"aa\p\k!bqY^<hq=j[[q=s^Wo_&+VpA4RWr;6*U %q>D6.q>9aWr;63Zp%e7Rq=saZp\=RXo_ACZoCi1Yr;$0`q>1-cs7ZKcs7H9b%f,ttqtg0bp\+:OoDACZ %rq6Beq#1*gq@`W$rVZKdqY^?jqY0aZqY^']q>U6jq>U3nq>'g\p\jmfq>L*cq$-Wdp%A%Qp\agcq>C(' %q>'g\p\Xjaq>'g[p\=R\qYBs`qt^"$r;6<bp\4IYp\=R\qYBp\r;?Nlrr2rsqZ$Hcq?$Qkq>U-fq>L-q %qtp0aqYU3gqu-Biq$?cprVZNep@\(Rq?Qfjq>1!dr;HWlrVB+]q>:'hs8N#mo()PPq=aadr:]g[r;-Ei %qu$?cpA"IXp@nCZq"=@Zr:BOYrqH<dqYBs^q"OabqY9j]qu$6`p@e7Vqu-Nmr;QR&rVccmo^qqVqY0d[ %q>(j'r;?Nep\Odbr;6?gqY9marVQEap\sq;p@RtOrqlKhqtU3jp%8.]rVQTeqZ$QjpA"R[q>C-eqYL*e %q=a^cqXs[`qu$Bfqt^3jqZ$Bkq#C*dq[NK%rr)fnqYBmZpAY$frqQ]nqYgEmr;?itrr<#rqu-No#lXVq %qu-QjqYU9js8;oqs8;ln!;cWkr;6Hj#Q+Dmq"X[]qY^6hr;QX&r;?HhqYL3jrVZQirqZisrVcZlrVlWi %!rr8trq[-%r:g!^qYL$_p\asfrVlfrs8DKd"oeGrq>1!fr;HQrrqlWlrr<#trVc]mrr3-"r;-3`q>LNo %r;?NmrVuiqrquorrr2lr.Ji]0qYg?fs8W)np\b$gs8MurrV?9dqt^$_qu$<cq#C?dpAb0grVcWpr;6Ki %%fcP+qYL*frqcHcq"agdrr3*"rVc`prrr>opA=jfrqZotr;HWos7lHgrr,"Xr;ZcorVuosr;-<fr;6?c %p\Opgqu?Wks8Vlfrr<#ts7cHks82TfrqZKkrVcZlrVl]irVuikqu-Kmrr2rnrVuops8Morqu6Elq>L6l %rqud*rr)`jq=t!irVZQir;HHk!<2ut!WN&qrs/K"rVuopr;QZp!<2uts8N#r!<;urrr!9)rr<#trr)Zh %qYU3gr;HWor;Zfrrr)fq"TJAtr;?j!s8W)ts8Von'`\44rVZTlrqH3`qYL$_p\asfrVl*^!r`&prr2fp %!rDflrr2rrrVZWk#QOi'r;-6`p\FamqYU0frVlisrVc]m!<2rs!ri2n,k19qq>'a\r;#pSp\FR_p\+L\ %o'uJKo^_SGp@\(OrVZ9Yrr2ol"8DN_p&=Rcp%J1UrqQWjq"aja%/]nrp\+@Vq>U6`oCMnP"nhWbq>1!f %rr2j(rr2lnq>1$fqt^*crqmH+q"O:Rq=a[Yo_eFYqY9dYq"OD%qYpBanF?/ApA4OXpA"L`qY'UTq"jdY %p@nCZqu$Bfp\FUmp@e1Po^qbHp@n@XrV@*'r;-3^o^hYNqY9dWp@n=VrqZNf'(u%qq"=:Qq"X^arr)]g %p@e7VrqcZjrqZipq=saZq"Xa^$2aSop@e:Xqtg0fq>^6dq>U+&q"X[]qtpBkr;6?dq"OLXr;66^q"Xag %rVQEipC?uoqYU6jrr)`jr;?Nmrr2rtqYg<cqB#D.rVZH`pA"FYq>1!cr;??cqYU3gqtg3dqYBs^pAjse %qZ$Bjq"aaqp\4IZqu$Elrr)clqY:'as8Dor/Geu/q#('crVufgp%nU_s8)QjrUogZqY0[Up\FUYq#CBf %pAb0iqtg0bq"Xj_"8M]gqu6Kpqtp<ir=/](rVQHeqYU3jrV6'Zrq?Zkp\=R]r;HWjs$-GXq"ajdqt^*c %qu$?ep\+4Vr;$<ep]('erVH?dqtg'cs8Mcao_8%SrVHBdqu-Qnq=sa^r;69aqYU6js8Vokq>:Wrq=saZ %p\+=VqYU3hr=K#.rVQEbp@\F`qt^$^q>1!fquZclq[35qqY^6cp\F^`rVlg#rVQEdqYU9js8;oqs8;ln %!;c]lr;6m#rVQEdqu-NmrVl`oqtg6hq?6]nrVc`prs\o*r;6?dr;Z`lq>:0drtGD0qYC!br;-<hrr2ln %qY^9irr2osrquotrr)Ti')MS,s82Teqtp<hrVc`qs82`mrr;rr#6"Muqtp6hrr)lps82Wk"T&#nrVl]o %"oeJuqtg0ds!@U9p%n[er;Zfrq"O^dr;Z]ls8Vifr;?Ecp\Od`q>:3lq"asirquutqtp6c"Sqojqu-Km %!r`)sqYq!&r;6Ejrr<#pq"X[]rqQWlr;H<g#lac#s8W)rrVlfr'E.h(p&=sgs82Wlr;Zfqqu$Ejq>UC$ %q=XIWp\Y!gr;6HlrsAT!qYgHmqYU3irVu]lqu6Wprqc]lrqQ]lqu$ElqYq!&qt^$]s8W&pqYU3grVlfp %$3'i#rr)`iqu-Kkrri;tqu$HlrrE&ts8W)trV?Ers8W&pqu-Hmrr2rrqYpKl!r`,tq>UQrrVcWmrrDrt %qu6<h')qk-r;HWkqu-NnrVQHhr;HWomf*:brr3*!qYU6jrquctqYU3irr)d!r;?HgqYC-gs82flq>CHl %q>1$fqu6iur;6<cr;HX"p%@tMq"jaio'Gi7o_81[qBkh'qu5^1lLFZHp\+FZq!e+TnaZGNn+65Hq>0p^ %p[7YIq"FCTqYp9fq&f+tq"t!bo^VJBo(;VKp\4LYq"OOVp%A(Sq>:'bq"OU\&,>tsqtp6cq#(!aqu$Bf %pA+Fcrr2ijp'^Thqu6KfqYL*cq"t$f%/Tbnr;-3^pA"L^q>($b$MjMoo(`4_p[e%Pq=tR"qt^!Zp%J+P %q>L6ep\4LXpB(-bq>U3qrVZTjqYL$`q=bO!q"FIYqt^!`q"X^ZnaubPp@nR^"o.ldq>C'sp\+CZqtg0b %q"XUXrq?<`rV6Khp\smcq?6Wiq"XUZp^m/nq"aa\p\+=Wrr)Zdp%J:[q@NQ'rVZQhq"OO[qu$BhqY9g\ %q?ciir;Q]lp@J+Trq@'$qu$Ejqtg0drVlcnqtg*^p@\F]r;$]rqu$BhqY9g_rqclqqYBs`qu6L.qY9gY %r;?Tpq"XUYqu-Ean+$#CqY^<j-MI'1s6/8*oDAO`q>C3go)/FXo_eUWpA"L^rVZQhnb)bUq=sgbrVQQk %#4hKbrr2iirq$fqpA"I[qY^6fqYBs^q"jmcr;urqqtU!uq"ad`qtg-`s8Dlos8W#mq>1*j%K#qrqu6Wp %qu-KmrVQTnrseu+qtg?kqYBs`rVufnrqd'#r;H<cs8Vrhp\Xda&-)Y,q=sa\q=jges8;]hr:g'fqu?To %rVlftrr)ioq>)Q>qt^*erquTkqtp?fo_8C\q>1!dr;6?dr;Z`lq>:0jrVcZkqtg0bq>C$er!E8tqYBs^ %rVcZlrqlKe&Gc2"r;?Hgq>(!hs8;]fq>U6hrr3K-r;6?err2rtrr)`jrVcWl!VuWlrsA]#pAFgaqYU3i %rr;ur!<2rs"oeGsqYBp^r<rW(s8W)sqtg?mrr2oq!rW&srr3*!qtg-ersei$q>1'irV,jSpA+XcrVn&: %p&G'WhXC1:s8Dios8DWirq?'brq-!^r;Q`qrVZ9^r!*,sqYgHmrVQR3p%\Lcs8Mlgp@n@XqYU3hrr2lo %r;6Bfr;HTo!WDrlq?m#nqYU0dq=t!irr2ourqlNhrr3*!qtpBlrrE#rrrE#pru:t8s8W&pqu-Qprr2lp %rr2rtp\t3mr:p*drr2fo&-)\/r;-9eqtg<ls8Mrps7lNlrVulls8W)or=]//qu$KorqufprVucgq>^<g %r;QZsrVcWmrrW,qrVca!rr2lor;HNlq?[-$rr2lor;6Bjs8W)lr;c^"r;HWorVZQirr3*"qtg3^rrW/t %r;6KprVZKk%eoi!s8W#lp&"U]q>1!eo`#$lr;6?^rtYM1rr2lpr;?HhrVc`qrquWgq#:9m!<<#i#l"/j %p%%\Fp%SI\-27<3p&4mYk4A6AqXsITr;60aq=!eIq==4Pp\=R[q"XOVq>0pdp_ir)q>'g\p\4=Rq>0s^ %oC2GGp@n@Wq>'m`rqZQg#P\#hqYL$_p\FXrq>1!dr;6?dqtg-br;69^r:g0a+8#-rqYg?frqlHcq>0p] %q>'m`q=s[Vr;-3^pA"L^qYp<hp]pQkrquHZo(DhQ%/K\lp%7nLp%J1Xqtg$]&,,blq"ad_qtp6dq>'g\ %p\FRtqtTp\qYU*_qY9m`q"+1Vp@n@X$MsVpq"X[]qY9j]rV?Zmq"XUXr;$9e!r;ZerqHEg"Sqlgq"OUZ %'DM:tqYL$_p\4L[q=jUYr;?HhqYg4#rVcZkq=s^YqYL*eqtg-`q=ts&q"t$gqtTj\q=s^Yq>1!dqtg-a %qY^<hqt^Hkq"OOVq>(Boqu$BhqY9g_rqd9'qYBs`qYU3gqt^$^qYL6lrV&2Gr;??_p%J1Wqtp6drqcBh %s75FJp\k'cpA=mhq#:3^o(r:Wq"X^_qu$?gp\Ogcqtg3erVl^/qtp6dp\Facr;--Yq"X[]qYU3grVl]p %r;QQtqYU3hrVZQfq@EDuqu$BhqYC-gqu-NnqtTs_+8>I&r;Zfps8Dflr;HQir;?Nlr;6<bs8Dijq>:-j %rVl`nqZ-Klrr`&gp%\@Z!rVrkrV$Kjq>:0jrV$*iq>'jqqu$Ekrr2lpr;?HhqYC"0rqlNfrVl`krVHEj %qtBgbq"agbrVZTjqu$Ejqtg3gr<3&qqtg0er;?Kpr;6BjqZ$Nor;QQnqYC"%qYU3hrVZQhqY^<iqYC'g %s8N#rrVZZp#6"JsqYL0h"oeQ$rVZQgquQZlrr3-#qt^3grqd?+rVlirrVZTls8W)trVZQhqYBsc$i^/* %s8MuoqZ$Tprr2itr;HWortPJ1qtp?js8Vrlq>'sgrqlHaq>1$gr>Y\7rVHQoo]u;Ks8VrjrVuoos8M]` %rVlQfqtpd!rr2lpqY^?mrr2lrs8W)tr=/]#qu6Wqr:p!^qYU3hrr2rtrVd-%rVZWns8W)sr;$0rq>1!d %r;6?ds8W)trrN)pq"t3hp\Omh$NC)*r;Q]qrqucprr39&r;6NorVQKjrVulr"TA;urVm'$s8)H`qYC$q %s8Dikq>'m`qu6TppAG-kr;?Nmqu?]qpAH'4rVZWos8MrrrVliqq"t*gr;HWps8Muqrr<#srVlcq"TJE! %rVZWnqu6`srr)iorr<#trVcTk%fH;)s8W)sr;?QorquZmqu?Zpr;QisrVZQm!WN&nrX\i%rVuorqY:!c %qYC!br;HWps8Moq"TJAur;?0d$i^)'rr)fnr;6BhrVld'rVQHfr;?Tpp@e/Bo_/(VqY9dXp\=OXp@\7W %p\Oj^o(i(YqXa7OrVlWkq=!eHqXsUWp@e7Uq>'m`q>1!bq"FR\q=saZp@eI\"o%]]nbN"Yq>pKhrVHNj %!VcBfq#U9bp\G!hr;?Hkq?H`iq>0s^o_J4]rX&DmpAFj]melqUrV6BdrqHfop%8.Xq"FFVqYp@$qYL$_ %p\+CZr;$!Up%eFV&,,\go^h_Ip%eCXq>:$ap\FUip%A%Qq>1!crqZThrqH6`(]*t%q"jj_q"XUZr;66` %r:g!^qYU0dq$Honq"X^^q=sg_rqZQg#5@ofq>1!cr;-Hhs7lTi"Sqlgq"ORZ!;cZk!W)WkpB:0^p\Xsh %q\8o'q=sa_r;6?dq"OOXq>1!dqtg0ap^-cnr;?Hgq>:$arqHWlq>:$brqQTkqtg*gq"X[jqtp<gqYBpa %rql`lrV6HirVI0&qY9jcs7uKbp\F^br;6<crV@K/q#('drVu]dr;6Nmp@S4]s82ioo()YUq"jjdq%EQ% %r;HTlrVlcmq>L9iqtp6cq>L3nqY9aUrqu]ms8;ios8E6!qtp<hqtp*`%K$)$qtg0fqtg6hrVH9aq?d3" %p\Fjhq!e=^rqZcpqtg-brqdW1q"Oddqt^'brVlfprVZTjqYC$fs8;Waq"sm^&,H"pp@e7Tq#($dr;HTl %qYC$nq"X[]r;HTprr2iqqu6Hfq]l(:qYU6ir;-<er;Zcmqu?Nir;HWorVZWkqYU3hr;6Hkr;?Nj#5\2n %r;HTnrVc`ns82ips8;ln!;cHf"o\H"rVZTmqAT/(qYpNorr)fnr;6Bks8Mupqtg0dr;HWprr;rlq[*3" %s8W)sr;QZmrqcfqr;QZnr;Z`nr;QTgr<iQ's8Mupqu?]qrr2iur;?Nmrr4nUrVcWjs8VunqYC$fs8W)q %qu$Ekr;6?irqufrqtL*gs8VlgrVuoss8MZ_r;ZWkr;6BhrVcfrqu7<-qu?]qrr)cmqu6WprquWfpAXX_ %!W;oprW2uqp\G?rr;?HgqZ$Qnrr<#rq>'pus8Miks8Vres8W#qrVlcpr;QX#r;-6hs8DlnrVQU$rr)cm %rVuosq=apdrqZC$qtp6cq"aa^rr)fps8W)rq>LNnqYU6jrr;usrr)lpq>Cs+rqu`ps8Muqr;Q`rr;HZn %rVl]o#6+T"s8W)srr<#trqursrVc`ks8MutrVlisrr2lorr)inrrE&tquZclr;-Eprr)forrrE#rVZWn %qu?Kj$MsYurr2loqu-HirqcZlrr;uss8VoooD]'prVlfprVZTmq\&i*rVlcor;?Efs8Vojq"FFUq#^Hj %pA4M2pA"@Rp@n:Sq#('_oD&7]p%eCRoD8C[q=s[Vp%S:YqY0^Yqu$6^rqH?c"T/&jp\+UZqt^]rq=jXY %q"ad_qtKj`q#C*`q>gEkr!E8sq=s^ZqYBjVq=b$jq=aR[#Q4Gmqt^![pAFXoq"aa\p\+I[q"OOXqYL3g %%/Teop@\(Op\+7Qqu6?`s7QBb#l"5kpA"O_q=aXY$2!oap\=U^qtg0Zq#L3gq%WVuq"jpdqtg3aq"jmc %qtp6eq"FFaqY^0_qtUToq""%Kp%J.Tqtp-a"Sqlgq"OR[#5e>srVZQhrq?Zkp@nC[p\=R_q@NK"qtg-a %q"XUXq"jmcr;6Bep]C9fqYU-sqYL$_q"OOZqYBscp]U?dq"aa_qY^0qq>1!dr;6<cr;QR"qYL$`q"aa^ %qtpBj%JKMqs8;flq>'mbrVlWhq?6Wkq=j[`q&fM6rqQ3as8Vllqt9[\rqlWjq=sa\qu-Kiq>:0kqtL'c %rVH`rrVQHerqQEirqloqqYU0frr)lns82inpA+ddrVR!!qY^6equ-HgpA+Ons8;]hrr;rnrquWgq>C'u %qu$BhqYC*fqtg0dr;HWo%/p,#q=s[YqYBm]rr;`grqHirq>1*fq>1*jr;$0b#P[ufqYU3hrr2inr;$6i %r;ZZnr##>-qYgHorr)imqu-Norr2lqqt^*es8;]jr;QQtp%A%Rq>1!^rVufpqZ-Kfr;ciqrr`9!qYL3e %"oA/rqYL-gr<E3!rVcZlqu6Etqu-Nos8N#oqYU-grVHKorVZWks8DuqrVQWks82iop\bKtrVlirrquZn %s8N#srVl]rrVlfprs\`!s8W)trVQKirr<#squH]pr$)%:r;$6fqu$Ems8)Nhs8VrprV-*es8Drqqtg0e %rr<#sqZd$!s8Mlmr;6Eqs8W)rqu6HgrrrE"r;HWorr2urqu$Nmq"b!frVR!!qYpHkrVuloq"agis8Mon %rr30#s8Mrnqu-EmrVld%rVZQms8DlnrVQU(rr)`jq>:*eq>:3lqtp$_#lO`$qu-QprqlNh"Sqokr;HNm %o)8XfrVclsr;HNm!WE#orrW/rr;Q]rqt^3qp\=R\qu$Ecs8W)trV6Ehs8Mp$qtp<ks8;ipq#:NsrVcZl %rVQWjrVl`kr;linrVHNns8Moos8MKerr*9'rVZTjqtg3frVc]o!r2Qj&c_h.qt^![pA+UYp@e7Uq>0se %q)%d9p\=CRqu-<_q"a[PoCr"Tr;?Beq=jRTpA"IUoCDSNqt]pWo_%qQq>0s`q"OLUp\=R_q#0plo^qhL %p@n=Vq=j^]&,H)!r;?Hgq>'g[q"jg[oDJ@^pBpirq=O1Gp&"U]q#9sip\=OZqYp?oqYC!`rV-HiqYL3g %"T%odo^r+T!r)Wlp\=X]#Q4Ajp\Ogap\FIeo_%nNq"aa^q>:!`!;QNg%f#kqq"aa^qu$Bgp\=U^%K-,# %qYU']p\Og`pA"F[q$-E]o_%qPq"aadqu6Epq>'g\p\FY"qtp<irVZQip\=OZq=jRRo(;YOqu6KnqYp<h %p]pQgqYU3gqtp3ap%eddq"OO]q>pEerV$<e"Shfhqtp3c#l4;nr;?Hgq>C6hs8)Zh!rDcjrqufirVmB, %r;-3ar;HEcq>1!drVc`n2#-e?qtKjas82Tgr;,sWq>'sgs8;imq=sa\qu$3]p%\LbqtTp[q"agbrVcZk %qYBs`qu$Hjr;-Hfs7c]lqYL*Zq@EDuqu$BhqYC'dqYU6hq=aX\$NC)'p[[qNrr)clrqQ]nqtp<irr*#u %r;HQlqZ?]orVld!rVQBap\jjgqZ$Tiqtp9rs82WgrVl`kq=k$cq"P!fqY^9iq>U3f!;lcn)uKO1r;-?h %rVlisrVHEirr;usrVl]iqYgHlq>U9hr!)iepA"I[qtC!gr;QQnqY:!hrr)j,rr)]iqu$Bgq"FCSq>C6k %s8DlpqZ?WjqZZrts8W)tq>0pc#QF`$rVZQiqYg@#r;6?eq>0sbr;HWoq>C]ur;Q]qrr)cps8N#srVl]r %rVc`os8VomrrrE"qu$Hnrqdf8rVlisrr;uoq#(*dqZ$Toqu-Qmo_JF_rr<#ts8Mp9qYL*frqcEaqZ$Tp %qYBs`r;HWps8Mupqtp<irr)foquuolqYU0frr)`l!<)`i&,H)!r;?Hgq>U?jrVuloq"ajers/Amp%n^g %rr)in"8r,rrqud$rr;usrVc`pqu6ftqt^'arqZ]ps8Voos8Dio"98Atr;Q]rr;$0mq>...