84 Pages

15

Course: PX 407, Fall 2009
School: East Los Angeles College
Rating:
 
 
 
 
 

Word Count: 44167

Document Preview

%!PS-Adobe-2.0 %%Creator: dvips(k) 5.90a Copyright 2002 Radical Eye Software %%Title: lectures.dvi %%CreationDate: Fri Dec 05 09:33:49 2003 %%Pages: 5 0 %%PageOrder: Ascend %%Orientation: Landscape %%BoundingBox: 0 0 612 792 %%DocumentFonts: HFBR10 HFBR8 ZapfDingbats HFBRBX10 HFBRSY8 HFBRSL8 %%+ HFBRMI8 CMEX10 %%EndComments %%BeginProcSet: PStoPS 1 15 userdict begin [/showpage/erasepage/copypage]{dup where{pop dup...

Register Now

Unformatted Document Excerpt

Coursehero >> California >> East Los Angeles College >> PX 407

Course Hero has millions of student submitted documents similar to the one
below including study guides, practice problems, reference materials, practice exams, textbook help and tutor support.

Course Hero has millions of student submitted documents similar to the one below including study guides, practice problems, reference materials, practice exams, textbook help and tutor support.
%!PS-Adobe-2.0 %%Creator: dvips(k) 5.90a Copyright 2002 Radical Eye Software %%Title: lectures.dvi %%CreationDate: Fri Dec 05 09:33:49 2003 %%Pages: 5 0 %%PageOrder: Ascend %%Orientation: Landscape %%BoundingBox: 0 0 612 792 %%DocumentFonts: HFBR10 HFBR8 ZapfDingbats HFBRBX10 HFBRSY8 HFBRSL8 %%+ HFBRMI8 CMEX10 %%EndComments %%BeginProcSet: PStoPS 1 15 userdict begin [/showpage/erasepage/copypage]{dup where{pop dup load type/operatortype eq{1 array cvx dup 0 3 index cvx put bind def}{pop}ifelse}{pop}ifelse}forall [/letter/legal/executivepage/a4/a4small/b5/com10envelope /monarchenvelope/c5envelope/dlenvelope/lettersmall/note /folio/quarto/a5]{dup where{dup wcheck{exch{}put} {pop{}def}ifelse}{pop}ifelse}forall /setpagedevice {pop}bind 1 index where{dup wcheck{3 1 roll put} {pop def}ifelse}{def}ifelse /PStoPSmatrix matrix currentmatrix def /PStoPSxform matrix def/PStoPSclip{clippath}def /defaultmatrix{PStoPSmatrix exch PStoPSxform exch concatmatrix}bind def /initmatrix{matrix defaultmatrix setmatrix}bind def /initclip[{matrix currentmatrix PStoPSmatrix setmatrix [{currentpoint}stopped{$error/newerror false put{newpath}} {/newpath cvx 3 1 roll/moveto cvx 4 array astore cvx}ifelse] {[/newpath cvx{/moveto cvx}{/lineto cvx} {/curveto cvx}{/closepath cvx}pathforall]cvx exch pop} stopped{$error/errorname get/invalidaccess eq{cleartomark $error/newerror false put cvx exec}{stop}ifelse}if}bind aload pop /initclip dup load dup type dup/operatortype eq{pop exch pop} {dup/arraytype eq exch/packedarraytype eq or {dup xcheck{exch pop aload pop}{pop cvx}ifelse} {pop cvx}ifelse}ifelse {newpath PStoPSclip clip newpath exec setmatrix} bind aload pop]cvx def /initgraphics{initmatrix newpath initclip 1 setlinewidth 0 setlinecap 0 setlinejoin []0 setdash 0 setgray 10 setmiterlimit}bind def end %%EndProcSet %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: c:\texmf\miktex\bin\dvips.exe -Ppdf lectures %DVIPSParameters: dpi=8000, compressed %DVIPSSource: TeX output 2003.12.05:0933 %%BeginProcSet: tex.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S /BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: alt-rule.pro %! % Patch by TVZ % Makes dvips files draw rules with stroke rather than fill. % Makes narrow rules more predictable at low resolutions % after distilling to PDF. % May have unknown consequences for very thick rules. % Tested only with dvips 5.85(k). TeXDict begin /QV { gsave newpath /ruleY X /ruleX X Rx Ry gt { ruleX ruleY Ry 2 div sub moveto Rx 0 rlineto Ry } { ruleX Rx 2 div add ruleY moveto 0 Ry neg rlineto Rx } ifelse setlinewidth 0 setlinecap stroke grestore } bind def end %%EndProcSet %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: pstricks.pro %! % PostScript prologue for pstricks.tex. % Version 97 patch 3, 98/06/01 % For distribution, see pstricks.tex. % /tx@Dict 200 dict def tx@Dict begin /ADict 25 dict def /CM { matrix currentmatrix } bind def /SLW /setlinewidth load def /CLW /currentlinewidth load def /CP /currentpoint load def /ED { exch def } bind def /L /lineto load def /T /translate load def /TMatrix { } def /RAngle { 0 } def /Atan { /atan load stopped { pop pop 0 } if } def /Div { dup 0 eq { pop } { div } ifelse } def /NET { neg exch neg exch T } def /Pyth { dup mul exch dup mul add sqrt } def /PtoC { 2 copy cos mul 3 1 roll sin mul } def /PathLength@ { /z z y y1 sub x x1 sub Pyth add def /y1 y def /x1 x def } def /PathLength { flattenpath /z 0 def { /y1 ED /x1 ED /y2 y1 def /x2 x1 def } { /y ED /x ED PathLength@ } {} { /y y2 def /x x2 def PathLength@ } /pathforall load stopped { pop pop pop pop } if z } def /STP { .996264 dup scale } def /STV { SDict begin normalscale end STP } def /DashLine { dup 0 gt { /a .5 def PathLength exch div } { pop /a 1 def PathLength } ifelse /b ED /x ED /y ED /z y x add def b a .5 sub 2 mul y mul sub z Div round z mul a .5 sub 2 mul y mul add b exch Div dup y mul /y ED x mul /x ED x 0 gt y 0 gt and { [ y x ] 1 a sub y mul } { [ 1 0 ] 0 } ifelse setdash stroke } def /DotLine { /b PathLength def /a ED /z ED /y CLW def /z y z add def a 0 gt { /b b a div def } { a 0 eq { /b b y sub def } { a -3 eq { /b b y add def } if } ifelse } ifelse [ 0 b b z Div round Div dup 0 le { pop 1 } if ] a 0 gt { 0 } { y 2 div a -2 gt { neg } if } ifelse setdash 1 setlinecap stroke } def /LineFill { gsave abs CLW add /a ED a 0 dtransform round exch round exch 2 copy idtransform exch Atan rotate idtransform pop /a ED .25 .25 % DG/SR modification begin - Dec. 12, 1997 - Patch 2 %itransform translate pathbbox /y2 ED a Div ceiling cvi /x2 ED /y1 ED a itransform pathbbox /y2 ED a Div ceiling cvi /x2 ED /y1 ED a % DG/SR modification end Div cvi /x1 ED /y2 y2 y1 sub def clip newpath 2 setlinecap systemdict /setstrokeadjust known { true setstrokeadjust } if x2 x1 sub 1 add { x1 % DG/SR modification begin - Jun. 1, 1998 - Patch 3 (from Michael Vulis) % a mul y1 moveto 0 y2 rlineto stroke /x1 x1 1 add def } repeat grestore } % def a mul y1 moveto 0 y2 rlineto stroke /x1 x1 1 add def } repeat grestore pop pop } def % DG/SR modification end /BeginArrow { ADict begin /@mtrx CM def gsave 2 copy T 2 index sub neg exch 3 index sub exch Atan rotate newpath } def /EndArrow { @mtrx setmatrix CP grestore end } def /Arrow { CLW mul add dup 2 div /w ED mul dup /h ED mul /a ED { 0 h T 1 -1 scale } if w neg h moveto 0 0 L w h L w neg a neg rlineto gsave fill grestore } def /Tbar { CLW mul add /z ED z -2 div CLW 2 div moveto z 0 rlineto stroke 0 CLW moveto } def /Bracket { CLW mul add dup CLW sub 2 div /x ED mul CLW add /y ED /z CLW 2 div def x neg y moveto x neg CLW 2 div L x CLW 2 div L x y L stroke 0 CLW moveto } def /RoundBracket { CLW mul add dup 2 div /x ED mul /y ED /mtrx CM def 0 CLW 2 div T x y mul 0 ne { x y scale } if 1 1 moveto .85 .5 .35 0 0 0 curveto -.35 0 -.85 .5 -1 1 curveto mtrx setmatrix stroke 0 CLW moveto } def /SD { 0 360 arc fill } def /EndDot { { /z DS def } { /z 0 def } ifelse /b ED 0 z DS SD b { 0 z DS CLW sub SD } if 0 DS z add CLW 4 div sub moveto } def /Shadow { [ { /moveto load } { /lineto load } { /curveto load } { /closepath load } /pathforall load stopped { pop pop pop pop CP /moveto load } if ] cvx newpath 3 1 roll T exec } def /NArray { aload length 2 div dup dup cvi eq not { exch pop } if /n exch cvi def } def /NArray { /f ED counttomark 2 div dup cvi /n ED n eq not { exch pop } if f { ] aload /Points ED } { n 2 mul 1 add -1 roll pop } ifelse } def /Line { NArray n 0 eq not { n 1 eq { 0 0 /n 2 def } if ArrowA /n n 2 sub def n { Lineto } repeat CP 4 2 roll ArrowB L pop pop } if } def /Arcto { /a [ 6 -2 roll ] cvx def a r /arcto load stopped { 5 } { 4 } ifelse { pop } repeat a } def /CheckClosed { dup n 2 mul 1 sub index eq 2 index n 2 mul 1 add index eq and { pop pop /n n 1 sub def } if } def /Polygon { NArray n 2 eq { 0 0 /n 3 def } if n 3 lt { n { pop pop } repeat } { n 3 gt { CheckClosed } if n 2 mul -2 roll /y0 ED /x0 ED /y1 ED /x1 ED x1 y1 /x1 x0 x1 add 2 div def /y1 y0 y1 add 2 div def x1 y1 moveto /n n 2 sub def n { Lineto } repeat x1 y1 x0 y0 6 4 roll Lineto Lineto pop pop closepath } ifelse } def /Diamond { /mtrx CM def T rotate /h ED /w ED dup 0 eq { pop } { CLW mul neg /d ED /a w h Atan def /h d a sin Div h add def /w d a cos Div w add def } ifelse mark w 2 div h 2 div w 0 0 h neg w neg 0 0 h w 2 div h 2 div /ArrowA { moveto } def /ArrowB { } def false Line closepath mtrx setmatrix } def % DG modification begin - Jan. 15, 1997 %/Triangle { /mtrx CM def translate rotate /h ED 2 div /w ED dup 0 eq { %pop } { CLW mul /d ED /h h d w h Atan sin Div sub def /w w d h w Atan 2 %div dup cos exch sin Div mul sub def } ifelse mark 0 d w neg d 0 h w d 0 %d /ArrowA { moveto } def /ArrowB { } def false Line closepath mtrx %setmatrix } def /Triangle { /mtrx CM def translate rotate /h ED 2 div /w ED dup CLW mul /d ED /h h d w h Atan sin Div sub def /w w d h w Atan 2 div dup cos exch sin Div mul sub def mark 0 d w neg d 0 h w d 0 d /ArrowA { moveto } def /ArrowB { } def false Line closepath mtrx % DG/SR modification begin - Jun. 1, 1998 - Patch 3 (from Michael Vulis) % setmatrix } def setmatrix pop } def % DG/SR modification end /CCA { /y ED /x ED 2 copy y sub /dy1 ED x sub /dx1 ED /l1 dx1 dy1 Pyth def } def /CCA { /y ED /x ED 2 copy y sub /dy1 ED x sub /dx1 ED /l1 dx1 dy1 Pyth def } def /CC { /l0 l1 def /x1 x dx sub def /y1 y dy sub def /dx0 dx1 def /dy0 dy1 def CCA /dx dx0 l1 c exp mul dx1 l0 c exp mul add def /dy dy0 l1 c exp mul dy1 l0 c exp mul add def /m dx0 dy0 Atan dx1 dy1 Atan sub 2 div cos abs b exp a mul dx dy Pyth Div 2 div def /x2 x l0 dx mul m mul sub def /y2 y l0 dy mul m mul sub def /dx l1 dx mul m mul neg def /dy l1 dy mul m mul neg def } def /IC { /c c 1 add def c 0 lt { /c 0 def } { c 3 gt { /c 3 def } if } ifelse /a a 2 mul 3 div 45 cos b exp div def CCA /dx 0 def /dy 0 def } def /BOC { IC CC x2 y2 x1 y1 ArrowA CP 4 2 roll x y curveto } def /NC { CC x1 y1 x2 y2 x y curveto } def /EOC { x dx sub y dy sub 4 2 roll ArrowB 2 copy curveto } def /BAC { IC CC x y moveto CC x1 y1 CP ArrowA } def /NAC { x2 y2 x y curveto CC x1 y1 } def /EAC { x2 y2 x y ArrowB curveto pop pop } def /OpenCurve { NArray n 3 lt { n { pop pop } repeat } { BOC /n n 3 sub def n { NC } repeat EOC } ifelse } def /AltCurve { { false NArray n 2 mul 2 roll [ n 2 mul 3 sub 1 roll ] aload /Points ED n 2 mul -2 roll } { false NArray } ifelse n 4 lt { n { pop pop } repeat } { BAC /n n 4 sub def n { NAC } repeat EAC } ifelse } def /ClosedCurve { NArray n 3 lt { n { pop pop } repeat } { n 3 gt { CheckClosed } if 6 copy n 2 mul 6 add 6 roll IC CC x y moveto n { NC } repeat closepath pop pop } ifelse } def /SQ { /r ED r r moveto r r neg L r neg r neg L r neg r L fill } def /ST { /y ED /x ED x y moveto x neg y L 0 x L fill } def /SP { /r ED gsave 0 r moveto 4 { 72 rotate 0 r L } repeat fill grestore } def /FontDot { DS 2 mul dup matrix scale matrix concatmatrix exch matrix rotate matrix concatmatrix exch findfont exch makefont setfont } def /Rect { x1 y1 y2 add 2 div moveto x1 y2 lineto x2 y2 lineto x2 y1 lineto x1 y1 lineto closepath } def /OvalFrame { x1 x2 eq y1 y2 eq or { pop pop x1 y1 moveto x2 y2 L } { y1 y2 sub abs x1 x2 sub abs 2 copy gt { exch pop } { pop } ifelse 2 div exch { dup 3 1 roll mul exch } if 2 copy lt { pop } { exch pop } ifelse /b ED x1 y1 y2 add 2 div moveto x1 y2 x2 y2 b arcto x2 y2 x2 y1 b arcto x2 y1 x1 y1 b arcto x1 y1 x1 y2 b arcto 16 { pop } repeat closepath } ifelse } def /Frame { CLW mul /a ED 3 -1 roll 2 copy gt { exch } if a sub /y2 ED a add /y1 ED 2 copy gt { exch } if a sub /x2 ED a add /x1 ED 1 index 0 eq { pop pop Rect } { OvalFrame } ifelse } def /BezierNArray { /f ED counttomark 2 div dup cvi /n ED n eq not { exch pop } if n 1 sub neg 3 mod 3 add 3 mod { 0 0 /n n 1 add def } repeat f { ] aload /Points ED } { n 2 mul 1 add -1 roll pop } ifelse } def /OpenBezier { BezierNArray n 1 eq { pop pop } { ArrowA n 4 sub 3 idiv { 6 2 roll 4 2 roll curveto } repeat 6 2 roll 4 2 roll ArrowB curveto } ifelse } def /ClosedBezier { BezierNArray n 1 eq { pop pop } { moveto n 1 sub 3 idiv { 6 2 roll 4 2 roll curveto } repeat closepath } ifelse } def /BezierShowPoints { gsave Points aload length 2 div cvi /n ED moveto n 1 sub { lineto } repeat CLW 2 div SLW [ 4 4 ] 0 setdash stroke grestore } def /Parab { /y0 exch def /x0 exch def /y1 exch def /x1 exch def /dx x0 x1 sub 3 div def /dy y0 y1 sub 3 div def x0 dx sub y0 dy add x1 y1 ArrowA x0 dx add y0 dy add x0 2 mul x1 sub y1 ArrowB curveto /Points [ x1 y1 x0 y0 x0 2 mul x1 sub y1 ] def } def /Grid { newpath /a 4 string def /b ED /c ED /n ED cvi dup 1 lt { pop 1 } if /s ED s div dup 0 eq { pop 1 } if /dy ED s div dup 0 eq { pop 1 } if /dx ED dy div round dy mul /y0 ED dx div round dx mul /x0 ED dy div round cvi /y2 ED dx div round cvi /x2 ED dy div round cvi /y1 ED dx div round cvi /x1 ED /h y2 y1 sub 0 gt { 1 } { -1 } ifelse def /w x2 x1 sub 0 gt { 1 } { -1 } ifelse def b 0 gt { /z1 b 4 div CLW 2 div add def /Helvetica findfont b scalefont setfont /b b .95 mul CLW 2 div add def } if systemdict /setstrokeadjust known { true setstrokeadjust /t { } def } { /t { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } bind def } ifelse gsave n 0 gt { 1 setlinecap [ 0 dy n div ] dy n div 2 div setdash } { 2 setlinecap } ifelse /i x1 def /f y1 dy mul n 0 gt { dy n div 2 div h mul sub } if def /g y2 dy mul n 0 gt { dy n div 2 div h mul add } if def x2 x1 sub w mul 1 add dup 1000 gt { pop 1000 } if { i dx mul dup y0 moveto b 0 gt { gsave c i a cvs dup stringwidth pop /z2 ED w 0 gt {z1} {z1 z2 add neg} ifelse h 0 gt {b neg} {z1} ifelse rmoveto show grestore } if dup t f moveto g t L stroke /i i w add def } repeat grestore gsave n 0 gt % DG/SR modification begin - Nov. 7, 1997 - Patch 1 %{ 1 setlinecap [ 0 dx n div ] dy n div 2 div setdash } { 1 setlinecap [ 0 dx n div ] dx n div 2 div setdash } % DG/SR modification end { 2 setlinecap } ifelse /i y1 def /f x1 dx mul n 0 gt { dx n div 2 div w mul sub } if def /g x2 dx mul n 0 gt { dx n div 2 div w mul add } if def y2 y1 sub h mul 1 add dup 1000 gt { pop 1000 } if { newpath i dy mul dup x0 exch moveto b 0 gt { gsave c i a cvs dup stringwidth pop /z2 ED w 0 gt {z1 z2 add neg} {z1} ifelse h 0 gt {z1} {b neg} ifelse rmoveto show grestore } if dup f exch t moveto g exch t L stroke /i i h add def } repeat grestore } def /ArcArrow { /d ED /b ED /a ED gsave newpath 0 -1000 moveto clip newpath 0 1 0 0 b grestore c mul /e ED pop pop pop r a e d PtoC y add exch x add exch r a PtoC y add exch x add exch b pop pop pop pop a e d CLW 8 div c mul neg d } def /Ellipse { /mtrx CM def T scale 0 0 1 5 3 roll arc mtrx setmatrix } def /Rot { CP CP translate 3 -1 roll neg rotate NET } def /RotBegin { tx@Dict /TMatrix known not { /TMatrix { } def /RAngle { 0 } def } if /TMatrix [ TMatrix CM ] cvx def /a ED a Rot /RAngle [ RAngle dup a add ] cvx def } def /RotEnd { /TMatrix [ TMatrix setmatrix ] cvx def /RAngle [ RAngle pop ] cvx def } def /PutCoor { gsave CP T CM STV exch exec moveto setmatrix CP grestore } def /PutBegin { /TMatrix [ TMatrix CM ] cvx def CP 4 2 roll T moveto } def /PutEnd { CP /TMatrix [ TMatrix setmatrix ] cvx def moveto } def /Uput { /a ED add 2 div /h ED 2 div /w ED /s a sin def /c a cos def /b s abs c abs 2 copy gt dup /q ED { pop } { exch pop } ifelse def /w1 c b div w mul def /h1 s b div h mul def q { w1 abs w sub dup c mul abs } { h1 abs h sub dup s mul abs } ifelse } def /UUput { /z ED abs /y ED /x ED q { x s div c mul abs y gt } { x c div s mul abs y gt } ifelse { x x mul y y mul sub z z mul add sqrt z add } { q { x s div } { x c div } ifelse abs } ifelse a PtoC h1 add exch w1 add exch } def /BeginOL { dup (all) eq exch TheOL eq or { IfVisible not { Visible /IfVisible true def } if } { IfVisible { Invisible /IfVisible false def } if } ifelse } def /InitOL { /OLUnit [ 3000 3000 matrix defaultmatrix dtransform ] cvx def /Visible { CP OLUnit idtransform T moveto } def /Invisible { CP OLUnit neg exch neg exch idtransform T moveto } def /BOL { BeginOL } def /IfVisible true def } def end % END pstricks.pro %%EndProcSet %%BeginProcSet: pst-dots.pro %!PS-Adobe-2.0 %%Title: Dot Font for PSTricks %%Creator: <a href="/keyword/timothy-van-zandt/" >timothy van zandt</a> &lt;tvz@Princeton.EDU&gt; %%Creation Date: May 7, 1993 %% Version 97 patch 1, 99/12/16 %% Modified by Etienne Riga &lt;etienne.riga@skynet.be&gt; - Dec. 16, 1999 %% to add /Diamond, /SolidDiamond and /BoldDiamond 10 dict dup begin /FontType 3 def /FontMatrix [ .001 0 0 .001 0 0 ] def /FontBBox [ 0 0 0 0 ] def /Encoding 256 array def 0 1 255 { Encoding exch /.notdef put } for % % % % % % Encoding dup (b) 0 get /Bullet put dup (c) 0 get /Circle put dup (C) 0 get /BoldCircle put dup (u) 0 get /SolidTriangle put dup (t) 0 get /Triangle put dup (T) 0 get /BoldTriangle put dup (r) 0 get /SolidSquare put dup (s) 0 get /Square put dup (S) 0 get /BoldSquare put dup (q) 0 get /SolidPentagon put dup (p) 0 get /Pentagon put dup (P) 0 get /BoldPentagon put DG/SR modification begin - Dec. 16, 1999 - From Etienne Riga dup (l) 0 get /SolidDiamond put dup (d) 0 get /Diamond put (D) 0 get /BoldDiamond put DG/SR modification end /Metrics 13 dict def Metrics begin /Bullet 1000 def /Circle 1000 def /BoldCircle 1000 def /SolidTriangle 1344 def /Triangle 1344 def /BoldTriangle 1344 def /SolidSquare 886 def /Square 886 def /BoldSquare 886 def /SolidPentagon 1093.2 def /Pentagon 1093.2 def /BoldPentagon 1093.2 def DG/SR modification begin - Dec. 16, 1999 - From Etienne Riga /SolidDiamond 1008 def /Diamond 1008 def /BoldDiamond 1008 def DG/SR modification end /.notdef 0 def end /BBoxes 13 dict def BBoxes begin /Circle { -550 -550 550 550 } def /BoldCircle /Circle load def /Bullet /Circle load def /Triangle { -571.5 -330 571.5 660 } def /BoldTriangle /Triangle load def /SolidTriangle /Triangle load def /Square { -450 -450 450 450 } def /BoldSquare /Square load def /SolidSquare /Square load def /Pentagon { -546.6 -465 546.6 574.7 } def /BoldPentagon /Pentagon load def /SolidPentagon /Pentagon load def DG/SR modification begin - Dec. 16, 1999 - From Etienne Riga /Diamond { -428.5 -742.5 428.5 742.5 } def /BoldDiamond /Diamond load def /SolidDiamond /Diamond load def DG/SR modification end /.notdef { 0 0 0 0 } def end /CharProcs 20 dict def CharProcs begin /Adjust { 2 copy dtransform floor .5 add exch floor .5 add exch idtransform 3 -1 roll div 3 1 roll exch div exch scale } def /CirclePath { 0 0 500 0 360 arc closepath } def /Bullet { 500 500 Adjust CirclePath fill } def /Circle { 500 500 Adjust CirclePath .9 .9 scale CirclePath eofill } def /BoldCircle { 500 500 Adjust CirclePath .8 .8 scale CirclePath eofill } def /BoldCircle { CirclePath .8 .8 scale CirclePath eofill } def /TrianglePath { 0 660 moveto -571.5 -330 lineto 571.5 -330 lineto closepath } def /SolidTriangle { TrianglePath fill } def /Triangle { TrianglePath .85 .85 scale TrianglePath eofill } def /BoldTriangle { TrianglePath .7 .7 scale TrianglePath eofill } def /SquarePath { -450 450 moveto 450 450 lineto 450 -450 lineto -450 -450 lineto closepath } def /SolidSquare { SquarePath fill } def /Square { SquarePath .89 .89 scale SquarePath eofill } def /BoldSquare { SquarePath .78 .78 scale SquarePath eofill } def /PentagonPath { -337.8 -465 moveto 337.8 -465 lineto 546.6 177.6 lineto 0 574.7 lineto -546.6 177.6 lineto closepath } def /SolidPentagon { PentagonPath fill } def /Pentagon { PentagonPath .89 .89 scale PentagonPath eofill } def /BoldPentagon { PentagonPath .78 .78 scale PentagonPath eofill } def % DG/SR modification begin - Dec. 16, 1999 - From Etienne Riga /DiamondPath { 0 742.5 moveto -428.5 0 lineto 0 -742.5 lineto 428.5 0 lineto closepath } def /SolidDiamond { DiamondPath fill } def /Diamond { DiamondPath .85 .85 scale DiamondPath eofill } def /BoldDiamond { DiamondPath .7 .7 scale DiamondPath eofill } def % DG/SR modification end /.notdef { } def end /BuildGlyph { exch begin Metrics 1 index get exec 0 BBoxes 3 index get exec setcachedevice CharProcs begin load exec end end } def /BuildChar { 1 index /Encoding get exch get 1 index /BuildGlyph get exec } bind def end /PSTricksDotFont exch definefont pop %END pst-dots.pro %%EndProcSet %%BeginProcSet: pst-grad.pro %! % PostScript prologue for pst-grad.tex. % Version 97, 93/05/12 % For distribution, see pstricks.tex. % % For the PSTricks gradient fillstyle. % % Based on some EPS files by leeweyr!bill@nuchat.sccsi.com (W. R. Lee). % % Syntax: % R0 G0 B0 R1 G1 B1 NumLines MidPoint Angle GradientFill /tx@GradientDict 40 dict def tx@GradientDict begin /GradientFill { rotate /MidPoint ED /NumLines ED /LastBlue ED /LastGreen ED /LastRed ED /FirstBlue ED /FirstGreen ED /FirstRed ED % This avoids gaps due to rounding errors: clip pathbbox %leave llx,lly,urx,ury on stack /y ED /x ED 2 copy translate y sub neg /y ED x sub neg /x ED % This avoids gaps due to rounding errors: LastRed FirstRed add 2 div LastGreen FirstGreen add 2 div LastBlue FirstBlue add 2 div setrgbcolor fill /YSizePerLine y NumLines div def /CurrentY 0 def /MidLine NumLines 1 MidPoint sub mul abs cvi def MidLine NumLines 2 sub gt { /MidLine NumLines def } { MidLine 2 lt { /MidLine 0 def } if } ifelse MidLine 0 gt { /Red FirstRed def /Green FirstGreen def /Blue FirstBlue def /RedIncrement LastRed FirstRed sub MidLine 1 sub div def /GreenIncrement LastGreen FirstGreen sub MidLine 1 sub div def /BlueIncrement LastBlue FirstBlue sub MidLine 1 sub div def MidLine { GradientLoop } repeat } if MidLine NumLines lt /Red LastRed def /Green LastGreen def /Blue LastBlue def /RedIncrement FirstRed LastRed sub NumLines MidLine sub 1 sub div def /GreenIncrement FirstGreen LastGreen sub NumLines MidLine sub 1 sub div def /BlueIncrement FirstBlue LastBlue sub NumLines MidLine sub 1 sub div def NumLines MidLine sub { GradientLoop } repeat } if } def /GradientLoop { 0 CurrentY moveto x 0 rlineto 0 YSizePerLine rlineto x neg 0 rlineto closepath Red Green Blue setrgbcolor fill /CurrentY CurrentY YSizePerLine add def /Blue Blue BlueIncrement add def /Green Green GreenIncrement add def /Red Red RedIncrement add def } def end % END pst-grad.pro %%EndProcSet %%BeginProcSet: pst-node.pro %! % PostScript prologue for pst-node.tex. % Version 97 patch 1, 97/05/09. % For distribution, see pstricks.tex. % /tx@NodeDict 400 dict def tx@NodeDict begin tx@Dict begin /T /translate load def end /NewNode { gsave /next ED dict dup 3 1 roll def exch { dup 3 1 roll def } if begin tx@Dict begin STV CP T exec end /NodeMtrx CM def next end grestore } def /InitPnode { /Y ED /X ED /NodePos { NodeSep Cos mul NodeSep Sin mul } def } def /InitCnode { /r ED /Y ED /X ED /NodePos { NodeSep r add dup Cos mul exch Sin mul } def } def /GetRnodePos { Cos 0 gt { /dx r NodeSep add def } { /dx l NodeSep sub def } ifelse Sin 0 gt { /dy u NodeSep add def } { /dy d NodeSep sub def } ifelse dx Sin mul abs dy Cos mul abs gt { dy Cos mul Sin div dy } { dx dup Sin mul Cos Div } ifelse } def /InitRnode { /Y ED /X ED X sub /r ED /l X neg def Y add neg /d ED Y sub /u ED /NodePos { GetRnodePos } def } def /DiaNodePos { w h mul w Sin mul abs h Cos mul abs add Div NodeSep add dup Cos mul exch Sin mul } def /TriNodePos { Sin s lt { d NodeSep sub dup Cos mul Sin Div exch } { w h mul w Sin mul h Cos abs mul add Div NodeSep add dup Cos mul exch Sin mul } ifelse } def /InitTriNode { sub 2 div exch 2 div exch 2 copy T 2 copy 4 index index /d ED pop pop pop pop -90 mul rotate /NodeMtrx CM def /X 0 def /Y 0 def d sub abs neg /d ED d add /h ED 2 div h mul h d sub Div /w ED /s d w Atan sin def /NodePos { TriNodePos } def } def /OvalNodePos { /ww w NodeSep add def /hh h NodeSep add def Sin ww mul Cos hh mul Atan dup cos ww mul exch sin hh mul } def { /GetCenter { begin X Y NodeMtrx transform CM itransform end } def /XYPos { dup sin exch cos Do /Cos ED /Sin ED /Dist ED Cos 0 gt { Dist Dist Sin mul Cos div } { Cos 0 lt { Dist neg Dist Sin mul Cos div neg } { 0 Dist Sin mul } ifelse } ifelse Do } def /GetEdge { dup 0 eq { pop begin 1 0 NodeMtrx dtransform CM idtransform exch atan sub dup sin /Sin ED cos /Cos ED /NodeSep ED NodePos NodeMtrx dtransform CM idtransform end } { 1 eq {{exch}} {{}} ifelse /Do ED pop XYPos } ifelse } def /AddOffset { 1 index 0 eq { pop pop } { 2 copy 5 2 roll cos mul add 4 1 roll sin mul sub exch } ifelse } def /GetEdgeA { NodeSepA AngleA NodeA NodeSepTypeA GetEdge OffsetA AngleA AddOffset yA add /yA1 ED xA add /xA1 ED } def /GetEdgeB { NodeSepB AngleB NodeB NodeSepTypeB GetEdge OffsetB AngleB AddOffset yB add /yB1 ED xB add /xB1 ED } def /GetArmA { ArmTypeA 0 eq { /xA2 ArmA AngleA cos mul xA1 add def /yA2 ArmA AngleA sin mul yA1 add def } { ArmTypeA 1 eq {{exch}} {{}} ifelse /Do ED ArmA AngleA XYPos OffsetA AngleA AddOffset yA add /yA2 ED xA add /xA2 ED } ifelse } def /GetArmB { ArmTypeB 0 eq { /xB2 ArmB AngleB cos mul xB1 add def /yB2 ArmB AngleB sin mul yB1 add def } { ArmTypeB 1 eq {{exch}} {{}} ifelse /Do ED ArmB AngleB XYPos OffsetB AngleB AddOffset yB add /yB2 ED xB add /xB2 ED } ifelse } def /InitNC { /b ED /a ED /NodeSepTypeB ED /NodeSepTypeA ED /NodeSepB ED /NodeSepA ED /OffsetB ED /OffsetA ED tx@NodeDict a known tx@NodeDict b known and dup { /NodeA a load def /NodeB b load def NodeA GetCenter /yA ED /xA ED NodeB GetCenter /yB ED /xB ED } if } def /LPutLine { 4 copy 3 -1 roll sub neg 3 1 roll sub Atan /NAngle ED 1 t sub mul 3 1 roll 1 t sub mul 4 1 roll t mul add /Y ED t mul add /X ED } def /LPutLines { mark LPutVar counttomark 2 div 1 sub /n ED t floor dup n gt { pop n 1 sub /t 1 def } { dup t sub neg /t ED } ifelse cvi 2 mul { pop } repeat LPutLine cleartomark } def /BezierMidpoint { /y3 ED /x3 ED /y2 ED /x2 ED /y1 ED /x1 ED /y0 ED /x0 ED /t ED /cx x1 x0 sub 3 mul def /cy y1 y0 sub 3 mul def /bx x2 x1 sub 3 mul cx sub def /by y2 y1 sub 3 mul cy sub def /ax x3 x0 sub cx sub bx sub def /ay y3 y0 sub cy sub by sub def ax t 3 exp mul bx t t mul mul add cx t mul add x0 add ay t 3 exp mul by t t mul mul add cy t mul add y0 add 3 ay t t mul mul mul 2 by t mul mul add cy add 3 ax t t mul mul mul 2 bx t mul mul add cx add atan /NAngle ED /Y ED /X ED } def /HPosBegin { yB yA ge { /t 1 t sub def } if /Y yB yA sub t mul yA add def } def /HPosEnd { /X Y yyA sub yyB yyA sub Div xxB xxA sub mul xxA add def /NAngle yyB yyA sub xxB xxA sub Atan def } def /HPutLine { HPosBegin /yyA ED /xxA ED /yyB ED /xxB ED HPosEnd } def /HPutLines { HPosBegin yB yA ge { /check { le } def } { /check { ge } def } ifelse /xxA xA def /yyA yA def mark xB yB LPutVar { dup Y check { exit } { /yyA ED /xxA ED } ifelse } loop /yyB ED /xxB ED cleartomark HPosEnd } def /VPosBegin { xB xA lt { /t 1 t sub def } if /X xB xA sub t mul xA add def } def /VPosEnd { /Y X xxA sub xxB xxA sub Div yyB yyA sub mul yyA add def /NAngle yyB yyA sub xxB xxA sub Atan def } def /VPutLine { VPosBegin /yyA ED /xxA ED /yyB ED /xxB ED VPosEnd } def /VPutLines { VPosBegin xB xA ge { /check { le } def } { /check { ge } def } ifelse /xxA xA def /yyA yA def mark xB yB LPutVar { 1 index X check { exit } { /yyA ED /xxA ED } ifelse } loop /yyB ED /xxB ED cleartomark VPosEnd } def /HPutCurve { gsave newpath /SaveLPutVar /LPutVar load def LPutVar 8 -2 roll moveto curveto flattenpath /LPutVar [ {} {} {} {} pathforall ] cvx def grestore exec /LPutVar /SaveLPutVar load def } def /NCCoor { /AngleA yB yA sub xB xA sub Atan def /AngleB AngleA 180 add def GetEdgeA GetEdgeB /LPutVar [ xB1 yB1 xA1 yA1 ] cvx def /LPutPos { LPutVar LPutLine } def /HPutPos { LPutVar HPutLine } def /VPutPos { LPutVar VPutLine } def LPutVar } def /NCLine { NCCoor tx@Dict begin ArrowA CP 4 2 roll ArrowB lineto pop pop end } def /NCLines { false NArray n 0 eq { NCLine } { 2 copy yA sub exch xA sub Atan /AngleA ED n 2 mul dup index exch index yB sub exch xB sub Atan /AngleB ED GetEdgeA GetEdgeB /LPutVar [ xB1 yB1 n 2 mul 4 add 4 roll xA1 yA1 ] cvx def mark LPutVar tx@Dict begin false Line end /LPutPos { LPutLines } def /HPutPos { HPutLines } def /VPutPos { VPutLines } def } ifelse } def /NCCurve { GetEdgeA GetEdgeB xA1 xB1 sub yA1 yB1 sub Pyth 2 div dup 3 -1 roll mul /ArmA ED mul /ArmB ED /ArmTypeA 0 def /ArmTypeB 0 def GetArmA GetArmB xA2 yA2 xA1 yA1 tx@Dict begin ArrowA end xB2 yB2 xB1 yB1 tx@Dict begin ArrowB end curveto /LPutVar [ xA1 yA1 xA2 yA2 xB2 yB2 xB1 yB1 ] cvx def /LPutPos { t LPutVar BezierMidpoint } def /HPutPos { { HPutLines } HPutCurve } def /VPutPos { { VPutLines } HPutCurve } def } def /NCAngles { GetEdgeA GetEdgeB GetArmA GetArmB /mtrx AngleA matrix rotate def xA2 yA2 mtrx transform pop xB2 yB2 mtrx transform exch pop mtrx itransform /y0 ED /x0 ED mark ArmB 0 ne { xB1 yB1 } if xB2 yB2 x0 y0 xA2 yA2 ArmA 0 ne { xA1 yA1 } if tx@Dict begin false Line end /LPutVar [ xB1 yB1 xB2 yB2 x0 y0 xA2 yA2 xA1 yA1 ] cvx def /LPutPos { LPutLines } def /HPutPos { HPutLines } def /VPutPos { VPutLines } def } def /NCAngle { GetEdgeA GetEdgeB GetArmB /mtrx AngleA matrix rotate def xB2 yB2 mtrx itransform pop xA1 yA1 mtrx itransform exch pop mtrx transform /y0 ED /x0 ED mark ArmB 0 ne { xB1 yB1 } if xB2 yB2 x0 y0 xA1 yA1 tx@Dict begin false Line end /LPutVar [ xB1 yB1 xB2 yB2 x0 y0 xA1 yA1 ] cvx def /LPutPos { LPutLines } def /HPutPos { HPutLines } def /VPutPos { VPutLines } def } def /NCBar { GetEdgeA GetEdgeB GetArmA GetArmB /mtrx AngleA matrix rotate def xA2 yA2 mtrx itransform pop xB2 yB2 mtrx itransform pop sub dup 0 mtrx transform 3 -1 roll 0 gt { /yB2 exch yB2 add def /xB2 exch xB2 add def } { /yA2 exch neg yA2 add def /xA2 exch neg xA2 add def } ifelse mark ArmB 0 ne { xB1 yB1 } if xB2 yB2 xA2 yA2 ArmA 0 ne { xA1 yA1 } if tx@Dict begin false Line end /LPutVar [ xB1 yB1 xB2 yB2 xA2 yA2 xA1 yA1 ] cvx def /LPutPos { LPutLines } def /HPutPos { HPutLines } def /VPutPos { VPutLines } def } def /NCDiag { GetEdgeA GetEdgeB GetArmA GetArmB mark ArmB 0 ne { xB1 yB1 } if xB2 yB2 xA2 yA2 ArmA 0 ne { xA1 yA1 } if tx@Dict begin false Line end /LPutVar [ xB1 yB1 xB2 yB2 xA2 yA2 xA1 yA1 ] cvx def /LPutPos { LPutLines } def /HPutPos { HPutLines } def /VPutPos { VPutLines } def } def /NCDiagg { GetEdgeA GetArmA yB yA2 sub xB xA2 sub Atan 180 add /AngleB ED GetEdgeB mark xB1 yB1 xA2 yA2 ArmA 0 ne { xA1 yA1 } if tx@Dict begin false Line end /LPutVar [ xB1 yB1 xA2 yA2 xA1 yA1 ] cvx def /LPutPos { LPutLines } def /HPutPos { HPutLines } def /VPutPos { VPutLines } def } def /NCLoop { GetEdgeA GetEdgeB GetArmA GetArmB /mtrx AngleA matrix rotate def xA2 yA2 mtrx transform loopsize add /yA3 ED /xA3 ED /xB3 xB2 yB2 mtrx transform pop def xB3 yA3 mtrx itransform /yB3 ED /xB3 ED xA3 yA3 mtrx itransform /yA3 ED /xA3 ED mark ArmB 0 ne { xB1 yB1 } if xB2 yB2 xB3 yB3 xA3 yA3 xA2 yA2 ArmA 0 ne { xA1 yA1 } if tx@Dict begin false Line end /LPutVar [ xB1 yB1 xB2 yB2 xB3 yB3 xA3 yA3 xA2 yA2 xA1 yA1 ] cvx def /LPutPos { LPutLines } def /HPutPos { HPutLines } def /VPutPos { VPutLines } def } def % DG/SR modification begin - May 9, 1997 - Patch 1 %/NCCircle { 0 0 NodesepA nodeA \tx@GetEdge pop xA sub 2 div dup 2 exp r %r mul sub abs sqrt atan 2 mul /a ED r AngleA 90 add PtoC yA add exch xA add %exch 2 copy /LPutVar [ 4 2 roll r AngleA ] cvx def /LPutPos { LPutVar t 360 %mul add dup 5 1 roll 90 sub \tx@PtoC 3 -1 roll add /Y ED add /X ED /NAngle ED /NCCircle { NodeSepA 0 NodeA 0 GetEdge pop 2 div dup 2 exp r r mul sub abs sqrt atan 2 mul /a ED r AngleA 90 add PtoC yA add exch xA add exch 2 copy /LPutVar [ 4 2 roll r AngleA ] cvx def /LPutPos { LPutVar t 360 mul add dup 5 1 roll 90 sub PtoC 3 -1 roll add /Y ED add /X ED /NAngle ED % DG/SR modification end } def /HPutPos { LPutPos } def /VPutPos { LPutPos } def r AngleA 90 sub a add AngleA 270 add a sub tx@Dict begin /angleB ED /angleA ED /r ED /c 57.2957 r Div def /y ED /x ED } def /NCBox { /d ED /h ED /AngleB yB yA sub xB xA sub Atan def /AngleA AngleB 180 add def GetEdgeA GetEdgeB /dx d AngleB sin mul def /dy d AngleB cos mul neg def /hx h AngleB sin mul neg def /hy h AngleB cos mul def /LPutVar [ xA1 hx add yA1 hy add xB1 hx add yB1 hy add xB1 dx add yB1 dy add xA1 dx add yA1 dy add ] cvx def /LPutPos { LPutLines } def /HPutPos { xB yB xA yA LPutLine } def /VPutPos { HPutPos } def mark LPutVar tx@Dict begin false Polygon end } def /NCArcBox { /l ED neg /d ED /h ED /a ED /AngleA yB yA sub xB xA sub Atan def /AngleB AngleA 180 add def /tA AngleA a sub 90 add def /tB tA a 2 mul add def /r xB xA sub tA cos tB cos sub Div dup 0 eq { pop 1 } if def /x0 xA r tA cos mul add def /y0 yA r tA sin mul add def /c 57.2958 r div def /AngleA AngleA a sub 180 add def /AngleB AngleB a add 180 add def GetEdgeA GetEdgeB /AngleA tA 180 add yA yA1 sub xA xA1 sub Pyth c mul sub def /AngleB tB 180 add yB yB1 sub xB xB1 sub Pyth c mul add def l 0 eq { x0 y0 r h add AngleA AngleB arc x0 y0 r d add AngleB AngleA arcn } { x0 y0 translate /tA AngleA l c mul add def /tB AngleB l c mul sub def 0 0 r h add tA tB arc r h add AngleB PtoC r d add AngleB PtoC 2 copy 6 2 roll l arcto 4 { pop } repeat r d add tB PtoC l arcto 4 { pop } repeat 0 0 r d add tB tA arcn r d add AngleA PtoC r h add AngleA PtoC 2 copy 6 2 roll l arcto 4 { pop } repeat r h add tA PtoC l arcto 4 { pop } repeat } ifelse closepath /LPutVar [ x0 y0 r AngleA AngleB h d ] cvx def /LPutPos { LPutVar /d ED /h ED /AngleB ED /AngleA ED /r ED /y0 ED /x0 ED t 1 le { r h add AngleA 1 t sub mul AngleB t mul add dup 90 add /NAngle ED PtoC } { t 2 lt { /NAngle AngleB 180 add def r 2 t sub h mul t 1 sub d mul add add AngleB PtoC } { t 3 lt { r d add AngleB 3 t sub mul AngleA 2 t sub mul add dup 90 sub /NAngle ED PtoC } { /NAngle AngleA 180 add def r 4 t sub d mul t 3 sub h mul add add AngleA PtoC } ifelse } ifelse } ifelse y0 add /Y ED x0 add /X ED } def /HPutPos { LPutPos } def /VPutPos { LPutPos } def } def /Tfan { /AngleA yB yA sub xB xA sub Atan def GetEdgeA w xA1 xB sub yA1 yB sub Pyth Pyth w Div CLW 2 div mul 2 div dup AngleA sin mul yA1 add /yA1 ED AngleA cos mul xA1 add /xA1 ED /LPutVar [ xA1 yA1 m { xB w add yB xB w sub yB } { xB yB w sub xB yB w add } ifelse xA1 yA1 ] cvx def /LPutPos { LPutLines } def /VPutPos@ { LPutVar flag { 8 4 roll pop pop pop pop } { pop pop pop pop 4 2 roll } ifelse } def /VPutPos { VPutPos@ VPutLine } def /HPutPos { VPutPos@ HPutLine } def mark LPutVar tx@Dict begin /ArrowA { moveto } def /ArrowB { } def false Line closepath end } def /LPutCoor { NAngle tx@Dict begin /NAngle ED end gsave CM STV CP Y sub neg exch X sub neg exch moveto setmatrix CP grestore } def /LPut { tx@NodeDict /LPutPos known { LPutPos } { CP /Y ED /X ED /NAngle 0 def } ifelse LPutCoor } def /HPutAdjust { Sin Cos mul 0 eq { 0 } { d Cos mul Sin div flag not { neg } if h Cos mul Sin div flag { neg } if 2 copy gt { pop } { exch pop } ifelse } ifelse s add flag { r add neg } { l add } ifelse X add /X ED } def /VPutAdjust { Sin Cos mul 0 eq { 0 } { l Sin mul Cos div flag { neg } if r Sin mul Cos div flag not { neg } if 2 copy gt { pop } { exch pop } ifelse } ifelse s add flag { d add } { h add neg } ifelse Y add /Y ED } def end % END pst-node.pro %%EndProcSet %%BeginProcSet: pst-slpe.pro %% %% This is file `pst-slpe.pro', %% generated with the docstrip utility. %% %% The original source files were: %% %% pst-slpe.dtx (with options: `prolog') %% %% IMPORTANT NOTICE: %% %% For the copyright see the source file. %% %% Any modified versions of this file must be renamed %% with new filenames distinct from pst-slpe.pro. %% %% For distribution of the original source see the terms %% for copying and modification in the file pst-slpe.dtx. %% %% This generated file may be distributed as long as the %% original source files, as listed above, are part of the %% same distribution. (The sources need not necessarily be %% in the same archive or directory.) /tx@PstSlopeDict 60 dict def tx@PstSlopeDict begin /max {2 copy lt {exch} if pop} bind def /Iterate { 1 sub /NumSegs ED dup mul 3 1 roll dup mul 3 1 roll dup mul 3 1 roll setrgbcolor currenthsbcolor /ThisB ED /ThisS ED /ThisH ED /ThisPt ED gsave fill grestore NumSegs { dup mul 3 1 roll dup mul 3 1 roll dup mul 3 1 roll setrgbcolor currenthsbcolor /NextB ED /NextS ED /NextH ED /NextPt ED ThisPt NextPt sub ThisPt div NumSteps mul cvi /SegSteps exch def /NumSteps NumSteps SegSteps sub def SegSteps 0 eq not { ThisS 0 eq {/ThisH NextH def} if NextS 0 eq {/NextH ThisH def} if ThisH NextH sub 0.5 gt {/NextH NextH 1.0 add def} { NextH ThisH sub 0.5 ge {/ThisH ThisH 1.0 add def} if } ifelse /B ThisB def /S ThisS def /H ThisH def /BInc NextB ThisB sub SegSteps div def /SInc NextS ThisS sub SegSteps div def /HInc NextH ThisH sub SegSteps div def SegSteps { H dup 1. gt {1. sub} if S B sethsbcolor currentrgbcolor sqrt 3 1 roll sqrt 3 1 roll sqrt 3 1 roll setrgbcolor DrawStep /H H HInc add def /S S SInc add def /B B BInc add def } bind repeat /ThisH NextH def /ThisS NextS def /ThisB NextB def /ThisPt NextPt def } if } bind repeat } def /PatchRadius { Radius 0 eq { /UpdRR { dup mul exch dup mul add RR max /RR ED } bind def gsave flattenpath /RR 0 def {UpdRR} {UpdRR} {} {} pathforall grestore /Radius RR sqrt def } if } def /SlopesFill { gsave 180 add rotate /NumSteps ED clip pathbbox /h ED /w ED 2 copy translate h sub neg /h ED w sub neg /w ED /XInc w NumSteps div def /DrawStep { 0 0 XInc h rectfill XInc 0 translate } bind def Iterate grestore } def /CcSlopesFill { gsave /Radius ED /CenterY ED /CenterX ED /NumSteps ED clip pathbbox /h ED /w ED 2 copy translate h sub neg /h ED w sub neg /w ED w CenterX mul h CenterY mul translate PatchRadius /RadPerStep Radius NumSteps div neg def /Rad Radius def /DrawStep { 0 0 Rad 0 360 arc closepath fill /Rad Rad RadPerStep add def } bind def Iterate grestore } def /RadSlopesFill { gsave rotate /Radius ED /CenterY ED /CenterX ED /NumSteps ED clip pathbbox /h ED /w ED 2 copy translate h sub neg /h ED w sub neg /w ED w CenterX mul h CenterY mul translate PatchRadius /AngleIncrement 360 NumSteps div neg def /dY AngleIncrement sin AngleIncrement cos div Radius mul def /DrawStep { 0 0 moveto Radius 0 rlineto 0 dY rlineto closepath fill AngleIncrement rotate } bind def Iterate grestore } def end %%EndProcSet %%BeginProcSet: pst-coil.pro %! % PostScript prologue for pst-coil.tex. % Version 97 patch 1, 98/06/02 % For distribution, see pstricks.tex. % /tx@CoilDict 40 dict def tx@CoilDict begin /CoilLoop { /t ED t sin AspectSin mul t 180 div AspectCos mul add t cos lineto } def /Coil { /Inc ED dup sin /AspectSin ED cos /AspectCos ED /ArmB ED /ArmA ED /h ED /w ED /y1 ED /x1 ED /y0 ED /x0 ED x0 y0 translate y1 y0 sub x1 x0 sub 2 copy Pyth /TotalLength ED Atan rotate /BeginAngle ArmA AspectCos Div w h mul Div 360 mul def /EndAngle TotalLength ArmB sub AspectCos Div w h mul Div 360 mul def 1 0 0 0 ArrowA ArmA 0 lineto /mtrx CM def w h mul 2 Div w 2 Div scale BeginAngle Inc EndAngle { CoilLoop } for EndAngle CoilLoop mtrx setmatrix TotalLength ArmB sub 0 lineto CP % DG/SR modification begin - Jun. 2, 1998 - Patch 1 (from Michael Vulis) % TotalLength 0 ArrowB lineto } def TotalLength 0 ArrowB lineto pop pop pop pop } def % DG/SR modification end /AltCoil { /Inc ED dup sin /AspectSin ED cos /AspectCos ED /h ED /w ED /EndAngle ED /BeginAngle ED /mtrx CM def w h mul 2 Div w 2 Div scale BeginAngle sin AspectSin mul BeginAngle 180 div AspectCos mul add BeginAngle cos /lineto load stopped { moveto } if BeginAngle Inc EndAngle { CoilLoop } for EndAngle CoilLoop mtrx setmatrix } def /ZigZag { /ArmB ED /ArmA ED 2 div /w ED w mul /h ED /y1 ED /x1 ED /y0 ED /x0 ED x1 y1 translate y0 y1 sub x0 x1 sub 2 copy Pyth /TotalLength ED Atan rotate TotalLength ArmA sub ArmB sub dup h div cvi /n ED n h mul sub 2 div dup ArmA add /ArmA ED ArmB add /ArmB ED /x ArmB h 2 div add def mark 0 0 ArmB 0 n { x w /w w neg def /x x h add def } repeat TotalLength ArmA sub 0 TotalLength 0 } def end % END pst-coil.pro %%EndProcSet %%BeginProcSet: texps.pro %! TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def} ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{ dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def} if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def} def end %%EndProcSet %%BeginProcSet: special.pro %! TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N /vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N /rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N /@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ /hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B /@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ /urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known {userdict/md get type/dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale }if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState save N userdict maxlength dict begin/magscale true def normalscale currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts /psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict begin/SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N /@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X /yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet %%BeginProcSet: color.pro %! TeXDict begin/setcmykcolor where{pop}{/setcmykcolor{dup 10 eq{pop setrgbcolor}{1 sub 4 1 roll 3{3 index add neg dup 0 lt{pop 0}if 3 1 roll }repeat setrgbcolor pop}ifelse}B}ifelse/TeXcolorcmyk{setcmykcolor}def /TeXcolorrgb{setrgbcolor}def/TeXcolorgrey{setgray}def/TeXcolorgray{ setgray}def/TeXcolorhsb{sethsbcolor}def/currentcmykcolor where{pop}{ /currentcmykcolor{currentrgbcolor 10}B}ifelse/DC{exch dup userdict exch known{pop pop}{X}ifelse}B/GreenYellow{0.15 0 0.69 0 setcmykcolor}DC /Yellow{0 0 1 0 setcmykcolor}DC/Goldenrod{0 0.10 0.84 0 setcmykcolor}DC /Dandelion{0 0.29 0.84 0 setcmykcolor}DC/Apricot{0 0.32 0.52 0 setcmykcolor}DC/Peach{0 0.50 0.70 0 setcmykcolor}DC/Melon{0 0.46 0.50 0 setcmykcolor}DC/YellowOrange{0 0.42 1 0 setcmykcolor}DC/Orange{0 0.61 0.87 0 setcmykcolor}DC/BurntOrange{0 0.51 1 0 setcmykcolor}DC /Bittersweet{0 0.75 1 0.24 setcmykcolor}DC/RedOrange{0 0.77 0.87 0 setcmykcolor}DC/Mahogany{0 0.85 0.87 0.35 setcmykcolor}DC/Maroon{0 0.87 0.68 0.32 setcmykcolor}DC/BrickRed{0 0.89 0.94 0.28 setcmykcolor}DC/Red{ 0 1 1 0 setcmykcolor}DC/OrangeRed{0 1 0.50 0 setcmykcolor}DC/RubineRed{ 0 1 0.13 0 setcmykcolor}DC/WildStrawberry{0 0.96 0.39 0 setcmykcolor}DC /Salmon{0 0.53 0.38 0 setcmykcolor}DC/CarnationPink{0 0.63 0 0 setcmykcolor}DC/Magenta{0 1 0 0 setcmykcolor}DC/VioletRed{0 0.81 0 0 setcmykcolor}DC/Rhodamine{0 0.82 0 0 setcmykcolor}DC/Mulberry{0.34 0.90 0 0.02 setcmykcolor}DC/RedViolet{0.07 0.90 0 0.34 setcmykcolor}DC /Fuchsia{0.47 0.91 0 0.08 setcmykcolor}DC/Lavender{0 0.48 0 0 setcmykcolor}DC/Thistle{0.12 0.59 0 0 setcmykcolor}DC/Orchid{0.32 0.64 0 0 setcmykcolor}DC/DarkOrchid{0.40 0.80 0.20 0 setcmykcolor}DC/Purple{ 0.45 0.86 0 0 setcmykcolor}DC/Plum{0.50 1 0 0 setcmykcolor}DC/Violet{ 0.79 0.88 0 0 setcmykcolor}DC/RoyalPurple{0.75 0.90 0 0 setcmykcolor}DC /BlueViolet{0.86 0.91 0 0.04 setcmykcolor}DC/Periwinkle{0.57 0.55 0 0 setcmykcolor}DC/CadetBlue{0.62 0.57 0.23 0 setcmykcolor}DC /CornflowerBlue{0.65 0.13 0 0 setcmykcolor}DC/MidnightBlue{0.98 0.13 0 0.43 setcmykcolor}DC/NavyBlue{0.94 0.54 0 0 setcmykcolor}DC/RoyalBlue{1 0.50 0 0 setcmykcolor}DC/Blue{1 1 0 0 setcmykcolor}DC/Cerulean{0.94 0.11 0 0 setcmykcolor}DC/Cyan{1 0 0 0 setcmykcolor}DC/ProcessBlue{0.96 0 0 0 setcmykcolor}DC/SkyBlue{0.62 0 0.12 0 setcmykcolor}DC/Turquoise{0.85 0 0.20 0 setcmykcolor}DC/TealBlue{0.86 0 0.34 0.02 setcmykcolor}DC /Aquamarine{0.82 0 0.30 0 setcmykcolor}DC/BlueGreen{0.85 0 0.33 0 setcmykcolor}DC/Emerald{1 0 0.50 0 setcmykcolor}DC/JungleGreen{0.99 0 0.52 0 setcmykcolor}DC/SeaGreen{0.69 0 0.50 0 setcmykcolor}DC/Green{1 0 1 0 setcmykcolor}DC/ForestGreen{0.91 0 0.88 0.12 setcmykcolor}DC /PineGreen{0.92 0 0.59 0.25 setcmykcolor}DC/LimeGreen{0.50 0 1 0 setcmykcolor}DC/YellowGreen{0.44 0 0.74 0 setcmykcolor}DC/SpringGreen{ 0.26 0 0.76 0 setcmykcolor}DC/OliveGreen{0.64 0 0.95 0.40 setcmykcolor} DC/RawSienna{0 0.72 1 0.45 setcmykcolor}DC/Sepia{0 0.83 1 0.70 setcmykcolor}DC/Brown{0 0.81 1 0.60 setcmykcolor}DC/Tan{0.14 0.42 0.56 0 setcmykcolor}DC/Gray{0 0 0 0.50 setcmykcolor}DC/Black{0 0 0 1 setcmykcolor}DC/White{0 0 0 0 setcmykcolor}DC end %%EndProcSet TeXDict begin @defspecial /DvipsToPDF { 72.27 mul Resolution div } def /PDFToDvips { 72.27 div Resolution mul } def /HyperBorder { 1 PDFToDvips } def /H.V {pdf@hoff pdf@voff null} def /H.B {/Rect[pdf@llx pdf@lly pdf@urx pdf@ury]} def /H.S { currentpoint HyperBorder add /pdf@lly exch def dup DvipsToPDF /pdf@hoff exch def HyperBorder sub /pdf@llx exch def } def /H.L { 2 sub dup /HyperBasePt exch def PDFToDvips /HyperBaseDvips exch def currentpoint HyperBaseDvips sub /pdf@ury exch def /pdf@urx exch def } def /H.A { H.L currentpoint exch pop vsize 72 sub exch DvipsToPDF HyperBasePt sub sub /pdf@voff exch def } def /H.R { currentpoint HyperBorder sub /pdf@ury exch def HyperBorder add /pdf@urx exch def currentpoint exch pop vsize 72 sub exch DvipsToPDF sub /pdf@voff exch def } def systemdict /pdfmark known not {userdict /pdfmark systemdict /cleartomark get put} if @fedspecial end %%BeginFont: HFBRSY8 %!PS-AdobeFont-1.0: HFBRSY8 0.6 %%Title: HFBRSY8 %%CreationDate: Fri Nov 22 09:22:11 2002 %%Creator: Harald Harders %%DocumentSuppliedResources: font HFBRSY8 % Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de % Generated by PfaEdit 1.0 (http://pfaedit.sf.net/) %%EndComments FontDirectory/HFBRSY8 known{/HFBRSY8 findfont dup/UniqueID known{dup /UniqueID get 4214391 eq exch/FontType get 1 eq and}{pop false}ifelse {save true}{false}ifelse}{false}ifelse 11 dict begin /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def /FontName /HFBRSY8 def /FontBBox [-31 -928 1186 779 ]readonly def /UniqueID 4214391 def /PaintType 0 def /FontInfo 9 dict dup begin /version (0.6) readonly def /Notice (Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de) readonly def /FullName (Computer Modern Bright Math Symbols) readonly def /FamilyName (Computer Modern Bright) readonly def /Weight (Regular) readonly def /ItalicAngle -14.04 def /isFixedPitch false def /UnderlinePosition -100 def /UnderlineThickness 50 def end readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 161 /minus put dup 167 /plusminus put dup 176 /circlecopyrt put dup 180 /equivalence put dup 188 /approxequal put dup 33 /arrowright put dup 41 /arrowdblright put dup 49 /infinity put dup 106 /bar put readonly def currentdict end currentfile eexec D9D66F633B846AB284BCF8B0411B772DE5CE33C33655F6FF751F340A8D6C01E3 2E02C24E186BA91B34A1F538959D4450CB683EAE5B034D030186901B458D3777 6B3942BD2E07121385120248891AEC2EB33C4E3A0CF00828D0F130C31A918C18 979FE94379C648EF21ABF659253E43CD1253866F157F1DF85AE7E8714F061B1E ABA3AD094FE8D6293916FA82EE4F486C7E513A06D4C9BE44306A8287970B4ABF B6D1F9274A5A0BB6ECF713ADBD1260D5D6C4420D357FD486470A74B2F0621B59 A9373ABECDBF32FA68AC06351EB3A0C389A576B6DBA855944AFB10A763BCD8BF 8B79AD7E65614FF892EC189B59B876216E4F7CE542AE8E603F206E9A5F86B4DA C92D7FC2B1E26D60973F9BC47377A309BE534196C422D12E3C8FFF9A1AB526B1 516B40A8A3B311E7E1E3EC357E937C529EE32FA380B3B64D0B9DE03CAF922AAE FFD26D141F2CED18E6B31DA311C35417AB8B02A7B772DFB475502EA28EF51A72 5D7495BBB7E68C8DCF7D18354164C9D2042F50AE635D7680F6F2BBBC9EB14C99 7FEF6E282A78971F20956E590D16831446625F2C003E4F5231D429FD9C0CF731 4C0E72E90875975068530716D94DB4DFE6788C36D2D8DCAE9293508268DE6743 47629B4F73F65F1B952A3E41E6279E762A30ED9F11F1B7969755511DFB97537E 9AC1DD35F28EE1C8926970A09B4D2CD2CFBF4367E26F12E02740FD20E6FF610C BE58523F93CB4443C83FD9683F87248884BB96506EAD1FF259DB4C2421C009B0 51E6E3BC0F51E8CC7EF3A5B67D0C3F8044E8DBCC8F779E3DA3243D7844562348 9D943099F01BAD7D74BBDC870157B1C0305ABEDB8E8C5D99156A933D9123C948 57E62C1277F7C6B28F6CDCCFE3A18B70DA757402392989570A2B2CDF0245A987 F5B2D4A91984C0733D9FE036BD0C056599834C70A79CCC9E745EE3B03BB98055 9F417E8213AB0B3F350DC3364996467CE5D05FCFF8D91C723C5D62211A36FF08 3EE62C2F0D947155B9C401494CA55F128AE991F61B649CEFEF63978D259CBBD5 2ACD0CF313E75FF446E7D626B67375D47046691E0C45104A9AD1B488393CDC8A 28F6899BA7E8A9A88E809735E9C9F21A0D64ED2C51B8817212550F603BDC996A 38A4A35C7763D3825106DBE88643F072583B0309744704995DA7797CB545A045 0CF67885A008A51EB978930165E3F573B9AAA9CE3108BBBA5E71CC7FF4A8DD40 57DA21C69499D339C2E2F9E767463C561FEE90668DFA46EFC5D7E6ED7A070ABE F7EBE0F8C7F875053D1498AA8E66F86D3631D29948915A2421736AE66FDE755C 23EA30E6D9A5D871DF47609EEE91910A9D3DE1711E60F4D3512A123C797E4571 60655A46085CC4DE87107FB8488C4E61D98EFD958B0298B51CB9DDA15EC69EB8 0ECCEBB65867B42F12CEE39A7D8E643D7EB21E741C5957808A84C71287E1936C 677EB18EE9B011D9C1A92D6127D43EFB92E932925057EB2A2218076D34493166 66E32A63FA9CF4DDBD940D43359A400EB4E712C9C9C16B3000FF061A67633697 2FD9D08363BB04C97DE00E72AE95D32B1B9BC8D4DF61591C8627AB9066A5A727 331F77E346CB74E6051CB4FAA1D829DDD35D2BA293772D24F00EE40E36BDCB68 D9AA12E5674550F711115888B8B05104079DB4557BF395882A65D7D7F89B51AA 7AD3AC90C24E9969E4E4A7F95E3666C5F4A51C6320A7560C76117AECE5C051E1 A4B7D87E0C7956D77C9BC5FE14661649D290DF48117A042F9E77E5F31FFE4036 3CA52FC2D589C2E84D8CCEA6E25C1CD7B45A3D2886DCCB45ADEE08FB170F8B8C 8748EEADD305201B6145DFE32C8602B10C703F85E92A5BD0156DCB36CC406C03 C94C88049D9CC90D9DEE76DFA43BBD2A711A1C2A87099FB1D1F77D212C4B7F69 B8DCCDEC2D8B2B3129ACA91194EB8C065B8AB634C1FC7F7DFFBDABDC32704B23 9AB9143EDD3A40FEB564001DAB0024D771495D6463AFFCD043D024B02BF59C64 BAE8AF477AC0814F9092C464680882DE45649F3A6455A33F5B41562076EA1932 DC252407E23DED6E27FA79786CA398C2FCCC9A4258C8EDB8A7E3FDB26C063805 B7247EDE81689E9D6DB12D68AE0F8C6CAFD80E4D4BD0E27C3A6E515BDDB6F612 6DE00E578745A6232B5ABC4C55CBF946C6DADBD83B091767AB51DA4BAB402C70 D2D4EFA26F22AAEA93C3B53DFB85D25944AB25D46F26C51025BEBC6CDE16F8FB A2F1BC5DE764A4343D932641377FA08ACECB876531141A170BEB176FE61A3DDE 0D63E174D6E26159AB5EBF7F47EE24C6C23ECA00F417A122BC1E74BED7446026 A92902FD0DB9EF124C6A32C0E766399B240163355AAA299A74A87558CA6899D2 F1F9E8F0BBF76F740710F4D305B2B5B53C441662CDD6EB6227809DF6F67CE987 4C71BFC6AC410B3DA9C821396D64B626661C9888CFBCC8E882A61903A283BFB7 4ADAE79E382E5DE8D2A160C85429A8AA6FE22478BB14985B413BBCC923CB2218 51F61C44C9C8DD56E9A1ED43925206F26F255EC631D11E2E80FD4F3C917A1795 54FBEF87FAF4840703E60F9FCEB79EBB6849F9751CB46ADF4E251EF804D421C2 CE96486E8648932F8A2D284F0E0975ED84AE59C639FBF2A41C24B94314201181 B9824E6EA044D25886C7F160FD8F8777E0AC4E0B52EBDA9A3C0D1F70C42DC20B AB5CE939F61A490F22A6064A5599CEF68283F98935281F082D661C56D9CF249A 92C0715580286C2BAF994D11A143319AF38285C2C39502CBBE178F95776B842A 4DD59122896A83CA5AA73CE009CFBEF016483EA3D1BF3F80D15DB709A8F1E24D 03F087F46B5FCAF70A2B5D81FCA7259ABB82028BC961FF00AA0516CBE04361E4 F3E49498A19560B9521C9F50A6743D0AC54970088B9ADA7612267FFD07847370 8C894C8C646E1F9DD7CAD9CD2E708162F48B00128E82FBA3EFC582845C7AF89B 24AD38789595478EADA52DC8F6CC45B8AF1D449ACACD8ED20F0B3CAD2C6E566C 0DCBC6AAFD10F072CB10E6819EE64288ECBBC027C80E87287F38949E3C483D6B 94B900BF40867E507E7BDD03BD91476EE418808C9001C88E35BD0F7B7F9A16CA 90911E9EBAEF5D712472AF592E5817F75D88129BB95E2D46E045EED75605B4B9 61C087BDE5587E2BB87BDA10A99D7C033BA1FA57368ACA61772E489FA83C17CB AA9003CA6F81D7DEF487597B6B2B373ABFD3A0623CF1E03EA5C8F91B00570D09 224C2AFD3052588059584C627F9DCDECA30A25A00D7514735C81B5A4DA37D869 420FD84951725E5FE0BCB26487AB28FB3A72CA15F73B66ACAA8666BE5CFD10EE F1A3F69E57804285BB3A6A9544F0B18F6A9987317B37577A93F3CAE8AD0C0342 0F26B44495CB546DF79C21F2E47E83C539C3865C0F4E2F00D9E7AF089F1E2B0E 7B6FF609F86050C6BC22AE7613B9C5192AB6C38CAB78CF337A3BC43797007D89 500FDDC4EE4C871D6384613C1FF870C0E5E3282B88E079FA782EE592D4669CA4 4C9602E682E4727B279788E81F63314209BAECD5C9471DE4ACF96407A50B2E83 B8C5C1C8D8C05D3FACB2509D29EB296A98B5DDB656BEA8D71BC896436F685A59 A72B23C7E2702AD2EDE6DCDE477DB3E861E083273F4F1F401D7BB175DDDCAED8 39AE799E5A389B76A39090747B4826FF2C6526433362A5A710EB0E14AD97CA12 83DFD1AFF87AA6FF3AD6A790A1695117979B44EC5298CE93F24C78377F8AA845 8F2D7315571913E6C5E80DBFF15CDEA786D4AE0CDD6E4CAD04E9164350252AEF 4D04F8F7EFE42A943F12FA0F78F6FCEAAAA93D9E714C9AED12A78755EC62F920 205F4D8CCA1B69949DCFFED15C79E06F256A31A983CB7F218A105919E5040E72 71489FCA9196BA37A49DCA7D9E93DA5A4AF10EC3A7A4DAB27DD95F0195E13A13 54D3736F687B9020EBE08074B71E877D539950E7F6CC46568FECB9CCA4E59B5E ECE09D096B65D2E7CE80EDBCCD1B441296FC805031C07B1196FDC6F3C1B74289 CD8DBE2698485634C776CA7A914008B09A6C3A5A191FEA7E75CA79153F3030D4 D67273E51A2B0A74BD9B2345BDD5299B794098A248B94B0642DCC3D403FF1F7A A9F2604CD0572B29C04CAA52F05483BF9E983704B65E231705C7628D5D31F833 26DDA3575E5DED53151A1B9BA507AB8F195870D7B74D2A10A18725C8C76D0C3A C8532A1BB279B60A917148F3590F95268CFA5CC7407E85F0E10B185BA83285E7 9E59E7C5C474C0E5B7CC9AC858780C6145CFD5AF68E19FAFABC4F057E7101EB4 A367EA5FC1FC506109F584D117DA964F7B907D0EE90A5512589D37CB28A2BC32 D0986713583E4AA640B80DE3F7FA2DADA952C0A81460803970A1590356956BF6 3D6DFDF18F68F848409FF11515E72D37CA1532D4ED801BE3FAA1CEFA7784BFB2 4CC47CCF4F703AC65E7CA73CD93DC74FCAEED878C7EE09E5D6A49ACA975F4B11 76C1E270E44AD30DA04744554D83893B46329117E702A40657C295920259220F C45D2ED8A86C8935AF15AA399D91440AA0A6F67C599B7CF54F42689D6DB715CB 966D84535B79207C04736902D4D4CB1AA37C532985C67B8A727F9F85FB9961DB D88B9E1736649187F955B8C6EF5E2A0D827F2E449560143DF274BDCFBFC38AF7 680D97344F71632E9BC09EC466DCB2A94601BE3C55F85557A3D008A71DF9AE4C 5901751FD84F8219B6E69CDFDDB0B6D9641D26EE8594BA559D801BD3D56A207E 960F8DC156EF260DCFAA516E07597F6170F655A21C7F694DCCB37E1869F4A9CF 15E8C2DDA1C0CE86B2CF4F2B64FEF7F78246F5D3D81C0CA5A1223620C3276A86 294EFE36474E1645881C412CE915757609433876A9A4D339826204E97BF203AF 4446541B36D6F1755443EEABD77CCDE56112059BE227635E84CD0C5DF24195AF A4BA7AA48C80D49D2415D710C37AA652D1E1D974B7CE2805157997A29DDB936F A81E80DA49C82EAA7A03338773726903A078F7361237C2D7E424C3D0C74F894E 0122EFB5209E7BA33087DEB3970DBA839FC3C6C0BD84AB5BBB9EEC1357DD1E65 636F6DFF901EE0EBE61A7A61A8E5D4B74CD9A3F59298D89DBF49EC79051F8405 FD514E8DD363A808D23CDFA721EEA2390FAAA6BF262CEFFFE247665015E93465 34163D959EE5B70F5B32DCC7D45F824DF454FF6AF21E48401ED2D8027ACFFDE3 3DDDCE1C603E319C534A4B9E23AB5EA38CEBDCC95AE454DC0198DDC6E1489429 1A4198147CD3B265A7DAAA2B78A087A1CAE0241EE6C067AC2E4C3FC3E30C4C6C 115A29B3B0A5C5AD52B235FBA9C2E136E92CDB33F5B6BB3C4F4514FDDFCBD101 A447E95E92AB2CC92D13AE749D96A96818B94A4BC4102729F72FB8F1762A0144 CB2B586A980D3F9E4D7EBB71AA709C0A5834948AE58EAE2F3F10819A5CE0AC98 0E52639919589CF34F3480209B0DA47703A476FBEDBBFC543709F2D5B1E2780D BFA579915E6637CE7E0D02420699E02D80797212DB449209635516ACF40BD0D8 BA38E2D2A26ACFF4082B52998B2EA53A2A40696AE22DB8F9BBB96D136BFE6C17 750DC4C2AB9CFC094E0C6842A82B850A2B299925993A8B3552400B38FF8D039D DD24F322C24F97CFA1DCA9F809003E31915CF01822BCD3C4732D5552005048F8 FA0838104A7E3ACAAE1609E2668BBD9B6E51678F9AE0D1509ABFB90C89C78062 8EEC5C556E9C4B78604F64D7163FA154C4A18CF4932FA2378148E6CC1801C599 52E0A61B19800265ED6BD2F80C50F8CCD77E497421B8A93C76D5FCC665C91EC9 C208C1ED47765ED268ABA95E028ABC367A52DE075553DEE6A78D1D565D3A791D 8613A9699FB08D2F90D233E90A309BD803DAA5CB71F8756ABF25F59EF084320C 2874410DA2D73B4F7D73BB06E4D1BEF02358715F74A540D2DE778EF69333C3A3 3B0166BA72986DFE44FCDD94623B9BE3B8AC2F195008AC37356E2F8488563321 9107C75C3CC35574626B04DC86A1340D6D2EE5D462BB759ABF31C756D3CADA18 233A7C61D32B5F3716CBC6D87521E4A4E110D58AA70B022FD099DF807B60898E C78D689878FC313F445CA98B414D41AB5E7CA41387D851187DA92117E3EDAEEB 6CBB78ED44EB3F3BD62DA7DB89B20DF20C93E05A01B4D901D0339577092A5B54 7F0CE9AD3710DAAA5DF077D5D3E55E242CE10A9CADE496B371C4004463EC54E7 0DD27C278D4579EF9C4DDA735FB2A6CBD7596AB32F2B333A5AE9E6BBD95FD311 C1BBF929F774AE9C3EF4380FC48F70F23B66598BA42391C1473EFFB48B9D1141 20EE3C43AB2BFF1C3CA588861F33531FA84EA62D39868E837B477C415B1775F2 898DED2516B6560B5983B9BD9D7E842141D8B061E5EFABBF6A19406F29DFA8D6 BDC2737721E5D5D4E76ADE5856B4511D28262E60D5DA90C59C6188BCC6535AAF E74E1F31C32C230EBF0BEA0013491558CB90A6885E9DFB31E35D47547726EB9B 35354F006ED049EC63CC2F9FEB2D397B768E0BAF242926CE225A45152331865F 0A06D8BAC42C0782EF1E222C70B05A634241DA81B0F4E16FE710CAE0E850972D FB9307DEF289D2140B82172F8A565CC6636D9037EDF1A2B5216478F705AF45C0 63228CCA35E834397429BE11257754CB92AD82130536E539883094CBFDE790F2 93775CA1408C29C313503867177F271A648F03EF801698A7E2ADE9CD517D4F69 012A7E6EB03DBC15446CEC2554B88FA234C303B80FC1F91E3BE76475B056C40A 721873C318AD5D9B2B2B3309340354D2B3A008B97735E1B068DDD6724B20E13D E6BD8568249CFCF2DEC3EFF192326CA202422B76DFD82EBE48E2B4CA2A3A6E39 6C6430162B00A165863B3B84795A6AE69E24476D2A0CFCD43912590F04C4FB7E 3F88F8A542652F8C6C74A96C5F14160A2F2016CCB01F4091B28C3B1A0C911F1E B030F069E8F09E79D0B0ED51680B7C2E13D7E9F4B4D9B51CD509DE887D79AE2E 0749D076983AD1FF1112EC4FDD1EA4740BBF9C8F66F5DD33A272366CEEB73F4A C3D3426D2FDDD368FFEF72F645493F6ED856AB669BB9D784951636AF186B107D 6D8C06787050B02B65877F3581C1CE516E5B3873613C18582CA31749C10ACF6D DDD4D409754BBCF78C51E8CB1AC23B8061066691C1E1CD094725E946BD871ED8 B147DD0D6F1DC95D9ACAECAD1CCA315D620E9E91F70C6027344912C9185C27E2 7400C65036D8C678E999CEC76C2E57D4D4D932344CB17E8C203216CA4595799E 7862D34A24ED0C96405F37E6FFCA73D67F1F199EFC55B9F3559DDAB57F011F88 834C03E528052035B552BAA4306388614EBEB304EFA49451F419CF688697AA20 3CFA2516F1DE134550DB47B7F19C82286DC77155EE1D0EF27078972E4B136350 25EA6E349D61FEC72788230345BA778F9CE27105F740349675832BED0E3146B1 C5181C9CBCE926CBD48128D74324B6A98FD0A8B860050EE714A70F58824BE058 749BFADF57274A42C43F14479D649E0B0C6FABB5150B15A87005F6C1245E7F6A 93B962CE87F87AD258A196ED3C0736D2FFB401BF5136EA14DFF6A9A943DEE78D 337BB04745779BB96320A85FD77136CB76D9F21DDF9D68A8DE3D8F7E93698EAE 4A2481EA71B1637B6DE8C8067186A57C83886DA87761BE600DEECD13448A82BD 652BE7ABFE6A03F525531E00A5C5ED25978A39BB85B12B267B399E06BFEE7DBD A177B6E4BDB95EA706C4D89AD2810ECC6F08BF0AC19AB67AE4DEA067A542ED30 7D905E2486925D5C3EAB8B7DCA673E4DD6AA98DF7C57A8FC41B33A69BC005422 F2EE65F677B9D49346F3508506FCD91D499DDD98B7CD96E7C26CF461A54450B7 0D6EB16764460006CB6597918824A917C6266712C5AC38A051BD7CC2ADDC659B 5C2B08B3EE726C6619B9B5C5C968742603F4FDB035787FECB076F66D0569A158 AF4444718A3573EAF76EA8DEEE49513DE1CC72133F228E476DBE3061CD16B6AD E0A4D931D72997CC2A31E7CE04BD8CB8FE35479E20CDDDE69C66F955940D517A 38DF6F58F26AB3AE4A670E4CD264A5FD7FCE95CF0ABE55EC8BF1E1FB0CEF53B0 BFEDF2C3D6DCF61CA6C0563F0ADFF57607D1EE2C30803C67984C315BCF1F10A1 557FD31B69F349F2521E22817B9D60FBA6CDE88FBFB4055F87BF25D2D816FE2B 108C36FADD52019DA8C9A7838F8A4BE70311218D1226787AA0A3FD23E2890634 946C26408B75445A0099EA06E67ACA22B1E387F336FFED7AF2A913FB2CE66241 C5102CAEC3992BEEF1911BCF5FB93455A74C7E013AC550C78230F9DE24876BC9 3855C4A27B18E547B77AB02D4D59FBB1DD13B83F916FF36EB0251F5003A1AC72 BF9F2B06826C7ECBDBFBAF1C648F893866424E6F5D4B90ECD96DD0F82E622CF7 41CD24B4A3B0264180882F360748FDAD3EAA5F2979C2F2A8B4A0F1D41D66381E CC75EA7807F5DDC4EFD453D852F2204265A6242771E4A0A2F8FA71EF7759C6F2 CB2DF05CCAE1902A5574656E1105C260CD3D44D148054FC2DF9830649EAEE440 E1EC453163523F3638D552A5C76833DEC9FF127E0B0F17C50BB65452A3175CA0 2EB794510B30EBDF4FAA83436E8FDA7FF9F0ED52EA5C3C8CAC52787AE6A61A1E 3D74346D1DE154C9A6EC3722200E422954F6A58F097CC13CA9BC695F782ADBE5 0737CE43B15AE34BEF6D4B9A5E078D531F9F88649F792346F010FD8CF83E5901 B9DF69318790CC766E7D53451C02C6F15AA38E1FB31A2B0975D02194128B8927 B42DD6CC0C9E92F0D6E598451022B9E48E7617A6AA4B3DB299800E797B143757 86FC03485B45A079E519B31AB93FB8CE97CCF116A8DD689E00A166AB8396009A 9D80988AA65B22AF2F3DCD882FA2F73BEAEA61E7677380E126250AF61A7241BF 5EB5F8C11B721078530737B744871B6B8E788FD5F874BA702838BC97008DE76D F6917DB77319AF0954456C6920F8818ED60E3AF7B679228139BF6DA9A74948C3 504D1B0CCBEED2908CBA3FD3A288E01E2B9173557BD09FD7C13FEB7C96054611 8C9BB6E9CA065DE0078D56D6B64C28B4D77F24CB59EAFECA61375982F92F0B47 5B057803B4BE1342CE651B1E28711B6322844900D9A9371A0D2EFE4ACE6C3681 17846D8BE2A2280EBBAC050B9EF0C258DCB32ED446E36B655A7FF57E74E2EDCA ADAFE0E162FCDF48FA17F09584148A40251142DB5306C5B308265FB81D66F8B9 0F388A05F0DCBEF183C47BC27333A8DACFDB10E3911B24A475299CF48355CB29 187AFD4BAC378CE1199AF89AB4678AB6609423412969FC1DECD51E5B3FAA40D7 48E7160373CAD07AAE053155493BC317F89A8A74CD595A8CE0E93D45BF7F6098 953C01ADE80BA8720E417921A6D16DA08C3ECC3FCC369824089657FC7433B881 EE328FEB0692AA733A3822D3CB26ED9010DD078370534CA562A06A98ADFCAF9D 29989D2306690F2689B4B60A5055543FB599415C638471E3F0B4BC36D82D6F6C 8571B6512A8DF217954E5EEA59EA0C7512C625D34DEB46C4AD0D21BFC3A9A114 05B0873D4E94DB1F1327400254C5502AB9797BBA00918A50FBA4CF44C7E55859 D6106F61A65EFEA568E7C8480531980ADC6C6B6F520F0BEEA1D8D895827A3F58 39271A2BB07C6B233AD87D49D94B03AD3A41B5772910B9C9B02DC43449FDDC03 F95FF999EF46DF0E1DD051E60DE1CF6EE31C5EC75E862C9D1C8D4F5D2C112F3B 419EDC7D0A77BC86148948651AF5CFA0C014A2D31E826B38A20F68DCEEA5A097 8FA8E4A2BAF57F68881F74972B19ECA5FBB06CA87D3D739250376A8278F55CDC 4678DF199DFDD699345E2F99AE6B05E8F7D51E4A878C7D02D5A405A3BB63516C 92DCE492384875CD48847144DF4015B3CAE6EA0A6DFA284EDB005B91C1E72A36 5E63D439AB4339B0DAE3CA0F373C5028310266784366D3E5B19628F781B70AFF C7B4CDCBB6A5CE017AA860B96CA41C168548C2F72C0250702826C0166B4F587A E41977105175EF718F781908DDA9EC89E2F19716811BA35FEA5AF6530FEE4D3A D3BFED9D1DB31CB9069D9C3FF5D78DA7FA746183CCB6806ED53B9BA76C8277EA 0299D4FF7FBCFCD84CCBF875257FD719D237283F6AE6A12B1CF5E83E311DC420 3744C86A1FE55F5369B12A05851331961CD49B789BEB8FADCFBBBBC2443D3F53 82A05EF150A8E7026A6F9B94F984129C446DD56ECEEA07228F0B0DD1460714B9 EF2C97CBCEA2B828E6F56DB195EA47DA1051E1EABAEC4DBE7679F7D60AB6DDC0 4938A42C948093629A56BDC8C2DB390FA2BF1C1B653BE9ACA74DD371CBF8A61D 1486F80C7C11DD39ACDFB3C725E6E2DA13DC0C4406A79F8379DD126929166E1A AFB0A95A5445B5800D0BE0378909AEC60F544C385AA294068183459B1E9CA73B 17DD9B8D910E195BC8D62FE8977B2DF4970EE03C65448E5F85C74B44F1EDB5E3 0DA2B09FB2012717AC3CCA0F72FD3DD6E6E2407901BE9E20CB160B6BC81ED469 6D66169BDC648AAFDF6B0A82D47326D14E817FF8C3EFF9588CAAD1E91B1A8C18 075D2261A987048B8D5C45E18A908E91524861B2801DDEA4BE4B8219388C5D8C 263196260A19A1BBE5F56FC10A1C2CA34EFF3A7D45FF765E6739F883F7465E6C 0DDDD8970909777818CD73613278786764E161D3E736F84F7BE7D33F27749923 8E388A4D0875E368521C0D91F205821C578198FEA3B8C3CEBCE2E39DCC9D10E1 5DD6282A43415B8C958B346537659450D64195B170A798A0DD16D8820AC61CB9 D9AE77DA6D70022E0D5A8E54FB5B299B012DCADFEB8FE99007AC7E0C79655599 49B5AAE58386D7A6D4D54B096463E1F3B65E79B96936F4929F48743EC18678FA 414D2F33B16A28C4A677FDE10219D049AC9E5CF2A8148D694CD23919C7EEBCE6 FBCB17568F66F1771118874A60130135D4BD382F68FF13076CA9D9C2EDFD62DB E2D50CB5DCA611CACB1FF890E93FBEE4A4A1E84EB2F3EA940624D4D365CDD8FF 305059425933F0D2F6FC94BC273C4252B09797E9CCA83904F00C6F81290CAFC0 B8F1FB2A83C9B77215FBEEC2843351AA810D82EB150ED99DC0439FEC5E4ECB9E 7FFE81A6638384A06F2DDC3FC4528059F4B3815CF4A9EB8C1257A3C3E462548F 4F0E722EA5DB05636D8DFE49F75A1F275581BAB96C0BD0939F2A3728524E24CB 537F0F2F73C59874DDBDDAE7A0498B8EE43B41E58B2A7BBEF09759AAB0F7E53A 4401832B644E4B33DD53D86A9D04206B330585E9F132B2C4390CC8DA1A4DF6C8 B7B0D720C723C598DA618563F2EF4D32A7CD496A46FDBD70056D4D0051F7E53D EC3C20F3167A6CA229FADA3EEF9589AD0DFAF5CC784539D39D01A57D3199D801 050A88FED777BA8EC3CDBCF252C40BEBAFA82C283311D45B9CC42B559E44DD69 0239B70551D389A99EBBE55D8AB479AB36E5017DC6D1723FCBB6A4CE17ECF3E5 175C41345260E3E389A3676A9EA0BD08012007D0449B64B11C2526E9EFF13F8E 61D18CABDF60F742C5DEF004F33F6177151111919C2D1544479517E0C9E4468D 5AA3B6CEA4A7AE4F7511B0BE89E0F4E73584BBAC619B7E3C36BFE484588705F6 0027BAEF9DE0E7514BE36D097ED4E170758E92E2B4CD8F2D1FFDEF966ADF4691 5182621902C64E72635E83A635877BE930215A3C4622DABC915CC89AE3B5D0D1 3C0E1FB1C4393F8C934CE32240EDCC1B4475BB2AF1352140C09271E1B8C1BD7F D4981FB8CF874E08864FE212AD383A12C1E322B7CF7D4ACE2F15782608EEA758 E308B3B911A5838DA00D9A99C501D58009527524ABE6ABF0CC395C4056882B2D 0F7585624FBBCDC7CAE4AE5CD28168209E831423E93E5376C6CBE7638F4D5E4C D32787932E1774F42D3EC2DABE9649B41F2D7F5304CFD619E86226048E662AD1 DF634EE6E121AE6A661F95E823B7E20B916D1A4774EAE53BF5452EDA6C4B4CD1 931F053179905C70C81940BD22CC5EC4407786DD45B040DBA0E3DFFE7A4F9EFC 74341375B42807CE93F8373928A24926858DB6EE19D9BCE998EEF26B721B0874 22E54044849F9DFB4A07824F00801B87BB8C1E6CEB0EECD31B6B0981ACCC398C 42B8B5DF22C35EACE2DFE7CB7BB477897F9DA4AAAD4AB2015C0B96B2D15A9316 1F3ED570B32626D28FC9902141CF3B32F32906B10AAF8C5752F3E043FD81A912 CA98B99CA7A9C76120DD406FB687F274FE6D4DFC36EFAE58366B99AF5CBDECAC 854C8CEC0D26C75964FD5BCB99B09B35045966EC76EF7C5673A51E4184F32FB0 43BF917C86135290DDA0FE0836640C9C78A341E6DB942C3FAA9E78CC66153467 5639FC9AF65D8DB78A5D841C68AA6BF3613CA6696E337699AEB38CA4F868433C 8190E5BE28615B2B3D694062004E28CDB0E1350A3C2763C055E5CC620E651BF5 C9B778EC8F3726A0FB0FEDA34077AA64373066E3FA16C9F8A4D1C8987CE68E7F 254D7DA44BF66DD4D24F33E0FEF0321F38FDCFBF8A8E82215D9CD92B536C53CE 08CC4951C6CD68BC2F85D650D11650655AC70A9AC748527C60A161A153223F13 D3D2A530CDA0BFAC05EDC0B59596417A4C87309A26638F1FB132B947 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark {restore}if %%EndFont %%BeginFont: HFBR8 %!PS-AdobeFont-1.0: HFBR8 0.6 %%Title: HFBR8 %%CreationDate: Fri Nov 22 09:12:21 2002 %%Creator: Harald Harders %%DocumentSuppliedResources: font HFBR8 % Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de % Generated by PfaEdit 1.0 (http://pfaedit.sf.net/) %%EndComments FontDirectory/HFBR8 known{/HFBR8 findfont dup/UniqueID known{dup /UniqueID get 4214376 eq exch/FontType get 1 eq and}{pop false}ifelse {save true}{false}ifelse}{false}ifelse 11 dict begin /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def /FontName /HFBR8 def /FontBBox [-81 -223 1112 753 ]readonly def /UniqueID 4214376 def /PaintType 0 def /FontInfo 9 dict dup begin /version (0.6) readonly def /Notice (Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de) readonly def /FullName (Computer Modern Bright) readonly def /FamilyName (Computer Modern Bright) readonly def /Weight (Regular) readonly def /ItalicAngle 0 def /isFixedPitch false def /UnderlinePosition -100 def /UnderlineThickness 50 def end readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 40 /parenleft put dup 41 /parenright put dup 43 /plus put dup 45 /hyphen put dup 48 /zero put dup 49 /one put dup 50 /two put dup 52 /four put dup 61 /equal put dup 65 /A put dup 66 /B put dup 68 /D put dup 77 /M put dup 80 /P put dup 83 /S put dup 84 /T put dup 97 /a put dup 99 /c put dup 100 /d put dup 101 /e put dup 102 /f put dup 103 /g put dup 104 /h put dup 105 /i put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 120 /x put dup 121 /y put readonly def currentdict end currentfile eexec D9D66F633B846AB284BCF8B0411B772DE5CE33C33655F6FF751F340A8D6C01E3 2E02C24E186BA91B34A1F538959D4450CB683EAE5B034D030186901B458D3777 6B3942BD2E07121385120248891AEC2EB33C4E3A0CF00828D0F130C31A918C18 979FE94379C648EF21ABF659253E43CD1253866F157F1DF85AE7E8714F061B1E ABA3AD094FE8D6293916FA82EE4F486C7E513A06D4C9BE44306A8287970B4ABF B6D1F9274A5A0BB6ECF713ADBD1260D5D6C4420D357FD486470A74B2F0621B59 A9373ABECDBF32FA68AC06351EB3A0C388FDDA2F27B3C21C9B44B099EB522866 390D8BAC531D259E9A89584301FECAC58A1C88672DE2403BC53580A4970194C0 65946368437316E8DD51F6F46CA3C8959DE0C3803C2F2C452D6C58B0F18BC28A FDC98B001B66B71B54071DDE46306348F7FC149349AA155358D10B954B37D002 E9758218489CF6D5FB6B271B9C9D9C1D752711E060D0D342BB1E41197152B478 12E3E42F3D113786885B3A1B512D68908309ACA46369EDA3EC63C3F58619E4CE F5DFE55499A241712996CA8E4007C90423307479BB90771F03CFC4A924888BAF 9C600F91585838DFF3745BF697B84FF928D37F28646A8D6DDEF863DBBBF58E9B 26B49DA182B712F9D7858867D2E576B2B23B413DEA8BC4CAA384BF14999DF19B B90422ADA2FDBD8E760E7EA6357C31A06650A3CD61A0C61F00A3396506B7500D B0204AEB243AFA0F23A9CB0DFBD3492C29C751BA3C992B39FF2D153D3CB0DADA 181B7C5539DB80F24E1DDBA4599E890E2ACE6F98C9900CCB4675280A10CF060B 8D220DDA1BE55DFA65715EABCC305065CA1E385F18C5A8CED3FA7366171A7B98 471DA0F72CF84299D23D4164FFB0F1ABD9E124FF2CE4F192625D6C765E16CB89 DA36A06F4227F1F70EB4DF0E88A2D615ACB7436680225D1625912AEF1B4F60DF BE1AC6CE645EB032312676B71EC40998790651F88BFE8CFA82ED6CD4B639BA51 69EADF33289FD5331B1D68AC74793F464F6BEBE25ECAADD5A7FEE87917A4C63B 9CE188D7DA9E03C08EAE590E3722DC95CF56DB06DA514B84122A73F3CE2902C6 818B74BC3E005CDAF99F7A96CC86AD60E05E933BF2FAED2DF4FCA2002D4BE8EA EF439C0392FF926171B0E25FC76F5B7917393762D7D7811AC3F374AE853CB3E5 19532138625EE58E39BA2749E35039E83E035B5D86EECFCA76455F8E4FF8BD62 AE25DEA00ABFF67CB85EFAE402433ED3699BF4310CB34A64391848CC391F73B1 DA470B4CE4EFB0F3A5E94C0430A0400EB99A8018A5C77179F5CACC3AD41CD762 C795C8183E89A7FA85A0C12A52763634899F898B868E03ED4E13B10FBC495497 01D11DD0F209FAD8D9BDB7835E97EB66928F45EA8146164441267E5414066D3D 26FAB85CE144D714421F6D812255D98D26686AF072D547A5AD7A1C457D4DE114 10C601C40D8A28E55E3F16D464B4FCA258AD32BD99B92E6E63B9D81546675AE1 6824DD84B6CA375598B6C439A2E90E364EB8B904108FCFB9E570D6206EE7C386 6DAF29AFBE13FC226A7F3FE390001B600BB327B726927DAA9BFF13B1C5E2DE5B 1C88FADF22976279F1B8285F5EEF1D958BA3D4C45B156302AD722B13F05F71D8 C40C2ED4E20AEF5359B2DAB8797AA0F03E2E9FAB9ACB87B7E560E51DB1CAB70F 0E305D7EDE7EF63F825A8C956D19CCDE33AA193D61A35EBA7F7E101843E35DFD F3E380FA77D00F5641F8EF4F5D0479FAA372BC4B85959C4D95B60BF4D8B3AFD0 A002B3A6E4FA114131410D51413D485AB9858152E3FA121F9BDD04B7EA8A00B2 A2442526A4E19A8C02D1BD76F1DB27CEA5D181D7E6B9C7962224D4E3873D2DD7 5BB1C61281E75298D261EB85AC8E83986EB56A641FCE4DB386E16B322AAF048F DADCFF8C54171E3379E1A86B0079EE25B86A0C5C433903862F2CCD410465A031 E1FA28D2A327DFF5132E6B76B0EBFF4AD9F19B4C11FB42E6A907DAD90271851A 5BD4BA6A59724CA86160D586A9E9854F50C7D92F3E4109D6F3AB7D037E509C5D A4A954235A57F0F59F86379081693B70E98C1801A6B5C62854B3D276E1E47A8F 07A43830B823E313133F5880A027C59089DB3E27C8B1EDB7C4BFFC78BF8F81BB 9FDB01E4A7E246AB68E6465ADE09402C8FFBF26EB6FE3663ABFB7F6C8CFA98DC ED579E0B7970CA869CE5F98AFEBC1391A91EBBC569D9F80305E6C1C2C634E83B 6570EBC5B25A663E9BCEF75CA4EB317A628F42F7EFAF5804FF3858952F51B3AA 708541C4671738A1E0CC16CC4016405B0E6B9AC2D5492238EA2FBDCB2AF1F9D4 FE05F4BAC0C7427791AEC72FFA3C864F02085789995563D721660379979EB785 0AB4020DE478A1737A36870CCB24CCCF84D585D80669DA11F81BF32F6FEE0C9B 3B76B029D38A87E0028B00C438969C2EB8C4646E484F7A53A2BE76AFB86E4FDD C0F31F92595FE56D439417455C5DF159449A392E7CC944A3871301FF9B6D68D8 4C4B1057CD7EE994D92CFB878BB725B0E81E119B3C1DC388C0FCB40E5323A575 E10783F79F90EC2C2B435FD2902560DCAEFE14DFE807F4F8A095040E95C59CDC 1729478C6741B91D8206296D827D3171351E8539BB0DF1C7BC773657737DB177 09D3A6913793DE0357BDEA11DA486A6DA3E670E6D13BC51C01FAFED3D4762137 6F2BEF2505E3ED7565083022A07F2DABDD90859F3DE0E2538E5B64EAC7FEE09C 6B193C4E6E66142EF709DD59E59BDFA45070AF2310F00A2A464B0CB8B5EADD62 9459DD381DCD880E4FEE1806CF60BE8AF5ABCB55D2BB1D80CD3AE3810C3DA334 C7BAB0E5221546611A586ED1B474EFAD513CFE9712A378B73A598E2E26B11AD2 99F58A257E97A14969834FEE29E5CDF49CCECF817689B658AFE7A9E8D9AFFE49 AF5581D1F9C497A46D2214703DBE80BAB7DEBE5C27041E38FCE81A6B22D1E5E9 B6571439E5AF3F9C528E48F0DDFCC9BEF0C673219757CECDA9A7C3D666F95056 05273C5535502AD15D73C09068553725AB29BBB0DA821631505D87ABF7EE1E4A F56E044B37BC6D86BA96AC3E0808DEC3E57CF0E7EE303A59BAFFEAD3E1B7C615 70FC1EB44F20143C90ED66A6DE3E4F67F3D23805CB9620828EBAC2624EF192F3 8E6E31238C56C3DA40B73CD36A17178728D757CE24139474F1DC27653F4E96D6 525D31A84F637A69A84A663208CE41A3FA8508290E2C6D80A62E7DED4BE23ADF D01B9DB54ACDBB00E3CE315A4ADB32BC55B75E31AF8F5E1604CA3B6C358612E2 344934A858ECEDE83DB61B80B1FA3A2C6E822989DC6A8582554BD1EF27073A20 1BFB29F5423831AD6EBCC64A6A252D009AB34D0E1E161887A7CA2AC11C797A81 7B3F07D74B61E5A317B0DD0439787C8C3781BACC1EED6CBA7C4AFC0CAC785001 3FB31022EED455ED44121E5747D42E9749E7F19B4DECCF92CDB100BA56A25CC3 7125FFC45C0DCF538C9E59D0F550D697699DD95C207FB224D93DE246133F3B44 FD2738BC800654A3C570ACF47D63B98857ABA9C24FAEF14E14C074611D030714 53658B2A127F3022A1FE930761CD2C8B06CE46849F4021CA494EF600B5650BE4 0B8D43C387FC6622F1F2E718E679DF5B9419CEEF1DB8CA2D13E661FDD0F1C19F D72592AB8491F5B92AE2F56CF8C7F465A45F6DD0AC741C0C1A900A3B5EB88248 4430A9ADCE03348F595E57FB99F756927ABDBD9F4BB86082F39A330D8F2A4424 F4F8CB16CF09C9417A6D014C321C734AD572D9FAC6AA040F5A972F09899122B2 8036E0B226E16AF3568CBA179B1E4B57CA313754BA6A309C46F4E875547D8DEC 899398257E8A0A58FCB6077B4E5085B8B5DEFACC6F8341130C03AB1DFFD90911 429CCB77D45C56525C6285CD68D40D391B47CD31FD69CC47972B3CE27E0AF623 23F24D8B923E258A1CCEE711CCA85239AC7D1C5CCE04B744DFAF215FEEE82867 22BE51E3354881F53A94D28938FF77D470848E4B739E114B2C49D6E7F3F6015D 03E541C698F790142B2F6871A780D2AB4B86CF4323421A868DE8F14F0673FBCD F58BAD190271D1019A001AC0042484218DEBE9D852B414503741363F723EB369 D5A9118B49D01C6C9D6A5310E7C5EB25E86C7966F18C451E4B0F6549079C73AE 5B941F42938B84780FFADD78F7FC45B09201BC937F0081129980144DB9F552AA 33332A57CFAA77FF65C7A772BA14C08CC976ED01F9D118EF274B78CEB5F28CF1 FD79F7EAEF9B7A6AE6D69F70C81483960CFCAD283FE98912235FCAEFEE23FCAB 95B42110937ABBFED6FD5FF2BC2B9CC9746E1941D47E49557A41C2E6E1EF0FCF B02070625A1B9E087A8163C238CC04BE92410B4EF7F662E70135EB85827D9C41 314AF757E3580791ADDA7454500DB6BE80E12AA773660990EF117FB2D031CC14 35714D233A821E05CE540D91BC3B3094B6E071905E084DF04C8195CFDF250985 E91AEA7454F6E037AF05B9C36F3E831B60390C5339BBCE792869CC9B4A063356 F8E63FB18743B8FA878B24435DD1FEE508551AF3E4061675F75191E363F2787C BDB7A1FA8798952552DBD1938C50E5DDDB62EC1C27544F9937F9B3F10BB9AF3D F6227C8AC27AE60C181984653D2D91243A5DAFAB96F52CD2CE44955AA324D889 BBE6B21BA188AD22BA29D32C5F0742E10BFE29A0F626822AA8AADC71C21FE1C2 5E48D4A387CEC80AB8ADBD2D5A033C33E3D40D12B216954D6C2485D0CF07B903 F3A63A1FD1202B0ABAD2BA4B33FF52FAD61FF8B36A27609F75D7584AACE0BBA2 C46A0A37AC1248D309F2389E8A4D8FF5770E052ED17FD19E28F32D38AFD513B5 A043B009908A08890232422A062C86DE255EFEF62BDD584B4112DF899383AFE2 23DBE766F097E55062878903E357560367B10BB95A10740EB2B3DFD31DC4234F 226D4820739A1912C86BA6DC2AE3BB8CCE02794C6D4FDFE6DF272C866192FF68 FB2BD70D01C7C15D901627746339EDA6EF033C791A1B6D82D3276D79C12851B2 3D3681F64FCB67A2E697C79407A16794E19B92641DF83BE8595738E3F5D3A187 C7D1837F37577134C1D0022937987DC9B8E269F5C4D5D949509A30A420D57B94 7A19D7FBF995EFD15D2FCA30E2C466F629AD9D73851EDC75E688F6A1E3F8C62D FE5CC4F13CD3D416CCAA7ED86FA4FC02E0BB2D7856D4671832F198C177127F34 986F8DE40F74E6E50F993979753D98B0FC99BB3AF9747CDA1C53E0DA46E7B3E4 C1E82ADAE4570511902BA07B464B434D111E0BDC5B483EE71FDC0D71688018A4 F18E6752DC29CC24BCA5694DE4DBAFA7D911F8FBA229B8889F4378526F6389C5 C6E8B92A2B996F954CAA5EEC77D8A4D46E6189B8563562AB3BC38302CE3FAC0A BB88A4E0DFC3A996C57CEFFC0C14EDD3F591A95145D00B2966936A08525226B0 41568879BC67A4434CFB5DD8E9043A7EE5914F0D986DF55F2E9B361C00830411 B62885B401B7520AD654F32DF03047033BB63DE6DDD721AEBFD2538488C89D07 6FC1306FF51E69660BFAA261B8EB6D603F962CF6A92F88F278D6D25B4B2DE284 4717EF47AD08274BC6EC924427593C9DB3E0AD46D7639991D9AFEFEA7CCA3578 946181525F2F21B7CBDECEDA8B48B1406E2D2D8F7308EE544384B69BAE6496F8 C6A3F07618CC0A2594687B257A9478EA3A5A47A7F725639E9C6A95243F289F2F 5345EA4234747FBCD612191707A71DF55D74C819B59D32F2F9027A892BD645B8 5BD95CAB8A00F1C99F5B766835F4954002E42606D66C7B07C09862D82DE432EB D1E72F78D9B398F10986D1E671F90136DFD875BF3A4B75C00EEDFB3A519B61BC 10AA7F2ACD1893674268685FE5F7A0B04EF69405415B32D1F1C3E6A0B7D5FD3F 1F5D8C29A1495EF6EA89CF757BFDCAA598ABDBF11EE4FBA3801E43C36D9E0CF6 C22A50B7926C5AB90A20AD64521A80D62BB174835E2EB18C5726DDF576F85C9B 2F5E63314985BA600342A7468836E1F0652062BEF643D96C34BAEA9838F54D4D 4268D4F46C17F2F67915D1F7C66383C6EBBFB2B61F1E46F3D16E8669891F0760 F1D44DDC56D2087EAEFB5CE6DE003596731FF8A8F43DD7D998BA3F7246757FEE CF4405DA028BDFDBE496C5FAB7663B313066A6075E9A0DC153E88EC4E683F6A6 1EB3C9934EEE05986CEF5E2D34FCDB2AD14F0880FED3073091E00A658A50C1C6 55056A3485C9ED49A036A0E5BC569EF404D2BA97369F2AB531222BBED7CCF08E 1B1FE3C94DC88BAD278BBAEBF2BE3A3192C731EA483FAFAA927C2F78C8F78921 5C2E18158B9D9AA146F14CE6288693629CE5E3A3AF445841AF40666B99655CEE 85E7B4CC56055EE9CEA274470E254B21EE721C7BB2D35F38BBE51FE1BB328625 D4FDB7C899EB36307758CEEA8267C95782A88755B76E77AD492B28C1F225400B 273C959E49F3F0B67693BD8658269EEDD033289AD8075A23B2AABBA59541C7CD AEF7E371658FC6214E1392E0F55FD77E7CB74F07F74B9C1ABFA79D61B31BBFE7 B01762E7CC201306E1B5EE3C8F2F8438E0EF6CBFD7134114B90B48CEC187BFDB CFB346724B7B4A82BBC2D0245C0C179A279D9C80B829AC41E30537B9B2A8865B 10C50F367BA571BF5DE3DF7812497EF6A45BAD7BF54074D6F45A8A4C89B13184 A6CF92E3A0616C6022F65AD971C28801DBD27ABA79D6C189A17A815865FFFE70 EA3FF7E093EE853C1196B50540B72AAFE2F2B63F95ABB46AEA1A13998C557734 0432915D73C97B82F0D9EBD2B86B8032D84C7F70DD74509E3C396DD6501177E6 9916F59744ED38BF3BC1DBDD849CBF76FA204E148231C46547D4F5EB642B740D E2803A11B82BEC3C80D6BA3C5E94C20838EFCA8E169B688CDD3FD4CCCBE9DC27 D39BD69C085D0BB27F7BE02C06BF3D4B49BBC4AA76F5DB31C2EA45242BE310B2 F400D52124C1B7BB9046A3833D50F1C7E41923203B5226688624130EAD6936BA A6E9E23C4CA8172F88328E6EDBA90D46B919032782B485F5ED6C6D12FEA9E1B1 60E911BAA4B62AD692124876F102A9648AF0066F1AECE6696BE5CE78FC152B2D 02913B9E9E0C11BE0DAF36343F8E457CC2AD9FFBAD984A2558A356FD74084BF3 92D990A71B9C9C363E4F79E92483815C4D8B8FB242601FF24FD6714C089DB145 E817E4A6613D47C7AB9FD8043C4F35B031A2F9322EC41B9DAE37C77D3123B7C9 5AFEEB4B4012AEB0D6071D5170213EC0D0F4C01F17CAF4DECACC73371338655E 516F48691BD07B046DAA8F9A7768F2078267F528838DC694B7FE7C82615770E3 131BB824DF034C2B85A423498DE2F555C415E0FC148A249A692CC456829BCB85 F68CD3E55A63F941495CBBE87B0C2B1389C87BF96EBDC156080A188361E70AE2 C1169041ACEDE820E119CD59384140E49BFB73A3CF3005B78EB07E780D3F9BD4 C76142E298B199EBB05088BEBEE278989BC1B5C13E70FC852E98F978E3002F2F 8CD01E74C122060B1D4A563FB7C654FA8BC891A81497AE90CB8C9ABBE0A635E0 852253BEFBD56FD221530F554C125FD9D2CE1266E96EE0B081EF8F5CFB15C5AF 7F303310BC4EFD3D9FD5202A8B04163B00EC1C13FA312AEE4DF145CE8955E28D 7912F6F1E72A4C60767B8B9EE59635F9AE2FECDB18434A48E98309B1686AAFDC 411CCCF31463199A9854DF355C3DDA02142279E30D180111BCBE8716BABE97AB 2296CA4A521C9B2D094AD16006A6EFF78F729939B4AFD13FCDF4B3E1D135E223 5D678C4F25E1EFEC9CE627222723EE11394811C312D04F6B8165798F5B2C8972 C2240AEC71AED9831718D3D7588E1323F39B1555EF06EF783D3B3BB49DF56768 CD2F681B598A33A4810042EA08584A1F92178A7661DBDC05DF57D241FE0809DC 5F965B7A69A13AAF5E0919F3875686BCCFCED3EFAC04A3B844B028E398169806 23CF048F3EA97B129C09A735884DF3225C2BE25DF7669487C0762513D4415F46 B45F30F9272CAACF797CC2D460C9BBB32029BAFD821F9283DB1B482825BA381C 277BCFFB1E02FC954BDAFCC6C2CC6B229FA588A034ED36C7C355F464C4884059 BB5EE39CC4CFAF88A98515499F82205B96EC71027FB0075F5A99E4C5E9F8770B 33EAEE77B06E4EB531545E00F865C6CA994C0D13E1317C4FBBD6B4B3E7423C7E 8FC5B0010CDFA6B864368B677FBBC92F22E2ACBE3082F315EAC876093B808CD1 55AE89C471521E45467C1B7325E36EEB3A50185FEBC69528C85BA66428FE2346 5D3FAF38EF2ECF0E5731457DB5AE7F98EB106F30DAFD2886A1943C2AC8257A50 DBC378EB8321E6B38CCE3B5263A7148C250217A9973D8F81017CFBBD283E9982 E831EB2F147C8D1C81E3355A1C8827A7C6BB34D6572955C65F52B6F6EDA54E99 AA92060869427242D783CFD9E4913B03979C3D7947380A91FA94C48EC990474B 7E8FA664BE96088C143E7AAD45A1712C91F6629398A701E66B48A66AFD92CB19 78854A54D34C47C728F959E1A4AE6C11961BEFD2267E888CD4AF818B2A670B10 E60000AADB3F5909DC501A10D66413FAF1A86787BD58FCAE0B8C4AC801EB9AA6 EDE071D0E7FA5B395511AD2B926BB53EACACAE226DFA7665D68D44A018D0FBE7 70F13C8F979BCB9419599D189BD349306EC2D7E113D3BCC24A58F6DA3F9367D3 E485F647E54275CF31F80568E76DB6E8FE0F62FE058F06D560EAC3410A56C800 D70F486AF612386840F1A77B771357164D521F269491F352A5669C551CC6B0B6 ECD515EC314CA11C3121DFD16C57105B767D8CEE125A5B14D2D468782A9D8C03 C2ABB506F3D39A7729855D058B90171B2D7F2FABB8DA3DCA2AC32E1BC584EE16 11E5F6ECFFC443E04996E54C4E85E2974F0D9FD505A0947EA739035A6D12722F DCE2BCF28AFE5BC5DC5CEB2237CD866141E0FC8CC8383B4C56D825689D816F64 ADB89E94C7D065D34DCCD363294EE11E8DAC16111EA4BBAB850868CD273BD151 B8B57B0C2248B102CA9C68E9749DE1BAFB8BBB88F17565722FA6BF1E824FC360 8AAB4C5F758C9C6232C933E7A6AD61267DB8034217744441D6152CCE6A224D77 5FF8987E4A42F8587C969D204985D57B8764351C1D91FD6DE8058CB404769DAF 0833020CA5ED36F5F830BF4C91C2E08E9600AED0923C0CD26AA60CE0BC6C8359 49DC4F64A06EC299CDDA7434B093BFD3E9219A31A3FF33BF235EEC43FBC718D0 ED5C05A327DAA18B6681303F9AF5C1D825D82C262C37B23709814CF4F9366FF0 FA42B5D35F9D7C1CACB36D2D0A36499A8A5887F51A8B5B85BD1814CF89F3F895 636D9C48516FADF6C2DFE9129AC13532A26EA41573F5801546C7E9F9FBA612C2 C43CA692263D5D6E9FF5F2E8813DEA42EEB32E50FEF3F5C56140429E9F46BC46 887E183F4450F7DFB2D585140A07B14FD9AF1241039EAD0D5A15230FD9E0E389 39B4018DF5EAAD6D6F4432C27BDF91E2EA2CD937517E3801744E8A9B4712DE03 138B0EC333899E534454A19A701E9B6D0C8A568AFE369FB9D93EDBAD73581819 F99E66B44F78338CE0A41C9BFD45BE4C48AC8BD11B185F4882D0E0895ED5C7C0 5A11FC4F21D2E70E2EA0FE6A710CE7B3E7B8049ED6D8D89A8F63AB27C595E01B 567D3111071D9068DF0161A5C6D91530444885BE77EC750FA533CA5612677C43 12BD4A3C6F0F7FDC3E793B7F95F274B7C0EB9F7FC0EC0D11DB0C069987C01247 C856E5AD11665BC4CEC69F00DBAFB19F14C3F9E2B74CC5190FA49DA720585A9C F8A34C08187A8D98CB7B61E6F0D26C8B4324DA51C6EA3C4D03601397AC612422 0C83CB00FD1E05EF5531416FD69BB330BAF8FCF22BDAFA5EE7F5CA771D9799A1 D4852A3A7E2F43A11B7EC6885C19F66ACE23B6057CCF21AF9F561C1BDE97C140 740B0C3EA2254540CA9887C7D79C57012FEA6BA854EEE6FE3592FFCC0D82C7DE 7CA2C2394520D09923F1BA73CF13F69C2A76ABF2D51C47356986B6F72E8253E8 ECF9A45AC33C997EAA0777A82017E6AC53AE6DB966A49A1E0FF43A2895BC189D 1F495BD9D68B7EF707EF23B94AC9EA6E9EB83135DBB7397ADB4804F2F004F5F0 FF7AF73A9E706299EE8BA9AD6D2DD3C0F45EA03591945D1F6B62879905D7AD44 42B7EF769681DDC6E4E344E329DB4F37AA7999793A2FC34335109D937CB9AC60 ABAEAA86F37F579B2D15EF73D087BCE854D84615DA750AFC3B903425F453B75B 05738D16E7A1BD262C3C925CE3BE137A20627F5D4B703E7D60437C40E058FBF3 187510988C2098C67503ACBCD72E548B3CCDAD88BEF8B3F710DBB9000BC1EC64 99DBD1C545FE20A9EC8E2280FA22F908B5B895C1B2313C046F4BC1EF515ECB01 2FD90567B166EEA933549DDF4556862BBF2E93F0EBE01D42F3E870C740B628D8 3ECDD663B3CA1B0C848E1A1C5E6636A1397DC4EF89CD995FA399CEE5EFB57B2E 5FFC8D715898D7F9A52EC17C3951F9E4C21D6C1FC48C9FBE7BD01A7EA97FD13B 6CE3D1AA646E7E2B098C0A760A69E9F4E37C626CEF87FBEC6130C9504EFF14B8 CBCBD5737258B6484F1D0F9DA95D245BC683F10ED5A37F4018F047ABCE6E098A 7D8139E81B795861196F178A08B5900E389A799D73CA060122589F430FC6BC01 AC34 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark {restore}if %%EndFont %%BeginFont: HFBRMI8 %!PS-AdobeFont-1.0: HFBRMI8 0.6 %%Title: HFBRMI8 %%CreationDate: Fri Nov 22 09:19:20 2002 %%Creator: Harald Harders %%DocumentSuppliedResources: font HFBRMI8 % Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de % Generated by PfaEdit 1.0 (http://pfaedit.sf.net/) %%EndComments FontDirectory/HFBRMI8 known{/HFBRMI8 findfont dup/UniqueID known{dup /UniqueID get 4214387 eq exch/FontType get 1 eq and}{pop false}ifelse {save true}{false}ifelse}{false}ifelse 11 dict begin /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def /FontName /HFBRMI8 def /FontBBox [-112 -223 1059 750 ]readonly def /UniqueID 4214387 def /PaintType 0 def /FontInfo 9 dict dup begin /version (0.6) readonly def /Notice (Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de) readonly def /FullName (Computer Modern Bright Math Slanted) readonly def /FamilyName (Computer Modern Bright) readonly def /Weight (Regular) readonly def /ItalicAngle -12 def /isFixedPitch false def /UnderlinePosition -100 def /UnderlineThickness 50 def end readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 174 /alpha put dup 175 /beta put dup 181 /theta put dup 184 /lambda put dup 188 /pi put dup 195 /psi put dup 37 /rho1 put dup 39 /phi1 put dup 58 /period put dup 59 /comma put dup 61 /slash put dup 69 /E put dup 78 /N put dup 84 /T put dup 86 /V put dup 97 /a put dup 99 /c put dup 106 /j put dup 107 /k put dup 110 /n put dup 117 /u put dup 120 /x put readonly def currentdict end currentfile eexec D9D66F633B846AB284BCF8B0411B772DE5CE3166449D69AB0542CB99558019EE 97CFE9FA87FAC14B55E860B5663A3D528CD3784FC9647A2EB72CF1AF4E31964A 3073722CB69FA5370CC5D9CDBF105662CA6188C1B3BFA7658F71EA5765A0D152 E60FD5E1DE3B99CE70C03D8CB4F775B5B17CE9573F5046E61444C0DAFD894CFE E17604820BBE5A8FA11A10565933C0A8320DC5D116C780706E315C54E72426DD AF1E6786D883AD182ED327CBB03C39C1A2602471C39296B7681215EC4F0E0E0B 264FBAD453DD3B112065828DC04E265255F88A98D894A53C2EA239F60D259B9C CD7E04DA11DDC2F3A22D1894C225E050650EB8F164303A21EB3E4ACA9B4DFD11 CA4ED32D27854CB2E5EB24A30483161BFABB328F38A4D1678E6036D9DF643AB5 00DB54732D4B8E196B9DCFED234BA0AB91D8AD043E1D0FD1D1D9BD3C56DDC8A2 14ED696F54B14C365C0B0E226BB3B496A1E39E96266E081AE341D0D85CE6E27A B8A8A52FED4E69560C1E0F97FD1C0092B4FFBACD0D05566C8D27C3E58FA46977 AD51C7231D053AEEBCB06CF962EC4611E6101893591BB373F3C8BAB6D2C8A7C2 46E26B1FAB9547643258BD3EE31D1EFAB387DCFAA2CC46426AFC1B62B130D207 1748CCB0B4DE24B7C17301B1C9B8B8ABF4BB098A213E2413F0E66D4D93FE5808 C62FED409D5F76C5C5EC8113DBEEDAC194F409A76686B08F5877C2C233CC68D3 8864254DBD165E83E3379F9E175BC31202B964CB5A81DAD34597170925DBEDA8 D30945C0C7BDA1D98D159FFAF9EA8134397822A8E98478697003275C759EC25A 3AA5C0C65FE6CEF48548FD157EAED0946A12E1B62C8975E5D5D95610C68CCFC1 9B457B2EB8BC1CD106535A25BD61E0B06AA3A7277E2B24616873829D585CA62A 7D2632D4196568D86CA9438A2D33C4E00BE50927789C8EDB3C0B1CA86057AF71 997EA9EA290EC614552E1BF452416F0FDA295D364CF0416B9E2755FE75683D80 A1B006A5ECBA515D419487434488362C7D16222179BC54E64C0F6AD4465A919E E2CC71A41D2C95F101D1E4691B09B50CF52FD2D2E95799C4B0380E64F8537710 C3613A8B5A4631A41300E4710D8009D75EFE71D92209E2081A53544251835DE1 232B745020D3714D068C1B479641FC3E74CA84DAAAFD920D39F198D67A8C73CB AE580B7948CAB6E034FB41498BF7EA293A26A2C5E91F724CA3C2970A4B32B4DC 6D195A5570040A714AA9197EA7D598EA1B4C648370AB9DCC4112EBE9FA9AC6D6 FCE815A87251CCD9FECDA66679BB4445FCB5C802AC1F7857B8DFA909A92DFDB3 83FC2F4245DE9724FE3AD88873D97EA93639CAC4C72D8E3E0772767C2C7F1085 FA39E8832EA55BFAEE2BDE004A8B7F463C933C00742EAE1B101E515597C1D40B E38235F3341037C239AA2D0EFFCFD6039FC3259FF9C839DA19BAC412CEE87D22 DA6A1928A1680178379E40B547B5A28B4F82FA00A8A574B26CE5AE48B4E19A77 B811CE9A63AEDD6BD2C78DC6DB635FC902FA2D6A8E2619CC57E03569E3A322BD CF16C5157F6C43AB035748D3D79F93C1DCF7DEDF7400C629A4AB31A55E096FA7 804AF392F152CDA0CD204B7ACDBE0067506C9045919D1B171D16B5268A8F058F 49C87CD2665496F87C964048D4410BF2DC868DDF0FD3274521794CF66F2790A2 3D1538F12E21F431BF03BA48FE5C0E03776C89B1911A59E60A47D75DEB6ACFE1 431996E510958244E5176F65E6E34994262C3700442278934D27BBABC9A2ED22 1DF179F8B73101D521418115EE723E78F3D3A505B07C4851DC8C47B8B4B8AF8B 91F9648A6B3309E0CFB48B8A5544EC6E1A9B4CAD33561E51B38A2064548E88D5 4EB3C390D3F3225B389BECB4BE4EC83657A478FCEA2240A71D8CBB0CA06EFEC1 B64E73593D296B514F4AB9B4569B2848880F0A0A744508D154ED1E810B0F85F7 DCDF4FEE56D1B2E8F5F48A53DA7F3B3E52F678BD96276BD5D5831C4B38C4405E 7CC50C1A4ADC99D7D6DCEB38D2153611AC3A6684F0D43F2936D0C46425179326 B362DA7CE983A89BA58D16A3D58F830B6E004799B16F310778EC33509D51B8E8 9FB950673A84A99EB64B26A97C8DD3E6FF7C5A1597AED15681CAD94C91081310 6C587FCC3EAD802A2903D8995431E55218575CED40B4EB39BDB67AA7652F0FFD F75D46589EE455CB20BEDBDE93C03C60BDD04D3D7BD9AFE0C8DEBD54D7DBD16F 1A9AC8227140DDC5D9ABD3D13D70E1F1621579B707D056BAF7E9507BF2DB6881 73ED49A4BAC35090DCFDE7C186447F8D581E03DD2A483A043C2AC4FBB3AC454D 890689373DE91290B15B37BEE78A108856D57131E76042145ACB5466B187DEF1 5FCD9E59E5E8776946EEA0DF064EE08D556F6AE0B81CDDFA90ED875FFBC1C16A A0D3DF8C34FDD50F9A7154797947F357CD64096B751F427B424DC94D2A5EF7B3 FC88525AB7764A45CC1E1C5C84C4DCCA7D87CCE75FC32F8F02A713F79FF5B0D3 A2CF63B7C5644EB3900EE52551839881E5739AB888796423481A315333A4A900 80C55730EE9C31D567C7B6CAA04D9285963B81D29FB72773D0C167FDDCE2D0BC 132B2882A0857542D27349B4644F1A711C20B56C5BB46A8DC8B308AC7CBBD418 8006BDD3FE5D9C877DE5598E69762FE55FB1E741D80AE6C6FB7A7627FA343D1A 2032CFE4B32637FA3980264C4DFF76FAB2D93EC06FBA1DA4E3B8376912F8FB17 A3C71F1A27D9ED15A7C32DD790335272B47DDED926B9AAB0FD568A7D66472996 EF7DE588FCEBA4672B1AE52B89EEBF7472CF11D1F5AC1EBB042C6008CE6BBC84 03A13D65D1C455347F37FA9375038CABA6E8AA51547744B95CBDC9AD9B25FB67 454C6CD8BB1C5C77F19A4ED9F385C9FB0ABA3842E1667F00AADEDC3F799C4380 BD538FE21756AFBEC47EAC50976B7834A57C1368D0FE04D13C14A5FFE9CDF6C6 E3C14855CCF9E537B13DBDE1D45C119DD10D1A4195F85C7DECAEA16919F9C0E1 8A1C7B5623558FA3E098F322ADFE009A3E359911F0C2B772267446C084B921BA 33527425AACF0645B0B1F0E6E92480BA41DD76C76E3B7C004E1631465DE4BEF9 639785784C144388EE3AA03F433ECFDBB1FC87D8772DC690F365B49DDBC92EE9 844E3998418F5DF9988907DB8FBDA26C8698376723BF4B4E82B7D22B4AB9387F A7FAE32C8DAF592C73A9974DDD7DD10213A132158B53EB385CDD377D7030968F 145793000E5B9D630111D5D22FEB874F7961D1B050E45E6511816BD381928E5B 95C3CFC2BC8048CB918449700930F89693FD9673F1648FCA3A82A1238797F65F C9A52126B0C4C13F27F45766B85556D1511FF24706C3CB393BFAE3C452436484 8BCC5214F8829D51DC0E6A1CEDE35ABC45F6C5D8D941FC8CAB169101522D9AD1 A7FAD1CDCD517AA325E70D6774CE1250BF9BF5B347D674A50E310F903A764E93 59B2239732D48E4B0807BF838044FA93A4FCEFA710D9C92FB784ACE71B5BF28F 7DBF43C17DE99C7D79DCA0B4E7D2A9C370DA4DE5D1EB1A48F6BAEFA1B75AA299 E0C91DC3D39C9563CEA3B7B4B2486DB92B3807E53041C4D295AEA0EAF17AAF5E 2161C1EEC65D9D462CAF26FDF78FB2C96AA07A6F5CAB4095B4DFAEE7F9BA0B53 43BB21530B2FAA18BCB5513E7D48C1CB7D36C41AAEA2C055C8BD6AAF9406F739 106A6B35210C61E7FF0BFCF3FDA7B16FC5FF08461183942AF68D55104F594DC4 2EC7D56EA3D8ED802FCBA6F4841C13B46BA46B2249C13FB8EB450BB0DEED36EB EB0A4D86ED37344E7701A4126E39B9248EA3FD5A6FA89286917979AE7E055E31 2A0D75408445A91DD7E51EC1CC5F5B59AF7A574655E63FAD31D3B4ECD8973916 C67A11A8A18682E947883C18EA092FEE56C94200E6269AEEAAF7313669286D2A 8A31D3D783F0D7F76D68CB5904C49DDC430F79BD8DC0FCB3AC7A22C64D888C54 06CDD293768997EF66D908B81E9B372BB58DA25F7E3EA6B6DC78C3A40AB1049D 4C6FC453C2D9C8D9FB720992A4D6969FD271B40327EA94C01657C421F0A01028 0EEECA7395EB01686A9C1B084DD1E345B2DA21B06465C8E5D951A54F1CBFFF25 D26775D6E1CC6AD6D8865ED0A8DDE4BB90103D01B73F77D4AA195A1DA85B9A1F 2AF82F129F4816C96DBAD371AC1563E8508C54BFF2D51EF0B644C308EB8FECC3 29BE29694B07126EA14DC67F681598B1299FABF2D953DB75BABA83DE0EAD0DF5 AEAD8D411254FCDD30773C5A6AAA454DB11B05E548919C7B4913C73E2CFCDF86 6B482CFDA6710C48D176D6C5A783A720111CD5B5823493F1FAED17FB91CB3C3D CC4248D6F5132AADABBD491C5B27BAC6350A76B1AF82F4C9BD57AC84BF2DCEB7 A37F74D62030630FD33B8B69D547965153F778B9C18A4081A50FB67422DC08E4 DE5F9039679DFEACC0626045DB39A8A62969A1AEB541482A4341BE4BC5F48510 E32887276377E67141A665425480EE91FC025B1E43295049974C094E12F565D7 4FE5D2703D2CD6675D9B68886A90D9B50F80694B9CAFCD88493F8B7BBC0268C0 07772E36DF1C3D6BF41CF27CF2FC0B196029AF5EF257CAC16CBA8E555945BDDC 3684004A9F7BA7D06D630B552317CF16BFC219F9DC137FA4051A192092E014BC B0B824D3CE9625DE1C04AA0BD97E586D51D1D7BAA834241D1C37A9939BCE0388 5A763B2280FB7B0203A8D6EBE77063C322B5DB3F68C51FBCD17F7930C729EBC9 167E549BB635D93027638CA8F5533534E06108D054CC7BB82F50049069C241C8 53B4CB187EB118DCEB78682A69677514724946281BDE287B8651FF5ABFE50911 EC432D5AC58E5BAF900939EFE58A57102428DBB7581551D6EFFB992F858EE648 72E428D8F91D724AFAD9A82B3CDC3DB2C7B19B0C46238434CEAFB4E056F7D859 5AE498BA87DA032960E99945DB64491FD34DAE1899ACDC1FE1CE8BF7DE3A377C 9416BFD2CE3C54E215D7BADE8DEA09908017407E9300356DE0586D2D7CE9D9B7 F4E371678948FAEF81964F9F5238CABF7A228E0E8A3D6871E438A79518F294F7 455A94993ABC4A728F2C23BA099CA0299BFFF6AB3ECEFB077CA4A5983900ABF0 392511DCCA8B8EB2CC1E3AF03469693E6BD234FAE13A1E30D0CB75AFE5FCD30E 708C018C41A41DDC1CAECDEFF58E393767AB6F421A18FF896920457A4D4F636A 91E4249A1744548E4053C6AC3320158D90292DD23715AA63AEF7249AF23304C5 1E0E268F55AA671E3F54BF495CBE1B0E5886FF10CD990B0F593211E741A0489D 678B6F4DF3143B7C5D7872A2A942B73B79AB3C3551328952A376842143CF5F1B F3BE550DDA9F4638C6930A54B19BFB0F3711DE78DC9BA4F2DDA897075A7BF559 3F7C2F92DC5EDC232EA7C5BC39FC99426FAB9DF0A9135527A7965618AF1715AF A4BEE008D786050B54E832BAEBB25D78A0319AAA2CF08F3A0CF539787A1B7C47 FBBA8D2BED4555DB43FEA826AA56CF1D305FE2992CB8B183725FB38292FFA999 B6CFCCA9A42AD6FC03E921D6081E42DBD16934805B983445249549BF34ADE803 16EA8B4E502D2DA1408D8B594C734936A10E9500A4A317D90CE80463922F440C CC874DA70678BA32B08AB78B633E13A7AC8F52A3F9E46BE46099990A5B8B6DE4 8F78FA005EFC169C657AAEC33FB4346A1F899EAF6F406F7001A2FB3271475084 B18442D8676D2618CE46CFDA2AB9749C7CCDCED85CDD546EA540440BB5568978 0CF448596CF32569B7DA1A3970886D8CDC0CA475D578AFEEB98236AFD6BC9BDA DE045B573CCAB01719DCB9F27738EE9022509116EDA4D07DA621C2B8944F1D5A EC1886210D2086653EA0E7E61BBDE7932BDF9B85DEC7B4A0BE0E9C9B8BC8C345 4341EC11F947836155F812685FC5B590D95D812DEBE368BF55FD1C3E1BD742A4 824AA6A5DBBA711E0D77CEAA11373C4B2DF419A1BFA05C8732E199856BD2E03A BE8F7B3060C06E512483B50C980503F040300E9D3FDAC9C2A7D43A81CACE3E85 883F23BFA08FF7765FF18251B03489952FA81325D0E59793924331177EDD23DD DE2C5C67FED95C5497905DF99347B84663D5BE56304C3DF500A1F8C4B6F444E4 EE1BDFC905B64EF4601C711787EAC1FD583A4CDA9F73376AFCA0C0D3229FC2D5 6586F63C4972687896EF7371E716FBC54CC81767B068FFEE9D9E251B4D4C6792 9699F3D575F2CD810D0D2E0E34F3DA629DF253352D31CBC61B35942AF259FBEB E37C1E40236E9AC69346985B03123B6BDF0E8EA1563D79A188915DC299F5D8FB 75F221C3C21ECDC5DA2147A5FD94D57EADF4FCB46298EC6857FDF8E329171F42 A3E0FF618C2951AA863725EDDF812D4612DD12690F49F5C92553DD43B16A5AB1 0B27131BBC5D515651E725FC78C675225A63AC7FB0CCA61CCD0A225029351F33 5A0CDFF6D7DD178D9CFE84AB5B575DED2143260D144A0180338AAEBB3A0D8623 BA234CFB744BA104C7140B306697878F2D119B61EE57F923214E7D2CD915C2B8 0818F83012B6A315ADACA29611070046D3A01C7FD12C2A68448CD4A59CB06B73 4F3D7B926AB289686131DAB0BE6CDC3C8300A62948AB52FF2766A472E84DE18B AFBFB7DEEBD9F325BD7E475B8420D406653A7B2F24CCFABA13AEBFB3E06F0B68 0FFB77AC7959B62E60F0F49472BC4817A6D59DCC413E0370B49C3A854DFB0612 88A7ACDC3CCDFB0BE97E630DA698FDBE032132F16151FEFECA6CC6A220125DB7 2CF08BC3B4BC3B498225FEFDA1BEE1CF26583001BEE117A274DE63006D72C35E BCE2CA0C4D27ED7600024DC0542EEEF27DC402F45F1D5790B2D96403940E8DEC EF544B2885990681E94BFFEE050631DFBE7C8285EFD18AA9A522F2083E1BA4A3 B38BEE670693F1646DC1736C5DD577A59609FD2FFFBBB743069B18E4DC6E0AC5 1F6DCA700D584BC2F3DDEE9F8EF3D33B6393C4C8607FAABC731A7444483EC6F1 683DEEF9EB84E24C5B6BB2E9968CF09549C8353076A24893E65D0AF47B1153A9 8DD1E4F5F9B92241BD92519C0C87466DE85A69380118EF40E197B43C6CC8E651 88A78E80E26AB7C30B22F0B066A620EA8640DB1C47756DBCFF750F2D84670FF1 AC882BF61B89DCB64617DFF073EC216BA422C969630305EE6580B6B27FB98AE6 F89B6CDFE732B3161695A86CDCE25C8A5D093ACD5F2AA79C586D63BC1F9CEEEE AAC146FF437AB17F74AF08D851CA24337FA4750BA863CEDA9A39B42368BE93C3 0A53E3C66567832F72750409C47CD1CB7809AEF240768BA08A0A751428F75BD5 71C28DCBD07C93814C006A82175B732E7A521CAEDA21206963E61ABDEA83EE1A 71DAC370821DED103BF312B849BE85D3254C6CC6710606D3CFDCA014E7368229 1350111284241C318AC2A883436998A3DC9A752185D469DEB28C8A20B1C37696 C2A253A517E672B40A73FBA34223A9C6B83C76132493CAC128BB366FCF98D7F2 0359408A700FCF2F17E2436500425ECB56543DA86A136F54C47B0F8F43F824CB 596B51723F70C8D1243F01BB10EA4377925B4034F6BEDE5929713AB07A40E0F4 4A6460F5E12BF88EE893ED936357BF4CF285488B57A5992B7C57434A8895C284 E3B656F636A4D376246612023777E60A5A8FA8F5E5B2201B948FD526AE7AE3DC F3494E800D85E85E3CD8B5C4D0B4B4540C5DAF30DF419DC29143AF1DCDCF73BB 1F2DBA4401F4900E1D24457B9D4EA2A74A78F687044FAD00A7F0502C23106D56 D5B4AF79E89DBFF76BA8FB41A53F00480D6E7A0165BF90E8FE5584791AFDE3F9 A26C9D9BB645C42C85CD1049EE3C44D02E46CF004AF4D76C843463B8634AAE61 24AA103855A29F8046C929210BD2EFE21F940B751C6D635B6EC6C6C47601336B 6235DC59756B0C9292A7DF9313DC12E0D054BEC287BFF7EF652D589681C61FF8 88A9B1E40D31C73F5B4E253538C5E0D0672F16AE5E99B648A29114BEB6FE1BE4 D99B1653902CA4E82F35F9DF4D9930DE5AEA07A6EC2C658547487FC2B6844308 370E36858E64403E0894616BBD9691E64833B16F5BD523699143C3BB3C7475E2 1AAF22AD06FB556EA6712C3B72529D338E22402A30C823DD655DAC4723566E52 093A40C10C95FFFF6F55524C8964CE1CA8A70C02CDD229749F777687ED8E8879 C26149F64F240678C8A67B3BA58728304A89D56F596F0E1E2A35E4D40759836F CF6CDC988E5148B85F4816973749981545F5B408A5B60ED6EDC56857F05D4111 2F42CB9955D35E1DF193348E8CA988354F249E77C9CC8EE4CE02FE54A2CD42AE A5FAB6694A64B334CB750BB6A4D0230FC0B5892B4076DFF12DE72E6B99353173 E55F38EB140E49B33B062B9A2D123485A68A8DF8E5E77CA392FA471695BAD76C 137370FA8F3B4EDAB0571AFA4A59F41CECC3F94C4E030B83F8825318D4195FFE C4E4E453FD9ED0A7E3BDE3246B57E842033FDF8B0E6C8833655D76F892772524 D62E2985551635348936A76DF8B27F6C8ACDD3B6D216A38F109BB72F6409CFDE 55776D77DAFB223001B9A9575B09D332F0E1EAF80B05584D8DDC36ABA2526703 D9F667491C308D22A4682DFA99A2872B51CF32216BB40CBA85C8FF135A452148 C39E1164A06C9A136AAD1DE4BABCAC7D6D0DE99A03A5EC10FFC2FBB9C5153DC7 CE07BBE2A8E71C2A8DA60ABED9341B8C13093A67765C33068E92D129E7403A08 7ACE85546A61EBC731E76E66F5F95746ECED86E98261A61D8A7D95A7CF836F49 F4621B585ABC8CEB85A48FE84C39467DA41C8AEE06DA19E43B080AFFF97AC975 BA9FC9E1BBD6B48B338FAD88F4C073178B3809702495AFC86116A90A4476FA64 814762B892C82C74C5DEC38DC72E0429597D21E94A1A248B43413000B9718367 072E877C92F762C54F224E93573B69C39EFF2F46F27150DD16923581EE6C4F18 62D7F435668A1AA0F6CF00554A8C727F2B01E4B3A12358B3A97A8F673DE1F1EB C8C85EC9C76EF352CB07FA9D2697B2819F3B1BE77E47DC26F8B6F0422F3340A0 1614CCC41D40D27BF5C82EE50DA6ED4BD6582E0925DDC2C0F2F0DA63D0CFAB52 4C88D6AC9CBD937D09C5B716237FF745E42FF4975E3E26329C3AEB150A340CF2 C6B6E847062270D43540E664D88B56E6F9CEAE61FBB850C398377A8B38708ACA 779EB9FED0372D8DF634C1E8BA5CA0034A524783D9164962E475E9FE288BD039 A4A6D2F8C9D01F8BC1FCC7D84BB65C0AD3CA20FC17D8DDB7846421B8D8BBD781 A3465B5F9060DC640932CBA3060C8B5339B3E9A1F4E0B6FE10ED07779247C34B C672DE702002CDA2F29CE89DC5ED417AD983D2C17B91AB214B8E408B75DD494F CB2435A51FEDFA44141CFF891DA8B8D94563F35B61B4D9B14598C9247E6F26E2 4B3B147A76AF0E8834E0A9D1693E241F72EBBF2C540FAB2C4995DCDA3E76BE98 97BAB534701FC7128048CE8F2291AE97EF2C4B24464258BB26B408EAEDFAAC03 5ED733BB4B25583F4953C330E7A3D48FD5E054BE7F06BB54322F82C764199501 54F33F4453B8D4CE8A0045755438ABE35D8B66CEDFA46FC3A438D8297F7ACD09 5D213358E7DD4D8E1F8547A794AB0BA05E60A274CB7F3A2D9BB0498DAFE5FC9E 5FB407A7F7C34A27559032C961BDFE5C9AC5EB723C6603038A785EE0D0682BB4 05C7DE5399667499158635E9BF44CE03E02A076530BEE6BF21EE316AEDA07CC1 04F08BA994239C9716711F492F317C6BE4E3D2EB5787EE3E3A5898CB767E458C E790744FD1FB7AEE2824230A8F956C6EE3D3022BAC91E69FBD52FC3A58E65745 056794C8F911BBFBD73E162152E1FB03D55A4352AA8B1A1C9CE8073DE7E611FF 5718FC0AA1CD01075466BF47234957AC99D8E8CB15CDB6D6F88E38FCF2B8890D 85BB4F7C96CCE85342DA83939C51E260AC1549AFC35446DF0D47C60BA4318009 CC92C5E9F333261DC6BEFEE8A2B36E4F8994E04C234382951F3523113A086436 020D63DA6888A36B0194FFDC0793E370E2060CD45618CE2777F0A29366690B58 20FDAD8051B933416BF45DE7F00458AB768C477ACBBC7D5ED76D1FE72D28F990 7B95DA641882E8CF028D9EE0BC5560F2A9F926A5855D4401FB1F62CD6C9CA9EB 4CB69D0A6F329CF3522C81BABB8C9BED90F772BF213C4A4863ABCE864936DAC9 8B07C10A0A1C5FC6AC8B366C211267BEED7075B675167872F7A506F4B9E488BE BE49F32A57A4764E0C948034D90F8FB896D5153A2EE4E4FF707C55BB3148051B 2B6F2E8AD884FC8A271B7B7986621F41648BB24DFC3A9B30EB55528601DD1958 932EEDB2A7475248B957A4A5B851435BCBDFFA707AB50B2BB2941322CBBE9B06 BD9521ABE4B2A8F2A32ED082A139DE79FA8CF2C3DA903126C6C791F660DC33C6 DBC8FB8AC137280C87919BD4986592F8EFBFE7CFE9AF241D939FF3E7EEF892C1 7520A4E90C0496F9C3078B262A8934FEDC476A88A8CEDEDD8536625229C7B25E E89917375417644147608ABADB3388C9C68308F631438569982FA64F0731FF2E 78013A8E6E4E71539314120A2A85DC75CBFB6782D8C7BDAFBF15D5D862CDB4ED 58239A5FCFB3756481838B5500C3E83DBE9F6B09E3ACD4572A579221972CEA01 97562D4C56CC0FCB642889ADC7DDAE3704E8E2CA7E622D460701760E7495135D 6EE1215286E75BD7E4465C96FBE9F655600B8893EE2C65BB593B873CD5012C5E D5A9F1AE7ED88340879B2EBF04DECC857AE1C13F87CEC69C9E0775F760C4EE10 819388782A29B8CA031CB50E8719471BCAB0BA1876010405CD72DF80E6DD8B07 3B786001E3C02EC29969AF637E04D93406EAFE4889EE5F338D3C4885368281B3 C95CCE251986A6FF136A085FEF3A1F8AC88267A1B6600190E9DDC24CCCF75C69 FE6A4B6EE265EC51A7451C87587317056F47A2F21CD6B7480D63381B1E202295 7AC237C188DE701498E8C8A4A3E8E2EDEB61B783E128C91C88AFE137CE1C7BB7 34D124EB030E6D1DCD1E503CBC1FE41ADFCEE6144744E50AD6669FFE3EEE760A 8C80ABA4CB3A94509BB422DB70692A46133710A8326357BB1DDAB3368A64C98F AB5CEFA3BF33844A8AFC99172F71C0983C040D75192478688E478603573F9FFD D42D1DA7BA6D125B96B6B31768C7B6A8BFCA634397723CE024CB9A1A8115CF0D D3E4B4DC396BE9F0F8A3D99758B736011CA5A4367C5B48AE04E8C4F911B346B8 EC57A4DA26D80D31ECB291C9DA902FE21F9AAE44E3E9F0B9856DA5A0F9A91E41 010F6D9407F5280FE5690CC794B0FD87620B527100738DD02FB92820F84DC9A9 231DD2E913C378A9B0A3B12ADD0E6C97457D5BFDA26F49A27BCD3ABDE16A8320 A3DE7CF8BE67751B687B091E30F62DF3027C7E083EE4F51AB14E086217DC4B41 B39782A8AED71723859AF26AFBB736DA74068843214382A646238E69EE9BCEFC 8171C932DEEFD1CCDD279E0EF57F31E9F13B966C59281B91BAB816434577E380 D4407D0BE8775E1B4DE1606C7A7611C1CB836D64F1E7B0AFF653300EEDB9EECC D83F382E45211576133DBBDA5CC4582CC3237C2700A912941A52336F854107B6 333A96AD20CBD48AAE0A2CFD33813965D88BC90326B7429F0143562145E53BC9 6D108520D9CE9193DA216221F842FD0F3ADB7E0497A23689E18F83C338EB243E CF90B8843B2B04EE0C8DF367F52A990C81BE29F2EBB890B79DC125866EFAA8E5 0F91A710D45BB0452D7895FED4BB91EAD1CAC84124A4D4C8BE1515C177B5DAFD BEEDF3E403BDD21575096795BBEBE095C2AC87C43AA6B4BB9146571167C92936 55944704B3C16CDD6A5AD50A261CAB35B6A107D6BC3640B32508B95BAE7358AF 74592C953BD5A9CB49B56961AF65810E941C049CA6AC5F2A1AABEF97AA88A1AF 3326C439878CF36B2D3F862C735F99160093CC62480FF18D0F3408EBCB34CD78 0C1B9A21634D1F6123CEB27D2C781BB6470B3EB66A8916D3F2B14783A8C01D14 84D908C8A610EBACB40AEBA51A14B7E3A339D61737D7598D70EF3C173D4E53A5 9BEC1A5FAEA379B9222DDAF173F13384BD0CB10B25E7445553733C6615C6B328 F78110607A91F8615132299BD16C37C767647858F20B0EB013D34E2768EED405 DD7FC8EDD79922578AA8D9A7A4F63F54FC2DA372CDA6F2D3CF784C8316A7B323 867C471BB817133799E570D780099B8BD99A2092068019032BA291A275B7913F B4DE7F32CA5745ACCA198A8275BCE4A3B3DE6C2F05C8F79037AC9FC260B1AA74 28170F94D10080BE0D5F941E9D266B545B689EF914964D6538D1200A19EE6DC7 209DDEE70D10AE030EC8AD23679660C4D06FC3648D5485E1E8D589D511138DF9 37DCF04B276509B4CE91E602D4D074FC29C8F3CA03D74C5BE217429DF4C9FE2D 1D6883001C1F1511E1C719DDB7847E4282DE593E96FF28DD153DE555538C0935 367E3199FB9049FB75A45A9DB9F23EEED18B599B8F3A816B04F919B846F1E35B DC743FF56997AFC4E47FAD2B9D403D4E3035EBD4AC4E972CE87C5FF35F0D9D4A 6FCAF43173FBCE731F0165D7CAB92EF3EB4ABCF5C01BED246E9900DB44BCD7DA 3CCCC4087977B00F1D5B0463B0524C7AAF6E0CFF30842FC307E6EB92A8504C6F BCFC3EDE6A208BF32CF59FF73C0389CF160C835F2FF0ABD079A7B69925DAFA1C 34743718AA6C1E630CF31899534B489BDD35B91FD5AB2996157BEF2EEEDF14C5 CE522B4F0A34110BCFF950D89F002258FB591CD57569936C968C6BB48E353054 661B03088253D4929FFA89194FCA0718B56867F3C8A2E2F850FF4849E439FF1D 64820B016C7E8B0373FBAE10B6F7411781CF16183F12B425CC46C23D3BE891CD 7E08D828FB82806B16C4B4EB1CA4EF832E7D6DF3E91CAC45DF4A18094F71A3F4 A127B7D76BCE5B7473EC4BBD11FC62903AD582364948C329F5140D0B983413C5 CDE409280A42F51E82EE599F754FCD537E041A9019F821427DAE3EBCA834EA48 C973B63B76B81BCB06D3401F57D2EEF6204EC074D00F1B54515F06E6C1FE4415 A6C898736FCF2DF33036B26E0EFA550062235914C2AE1106BD67F60C6B62EE5D 41CA5A02094F034AB5241294B87FC00C7C270EB7964CA3443B583DD01CFE2C9A 5BE1F6C5C6048D5F44C125D5EA305C71530FD917C5C21B76B7054763BEC43D1D F618AE1184711BFDADD1C8D5B249158AE1DBD6764DA32786A44C6AAC554217B9 4E93AB3D25851A83729F23B6DCAECD0250B1913BBFEF440A69B36102CCC19A60 518F19E88A2C6241274A5949BEC109FD3CFFD0B01EC6A7CF522CA182D9419587 BEB36A76CD1BBEC3D36EC30DB183803736CCE7AA20927573759A5EB1B3A318D7 33AF5487CCE3BC579DA6176CD477FB068654078FCDC06EC6FD4D004E542B2787 8943AD99EB4EBF0084760DB4426737F25E5F62862BC03F7EB57AC186877574EF 06A43B7DD42C764A2BDA0F6C1B2483873061F714FCB61DF051FCFA4C0E9EA759 6A0D2DD7772B1F4A0993B876FD7057E96DF730061973E2752C06A1144B5834A4 11F1481DD3A59274F769B271CE071D34AC3E702789B6A9E0B2986D0EF32FEB5A 0C962FE0AB487DF99B181D0A16CA68A4AF9624A33AE5C4A98E96EB88EB47A7A5 F4B7AA4DE9AA7D025D6E415D6D8157539A3A76839679702FDADB6E7920C52783 F657A5A2834F8A257BF8EE3B3189E7864BFEEBF505916661470944A1DA850E02 C200C7FA1FBD85DC317206AA0B64A69224CE36D7EFB6FAB7AE5A7D1BBD322604 55B8AF3D4FA5ABF6A6C168B998A2EBA0D66477E7624183B1F8A511CB5F39AA92 160B0E64BCF761AE70ADD8DC35F54C8FC4D35A1EF7B8A42192D453550224D5F3 FEA8C03EB6A9762604DAD23CEEC2557A30F54AE19F6C781599DD18A307A2BC78 814D206C6A115DCA8002DAD55E7E6F9360CE098035A52D4442669E0EC1C43C41 FC3B15F12816C4F9E550D1C5C837CB34607DC3D1D054ADDD7ECE897767CA1DFC FCF84024ABEB99395B23279025B94577BBB19FBA0F18FBF21087A82FD6E45213 FCF9D60352A41DBE684AE4E8B18D213039DE2E766D7695FFFB2D0EADA1646681 6A22DBF7EE3CC3C71FE35C4D6B794372662D6851E12A1E5790B3723BB7C70A6A B352C8076BE5B4C808E8DD2A9DD208012739D924271D6D449D5733F21B6E78C4 BFB4650F1857E97DD6DCB6F07228D5E58C668AE7A3B6EC7311080C86AA022E32 5A6037DBA45561600BFCFAF86B61FFAADCE219D41E2FAFBE7F8635EBBB7FBBB9 9DA67E3DB3679A3A06FC59208A452A0C0E35356134C8A3A965E639923E1D167C 0B0A5C89C8D4CDC43CBC4EC2C438501E6463509AFA041F259959E84AE97122F3 6AEC9EF222FD68CA73E98F9C3CD5F12C208EBBF856B92F5F36EDAFDE5D1A75F3 AB1C7E663A30358ADD815687DDB99D33826C0CEE2AD2AA9B10F01B929E373DA1 2876BD26BF314CE9AA91C970DE110CC6503EC205B9F04FD744B74CE088728871 5E01AB33F0A24A7AA0F38D2057D6CFA87F0DC4D0FA7E2406F05A912C6D3C8244 4167149E9438DF0CC32B0D676E5C788544F06194E725C19DF00F7D619D9D7668 CEA6D350CACDD8ABB787B9001029219B886A9610AA37299049CDF6DFE8B9F60E 81AD6DAEB728049726C16A89E8BFD638E0100460B7310CB5904E869E4BBD09E4 9059A510873DB190B052F93F20F2E75A071BF3BFCAF3A8211A8445ED37DC6A7A EDDBDB44E4B2EFBD170816151F5E3C23828EA0B928CC7A420C2589C4EA7E4728 801C9E4825551A69DAEA71D4347680EF8ADDFBA5AEC8B0EC68A45ABAFD6C6F41 3CF71FB27E275E3BAA134E126CDD37322721D7CA972CCA73361453C9177A780E C294FC780F146CF070A5F28F732D13E4E9F8AB7A7B81CB8B2D02B63DF5D1A82D 3D4C669AB12FF9534B549CA5B96F3E8DEB3EB50A5B38ED9A70DEBBC767E30B10 E4C86A74EB7CA7857BF8A5BBD6851EFFA35904A49146585B872B05CE36F42257 ABB849F364AFFB2DD6E079B1477B93807D36B84FC067C3BDDBE47A48F65D0E0C 627A5161EAF2618985A922769A5E71024A9C18BA1EF6049989BD11A4A960BD27 D1F80818953FC7AAB14E352069EE66909F455F5ACE716D6308E0DC2E406BD098 7BC3F436F93FBF0369AC60B83413DA4EF0CE5871E400B039C7F52FB165D9C8CC E83F30EE17C07FC0DA3C40F050D121FD2537A128BFAD405872F63DEB48BFCCEA FDC15F52A5B6835572E40C75DB4351CFF324AAD0152205CAAB98959D9DB9B314 1ADACC79555DDE0C35D27712F48397A8E9895ABBC34F57821B4AAE46968ECDAF 2C312D14925955A826F93A46A8E96CE600FD65A6F77A63E5FC3086F693F8471A 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark {restore}if %%EndFont %%BeginFont: CMEX10 %!PS-AdobeFont-1.1: CMEX10 1.00 %%CreationDate: 1992 Jul 23 21:22:48 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.00) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMEX10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMEX10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 181 /parenleftbigg put dup 182 /parenrightbigg put dup 80 /summationtext put dup 88 /summationdisplay put dup 112 /radicalbig put readonly def /FontBBox{-24 -2960 1454 772}readonly def /UniqueID 5000774 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF5B8CAC6A7BEB5D02276E511FFAF2AE11910 DE076F24311D94D07CACC323F360887F1EA11BDDA7927FF3325986FDB0ABDFC8 8E4B40E7988921D551EC0867EBCA44C05657F0DC913E7B3004A5F3E1337B6987 FEBC45F989C8DC6DC0AD577E903F05D0D54208A0AE7F28C734F130C133B48422 BED48639A2B74E4C08F2E710E24A99F347E0F4394CE64EACB549576E89044E52 EABE595BC964156D9D8C2BAB0F49664E951D7C1A3D1789C47F03C7051A63D5E8 DF04FAAC47351E82CAE0794AA9692C6452688A74A7A6A7AD09B8A9783C235EC1 EA2156261B8FB331827145DE315B6EC1B3D8B67B3323F761EAF4C223BB214C4C 6B062D1B281F5041D068319F4911058376D8EFBA59884BA3318C5BC95684F281 E0591BC0D1B2A4592A137FF301610019B8AC46AE6E48BC091E888E4487688350 E9AD5074EE4848271CE4ACC38D8CBC8F3DB32813DDD5B341AF9A6601281ABA38 4A978B98483A63FCC458D0E3BCE6FD830E7E09B0DB987A6B63B74638FC9F21A5 8C68479E1A85225670D79CDDE5AC0B77F5A994CA700B5F0FF1F97FC63EFDE023 8135F04A9D20C31998B12AE06676C362141AAAA395CDEF0A49E0141D335965F2 FB4198499799CECCC8AA5D255264784CD30A3E8295888EFBC2060ADDD7BAC45A EEEECDFF7A47A88E69D84C9E572616C1AC69A34B5F0D0DE8EE4EDF9F4ADE0387 680924D8D5B73EF04EAD7F45977CA8AD73D4DD45DE1966A3B8251C0386164C35 5880DD2609C80E96D1AB861C9259748E98F6711D4E241A269ED51FF328344664 3AF9F18DCE671611DB2F5D3EA77EE734D2BED623F973E6840B8DAD1E2C3C2666 DD4DD1C1CC71EF3BE29E7C9EC47F20088C52CAEC511F41B45F7509B28A1BA4ED 78E991E33133F9A247A739FAA646E4E6103331D78C99434EFFA0CFDEBA96E089 9F26A71166DBC63756728323EE18276860CE7B87D7E9687475EB8C3881A3B7E9 032E8B59041D9C97C6EDAC2AC5F3A4157163E9A2CAE30F89D8F55D047EFECE90 9417023E780A9F6A309CA1E79F7467512A80BD3B52ED20D56209C4BEFE3E5A8C 03CFC14C76FDF4D9E42681CE3CDEEF6AB54D3AEC732EA2C84F6A11CDA44C5A2D 78F1BB59F6500FDA925F1BCABA100F629FFD6AC36D373C6552F48E3D2A09B456 861DA4EA9F140CA1F956781A6B31428F9163417DE2AD6B289410F45702E320F7 B4C84BFC68DD206F79AA0B99B12C446CD6D56CBE9BAEBE664C4D5617D3C4C14A 6EE664C63980E12FACC95133D6B4B7490EC09BE0D33DAC68E8DFFE16D8F2214D 63BC760FDA7C27DE45682CB9C8B4AAA89A125CE415B56DD459772243D9E792C2 44BD1549385C8A251891B1C95B776ECD5B40BBD219917B1E27AEEE0450E4ABF6 97BBD26C1AF1A0DBD7004BB9190B3B37FEB6678F1AC929B86E1014B98305AEB5 AD0E0AA850463D409B5FCD48C4B3B77DCF20DAFC79301014D474A9D512BDEEFD 4CC90AE3237CC95377B164F3E349B299D1492CA2C62C7F7E7BC3AD1D042C0D21 707805E844AFD81F64398A4D108DE375192C7D98AB9E69C9545D179080227761 DF4472F4DA537598608E4950E486A903AE89E433C390349BD039E6FF2BC907E5 096F32B1CE4D578903ED050D1E5FE1EECAC43B4194996DD66ED379F386B71B96 BDECB7E0786F52DA41E02312BED341A5EB4A77FEDBE847BF70E6065CD9737EE1 10BD1747E6E6EBAC2BE0743847788C43D0CBB75BF20FCDD0E9A44C2A22A89A04 170E230A86F2C4522187B8BDBF65EC7FA66AB4DBA19F6EE0F579228F57C2D4D1 886976EDE6B544D9C96C3900DC3F1B4439F497FFEC21740DD2D585E81EE369FE 5AB34932EFE38E1AFD65A4B85053AF445BBAAB4084B854570B51E7ACF82DFF18 B90C89F7F8A764BCE56B86C48C51C344FE471A7E089E4EF6D111BFDAFBB56704 49EC899C14167D743D80D3376C7AF79FF0FE062ED786271776CF1D7BD6D2E8AA 909FA05D52693F6BF10ABBB97B023630FC48E2C1A65E5DA502412C0792BEADE4 F00BFF0AC796096B34DC49CC0A889CDFE776EDD9C60E884FF472FD819F8A46D6 EA38904C0EA86EA884134366ED21A329F8ACD722A702BFB5E27C73AE45FF20A9 52B0522005DEA96196E1EF833677C06BFD3F49FB8B87938F514DAD329D891A7D FDF1B7B661 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: HFBRSL8 %!PS-AdobeFont-1.0: HFBRSL8 0.6 %%Title: HFBRSL8 %%CreationDate: Fri Nov 22 09:14:49 2002 %%Creator: Harald Harders %%DocumentSuppliedResources: font HFBRSL8 % Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de % Generated by PfaEdit 1.0 (http://pfaedit.sf.net/) %%EndComments FontDirectory/HFBRSL8 known{/HFBRSL8 findfont dup/UniqueID known{dup /UniqueID get 4214380 eq exch/FontType get 1 eq and}{pop false}ifelse {save true}{false}ifelse}{false}ifelse 11 dict begin /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def /FontName /HFBRSL8 def /FontBBox [-112 -223 1180 753 ]readonly def /UniqueID 4214380 def /PaintType 0 def /FontInfo 9 dict dup begin /version (0.6) readonly def /Notice (Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de) readonly def /FullName (Computer Modern Bright Slanted) readonly def /FamilyName (Computer Modern Bright) readonly def /Weight (Regular) readonly def /ItalicAngle -12 def /isFixedPitch false def /UnderlinePosition -100 def /UnderlineThickness 50 def end readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 48 /zero put dup 50 /two put dup 51 /three put dup 65 /A put dup 77 /M put dup 80 /P put dup 97 /a put dup 98 /b put dup 100 /d put dup 101 /e put dup 108 /l put dup 110 /n put dup 121 /y put readonly def currentdict end currentfile eexec D9D66F633B846AB284BCF8B0411B772DE5CE3166449D69AB0542CB99558019EE 97CFE9FA87FAC14B55E860B5663A3D528CD3784FC9647A2EB72CF1AF4E31964A 3073722CB69FA5370CC5D9CDBF105662CA6188C1B3BFA7658F71EA5765A0D152 E60FD5E1DE3B99CE70C03D8CB4F775B5B17CE9573F5046E61444C0DAFD894CFE E17604820BBE5A8FA11A10565933C0A8320DC5D116C780706E315C54E72426DD AF1E6786D883AD182ED327CBB03C39C1A2602471C39296B7681215EC4F0E0E0B 264FBAD453DD3B112065828DC04E265255F88A98D894A53C2EA239F60D259B9C CD7E04DA11DDC2F1C529B3B5B7DE0957CFE1B285BE9B6291A3AF28ABE4351F02 AF04A88A79079211404AC73DDEC9B5D26DA505D43121C668DA274B256C038A55 7A579A16CFC172BC76EBA9825D868905E4A0FA9B766E979CCCC6F707783FD469 99502A7DE7CE180F052453889623828454471FF034CFBF5AEC2FA95A15C34651 EB2101818F465D48B7E4DBF33B1CBAB6F20ED0507B10D0F945B9027874035F00 A4115007FCE66452EBDF55BF6C39D50EFECE2763390B4C9BF08BE144F85254E4 C577D4525B9E89215244895863FD1E235527E12D470407EBDB0095502F63D4EC 15BF4B876EE607DDDB950B502465FCFBB99C1B227710A7CB4C3D95A95FFD0615 4A5EF155C1428B78E08C8091975B3F46AB1282DA8597A8757631E63FA7C77888 100695668B808E9F30C3AA97B5238806C9D313FE7091B05A62C332315262CB11 C7B4C396309C641B0E235F81D516144088D395F7757BB1F9DBBFD36716B1F821 7B47F047C36198612C1BF0BFE12C6EF73850B34C43111C132B95518276BAF725 E07C223306F165CDC76E41F9FB798C1FADE549CC6CD6A173E85BE8DD47246CEB E388E2EB084801B26A2CA7E6BBBAFA5292E4440CD64C1AD5C8717890BF63D910 C0573C6CFD692CDF697608C83A602350A578FF9F8A36C80089AEE52B1A9AA02F EF2CF3A119F5309148F8DC97ABE85A33C7642A345EBC23BFE6C5D001B262C872 D77C55909F87513ACDD1EBB76C55A6CC497DEA0AF5E10B9B90EE0305BF5C169E A6E9534831D9C8EABB19AE0032D6FEE19F5FF434EC61CE1A022FBEDA5E099B6A 85D8EB5E6947858AEAC1CE710615D15D3CC7620516EB871E1D6C0A3D01721D23 75A21DF41E06D6B0EEDDC27555C4CA728ADFCA54BDFD1B587C744F873895F616 DBA6DD8B528D7CFAAC23DE2CC6CB2986F81259F8D07EE4A9658ADBCF4C958B5F A45FBB410D760CFED55BCEEDC34D618D8C0C42E9AD62A8BC381A000A348BF9FF CD1ED836E6887304046C4E79F1F16240BB8AB1EF53FFC84086D1CFCDC7D8736D 443A8CB5D0DDF01A1DCE725B70A3FCD7EBCE6394B5A8D823D3AEC59E53F90591 C3DC173FFC8C916C717353F28514DD7C88FCD829484666D18623115F7956F365 A8580A4AF1197A8A863267262247ACB8F2526B6FFE0DBE875FA4043B91CBF3DD BFA7CF76AE5E9FFD0E3A7DD9221A37757607E1418F1A65B5600FE40F112864F4 ABD81B039362EDB589255DAC4B757F3B0B5A9234A25A32870AD94ED36C8E202D F527FD4EBF639712DDE88FC2C42126E78AB7797BF4B971457231BD392F5715D9 E6989E9A617BF920D26535A08775DDA92301A4F73194E7E51B9F3E50A2FF1048 A8F0D626A061DF45833F31B6A860483E22E890ECBEB8491990F23971ABEA9F4E 5A89C143AA0B83815DCCFC3B380B40DA803B5B77BB6306DE98F687CE863A6531 F1A487B2B9AED1BC2B470730F4D99547489F8A6875C4F53A340F884092AD6839 B5550286FC510DA3D948FCE05CDED3DE97EE2F7EEAAB3E05B3700BF7D4B95FED E290EB718F0F42F1E065E5D0EB8B55F28DA65F8B91897B2438139EAE968F0982 C3BF0C4029DEA494C030E96AA22DEE64A15927E44DF822CBCAE70266F6CB7515 6CCBD55F457EE218A3D4AE53D0FF469357DD531AEC3E2A8ECC27C0AD1533A1D9 4BAA78354549739ECEC1E8A414F66AF382C49F82350E317F7BF7A606569B51FE 7DC06C5C3EBF14876ECAB013AA0CCEBFDD9230844659230A1698BEA13622A31F 35DF531762ED851607F2C9A3C43EDC42F35447EFD315CAA1504E6DE770E0E937 8A2A87AF50E49D82A5C60B995F74E99F633650E9DD682C9000A9C5ED9A64395F 84AE9A53CE17D374E8A41358A0D45466391F87CB10C43B648218421FBFFDDBBF 5ACCB82C72F6CACA2AA431ED4C5CA55F37D8EF33F9FDBCD288F9FE284719629C 41B5F3019C12E32703C41E241E02E1579986AD19B77C1E0DE7B35126D3770435 69A5D12D285AC2845D6C94C4736B98D41CB7681CE0E4C3556109AAD0F68E42EF 99332EDF0594AB2D97F26DBBD2DA475F27097092E43D3EC07FE9D16D898001DA 0817113F322D9F0E4C43D25B318D39650E6AE28D5F5D1DB9CBC554B17710CF2C 2B46431CAE0F69A73CA0238C171EFC53A377D7AB93AA5166A8DBDCBAF89FD00F 7DFC5D6C59E83260CB84EDB2985CFBAB2825D99C049A2A34C1F8ADE815192D80 7F33AE62F759D917CE441B1AE0B7A6C63CA16F2CC1720F4DB1E0917196A13431 56231127A79D1348C66BDCFABF7D2041E8B626114D0713DC2FC70B6025FCEBF3 B9933592F8F3DF6774AE85CCD0C84F1775E1ADB8C7603A7F32EF6DCBB27640AB 41C97046BE0B10D1A9AFA2C0E76EA7823D55593E7B69B8EBEA0B9C1707858F04 37233F9777DA71C850566088849EE8921342AA0933E69D079FEEE582A7B0ED9C 619B24AB69926A441BA9F660935A9031104A63BA61C7EECC9BFF249B5E79535A E3578D617876AD9139F89F960A2A7BB5E4BF4ACD1C65DDC6B4E21EB6557138E9 27C7BF792F36F4D61258426AEB6720EF1427B16A9FD117807193FADE2B9A6B94 5F6E8970E08A4A21AB565D0FB79F800F11A40CB1E48CB04EAC153EB0E762E14D 67DF830D59120C3DB28885BDEE2FBBC3428B7F7BDE8564D6CCB6E8B0D2FABD45 850F14271EB7ACA042CEBE8A1911A99B53A25B8EC332673866F46C7F83BA84EE 0A5FA1AD59E445977D6C4A28484ABF7962757E1D31149610E45DEE1BF0CD9AFD 75A69D20C0035F1EC4244DE3B9874E4FAE5DF80B3D8EB36BF41B1B5ECB56094D A4C6F1792BFF2687C78B83F28EE06EEF7AE92E6BE68210642AA1FAE6CB05B3D4 BAA616583B4C22472622E1FE117F7E1A992D65F8D28E2A8EE143A4EE42A0AC2C 5A30D34FBE33ACE7FD54395A05FF89697A308C113EB2E1644D792254741A7028 E660202A6E727D4F86199FFE121FB9FF3527DFBED3ED332DBE71F6894ADA6008 AD37EACB77EE738688762B48C573D511561499527AF352BF0CACF85845BFE331 2AF40CB6529B6FE377ECC6714AE0FD3F7DA9071CF9D62DD2059BDBD4DCB9217D 0015C600E63C715718994FDE47090292364A6EC629B5580737501123E984422F CDE4B4D2AEF96B4DF1A6021687425247D67D632E9C5DACF75CD9F1B1A79E6BC1 7EA6D580033B98157C0AA66261878EC0804AF7E824EA98EB2514BC904C6B1469 08E7F78841A714C5F5615274ECEF1D0F4250BFBE0A3D527E19DB9DB00E11107D 301210BEE77AAE669E1319F7A01E8F1A79938DD8F02B5F95494F72AB63AB7394 A7FEE17A0B195F48191A6983BC3A2ABD14876415F514D1AE5FE6D865F7505BEB 54810817C41C69950A6D2FCA75799D6CB8AA293556E4806DBAF8421265CECBA9 13F73FAE1A64950BA2AAF5EC424EB5F61DE4D52DE547D44CEEE171D604858E76 C5243C7ECABE7185334E628F7F88E15777113BE56C4E1D7F6A2BE9F47F172E1B 60A57946DBECADA680EAE6DF06AA385C480943FD4CF0E85C85024DF52E2D34AA EA43C0376EF5576F8B5081B3A1A545129609FC58D0FC405073545409D44104FF 8347DCB7CAB0C070463BC0CCA0BF3C4A1AA347F32B6DC4C556C15E9373430C02 97D2C0C59186E0D1C7396F858FF6E7D59BF8339368A816913264891521EC658E DA70666A58779950D1BA57B3798CABCEECC98994532FDDCAAB9DE5363FAD3D0D D5F6B8F748126E2122E125D3508B6AFC23840CED7D28D6925464516831567CEB D292C21E14BE1C5B04A6DBCD6CD2F17EA68D779DACD1AAE79B1C1A1D5BE9C1CE 9094FB7A71341811F42C7EFF9DBAB2FB0F5F4416678DD34A68116AC7C502A30D 8B20CF525BBB0CD808CC1AA62ABA53FD79E25141062767C1475FDEC817BA3433 A5150CC9D831A17138231329EFB1F2663F525B8107061FEBBBF0C56F25FC81D0 9E1A3853F2BEBE5387294185C08396208F5700485EFEF359D2C658F17E19693E EE1A89BADCB43CF31587891E8E72557B505E5E5E4CD9ECA485E6396155BDC12F 8ECD89BD35480EA6974B92F58BAB410B8C56338A3A7B16DCAD1127F49D6A1D6E 729F0CFCF1357DC47FAE3D703AA7C1FF770C003FED9E1E6CF26F33F33A3FB7B7 ECF7C071F2622BC063D0784F8225BE3F088AE452929D20CAF7A77F81936C4EA0 613F8DDBD6BAAEB68B8EF7B0A140CDDD8DDF1EF83A80CE7C520666C8EAC34D03 A418654EDA131AE8F6C8CC38553C3AD9C726F5CA80BABEA12BCF9AEFE816A521 B6E35C1ABEBD3C54B70F0A26B1FCABC595892778E14057E0D7B4A3BBE1B202E5 9D32FD7F11B3F6729444B07A06C56948AF2CF370DD2F82B53506364B7F4FA870 DC3626ADE400DFE104531687312E39CFBC3FFB4E49F0D47F6A8E40A6F53F693F 9B59380896005A738E753BE47CA486606BC1F28D4BA51E36FBA0B5D053C2E354 FA7EAB1EBCBC70F6C1261BAC826CEF1FE4FC899B39F8670F93CB15981758CAB7 F419AD315D93081A9C544911578F80B8CE982A490133088E3F429D92E6673855 B0C0BD7F199CC137DD30B0F817772307877AB3ABBD58A5F1A07FB285CB853FE0 5FEC631E0915A7C0CF4FA20CC00113C6D2601F0CF1EC6BC0128736BB54205358 86FA8C099E4550D52F61738E90C4328DC63D668A48E1F47D13734DE995635463 6A19852926C98DCD058D8EE191B333927F21E6B560F61BFA09A4F5A79F2F13ED F42B9F288096ACE1671C56CFB9383B93088D8E17835E9741413E06229371DC44 F4911155C63050FF7DB434DB07D4F944E9F74C5DEA3A5D028856EC2E62D45789 DB3F29D304E20D1B011C6C2A086360D2B05DCAA4BBA7FBCC6946B8A124A1BBF4 B320AC0BF555B76E1092FA0BDF11FC87A1C3F4C5686504C865BCEA00A54714B4 00B43436D11CD6B7F074FAB44558BF084E2430D05BA669D0EFB116CCC0BA39AB 6E31F02EDA9CFDC2364323AB7C169E003AB255A71C6E032BB486E8DA387E45F1 4021CC85CA2FE0B5465AC8A43DC24C465C10410DF8B432443BE39F8A6722688B BD08404340EA2F6954CFC5639AD0A08C85CE3F3C4E58FE5CEA1E50DA314C08E8 FB9D7A6B7780E98CA3341EC6329F7645B3E45FFBDCC821A79EBD11034AF77A11 12FC399734D16C8AC84EE16CDB8355AEDED3126BB3B717E16ACF7053CC8EEF5B 98565DF94CCAEBD227030651D637102D300A1B1FE48325ACAF70166BF7910BF9 03C89FDBD1F9C14037EAA0C8CB54E8919EF963C8DE042433DFA2CF28B81A5E77 BF1B3D68034ED2822B8CE8C37271E588C6873EA76DA5E59EC5555D944618987C E4460BF072E66BEEF1ADB527EB8B4EC744B250E8AC6C93C4A81F8FF4AD0A3087 8A0126FBCB2C66AF8D0CE707DFEA9EBE3A2B8C4820E7716B2FCE4DD809A63BD0 263C6ACDABA33669D2DF29A591575FC15BFD01AF03BE57A2E36B2F94B23EEF2D 8B8679EA5821310B8F988799111E3E6BF2A6444A45F15027E8FA6924D37D884C ABDE7231E7640FAE88388DB72425B39025C69D89312C24F3DC7C1552593247DA 607CAEE514E92FAA2E0C8061D1F20E2AFA13FFD47A8AF5D2CF5BF430893B2EB4 666833A5960F17172A0CFAEE7584CEA2820247E936679ECFBEC4370EFB683995 A3993F1CFDEB8E4AB136D1B170C6D036762FC5EBC56A8024C0C7C4C41B3520B2 A9B1834FAE30EEF64CF0F542387349A7CE983336C1633FA300548EBB6B558E2E F026E56A7891F8CAEE0886963A63F2AF0DFDD3B378AB9BB0177087275A467AA6 80CEB137D5AB2D8B68780E59DAE68E9912D86E517C21B838545D434D3831CE89 D67C558C8568258F0AF2D568A4E38A570EF90D4326972E06C8116813020B9816 1F48007F885708BDD92762EE422D1F6A786C64137141B06FC611A3C1D356F3CD 4A7A8470020B3DD7048C8AAAEDC293AE25ACCAFDA07286173B6C085BBD88FB5B 679426F59170116A3D0DA0D15B956605EB4BC7B6D0887DFE0768DEA1F16FF5AB 5FADF1EDCA85969D253CBBCCA5EB7190E2AA84FE2E89733D4A41386554F68E38 46AD630B7F2665DE5B783287BA249C1BCF99BAF72BB1C0A6CE09B01BFACFD217 EA3BD55DE7726BD2AA5001DF819F347A3A851AD73BCD5E9C180BDA168B60EC27 40B17E4DC6D33B180005DB3D39A5E16BBFA7249977AEFFCECEDA39A7592798A4 EA5762774E44A4DC5F19D1E0227F9F08DCFE44DFF9CB75E8DF0DF755CBE2BCA4 85CA2CE1880FA511A1D0DF63CF961667A06EB8090F9C26248ADA69D9F0C4A6C1 3D58BBCD05EA88E68BEC38CC7CC575ECF37FA4B9C8FC765703C5900602154C04 4D2D7C3FD3CD5B8CD3117E2B54A316981F7D43A5F98528FD45ADD10DE641AEC4 11FD6929308F0E4F44E893D43254D999C6C55079F876BCA0EF07998A1914B69F 45E5727C7C9C831A80DDD4B0C2D543226B36531731198BF52337B47FC9B29372 938B50CA572BF2C008A1996246E604FFE3A1D0E8DA6A092A0E6A368F19119A3D 997A05E5DF57FC2AD4FD97661D3CFA5162023C9FAEA085E49E14F14C6ED118E6 2675FCE03DD2B58F99EFE4015EF8DEE858778171B41BD344435E7E21F35A109C 9354A1361E3E8DE3C3C1618EE376CD4A27A1978ED0DEC5CF139544DF3FAED4A4 2716DEFB2DBFFD0F2429591E0BCFDF3380AD3A3CCCDF715F9464A63675F02E96 971C7BFDF0A462EEE084ACA59008C168CAE177FAD6250399ED3303C2414C48FC 070746F49B50C1C3352B1B5B56E652F00EE79060842A33A8CBD002E7773CF6C0 51A6D5F02E35480569E9D00493C494F9FBBD91164D48D377E146E7A9707EA4DC 8B7FC6A170BAC662D64EE49C18860955925EBA78CB12173B99DF605C8FBC0312 20F12ED720668C81624608B247F0DB7319FC4D7EC51C85995279036DC58C80BB C82E582FDF9CDC2894F3382FD6BCCC74E8BD46C4E516A9246D76EAC4874068C8 66C53A102B938F9B33550629DADFBA427D64D818CD5E2E0A8CCA59EF0B79054F A163C0DF662537620AA97A7215A17DCB21409084682AF0B08D79BB1D082CAC05 AF48F021552FC1B0AA897574555F3979B2ABC803A723B1C21AE6B7512E0D893A 5D443C0D68B9A4FAF97316DA0A0A5AF4AD66A424972656E71E185DE267D043D6 AA075B05AF285A0AAC7E09904BF2AB56D3A45BB2B75B713D0A65FE2CDC944A0A 8F9E0CB4721BAF45D3D49758893A1EF8EA925740B66827F563D614917368EEEA 3025349EECD5CD8FD3C0E8B19EA82B8B1C12E529DC59E72E80084E34B722FAEB 743082AF452099A325C9BB57616B82225BC148C0DA9D49032B0223DE098194CD 3E94EC2D96233A6E0913B5946476904D0D24C371745AC0072A4F19C822A7C2AE B19753A4235479560E3A24D5403B0C15D5E7BBE6D593140795765C55E9A8ED44 0E08F2CB6390BCA50BA8FCC0EE2E7FD05E1A84A94476BD5C3D539ADC1164B179 637702952C4F82B626E631B5477840F1FC1BA268EA868BEBDD99D1F9C7844874 5501CFAA4364CA505DF5F4605A66D92A9468A3C2335893C42AEB42D43FFD2138 0DE5A6CED7955DAE2974AF9990CDA9F08FCC3727D2412FAA66E94AAFAEEEC73F 2A5106CFD4EDC27DA7AA8776744C6FBD22A705D7FB9EAC8BCE61AAD5708F26BB 08D4D5F416315F99A3540D59B255038FA9FC778E72F7016B0F0D3CF71A53C9B5 11153516BC8E783C88A986FBE932CE11DD599657DBDA2E342B428558E7608FA2 4882FD30E510165EC7527F2C3BB7E7273593D66255FD6112068A9D4DD635078F 0A6B5961C6A71FC7E5C1595FE4FBCB67467267A65F97C4D7682A32110CC8BDD1 BA34311B6161774A187CFFD60BDB912FED1558AF306E79A7C9DE09F909411EEB 651E7F3B5347946D7E271D3D26EB84A90EF2F03DD7E3FA237F47A0ECD1E0E62C 994182AF3131F074F692BACCF3A3EFDE652DBDC683A1984F4A0DCB136F6DC201 2CC7497D5E51D682463DFC6621A0939E9A444E46445CB08C330FF6A97DD2205E EE6AA3DC02811B6B8F085978CB11CA72310B3785910458CA7D5ABF008D8C7201 277C0DD1D1ED5CBA3769208FAF5B083BB1F81DB1429322717C1C4500C7FA2B15 DBBFE4F86B261F72E75E7F68AB0E650F03E7371C270CE6D3EEF054D8B0A3FDE8 BFCE39D00E1A1252105A3DC4F027B67961DDC37B7C19EF20CA1B0D69B4A0C118 40F2A6E424AAA5C915B5338A9A6DF028E8EBA71300AC63F1242566289E8631DF 2049A98E30904101A131E0EC737C3AC6FC91EB9586514D7EEFC349B1A6520F10 F67F3E19AE608FEA4D4EF766696823ADE2E6E5D00AB619C7900E1C3E4699AF4A A9BE40B2331F2F1C6F59D27EDFCC3BE063745152D218852514298276C4B93D3C 21BD1F31DF05927D5D4F74FBC752CBD067B8FF39D5D3143C0143E0733A5B9E99 0E746E649D7DB7DF493B47252BF9CFAAA8ADA2198646CB05BD880263F84DBFCA FAAA29503A7440722982BB512AC33BB7F8EE69C428C0E1622FAF162D0003BFBA 62380A56AE00501136E0C22385FE69D80ED1F120D672FCB97FE563B38F648027 3F47C2A67FA1D547FF9DA2D552D6A5EC8599D898C76F2BBA90EB48A008DF830C ACF235A0BFEC134178E47B1E1F099D8D2AB9A03A55DC12FCB1B57B09B023965D FA63F45FA12D7B153A61FF6E16C4B1158926B4B911F32DA133B387F7D21FABEE 73146F6FEF38D551E1130CC5B30A4BB78630C0CF751AFE9942922B54EEC9A8FD FD819DF2184D2F9127CA98D256EA8EA753FD337131FFD07328565672AF18D29D A9A3D6C40996BCF135AC8EFD670F871C0DD61B47A9890990E921D042B3D8C735 2F1F24C842384E7E34F90E6F980D90CADCDB708ECD7830B3FE947F9601D202B0 0DBF16759CDE4A8E7DE4A3B02852708FA0D3205A0ED79C97B5C0324AD61F772F 08B94EEF8A0E7B6FC923CC961F50B42C525A75C118DFCB1E5F1A9B9BCFBDE852 DCC360409C735E6BD8A3B5467B81113EB44CE189F79CC26E31BC56F2CDE864B0 7AC0617B202439219B16A97C5DB91466CBE78E88CF73E301ACBBEFBD47AE5E30 6DC49537053CD91E0065B8D63B607633A6FD91B86AAC89984A3DE0BB8EDF3BF2 5D923897497030552EC4CF8A5ED8657CB44BC6AA8174215A13890131D396AAF1 51E5FD3BC4575584B5A7C19BF6459F941AEAD5FA297600AEA1D3328259B8D869 1C8A4FB2CE6D08FDE7416796ED95BE906F4EEB03490C9845735DC0BDE9097191 D6CC5D847F804C4800E3ADAB363CB15D5E915CFD83B4D0E9FA93AD9C95FF372B DBA57DA671A26ABB438BCB1BF1D5CE85F70BC7EDB8F652C9E63CD2DC86F5E188 6521CF558E269FBC3685DCCA5259DD56FF72A107A852C94CC27779638365D20B 285EA53C871FD47D0426DDC1462799376514C86E78505DE748BB8D2D34056F00 A53E0D1F7C50C2EA7B7392EDD128F00CDA77A48935E0EB5335B891476A952634 182973DD7916D68EF26D3DF98020A8687D8C566438B4E2412A1B55BEC557DF93 EF1A182A5708569E1634563FCCCB368E01B6E4541079A0FEB9E0FB1517CB371F 52BCD2A1D80D247504813C3127AC11327BA7A74D869C9F8200010B28D99C6A60 1B77E70D00A75058159C58045CDEA033426BB4D33676F3891C4EFA4108019C57 2FBF77F58C7DEE098FB58DA80E8F20D23A0CDE9A45A371F96AB4B09CB457B51E 1CFDD0ADCAD5A8F9BEF67DFDD54B6D3DFD534B222D7379A027FE2A5268D57836 BD5520D1DEB4F6B06E88B0030463CFD667E00C696FDD66ECCBD2962613F1FFB7 60093A73B9206D7315ACF99100AC020FA434BD282CFC5D7F936AC2660CF26DF9 62069893177B6C9AF02684614ED9A3D4E6D844C3DC4A3E028F90A7C77384DCB1 5760214752D7E2C0A3BB69C0A65EBD899F0321F3EB52958EDF83261A57E61FB0 A94BFB4C810215321B6CAF80C21F5EDD381DD9EAA2DD5E19E638B7951859C811 0F6E0E01417999C4346A1C5DD1952C9ADD6B218AFD54692FD0CD2FD2509EAB7C 1C0678DBBABF44040053086FBE60F5C198F5A9C2727BF72B7D4A53EE4579E1AE 3D933903FCAED46CFD51444E71BAD153A8A1141B7E503CA883E4DA501D1C4535 A47D2EE54A2553FC28116B1DD70BE6F5EC270F329C3C11F7C773A52A52ADB7CD 50C338B8599CE251E77455DF2795268814CC4ABA5A16FFB86E9828B6F8DA8DDA E50695FD089F83ACFD2EF6AD9771669873312C7E6EA2F0E1F180DC93330C658B 01D6CFB246AF4411FC31B0E103B6C5E0336E1A2D2902387B9EDE2862473EAD4A 20BB889E0D3A565B7972837654B0B21BB0F09B809B60CCF2DF8CA2394701552E 36D785CDA4701696D0884E8B8954C5EC1F1B5457E40D05EF1362A69BF555ACB9 36F61BEE71099C871ED94FB220F86A46C7FA5E7FB3FDE4B11752B8ABBC1FD931 EAA63302830712503BC571C1E2BB5F43986A121E56B30E39D73362E71A7A4CBE 4630A27D029AAB11C5669FBAB36706F5415171D3372368B1E49D5A5D50C5EB27 9DA59A2A700C34C1D5F79358B8906B8C90A91134BFE13B2152BC425722974B0D 02E1DC152F8E9C40EF5F146D57D0287DB79A3E9495E26B99E3482F9AB94535D2 A56507CB14E3DD222A19A09E2C973F818F43140E7EC5AC5D534B39841AC32655 F14A80A67732BECE5DD2E4480EC644498D8AAA12D4AFBCA9099D59DAA32E8B67 B91C903857D6DC08015196DF140B18E72FB6CF7B66E6956A17F0FB0EB6A323DE 7EA2A8E0BCA77720D1CDF123846A601CEA685941EA0609612C2E7238E29035F9 1345BEBA6ACB55D4255270DA486F6FE34D3667A82455C8A4717E304AF630FBC0 35FFE84C33DFC04A3E016D56727F663A5CEC3D4EC91B244BBA84844F14EE532A C9C9D34F5D8B8B7B0DE53556AC799DBFE2B785DA4928F96BEED103479BBBA94B 500E78CCD8AD7D735404030A0F0E391668CDE9C78041359FF5DA23FBC6D6906B 85F41D65009CA79AC7429F7F055DD708F355008234B0E6FFA914E7FB7971E9AA 19544A9A7C280419319278922D6DFF331ED59201483DFA5618730B4A8B6A207A 022C5C5CA98EF3F52F138CE6CA89C2C649832B69BA9C36524C46A2D0 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark {restore}if %%EndFont %%BeginFont: HFBRBX10 %!PS-AdobeFont-1.0: HFBRBX10 0.6 %%Title: HFBRBX10 %%CreationDate: Fri Nov 22 09:17:31 2002 %%Creator: Harald Harders %%DocumentSuppliedResources: font HFBRBX10 % Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de % Generated by PfaEdit 1.0 (http://pfaedit.sf.net/) %%EndComments FontDirectory/HFBRBX10 known{/HFBRBX10 findfont dup/UniqueID known{dup /UniqueID get 4214384 eq exch/FontType get 1 eq and}{pop false}ifelse {save true}{false}ifelse}{false}ifelse 11 dict begin /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def /FontName /HFBRBX10 def /FontBBox [-71 -223 1099 756 ]readonly def /UniqueID 4214384 def /PaintType 0 def /FontInfo 9 dict dup begin /version (0.6) readonly def /Notice (Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de) readonly def /FullName (Computer Modern Bright Bold Extended) readonly def /FamilyName (Computer Modern Bright) readonly def /Weight (Bold) readonly def /ItalicAngle 0 def /isFixedPitch false def /UnderlinePosition -100 def /UnderlineThickness 50 def end readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 40 /parenleft put dup 41 /parenright put dup 48 /zero put dup 52 /four put dup 55 /seven put dup 65 /A put dup 73 /I put dup 80 /P put dup 81 /Q put dup 88 /X put dup 97 /a put dup 99 /c put dup 100 /d put dup 101 /e put dup 104 /h put dup 105 /i put dup 109 /m put dup 110 /n put dup 111 /o put dup 115 /s put dup 116 /t put dup 117 /u put dup 121 /y put readonly def currentdict end currentfile eexec D9D66F633B846AB284BCF8B0411B772DE5CE33C33655F6FF751F340A8D6C01E3 2E02C24E186BA91B34A1F538959D4450CB683EAE5B034D030186901B458D3777 6B3942BD2E07121385120248891AEC2EB33C4E3A0CF00828D0F130C31A918C18 979FE94379C648EF21ABF659253E43CD1253866F157F1DF85AE7E8714F061B1E ABA3AD094FE8D6293916FA82EE4F486C7E513A06D4C9BE44306A8287970B4ABF B6D1F9274A5A0BB6ECF713ADBD1260D5D6C4420D357FD486470A74B2F0621B59 A9373ABECDBF32FA68AC06351EB3A0C38F58EE73E9FF704BE3E5E42CE7F6FF33 B18E14EE5154C49AC47104327E1176F71C279837AE15813E024FF291978D1B32 D3414C2F3FCD0FA2A4A0A7FC98FDBA084435E08B449C984D40B88EB277F9775F 3C11A3F930054EB5F2A3B9077FA724F8E54ECB493CFA6606B8E999B477CAF5C3 64D01C74DC92D538D2A523A96186B25C3CDC48BD3C12A8F5B200239A8EEA000D 2B379F29520347F99798ECD4A2692C5B53E6E610143CD956D1745D0A59D655CD EC21F60B2DDA04AA59DAA491B657C79A4384AAE603222C0FCF262747680FF16A 39FC9C421592B2B377E7CF81986760F3D8D571C9D415F9DE132E569CC1EBB936 B06898320D4954E7F975D13C6CB75B22B7008092D06147CF776854E14C980E66 C9F29FD27742E49D48D6D3447211785ACF9F21E60AB6C766AD914B127390AFBA 90F3EFFAFE76A2C1402A3BF3C4B70FB2243A5A96CCCAA47E929235E9A18FBD81 77E099E9FDA7453005EAE38D8F8B90E8A2031BCAB0A38A437FADFC9F826BAEA1 551BF1D4BDFAE8AD904E5B017F1770C6FE958EEE00CE1DE4B7109703632C77D2 9BB081BB99DF79CB474DE172C70BF0180333B6C42B537F9B4266B01849865796 CFED85834E68685858159AF11F13095F6E7A0270295CA87C2B96E818D07EA779 223E0ACB915D471815C018AB65E343908EA77A30C749D04C5B16356D8ECC6BF2 12F6E040553659231D424F5A59A94C611A3F10BEBF0A22C3B6AC03797DEE5464 9FDBAFD52349EECD4E4DE037C2D6997F33ABE592C0CC41EA62FB7E6505D0D062 9945A8AB1F2CB5859E52B43E21DA2320F008BD5076ACEFAF0287010341B6995D EC3C47CC8270B6B1A40AFAE8F5F752A36C0159FAC6850201D7E9CC89CBAD30CE C9A102381732BEB2B958FD3F1C07813BF17E581597282F39118EC24F8F4074B9 6C17C6D3B1E5D72540938F55C7B1794A6B30A7396CE684B9108AFDF5AB3B0ADF 0D272C713BA3B615F693BFCD7FD07158CECA1F10A5D75C8B02FB44858C85FF3F 30B6EC51C08D9B4F547298E65EE3D705210FE250E64C24A95C9342F0DCC0ADAC 1448616F531F3E2F1438FF2C98CFBED9D1B87A8DC71DD68B48E1C966330A3DA3 63331BDB4A21737805D0C1CBE038237A8AA3D32BF8D6E1ACA3F8030312588A12 1F058903F0EFD56598F4761FA6C4AFB18AB8418651E153921FAB9ED7F964ED31 4D50CDC06341481153D908E60CE0D8542F775920C658A959215C7F1003E5B41D 2A7BDB7B8EE627BBB16725C10750008CD4AA40845001112BF915FE1CAD98D0EA C02F1CF6E09E92D62158E69C62F47CFBB85BFDF8A699A64CFBF0FCA8D2C584AA 521F3FCB1FC8FD435AD5424312FDAC01C613D997B5CC8C61623AA82E7460074C D7A9D04043F8BCE20460B819B52B85053185AE6CD16845BA7CC58A0CE61B6CEE DFAF486F58FEF25284B5B5618A6762967822C18ED64D2068C3DE2065A772019C 474B0514299334543AFB41EA6562C59C5C28F859D516B562BE6C8DE633C308E6 17BCED4F9205008079F09BB2FB82B1D1E2E12482412C22EC0C64A7150D6C43B9 A09A43832B289ECDE5DC0AFB32A9BCBECCFA292AE5BA0FB5139640599CB59413 87A78C1E733A92C8B97FF27348B1CDE907447DDF328FE1C6925884EDD2049ADC 2E45DD3BF0F56C7B9B1A8838AD07317657050B505070A9C4DE98D41C7F6DFB6E 00260EDCED9A6FC8E5B7B915712E24DDB35E63C8A2951F771CC656327D113461 7F6B1B60CCA38D23AB92E8A97C2CE2BCD216B45A7F12D8A7E2D22AF9AD54E05F 9811643264282FCC0CD09617237F58EF15237FAE74B8D924E48E8EEA7BAB1F7E F9D23EC5D263FDB1CE3CF726D64933BE3E7B9289E87FBBEFB7AE92D206BCD88D D228EEDFCA2E75FCDE835DC0BBBCFBFAAE0925C67715CA712F25D55BD054E058 D3E91D4E09F7B7B2AC0F915A89AB253EFA653E29CDBE7BEAA5F0B89AE754BF7F 8203F0C857CFAE8A868BC6584136962A0E74F946EA19C26B2B56BBAF1D727BEA 6D6BABC22C30EA308E6A5C8EEB5921F493C8F5B7691CD5CA6F336551A6836C04 30A946C0D864190CE11362E2DE7633D312A996791F48BFF3535DFB0D05AEA2DE C88BA1957B94105A98E5ADBF4795A108E6C6E15097A1E92EF181A0F0E3854B28 930F95E0558CF3A66A20FC90AAECB93C7FFF2F16174606AB2770299A4EAE7411 7B5C245A4CCB9D4320925A3BDEEEC5D09AA10EC896D547FCE3F28096A95B9ACE 24B77BBC1AFE19165F8DA89115FDE6ED9138A53B0A146FE4BA59140DADD4CC29 7DFC37AD7469C554F21DA9C2007FFA851430CBB33294081B7ED0D12F094EBC9F 3A303E146D5B42D12885FE7AFF1961031A81A012D0104698BA30854D6D0E39C0 9BE3CBACE7032FA494C240ACBD6FAAB7F7E185DAA3D23431DE441E0D14ADD66C 3B5C2E9F7BE3D10A1AA9711B886A186DB61E3F985EEFDAD748E35BA035E3BD19 641F47A05F49CA2A65E0A3E935AA652C0B7436CBF8C2255DE4C035D2303AA66D F56526A41CB14283237C3338EDC66E14A05F7429969E4E7A93AA015831B5271A FCF83EA09EC1FED6A31E8789F3A05B1B2A3D8A757B04DDBFE5FF8BF5257A549A 4BA9866D7621F5F5FD315EE4C1EA704A154645DFC342513361C9C6BB8740A816 C9CC7B59EEB58335FCDB592821C7797C167C8DAEBC28D7DE5CB57A30F23A2859 902409CD4BB5F23D344B5B3F2A805F8F3BBBA4BD19649A69BDA189C181AEE596 62497B7E12725659EBEC192BFFDB175F07F9957A1610D43AE6D6D28296FF0C92 CA794AF8620ED7455C976C40C6E24D231F29E6BA9DDE95A4036BB8EA2D68E485 370F7052C49FA92419B17F95F126BBB27DE9E8127325C87E3842D1ED01722E83 6098636FEBAF6E9A2C69F153AE233488B2D41B812A11DD5572E0106DB6CF9706 6AF9A730E2CB0E054CD9313F946A2BAB714A362DCAECAF285C3F8DEE0BD782DB A0EEB9939BA295DE4E68439B79B3BF41119BDAD22EC94394D585108F439EE6B6 8E810458E2756AECF6A0D26E19F8F0894C659A61707FCD8CE92BA55C13091A80 CB3496E9C65ED640CC003BEB03019E2B2158B7FF166C507B49AAF6FA4A71C746 83F2BEF3C5593A7FBE0018B685A34C3C85CEDAABD9BCE6C7C5241362E0D71E54 543FE04B260E4F9FD9831354B4F5CA0EA943DC94FDD1A838F1F3750B8A5BCFAF 471583C974089DD58B9825B2E79E75461E4CFCC12925529A1273BAC1F98F12A9 E59DF189DD12E48CE6DC87C20244698BB756D8D9BA458A0FECF7C5593A7FBE00 18B685A34C3C85CEDAABD9BCE6C7C91E817B839CC44AADE6DFC1BC7CD3BC95E7 55B0C4940AD93441E22F30AB261206BF5ABDC96B4FCA84DE1AB13DEEB08AB130 15B27D058BF33772D7AFDED0E9FEA590380549E139FCECF9BC67B578D2574388 D48FE4A0CD8D8A5948FF72976279F192FD0E96F13E4BA7D44ED7214049BEBC23 CE9936D3E707B27336F256F79DA4470B37F7BA7381755C790F1D9600FFB5860E 6E5A49C78E629FAB784FD7E343EBEDCCFD11799F3930E71A3F36BEDFA4A89877 8D66F8BE7ECBC8A6F5487147C89A53268BC906C700712F19DED0350DAC372537 A0C28958596478401F6EE01F4848093160843C3C96D91BD898022E36EB7D2D38 7C7E2B0184F925114B264DD4F3345CB513B7EF1CF7A510E13B8D6211621CE019 5A55CD9EB0FD161922FDB5E26D23BC211B27FC862C6DA3F5BF8806789159BF4D 3E5179BA96D4C42B00A0586779AF55F79D46CDD5C15AC7FF48EE2139BD9337BE 6E68ABD020D3ADD57B17D30AE4796F838C883BA9122F5269A0E58EC53EA62A6F A24BFC94430D2C9F5228B15E287DA1EA1839CE3D914979E7FB05010D09AC8A44 698564528085CF1AB517980D231C0286E8BD991984D6671555501DB29FCF4D15 D5B3647AC2340642EF4964C257F3ABEBDFC269CA0E864BCC87714E80362D6E7F 4DA11093DD8B060436E6EDFED1497B7A637F233596615752F1278BF6313D4D7C B618F8977DD9424E0492D40ED921919B3078FEC35D311CFB21EDD8B442FC51F0 03C1E7F5C0E17B3519DA73D378A2C924BF9F43B463B95D06A6390C8E93E9AC04 EA3A83CC5A47E1993FA99954A10C3AAEB73B6A28DD8D4DBCE5096FE80D94FF25 9E32137B885597369DF43893D7D2DBE738084795BA932B01DF194DA3B3C37E20 024A1D3C689C81A1E39B15D9C0F039F821443555235A17EE1371F5761194E107 3EAD6C0A7EBD41C7F28F7ED03EFFB95BD73EFFA8E79938D5EA89D19709EA5DFD 5F1A60073A969999F2A93A4B9E7F617EE8066D99B06D30ED9219FCF013C89B08 E4DAEE9941D44D8DAC7A604D865BE4803EE9CBB72DD63245E86602BF37AB70E7 71E642DB28A2B696BFFA2D88ECC041A355B9D40B657161057D13119967E5939B 796C327DEDE177FD3112D2DAD91A9E8DD41D4371177FF35DF164DACD9754C869 4B878AB6D07D8F0272E1BD78909C7D94C502EF93F5310A6A56006964951DEC96 BAFE571292D6EA772C1C0B0AB251E9C2D965D130D2C607F85DF2CE2720D52856 9D8A74022156AF24B146E491E9BEB7E636698232A3A493D8BE0E66D64ED68E9F B47D35A26B82D04AB7E6519D725ECAF2BAF641E76CD163C0DF5E0BBE0372D07D D8677654012B2D705AFFF769865AD8B005FF2F0CACB4484EEA9FC52237E5ED98 674E7C8CA0614001C00F5D3628A91AD89B82B4BF8DB35A36C6F86B41CD4B3BA4 BC0F82B4118BF85FAAF3BF06FD4D05198F0012A20C813E068E6B9A3CD7D808CA 358CD26C043CC140D9ACDE14B0AFBB5D3A3103614DFF293D900CA973A1ECB001 50D9E0263654F96AA5FA7A767AD33F32506A2FBC36194391CE27B7C4C0319218 0063EF056B5D654445780C198637F7CD43D44A815443BF90101F703AC02FCC00 D59A0DD24807AC2A67E64448F9A609ED3C027001F3808F6AA3A9920D3A8A5F67 648F289178BD7AA3CD148E9C1597CC289F92A730B42FEA7A93DEA70F1CB840B2 C99CAC25ACDCC0461BFF32EAF7503E2AFC54DEC9DD2FF58371230DA037371BA8 F82D698E9AF654AB74437501F7AC80652B1E233E5B97F11347E49224F3FE0742 D530317BE39651C7EA0C5354769832981B3F08DE9C8020941B28597694B48557 7C32CD71BEAD5E776141618E5CE8F06DF300D52C3BF798B9A88880A8E3F91B4B 446C3A8A2593F5F951819ECB384B2C332958B702D8773FF0FC266C8B9DEBA5BE 37009036A15BE88A4AB7DF1CC00F4463D2B23BCA5E9A318E336B05D53B2C646D E000F6D2CE347057B4C6CB39784C1C363290A83D9577C4926174AA8577920285 6117D846A1F63F7BB01D783ED890EBF984A625068B276980359083E3E4559E03 57D470F46AC06A498685D4414A22200C4B8CA461605C4E21B5221FEDBCB8724E B1C4FC5F9320EAF0B95D53120E3AC56480C6961D4C4CEE4447FAA8E64607E42C A6098FDE5615616A42310A5039DC7DE82EF817E36713416B9D39B3A513C6EE4E 3574DA021BF8F3E1B43645362C23AC186CE55D09F367F2CFD1D5E0BDD4172781 E51ECE8495B828A7A6E50733B3B461EA5B2FCB79F7BA299EB11F79C36E232C27 11F93EAED99B4B36F164F2E047F1E5016E1E8CA02D991AB70681878C9D950DB5 DB8011907B8AB736FBAF7225B918A0EED0D6AD15DEA682C65D0BA9BDB3E0ABDD BE1194FA92F441415A12769A52588647510AEC4E2ECAD7923148CC4786F03640 511FD93D43C95625808704BB7F30C62A34721FF2562C93245B2D799FDC16B98F 41DA09E009517DFF505CA3B57134D88151A173DE1E5E6975F35157BCC07DD7BC 2BD7FDA3BF8603D6191D24ECD55B2D3EA90F5B868B1C3228CF8347A1B0E38248 60A5D1F54A2BA682303D0F478EF1FB59E6AA53354BBAA1744E66E4984D87B8EF 91F4BCF1699226EA6C09070E928F6711C1985B6264174B88194F3378FBBAC064 946E19C7C1D988E2C83D3F7D574E26446C5E88DB8327E4612D3FB3D76071F209 384E0B4FCC06F3D9DD66E35C747EC63873F05025558D7EAD74421365D2262070 2C1DEFC2AE1B19F03FF4DA28C8AAA16F941F37B88197DA098F6FCF48DE8EFDA0 9AD5B5CB75A8833CC524B07B2140B919A8218308615B1F80453A101C6021CC62 0F3A23EA4E679CDC8A94FF5544695C94878A2EED21D12A0C6D1735EE85792D17 4D14C64A33538D0B769C8BC0E1823858F106DC533FAA3A3D6327E247EA8B71E1 F4636BB996A04B7E2282EA8E9701D4FFA4517355787F9BB2F938C0D49A172B68 E6B5CBBCB53FB9DF39C9BB20AF58520F8368BF7AE4A058440484A8F217B44344 371F2794C53702F0417F6668F9ECE2BB4C443FAECAE6B6EC1538BBBF4C2A4BC0 2BD38574BBA960474A04C224171C13333F850CE2D3292FC7E16C123730419E65 C14FFFA64DDC355717E6A04BA85D400231E416D7CC864B7F781E7780854B88B1 95C0959D28527BE1BF4483C7B0F19CE714B6509857CE5B30C689BDFFB6F13EB9 258BE0804189EF6EFEA4D39FC994833E6E227B4E95A17323190CE2FA1171959F BAE94F782457AF24B2B6412CABAF03526E49555643C5A582C44AC1660A8297BD FCB6666FDF04AEA83F0080F1872B0C648C19DC44D80FB7119F36DE9CA0BF1E4F F29D8FEA6BAE79BB7D4559792C40DA0EFDA358379DAB8248AC46597844FDB4C9 6806AE708D8B3F6588E36878796B400E29AB5ED1719D580200696AE324DD4F31 57C52B5B0EAA3002FE1D4D1C1548D2DD36FC5690B0BD47AC7C66F38695716187 398C5BB3683B1A4DD13D9DF05D73F7E8A832797D09EC3960E2BC45E197A94466 D0F87CCEE00287E9E6BB71F091F17882FB0CA786D73E767DEDBDE777F986B598 A5A1C422C4C8453A241B55E410AAF30E6BFBAFA3DAF73937378F0C6B7A861686 0EDD6C6DF560F9DE83F8403A492F1555D7B6CB7972E7E54F3C5896CDD2718F4C D22B4ADB7165446CA90F439D99FFB3CE6E27128F8926F8BC805829533DF20703 A8D69B9C0B4EB723A3F5AFDAAFF5B45B99A4E8CA61FF6605E03A43BB9DC76E88 3BBBED8756C53EAC94FF0C1045F7534FDB92D61CDA43EE659FDEEF31F98F011B E1E834EA1C8B5CE8D16A5B137E4431B705D154D2A4B950FA970D17AF770AF285 87BA6E7DA4C1F0532C5DB1CA4FD7DFC05A9F44C6557DEB6F6E2521D525E7A72E 5D8CFC7AEF209C995EE1AFB63085754AA20935DDF3075100E38ED99E0388B0F8 BCE3E14BB5753AE7189A1472EF9EF5C9E241CB68F227FA201A5E5B6AB2F522C3 2968F3BA19638635B570AC414FA762199F89935C26214D95640AAA3ADFA14D7C A18DC879E0C73C5D5ED5B3B8B910ED94D498ADAF1EC2592E614969928655579E CBAAD1FE56C12852C200855875D1AD46B53417309E772950DB4902BB11B009E5 F0495F54931E74494808FBA5C221FFC28F8BB56381D86FDB5D38B198E5B0EAB2 B42DE438B92BF4CAFA07168397871721897DC80261FE76688668F9BCCE94B297 EE08CFA47348024BEF617041D389D19A147CE89E6C662A974E5D0314D8A5AE8A C52BFE53D24EC7721B42A399DAA7FF5593871D8E719955A95D17F30009E201A1 9A293F7C96EC425F44CF59525F0CB61E9B28AC4969202B95228804E5901BE79B 11F1803CEC5DDAE54AD08CE90A36A5372B1FDA040CB84FE21CEAF5A2C3B1BC27 3FF6301D8E024658ABBF03F9EF63C4FBD7C5C86F8DD0476B248A6FE29A67DC60 11F3582054B8ABD16B7F94C50F484584EADB385370CB48F2AD707CE280A04BCF 2CB319EBD64782FE7D746C3F085815D31344C95E6C4629E56ED5B1AF0A40A057 9DFBEBDA78A83B7AF1AB4FE1D329368A2C9FCA6ACA204738D77EEF55607B78C3 E11939AB311604C75736BB034498AAE17B919EE4E32661FCA6FC63BCFBD62A2F 68A27C5807D1F204342D4D96BE176C9E581A200235923035DCA3F83B86CD9F52 AE58AE06A56BE83CC91E2BDDED235A598503792A2D4DD7FB945D61D65ACC0241 4F693EC1A297F1CABEA7291F4DA7C9EAEFEE4BBE80308831A2983C31434DC4AB F99EE33B400C93EE381647AD6874B2C10F79A4F0E84F0F99F41219E74E14A14E 861B28AF51CC9622313BF41D7F6A7008EFEDB21D2AEFE500BE7E797AF3161F8E 05CED45EA89E6D3B269B1F5D63E10A3B160B7463785BCCD7FED94696CC43CD8F 659993E3FF53C5DF2D31109FF22F152FE171266DDCB238938A0F18195DEAF27F 680F58FD87FEB62924DF1CDFAC2813AB0AD70DF165E3499AEE2AACB2C38112F6 04E4E2F176C4F011AE80DC1F2773C42A758ECB6B20E60FBE495FE8AEE915CD7E 4F3E107D8427C70E994A75778A3693C991A96A9997D95065724444B7C8DED5A6 6F96B918CFE2FE840715FF6E1CD5E25791AE0BDA87B90AD919421BF82E0EC93A AE4E9EF4825C850AA588AA 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark {restore}if %%EndFont %%BeginFont: HFBR10 %!PS-AdobeFont-1.0: HFBR10 0.6 %%Title: HFBR10 %%CreationDate: Fri Nov 22 09:13:31 2002 %%Creator: Harald Harders %%DocumentSuppliedResources: font HFBR10 % Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de % Generated by PfaEdit 1.0 (http://pfaedit.sf.net/) %%EndComments FontDirectory/HFBR10 known{/HFBR10 findfont dup/UniqueID known{dup /UniqueID get 4214378 eq exch/FontType get 1 eq and}{pop false}ifelse {save true}{false}ifelse}{false}ifelse 11 dict begin /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def /FontName /HFBR10 def /FontBBox [-77 -223 1049 751 ]readonly def /UniqueID 4214378 def /PaintType 0 def /FontInfo 9 dict dup begin /version (0.6) readonly def /Notice (Part of the hfbright font family by Harald Harders, h.harders@tu-bs.de) readonly def /FullName (Computer Modern Bright) readonly def /FamilyName (Computer Modern Bright) readonly def /Weight (Regular) readonly def /ItalicAngle 0 def /isFixedPitch false def /UnderlinePosition -100 def /UnderlineThickness 50 def end readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 175 /fi put dup 176 /fl put dup 39 /quoteright put dup 40 /parenleft put dup 41 /parenright put dup 44 /comma put dup 45 /hyphen put dup 46 /period put dup 48 /zero put dup 49 /one put dup 50 /two put dup 51 /three put dup 52 /four put dup 53 /five put dup 54 /six put dup 55 /seven put dup 56 /eight put dup 57 /nine put dup 58 /colon put dup 59 /semicolon put dup 65 /A put dup 66 /B put dup 67 /C put dup 68 /D put dup 69 /E put dup 70 /F put dup 72 /H put dup 73 /I put dup 76 /L put dup 77 /M put dup 78 /N put dup 82 /R put dup 83 /S put dup 84 /T put dup 87 /W put dup 97 /a put dup 98 /b put dup 99 /c put dup 100 /d put dup 101 /e put dup 102 /f put dup 103 /g put dup 104 /h put dup 105 /i put dup 106 /j put dup 107 /k put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 113 /q put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 118 /v put dup 119 /w put dup 120 /x put dup 121 /y put dup 122 /z put dup 196 /dieresis put readonly def currentdict end currentfile eexec D9D66F633B846AB284BCF8B0411B772DE5CE33C33655F6FF751F340A8D6C01E3 2E02C24E186BA91B34A1F538959D4450CB683EAE5B034D030186901B458D3777 6B3942BD2E07121385120248891AEC2EB33C4E3A0CF00828D0F130C31A918C18 979FE94379C648EF21ABF659253E43CD1253866F157F1DF85AE7E8714F061B1E ABA3AD094FE8D6293916FA82EE4F486C7E513A06D4C9BE44306A8287970B4ABF B6D1F9274A5A0BB6ECF713ADBD1260D5D6C4420D357FD486470A74B2F0621B59 A9373ABECDBF32FA68AC06351EB3A0C388F7EDE3D9D355D9933DBEDDB5162DB2 E065C95E6D27BCABD3175EE1CE0E7E7C00571B5081E595D70C9CF1647EB0F53F 7298F407369B5B2256D99F3ACE73EA11EA8AEF444CC2B95AA8888CDDD54FAA38 349925414B53EBA844547DF4B6776B552C3A8A5E1051C9F8E9F2B66BB6A3061F C0282C9E8CD03BA95B247F97135B16F1DAB3994CDDECEE95D123686A5A904415 F44529729B8D918A05763E3E72ADB48EF91845262D727C5317E0EF57B941CB1E F30E5BCB083CF9DA2934BA93AE9F58866761F5A6F06AF1593DC77775DCF4473A 1D9EA86FA4AEDDFDDA0862C71F7D6549EBC1D110ABFC616EBD848228C8C15827 B05174E11F2419EEA608A97607D38A899E0C835C7B87280FE33D83D12F9C1412 1E2192BF3FDDC35FF01837DB532F7C1E15D4A0FDE8770579643DFBE83F67B8C2 D5CF2F090455080C439E61514674B8F7052D1FD58C7CA74BAE5F3B1BCA3ECB96 DD1881E675ADF443DE3A105AC3D890DAF756B1970EE8DE34886804D790110FE4 88D09F26AB9A1BEDB993E313B478C5F3DCC8C4CFC410FD66134C4CED480A19C9 3FBA1B91D9B26595F4BA992AEF7035B0EE0C9FDD8C6B795E560D7B1CF90555E0 7FCA6CD43A263520F8F243E6AF9DD3B460124F5F78ED4C782899A87DEB5EF1B0 CEFDDAB76C3DD587301FFB94B17AE0CE33920ABEA864204512AC262882C7F76D ECE373813F5120BF4508B8BEBBDAB1875F3593F45A9C0A57129453D006E389F9 25BEF5AE2780AAD722FA2EE02741E3BD050CAF5A2EC30D299986292940FC1F7C BD69A7AB9006DA726370135CA257262E2D799D32DFBD971FDC4E6E6505AE240D FF74A2F754FED15CD200D28B0564ED41977BDEF17927C9D06F5716843863D01C 1FFE63190D3C9DF0CC5BB3D84D1CD5BE08DB07A339E17B8C982B8395B1782BAE 6A6AD6AC4DEA821CC5FE7DDD3CD527317F3063086D8B6746817FD31B267DD0FD 75DEF6C4238A71C1F351982211A424AEF6EC71253007B8C2A6733B9AEEC1EA50 C522B5A42C4A99B079ED011928C2CABB928EDBF84BC2F29B7ECECE6266769BB9 A4F919BB5E4F958D452D448485D7F64F8FEE8212CD7728925621AC4EE580A496 B1062FDB354D0361A30543CA1CB15E82286A1A7FAC8FB6B47C80B4555FE343F4 0C4F652DF6A4537FC25299BE55008332B6ABA8530292FFB46990A5043226AACB 842E7FF72DC5293A100D8B2C23380A3492F87E469A8D4A0B9D7C5926D1B55575 FDCB5F12391781D1555E66E0D67549FBF0833C82209DDA78F22714FB9DE80D38 33DEEC7848D7C0BC7A38C53B3E51C9FD432F22202E89A91B046BA4CDDEA3195F EF30511D5C87876C863364CE4B089A976F9C2607582534D5F0F263FA4C86EAD8 8DD4B095845443961C27E56CC157560A9FEBBFE627DFFC6E90B9C4CF04EDFE39 D0B1B9645A3C1F584C7BDA1A1CF019F96D8CD3EF01E888148FD13E5CEC59FF9A 295E5E09A7170263EADDD822C4806C9910021263EC419BCE1D83330919C371DC AC3BAF49F779E13BCD867CF27A8222DB2B75CA6D2D249929BA4C2DED2BAA764A 41DCB7D0007F0BD2721C066F31553E26153DE9FED3B3F6B887D11FC9CD13CA0F DAA9BFEDB9CEF1998EB975A32C3FC5056FF3647FED0AFF1F33FB13863341D127 CEA81A0C7DCC7B2AD411091E49BEE16A177AFE57D15B1C24797AFAFC1FEBE672 2104D834D413E8CCEC1D4BA23F119C8B0D59E6CC257CB5621933DC5929F623CC 2170D51316784B01E538A60CD0507B3A795F0368768AEEFAC6AB8E84B4BB49A9 72F49D260EF7A5A6763155E7FDE34FD31DBEEC75234E4ABD28D403F75CC1E5A6 817EF0D28C1D8B0F466E3BE65CF18EE527FC661B1ED5A694C58349BEFFC4449F 832807549F2403488CF2897FC489FE4605247509EC69336998602318DE152D2F 89EEDA09B9025CBC117087F070AFF16863C61673B7A578E6455C8283ABA9BD28 91CB01CA73C63CB787923C5AFD9B42A8D53BC397F9936CBA7529A4BAD58925A9 DC9B110374E5CAA61221CB271314CCED8FF738C8090E857AB029E6C75123998F C42D3E0C3F20960AE7B25433212B4E4CA2D203D5E732FA02797B386F29C56DE6 CACF4C3FF495F0D3B1317D4933E1E097ADD1382058803390CA8D6FB9CA953A63 369889DAF8A3F15A90660E66A45DBC1BEE2A6CDC46E94F4A4CC84D6DE6DABC3F B540265026F4B11B27A4706245DA08212C5C81CA38B21F897429B05E2657D357 45752639F723769638F6DF84169A5D474CC5B6B89638EDC44ACA65EFDFEA267B E5FCB0B209B090009718A49C6D7256EBE0D9738BFD8F085EFAA28460323E61C3 4723FC8529F418BAB1B4605A00D65EEBA914A515BE7F74FF21BD3F405F2ABA90 EA40D6F2FE1D28D125B2A6759C9457FD9AA18D51B6F3880C38FB2349BE51D981 A08AA153E57EEDC182CBE1F42E739B6485473B414FCCA4D5C10FF4BF96CB1206 FE22B8C7870AB75D35B65E0E2932C7A6F29B88E46C7F68170EB2E1D090632656 DFBED6B6530C85B9E4CD3F19CD16D88BE3568EE929EDCF52D707A3BC4E8622B3 445F20AE69B18462093CE0E3A9EA5EA803DEF4F827195104AFFA54564D3AE7AD 024ACD65573E89FE3A8E50211A9C8007A5241121B9AA21E14CA6A0994805309C B53D026EE63E1F040A9D7D3D73DE38C61E30CE0746117F7A46FA31ACF24C10BD E010BE46225A24A02696E6FAA256E4EDA0C0E69FAC766B996FDDDB517431692E E1FA11B2938E6936F3BE232B3F1C560A86F5575A26C826C06BC86EA3DE3D0D7C 2532101A57EC7ED6348793F17DDD6C4FC0C45F3AD390C2C9BB558CAF8575273D 16EBC23BE116842DA0C544168426B70804A2821A22294EF0C6B9B9531E6EFBDB 05DDBC14E325FD3B917BFE62F4E10693029CE005C4F875A426BCE84007F7C85C EC9807E21A6FE5FC33710B58A83FBC8DB8D65440CF9B6C224A58EE60D2815AA3 CE8FF2CDEAA92443609C8085015695A4B206D9CF65217A4F6EDFEFB0CFC6729D EDF9194479151F5084403D85342A87AD49F6A53C06CCB01029B41656F6870590 4A9A9610DE4093C93733A857A96B54E3860BE964F1584827ECEA7AACF97B5A5E 1A7D5FC28B0065B7298D40B34254D44EB9470C5AD501C5B4F3268A8831F3B9BB 04730933098F1B2F5315E89FC5B3B3EB237EB85B600F78A5091A8C3E6A5B6B71 79ED1B6262FC5BE46A09CB55E31BC6E16BC146E9E2AB15D3744766B9266B15EC 6EA658F0F3667839CE16E6E6CE8CFADD5E440B6B2691509C2590F330D4E8A72F F459C6CBD2D5FE69834D1E1D5E6DA898DB6D9D00B19485F1C9EF4B17B37C6558 A25D79BDBFC00183D9085270E3A62C4655FA5FF17BB8DCA8667646F1290FC471 B4286845B66BD05263D8F4A3DEE9E1C28089925C92F1F80D05088FCF675D37F9 73F00793974961472B3DE03D363A10A735C3DC1B6574DC90C9AFC790D9DE8B37 194D9D160501068A20F2659B48F4C0FF1ABDA52ECBC54005E62D5E8008E8E263 AF7EF91B1D39EC4C9276F6C9F0488AAF4A1F8B5F34E6803B369247C5AF9BB470 D331B0266F6098E67EBD3B656791D3E5874AC595DC2DEF334E2444F110DDEB53 058946917273434C445D35F8BBA0C22C8735AA51DBC167B382D1EF0CF82BB089 AE0DC3AC28D2EEB26A1558ED1E2EE3B859199D40F2A08CFC3707CE2A2CE121CA 4C64A30A720FD902148806A65C04231EA99689D0750905DA9D79B7A7826A4111 002F642DCA7865C214C797E6A6539D45644BBB9C6D65EB90753C4CAE78D89CF1 2B554C7040FF9E287E2ACF57E5766DBBCA56E375311CCA35B64DA446F65011E0 443FA3222805814BB460D421F3AA230DBAC80413FA6BE0E067EA6B059143ADBC 88E8CA39D3E3162E2D39E541001118BE0DB2B8DDD5D38488DC94FA662703D2BF 5F67CD3DC30D6ADD0AC6F87126010005DF6E320979E42EB9118D0CE620F83E93 37DDE0915D28F8F7AC3C1CB081B75D29226A0C1D5225654BDC8AA83368F14D64 B13310B7690E5CBE570A8ADD61F493619D43AEA914997FB26DA3444238CCCD5B 420EEFF0B2E3005CB535692DE1A35069E402DB0B622EAA8B82FF29859F21345B CA3D2AFC74048DFF8BBC9399E3B6EF5527E8E1200DFDFCD73F9997829D8E90AA C3A4CD4331B658CF450ADB390E1C3DAD835D31AC8022325A2FD8A4C2059975EE B7C73978C1680BEB57ABEB4A6D44EBDFBC4CB61901896DF99BCBAFCB0B8DD3CB CA5871CB7AD1BCEB50B7E52DEBB6D4967932B01AADFF0100BD3AB789E04108B2 DA52B294CEAA740F09F5FFE4B8BB69A00B1DF6718C9CC4D4DB756940FBD1472D 38758D11A7876D43FBA44BA959A73A40559A419380624E74865D84648282C7DD 6824745BA66ADAB32CC764DFE9A960A10AB66A946115057A8EE391A0A5DEDF70 36357E0FDAD7DD538E20FB79B00D05C785372D25FC2AD755D4B7EBF7E2882531 FB2DF9B973A25A5CFC67CBEEDC6AE70DA110ADA3FF7F79EA9E299F3FF0F0633E EE78824CEFA9DB2DB9DEC15415B48EA05B0C0BA69F29AD9F6EAC4FB4AD2DEEE7 3CAEBBDDD4FB1CB390657B3E98AD27812E443DF099D456E911F915C7915D558B 3821D8208CF7F2854DDB446FF6B4487F110D2DA93F5541FD5E2B028864C7BEA4 BED8DE588BDB8BB7E6CCB0E1154FF00D155D3A846CF8F3826E961EE195DB26A0 BCAC718709C4DDD17A6A2A369C0F4B174CEF1C3B096EE77AE62DECC6873E3B21 18229CC32084E2B8AB66C72B289A5635879502C05A55F19D9D37249674939ED4 4D1C4DF56CA99438C6AA80D788A0868FA76E6A5EA5EF2F6B9676F84518135272 1FC67E56D594B8DC85E687110CE778474E57BF572505E26D245B0818EF04A7A6 40179D40C8B50465CE7D450EB98B515E226AE493FC82F9B13928C9F7F470BAD0 37CCF8E88D099058D8E0089FC07232A3E3B11B8E1F36C61D7CEA53F133BDEE33 CC5821B37CC30EDB3B9417D502ED080CB30C914864370BE3B6FA3814153F5B0E 2189ABD03EF325EEC2F8B2CD80A66D4B4B328D07F84895AB9E6415E2375DEDA3 97D6BA4320A6AECFBA753386EB945917931B22963E00E7C7441BA7C2A1F162D8 4E1EC8FCA85A9F193DBAF54B3674DE90A99980C983AF799F7D0382E5EDDD8FDD 53859244E791BDDBA8C9722BDEF86082852716FB5FBA5F2047F10FFD3765DFC6 B50D1476031A019541E6E8B1B15D99ACC38C1032274CDC5BE176DCA9241D01E6 17BAFB6488D8F825C7734217291447755E3FD161F26D9C5B176E0BC6C652AEE1 B9859E3EB9C29CFF76EA00915554CA3E0F7CD6D329559A724A511655B15078A2 719AF99506B9039FE1B406B32DAEEBF62D20510C6038A8128CE7BAC229B586CA FFEB008F85E96926D4E73589A1A39D2AA5CCE02F3F6D0619FCE592EE35E6FA2A 924D4D58B5F71908C849DF7CA896931699D0A7FC0AA95F6ADC576C27369296C4 53091DB24C59530FF597B0242C850A5CD316D0D967A5E8BF5F2B6FB170A5E539 DED0A9A914EA9A280A1FC142341627903787211EA19E783E17043B1D0FF49368 0230A7F88EE867F55C824043A995A8C8A9E7AEFCBD5F9C1080CA438FE2F41755 617684C9CB579F33059DC891F87D108A8B402AC809729C78B1D421789753DF8F 7127CA923E589776122BEBFDBA2A89E27CD2F4BDA01E88381C57189FF4291324 228E68B857E9419E4A79FA5C714A2649F28F5B72D2EFECC8D745639FE82DD3EF 46605F162F1F66EAE3FF4441C9269292C163E6817C688B50FF011F7B0BF99DAC 954FA264EC07F8FCFB247E616EB75CAF5CE5D7C8EB4A1CC3F8EB430C92B8103F A5D6BA87B271FBBCC420C8EEB3DDFC194AAEA80FFF012CE7C30C529C8B7202F4 370C271DC8929F2FD3D8838F9D7E350B1DA520A88C28271EDACB88C263983303 7DDC6EF02B138C8618BEF93F07198239041DBBC7767C94B5BACA9228D77029E0 1A292EEFD8AFE3054056DB89AB76540DBC998CDDBEC960F6F26AE2F470A4D99E E9CDC913BE6F4C5CA68C861D8E5E3044180DB5BA5D1F3A724CC4A64A4161E924 03F3FC12271F544C0417E78459DBABED1AA2351EED5AC1D500A968E75FA66618 E2B84B1A1023E0EE7471831E5146FBC2FE04D6099077FEC16A8A4CCF015145C9 0ACFDA1B71E7AE5CD21F8979911ED014D194C26FC3FD0A9C0D002CD0E2676F3C 5F820EEC96FE61B721004D17A8F0A5C996BA5B03B1DC8A57CDE24FAA1D4DB9F9 1796DA896E9EF9173120A4BCD1A25EEE3717B4DF2A07489079803C54F0A3BE12 9975250C1AE455474D5D0D45403A4303A028EDCD9CCC390A672DBF71A8130B65 209933B80F12AA441D548C54A3F57D68D0D1DC0724B883F6FAEE036BDA40C617 C925806799F75DC245D1337FC89D5E71CA51950E8D01331B170943EE51645FE9 74C00E9FFD77DD20D4192B3B41AD79E4CB0D99B774C1539796E8E3E40E2C8BB3 0EB2E8E07C8B303A4281D8DDED40A405CAB2160C3A09DB96A8B76239F9E29CAB F4EBBE8922FE3002FB275A91B4514DA3F9A592799E0DA919E6BC6CB59A1C477D 85341DF4EFC63A62100A11CD950970F9970B43FCB3E37EF9F3769E6FCD5739A9 DF643169DD417AAF2F401ED2D1C604B090AEBF59F9889EC2260CAD1658B65CED C0EB7B1F3FDB09986690F0D603E06B449153BB95EE271B75F8787E0FB60631FE 11863CEFE2B9924DCF25E9EAF7CDBC6CDF9BA3F1615145BBBA2FFE701BF01FA0 96E7E020644939672A465212FF8AC03685E5CB195E6D2B8F8DB14C3998AD449C F93DC43C172F4B2FCD30CCF1A01850C367E6C4F7E723DC624881FE483F583D67 FEA4E4CDF258908A8458E310AA0FDD61D932265D68292519FD3DC80EF877DFB0 7BC0A210D546A5AE610DBEB04660DA44963FE1E01FB53A41C457F96C6CFA3D95 6B35CED8EF691B199EC9331CABC715437DAEDDD9352444DEA84DEB5DB6A80004 7CA4336472E793EC149326B0B2356764BE7F37AA626B3BD4C7CB586FC67444D7 9E59ADBD44542DA855A35850DE322CC01C66511ED5455D473F5BEDE7CEB78E7F B57129DBB20DE94FC72306731CA43F0AE5BE4ADCCE54D0BEFF8C819DCA270ED0 AEEC6BF860B56019C1B825267C2C40E04FC39A0222721FAFB06BAD367676B1C5 ED272FC514D66D7ABFD7BF3139C155AAE47D82BE9A4695693A9822B638561601 E5E77E3A7FA56C6D19B9258498BF1B8C21845FAE2E7B1D965186E0C90C17F2FB 0B67F8B9B4180E23D011A2CACD814E442C499A1831A7EF2E06343D21926FEA2D 5683558FC89E8810AFDCE0154B6B9A13190BDFE60EC9A8AA6F70C4BB0FCFB3A8 91B21880EA754B5FC96423BE092968C2C49B7EE8B4B842CB9DAAD77DCB384C19 539B153F54680EFFFD5FB8FED37F3AF03AA81C5D20718645AC436C8D9125291C 94407844473855F63BBE1DB89583CF1580CF0FDF5FDBCF48BAC345E8385F02EA 282080CF67A94F2C8351BB3D673A9AD66C7A2660B6B86DE5497492D142BCE001 BDA4076C4E243E251C40241E6CB669C8AD00643D68A870FA2A87F3B77A6D219D A3AE96F455D7B84B01183B633F754258744E18F84A0305B8A4443A373C8D0417 7C53C0469A281D5CB1E467AF61267981E8C3BFD5D4311FBAB89475E8BF961740 CF1A55146BAAA5BCBA66C4530C7DB8E0B72E5830EA90BAD003A7AB6AC408B057 E3F56461842D55D7E4D4A85878F2468BFE4ABD237AB05A858A5720390D00600C A81853436AA5CB44EBE0152D9C30C438C3A8D003981135528DDA7CE219CBF98D 4DD0ECB82FBED648C292373B6EC8A0C8D3350F6FD23F51FE379418568EDA7A42 B98B167908F22046F1C658DD63DD242A5DB293D48384D81E225BA6387351FB69 FDF2871F0738A183015B182F1811D000C48DD83EE5BD562D0EC863B9676FED2A 82FD5ABDBE86EC979CFAA10A6FF936A46D530BF94DB902717FD6AFB6D3235FE8 1D1D43BCC19E45CE1E0C4F2554BD6F1FAA72E003BF7B7C121A5BA060A85BB962 A731A1FB2D7348132D23E0778D0C6E635F0E25FF8AE67FFAD569894B41E237F0 B47B850068E59353A809CE5D7B3A1337B3CB41C075C4DF19A0F04BCDA94A193A 82EE5A28C9320B7CA2BF5B5359BDEE44244108B2FA7B73856209CC5E967F9F22 D433947287EBEC2B0F3C9C25F388BE782679E1EFE2A9B785DDB004730FD00272 8378ED2ADDC8CA7D898531EFDBBC95D1F7DC4B8D59F781ED481DCEBB617A4209 CD06B6B3E64B7648F20B192859C58FBB833E20926B2B7BB69DA1A2B6894631FE 184D3E9208BC1825EA9AE84F8A42A44A5979AA00F24CCC58CD51DD3E4419C0ED 3264BA8C6FCC4662CADF8BDC396324D4AED86E5A019E970C2C37AFDCCC70F76E 84DC591E15CF7CFEC03ABA247681810C27D9849E6BDECF50CD7D8E8266D48A1C 93F209BF83EA0B9EB6CAB53162AE741DADD6E9FCF7AE18923D4E4EF9C6771070 24335F8176A2911C5F17518B1FDC713960664987B97EB2E0ABBB0D71153D7228 E4CB00766F2660E048A5D2B0F3395A20976E81352070FA4EC3A665A44F847CA8 C17652D8660849AF3E1B473A86D5348F97AE8DC81463B60D336A90B9CEDD458B 8DBCA15F55E9BBA1908F9EE7580EAB0A2539676E8CB37F0C99A28FFBD0D51019 25EDBF5A1D1B9ABF48779627A0136A8015838058BF2407C95096D78089B651E1 AE5B4376840B593A20326430987641E56501E147A2A23AA7BA8B534AB451488A 51F7CFBE4D88C4FF60B997ADE2749829334D9897F04F2E38453DD409A5ECA2B5 D7D2C21A9EA6FCDC834BB0E1DB0B5639C93AB96EDA22341D9256726878425CE5 7953276D089226ABDCDA689F209E942A5EF7A402F005A47141DBA0EACC836DEB 2A35F54C9570EACD20BB25561C0763501D850B5089C7EA69B263D4D8CF117630 2178A54295BA732A92DC46D409A02A29F42DE93D8AB23D78EF4D598C2A758109 4D67FC70537E3D2FB530A8E0B7C7C7154383A14010FC4E625B0CA1666D5CB8C7 7B890508CB293920AC8B46B585BA4F5232C3254DFA7C724D5BCEB0247B873406 6F5730365D1904D99A6A2D5BE1DCE95F35EDBEFC8F4174F6867C4A3D8B6A24E8 EBF8DA07AD23AA6F96CFBAEA99B09ADDE6E7F95548A843E5302C584C76690016 860F7058F39998EFAE1F6B4CB7BE386B7ECE0A45AEC886D798F10FF95327FC93 E10EBDC89A9D9F04E4CB5FF9DE08692AB0267EBB3BDACC7A58B42A2AA2C11A90 7CFBB3A973C16C07DFADF3D2D90AD2F4F0C12562D5719663E2934C8DD15F2F8B F74E3D41CEFF8ED154862B963A7473AD1C3DADEC49A9AAEA2F25464DB29B4A11 7986D63983BA0C2C786456F1A34F6E9B106590AB00BA97EEB0578F58272BABFD E9A33C00AAA15C0A951302803F0C2AB21BE07E7A350CD2DC7504F192EBE51ACB CD72344A173F07B928AA56261B276398707B066DA2E76F7DCF8638B39BB7A7E3 82C6F1A497680313AD5BEE40CA1A90DDB5058E2CACF036E976FE302B3EA2160D ED6897A0526CDFB7E7E5BBA12AA912BE67198C4CD12E9A1FFC4DC1F287FB05A3 D111F600ABAAA38620E1421406D37F4ADBC732D293DE567DF1388D232177DE52 E9BE3CEE2324D8F6AFB8A7594DF86445FA4C913F13326F5629F0A7135BBFAF9B BC75D13F5A7257F8E3953B5B1F4A28CA066AE7ABB6B8A38D39B6FA45F977C707 B131E7FA43E993CABC7DD91956B5DBF4D37748A4248E30237B22CF1D8BE2E7EE C9B0E81E871C39B9B73896731F159B00FCC8BCE84BF61098D4D5561CC2506D34 7A79CD54B083E88D73CE9C8350A90ED707E289A1EFBC2ED375E32A9BD6BDC8AE 867C5EB4515D5D82E7B048B632423AB1C25A7358094BF7829023E87ED794A9C4 E76B0858DFC6334E0BAB2109571E130C2B007C45F908D0A8C446BF3469BFBB87 4F021F6FF6E3432C98DB5496D45E4D6065B77A71D2E0541B9100595D24917E1C 513D8C673BD54A1A034D212834EF207836C03367BBEBBFD3A3186935FA5C6099 11CD4F8AD4F5DC8B48A45D5B73C4B9BE57187B6E1538A6CE5E4D48F5FA0A5926 86DA6F3691B08BCFABA4449B5DC977A42DAEFFCDC86FBD48C004E6EC67FB91D7 954EC88AEA207E151B58E03C567656482F142148AF3FF36C26178187CC39EBD7 D100C2E459C54167236ED893F94CBB55FCA7617F96B329F4428E30E86FBB4DAF 9FA54DB148A4569C906AB119BB2160CE0B4FE0739223C1E27B438E52CC9E68DD 13901F09FE3C7A239D02203277528A48FFFB672BF710DAFFD84137BCB01C7FE7 A1B90F8114C019EF8A51D500AC9C4D484E77452F9120F99453CC4249668F6E13 F42E11AFF798B2E1C1033F429C07CE1854A481597990CA820D4A2C826EACBE2F D6F72BE394D85F6DF1DE01EC2CFE7C00F88434043A1BF5F4898AF27D1FD377AF 42A11DE80E27ED4B21CAC167E8E6F6656E50784A5B236F297991D3406F78C178 8CB8864C70AE84AC2B0ED332A63F4A269D4B8EF721CD661FAABE8F09E5350038 F8C87ECA69B271A152959729E9FC8F46DCB90BF1CEDE9F67402728FE1D5A9A54 43DC303E99688D9B261B1346D9D39C9827717B0C83931BFAB507E01F015410B5 E834C0E680E0B3BB3847E9D8709AB8D1B80D853B0FA15A4D58726028D8B73BEF C31ED9F173FE8F8AFA38B833DAC70C544C8A93CDC2626503BD8F20BCAE053934 2F8002ACCA44DBBC0C4555AE6EAB7A5A4542477BA40D36DF5A72B5753F4B3FEF 9AD4A552511E53807689C1CA81E430330EE44D1420C16F4A8F19C2C30B91A00B 49B7F7CBB9599F771F4DF75FF3332B415E870360A1787E310D3938C3B774F969 82F6F496B75E77BBE8DB153347FAB296487AF823158665E1E0B321037C1D8421 17EA3DF7D8587D3FFCA734138A1256A02000A3B3AD0525F384F67CC7B3123740 E7AEBFA17E226A02765FD40A391CE035991E698FC162A8BE0D4D4F488B492151 3CDA0529F2B8832F8A6B935D712B196C78397E0E439CB37B2E0800514AD18FDC D54DF226DE0DB452BBB7C603F7B618B9D2D4C301F3669DD4BC135C66B67F0E42 E6D56F089904A21E4582E5C1AC212C0006672B92D0107720921B5E96B20D06CB 781E2093B59BD423945B626F34B8AE38B38EA259CCAE1C3CE92DF78AE7FBBBB4 A281CE3376B67F6319843E8DF73C9E8A0C888BC7942606EAB38225E777E58324 91878AEF0B41BEC5375941AD647366FD1C5926420C47CC58768910076B566124 436CCCE04625A847EF053BA42735B3A5430EE54BED659308DBEA0EF82C48C4ED E0EA6F30FAD44303D7C5AD89EC7E703E90464EBD84C0A4752C1F49115FBF26D6 9E42DA9911526ED8F05B4A7308070234549FB6A4ED42741FACE2E7664C776270 25A5E6F15E69625AA2CB15FD9370AE3F9052D2454D0A1080184E1A72F8AEE4AC C90BDF299628952084D2A5F05D46B8456EF64CD6048D99656919C763A27D053E 55830411DA2961C3129DECFE02BEB74D076F42FA517951F32CC7846E7D3E43B3 829E771835EA607E1656276110E653530A4D94588B26F4ED5D453CF22EC16706 40133565602456DA061D74B4B91D37453AF5C30B5DBB735A25C281234DF65D47 C8EF831CFC1821695AFDE75C0EBA85D0CBFCD23CC9ED76AA5B3A48D7B4A36295 6189FE36E53F01F40B71858A4445ED454DF060FE6E13F697E91A5E5AAA6B0C58 238117036D8D918A3AFA74324FC52237E5EDA5E2B4EAA3EDDE56E0099D0E09BC 018D228110D51B4073BFDC974A150AB804C39AFFF6B3849F7DC40755A6E395DC 9D7233DFC5E07C598B47CD7FCAE7FF8EAD51449B3BF3FDEB2C7DF0633DF3680F 7CCB1077C4F44320D33AC436B548ADB23FF94BDEEDA40306C018B556F6C13C36 121F5997E8E2B2BB5B8388B8BF47ACBB712A183D6DDBA3033540F43206FB9B0A 0987D09F57FD5606918DE747E076498D9C2844E4A536DDD549C893E315D9E6BC 5CAEB70EDD96B36924AF17A0CD3EE8535B3A53DE117752FCBC1B872CE595CF30 8FEABD6947A91457A1C3E8085DE0FAFD2DDA502A5282BD2124EA9A24A453DBED D11F801C347C0703C84A3F64E18E3DC1054824EF1E1EED154E61D71BD87A031B A6833A32533A2868E6816793E70D8EA90378ADC6BDA262B3934434D1EF8BAD18 BD25638017A096F14B653DFDB806495EA4791C5CAD5D6C7197DF276108B508FD 58976B5A2556764AAE9BB639170D3B936DE973AC1580DBEE5453AFC530407CA8 F1AE147A2388E616653C5B22AF123956FC8903CD31CDC48A599C32BC2A87D6BD 750D7B7E15A96EA4BEC2B375F9CD61854482FA5D9215449E89415B3446396F3A 9C99DE92EE6136FC3B2362B4C0A2C89C20BB5F9401F5B10C836C7273A5B3EE0E BAE8E565F4918F5953CEA6E135980EAB7636B003D2BDCE092E77F7E349CB4AE6 D835E292196D91BC364220D7023CEDF76EA8F7831FECD708E2D06593CE5D7D69 2EFD672D2DB5AE64A415705EB8BD6138C4AA9D9AB48D951D90E1B6E705736770 00C42D84A9028D733949FDA27175A98BC14E10B71E5CC7CAC31B4FEF5EE0E093 E564813DCD26A241D0B0C5627B3AE06022F64AD1FB265776D38BE9527F7087A2 96F81A35B11BAE36D7B736FB8D890289002B00B140789AC50DD3C007B4C60038 DBA31B0EAA695AF99A0308A1FEB34E7C0055A34AF6B4DDA4D1CFCF8DF4B520EB D1D0AE8A010BAC4B04BD4BDFCD182F3A6E6C3D335C2F32EF705BF529D4A6506E B7E8A2B195A3B81B0C752ED5C15DE264A7BCEAF4645DCEB4F64BBF5A5D531453 6785D970B480209CB52035AF54ADE5803272A4D069F92D50EC54CB81AC9AF8AC 81353658A1B1129CEECFCC0C8E1CDD2B3581AC2C618DC8D3FF7B87808EC3334C E654599699B2CD2337DDA021A7334513A6680683F684BD47D247B362A33B7512 268AA67F723B4823DF79874EDFFD6897B8EB0F4737866530CB1EF266B1FB6DCD 33DCF85211F19495F602A397E0D436079C503C71DD28539A1571C57307C6AACA 4F39C77BDAE6B4F86CC49443527BD599605C813BCA4F9E80BE94B409D726744B AA357C657D32AAE018F22233F2ED2F01BA8766F0A39E14B470F2B23138E0CA59 FDFEE4508D456830D3F4EBEAA89B0B7AD49AA4DFCD2E75A7E266EAD33B3C0295 757FF2E330CAB19AE3A90CD3F4E1398CBCC54EBB0D4AB6C4F2166B9DB1D45D58 F4F20D8814C35154AB929C9DB50CE7A9BD8AACE327A84C48DDB4181C065D3F2B D80E119A5EF508560297ED9661C37C289E3A53B75439ACF10DD9AC5D9D349C92 EF3559313B6052C77E605A2728601235DA4FA4A0A7269D399418FB13E0212245 F950C47D3307445DFD83ADC79CC3A4CD6663718F996C6D0802DCBDB0F9E9348F 4B9328E0CCFE70C21F69EDCECECB78A0EB07F2DBBDCEEC6710C86C83B0218377 6EEBBC24DB74EC708D397D51DC3D79CD4F73D3330A61DD7DE1F241D63545A7E9 476B14AFB13EECE4DC98BC6B8D23063ADA7248865DEAD0649DB503DB34BB67B5 4338EBB9B9F62E3A3E9519356C7643E411332216694547628B23726509FA602D 810CB8A36AFD2EF2436E46FFAFB1ECFFFD489FC24EEFE7355C1A9319A9357E6D C02F54222ADBC7A09D129B58B0CB398F7BF75A2E52C56AEF5B5467AD61A338D3 C3BD8E94D67B292650671922598F9CA6D104CFC2F722440636A8841857B3884E E07C77DEB0C4C14943DC9C3424DCF3BA89AD5F194B208B1EAB47B407A6451C47 44919EAE45782E9058221AA9DD6BB4DEFBDDEDF9D541653EE4F8309F9255F5F7 215B7552CAE597721315B36C82E9552FC9E576EDCE5C8D7119A1C124C7A6110B F26FFDF4E672A05F53ED9A489CD4B02694857DAEFC023EFA1F52CFE7DC61E32B F092B941C664EB0007B1A650169601AF4CCD128E5ADB89D10FB3102605F44C71 C868CB2AAA042BBA95676DC7622A6D25AAE8AA82BC49B30B59D310B7933EEEFB F54F4B599ED16D69BBDCE760DC9687D8E51A7882B16DE837E36735F4355158B5 1B1CFE3E95E2FDFE62585A2E3E60FEF8FA113F93480A4D0C2F9C323E45B4EEAF C54283B1451D94946C296BA8BA5D651FC7A9951542A27C22A7EDC6BE43FB4F95 72A1E77A60569C11F982DFF2405C0D64FB39C512E7F85E8B0DAC542A3DCFB807 DF8FE4CF40808070AE096A031223BB4482387DE5DE13BA76BE314EE16FD62671 08950AFB9EF5DCB36193797CD22E5196C86996993CAE08DEB19B0886B302F81B FEE0BC16EC59FC5901AC0EFB88DE773233A134C65C8C0530CA11D4CFA1566960 07BD4274A0B70874A10D1218D1C8CFE688FB9ECC8D14FB020E719D1EFB865538 72D3AE4E8DD817BAC3D22E4AD1C2BFEAED8FB39E77FEFD855C8029589CD99AC6 CF327D3261042F5C85F21B67E778D0503C4246090EA09F20F317AE6BE1F51F80 A67742E36D7FB8C88E2C2C40998F518C2230188CEB0D21D7ADC7DB6B594C1EC1 42D1F1698810699DED186B0F97B27345AA83EA421C9FE6FC611061AAC2386F01 4DE54D5A0581363BCA60955101EFA2C5722185657C0795BEB49E7597D3D65103 B232837615503E123387135094FDEEBB2DA353F2A16188DD1FAC158A841C5491 45F9CE3655327D31F442ED4DC3A465E84A043007B07A1C7711F58FBD8C9A4AED A5694BCB499D10765C664DC8588B77BB7644F19A 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark {restore}if %%EndFont TeXDict begin 52099159 40258441 2074 8000 8000 (lectures.dvi) @start /Fa 255[1897{}1 2295.84 /HFBRSY8 rf /Fb 212[1897 1[993 993 40[{}3 2295.84 /HFBR8 rf /Fc 135[1118 12[1189 9[1197 97[{}3 2295.84 /HFBRMI8 rf /Fd 134[1609 3[1814 2[1213 4[2835 7[1635 3[1724 13[2043 83[{}7 3306 /HFBR8 rf /Fe 255[1518{}1 1836.67 /HFBRSY8 rf /Ff 143[2755 23[3979 7[2908 60[2028 2028 18[{}5 2755 /CMEX10 rf /Fg 135[894 9[1008 1575 3[440 7[958 30[1342 15[1022 1022 5[1518 43[{}9 1836.67 /HFBR8 rf /Fh 134[1341 10[1511 9[1511 1[1511 1437 97[{}5 2755 /HFBRSL8 rf /Fi 149[813 56[2927 7[2927 7[2927 7[2277 7[2277 10[2277 5[2277{}8 2755 /HFBRSY8 rf /Fj 140[1175 3[1532 1511 4[660 5[1362 37[2277 8[1532 1[1532 1532 1532 4[2277 1[1192 1192 40[{}13 2755 /HFBR8 rf /Fk 135[894 9[1008 2[951 497 8[958 78[895 18[{}6 1836.67 /HFBRMI8 rf /Fl 135[1341 2[1511 6[1511 2[1426 745 6[1362 1[1437 10[1473 1[1755 5[2091 8[1997 7[1464 1[851 851 18[1984 1[1471 4[2059 6[1809 3[1788 2[1343 5[1684 1998 11[{}22 2755 /HFBRMI8 rf /Fm 145[1379 1[602 6[1243 20[1760 2[2360 11[1810 13[1398 1398 1[1398 48[{}9 2513.94 /HFBRSL8 rf /Fn 242[2671 13[{}1 2513.94 /HFBRSY8 rf /Fo 156[1243 99[{}1 2513.94 /HFBR8 rf /Fp 134[1257 3[1411 1016 1060 3[1383 1411 2179 3[642 1411 2[1285 1411 1229 1[1320 8[1844 6[1997 1767 6[831 7[1844 9[1383 2[1383 3[1383 6[1075 1075 40[{}23 2513.94 /HFBRBX10 rf /Fq 27[2526 228[{}1 2755 /ZapfDingbats rf /Fr 128[1446 4[1240 1263 1263 1906 1263 1423 1045 1109 953 1423 1423 1446 1423 2227 620 1343 700 620 1423 1423 884 1286 1423 1286 1423 1355 9[2663 2[1997 1607 1848 3[1951 2434 1561 2[735 1951 1[1642 1722 2055 1848 1894 1860 5[804 804 1446 2[1446 3[1446 1446 1446 1[804 964 804 2[1125 1125 804 25[1515 1515 12[{}57 2755 /HFBR10 rf /Fs 134[1931 1931 2[2176 1594 1692 1456 1[2176 2207 2176 3402 950 2[950 2176 2176 1349 1962 2176 1962 1[2069 12[3055 2452 2[2777 2[3725 8[3145 1[2900 2857 19[1471 45[{}27 3967.2 /HFBR8 rf /Ft 138[1186 870 924 794 2[1205 2[517 2[517 3[1071 1[1071 1[1129 19[2028 1301 17[670 1205 1205 1205 1205 1205 1205 1205 1205 1205 3[804 45[{}23 2295.84 /HFBR10 rf end %%EndProlog %%BeginSetup %%Feature: *Resolution 8000dpi TeXDict begin @landscape end userdict/PStoPSxform PStoPSmatrix matrix currentmatrix matrix invertmatrix matrix concatmatrix matrix invertmatrix put %%EndSetup %%Page: (0,1) 1 userdict/PStoPSsaved save put PStoPSmatrix setmatrix 560.740852 421.000000 translate 90 rotate 0.664750 dup scale userdict/PStoPSmatrix matrix currentmatrix put userdict/PStoPSclip{0 0 moveto 612.000000 0 rlineto 0 792.000000 rlineto -612.000000 0 rlineto closepath}put initclip /showpage{}def/copypage{}def/erasepage{}def PStoPSxform concat TeXDict begin @landscape 1 0 bop -8000 59998 a @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0. true 0.0 0.0 383.30276 296.18846 .5 Frame gsave 1.000 1.000 0.878 setrgbcolor fill grestore end @endspecial 0.098 0.098 0.439 TeXcolorrgb -6740 -4468 a Ft(Lecture)765 b(15:)1018 b(Molecules)764 b(to)g(Metals)p Black 0.098 0.098 0.439 TeXcolorrgb 49100 w(15-1)p Black 0.098 0.098 0.439 TeXcolorrgb -6740 -3544 85479 98 v -6740 -3119 V Black -5102 -1323 a SDict begin /product where{pop product(Distiller)search{pop pop pop version(.)search{exch pop exch pop(3011)eq{gsave newpath 0 0 moveto closepath clip/Courier findfont 10 scalefont setfont 72 72 moveto(.)show grestore}if}{pop}ifelse}{pop}ifelse}if end -5102 -1323 a 0.000 0.000 0.000 TeXcolorrgb 17455 2305 a @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0. true 3.8 neg 3.8 neg 161.35812 15.8 .5 Frame gsave 0.098 0.098 0.439 setrgbcolor fill grestore gsave 0.8 SLW 0 setgray 0 setlinecap stroke grestore end @endspecial 1.000 0.843 0.000 TeXcolorrgb Fs(Molecules)1397 b(to)g(Metals)p 0.000 0.000 0.000 TeXcolorrgb -5102 7534 a Fr(W)-80 b(e)915 b(apply)h(the)g(H)-11 b(\304)-1435 b(uck)-80 b(el)916 b(app)-80 b(roach)915 b(to)h(a)g(one-dimensional)h(system)d(of)j(atoms,)-5102 11462 y(where)e(it)g(is)h(kno)-80 b(wn)917 b(as)e(the)h(tight-binding)i (app)-80 b(ro)g(ximation.)1219 b(Then)917 b(w)-80 b(e)915 b(b)-80 b(rie\260y)-5102 15390 y(discuss)865 b(the)g(p)-80 b(roblem)866 b(of)g(a)f(pa)-80 b(rticle)863 b(moving)k(in)e(a)g (periodic)h(potential,)874 b(pa)-80 b(ying)-5102 19318 y(attention)915 b(to)h(the)f(symmetry)g(aspects.)p 0.000 0.000 0.000 TeXcolorrgb 0.690 0.188 0.376 TeXcolorrgb -3868 24938 a Fq(\344)p 0.000 0.000 0.000 TeXcolorrgb 0.000 0.000 0.000 TeXcolorrgb 1447 w Fr(Tight-binding)j(treatment)c(of)i(a)g (one-dimensional)h(system.)p 0.000 0.000 0.000 TeXcolorrgb 0.690 0.188 0.376 TeXcolorrgb -3868 30557 a Fq(\344)p 0.000 0.000 0.000 TeXcolorrgb 0.000 0.000 0.000 TeXcolorrgb 1447 w Fr(Bloch)f(functions)-5102 36176 y(Refs:)1220 b(A)-80 b(tkins,)915 b(p269;)i(McMurry)-241 b(,)914 b(p160.)p 0.098 0.098 0.439 TeXcolorrgb -6740 56276 85479 98 v 0.000 0.000 0.000 TeXcolorrgb 0.098 0.098 0.439 TeXcolorrgb -6740 58788 a Fp(PX407)874 b(Quantum)g(Physics)i(I)77 b(I\(Annotated\))p 0.000 0.000 0.000 TeXcolorrgb 0.098 0.098 0.439 TeXcolorrgb 58773 58712 a Fo(c)58059 58788 y Fn(\260)p Fm(M)886 b(P)g(Allen)h(2003)p 0.000 0.000 0.000 TeXcolorrgb eop end PStoPSsaved restore userdict/PStoPSsaved save put PStoPSmatrix setmatrix 560.740852 14.173228 translate 90 rotate 0.664750 dup scale userdict/PStoPSmatrix matrix currentmatrix put userdict/PStoPSclip{0 0 moveto 612.000000 0 rlineto 0 792.000000 rlineto -612.000000 0 rlineto closepath}put initclip PStoPSxform concat TeXDict begin @landscape 2 1 bop 0.000 0.000 0.000 TeXcolorrgb Black -8000 59998 a @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0. true 0.0 0.0 383.30276 296.18846 .5 Frame gsave 1.000 1.000 0.878 setrgbcolor fill grestore end @endspecial 0.098 0.098 0.439 TeXcolorrgb -6740 -4468 a Ft(Lecture)765 b(15:)1018 b(Molecules)764 b(to)g(Metals)p Black 0.098 0.098 0.439 TeXcolorrgb 49100 w(15-2)p Black 0.098 0.098 0.439 TeXcolorrgb -6740 -3544 85479 98 v -6740 -3119 V Black -5102 -1323 a SDict begin /product where{pop product(Distiller)search{pop pop pop version(.)search{exch pop exch pop(3011)eq{gsave newpath 0 0 moveto closepath clip/Courier findfont 10 scalefont setfont 72 72 moveto(.)show grestore}if}{pop}ifelse}{pop}ifelse}if end -5102 -1323 a 0.000 0.000 0.000 TeXcolorrgb 9423 2305 a @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0. true 3.8 neg 6.67998 neg 231.32463 15.8 .5 Frame gsave 0.098 0.098 0.439 setrgbcolor fill grestore gsave 0.8 SLW 0 setgray 0 setlinecap stroke grestore end @endspecial 1.000 0.843 0.000 TeXcolorrgb Fs(Tight-Binding)1402 b(App)-123 b(ro)g(ximation)p 0.000 0.000 0.000 TeXcolorrgb -5102 7534 a Fr(A)915 b(H)-11 b(\304)-1435 b(uck)-80 b(el-lik)g(e)915 b(app)-80 b(roach)916 b(can)g(be)g(used)g (to)g(describe)g(the)f(bonding)k(in)d(a)-5102 11462 y(one-dimensional)h (metal)d(o)-80 b(r)916 b(quantum)h(w)-80 b(ell)914 b(structure:)p 0.000 0.000 0.000 TeXcolorrgb 0.690 0.188 0.376 TeXcolorrgb -3868 16691 a Fq(\344)p 0.000 0.000 0.000 TeXcolorrgb 0.000 0.000 0.000 TeXcolorrgb 1447 w Fr(again)h(w)-80 b(e)915 b(consider)h(the)g(case)f(of)1788 b @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0. true 3.8 neg 5.8 neg 120.46892 12.13333 .5 Frame gsave 1.000 0.906 0.729 setrgbcolor fill grestore gsave 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0 setlinecap stroke grestore end @endspecial(one)917 b(electron)e(per)h(atom,)p 0.000 0.000 0.000 TeXcolorrgb 0.690 0.188 0.376 TeXcolorrgb -3868 21258 a Fq(\344)p 0.000 0.000 0.000 TeXcolorrgb 0.000 0.000 0.000 TeXcolorrgb 1447 w Fr(but)g(this)g(time)f(the)h (atomic)f(w)-80 b(avefunctions)914 b(a)-80 b(re)1787 b @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0. true 3.8 neg 3.8 neg 53.09955 12.13333 .5 Frame gsave 1.000 0.906 0.729 setrgbcolor fill grestore gsave 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0 setlinecap stroke grestore end @endspecial(s)916 b(o)-80 b(rbitals.)-5102 26666 y(This)916 b(is)g(called)f(the)1788 b @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0. true 3.8 neg 5.8 neg 143.97878 12.13333 .5 Frame gsave 1.000 0.906 0.729 setrgbcolor fill grestore gsave 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0 setlinecap stroke grestore end @endspecial(tight)916 b(binding)i(app)-80 b(ro)g(ximation)871 b(.)9168 42843 y @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0. true 5.8 neg 5.8 neg 237.41191 62.70549 .5 Frame gsave 3.0 -45 PtoC Shadow 0.545 0.545 0.478 setrgbcolor gsave fill grestore stroke grestore gsave 1.000 1.000 1.000 setrgbcolor gsave fill grestore stroke grestore gsave 1.000 1.000 1.000 setrgbcolor fill grestore gsave 0.8 SLW 0 setgray 0 setlinecap stroke grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0 setgray 28.45274 28.45274 14.22636 .5 CLW mul sub 0 360 arc closepath gsave 0 1 setgray currentrgbcolor 1 0.545 0.000 0.000 setrgbcolor currentrgbcolor 2 grestore 100 0.3 0.7 0 tx@PstSlopeDict begin CcSlopesFill end end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0 setgray 28.45274 28.45274 2.84544 .5 CLW mul sub 0 360 arc closepath gsave .5 setgray fill grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0 setgray 85.35823 28.45274 14.22636 .5 CLW mul sub 0 360 arc closepath gsave 0 1 setgray currentrgbcolor 1 0.545 0.000 0.000 setrgbcolor currentrgbcolor 2 grestore 100 0.3 0.7 0 tx@PstSlopeDict begin CcSlopesFill end end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0 setgray 85.35823 28.45274 2.84544 .5 CLW mul sub 0 360 arc closepath gsave .5 setgray fill grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0 setgray 142.26372 28.45274 14.22636 .5 CLW mul sub 0 360 arc closepath gsave 0 1 setgray currentrgbcolor 1 0.545 0.000 0.000 setrgbcolor currentrgbcolor 2 grestore 100 0.3 0.7 0 tx@PstSlopeDict begin CcSlopesFill end end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0 setgray 142.26372 28.45274 2.84544 .5 CLW mul sub 0 360 arc closepath gsave .5 setgray fill grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0 setgray 199.1692 28.45274 14.22636 .5 CLW mul sub 0 360 arc closepath gsave 0 1 setgray currentrgbcolor 1 0.545 0.000 0.000 setrgbcolor currentrgbcolor 2 grestore 100 0.3 0.7 0 tx@PstSlopeDict begin CcSlopesFill end end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 1.0 SLW 0 setgray 199.1692 28.45274 2.84544 .5 CLW mul sub 0 360 arc closepath gsave .5 setgray fill grestore end @endspecial -5102 47024 a(Applying)916 b(periodic)g (bounda)-80 b(ry)917 b(conditions,)g(this)e(p)-80 b(roblem)916 b(is)g(the)g(same)f(as)-5102 50952 y(that)g(of)h(a)g(cyclic)e (conjugated)j(system,)d(such)i(as)g(benzene.)p 0.098 0.098 0.439 TeXcolorrgb -6740 56276 85479 98 v 0.000 0.000 0.000 TeXcolorrgb 0.098 0.098 0.439 TeXcolorrgb -6740 58788 a Fp(PX407)874 b(Quantum)g(Physics)i(I)77 b(I\(Annotated\))p 0.000 0.000 0.000 TeXcolorrgb 0.098 0.098 0.439 TeXcolorrgb 58773 58712 a Fo(c)58059 58788 y Fn(\260)p Fm(M)886 b(P)g(Allen)h(2003) p 0.000 0.000 0.000 TeXcolorrgb eop end PStoPSsaved restore %%Page: (2,3) 2 userdict/PStoPSsaved save put PStoPSmatrix setmatrix 560.740852 421.000000 translate 90 rotate 0.664750 dup scale userdict/PStoPSmatrix matrix currentmatrix put userdict/PStoPSclip{0 0 moveto 612.000000 0 rlineto 0 792.000000 rlineto -612.000000 0 rlineto closepath}put initclip /showpage{}def/copypage{}def/erasepage{}def PStoPSxform concat TeXDict begin @landscape 3 2 bop 0.000 0.000 0.000 TeXcolorrgb Black -8000 59998 a @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0. true 0.0 0.0 383.30276 296.18846 .5 Frame gsave 1.000 1.000 0.878 setrgbcolor fill grestore end @endspecial 0.098 0.098 0.439 TeXcolorrgb -6740 -4468 a Ft(Lecture)765 b(15:)1018 b(Molecules)764 b(to)g(Metals)p Black 0.098 0.098 0.439 TeXcolorrgb 49100 w(15-3)p Black 0.098 0.098 0.439 TeXcolorrgb -6740 -3544 85479 98 v -6740 -3119 V Black -5102 -1323 a SDict begin /product where{pop product(Distiller)search{pop pop pop version(.)search{exch pop exch pop(3011)eq{gsave newpath 0 0 moveto closepath clip/Courier findfont 10 scalefont setfont 72 72 moveto(.)show grestore}if}{pop}ifelse}{pop}ifelse}if end -5102 -1323 a 0.000 0.000 0.000 TeXcolorrgb 9423 2305 a @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0. true 3.8 neg 6.67998 neg 231.32463 15.8 .5 Frame gsave 0.098 0.098 0.439 setrgbcolor fill grestore gsave 0.8 SLW 0 setgray 0 setlinecap stroke grestore end @endspecial 1.000 0.843 0.000 TeXcolorrgb Fs(Tight-Binding)1402 b(App)-123 b(ro)g(ximation)p 0.000 0.000 0.000 TeXcolorrgb -5102 7534 a Fr(Consider)916 b(a)g(periodic)g(1D)g(lattice) e(of)i Fl(N)1101 b Fr(atoms.)1220 b(Eigenvalues)915 b(a)-80 b(re:)764 13739 y @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0. true 3.8 neg 5.3 neg 76.96222 12.13333 .5 Frame gsave 1.000 0.906 0.729 setrgbcolor fill grestore gsave 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0 setlinecap stroke grestore end @endspecial Fl(\270)2552 14083 y Fk(n)4532 13739 y Fj(=)813 b(2)488 b(cos)g Fl(\265)15542 14083 y Fk(n)16709 13739 y Fl(;)1686 b Fr(where)e @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0. true 3.8 neg 6.46666 neg 69.10971 12.8 .5 Frame gsave 1.000 0.906 0.729 setrgbcolor fill grestore gsave 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0 setlinecap stroke grestore end @endspecial Fl(\265)29127 14083 y Fk(n)31107 13739 y Fj(=)813 b(2)p Fl(\274)92 b(n)67 b(=)-170 b(N)1871 b Fr(and)814 b Fl(n)880 b Fj(=)813 b(0)p Fl(;)489 b Fj(1)p Fl(;)f(:)h(:)f(:)g(N)835 b Fi(\241)650 b Fj(1)-224 19300 y Fi(\))1626 b Fl(E)6326 19644 y Fk(n)8307 19300 y Fj(=)813 b Fl(\256)650 b Fj(+)g Fl(\257)133 b(\270)20577 19644 y Fk(n)22557 19300 y Fj(=)813 b Fl(\256)651 b Fj(+)f(2)p Fl(\257)621 b Fj(cos)488 b Fl(\265)40960 19644 y Fk(n)42940 19300 y Fj(=)1685 b @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0. true 3.8 neg 6.46666 neg 110.28639 12.8 .5 Frame gsave 1.000 0.906 0.729 setrgbcolor fill grestore gsave 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0 setlinecap stroke grestore end @endspecial Fl(\256)651 b Fj(+)f(2)p Fl(\257)621 b Fj(cos)q(\(2)p Fl(\274)92 b(n)67 b(=)-170 b(N)185 b Fj(\))-5102 25505 y Fr(Allo)-80 b(wing)915 b Fl(N)998 b Fi(!)813 b(1)917 b Fr(gives)e(a)h(simple)f(model)i(of)f(a)g(one-dimensional)g(solid.) -5102 30929 y(There)984 b(will)g(be)g(an)g(in\257nite)h(number)g(of) -5102 34857 y(closely-spaced)856 b(states,)867 b(occup)-80 b(ying)858 b(an)-5102 38785 y(energy)915 b Fh(band)1180 b Fr(of)916 b(\257nite)g(width:)3558 44990 y @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0. true 3.8 neg 5.79999 neg 107.38379 12.13333 .5 Frame gsave 1.000 0.906 0.729 setrgbcolor fill grestore gsave 0.8 SLW 0.804 0.729 0.588 setrgbcolor 0 setlinecap stroke grestore end @endspecial Fl(E)5555 45334 y Fg(max)9748 44990 y Fi(\241)650 b Fl(E)14672 45334 y Fg(min)18623 44990 y Fj(=)813 b Fi(\241)p Fj(4)p Fl(\257)-5102 51195 y Fr(remember)915 b Fl(\257)1048 b Fr(is)916 b(negative.)40223 53825 y @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0. true 5.8 neg 5.8 neg 148.49706 112.49776 .5 Frame gsave 3.0 -45 PtoC Shadow 0.545 0.545 0.478 setrgbcolor gsave fill grestore stroke grestore gsave 1.000 1.000 1.000 setrgbcolor gsave fill grestore stroke grestore gsave 1.000 1.000 1.000 setrgbcolor fill grestore gsave 0.8 SLW 0 setgray 0 setlinecap stroke grestore end @endspecial 59820 41577 a @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray 0.0 0.0 42.67911 .5 CLW mul sub 0 360 arc closepath gsave 0.8 SLW 0 setgray 0 setlinecap stroke grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.545 0.000 0.000 setrgbcolor /ArrowA { moveto } def /ArrowB { } def [ 42.67911 90. PtoC 42.67911 90. PtoC /Lineto /lineto load def false Line gsave 0.8 SLW 0.545 0.000 0.000 setrgbcolor 0 setlinecap stroke grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray SD end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 SD end 42.67911 90. PtoC 2.13408 setgray 42.67911 90. PtoC 2.13408 @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.545 0.000 0.000 setrgbcolor /ArrowA { moveto } def /ArrowB { } def [ 42.67911 85. PtoC 42.67911 95. PtoC /Lineto /lineto load def false Line gsave 0.8 SLW 0.545 0.000 0.000 setrgbcolor 0 setlinecap stroke grestore end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 setgray SD end @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0 SD end 42.67911 95. PtoC 2.13408 setgray 42.67911 85. PtoC 2.13408 @endspecial @beginspecial @setspecial tx@Dict begin STP newpath 0.8 SLW 0.545 0.000 0.000 setrgbcolor /ArrowA { moveto } def /ArrowB { } def [ 42.67911 80. PtoC 42.67911 100. PtoC /Lineto /lineto load def false Line gsave 0.8 SLW 0.545 0.0...

Find millions of documents on Course Hero - Study Guides, Lecture Notes, Reference Materials, Practice Exams and more. Course Hero has millions of course specific materials providing students with the best way to expand their education.

Below is a small sample set of documents:

East Los Angeles College - PX - 407
Spectroscopic TransitionsThis concluding lecture on spectroscopy introduces two essential ideas: selection rules which may restrict the transitions that occur through symmetry relations; and the Einstein coefficients which determine the rates of spo
East Los Angeles College - PX - 407
ScatteringIn this lecture we introduce the basic formalism of scattering and treat it within time-dependent perturbation theory, applying Fermi's Golden Rule. Scattering cross sections The Born approximation Simple examples of scattering Refs: Ma
East Los Angeles College - PX - 407
Lecture 9: Greens Functions in Three Dimensions9-1Greens Functions in Three DimensionsWe generalize the Greens function approach to 3D, and rediscover the Born approximation. Scattering in 3D The Born approximation revisited Refs: Mandl, pp237
East Los Angeles College - PX - 407
Lecture 10: Partial Wave Expansion10-1Partial Wave ExpansionNow we turn to an approach which is complementary to the Born approximation: the partial wave expansion. This turns out to be most useful at low scattering energies. Incident and scatt
East Los Angeles College - PX - 407
Lecture 12: Molecular Orbitals12-1Molecular OrbitalsIn this lecture we introduce the general form of bonding and antibonding orbitals, starting rst with a toy model which illustrates the ideas, and then moving on to treat the H+ molecule ion in
East Los Angeles College - PX - 407
Lecture 13: Diatomic Molecules13-1Diatomic MoleculesNow we point the way to generalizing the results that we have seen for the hydrogen molecule-ion, in two ways: how to handle more than one electron, and how higher atomic orbitals combine into
East Los Angeles College - PX - 407
Lecture 14: Conjugated Systems14-1Lecture 14: Conjugated SystemsIn this lecture we apply the Hckel approximation to help understand u bonding in certain large molecules. We take as examples a linear molecule, butadiene, and a cyclic molecule, be
East Los Angeles College - PX - 407
Lecture 3: Perturbation Theory3-1Perturbation TheoryIn this lecture we discuss the transitions induced by a small perturbation. We examine the transient behaviour produced when a perturbation is switched on rapidly, and examine the conditions un
East Los Angeles College - PX - 407
Lecture 4: Spectroscopy4-1SpectroscopyTo describe spectroscopy experiments we must consider the interaction of the system with an oscillating electromagnetic field. Fortunately, with suitable approximations, this is just as easy as considering a
East Los Angeles College - PX - 407
Lecture 5: Spectroscopic Transitions5-1Spectroscopic TransitionsThis concluding lecture on spectroscopy introduces two essential ideas: selection rules which may restrict the transitions that occur through symmetry relations; and the Einstein co
East Los Angeles College - PX - 407
Lecture 6: Scattering6-1ScatteringIn this lecture we introduce the basic formalism of scattering and treat it within time-dependent perturbation theory, applying Fermi's Golden Rule. Scattering cross sections The Born approximation Simple exa
East Los Angeles College - PX - 407
Lecture 7: Time-Independent Scattering7-1Time-Independent ScatteringIn this lecture we rewrite the basic formalism of scattering in terms of the stationary wave-functions. Flux density denition Radially scattered beam Refs: Atkins, p48, 451; M
East Los Angeles College - PX - 407
Lecture 8: Green's Functions and Scattering8-1Green's Functions and ScatteringWe introduce Green's functions, and explain how they may be used to cast the scattering problem into the form of an integral equation. Then we consider the case of sca
East Los Angeles College - PX - 407
Lecture 9: Greens Functions in Three Dimensions9-1Green's Functions in Three DimensionsWe generalize the Green's function approach to 3D, and rediscover the Born approximation. Scattering in 3D The Born approximation revisited Refs: Mandl, pp2
East Los Angeles College - PX - 407
Lecture 10: Partial Wave Expansion10-1Partial Wave ExpansionNow we turn to an approach which is complementary to the Born approximation: the partial wave expansion. This turns out to be most useful at low scattering energies. Incident and scatt
East Los Angeles College - PX - 407
Lecture 11: Born-Oppenheimer Approximation11-1Born-Oppenheimer ApproximationWe begin our discussion of molecular structure with a summary of the much-used Born-Oppenheimer approximation, which allows a practical separation of the nuclear and ele
East Los Angeles College - PX - 407
Lecture 12: Molecular Orbitals12-1Molecular OrbitalsIn this lecture we introduce the general form of bonding and antibonding orbitals, starting first with a toy model which illustrates the ideas, and then moving on to treat the H+ molecule ion i
East Los Angeles College - PX - 407
Lecture 13: Diatomic Molecules13-1Diatomic MoleculesNow we point the way to generalizing the results that we have seen for the hydrogen molecule-ion, in two ways: how to handle more than one electron, and how higher atomic orbitals combine into
East Los Angeles College - PX - 407
Lecture 14: Conjugated Systems14-1Lecture 14: Conjugated SystemsIn this lecture we apply the Hckel approximation to help understand u bonding in certain large molecules. We take as examples a linear molecule, butadiene, and a cyclic molecule, be
East Los Angeles College - PX - 407
Lecture 15: Molecules to Metals15-1Molecules to MetalsWe apply the Hckel approach to a one-dimensional system of atoms, u where it is known as the tight-binding approximation. Then we briey discuss the problem of a particle moving in a periodic
East Los Angeles College - PX - 407
%!PS-Adobe-2.0 %Creator: dvips(k) 5.90a Copyright 2002 Radical Eye Software %Title: problems.dvi %CreationDate: Sat Nov 15 10:56:16 2003 %Pages: 2 %PageOrder: Ascend %BoundingBox: 0 0 596 842 %DocumentFonts: HFBRBX10 HFBR10 HFBR8 HFBRMI8 HFBRSY8 HFBR
East Los Angeles College - PX - 407
%!PS-Adobe-2.0 %Creator: dvips(k) 5.90a Copyright 2002 Radical Eye Software %Title: problems.dvi %CreationDate: Sat Nov 15 10:54:50 2003 %Pages: 1 %PageOrder: Ascend %BoundingBox: 0 0 596 842 %DocumentFonts: HFBRBX10 HFBR10 HFBRMI8 HFBR8 HFBRSY8 HFBR
East Los Angeles College - PX - 407
%!PS-Adobe-2.0 %Creator: dvips(k) 5.90a Copyright 2002 Radical Eye Software %Title: problems.dvi %CreationDate: Fri Dec 05 16:16:31 2003 %Pages: 2 %PageOrder: Ascend %BoundingBox: 0 0 596 842 %DocumentFonts: HFBRBX10 HFBR10 HFBR8 HFBRMI8 HFBRSY8 CMEX
East Los Angeles College - PX - 407
PX407 Quantum Physics IIProblems Sheet 1 Refer to the list of formulae at the end. Problem 1. A tritium 3 H atom (Z = 1) is initially in its electronic ground state |1s . Its nucleus decays suddenly by -emission, giving a 3 He+ ion (Z = 2). What are
East Los Angeles College - PX - 407
PX407 Quantum Physics IIProblems Sheet 2 Problem 1. Find the dierential scattering cross section, within the Born approximation, for the following spherically symmetric potentials: (a) V (r ) = V0 er2 /2a2, the repulsive Gaussian potential(b) V
East Los Angeles College - PX - 407
PX407 Quantum Physics IIProblems Sheet 3 Problem 1. In lectures we examined a toy molecule where the `nuclei' are represented by two attractive delta functions separated by 2X, and the `electron' wavefunction satisfies a Schrdinger o equation (x)
East Los Angeles College - PX - 230
East Los Angeles College - PX - 230
East Los Angeles College - PX - 230
East Los Angeles College - PX - 230
East Los Angeles College - PX - 207
UNIVERSITY OF WARWICK DEPARTMENT OF PHYSICS 2nd Year Examples 2001/2002 Term 2 Weeks 11-15 PX 207 - ELECTOMAGNETIC THEORY 1 Starting with the defining equations find the dimensions of the following vectors E,B,H,M in terms of mass[M], length [L], tim
East Los Angeles College - PX - 250
PX250 Fortran Programming for Scientists 20021PX250 Fortran Programming for Scientists 2002With this document are 3 projects of which you must do 1. Read them all and do not assume that the one with the shortest text is the easiest! You should s
East Los Angeles College - PX - 319
WATERS Craig WOOD Thomas LEE Richard KOYANI Hiren RUFF Adam SHARPE Jonathan MOOR P. SIMPSON A. CHAMBERLAIN Ryan HOLLOWELL Will HARESIGN D BELLINGHAM M BUNCE T JONES C G STEWARD S.J. JONES A.C. Simon Wongsuwarn MANSFIELD TM HUGHES DC APPLETON S BENNET
East Los Angeles College - PX - 373
UNIVERSITY OF WARWICK DEPARTMENT OF PHYSICSTHIRD YEAR NON-EXPERIMENTAL PROJECTSTUDENTS CONTRIBUTION DURING COURSE (25%)STUDENTS NAME:.Awarded Mark out of 10 Contribution to discussion Sessions* Work between sessions to produce material Intere
Ferris State - P - 311
Introduction to Modern PhysicsBy Charles W FayIntroduction to Modern Physics: Physics 311 Lecture Notes Ferris State University unpublished supplement to the textDepartment of Physical Science 2009Table of Contents I The Birth of Modern Physic
Ferris State - P - 311
Part I The Birth of Modern Physics1Chapter 1 Classical Mechanics1.1 What is PhysicsPhysics is primarily the study of matter, energy and change. How do we study matter? The physical world is studied through experimentation. Physics unlike math
Ferris State - P - 311
Part II Relativity10Chapter 3 On the Electrodynamics of Moving BodiesAlbert Einstein attacked the contradiction between the Galilean transformation and Maxwell's equations in his seminal paper &quot;On the Electrodynamics of Moving Bodies&quot; (1905), wh
Ferris State - P - 311
Chapter 4 Does the Inertia of a Body depend upon its Energy-content?4.1 Does the Inertia of a Body depend upon its Energy-content?We found previously that the ratio energy of a plane wave of light with energy E in the rest frame and E' in a frame
Ferris State - P - 311
Chapter 5 General RelativityEinstein cites 2 reasons for a new theory of gravitation, 1. Special Relativity Applies to all forces but gravity, Gravity is not invarient under special relativity 2. To construct an inertial reference frame (IRF), one m
Ferris State - P - 211
Physics 211By Charles W Fay, Ph. D.Physics 211: Lecture Notes Lecture Notes Ferris State University unpublished supplement to the text College Physics 6th Ed. By Wilson, Bua, and Lou Department of Physical Science 2009Table of ContentsLIST OF
Ferris State - FAYC - 211
LABORATORY MANUAL Physics 211By Dr. Charles W Fay IVPhysics 211: Laboratory Manual: Spring 2009 Laboratory Manual Ferris State University Department of Physical Science 2008Table of ContentsIntroduction 1 Measurement and Error 2 Free Fall 3 Pr
Ferris State - P - 211
Chapter 1 Science and MeasurementWelcome to Physics 211. I am going to make the claim to you, that you already understand a great deal about physics. However, your knowledge is for the most part, intuitive and nonscientific. To make our understandin
Ferris State - P - 211
Chapter 2 Kinematics: Displacement and vectors (Chapter 2-3)2.1 Kinematic notationWe have said that physics is a science based upon objective, quantifiable measurements. Let us now carefully introduce the first two quantities we will measure. Disp
Ferris State - P - 211
Chapter 3 Kinematics II: Velocity and Acceleration (Chapters 2-3)3.1 Free Fall: motion under constant accelerationNow, what will happen if rather than rolling the ball across the surface we drop the ball. We still only have to worry about motion i
Ferris State - P - 211
Chapter 4 Force v So far, we have described the motion as a function of time, dt, (t), . a4.1Newton's First LawNow, we would like to examine the nature of acceleration. We know if we push on something heavy we have to push harder than if we
Ferris State - P - 211
Chapter 4 SolutionsC.W. Fay February 4, 200920, 38, 62, 80, 106,16, 18, 32, 44, 52, 54, 66, 81, 97, 107, 109 Assigned1Problem 4.20A fish weighing 25lb is caught and hauled onto the boat. (a) Compare the tension in the fishing line when the fi
Ferris State - P - 211
Physics 211 Test 1NAME:Physics 211 Test 1February 13, 20081. A soccer ball is kicked from the ground over a railing so that it lands on its way down on a balconey that is 3.50 meters above the ground. The ball is given an initial velocity of 11
Ferris State - P - 211
Physics 211 Test 1NAME:Physics 211 Test 1April 15, 20081. A soccer ball is kicked from the ground over a railing so that it lands on its way down on a balconey that is 3.50 meters above the ground. The ball is given an initial velocity of 11.7m
Ferris State - P - 211
Chapter 5 Work and Energy5.1 Summary ReviewSo far we have discussed; displacement: d : a position vector with units of m (meters) d(t) = d0 + v0 t + 1/2at2 (5.1) velocity: : a vector with magnitude of speed and units of m/s (meters per v seco
Ferris State - P - 211
Chapter 6 Linear MomentumLinear momentum represents the difficulty required to stop a moving particle, or inertia in motion. = m p v (6.1) like other quantities momentum is a vector and can be added as a vector to get the total momentum pi = 1 +
Ferris State - P - 211
Chapter 7 Uniform Circular Motion7.1 Circular motionLooking at forces again what happens if we take a hold of the end of a meterstick. If it starts out horizontally we know that it will rotate such that it points straight down. How do we describe
Ferris State - P - 211
Chapter 8 Torque and rotational energy8.1 rotational motion outlookwe can compair some quantities in rotational motion to similar quantities in linear motion. (angular position) position (angular velocity) v (velocity) (angular acceleration) a
Ferris State - P - 211
Chapter 9 Solids and Quantities of Matter9.1 Stress and StrainWhen a force is applied to most solids, the of the object changes, If the object returns to its original shape, it is said to be elastic. (Bonds can twist or stretch or compress slightl
Ferris State - P - 211
Chapter 9 SolutionsC.W. Fay March 17, 200916, 36, 56, 68, 93, 94, 14, 22, 38, 73, 78, 90 Assigned1Problem 9.16A rectangular steel column (20.0cm 15.0cm) supports a load of 12.0 metric tons. If the column is 2.00m in lenght before being stres
Ferris State - FAYC - 211
14EquilibriumOBJECTIVES The purpose of the this experiment is to study the concepts of torque and rotational equilibrium. THEORY A system is in equilibrium when it is not undergoing acceleration. This includes translational acceration, and rotati
Ferris State - P - 211
Physics 211 Test 2October 21, 20071. A block of mass m=0.500kg hangs from string wrapped around a pulley of mass M=0.750kg and radius R=0.250m. After some time it has fallen from rest to a distance of 1.30m below its starting position. (I = 1 MR2 )
Ferris State - P - 211
Physics 211 Test 2November 7, 20071. A block of mass m=0.500kg hangs from string wrapped around a pulley of mass M=0.750kg and radius R=0.250m. After some time it has fallen from rest to a distance of 1.30m below its starting position. (I = 1 MR2 )
Ferris State - P - 211
Physics 211 Test 1NAME:SECTION:Physics 211 Test 1March 23, 2009given: G = 6.67 1011 Nm2 /kg 2 Multiple choice questions 2 points each. 1. Consider two unequal masses, M and m. Which of the following statements is false? (a) It is possible fo
Ferris State - P - 211
Chapter 10 Temperature and Kinetic theory10.1 TemperatureTemperature: measure of &quot;hotness&quot; or &quot;coldness&quot; Heat: Heat is the net energy transferred from on object to another because of a temperature difference. If there is no heat flow the objects a
Ferris State - P - 211
Chapter 10 SolutionsC.W. Fay April 1, 200944, 65, 80, 95, 100 10, 36, 43, 61, 77, 86 Assigned1Problem 10.44If 2.4m3 of a gas initialy at STP is compressed to 1.6m3 and its temperature is raised to 30 , what is the final pressure? V1 = 2.4m3 V
Ferris State - P - 211
Chapter 11 Heat11.1 Heat: reviewHeat is the net energy transferred because of a difference in temperature. Since heat is a measure of engery, we use the unit of Joule (J). For completeness we will also define the calorie. 1kcal = 1Cal = 1000cal =