This preview has intentionally blurred parts. Sign up to view the full document

View Full Document

Unformatted Document Excerpt

%%Creator: %!PS-Adobe-2.0 dvips(k) 5.90a Copyright 2002 Radical Eye Software %%Title: ApproxDecomp.dvi %%CreationDate: Tue May 27 19:20:35 2003 %%Pages: 8 %%PageOrder: Ascend %%BoundingBox: 0 0 596 842 %%DocumentFonts: CMBX12 CMBX10 CMR10 CMTI10 CMMI10 CMSY10 CMR7 CMMI7 %%+ CMMI5 CMEX10 CMSY7 CMR5 CMSY5 CMMI9 CMR9 CMSY9 CMR6 CMBX9 CMTT9 %%+ CMMI6 CMSY6 LASY10 %%DocumentPaperSizes: a4 %%EndComments %DVIPSWebPage: ( %DVIPSCommandLine: dvips.exe -P pdf -G0 ApproxDecomp %DVIPSParameters: dpi=8000, compressed %DVIPSSource: TeX output 2003.05.27:1920 %%BeginProcSet: %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S /BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S r rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: %! % Patch by TVZ % Makes dvips files draw rules with stroke rather than fill. % Makes narrow rules more predictable at low resolutions % after distilling to PDF. % May have unknown consequences for very thick rules. % Tested only with dvips 5.85(k). TeXDict begin /QV { gsave newpath /ruleY X /ruleX X Rx Ry gt { ruleX ruleY Ry 2 div sub moveto Rx 0 rlineto Ry } { ruleX Rx 2 div add ruleY moveto 0 Ry neg rlineto Rx } ifelse setlinewidth 0 setlinecap stroke grestore } bind def e end %%EndProcSet %%BeginProcSet: %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S r rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: %! TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def} ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{ dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def} if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def} d def end %%EndProcSet %%BeginProcSet: %! TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N /vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N /rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N /@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ /hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B /@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ /urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known {userdict/md get type/dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale }if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState save N userdict maxlength dict begin/magscale true def normalscale currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts /psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict begin/SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N /@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X /yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet %%BeginFont: LASY10 %!PS-AdobeFont-1.1: LASY10 1.001 %%CreationDate: 1992 Oct 23 20:19:17 %%RevisionDate: 2001 Jun 05 20:19:17 % Copyright (C) 1997, 2001 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.001) readonly def /Notice (Copyright (C) 1997, 2001 American Mathematical Society. All Rights Reserved) readonly def /FullName (LASY10) readonly def /FamilyName (LaTeX) readonly def /Weight (Medium) readonly def /ItalicAngle -14.035 def /isFixedPitch false def end readonly def /FontName /LASY10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 50 /a50 put readonly def /FontBBox{-19 -192 944 683}readonly def /UniqueID 5011949 def currentdict end currentfile eexec D9D66F637A9E5292A4933615152D29EEC26E1BED2E48CAB7AC058698EA30B07E F8BDB66981B14445E1107420FDAF32EDBD5C26E35B334E3AF24373B2A13984D9 1D56801ACCF98612DE2C19685E0F4D52369AD642D169AB57DAB10665C6C01538 4E7DF30628B47D6551F93A50553E592B5E1540B411A313F39E4149341C981D3C 705F8AD7782F59531404B3C001D8B882E0C5468D00B26040A352ED823D7C8DF4 B632A37A034C6304A39F28739AC3D634CDC707B53474E63135975E7F0FFF2458 99878B3A6D8D7AC6F2A2728768B8C2226075299B8CB08B76AED9A00BF448A646 87014E8B1C1723204BCBB97BF0F735E436F1805B4026CA792A2464E1FDFC4385 B407DAC19BC7769BBEA6BDD0EE65133044D18530C5A3915AC9272AA4A7FC35A4 93A7A0CA8BD1CFA4382085D949EE819A51062591606ECEB5B37419223CC0400E 158F1A0849868CFAE0F71DA6B4FA47A636EDE756530425A6BFE45B8080808B59 6B886D033437677B151285B047C84C2E2FCB71CCDF34E20E925269E5F1A210F0 391066823D8F21E03746BF79AAC6FF91517631686722226462D6A9EC5FFCC806 B959AED95F492481324749E00CA117821C347F9B924BEC8C64C954570252E909 5C33AC8B1320BB1992A88C619DEA7A8FDDE42390EC82A07BD8BB7F0014A41EC8 04225B5063D3F04723F51128DE8ADB79F62903E1955A7D49220223CA34FDC3EB 8FB71700EB9CC40DF747C4CC60AD11D3FC038CB2051F7E97CF7C7F7D0F49CA1F E0FEFCE664544CD1F7C23B05BA649D373539E7BCC761611C17489084912F77C3 5FB3BC1E91E2B4A47C27BF4989C7703E83C5A505108037DE5006D4F510B8FE1A 570E42E4569FAEBF66058F9D9608A771BEACA2A8AB629DBE939CCBBC116E8BCD BEC3A33CBF185A68DB60CAC5B21AF4D9B46B3FF4FDFBD6BC3C8101BE15E79245 F0CF8F670CFA19ABC08C34D85B10C17190497EACEF6E401F322B1E281C1755F0 BBF9838AF83A0A1601D78E78FD599819762347A77C71374AB428093048E3F1C9 40CFD63B86C7F70BCD2AC3092DDD3BC91CA714BA28263EB863D5E6E2DBD4FA08 6B22C1D18B16D7042219B9F0BDF5BF10AADB658CBED51C8B272E4DFA11C5A603 8B4A437EABAA699B86819EAA072F7D90A9CE1B52287DD3D26C470AD28C07F7BB F6BA9450A2EE874D68A3681162DCD5968BA36603E7BEF09AB1621FD7315CCC00 65333DCC00A2DD41AA1F60E1AE9DB95476A21A15A1925C351E1B5C01750D8F43 E979C63CC3E28A952C3E3C205D830AAC390D243D9919B914297F5F44D7CC8FD0 7604E9B24FBA46D3D7A63F87D704D55A90C06771B0AAC17CECE92A0CE0A26E0C A30722C770B7A6FD89EFF7D09A4F61F794966D65331A12CBF82D4FF7B2A68B69 8A15F1D5CA04272AAAC480AD8371256947302F462234F3714742E820DCCDCD93 065451BEBA27A609A74EA3DFAE847AF90BF42D2202B5F11BA07F809932611743 210014C92466F6016C22 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMSY6 %!PS-AdobeFont-1.1: CMSY6 1.0 %%CreationDate: 1991 Aug 15 07:21:34 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMSY6) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.035 def /isFixedPitch false def end readonly def /FontName /CMSY6 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 0 /minus put dup 50 /element put dup 102 /braceleft put dup 103 /braceright put readonly def /FontBBox{-4 -948 1329 786}readonly def /UniqueID 5000816 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A 221A37D9A807DD01161779DDE7D5FC1B2109839E5B52DFB7605D7BA557CC35D6 49F6EB651B83771034BA0C39DB8D426A24543EF4529E2D939125B5157482688E 9045C2242F4AFA4C489D975C029177CD6497EACD181FF151A45F521A4C4043C2 1F3E76EF5B3291A941583E27DFC68B9211105827590393ABFB8AA4D1623D1761 6AC0DF1D3154B0277BE821712BE7B33385E7A4105E8F3370F981B8FE9E3CF3E0 007B8C9F2D934F24D591C330487DDF179CECEC5258C47E4B32538F948AB00673 F9D549C971B0822056B339600FC1E3A5E51844CC8A75B857F15E7276260ED115 C5FD550F53CE5583743B50B0F9B7C4F836DEF0E4DAFB5591D919AA50F0078928 03C748D6E926C1F493B1C7F9573016B615ECF2B62C88534FCAD46221D7A20BC5 82BE6756538242A42EE1D9B0622CADABCA834E12346D0E0751A8A67B8A222235 062F00F8D0E42E76FABD2D2B2120B7043BC593F6F5F8387DD8AE637B9F57EB31 11C65E6E73427A8C1E2AC62840C525292D6B5B11EC930DB45D02C1E06CFA955E 4E9A1620CB04F2B83EA34620B5C53CFFF18A6D643F795B7692EB77E7B85C52E2 BBC40025D8386C88ADBC882C4E39850F2E114EC5FA856139CFC6FB5AAA07B7CC 1E6EF83176B9C865058F3FBBA961B85EB35934F92F09217E56D9C29795659D6F 0B10BCD38CC882872E9EC13AFAF293E991DD9F4EF42110296BEA4E3733843043 17795D1EB8935EA01B14E89DE4C0012E8C153E136FD52F58CCE1C1CDC8839818 50FE89F44F5C3972D015A196B0D9B3755811D2F04B92D0CA2A249B051A1987CB F6257D14F38C71C238686F8B55A9B40D8BC6A544EC9A5B15F9859F65BE66261F 40B8A71456826C1FCA29C7C21CC5764EDE665D1FCBE835F009EA32FB3C883361 06A0C6DA5C7335223388D2ADD0D79E5FCF23A29075CC87FF29C28CB1151C6354 347250F2724E13236CBCB515E6AA4FDE90F5A64EEA1F9EE0DE46BF6E1816C6B6 361598103AA73E1C61BB100F491A4B9257F99880106C0200986B2FA083D0F5B6 FF85B4B4DE571CB2E73420E331913B971633C6ACCED270115A885EA7F688C947 11E8D91524A60B1C1D9C5EA29795E8402A5DA5834B1C2F217C3EBBB7F61BE4E3 CD4C37F6974A4B7EA40D2C9BE2536B49056F4ABAF07E68D6C6E4C315672EF8F4 915AA897605406620A5683ED4482FF13BA42D613B3FF85AD7FDC46FFF20867DC 1A8061AC0025DCE243BADA99AD395C2132A010A1A4E94B600E0682509A3A7CA4 7ABCC23BE8B46F4C007B1FB4EA8DC535037887C4B995DCF13920EED3498E070D 0EB84A342EA25706A7B5FC2A3D4684FE6EEE0F68DE714F1A0510FEF3ABDF3EE0 4ECB5C49F3DD0E640C5C35D524C83795D8 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMMI6 %!PS-AdobeFont-1.1: CMMI6 1.100 %%CreationDate: 1996 Jul 23 07:53:52 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.100) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMMI6) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.04 def /isFixedPitch false def end readonly def /FontName /CMMI6 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 70 /F put dup 76 /L put dup 88 /X put dup 102 /f put dup 105 /i put dup 106 /j put dup 109 /m put dup 113 /q put dup 114 /r put dup 120 /x put readonly def /FontBBox{11 -250 1241 750}readonly def /UniqueID 5087381 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE D919C2DDD26BDC0D99398B9F4D03D6A8F05B47AF95EF28A9C561DBDC98C47CF5 5250011D19E9366EB6FD153D3A100CAA6212E3D5D93990737F8D326D347B7EDC 4391C9DF440285B8FC159D0E98D4258FC57892DDF0342CA1080743A076089583 6AD6FB2DC4C13F077F17789476E48402796E685107AF60A63FB0DE0266D55CF1 8D0AD65B9342CB686E564758C96164FFA711B11C1CE8C726F3C7BB1044BBD283 9AA4675747DF61E130A55E297CA5F0182A3F12F9085AF2F503481071724077A9 387E27879A9649AD5F186F33500FAC8F7FA26634BDCE1221EC0ED0E359E5EA5E 6166526FEB90C30D30099FBDC1BC2F9B62EFEEC48345160804AA98F8D0AA54B7 A480E715426651865C8E444EDB798C7E11040AF6E5A7ED1888653C6DBF5E6169 70BCD9C063B63B561EF165BF3AF11F8E519F37C6FDA2827685739DE2C48B5ADE EE84F067D704D4511DBFA49E166D543CFD9ECD7417055D8A827F51E087CD2927 BAFC7E6CFBD70B0FE969F890A11149D3D44D422C3370495DA9951AEE7253A49F 3A9444C8CD9158D84117299F7F2332FEB0F94E6ED8BC7AA789A3219BC2F227D3 3B5BC75FB53B55D72AF4A6A7BB613FA235B11BB37D059FD87127CEF73D5B3FBF 9F91ABAD78BD9240BD9525EBA78095EA0BDB25D1A19E876F292882EAD5619D46 D20317A345D931F4FF4EAE6216C27044CBA525E3B917CEA25A04C120466C4B93 FC720E6BA832A06CCA0A3916CEF0968D49085AEBD243C41A448289A6F05CE3F5 79148DC112A3CC7E8FF810B8C1A09E05F496C0F1EBA334E42E05C376C98F5F69 C06C71BFC0A2F3AC9951CFBB143C66FB84F9C4ED27DF70869352D61BD5E11508 0797B87C726ABE0FD05DB617F7B7BA6C376A8B4E29F8C747E5D11B0662972EF0 1C8A39DD37FC8B42146281443AACD6E1EB3FD98E0D38379A26106596B49B2831 0D411F922A7728946F37D7FF7574ECD87009C39AC330DC34223E191E0329B3CF 72B64A881174382F7725D2C192EEE65BB8848C6C6D11D41C63DA97CAA0E228CF 7EC2880F11FDC9B5DF2E1D805D6D57B654C599999F5954919C09ED3D3C169B9B 668CA58CDD97730A3EE6CECD5E92E19B29F11A037E50516807E2681D2177B49B 6031431F22528AAC2F1AAF319CFBF92DB3A369966C7F67FB53CF6910967DC6CE 5B6D65D0E0EC0CC38F3220F061A89A9C317461D8A72CF9B5864AA89D0A8D706C C2DFC60D26C9F2C615B0EB336866DD312C2C77615F492FDC0073F0323D35343F 36B92F68AFD7D2DF2F3BB7F99078F4E85B4E54D8D0FCA229CAB830582DAA951F 5F566A9DF449DC92578D4BB6038EBD045F4283781706C370CD5971A683861B27 5E46B050F85785BA5672DE5B95F712B81546C51A2921B092546276DF8A1A8749 D09E5900B2950486E570FD307253C5066848F2F5D905D7BD017CDC72EC7B8F64 6E0EA9F3403CD0FC3F6C656043B5B24504324E0ECF9BB2899BFFE1447B33F96D 402B5BDB476D52F537DFE8F0CF5ECED5808CA34FC802F098697E2192F5C5F220 9560AA149A925E9929C762CF8BEB33BF326246B57A0D3C3DE2F52CA44FE8C608 83A1A043BC3AF8D57438FB8CE514D16B41983462371F407381C80BE721B3053F 5E316B1956605D3C176B0A840764BAFE4CF38365986D6BEE4AEEF3904C612A1D D2DF4A1C80E8C5DFA6BC4464E97840327D1FA83BB599BC18917C01A2BA6709A0 25FFFEA2F36C3BF89DD4BE0FBB3434C8B078C686718B9C3BC9C66FD215EAB86C D1329CA93C0071E86FDD1843E7982D8EF7A651003AD2069474AC54D285C5B4FE B2517165C75907F4E9B22948AABC6352E4EDDE175F07CFC643B7EBEC418E7CF2 7D4560E79A83A73C4C7D5DCEF6BBF1F764D8E81EEF5A3B2DE87F0AFB2BB4EC89 167BE31DD973084C3D21DAD5E96514FF25DB3C995CA5BD4F7D467C649C7ECA8B 7641D4C66BFAF9A3616BA161883FEFB1FDE9DD50D82CB414D01D275D537414AE FFF3F025224ABE35FA63A191FE4B8232079A03E3055EE091143C66E6D3B988ED 987A55ED58BB9C26B0A6BCBE211B8B0B9006A375C9ABDF51456D0177F29A97B1 D859DCEE7479FD69A474E29DF640C641CAAF8A65457D8CE1359DA27F249FED5B BB25D9B6ECA13E0EB8EAABE462B9811F3FBFD643DE08F6F0029FBFD739847484 DEAE7C4E2A35F3FBB2052A4C35952AD780DCDB253008268C42BEF0F95C8B11B3 366A7F9E4CEBF6A8E4934AD804DC3DC43CAF8AFD494EFD8750DAF359D40E6116 12F77D5812A8005402975164C0037354FEC6955ECEEBEAB14CABC6BF53B40CB6 514231447E4191C23E0285556607EA9D3B6DFFB787B34912BE5D0B897FBA9DBE 98FC1E7027A2E98313583A2613F85BA6E07EDB740A58CBE10CEA5F1326E71862 3EA38A5E99DE220D2B84231B808E419D77E1168EC6989C57B078C4D4B6EC86DB 3C1522B7E2238F13810CE0CC12396D30B4747B899F3D44DD7361D12AD68D78E8 CF2577A8644BAA2BD4A8852B53A4BFACC1BFCAF08A0D1CBC16290ED3F91E0991 E93BF5D6C6678B0BEA7DC00E1CB36000598CFC4DB6754FA9F4CC1B687C5299E0 68AC7959B60F446DFC705102937CB0F2DC4CBC840FF5334C0364EF05BB5B1B92 0504F5DC80984A436B35AC62C700FDA08C17ADCB30B2F481547861354407D105 76484C6B88B0FFF2A414DDD75C3E78528E1F4B080AF3B0E6EF6A6B63B0FC7E26 FD61BFA8A652D337FC1C05AF595674DD18B1B7707F625A55006ABFC53CEE4093 AC85863AFB04848156E19D333D8F378013D966F229D719D1F94D2FD2B4BFEA40 83D450F1CEB2ADBE1E0CD4B6CF19254CD3218744A835C13EC379C2AB0DBBB00E 58370479122656F2EB81101A9330B74CEC3FA0918179C48C70AFE8381CD0410E 4C77053A9A8456AC7135AC04CCECAC712AEE494DF31E29D5A57B0E47EB8836C9 AF2475662BF626368365DE0C21CFC2316509E7A07E487E879161C24137BA4A49 FFCF39B44969D6461FD22B22C8C6CE989F0983954835B4AF1A2A675B2749C5AC A0467FA982260ABD63BB4F6D50F9B35E8B65C7664A6ADE88941F86432196F309 3BFF9145DED53C5F4A15B6791E6FB1134F783CF26193D4E010ADF859A7133EB8 4BCCE93B0743C55C219E56B1C7FA9930BE7511F2583A267E6B7B9C13CC4E1F59 4C044C6AB0F4DC27AB837A99FC9E1C0F60DF27826ED60659C514A6D64838AE75 E9AADDBC9FA2F4FBDB9885F1AEA04129CEB82FB5160E47F95279A88C1AAA6E3F EF8CC460528ED4BF6D4D5503283CC703814707FFF71D30FAC54952DF294C765C 845D995DD20E152D294AB752CD71AD9DE2737246168401FC73F83AA9456593D2 8DCE50B86873F123462CBC17444F368D78563DE61A06693E9583BE516023E9A3 6E5194BD67D7A4250BEC3B1DC472A56E45718EEA3AD8217A0CBA3BA7CED57216 60E7B766A27919059B2BC685C5E6BDA573D83C8699C7E2393CDB18F7F23649B9 0D56C290FB593E016CE4B52834600FCB4AAD620F191BBD3F5FEB66BB749B8B19 83BED4B13E06053C9D87FD338D637A4C7047F380274EE1BF7D8D05D4E96E599E 4AB1B49D9218DE24098C855DA6FA3ECBA30B4CA6BFA974D1610D64F53F209CCF 3B8C83BF5E16EE68401E11A234232F83BBFB00EEB10B6B1B04D74B7D9146F1FD 6643D21701260263C705929A57B66F6A59C215DCEA9B7B4A73514AF584A5650C 5781A7CF52A40593E5C1CD1206DF3DA8A1C980402F15938BDA744B0D185C42D5 D723261C728EB1443703BD6DCDEA2CD809A829E92E0CD71D27FFA52596EB074F 465ADC12EB69C90FA55E431D6A215DAF552653FA27FA1022BE938CECE1C1B9FC 795BE553158CAA17E9F8EC8080A0722ACA931D544BADE3CE421F57252F20525B 553CB4F4B9976C6F8685F94522846193653CA82439B12C03E1D1052A777E1498 1A0642FA0777B67475D72BB4DF256013914796BC9EA7F40CA777F085CD5EA891 6F903E50B0442A5033549C48EE72718F6F4DDDAC31DAD0ED9F85C1775EDAB445 74372C76B2358AA2872A989A9588FDA0DE2E73E53CC7C49EA37F9DB3553E7845 6ECB5DAA15645F903BB361A1735F4A9015F9084A79308E108EF783BAA4DA62F7 282B202584810A8630EBE09AFF6FC1A6522DFD2766DA903FB1852DE64935E2D3 0B95E64BB8368CC9B9607DC59FF34DB40FA0D4713A676252467F35E2F634401E 9076BA3436191CC4EC3B0EF4873E21C1D580582C80B62D48E6FB437C44B1DEF1 96B177B147C64C293F800C31600277FB291E10D6FA2DE7DA9F229E675CAB1682 BEB1F4009AC0B0D86FD8251CEA0F7E1E44EE235C5C6DAF7EFA4CA051EE5DC1D9 ACF5C2B5F3306FA2E788F2F037BD10E0D6CE89DD93A7B585674A1D524BC8D9FD 606AA5B5E9D51CD153A644824842612FAB5E60ECA455ED62E3485CB77A908477 B0CB51A21B08FBEA6C31B075F7AB833E25D2C0D9DD8F 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMTT9 %!PS-AdobeFont-1.1: CMTT9 1.0 %%CreationDate: 1991 Aug 20 16:46:24 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMTT9) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch true def end readonly def /FontName /CMTT9 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 39 /quoteright put dup 40 /parenleft put dup 41 /parenright put dup 44 /comma put dup 46 /period put dup 49 /one put dup 50 /two put dup 51 /three put dup 58 /colon put dup 66 /B put dup 67 /C put dup 68 /D put dup 70 /F put dup 73 /I put dup 76 /L put dup 80 /P put dup 83 /S put dup 87 /W put dup 97 /a put dup 98 /b put dup 99 /c put dup 100 /d put dup 101 /e put dup 102 /f put dup 103 /g put dup 104 /h put dup 105 /i put dup 106 /j put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 113 /q put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 118 /v put dup 119 /w put dup 120 /x put dup 121 /y put dup 122 /z put readonly def /FontBBox{-6 -233 542 698}readonly def /UniqueID 5000831 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5F00F963068B8232429ED8B7CF6A3D879A2D1E 2931CE5F5D18C658602059F07BE66E6EFC9239D7AB2FB8A4CBD41675B8ECF279 650C29E53B14AC0E392A664848C1844B1CECBB2D5CFB72D0916B675C9A9A1E35 F12696A6F628473C604A95376468E06E295AD6F76CEB939D94113532050B9D5A D2F41A9EFB9424D986612313B89EFE9C8A71313340B248F6853B1EDBF02B7F9E F447220FE131D7D54CFB8AA1281DBAEA73E665BACB1F164552CC0CEDB63BD4B1 4A9AE8AC6FA02242DBE8DA46B64B6BFC11762F0784F216FC8B9120D688D1705A 438B14F5E5DEAF2A98408B3B64620DE3732A4DAE6D08D5D97E34C75DAE19EABD BA0796165C1151BCBFB1DF8D29A63A8300DBDB9E3323CB82D0337598B83F4F2B A97CF5196D4D1CEC1EDB8966E548C0D9C194C932319610FB43EA1B86322FE641 AB48770FF13BD475A7267E142388563D1A400419C585B22A9886074687BEDF74 D905BE8EE440BA2ABF28EAB673399B7F129B9729DD5564C681954621903B84BB CAF89AC5ADB2932472DF29ADA2BDBDB4D05F65F28F5F4C529613D61858E0074A 082A852710A62A147C966F2B85B51B0BE85F11D2057C66FDD61F6C5755367980 9F4DE680601D4DA41B46F8D2148450000413C27AA39B586B74B977B25F0FD3C0 4BA1EBFAFDBEC531EA13DFBD6700E53818CE04D23886B8AE75DCC36BCD3189B1 0D55FAE27D0D126E82AEF31D7B5DF27E58C30BB0867D6D7AC1DA9EFB8A2DF095 B5B934A68EE122DA0A83B36C952431586B957990206194E89339048AA6EE4C53 703763505ED57C494DD907D0EEA04F6B1D4C8F3BA778F4E7AA832AAB4D75F024 61E91C6D25FD6823CB24FC863D358AEB664097AF08705EBF113C9944C3C4FCF1 FB96C7060CE8450F7AB305FEA0DC033EF6BD2028ECB2E5C18A73D4215399F5EE 54875654392480480FCD98975482BB702B05E599431B24C6FD25CE306E2D8FEB 83D51F5569D28ECB0621B09793559503B9AA69FD913D7F7FDD262F8985748D17 28B74CA0642F01E562BAC442E2ADDBC9B45DC7C429DE36DCC095A07A0D1CF739 8E5F4185C3B78B706F9B3ECADFA3D249BC7F93486E2216754ACBF1D775090362 09A924EE96C4AC43FB60DEEBF3AAE1488DB6EF97AA13FEEFB00FD4FA660F5D3A 90CF4B15A0939A52C804311F607625D1D608EE5B1D45BBB3F6FC4704D6CBC713 540E7D294AEC99A79A5E160846BE6C919C1741B60001D0558CECB3ECCA097E5C 1A4E07D3B6031A84976ABA1F93260DE321C3240918E031C99444650E8CC31931 D55C9A70A3ED1DF70AE7DE60F5952CDD0223E8489468BB14C0BA31D8A58A5808 003A6422FA129D408E4DF3958F40AAD72974A0A7A93A5321A079C566682CA6A7 30FA7525C6ED28D140C85E618B0625AFC415D999F09E86941B7AD6083FBC5748 A402CA5598F9C40E0E31FC716E97E0393EC94901F5A343A253616B0743CE40D7 E4FAAE1FA647C2242F493A7E4695A0037D493C9556040345B67EB17C36D26C7E 2574B67D029D8278EB4CF1887C2DC1EDAC9251204B390DAD553627A6DE810E03 BF671979E82B3BBC65E653CC9835B518C1962DCA0F0DCA86DF86D8D0686F0EA5 D6E7B54761B42F4351B2C70E09A86D3942E1DAEE74667F9ED1F2D9820764F434 87966358F2943D1C2BBBDBA6AE72D3A2F252FD014D0D4D3CEC76A85A0E143F7A 8D110DD7E9264703A5C8674761F3575C73B0A684EA64E8FD6B10269E275A94EB 4A29C2AB0FE1DF202ECF73F32E7C092B45ABC90A053344A9C530E6E589BBA03C 14274A5391FDE44E1735A1C146E5C31CA318FE9FD145D93E97A8C02A8A4C169C 2A4B391A2FD1DE44783A4347B88D05B092153CD7AF2994BBC2441491976B7FBC A7703EED5F95DF10A2C66EA58A3B0D12F5B4050DDBD182AF4591007BF897CAF1 175D286624F6998FBCB9F34D6348C3431157766539C11435CE591E2D778AA9E2 269765C90D884A4EF47EDA8A84D61725372BB70CC2A8DC1E1CB4A51BA1C4E722 0AEC1B76349787062ADE1D4F5A93323CC39791345C879E02A605E86FF1AF51EA 649EA437F870DA71F88592B84B59686A7DBDF990506583785B8CB637B7A11E5D C8BE77021F7A9445C1138ECF18834E20CF77AAB6E884BD0234A1D1F53686F126 1E78AF1AED17FD502F6B8B0BB43AA073F8DCD5FE45C4EAA86D6A2461648B9DDD 19C97E10B826DABC6B693D64E650CB8F07B2FDD7C3820BA981C548669820A4CC 56B9B890840D7CED807DF9863FE82757CE2F9E280EDD25486B2C8CF58D69C878 0ED5D3FBEBE1A416FC67E96EA220AE0135048425CF10AF1CB5F9334D217F8F0F D9430A08F53B5C1E30E53E979496CB1328AEFDA69D0DA248687CB5748C488884 BB7DDE6F4C88A3BBA90A4D9809F2907791BEC4D47C0EDDE707578C63A9F8916B 97A722F90679AEC65B82EC7AEE008530B2DF5C3DD54A56518D43877F6636BF1C DFFA6F93E9692B71AB94BC3CC9FFF23031E7DB3C4BE90E755A7AFE83253B7313 8E2D85E1707A6833EF634D7534E5A25B80C9268D7BFC8ECB6EF4AB30A8038A63 44D5A197A63EA7FC558B4B132FC584A8928DF1AECF75DE9EE8BACF69D5968C5B A07D526F8BB152AEAFBFF118C25062BE0BA992D063FC4C3FF79C2B7E02FFE7E3 12F7A4645EAB6594D4E4BF07D7E2E4A0B9F1D32A5F69B3B24F8FEDC06B02D569 97BABAC5CF59C767EE2DDAA11FEA48EF095675A3604BDDC0B03DE96BEF145749 2D0FFF75CB79B8D6A21E029E05FE4D314B6A4549962C2204A2A3D892F86938A4 8A981A4494314CF21DE0DB502D74D73556CD6A2A4B3B186019BC7E3E71177422 1425D4E01A0A75976BA2B30E69B792A38807DB530C342B527889E70F6B79F9C8 901625051D409FC4176F2AC269D6D5AB9592C313ACDE27270DBBB990B34FAAD6 F6BBACFCBB309CCDB5205B6A101C8784DCAE64C9DACFE8ACF78B6CE726064372 7DBF168494761FB2ACD2BB7589520AE30CF6E3161F0CEC5703AB3F42E20F1195 CAE8B2361DB902FFEEFABC8B3599FBA8CBBB0FBB83520398F6486A4F6B367769 490F54B4A211E6527E4232EA7E002083FE401DC0A14B55836664D4CAE47BC652 AD6795C79D26A2CC0496F134FE055EA6C2E88478FBDCFE76C690B82809A7DD57 85D50D12AC5D57F5B5FA4872656FC3B00E4C50F98BD8760044950CEF5A1DB515 95E55C722CB6579FAB405A8BB272C10FF99DCDB79A16095C55A5CF2C2AB0FC45 BAA71F23319DA3440A0C7F925EE49D152CE98B19668242A7E29707C35F33B7C3 EFF88946CCBC057C62B04E865DAA76FDEE20B6C43677C2BB2FE001F014C12FB0 E3A7BF1BB00A45DB3C2E93B929EB79694C89ECE8A5997EB2E8209385C6446362 8808750009BD294671696E6B2F72DA85F507E9673B025023611D85A9E7411DD4 D2FC38535945A8C0D10C2DA84B7F47D142486AB5019ACD88AE2CB13AA95F0806 D3B1795188C48D52C4B961011335A0781C1ADE925D42087EC9F92CAD072DA767 42693F9055A344D3949D54A49EA63FAA19B7FADD5B1F2A45A06FB050155BA7AC 011310CEB9575272D44B93DF33CC106D11646A09A3CE4AF7089B51D92DBA82E7 3897D918910A1BB4A860E551C984161387ADEB2547E33CC07DAC67B944C0A9AA A26027C1D6EA83BD0AF1B96406F6E6FFE8206637BF778B490C3003AE83B977E1 3AE092B253AB63BB976F6D30C22012C056AA1649AEAF8DF997D82CB5753ECDCB A7B8FB02424DAF5868778C364CB9EF6494A4E86FC24B4FC4E106EBC4ADAA95FF 926A4C86AD2E392A4506E434F0615C58071C4BFBAA4EA4B84671BC52A9799710 B79B297E1490F124CD74BC5F0B3C097C53644CF7485E7B48B2458C6894FF9287 5B2DBCFD3DE00A3F7930817F45BA6232C45AA995898566D6E92DDF931C4487BF F54CB50EB2670C364981A2DF106D85A960DFF6CB55F478EEAB41D60E452514F0 F06EC5F05548C534516E1C905225906E4D18DCDD82EDCFE43B2CC830F2A97854 6CC91C9BE389003BACBCB80D62A322746457CEC672CE410C9750DF2578633C4E E083C3D0EDC0AEFBF2C42EEFEFCFA1724489BBAD1F038736708702D3F3B19496 BEB222BA91C1A1FD4E7C2F53DB600D4A6C734E1F7663CDFD978D52131BE52764 0C50C914C6E8D3929305FD463C14473D80DA63B615D9AB257F90E1F3DEDA6CFC 1A652B78C4B9C0278B5CE7C1EA852C5133BAF114BF9A5139869F6346A7F4AA02 D45EAAFD0169A8051912C267F535D1976360435A9312855C4314C68BAE344EFB C1CA47B244762575F1A4F8E897A556FC625F5884648980F11998FC307D72D625 56723B138EA113D880188DC92C6B3AAF57F68E02AD19B365EC7E86DCD5F224A1 F7BDCDC240DDA655C017ECE6B27A00AE9BB54C80095D860F203C6E36A87220D0 F280E84D7D59247D488B557B1D3F9F506FCAB2A3F9F3A6F2278D40C4DA6F88DC 9D5B062B6A6C75614647C289A51EDC269E737A61039959730F7A5211BC3F6B20 F0AF343450FF0501E79FF7193D1BDC99BE6339F2BF622BBC43890839FAA97895 3D2D61A9878E7455CC09239F560E00B5F7BC8D35736FF2A32828A58853EE0F25 42BCBA9CC7A562822F346D9F027CDD099C795B087858908313E4AF63F6014812 693F97061515DD32AFE6228292EF099420793C25BF1C89C1E58D7735A33641E5 0A9767044E1EAF9258842DD98169020EC541A5979FA1CCFE8683692B4F61810F 2DA644A382189086E3513DF149D9558D875B22BDDEBA8D9E7904AA3DE9F4803D 460A89FA7490F15D224FAF28BDC65F17EBCD1475847B64695161571FDBAC23DF EA5FBB07BCFBC95C6AF2D06F3909426EE79590FC1F047788B1F0554958ACB844 9087BD97E412CC0DD6C775B9B73037273C950F8595EABA77762DD1A3F7C2874B B7890F8A68588EB734857771CFFCD723A65188F695309EB0A199B673A64A4236 D56887C562D154C35F9E6C40805D694A581F90A2D21C126FB2AD8C5C9D66BFDB 197675679D9E92007E6C7F3FABBFAB5E4023C48D233332EEB25517478705713D 26984FE49688376F50D97E664F3BDC9C8CFC6F33B260A1186A10E419CB60F046 D8AA08EE4ECB26665FF0FBF25C35F561CB547C2477D2F757C20220A044B61AE6 B7581388B4C0E2BE075002D5F37EAD6CD060406E16D8144AEDCC876248CDF9D0 5A453CF7CC0FFAD7B2DD0F0A60A2797467DBF452429F7E4CDEDCA09437B86ED4 81283242165FF159D5006DF289AB35BB3B7DA22BF179C08D2D3833D0957432E1 0B62A46904365985D1880E72E0ACFB5921C8EB6B1E5CFD823007E4E3E096363A B89569AF79505FACC30ABE1B962DBF7CEB2E555100C85E9E39757FF161C43F5D 0167AF70DFBAB8CA2C9EB18830E25C114800287D04E4415E46CC447C0D8A3BA2 20085A95B4EC8243AD6C247CFAB5BE40E10B122671FA3AE9FF6679A539EB284F 56CF1EAB3A707A7514015C5A1DC0C134E908FE498914E2B5B3E70E05C22A2539 2B12A12F9B7A5E98EBBF9CC1CA0288FFC9F6E7F6CECB5D16ADF60BCCA75F39CD 4CA915A8C28D014F285868BAFEB14DC2875E377CA9290AD9E55E2475474C1FFA F1E6AD41FBB5AB654343C95EBF0DAED03F7E51E30F11E9C92B8BD122C19370D2 0F01135FC98896E2F32A6084BDC6D19B6D9F2965CC9322D747ECFD6BC395076E D78349AB44EFFECA0162FED4C22E6764849CCF7F3E1CA76CD8522DE4AFCE83C7 E10DB9163B9992966B542B0D66B24A77051DE993AB26573ED68A7C65417B459B 95B7BA4748FABCDF76E5DD94BBEA37C9DDABAE12F0203A137A72CC9AD046993E 1D456C9B35A3CCD8EDAD22513DD09A15C8CFEA2AE988DC5057D2B9E3520866FD 758B48E3C4F8A032190D874AE70C7F73978ED648A1FA910A2C3490520E37C11D 3C09C032848EE63455FFEB4ECD3E34B1B26F20AC358611315EB62B52FABB2482 5B097F31EB1C3FA3891BAC6F966D5C65B5D6BBE333E6EB144EC6394F59BC089D 4AC09BD678C87758B121A949C84105280831C48996BC2D1BBA6E914A1851EAC4 1BBA8BC9B48A35C263DB3D4C782D41AEF32235C54F9DC31010B8B58F6FE1B339 83580EC3231EE8389C20D5FA6B4ED5FE27460A74B19D1119BBFC275789EE03D3 E97465A773B7A0DDAA50AAC6D027F8C22B06245680FE2526D77B46CAF574A902 51269792C306804C05912658B137EC01ABF0B7E40FA8EF107A6A79C9A10826EA 408907ECB96F836647BD9B1E56E2177A0CDAA65708742F7556CD0B712825C127 B58B8823F232EF6DEF2D63A1E361EEA7F3BA4776EB8912B1E6EE7DBAA5458BFE 236C4C6C0478056A163AC067F669E74745B1874FC7891A330F3A1ADE7256A2BB 67D98D8E75CF56EAF08FC57F792377472D9AAAF3A123D2EB2DCCD7A20FA8466C CF71EBC4430B65D28EE65E96312B845E9787693333982B46D3B9C48786F08A98 C04AB97A9344C3F0C8AEA5290050DB49D5E06DFF88ADABD1D1525EDAA462E655 016658283D7C208D9D88AB9FCFBC6E29A79B44880395CF8E0A6DECEA82E9850C 80FB4DF2A47FA62FC33DC4B3A319F601DB7E8B287272546B863547A390516F65 67519E9E4695FD55B5D63F553DAA44E0486C426CDB5ED0F1FF4F0684F1F6506B B6A6835995F1141A3F330D2BDE2EC1239B6A627E8C1318CCA7A8676AADFFA27D 387E9BE50056A48A44D735EE87A2D1DFBD397E11BDE99103B42D27B1B1EEC33B 009B1778D6738173C4F4D8419F79A462D3EAFD298D69E38F01C3415080EF2F16 22F40FA87F299C50CC8B0C90905ADFCE7ED3203A17687AB7B9042667A71906D7 8354FACC48BB984F1607D15EA8DFD458E993631BF7B02801393A51BED8538ADA A10FE3DF926F1830E5CC5162CB373FFF713FA990E72CC9FFDFE00BDED55640FB DA2D50617D5C5730879149D4B24052480BE9FCBED5E29657D62238EED2D476F6 7B959F1575296133B54EB59B3A6CED34AD4894EC03EFBA097FEF94C555683821 724DDA29E682DB48E9EC490768AF64EABB3CE65957817EC8BEC118AD7F543AA4 93643ED33EC2E538EB7C99C12BAAD2BBD32072DF3AEC27E20C3A5AFAD726FA8C A88248D5D6E1587183CED75C1E083ECE3D32644F113D4F3F6B31EA99F06677C3 2B415E6C9BCF8C63D9583DAF5A65791D50CF222243EB4799EA4ED8E9D1368598 0EB19BA6020C378E16822EB3E6B3344AD1C60CF78313CA6FD6BA3CA4A06C32A0 C432D99E2018AA70F2C27CB9306818A461D0CD0E510D709DA0329514D1424E4D 90EAE74A0AE657B177D39CB8D25DB40C0D80E44C6F7368C5C8D58E52E40B32B6 1DF715B99A003EDF15DEF3ECA5823BF0CB680764F3041051A4BD47B9A3A585CF 9710555E7AB06B7E1AF413B516107F1F9225146960BC47FE8833EEFAE1FFD60F 275433E5F99E1E66C2CDB8C0A9AD73D4DD6F2198D4728C79D2D0B576337F1FDC D82194D963336381EEE8429CDE539170DBF306ACDAFA402FC679FF6C26483F18 71EC28BFABAAE5AF5B02CC0D5F48B443E34FC4049D8B60FDA93C8008A32EB86A 06326162CAD36F6FA03CBB6B7C22151A362001E3EDDB151D4E3265731A13B6C4 316357FE49B82E092D9D5B998DB0F4EB56FD7FDE30AEDB5E4C3142DAE69C4E78 E02DF10102C64DF3E83898CBE75ACFC9DBBEC9DFD794435684070FED5FE3C453 AA287F0CE3AB4BD727AFA60970FB9461D42B84A8AFE9917129630D8FAAB04304 738940F7C17D34C9FD5C16FB81B35B90B6137B31966A97EF430EA69DCCD64FDB 7FECF134B95876619B881E52B9B214F4EF7D9550077FB199887F0F8FCE846CA9 4B0978219D34FB5863A851B51F0396F8B5D8780156BAF22EF4295A004DA75A1B 03D6A06ED9ECFA62952A85AFD2F469EA1D2BD195B0A3D82C67AAB379809FAF09 F6071C93A84F0FCE964DFA281991E918863F10CE34E54D9739F4A60FD487632B 6A9063B5100ADB10692DDADD669F782C549EDFE88E0FCBAA1F7ECFBB546D3E66 97BBF89BEB0B21E73B0787135AEE68A2E5046DCF7D60D8CD49A3074DD0B27FD7 2A3217FF9859AE3824790C6FCD619D33D3DD29D5FA39967251C78DA33F92BEF5 95FD0B517D3FF1FE577BC9D1CAB77991EBDEBA4D13F971ACAC64281185933198 D4BA576AED7CA18C45F526BEA6AE0A69BC97AC9558AC98303FCD9A3F2DB321F4 190B0C8DB3A071308D76DC1D1A685E2B837FA741515C669B7085385AC2258908 0836A19AFFF4653EB39D7BADD98E67AAAD9AF1414893F4BD59B37C7FF280D9B0 1C490C9A0309B11DA796A798403AC17A8A2E8E2A8548DCAA98947170B2162FDD AF7F3F366ABC6532E01E5B8E1B8C789D395D9A28B79C532A4302B42354330A7C FF44D736DB548EFB302F258F57DFC11CB3CC409D9AE81839BAC4B554F50B11D5 832F9D1B3DEE67F7F3E07AF4B7B7B57F90A5C99EAF8B9025F7FF27BBCEC664D0 56C1144D21B4A6A59068A7294C5102E6F61C409F009742E6DADC46AC3EF89293 346272977B0EEF2C217073FF33D7A4D0B86EF71ED513F22851E65B7CED407C0B CBB4E8D436D3949E3CB113F82080791DCF73B53DABC5356CE5813111E0ED9FD0 9065B138527D96E15DC895E0599E266D7BEACAA5A990748EE7C064FD1B27499B B94F764435041897785AC1680C7FE7F8CF850AC9401E2D4DC9A1E57705137640 10CC610443B8196626FC7D4107957408D12BAA8DB6703B13B9B2DB874926B59B A3092F1167527D6FFC7533A681A0CCDEDAC9ED1E8074B8BB4F2C84FCDB23252F DCC7BE7A75E0FA85921DD1485424AD23681BC04D20816D20F5013B9DE2653C10 DAD193AF282B13641C8C60EAA314F20FEF0BE53F6798A507929357949BBD9160 FA16D88A25F307D8D259348322AD1CC58265D3A6FCC5B86CBB270865D589FFAA 50C09600A283860F6BDA891F690BEB712BD4457C850910E9F8C9292A7E515B20 5369CF41FBE135D7977FBF63A68056BB5496A77B5BD9976808E90056E959580C C47A234A3C70E78F79B9E1B9FF6336635F490AB40A7DE5950A215E815562D9BE 23B32AAA21FC0CCD7C56F8A1A24DB76DFFD21BD3D5DD6861CE1BB0ED9DF674FF 45D43561776C7CB658E85AE4D206673201192F19AD9AFF9D598ADC0C0615D673 B472F40165D2E429DFACC125737487819F713B855B9E06657C902BE6C789FE11 38C66313272D00505CDBCAC90395EF52EB9668DE094C7333A80E1D8862CF6D4F 6A4382B2441F0E5361A797CD4404D785AF984E73C780143A4F74648B67BD2874 20A908D67E0AB98B890C3A67F5EB908F454C4F6FC98A89960734B4E15EC623DF 5A97FAC5F5218136687339E3F80B808E836156618F7860A5A4D2F74E63593AD8 F5515C4A91CCAB1A69608DD0B88BC093AAF415F58612236CD08F47F0B7193A41 DCAAFE43E983AC3BE64A647A3F4FBABC9361C36D12EFE1B932265CFDEF36604E B5F0FAC820783E03C951CA0B7C7019ABFB0C6FFFFAA4AD3D95E64B20E66D5300 4E8C88E7A4557D010F9066A7D8383B479E304B39BA 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMBX9 %!PS-AdobeFont-1.1: CMBX9 1.0 %%CreationDate: 1991 Aug 20 16:36:25 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMBX9) readonly def /FamilyName (Computer Modern) readonly def /Weight (Bold) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMBX9 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 58 /colon put dup 65 /A put dup 68 /D put dup 73 /I put dup 77 /M put dup 79 /O put dup 80 /P put dup 84 /T put dup 97 /a put dup 99 /c put dup 100 /d put dup 101 /e put dup 103 /g put dup 104 /h put dup 105 /i put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 120 /x put readonly def /FontBBox{-58 -250 1195 750}readonly def /UniqueID 5000767 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5F0364CD5660F74BEE96790DE35AFA90CCF712 B1805DA88AE375A04D99598EADFC625BDC1F9C315B6CF28C9BD427F32C745C99 AEBE70DAAED49EA45AF94F081934AA47894A370D635D93B1823EC35EB8316AA1 86031FCC99F57CB21E8400E54AA474B57112F0D4754A16BEC19117E9D3638986 0777A71B135CC18E20E193AE6C2BCD89F4A27516DBD2BFE69FF9920D547796F9 89E0825B6BD5F492B36AF136EA91B826501ADB1979A4204B2CB5C0517F2B9494 9B2077F316D2B3DA256C99F7549E6BC4B04FE12072B09B4F5D482A126AE351F3 97DB85F3026A793B51E6B28B54661FEB087F011F0BFF67272DD1E8825C180723 22AE77CD6166D2605D0C0F131537417CB60086F08E7197AA916D590944BD801B DEE8F29FFC516E11396CCB8395CFEC9262E22521882DC0316B0A129DBFA5FB57 E656890C2471675E0566FE461028FB05532E274E6DF77E7D320D09B2203BBB5A 8B185B66B2F8A18A49589C4EE27596DD56260D0D759D2A12CEF7FC3010BA1B36 85A2FD45129DC01A0C7570423305C25D957DFF9215102FFF35F428C823D549E5 014E7F99ACA6C10B3C92805376D0F3F280D65852CEA54F5CC9DEF9EC1347824B 0733D3341B34937316E77E952AD9366D3B2ED045165565F07CB636385E5A5911 2620E185B105EF6C93890833054E05B6301137338A3F1D6AB2F80095E57AE60D 6E5EE2764624849978C811EC38E014AE4A5823734C5CEB2BC22DDA46BB408D00 4F25CA8ED287D35E26A4CACA77D2D4B986ED2ADD3BC0C3405741CAD56DE28C7C 68E8944967C022CC55907B3DFACC1EFAFD38D3EDDA1AADB6E2C006ECBEFAC8D7 18ED3C46C331623D8FAACC6CF9292B8F1B407806A0D4808F51A5BC97FC6C534C A507D5F9798EDA35A1E5E2A5E60F809D44A98AE7092A28625D53DC84EF86C17A 26EAB52160447380A176B52785149614ED2332BC389F036946003DB49B288BA7 FB78B876BE0C5FAB98D7BA20BDCE6CC339A815C66D8A86535176E255EB0A46EC E82B1C29AA4A14CD50D271AAD9D13E6CBB29161746F4118A05656AC9081AF1B5 3E9FF850863A6830BCFD184627E2BD0F793FDB6101A45E7594EB6A8CE6C7F9D5 CF4BCC1BBE4DF43AC344D1D7556934458D3B7F8CC1A4DB3333AE18CA46EFC6F6 8F68C7F95B10A37762CF9317613237A9E9A40C009BBD5D4C575A837992187628 53CF039C3AEEBB006834A3314174B11AFB101AEABB688911A17A2D5B6303C28C C0C9A4EDC7D90054375693D91F721ABD7E973294A10A2700516229C40843C32B 44B5CDE3677A303611333744CE37446663277305C078DE3F28F4407F9AF532D1 97C3311A1D85A0B14E05AEA23A7C3DEF3E4A8F8DF27E14BC155985A0870B4210 81E4FED11E54666A1FDA66DE0B4008FF195863866AF3147540A05870E21D49C1 2631EDE934365F0DF41EAD027A1A2E49C0328B7DBDFB1375594035074EE9BEE1 69C3B515DC5F5C2FE511E588C43E292232C8DED1F158F8303D864695ADEE844C 2AB3B0608A39622B17CC7B9792CC028F8B4A762F3DE33BC66B1AF956371A0C40 553AF1B1E2A284B88FCF0FD76C69D0D300BC26AC07D3333240032933098A9295 F9BFBD0B406FFEBD46D7883CC996630100C5ED8B2EF54682A872AF2616E97CEF 278A0F580CAD5B9C2B94420BE8527E05F967A24B79355004C7D85F2F59D3E268 2CF631B8B4B2ECE75DD7BEB6319A10D889C74FD24F897AA530C3AEE96DEDFAA5 2558656E6F8D7B1283F4EB18626D8B8BF4D0D01A067ED4F7EDEC9805A3CAE204 23AF5C369A5A8FEE3C08D0F96CC692B35E0A8CA94A824E0AB307A672C0614851 572A92B5DBE01649D1AC86080EB8991B06587ED0D00EDBEFC73DA770477C6CC0 8EB7978BE176EA46CFC79A0D592BC5F910395DF593850D9584464FB020EC232F FDD4E395399FEC47C130483DF1CEA37BCE4BADC1D68A52808EC85046C1BF333F EB94470E6679B72AB6EA426A7305AF033C597C42698686DD55657140B1D09226 6CBB7FA0E0095C5BD85275E84DA36F881B0A941E7ED32E7ED9A1B099166C9E8D 79557E78C8C4305B190B15EDC811B2BF9B82C3D4B9FDA5CEAC2F790FC3DAC73B C17CD9FE5A4911A163205FD7A860060B4BC71FF9C98CA7F28DF7F929EAF47E9F A27EB4E4D0DD4538AB83E6CC178322C84BC673A0DF825FE67A718FFD4E6DA4E6 D76FF1CCE529DA0E002B0A2B8C5118ACA66ED8CD90762A22A7B62B99B77D26CD 07E3A989C19CC243479886D92E6719E5650EE549A8EC30F9CF792F993A50F1C1 DFEA87BB305AACFE2F5C427351BFE50163A306A8E6B249ABDB921F2ED0F6B6CE BC5281D948E39ED6F7451DD8ED1330CB285917E0B8E62F38C4935C30AD4AE3F4 8B71A4AA6FB90D1EE7B3EEF1542170D58D1F41F25639613B8FB760B6856CA32C 15E25E25B3B332C24D3881F21FF4D1FF9F840338F0160FD024877EFC309CA0E2 A4E1C200FBFE7C822387FEFD0E5F61A939FE97213585E5B4388D372E3E7885D1 1F619039327334F21B73F971850501332020B5E804EF7CD304047775D78AC9B2 2584A00DF24B50FE21B4C59B08CC96E2B6EB3A4D275E715B3F0679F711EE265A 8A0F85FDBC4A811BDC66A823575EDF3EE47EE3F47AFD70D75D26C6EFA10F2E96 D1C90240BE834E2926823CFA233F84802B558C2489D86630C59AEA82A078D4DE 77D8D3C53B09F7E58353345E679CE0717C60792C7EC99023B6E8C1084C365580 488F32E01501D6C7176BF4BA65C47B4019026342CBD9287B6A6EE2621302699E BDC251CC0273CF91DA66411434EF6E5085C7D1C00ACCDAF03260D278DA318D37 49963849E3BA9CC921B9AC5AD0E28D8A06ACBF346D2F261E2D9F5F0CE18CB190 3C172650A757C3A57AB35119CB4FFD965E8DBF2E6E9ED1EBC89E92A00A41A1EC 3256CB78E4EDCB7A452DC55AD340F2D8816D4DB2C11820A2CCF5EA5F5B9DBF41 AFAE777E1EA2D1D5EBECDE9049193EAA6DF24BEAE9AAF7FB154FC0FA20902279 B71D4F03A9EDBB2759A69B5BB23678E6615AEF18DA4C379A67759634280E26EC 762078DFAA7E8467B4A87DAC6B287A1FA2A4FD143C5E6BE34B515078E8E5D431 814C0120937BB0228E8B0C29307CC4587C65149C73DF1BF56025D671916C81B2 CDA6AFF3B9ABCF2B0590CC18EAF384AEB657CA8C94604B6BEFB77C1C858C293A 2973F40C5EEBC7C84709B63F6F4C4C6DEAE877255D4A43201B8991FC56EE5974 9B5577DF4873AAC80A5CA82BE6C1DFF8131AEA0C5F6A5EA18ADD56430D895A14 AFC6961AC254A1374A8CE485F8C8CBAF3D884A87852290DB6D37A1C86706B593 76BFA5FEF3B64AD319DD89DBF970E62E3E5E949F5543252E52A556FE7F484A39 80B2F98E8A6A86D556F127621AE4DAC37D5773200A572B21C00F8B7C71DD7603 902C9A1B5C5D2BDE0F7840AD37B4EDD4E8A0EBDAB5B7036F2420D185771950C2 A4F20A6F778DE2C8087CB361E0FE479C5363CFA6D30CF7B5B2CAB4E99FE49791 66D1881500D95C630DD712BE1E3D6BE88D17A27F8ECAA90C22B1ED015AA26360 5A99B7643E278FCF64D13380502C20BC98FCF0D8680670FFA68622C4E3B71EA9 5D9316419747050F168A3FA480C5D6D3E783D0358EABE227D15F5B48B9A7376B 70026D29C61CAB55E99948807F9D3A3C358987B366ACB4C7E12CB06EE616E0F1 52FA6F23843EC98DC318CD2F83164C45DD34FE4E07B8201595D385CFD8AEBB50 559274822E649D4CD7C852B8F7D3BD583F75FFE8D2002159D86E624C06C2CB13 D4857A65F7AB69B56AF67834DEC9C7E4AD5C4460ED6CBBA1FD848595909E8CFC E6E1DFC7E8A94D1766491373ABFA3C7D1AD2D8B4995C22C59ABF44A85AE41C55 544DFD14EE1D9A85296545EC75374E5E403C1879448AA1659C69ADC488FF109D 3BA6F4EBA36DDAC7BEA0D5A3EDC2B99E2FB07DC36107673A079910D26A9569EB 3D1B72EB4F2360296271AD927BB7B462586DBB76B1203F35C4064393BBD53847 C4F6C5669B51E62B458843C52D0E106BC62930CBCFC8B3B8D69D11252C7FE773 8DB7D2026443B940B5321F346F840D82DA2374F53C3D249BF4F198C603E17F41 F5039061C9560110BAE078FBE52C050AC43CC5CC1ADD12FF6FB3A5B3C39A1759 0FE3F5D4CB7DDB4EFEA34F4FF3CCFBAFAE68247BCE8AF06B4FB729DDC6FAA5EA 302DF5D8961B109BB053913C8FB4660B04AF54A3CAEEA32B0DA349ECE54A0DA4 614930ECF12348ED9FA3955AB37D22276297942199625A990C8357ED6BD75155 D34238708CFAB3A04BCA2C5A16785A6132778E80D5774C49D73CE57EF9C0F85A CE75D64D28959E891AC0BAD4BEC57DE742271B5A6FD60CC0C1AC6111C39DE89F BFC2DB6B69730589DB65AAF0C3CD7AE64B4D44B01A1B41AEA533E7F16E8B7FDD C7F928C43F3C23A59680F16D339EF9D6ADD5858314829648B70E9112136196F5 341B142220D63C76DCB56073C69DC36F73F703368CB392E4AC871E82E06A5C7E 58A88E7C77E00E9045AE4D081767005243289D68590EAD4C8663897F3374448A 68C8CB30E11620C7545EF12363ED0E73148B072C77B0B70A431A833901AFEF93 76328642958079F04BB8ED7625E996DC659CC0FCB4BFAF5D4DE722777492972C BE4A301F8D7BF5A7518272D50C85FFAD88B1654939A3D3F1C2A4A5A44E7AD68D 63D5EAC942012027BD6A6725B80B2461DEFA66507CE0FBAA809018965AF744F3 F636D41AD9E27F911217892E326CD8E25A10ADF7B49F66D5ECADEC4CE01A0CF1 F76129EB27B9B4F3CEB5100767189927281CAECFF8B6A8449A83E96F6F63FD2C 0F8AD2BF5ABF0E73DB91B202DF122A3714E8721794A7F93675D58002EDD88EE2 65AAA084C5EA2688C354AE94B6F749E1DBA8F6A5FC066F41CBC30062E1BE939E A4CB6746BA84D0844F1D62B062489ECDED231456D68F4FC69CC83A46C104211E A2B4A3AE9FB2C989E47B9256B21D61AE3D351A87D892F9D120344DDBD3B1EDF2 D0C0D59EB29DA16D7106CFCFB23F61C688B67F922B858648E08C6218E4AE0923 E732ED94CEF097ED259FC2C1A22D34A4C9E72E4FE995083DABF15094C79D690E 6CFCC9310CDE72104C8F0A6B01CF4200C7E37EB114165C0891171AD49E6BD419 E8BE517D0ACF19432D9D39B2ECFF6C316DFD0580313DBCFD62DCE515F475082E 6AA08C58BB4564D4E91B48AAF9495CBA41ED37E10B3028108FB7BFFFBE2DD5D2 4F8812DE34D0AD7068F99D40BD770BF2EEB89AEF5BA6CDBE3A41A8D776084835 427A7CB54EF6EAFBD8669E62723D0EDADB0520FF09CD3AA3A04B232CB560292B C9EFCE036C1A2F48867CAA544FE0037367DEBBD07783EB1712DF8FF3C545883F 849EEF20A7531FAA5B7251DE22291306333DBE5E56C28A29D7FD7B02AA93A353 619AD2BA4D2FCECEBF9D6F952B70848E0AD020F36AFF513A41588966A6805930 14FFC60A6EAC378982AED4B383DE9AAAAFED7AED59CAC63787B0F644BADBBDE1 A1C5AACE5BD96510B6C6451ED453B64DD475426F9E61430236AD19F8DAE532DB F13485DA58F9CF838226FA2BE34F224745E5F4874BC41DD60E0189CB7285EE9E 2FE29C0E96559C5FBE6376BFBF38DD2DD1ADF658124048F1F8C993EFD4BFF399 B5EDDB7BF533268A4B8C27354EB8BBF07B0631CB1D67387A2D0B96EB2F9C7E90 16BF039291B8F161237E063FDB7C7BD6F001F69E33F30F6FF6454A7F397B1F61 06B00252D1DF53DE99B5ED7D3FED57EE45E73B3AB9741097F139E3B95D641E9F AF7826302498453CAAE7715455A8710000B5810F61E02496975723E8D7B1B8A7 109A333351574C246A83AA86EB95E07F0BB7318C39421232AD4706502408075A FF1338EE1F4C3DBCC62D207AC11D74C92930A9C7FB6426D4C6D3E9D2583A6865 E090213AAA56F6D4586FFAFF841286184FBC244DD507F927E63BC5B06CEA4AE3 CD49DBC29542824619C3BB899897ABF1A290AC9BBDE8D36F9C743BF39CE55F62 8B4D4F943F994F2FC8FC2A6B1ED38371036432F837185EC52EE0EADA60CB1825 D94792746F0E7B4E3C49718E0CB94D670742548697401ABA8E86B9335E163310 32269C649E83188D11A2ADEF459B65BFA63D24D9707B8299B66AD2437262EC08 58C14CD17B037097C2CB386A1921F1875A8C3DD69CF21B69ABDF36E45864E2EF 1754742066 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMR6 %!PS-AdobeFont-1.1: CMR6 1.0 %%CreationDate: 1991 Aug 20 16:39:02 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMR6) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMR6 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 49 /one put dup 50 /two put dup 53 /five put readonly def /FontBBox{-20 -250 1193 750}readonly def /UniqueID 5000789 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF4E9D2405B169CD5365D6ECED5D768D66D6C 68618B8C482B341F8CA38E9BB9BAFCFAAD9C2F3FD033B62690986ED43D9C9361 3645B82392D5CAE11A7CB49D7E2E82DCD485CBA17D1AFFF95F4224CF7ECEE45C BFB7C8C77C22A01C345078D28D3ECBF804CDC2FE5025FA0D05CCC5EFC0C4F87E CBED13DDDF8F34E404F471C6DD2E43331D73E89BBC71E7BF889F6293793FEF5A C9DD3792F032E37A364C70914843F7AA314413D022AE3238730B420A7E9D0CF5 D0E24F501451F9CDECE10AF7E14FF15C4F12F3FCA47DD9CD3C7AEA8D1551017D 23131C09ED104C052054520268A4FA3C6338BA6CF14C3DE3BAF2EA35296EE3D8 D6496277E11DFF6076FE64C8A8C3419FA774473D63223FFA41CBAE609C3D976B 93DFB4079ADC7C4EF07303F93808DDA9F651F61BCCF79555059A44CBAF84A711 6D98083CEF58230D54AD486C74C4A257FC703ACF918219D0A597A5F680B606E4 EF94ADF8BF91A5096A806DB64EC96636A98397D22A74932EB7346A9C4B5EE953 CB3C80AA634BFC28AA938C704BDA8DC4D13551CCFE2B2784BE8BF54502EBA9AF D49B79237B9C56310550BC30E9108BB06EAC755D6AA4E688EFE2A0AAB17F20FE 00CD0BFF1B9CB6BDA0FA3A29A3117388B6686657A150CE6421FD5D420F4F7FB5 B0DAA1BA19D638676E9CF159AC7325EF17B9F74E082BEF75E10A31C7011C0FFA 99B797CE549B5C45238DD0FADD6B99D233AC69282DF0D91EA2DBD08CE0083904 A6D968D5AE3BD159D01BDFF42D16111BC0A517C66B43972080D9DD4F3B9AE7FB 11B035CE715C1218B2D779761D8D7E9DEBE277531BD58F313EBD27E33BEF9DC5 50C7821A8BBC3B9FDF899D7EAA0B94493B97AFEAC503EB5ED7A7AB601E46A2CC FC2A276E7502892F26B8E36F84B72BBB5CAB7A8B977EA71F0933ED4D23381C9B 5A109609AC93B063442561EA01690617BDE9CB567BE082F1741798F7E70A03E0 A42B0AFF0F002B1873299901B06CEB5E826D174D9256368F3CD6CE1BF7E990E5 B2D2C02F150B9FB8351E964C38E19D59F3ADD001316A1D3CD06B8868A799A1B5 2C9F91F46AE11294585C3E8B848F41F08E215569D5038A934D77D94CD4693E24 C364AF9C346E7498844C19F2188F02148E9DE193486DD925344373BC133E3D77 ED74D8DA0F6D7D8F717125C4B1099CBA9AEFCBBE338A659E14E081A664B0442C ACA0D1F31F64AE067D74A6B39AE50F149DF744B3AFF5F9ED11EA05208D60F0A3 4BDE426F89BFC5B91261814321CA18028A6800D718B4FF4B0BB7D02B8341B78F 905E598F74B46EDF93E669C931C80B314BE535C319AE9CD70A8C6F406E44B394 E068DA82F0E23C31D0CA3FA31ECC9C8125ACDF704BB86272D022CD2F02AB4753 CCD3932ECF047B8F9A90568FD379A008106913630FB61FCD2B187BDC21FFCD5B A4794DC66E7BC1F1277F0CBB15C49EE4861B1E9A942E8F7741CD8E8866246118 0C9635FF7F9D3E133E051A40BC26B59594461B1D21665BFE0C543DBC68BBF25C 737C1707C7387E6FB45AFFFAD85E1D2288904405AF2D826807B055FA43C63B90 96DC65820347B7AB6FCACB4BF45ADA91896752C522B09B4C95D7EB3F10CD7F9B 2CD2167FFBE8982F021F58F2399B06FFE5694EEEB7BFF5BC4377DBAEF2FCCCC7 3613153962E03368AC5DDC4E9081B6CEBB777A186B276E0D4DDBA68EBF32E553 9951B31EA21342B0D27661E4DA08917F8B36D4B3E2CF376891DB6440855EDF06 A1BBF28086B6E76BECFB113D4326E0ED37 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMSY9 %!PS-AdobeFont-1.1: CMSY9 1.0 %%CreationDate: 1991 Aug 15 07:22:27 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMSY9) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.035 def /isFixedPitch false def end readonly def /FontName /CMSY9 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 0 /minus put dup 1 /periodcentered put dup 10 /circlemultiply put dup 12 /circledot put dup 20 /lessequal put dup 21 /greaterequal put dup 50 /element put dup 54 /negationslash put dup 56 /universal put dup 91 /union put dup 102 /braceleft put dup 103 /braceright put dup 106 /bar put readonly def /FontBBox{-30 -958 1146 777}readonly def /UniqueID 5000819 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A 221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A 27D1663E0B62F461F6E40A5D6676D0037D33F24E2FAC2B0009AD3C8350CDF8CC 65BCA87979C36D14CB552E9A985E48BE4E88ECA16DF418749AF04FDD2B0E1380 D281BB2476BB45FF30946B247DFD7F57305FA87E50CA338121C71CDFDF927A9C 77FF14CB4A1D6D80356FB1171ED38C37702350497B44E42CE31DB2F493807DAA 15B887C671199A54C4C1294BC520F5538C15556BC43C9F62342B121C6DCD6C5F 491DA47FF360201EE21C08A781ED0589A6DF91B99FE118B9B29E4F068672E52F 1A06C514D91C4C937D4E642503392B1CD1BDEA5DCAE1267AFDC3E93796BCAD88 E05E54927AC165AE7D5964D8E2688F4605DC76356948D67A39DB7AE83EFAB826 E58A074B03C8E54C343F6B6A57E05D5B751A9BFF4863CE7A7D3CA344FA072CAF 2FEABAB99CC8D58CE1F4A9B1964327B38C3ACB2C5574E0364CB370A41F2E900F 177E6B0160487ED8D4A9430C7FDDBE2D4836FBF9D151682A5B589D783ADE0962 E7EE538B1DD43652170EFB0EEA247004006FCDE4D2642727446B325564C638D9 08980199BE16A3E7CF174EC37A0BE82B35DB89349509502E142D8C439E0C952D 7B60F487E20D7D6EABA1A49497AC9637E8BCD60F4F1C98ACD1ED628CCF8AF088 CF643019D3DB81E33EB4EF2E7B09BD7D1373925B3C8B15BBADCC0478A62A13C2 463F6BBE4D9E879CC1201BC169DC9B7034EAFC5727F3960B51F4F241DB374683 2E517462B76E33761F4E27566C6F9EA4EABFBEC66DB981A001F19EFF26A508D1 E2335FFA102C0F2730AE8FDC31367D947190A92A7116B2A05BDA8EB4C55E3D82 E76A3A9AC55063B5188D449796675FF659B1F7E5BEE9768EDEF3D2E7003AB61A 9F6F4DFF9DA8239EF8D771CC96979BFDEE4DC28B1D7F7EA39A5F28C8DBD18C1E C856C6AA1A6186033E3AA1BAB304462AE6D6BFA60603CDECAEEA340A2DE83C26 2893F60BC2E5312D85B873ED14B958CCD86FFD68A1B5A20B09FC010CCE4EF433 99F39BE4117FF3970448E3B805F9032DE18EAA9707B18E8C7B2E5792EDA2B3C9 CB956A3208CCEB66FE2DE69C1D4F3666FCE07188C18459953DFBED3FED4F7DE8 4CBE80B7AB6CFB2A1D7440296E258DFDBB1509E360D8C363ADA7010304F771DF AF28556231E9491FE840F69BE8C8815527E9953D32CE4A7CEDB41A79EAB3FC50 EF67D914C6F485EF9F917A804A007B1618B5F53917D50A8988CA7EDE021582F7 70D501B9E0E882165288BC0245114038D02CE5DF34A2A2B799154583F170479E B0211657E895F55975CE584F8BD6410941BA404A14B59CED5C0AE1C4EDF71A31 91999B9B84E732ACDACBDF0C5533280C5A1B3C6A7AFA6823A5953A75D35B5181 EE6804B0BB0D1400A671CCF33EC6411E7BD32E5085CBE414DB2A29A1E1E704C6 F3AECCD9B104CA57900CD993DFD1CE2902908EB205ED5F91E0AD69EED664B69B ABF4E2E690B3FF0D3EE0AE4499A1592181585CC12639F0B0878A1F966693488B A646CAECB63279576B9587E4BD54997ADED3046347C65E6C39B85C0FFF06EBB6 FFA5A377C419FBDDFCA200A1AC1C75BCB946601B49C56A0DA12B2E59904C8058 807E8519CE0DE7B2DD13C7AE2407F2009D5F71DF25B1E7BFE58E966DD8EB4571 AAD09228D0D58DD80E1EBF0421623CFEFFE3D9C48163708AD29B034845D3B6EA 89AB289D5CB7E33A8EE5553F65152D1C16E5C7D5B30089D4C1E44D4D213A16B7 E0ED38BF251C10B00940CA485619F26196F4F6A6FEDD8E90885EB70242081F80 D50BFB3D9D82C4653A056A4DB44FA66EC9132097C817A355E6478286C72E8A2F E03D47294233EB53FD7C3322BFEBF287D6E793C16FEE6F77B1809520C465AAF6 11EBE9D2961B6617686A07F82860F197BFF3A2941F583684FDDF82A3DF89AD89 9139B0D9633B6E0CA83C8EF155C8DCEC0F4AE1BF1163D1B590422F910868BD06 537910878B623E15DD9D1FC40A87AECC6EDA393AF10B1A4888FBBD0349B0A701 5671B26489E303692D33298C742A99996639E1ED4D07FE38C3521EBE136478C0 509B5B23909AE79C46A69D5970D354E43AE5DBA6F837914296DDAF853C9B225A 569B6194EE91E9C6B8833293A39358152CB838AC1685BB2DA38622DE2C9116E9 B2407D8F889C4352A48D157E4962BD9F5DD5C83BC70AFE267993CBADC97142DD A755D5349D83F565CCA12B5A2A8DB0D05C3A74C17BBE2E1FC3322B338A295191 19BC047678AD6372AA71B2FAE68D872461B40FD088C356F2977EC6C751554D11 7B5FE262360E01219FDF297D6B79DE2338BED7C7702FC614DB280E38C52D3B0D DE4EC55087332BF57F95E6CB6C1F756625108844B1D0656A95DE19F97DF6BF06 1A3AFBC10E45130E95CCC6526FD4DCD8EE3754F69CC7959DB2E89155E41D6774 7051FB85FFD79B57CED1C8913BB049C02D78549FB3C25EC8507E7698966B7ACF 9C08BB940F6F6F0A79EEFE1EFF5F21E5451366BF210332D4984CF535914770D2 28F00EFCD2F1F14B30DECAEBD47F93D1C4F888151EBE76F8760F384659FEE0EA F2FA7759D751D9D438CFA651E50642DA256AEEFE3B367F31F2AF68F7676A91E6 B316C07914C4596746E78E854B5787D627686BAABD62432EB72577968519A070 4177F1E4535447AAE75283E98233226FCC149AD330685FAE814B59ECB616F00D B171D7DEFADB15FA7D8019860881E280B1707202BD9553F32A1799FEDAB9388E D6C290674F83C521B370290AE4A81146190BA6BDA3D5FCCEFF313EC419029493 E1002F9A2BE3610B4C0392A8EFF798C5A484E3412772686B4FD8FA611CA81FE9 6E79589EA7170DC15E023B1A2CD98D62D2E0A390CFB1A0DE1E08F44FACB40738 A0CD72D214EAEB015A2F870CB680B1BBB53DB17DD7B9919A5676DC9C203B96E9 A75EB04ED894A10532EDF8D6E98E5CD03204D2F4FE4CCCB6AF51F84FD36F87FB AEF238995E5F2CA06C5159963B5723B056113BEA98101B5C823B98EA3D2B7FD2 383798DA3283D6EF1878047B90B5CD755417 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMR9 %!PS-AdobeFont-1.1: CMR9 1.0 %%CreationDate: 1991 Aug 20 16:39:59 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMR9) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMR9 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 40 /parenleft put dup 41 /parenright put dup 43 /plus put dup 45 /hyphen put dup 46 /period put dup 48 /zero put dup 49 /one put dup 50 /two put dup 51 /three put dup 52 /four put dup 53 /five put dup 54 /six put dup 55 /seven put dup 56 /eight put dup 57 /nine put dup 58 /colon put dup 61 /equal put dup 65 /A put dup 66 /B put dup 68 /D put dup 69 /E put dup 72 /H put dup 76 /L put dup 77 /M put dup 80 /P put dup 81 /Q put dup 84 /T put dup 97 /a put dup 98 /b put dup 99 /c put dup 100 /d put dup 101 /e put dup 103 /g put dup 104 /h put dup 105 /i put dup 106 /j put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 118 /v put dup 119 /w put dup 120 /x put dup 121 /y put dup 122 /z put readonly def /FontBBox{-39 -250 1036 750}readonly def /UniqueID 5000792 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4 87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0 92A36FADB679CF58BAFDD3E51DFDD314B91A605515D729EE20C42505FD4E0835 3C9D365B14C003BC6DD352F0228A8C161F172D2551CD1C67CD0B1B21DED53203 046FAFF9B1129167921DD82C5964F9DDDFE0D2686875BD075FC81831A941F20E C5CD90040A092E559F6D1D3B0E9BB71733595AE0EA6093F986377A96060BF12A A1B525CD9FA741FE051DD54A32BECD55A868DD63119A4370F8322CCBEC889BC2 A723CB4015FC4AA90AE873EA14DE13382CA9CF0D8DFB65F0ABEDFD9A64BB3F4D 731E2E1C9A1789228FF44116230A70C339C9819676022AB31B5C9C589AE9094B 09882051AD4637C1710D93E8DD117B4E7B478493B91EA6306FDB3FA6D738AAB1 49FBB21A00AC2A999C21445DE3177F21D8B6AAB33869C882613EA6B5EC56476B 5634181ECBF03BFEDB57F079EACE3B334F6F384BDF9D70AEBD592C8ECF21378B 54A8B5DBF7CB9282E16AA517E14843909339B5E7C55B038BF3BB493F3B884A1C C25F9E8FB912CBE23199AD9D2C3E573727701BA301526C66C3617B9514D6F11F 11930B1D97C17816C85B1BFD9B973A191B33CC3B391815AD14F1CBE935942AEC D4004E6BEF379066FD72209DC88D2E634E79BCC2B98C766CBD92C561F2703F8A 109E6C6CEC7B866F2FC7ADF646BF492E520319F3B949AB5D84AE990B33344A40 3971F58DFDF8D8D67FA0B8F2A0D884F8C09A5A721319B911DBA0A35903877343 C37BC36C5EB32353272D1E6ED5FCA611BE319A7E1E842CB7576E7B1CC7164603 217D560459B79D0A32D54DEF437F84BEB1CC0E2F0BD681BBEFE2C40FF0C09B96 8163E733C3A1610DE8683EBA7A2217DE3AC3BB5AE3E0605F6AAE206BA7951EB4 62C07B287A178FF625A397D414E5012C1B50B807464D48B5B7D718BED40827A0 032659FF79B78181E8296F825A97182103FD15711FBCEB106A74139336214197 45EB6BCB8EBC7537606EA80ADD7277AF7724ACC583BBC88E9847C62813AFA460 33F543CDC30AD8B739600748D151701536C1A6CE2DF9FA9EB15F76F3B086B5C1 C163ABCC50C55C4C9A1737784ECCECE443B95AFC22A92EC049348A0F5F8D54BE 919F818667509C857820DEA50A751F617754E156C3BE5B192A803DAAB8216636 0BA0645FBB44CF9186F3BC46D552C6E669240F5C60429938B5A16BC6C7FF315E E4C1CAC665D9D900F37783115A9427D1F74B20977D5469553E38C0C31415BF1E F7D31485DDA777F881B8ED8AC875E19115E08B41E107F49A9A304F325BE464C8 5D1C57B5306B4435152A5225983D4A682BDFDAF2B8471795959E92C22BCF2B61 F846A7195971090440C11EA9E5BAECA2B7D813FC2945806B6943CADF1FFF7427 64E68DF16F803F783AB2F8345944551F351706783CB0EACE50B2E76269E0EC73 72831E62C1F93DC300F52730E968498B5E285FF5FDE0A79E316FEE566287EF43 950290208D74CCFBE80569C24A5CD23C35FB77A5A75FE2765A6B386EE543E6F4 B2232FCB22E32C81D4C779751E30097DB1DE159E8E0F235FDA453006F42FE9FC 8524D8A7AA6EFDBDC03E369B620B415F08863C8D7B0E097533F51C3EFDD1CB4D 785C9CD00EA85B8FAC4B4F4266052CD9BB6B0B89102AFA1D5D7D2981935DE63B D366F6E9FCEA14D89DB5AFDF6C668E33FC80D8A8CD5DE2810224BE4A267E4EC9 9FCFC8DFE3979516359780163D510F02AC7923FC64D60E4F6CD48EFF5B3CAFD6 69A539F2C37C15A994B519D202273D3D4D03D307A2928A60E7287978A3042D1A 53789367A6C6E3113C1286A446E650D0E77840A700B684D19CE99A1A1ACC6053 8BA90F18E406B93A874CC4F5BE239929A918C294BFFD33B0EC2E27C7073259DB 735FE2960587632E7D62E1B53B9ADDDA66CCFC236B8CD69AA718B2C0BF1EAD53 F67C599308E0A18E537B372FC928A336BA517CA7771ED8362C303B71E44755CE CBE71C0C69F776E9BBE2CDA567E0B1523492558E3D65D1F9026CCBCBF5F96DAF 106390054AA045A38BBC36F08939BA3733D8A48D7A47608C1020F88C74652594 F9889FE516978F9FF7D24EF971016D49E036DE117C5A617601BEBDCAAED31A01 2C6CE9B59570B6580DCAD208E76D19DE0CB2116124F008BDA75B4EB093351F3E 9F6AAE0634ED5F6EAA82E2FF81E2EBC351938270326BE483052C44B8D6FF5D98 8B34A58DADF0C7CE9891AAFD1324395A5050B141EA311567FCA951F6DCED07F9 BF55BDDE8D743C89A3828DA1771E0DD52A1521CFAFA13E46C1927A617E4F6777 7B64FA4D69A56DBA6D73D63D6B07E2B3D140E609240DA2B5D76A8F2DB24E6E8B B8639E63FCD30C8F4B9184DD4E495DD5068AD50BF6EC17AF595B091981D2A92B 64CD51FE4A7A95EF28E167BFD175D9D5E0DF382ECA827FBBB11F44895D3CF86C D9767CDFDC640933080C759A1B755EB6DF1E896C0438AEDE5D90E1C1646AE9AB 11E777FB5149BC5ADD8911D2AE13C713E013F340B595ECAEE58E97118A9F3123 803908CEAF1F64E9F9EBBA45F446632475C02F0E44D1BF4E1645092F70BBBBA7 63B440458926CD62BE2CEB108B1957CAEFD597EFBE974099259DE87CB19BF96A 8FD776E8F0FAD8D73671E3747926602A535052C07A890BEDCD4D8F5CD282E3DB CB9F380121E6E7EFFFABFE084EDFE5C5682835DE2B6E29212B64663B7F4C7DCF 830E0B15B200F1ECA79BC90441FEE114A667EAFBC0A500708665B3850A923179 F39088CC9640AF9718FB021CA41EE82DBD68940DFC22A61823D86984C9BF0CFF 157B2330E9F418959C1EB9E2874F792638EE7DD0C9B73C3EAD83A90FDB7AB510 195F8389A16FB91EF3B81CA1038A6749DA105EFE7B15F19623D3EABC8F3FFD3F 802A1F858B5A6FDC8443DD1B22DCE52210EA386A0A221FD18090B547D11B9178 119897BFADD16E7F8C1978FEEA7712B6AA1A7EAD4735FF77D7A32B12D0F55FA1 79946422037130BC26B0C3EA8098D4F142407471E19DA034873A9DAEA88F61A0 5CE576FFE9B0B683E9D3BD705E245EBF866575B8FF388BDBD13424028529D87E 6AF66F3E1590ED09FA13D7FFA4ED0AA06257F53AE621A215FD8D00C295BEF5CE 3EFEE73547EA45D9B7BD1DD0FC19969A475678BBC26A25E54ABE024DA46E8449 1D479DD0E8660F45AFEC830D470EE51D9B4A12EF2056F81A1A213EA742EBBD09 9895E88B5FA1B6E2617EA849E461AEA67F223CCAA788A838EC4C9CB17F0EDA46 DE1C578F6330EBDF9E2BE9B6C863FC337F902FF9E34FD0E7C12B771347E390C1 24B2CF52F66A8DA4B92433161A1ADECAD9D9BF564D089EF12F48FF7055697E48 7B52739BAE87E5C6EAAA68F3EED6033320968E128982839464813AB63C128AC0 1DB415EFDBF3833A6792BE2E2C2C735EF580412ED9ADAAB63373CD52AFB34DBD E6441216F168BF6B0E39F5FEC55022E08FC362019B6E3ACB6331082A80A04FF9 B4B3228C61E54E69C5A626CD083C66F9442B7BC86884308E27A638466010AB6E 00738B77E1679FB4CD4B83D2BDD7638F27F48ACD9A07E04B0981F9FA576AF602 DDDFDD7E483AA73F1994BC693C5C013E7BBA45CA6BC868549A179817DC8FC820 E45AE91AEE43C421C29C362E65DD6999ECA799A669F76D7C1C0051DCA72969EB 6890757DA3F2622992AC6F8CCAB1ABDB06E67D8D1286D2F79165E9208378E236 7BA2DAED0C05669D297B93FADD5BEF8F15313646053504B6DD4FD402A58D1494 93E4E3DB0402D8128386ED2E39A96694826CBAAAC4835275156172E26D43C2D6 BEE697716972C2528CEC63703D4EB248A588F2E96304E5B2B3C34CA938B1D859 A35D337F0CCA1AAA22227B474374C8C9689811BBC3B807BE8CE98D24000D779D A54F82FFF81AE9AA49AD6566D5689E19B7B365EAD99465100FBE169B6CA5E9E0 237DC0E7F6EE059A73835F5C2D1CA614C557002DCC762DE9B00A7E57A4139938 BC9DCCE64EA709E1CBD50B8D73660C51CCE490280ADE65974EC4E1752131E5F2 15AAA9BC965C1DB2DAD3A4F5559692D81BA7ED06DE1C532120F73184DD186C08 43C5337F325F3AA654685A8D7EB81F9B49E2019523C6BE7BC54DA82CC72C467B DF7A9D726DCF51AFB2671F2F6F5F04E523EDB8375B8BF2D54ADBC4F912E63CE9 EF20A59BAF8DCE92C9D1F4DDBC1F551CB2D396AE2024237BCECF4B9015A8ED99 43E26CD1DFE4643691BA745B4C3ED21A26F192081E73A68943B425F3822B212E 7CCF997D0AE5C1E04FB6DB5DF38496090F540220CBFE7D30DEE4FA797390FBCB 3527DD6AC854EAB43B065076DEBB8CF1D29078D0504ACFA77E1662DA30AA5536 6CFCEC665E844D3F3464F1BE7093557973417A0D0FA67FE14DD8301E3D66CF07 D265EC58EACC57DB8B20B6415186B81A6DAC4D5653CC64BE4C155F5B90A5CF38 E894C9695DAA1D377B137CA8CA495F2E4069B011924DBD862443E88888BA4D88 8BFA9AC08BFFFFD60BF14E069188E4E9E037E48A986EE8685105B3350DB39A18 E39ABB7137A9B8ACBA741F6626261832E62446DFBB5B7F14627E864CB64670DE D9166535320386332415F50D100AE16F38F5DDCA4FC7A23F735D4BFB7B353D5D E8114F3CE8E94C4080073F1A6E1E19FC653C0F4D63BF1812C3448546455EE81B 9BB435C00015EDC9F250CD61FEC4AF6E5AF2DD74FD1DB55C2B774A5257E96A5C 1A1F79955A0D2D5977F24B53D67768BE9895F40ADBBDC606108DDB95309A01B7 F9B121D7DD0836698B370227E9C4F0DE11F7A3D34AB29B5BA9C4C43543A61DE3 4E305DF9D6BFBB83725F5229F1A41773978D0ED63A68E8101E86761C5892D5BF DC3D61D24E117004D1747A1C799FB6C9901E5539FA8FC090448E8F13FBFEEEF2 FDC0360F71386D897560B8E4DD35A1A86814E392DED405599B006C594A71CFF5 47889A0D2DE35621E922BEAFA349193070A81E25CEC88D7C522C1237E156B3FE 8489469EEF467849A45ABE9174781DE869DA6FE7C8157F43D261A4F2F400CCF0 2325C5C8127D711BDFF04817962B707195FBD4A30E73AD3458E0E52356859887 C6643E92C6CE9B60A3AFAB6EC455BDB943CCB9807ECCB55409F57C5C8C24127F A336801920CFD5BC5C505E8D70A5D33375B4E2C15EDB247385257BFA9E834387 85A3D83DEDDD3923F7BDDC7E41AC1C2241C7730C8C2F75471198884270039CBB 5EF2195808FD4A025774D274249AA236F67242A463D47730C6B740340583AE17 76EAD3B8B6DF0BD3880705CFF86F3C00448361F4781F8287A384C1FD9CD7B6FD 5FD32A235FFF20C246E36FF0E866361F56738A812E2538A1C0902CEFB97306E4 95BC31BE7AB8D9C7FF349D01B6E63EC8DE569D9EA310831BA03C8516FA49AC4B 563FB7FCCC7F563EC195B4D1775220DC36A97BBC27747F0E61ED8D7A35A67ECB 0E5BEFB489006426559B5464B41C5955AB25CAFE7858042627E614F29F306FE3 81F9301D3085EDE8F167DF1F48AE998AAFB922F62AAFD78FCEF471621CAB120F F57943760D9F2B0EBE8B83774E3D4196EC66E2846F69B1AD8DCA443F7167CA17 77428ED45D9F898BC315A12089A4B23FB9FD844B1DE28A21E90E5AE9702693BA 9687FA6FCD0A57DB646E069D06748B66C68E5B9721D93F73B174824EF9F7DE59 124A1092C0431F3C5622E2A3470856218013A76D46B6E40402D79E204B83FE63 141C93781E96A28E1B3B5D8192B18D3EF21904A35A1063EFA021BC6AB5EB137D 0AC2A7D573B7D6145FB551478A481C0062CD80964E9262AD9A29F4B7B8BD94DE 8B5420A2D4F793D6F83A4AFF31B45A53BCD8D08B4ED2DD5DBD7449BC9ED216A5 FF84DA90441FA7D8B8099C27BA026394566D4E0CF5AADB0E34001392C38DB307 2D48860175525347ACFA7BAF0C14B1642071195599E9A638903F2FCD01E4514A 00C0D72CEB29E3D9621415D1475B0680B5804DA5CAD2620FA16C0BB8C8653347 20117E50D213EDBE1A65B9F11A49C9C81F1F43FA49F55CEB41C0C76B334155D4 EF904CD54D96B9ADEE62D4FF97A18F7EA18EDE915425E26CD2814AFAE8EDC23B AC42CDF5A6962CC32E9F470B38E340E975BDC1A79464ECFE419BC4DA2FBA02A6 F0F3AA5E6D91988F714F41F527F5CA0444F6734C75F34BC76D2FB9B03071E5AB 652A06498CC3B8F5C2DF6D85858859AA7CB5E387AC5788B9CF40FA141A8DBC24 D529F298E2246DEB3524AB3ABB159C352CCB91BCB4074F6CEC3E38B01D3F9A15 6C73CDD39CD2E10B6CD890F24C5C0E5DC2ED326D8DDCD5DA61F772888C948A3F 3E57F8B03A7BAFC1F917DC127445CE95D0B1E6FD74E70AAED640C828F025329E 42A939ECD5B79931C6FF1283153FEDC3B1596956BFAADA746EF0440C82667E28 E3A1B159757DA489E98BD1999AC1AB15EBFA53A462D2D28A5FCA136F381BE3CD 32A46A861072B85A4665E36C97FE6C4511DD18870239A705A189E099C54363DF 5F16B1A14C51CCDEAEB556C23ED777219DAFA2E40599F292631B50CFC6DA9E0B 70841C913E65777874BB031A18A39CCFE803FAB60B06D7C59CE272398F71FCEE 67158CFED127166E3BA57932EB4E2123F21743DF2928595C2D413EE626243D7E 4B737EA47F42D0BDE3349BBA42ACA960B5A0450832B6C5305BFEFDE71EB8E995 8CA70DF3F0AC06D6684CDDFC78CF3BB6534A190A7E9F3FAC66E983890117C037 156F851216CB9C148F82BC86F00DF8CD8F65838BBEF8A01FFC0255B10BF2A357 F45D1A2AD86E2155119A0FA99A20792AF42F8079D652CFB59C886677F645A48F 960DD0E6524058E2EC2709AE32B2C6F0C4A0532B6FA1DE3FF7CB775580438E75 47A8769CC89E03B0DB665B0A3F734A4EFFF7E86C56E69C8D4FABD700A99A897B B602ACC4EB2D0926633C7FE22FB6D9CD2048E5F20857A5AC8EC4E2BB247C931B 952D2B1857FE3790811AC9D3D8B37D84BF2DDFDB423F1768D37BDE43C4F25D57 D9214518D4E698199AC73B31C35BC0949A351008A01253F0709881CE79945014 E3CAAA52BB80687F56279577FE0D9E78ECF24E585C0D180B18627D88CA5D0A68 580DEAF1D11C4BF8C3AFBCA4348E3F34CDAC38A7EE27D4438C9B3C38BA1D00F7 AC3063B92C35E43B50BED0B28902044504595C723D9ADFA098A701C161663621 5768A5B652A9EE20840DFF63B2ABE7AB25DFC81DCB123DEA6E399D6FD2B92E26 5180D115E7C870FFC7B6E300DDC83FFE4AF92563298A9D7D7542775CAD3C228B 869D57F27616E1B6302AEEACBD5012DF5981869EFA87E641DFC0F8D6B099E5D0 CCFE5F2D7C6B89034851738E038567BE00F17DF107BAC43E33F06BFE49FFD103 6B4BB06EB514A391F4FBC81F99A783F2138C2D77479D71CA312FEF7902D7729C 8BA79CA1D7257381FD11AC69BF265482E261BDBD57626132032C6D3B9FA38B70 BE9214F47C9309B06EF5F2E839E7DD05EECA7E798B9F691F1F3F5443EAD1B4AD D60DF3925C3934BE165B04F6F48F4ADB9FB855E208CC2B6800957037D233E4FA 6EDF1F4F1E940CC72948F2E0ADAE7E5AD03A376A190AA8CC4896CE03086608B3 188DE90D97FF61BD33C0A7416A2C30268290901E587D3E47ED9C3BF10FACF12E 3F90B576D1CA4AC5D37ED407E3F59D1DB031647EB8E10822DB9FC74A21D197BC 9E03B03E340C8E1EDCF9A3B6C31B8A2468FC3E50B41A60FF8B911485AEF915B8 39B2EF589150BACDF8C316ED1F0C819F85916D2BEE62E85D7A8332AD744CAC1A 5A9F7672F6C35551AD75AFA359FD8BC2710D4363697BA9748FDAFF553458284D B075B1E84880D599566C954D70132C5DF8A3795BDDE2A2F610D35AB412E9FAE6 8CC028BE0BF6D76F8CA2F716E01A30493C4FFDFCCD0FBEA007FB0B7C7CBFAE0C 5B18C12304B2C601FADDD04CA3BBDA2061E5A5D22C2BE8BF52F68685BC9662C8 534DF20E41CAC191764EF9606DAC48EB23DFCB4B94C7B2DFC73CBEA077841574 E968DA1AD122E422ADCD36441B7E5D73F5481C92CBDFA6578130C176B68ED67C C4CF72A03EC56FDF8358744D043F121587582F56DF1CD32697578FCCF550FCB9 466AFDF197A0EC02118FB1395796AA2C06111426BD4354452BDA743B9E344945 6FFC996565B34C84C18B64F2829636D1E03944D8D491AC59CF7FF1EFDCD5B1D6 E62BDED3029B5BD8E620ADE4FC3BE637015FA467302DD13989B3D28C451ED27E 8562B0EB9DF227D20E2924E21F6FA85533D4912E3D8FBD89741D190A30E13D8F 0492DEF5883A2F1E0F5CA9E202F2BD27BFF0FEC2D80631244DD570C164736DC1 5CA7396AD854B6AD42B9E87C64C1643534B208BFF8C92159B779D27764AA0927 0C0B8E87254934B8CCD6C6B913AFDEA9BDB4870D4F885DB3CF7BCFF2E6D3006D 6751A5A86F8D621E87A787020009E8A1F621B658B99CEFF3013DD6EEC6BFCDF3 AF78B4359724A4196B7DA7FDC30541020248CD3D90B1322873C816E605C28AA3 7BD99395AD3FA38E937F41A7AF60D36580396383A5D751447C584C60D4849B88 A5CB455C29A28924FED216D0D9D4269624F1752EE2B5AF19FC8CB547B45EBD12 906B7D7AB190E26762C3C1BDB16046EA63A8281830ADD168DB11123CBCCB9B48 1F8B185230793E9BE0193B0DFF570247D902E64E4F74F3B452A1995C72805773 C1FB524B12072F48D49BDB3E57934E77BFD2D3B4E5C4A0CD73F2D5978A1D3EAB 077DD44FD7EED95DB7245B222D27FB095AA19605E08B4A4930201B09439F1490 DC08D3704C3E8032F3AB9DD8456184C38C9DD34B42F5524300AFF7B6E412DD1B 98A57A370DCE592C97881A07FBD82A263C90C016BBD612327C14238E4C76F891 86F5453928D9027B4C2E5EBFAB54CE630F754D1D294E61CAF7276D02F0EBDBE7 DBE5020122266095CD52EEC926E5A58BB217E834A1ED6BA8DA1AE182E935E4D2 9BD64DC4076F8D0CFAEA354F31684D2F2EFB6532AE9173A9B1C2D57AABF2EDA6 C97C951FE83DB3CCF7DAF2ED38354B2EA88315C328DFB866471F76DF0438400E 2096414EF36E72B64D561F96207E6230A715A700401854C9244C0C8B98DCFC6B A057A8C07D8A1795CC1AAE2643728524580691754D3BBEFE592DF47AB58188FA 2C79F35D8860F0158A62B1CF66BA47D5C8DC540246D1DCAA3C349AFC75DB0470 C06766E644C4451BB6872748749486BA879CF251A5EED7AFE545FE3927ADC85B B457ACB9F82CD357E89A542238243165414FB795827DDE58A33946EDDB50F254 FD47180ACF2B25B3228A62621E5418FC8D81523934863DA1043A4C414898E6DD 8C534837C0F581A2BE75E4B0086DB30A8B652C1F97D5E378A824E8292683B31D 46783D2AEE13EFD8A090DFFFB5C738B46C50D845F769745BA824B7668C93129B 20063D6F30F6D1466A6FC35A98406F3BC77AF05E1FA11FD7113AAE7BC186CCE2 2BD35A6B2BCA17930678F4B87B23796ECF9809C20CEE71179AB67E5EF8751DE0 9CE280A22DD4B0463AB2305C871F821AF05F750FD0FB1968FFB06D1331C2479F 0D127D1F89BF2204950A58F035E2DBC8647B74B408559FD1A408E3A58F12DD1C 2C1A138D29889F56E45EEAFF34EFCCBDE9C2D55F61F020ACBC13F2E682E12DB9 6B4873EA8F8503CAB6FA582F813D023F3B8C9EEB11013B084CB53E30C3C2D419 274BE54D34D0D20D87A4FF0BD7E425040A8E4B879FF15CA922CAA073A2D04609 644B935BBC5AE9817052BD2B2CE21FF5C74132A2776F3AC813198C48E3D4BD88 8AC41AC8068C154689633BA161A06752F4198C7B72EDA0129690A7001E41E2C7 EEBCB6BF54D05191F7ED0E01BEC849A6255E5A8F6BC7CA4904093C4A33E8AC47 A85ED688B00DDC5AE98AED1D67818A7BF606495BABF4A04AE1ACDE4331A9FAAA F01E9B39C9BF1951506160B9B1D9FE3DEFEE64A8E6557FFBF9E229623A8FEBB1 17119DE3367D331060DCCFEC1EFD317979100BCA3E40C0AE234779B1DB6F1770 D574AD033CF12FA6E5A95B4B9314A4C72CD31621B986654AF7BBE56AC8EB0F92 1DE45121E1559497E0CB65AA03FEE6ABAB87C4FEDAD5B2B35735AF0A105C605F A0E11B31B14FCF77FA3AC35332DFAF2F35E2B85ED77E2902FFE4F1DE3288352A D17E313AFB65A5A2DE586D299BCA0144436D33A04FFCDCC02F4B037A5A7015B9 0C9121ECA326A3C4C5A42D0B59916C2FA5172668427B1587279A7F1C3B098C60 1B5BCC5C0050939978DBD3DFF19A2368C9DD1133C2837BADBA0361D54B26438E E3E3D1AC3E0260C33BF255FB268D21A14E599F27FEC7E5AB7AF79733B5023AAF 7C9D1672CA5460272ECEAF131B427C0EE09A228029E5DCD0E1BE9D5E7B2AA568 81AC70D8CECBEABF4085E0CF2D0A75FD9984E1FDB1C48F09B9C91978233C3010 59CDEA05D217D83DAD0C6A748D421B093D8383CC30E579CDA9E5D950B8AA51F2 3095A5B6515FD9E7024C90A3778E2FB16199672B980CEEC82968FC5C48C032F4 B3CF9027678816C3E9A39AFD00B2F8BB6DC06279E975EFDAA2F7437FC5A7F422 0ACD050D0572B4F33195C2C7D52009F684E572D1260D15FDE468917E8C0C04EC EE8E4F4ED05DBE88D813F9EF7C93C5E42230DA922C4BB7E11626D34D1DFBF939 6DB6C5D86FCE205BFB376D0B3AFB0261E0540357941B7A0D2AF6AAB401EF12A7 5473437279C35F84B807DF8C8DDD7D296473699003691186C2889ED9FB5C1DD0 464765E909FE915CEA17E0739D18308AFF4EA32B868E808F6FA9A1EDAA21BC2F E81C617C16666932058A5785A4D343F0E8AA715A16D8ADEA680E365040B96576 FD900E279903980DDD828C15F7261319BD01B2055B6C0068258EDDD48C66A9C2 5E26AD90EEFFEC19C770B7D4E9280C256F2B7FA5C13D59787146E440F2746E16 3EAF2A529BC73B78E2C845692A1EF7CE8D0529D7120D778C811CAFA995A83A46 F86C6F2EF0A616C4947468B9679A57C0BB971554F5F3CD4C02B9911BE7489865 BBC2F374354BBD502DEBD27DF832E77167F21D87CAF285504D113734CA7F9D15 D250FC28E6D3880389E0C60CFDBA54E80A28BD1E02C41E434646346992F7C88A 7240DD70014C38B48B239AB80FF9AF154E4A3D4B0AD44ACDBDB3AD7F745B75BA F86D2F57B722747F23FFCBEFDC81F46091C3B967BC550CB65585260D316C9D37 8A3B91583FDC209C13714E6D27EE77288B2505384C3A74B841016BBC828C3ABD 2991B6947D0BBF04227B863179590F3F95C27693FF28EE9D46408D3282C15DAC 67403023507BD51C9C2720576F7FC8A17A93C7F814B9C5DD6232ABAC3B2C8A3D DF2EBDC08F3037010DB637A411E9FF2454E64E8E9D7B574111C11A26DEB5168F E88F77CFE5389B4CA4CDEADC1BA8D3ABFCF410F56E6337D35C625A281B2B416D 36C3263183368510D961AA6288263FD991405A881CEFB9DB05E2897936A98A3B 941A3EE801A33609C3167B0CB256BC64844DBA5F4194D359603B118EAD9A65B4 669AE81D06AC876A45AD6AEE0206CA67F1C9D97586FCE2507A212FBFD6A5BE73 AF59F89DACD2A376775D16FD24EC2CF4DD167C7AB4CCE4F040E7D8CF1791903F 34D7FB1573765F419B344D0739E0F289EF227EAC82193FA3966361964343A0B0 ACE1AAD6E60F17C86BAD22BB95EB862E22FD2F44F8A139B7BA994F19F8BDDCF0 FAA23DA3253B93F8DB9B264627E3B0CA7F01BBB78BDF7415795179132C689EBD E61665D2C86D4905A0A57A810299076878 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMMI9 %!PS-AdobeFont-1.1: CMMI9 1.100 %%CreationDate: 1996 Jul 23 07:53:55 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.100) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMMI9) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.04 def /isFixedPitch false def end readonly def /FontName /CMMI9 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 15 /epsilon1 put dup 21 /lambda put dup 58 /period put dup 59 /comma put dup 61 /slash put dup 62 /greater put dup 65 /A put dup 66 /B put dup 67 /C put dup 69 /E put dup 70 /F put dup 71 /G put dup 76 /L put dup 80 /P put dup 86 /V put dup 88 /X put dup 90 /Z put dup 102 /f put dup 105 /i put dup 108 /l put dup 120 /x put readonly def /FontBBox{-29 -250 1075 750}readonly def /UniqueID 5087384 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 9E394A533A081C36D6F5CA5FED4F9AC9ADE41E04F9FC52E758C9F45A92BED935 86F9CFDB57732045913A6422AD4206418610C81D882EE493DE9523CC1BFE1505 DD1390B19BC1947A01B93BC668BE9B2A0E69A968554239B88C00AF9FBDF09CCD 67D3B2094C11A04762FE8CC1E91D020A28B3C122D24BEAACF82313F4604F2FEF 6E176D730A879BE45DD0D4996EF0247AEB1CA0AB08FF374D99F06D47B36F9554 FAD9A2D3CE451B7791C3709D8A1DDDEFBD840C1B42AB824D5A0DFF0E0F15B0B7 22AEEB877FF489581DA6FA8DA64944555101EB16F7AB0B717E148B7B98D8DBFD 730C52937E226545CF8DC3E07C5BA30739BAFCD0F2B44275A6D503F582C0FB4F 449963D0AD2FAFDE33BA3D77BCA9D1DF878DDAFCA2E22CC4BACD542B282164C7 97C2BDE318AF9D501CA21F6E662E7AAB75A5F24D2C182E598D175D44E88AB19A E7CD59584F95B389183EE21B525BF52A3F23C0FE5383A5565A19361D716F508C AAB78411CA5A4D27552CC1C435760D5A89D535B71C593E755C616661363308DA A683F54ED0C23FB2C225A008392B0B719F66F11A946A090B7C00B662A3C69599 B4ECB0CC70C85C4BBBF207E0026F6C7A19F2ACFB7A60804FC98A4BFFD7BFFF2B 9529E6D9D4238002BBC255BC62959D6F3381FE06E0621B879D5FE5B541D45A1E 759A6E7DC32B1D1632368D09A97039DF255B6492B1B2B7E2C1434E8306ECA7D3 5A79B6D614B4979F10988BC76ED53A5F45315CD7DA216221F842FD0F3E050DD2 BAC23C984D506D8F7D614BCB6B244F5F41321549BB0BD041FBF3053307168680 3435E9C944489A387DDFBC72F3B1FB5BD28188E64D8E7EE9B95146F4173F24BA 76B4908207965CD9FD243ACF8382083CF6B50EF6304AC3264B3EF80FDC77BA3D C609811F674DC83F31A5292325C557508F08D4AA946B268428EB4863D4A6ABAD BEE3D04A84D6036DD8A6143996A030796E190A18438DC89317CF01AF39BD56FA DA5C6ACADEA3ADC6DC172A191426447A8F69BEB37EA5D74D6306212FBB855F63 C1609BDE591DD691BD49633F918A9FF6BA5062619091E49BF820C85A42D9679D B841A6824B97F0AFA69D4D90D9C527580C8D05EADE0DF6BEE715DA1F9183DA55 3D1DEA390B987698E19B7D9EE9964F9C1A67AD8A47F89FF755BDE469E991F9B1 8E5DC2CECDC0DF87324EEB9BBE98831EEB5A6D51274103014E310AD6596D5014 4F2A5505E52839DD85AC121BD5AA885AF67B14E5091DF00319CF25D7F54372C9 95ACB6B6B254B71A5D80BBF325B01AA2734EA28B580DCC1E4A8393478475AC8E 1CD1B82D20A80DFD7233D4401C5F902C354E4C761938A62AF2B63D5AA25D12AE 652949369FF4B6E73606C86768023D0ACDFDEDBB5274FD93A857C047C1290BF3 E3AD39B9DDED784188860ABB1A3F13C3DABA4EB0AA00C284076367E8FBFA9213 A573DA3DDD209A4CAA193AC58E0DD1DBD23F2D29BE20EFFB24C72BD6ABCA454C 87E51DAF334E72143A9623D107A32B58BCDE251F5E21F4CD94493C4AC1DCC635 FCD40665F5013BCBC8FBDC10D1A61C528A20896257DFDAC5040ABEC1D31D7F55 603396FF27008C061704B512277DCB4B21F4AE4AB8666268BB37C0B8D7E713C3 AB228806AEFB8CB9454322E2B3D53486CA1EF409003731138A71CC3A6D8CBD45 DA1429A20C06F9BC7C3A5A139C21427E276D4A525D3ABD9F421639022D8DE021 8FDFFDA8079A8F84357EACF850783783CF2D51F6425571AFAB01AA9775BA823D BE2D10564D738D89F7086EF633CD6F83FBE5FC03709A7019483D66267B2D7E01 A65212E61E2D36F00CBDD606F12896E6EE8298544A785C600FD97BC0292E8F2D BA1402A0F92D84476D82065D2F6191A793559AF6981602AC370602CE40BF7726 B921F0D2CA32A9B5D184F15A5BE819339A1790F6500C7EBA1B013DE28E1FB9CF 17ADBDF29E023F7C9A4A5539D76F085C6BF50C7C5BE1E47CB852291C419AA5CD 9093F4A2EC0A146D08851913A47A2D88DD32E272D64D8DF64905F3F95B1FED84 EC07952B59D04B9AB45854B53B5BCEB569F70F71B1EC9B749F3FF31D362DCBA0 B9814B5DF049969EBDF70D6AC8DBA8D362ED3124D68D25BC0E276F65535D26F9 353177B1C5542E815C70DD370974EC4C7B9B65C4C256852EF8793A2F3D94F69B 954B9FF221EAF7F83025BA3BBBEDBCE14A145CE1CB1056728B8BDB647CBAFF1A 01741913E527CD7DD0C4685107933C993C8764FFED4E9DBFCB10F62B70B72AF9 DA76FDDCEA623DB1FFAE82B1D5AF887D1DE1460FDC2B62D3140E67F4FE6514CC 46D44BC63E26D2B3AC0C43A4B87D3C8708FD58BF60578F62D96D41F60C30CBBC C2612B21D291DB0ADDA35E011E70FF8E05C8EB145ABA931656D4C0AF362602EC 572AAAE55738AF6381D7F49D30D2F6997EB81C6E6E41EC58EB21385158284947 5A0EE74B44F5E2D42FFA44CAD9F1AEFCC6A9F376A4A45AEA00611F64DA5964C6 E44B65D25F08C5AC0BBF9FF1FDA4DC554F8D4E26BC83770E6F2102A0F8B3B5BF 9CF0FA0E72765B8821FB9416CC72B020D5625205604865EB3563EA2D409C90F8 F556E463881B42C8A568A6F7F0E5620616FB831530B2DB1FBCA99FD2F233380F 9C77E7430D0EEB98D2BC0455A2CDB785F470CBAF958B0B81390C67BCF66BA8A6 B08256DF0D2E943EBF5A3DD2164318CA10993BCC997383CD806F3A06BA6FCEEA 12F47F87BEFA82ACA10A31063B7770971FC935679C62FD003973446BD7C299C1 E8337929DEF9787C0E90C534A6127CF01C3AD803898B71E530717698B4E7698A 6C389493E41FAE9AB0DEFDDE4C109223F1B1F733DA3D6BBAE5051B3A1C8828A6 FEAB92A4FDAEFB29418D44DECA961087E35CE60F83943D1CED2277E84CD34D4C 510031284EC120BF2B51CAE2A1EA7D2DEB13913CE206AE71FFA9855D61459593 AED5DC54BD033C7D25580352124D18D5EB141741785C45CD52ABE8002AC89E9C A407C2B708C9C49DCF8191D9C5A4A158379BAEF0A4FD3EB16E0672A668576740 FD2141703AE536C3AD57410BD5C16B43A1777C9A82567639579FE7E7CB1F228A E2B0F2F827DFC741386C1EBDA73A04AC9C2922989488C074063280F8BC2B4F25 2F960F75AC334BF055732961E81DF2DB755ECC33BA8220FC8F60BDD5B5B23BB2 3F1F85246CBB544F3DA4DEB15541D2A50539FD7A3297EA2335D4D088075658C8 D2B959C19AE3E1CD4DCA403303C27053AD3122AB243432C6138363D10B1F1077 570C330AFC5E049D15D4E39EE0C2B8A2C7DBD1F5E62C70BF03FBA9A4B85A596F 3C37D4FBB440563D10BD0E5D8D0DF7596A2148874518FE331BD01BCF402BB8B1 5F00A7FA193EBB0DC426A4A77A2A355706C770A650801E0D23DC522016DBFE3D 49A673C13D97F24D85A6A0D232392651C53601D4E0404014AF0EA5A261426B7C 54F471EE5880B44750DEF0EF9737D84AB961EF26AC1E53C1864E1A9107C3BEB0 B098208AFA7FE5AF3CC2CA65FED595F576200B7865E498FBEFFC5A9E1D60C038 8F58E8A5A70785B44FE0A645E5B3FAC3B5701FDB7882280E0ECC8A80915E804B 6BC9281BA379A06F8FA671FFE75FB8EF3DB226DAE039A7EC1B3869B843D508E5 6AFD6FF24F1C4B7EC8F13856CBD52306042C73637D3B28D1951E6DC69DCD3B92 0B295029269046DE16B2C63A9B44503973B761793998A4C3240F9A4A9B18603D 571B7FF4DAE3040424C9FEDDB07F731BDE45BA7ECCA515A1934F4A9D0C9A80F0 4236C1F6A084E144D3CA1DE8605AFCE9F5ED31A3C474981D5FC590D1E76267DD 61E73DABC20B45931059F8CACFBBA2B764EB64F2A4C8A8EF2EE872AA5012BA9C 10107387A2F9684E071830DBDFF8F7F561ABCB24B5ABFEC52DDE4E329792FCD1 B52265974EC35A51E26F3075F54F4F5F13739080F1BFFAFBD6399811563A01C9 8F529A053060FA55D603D0D439AA32EE2E465D6D1079E9ACAD97CA2F79A36054 8598AD6CFB104132A2EACC4B402171D46DEB3C21831B86E20A8B51EF34BD7C73 C3C481D88F52F1F4C1306A5597049A47DF93D395A45F01E56F6CCC97B35C9475 73119573EBA1C4C39161199F5EAE3F37AB8CCFE36080DC761E05F5BF589BAE6F 72A3236FC7F68A934A57ADFD258BC89391D2E55D907410473EB36F7B91331C13 3F29C13B849C10B08BFEF1370F2F251A9B88814828D771786A161399A055E091 683927D44D4E7FCAA8842CC9959F5C074BB23C268384967B2AD708FCE60186F4 6DB2BDC7B9C55FECFFD83DD62700103CB7A8D910786552B9EA51456ABD5A3F0D 083F2E616282B76FD49EA5BB4EC072EDAD8A6AFAF2D0F09FCD9183A580B02DD1 3A8F0F46405CBF22E065E1774BC9A89146E8A23BAD95CE775C8516ADB11CF27D 7745D0F33DC37F9C27566C63C76303936C81157B756983530D3A656684A5118C 73F0C38BECB406079F9FA73054D679F3B9501C22D159F3729C7415312CFB1D21 50B2AC1D72D2F0D60D03D9D0122168BC64D1B36487DA66958109810DCE8011CE ACBF86BAAF8292F25726692748C60010F71EDFEB89B331542C44A3D05B1AEC8C 27A0FF879D8FFD50179FA931FDA59B420B4AB7D3D48247DD93B610BBC218D43E 604BEA1C02802FA63564CDD98DEE1C94A3D5882C416DDFA0ADE8EA48843F174B 70F479D6A8B461E2D0554C9E985E4DC6FCF16B4FD6DF07EBBF89830749AA5170 BE70FEE5EDC3525D65768C9CDCA36E14093D7683078054D87FAECBB2CA4FB920 74C10B61C7347CB29315542EE0CD41F917BA5D4D5075B9789F005F11FF2A9DDA F0F6364DBCE7553D83989A5A1A705759137F5150CCD9851E6D28CE2152397A9D 43F116C287774E1C0398734434930FAE9CEA31D350238355A5954D1817415D02 FBD570E2E49EF00A3B6D5E0E16583066CC99EC639A827D772F9AB0A963D31B17 F17FDDDAAD73FAE79F897DC0D2927113AD6B66AA0D9194B32F6E2045A738FF6B B3CBDE1E4357612BE9A010D53B05FE2E4DBAA53FC0C59767820C0E589212B8F2 72E5E9AEE88A3F5CAA85C52336646CB904D267EF76BBBB97C586416E639ED921 FF93BDD4D9D9BBFE9C8FA2A3345098D06506C63AC98FD07A8BC0DEC466AAEEAF 64A49BF0CF8B7541BE4D9CB001E6C5B9EA9C431E20B4472F36D4364CA2360EB4 EDCC4B7761C5C35D19D3486E28672D12385936C2BBB6A9113FEF654A72920B0F 90C0F8BC88A9780C45FCEA4C6700AAEAEE14962DBFC7E6B15C5029AFDC0F2ADC 812134B3F058E3F0AD5448EEE0654D7B332E9030FC35827F764EC341D80F3481 540D3562EFD3E591EB66CA6B564521F0C5B69C8A3000451E99041F4701D1F0A8 B846C7018BFE4713F14C0C99F33E2E28B40593D971FBC941201B8442FBCF329A 567053A17A9D0AAC378F9B84DA1B40389FFC87616A320673DB061D748C23B888 5CF8978C0525FC4D81714DB3B870B882B3481ACCC83EA2C0FA871B2AD79C7D5F 3858B7AB96C475330ED2B428753D56998A2E285AADBBB1F5A25D22E1C27F7952 152EC8219EBC1FE93B3824431FC26DF13C6E9996EA850B90B35190CB310AE96A CF30ED343F7E36E202BBE343160535F8F3C1373F13716EEC7BB11083430C9376 10F99250F64A90B80966D7A8AF3B95139E6817CE7FE85B104809C51FCE4530D0 0B2E53A85082879CA65A22B32560920A0777118953B952C66BC2E59A645687C3 DF4C7610930086D12253B77CD8EE90655CB8AE4D247FC9CCAE45FCC36852DCA0 48AD4FD936F5CBF3B1C7777E0DEE04BCD7747C258BADD98B6AA2CA571ADB8787 658902FAD75227EF5D08412CEE748F42B199D3F32E8368CCCDC022E89F5685A9 2C0C7AE664BBF11D58D39A64B853CA309C6B8E6E9CF4826D4E97C6E0826BB534 295A5723D14EA5044589DCDD63F2811F77AF04E82D3345B353711A71C138FA52 7AD8CAC65AF7BBD1ACC5DBBD7A7B6C2698E32BD81FBF8F51BDFE8B824E0275AB F061565E44FA01F213054FD982B2122B6443CC5FDF57935AC6601085B25785D5 579F73C0B753559B61E7219D27BAC29FFA5A68BE1235DCE3413460C2C83AAEE6 D7F085FFAE6FF693D544A7687AF19B956E961C55189830F42D6EB4A8F02D0500 095958B66005348EA03006ED54FAF16AFE1E6DACDFB7EE25CCF767A2ADB5F9B2 32A407236E8DFEB7372CADB9731A4ECD0FBB702E6469FF0AA4191DB051C69375 5ABE46E9B424482E395C5BD41149967E54EF9CAECB86779F50213F203245DA3B C60264E75C8F3B72550BB95AB5D8BDE8C89C0D1928199245B3E972E669F5C8A7 1507A22E66219A51D95B04E90D01C9B00A57D67284E2C06D2976BFF637D1C511 0B819C91B9D52DFB0F20FEC5AEB18E96FACFD5369A93EA7E22B4C7F931472561 8267768EE95FEA938AE794F4235FF76338CC5CFA33D69C1A999288BC8ECE7EA6 4A602B8F4CFC86F93E71A85C2C18262F8DCF56C4E6D049DD71E4C8C8BA401AA9 AC3F0084D08EDCEE559C282722480FB59279E2F15FC2FAF817788047B9320270 625C7BF865B0838EC678B90D233D48B426EAA4909EC1EA47C40CCF90E8BD068A 8E75E5434F04BED2047FE8CA0044F7D7E6E967CE674D3A6F2B37ACEC51FCCF40 E12CDFB66977C8E57BC5A17D5E488A3D10DAE32D8EAFDD6FA376A6C21671CCAB 46CB283ADA110759CDD4A32A86EFE4EA85A87DE558BBD784A5E99F465B31736C 4C766D04691ACED5529F7D4E82C54451249E0E84D4303F66CE5E7383C3742AF5 8858CE6B6D2650500F24E2C2711B18454C9596AB55B85704C983B520E90025 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMSY5 %!PS-AdobeFont-1.1: CMSY5 1.0 %%CreationDate: 1991 Aug 15 07:21:16 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMSY5) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.035 def /isFixedPitch false def end readonly def /FontName /CMSY5 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 0 /minus put dup 48 /prime put readonly def /FontBBox{21 -944 1448 791}readonly def /UniqueID 5000815 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A 221A37D9A807DD01161779DDE7D5FC1B2109839E5B52DFBAF552B11EFFB6A16C F03FB920C15AE724EFDF0CCBF00A838D34440FF9FED532F44036AD22561184C5 283722DDFA7285E62754372D716D704AC0E00B2F6AB67154241C7449AA047833 94CEDB08E8C92907FE72A0B05AE36A7B9226ACD6E7890A0B528FDDE84A950FC6 801DE75CF2E739E9121149CCB8B1C87A106822648D84A3D3FBF295EE6C4BF403 BBE9A1C1F6DAEDD1E642ACC486E609703D7612BFFD10C324F5DC710811F7F614 3691B400E3773987424C0D2B0D8A736873C6371DDB2442F05E018A2B5CA9A4AA 17AABB95D09E5890CFFFED5AC01495D89A53D3C9AD5A9C23D5050E53AD0EDBCB 74CFD3E2297B2A8DF7D4FE91255B64B1A27882D0E91114C042D0F291AECB4EAB AC972162377FF50153BD28D6BBCFB47331F80F948DB61A4D3554AE1391DF574E 7DAD8619F30B83165A7B3DE1186D47F66A2633F8872BAFA53C3F179C951D3E4B E45887979E4F54221C8AF765534EE1A40D197F6709CCA448DC7F5A440B0FE0EA B6F8B8BC7D779FF1FC042051A5B993605CADA10B3319AC65AE38B577EE04BE80 D75AF9BA4701849C3C6E730062B794E730A8EE16001DF8937F8562F7498A42D3 29969FA66B8D10FF51F5F9C785876AF93182741AAB34573F1F5F6C6471223443 383C319722332EC39F82827B6BC98594667F65D63D9F782EB097526ADE032F71 3AB91345E1461776725681A8DDFBC6B7D05E060441F8506215655EF6B25BE656 5D74 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMR5 %!PS-AdobeFont-1.1: CMR5 1.00B %%CreationDate: 1992 Feb 19 19:55:02 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.00B) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMR5) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMR5 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 49 /one put readonly def /FontBBox{-341 -250 1304 965}readonly def /UniqueID 5000788 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4 87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F D1F017CE45884D76EF2CB9BC5821FD25365DDEA1F9B0FF4CFF25B8E64D0747A3 7CAD14E0DBA3E3CA95F10F24B7D5D75451845F1FB7221D7794A860756CFBB3E7 704A52A22448C34812C3DBEDD41892577AABA7D555E9298C1A0F7DA638078167 F56E29672683C51CF1C003764A8E7AD9D8ADE77B4983F56FE2D12723AAD8BF36 682CFBB71B1D12210144D39DD841A971F71DB82AC6CD815987CDCF29ABC3CC96 5EEBD5D661F452C6E0C74F9ED8D0C5B3755551A172E0FE31EA02344176E32666 14B6853A1C303A5E818C2E455A6CF8FC9A66DC6E279101D61C523BD9DB8EB82F EAF4D7FDF6372383C0794C4568D079648689A199D4B65BA646CF95B7647E4BEC 83856C27A8EF177B3A686EDA6354FE9573E123C12EC4BA56A7E8BFB8F9B75147 9DD79A743968F36F7D0D479FA610F0816E6267E5CE327686A5485AB72201525C FB3B7CA10E1BF26E44C24E1696CB089CB0055BD692C89B237CF269F77A31DC81 0F4B75C8400ABCFDCEC6443CD0E81871CD71AA3064ABDE882C4C52322C27FA8B 41C689F827FB0F8AAF8022CF3C1F41C0B45601190C1328831857CBF9B1E7D1AA 246117E56D6B7938488055F4E63E2A1C8D57C17D213729C68349FEC2C3466F41 171E00413D39DF1F67BC15912F30775AFDF7FB3312587E20A68CF77AD3906040 842D63C45E19278622DD228C18ABDD024DD9613CDC0B109095DB0ADC3A3C0CB5 AB597D490189EA81239E39202CBC7A829EB9B313A8F962F7879D374ADF529BD0 5533EF977142F647AD2F5975BA7E340419116099B19ACCCC37C55124CA6C6A2C D961E1362D29A5F4C3393CEA88D53E01D0FDAE7050612947AD1B04F42B0F3B0C 4ECD493606D6321E7773557228E0C71A0C5EEB809E9853FCD689BFE16A61E8BF D7E8683252EAE940B67546EF86DAD7CB9D786603060FDA494D3297F3F70864DD 1C37DA22110220A988706B11409E2F475F486C749DDCF8199C25965925D091D1 819EB866D2CE64D29464F7A6045778F1740A06610F1DD94F2A4EE817CAFAF919 8D241C7C3A7A4BE1016C9A8BA70ED76B436646786E4CE058A6B056B9BF766110 41EE4F93833911E1EAE9B21DF6925E77E2746E2FA82F76494E50D61E33B160DA 780549CEF58DE177E36F5858137038EEBBE70A3A26B51508291B3049E2D392CF 3E 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMSY7 %!PS-AdobeFont-1.1: CMSY7 1.0 %%CreationDate: 1991 Aug 15 07:21:52 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMSY7) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.035 def /isFixedPitch false def end readonly def /FontName /CMSY7 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 0 /minus put dup 3 /asteriskmath put dup 48 /prime put dup 50 /element put dup 54 /negationslash put dup 91 /union put dup 102 /braceleft put dup 103 /braceright put readonly def /FontBBox{-15 -951 1252 782}readonly def /UniqueID 5000817 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A 221A37D9A807DD01161779DDE7D251491EBF65A98C9FE2B1CF8D725A70281949 8F4AFFE638BBA6B12386C7F32BA350D62EA218D5B24EE612C2C20F43CD3BFD0D F02B185B692D7B27BEC7290EEFDCF92F95DDEB507068DE0B0B0351E3ECB8E443 E611BE0A41A1F8C89C3BC16B352C3443AB6F665EAC5E0CC4229DECFC58E15765 424C919C273E7FA240BE7B2E951AB789D127625BBCB7033E005050EB2E12B1C8 E5F3AD1F44A71957AD2CC53D917BFD09235601155886EE36D0C3DD6E7AA2EF9C C402C77FF1549E609A711FC3C211E64E8F263D60A57E9F2B47E3480B978AAF63 868AEA25DA3D5413467B76D2F02F8097D2841598387C588CB084A0351E1B0134 ACDAF9FF07D2ADCD8915FB8792BD7F250469A256B05DED7089E2D994E72C1877 5619AC07A1EF0EC47C91002DFEF22111173232C13CBDC15B370BEF2F39E24CAA 8BDE80F48411B56D37603BBA5A934F8F24EE7B7D2310D38F128E141775ED4CD8 D4E13F205D5F5E173E6755D013884306F3AE2D2A85A3A1F2161FAD28954AB8E9 2B830051DA7BEBAE46C04D2FEDF469B94B3AAD91F66D22A983FCFDEDF23EE52C FDD3450DA0A26EEA38087A0B4EBCD3BD49D9E3001E7054184D063F80A3E86115 A80FDAB9B533FBBA55E33B9DDF7846045765A0B0F448620D4E14A86338BE1721 A6A730BE29A3619F62E42CCFD42944240C866F8A085D8C6716E1C0D5DC45BD1A 5D9DC1AB368C9B65E1C6133EC3393388EB9EC8A5815F6C41A4383FFE248B7EF3 D8627E280A3958667DC7FD3A4ECE8E2AF6F772E86477E1089BB33426CCCAEE25 1384366EECACB40093AB888D30F81404CEEC35CB5782C65E35F6D5492B71BCED 8C262E90DCD167DAAA4DF89521914C42257C6600369C29B87A9503DDDC699931 F1FD403C309B210017F3F76E8C627E1DBAAA86D3E37ED7701EBDF215AE2E1E3B FC2C3B3D98F2CF8191F9A21010C42F78321254D88B7AAB56A733219106C9F40F 3ED371F5F95A17FFA9CE7D9836A9B5F9E0045AA6AC496366D53CC1C367B04A1A F03C5DC8DD2261426ED2A4734729949507CE0D738502997B77730EE1F4B17F7B E09AA54077A5E50E122D0B3B21A6CC9CCAECF97666D9ADA6F3679464A444DAA2 CA2F951869E4B011D158EAB99C92704E4D7CDB4DB800DACFAC377DA28CEE7E2F DFADD745C7ADF5ACEC1B61FC68A06F3408B4F672E8C76C7D630C95C5B71F16D5 4B0323154A3C09946DF67B71027790EDAB2B978D982E0AED4C481E40346F77BB 544DB9A11A9005AC4B91D8B558C0995643C9B9815F59C388D72252E98A477A6B FABEFF344157A8565BFBEE4A43F7714EA8C732B955913C5DBF1394CDDDDD8D62 6610BA34E3896BFEFBA37B12F78A961910DB6EBDFEAC0F43F06CAD86134A4156 D2594C441F2456AEC6B7506F72B36D57128289A22F9DFF4BE1CB1C6BCD1D8971 F09573DC207C64012C60EA351DF41724970C2C1E68B3517ACD8A8C39B733303A 6D1F5A3F5904984C5EB31167861B5B8B718F9494FC5B9D1B410F97C034F9A1C0 E416A24C541B33FC706CFAE5BDD7CD9AC641CE163D53ECFAB40E752EAC451B11 1A183FCAF4E1157C836C5B6C1F75C46A4BA485BAE8479862BC33D662BF0F47D2 950A723ACEF00FB3B828B5FD6D2CB7B628A7DB5AE28C783D90F5E86C9E43F348 D19365A38C88E0F35AF449AAB0275E13974B9528BEE30A272EA1DCBE5B297902 D40E826BABE5FB00C540E04460FF717B541CE319C083E745642D221E5ECC4210 2DF25AFC6924842C2D392BF83A394BA759C644134115E2A98A7CAE190EC47167 EDF8B7FFD14357D4FBD3885C632CE5D33B393891B25B56995A4848FF0E372C5F 6B6D4E047376D8900B9A9A80B54E3B7F6CA3F1C7DF7E42FBF47315C0F881D104 EDBC838CAC4D74F11C9AB730E181EA9119C25FA76D85DBD123DA9142531697AD 49BE233B0D77AA6138C6DEB01430EC50B568C4AE4172AB1818A2B90037AB9FAE 011EE4B4510D016B7C9822854AD1F662362B5DB055020CC271A95618A21F0EC2 D640F1E71C3E65ADCC2AC985644B7B2CBCB94CF67470AF8FB0F7BE 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMEX10 %!PS-AdobeFont-1.1: CMEX10 1.00 %%CreationDate: 1992 Jul 23 21:22:48 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.00) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMEX10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMEX10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 80 /summationtext put dup 81 /producttext put readonly def /FontBBox{-24 -2960 1454 772}readonly def /UniqueID 5000774 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF5B8CAC6A7BEB5D02276E511FFAF2AE11910 DE076F24311D94D07CACC323F360887F1EA11BDDA7927FF3325986FDB0ABDFC8 8E4B40E7988921D551EC0867EBCA44C05657F0DC913E7B3004A5F3E1337B6987 FEBC45F989C8DC6DC0AD577E903F05D0D54208A0AE7F28C734F130C133B48422 BED48639A2B74E4C08F2E710E24A99F347E0F4394CE64EACB549576E89044E52 EABE595BC964156D9D8C2BAB0F49664E951D7C1A3D1789C47F03C7051A63D5E8 DF04FAAC47351E82CAE0794AA9692C6452688A74A7A6A7AD09B8A9783C235EC1 EA2156261B8FB331827145DE315B6EC1B3D8B67B3323F761EAF4C223BB214C4C 6B062D1B281F5041D068319F4911058376D8EFBA59884BA3318C5BC95684F281 E0591BC0D1B2A4592A137FF301610019B8AC46AE6E48BC091E888E4487688350 E9AD5074EE4848271CE4ACC38D8CBC8F3DB32813DDD5B341AF9A6601281ABA38 4A978B98483A63FCC458D0E3BCE6FD830E7E09B0DB987A6B63B74638FC9F21A5 8C68479E1A85225670D79CDDE5AC0B77F5A994CA700B5F0FF1F97FC63EFDE023 8135F04A9D20C31998B12AE06676C362141AAAA395CDEF0A49E0141D335965F2 FB4198499799CECCC8AA5D255264784CD30A3E8295888EFBC2060ADDD7BAC45A EEEECDFF7A47A88E69D84C9E572616C1AC69A34B5F0D0DE8EE4EDF9F4ADE0387 680924D8D5B73EF04EAD7F45977CA8AD73D4DD45DE1966A3B8251C0386164C35 5880DD2609C80E96D1AB861C9259748E98F6711D4E241A269ED51FF328344664 3AF9F18DCE671611DB2F5D3EA77EE734D2BED623F973E6840B8DAD1E2C3C2666 DD4DD1C1C9C622FAEAB9D3E54476B49A2A026565F10A95536B67FDFDA5E9E69D 8B247654FF9A4D74E77A5441E350724A552B878A13AFB446B4DDD357A86F0837 94F258DA75532811AF41958507DB2C1819547657ACD9D4E81A667B89B0EE8E23 AA9B8BE4A45B48119FE65DD884037E05CE097127774CDFE6091C7E6C362D27D1 15E0C7B74AA32B6BA491EAB95CBD5340142BCC0515D3CD47A2B2E345DC5B5444 036CB75A23D92ADE4098E415F5DD6C311A31300230252DE1C07D920874934055 1A73D5122DE433E4A3B368B7175AE73B24ECB27712787913C4A4D45E2DE6DD4A 5CCD4AED16F9FB8816B94CCEFC91C0FBC088B1FF891CCD67413667D6FFF496D1 FF9974A488BF23136C59F825DFED4186EB19660501A665E805AB73CF5FE8BBDB 40BB10AE13649F6F691DC5B8747D499C6C2DA235ED6CE2CA0EF743FA6FDB03C3 5678F2C5C4A9D014E21742994EC22824B94472621723EB1C662E9AE39377CE72 9BAAD4908A0C47CEE1121A40163321CA324734B5551B8B3D1D1670EBF7F4073A B436253FB8A03366C16E7BB4DDD861104CE741BD0C84DD0802DE19CB8013E457 310BF0C3 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMMI5 %!PS-AdobeFont-1.1: CMMI5 1.100 %%CreationDate: 1996 Aug 02 08:21:10 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.100) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMMI5) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.04 def /isFixedPitch false def end readonly def /FontName /CMMI5 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 69 /E put dup 76 /L put dup 105 /i put dup 106 /j put dup 107 /k put dup 113 /q put readonly def /FontBBox{37 -250 1349 750}readonly def /UniqueID 5087380 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA06DA87FC7163A5A2A756A598FAB07633 89DE8BB201D5DB4627484A80A431B6AFDBBBF23D4157D4AFE17E6B1C853DD417 25F84CD55402AB88AB7EEFDEDBF2C2C731BD25567C53B474CCF739188A930039 098A197F9C4BE7594D79442B2C8A67447DE44698321145D7689B91EF235EA80E B600AA8E238064F154284096C4C2554EFE8DDF13AFF8D3CE30E0999375C0FEE6 F992DEA5FC3897E2CC8B7A90238E61E41622DE80F438DD994C73275CC52249D9 F6686F87F394FB7BB668138B210BEC9E46415A1B58C990B81E7D7DD301143517 4C2A259D2A0A1E200F8101469C10D7D537B0D4D39296A9AB3F132DA9A3B459B0 F850E2B3A03BDCB35AEF82285D19C38F474FB414F8EC971B994D1C7DD753B271 2B71549DF497C665DF0F266988209D9EB616E4D9BA229FF984E7A886DB01FD21 48ED2E4859FD6416C2CE52537464EA884C8C9C2D1083E2B83BE4B766474C23B6 6E8EC5003200AB10514BB44D14CA700416AB6B2683E80862E7D5B49A05526A32 554BB23AB8B0824BBA198E3825CE82380CC0FECF46651E3E5D77F09465E73164 20342822F29572BC7F73F2C3BF95ED3BB6FDEADC20C6AC866C4F2C679594D7E8 8D944704A3C5D771DC39503BECAB89F34D8CDB8FDB91AFE21F3F0260D05E90C5 73E2C13DFA022C4522E5918EE25038A0498FBB530DA33B0AE238B1C6ED03FC04 2BFED8236E07820C5BAB411EAE1B31D93A2FA7C374B1725FEC359ABCB88E2C89 214529A263D795AACB0B95A3AB2F4E08EF350C282CE521716DBB06E5B8291B3F 5D4ACA230FA192F64BC902A4C8842C0F916F92FBD002ADD408BF0401D0284FBB F05D4C6DB631420747CC902C5E1617E6573612FB26C8378DF41FFB5048D3CF06 4893DBA48EF4B043D760F60C75712169D16C83EE020C45369E443E853E1809DD F395B812067D6FDBD26111B34F42C21036AF952D0D767FD17F6959D9FDD46005 D64FFF54772B50BB9B173AE79702981F58F9F235C591F476A31852174DF0619C A470359153DC32610E782B204E7945515464DACE9099B81EEECC7EBD4B5126AF C3FD9DDFB329AF1C95C41FA4A5F6958869509A23BD7210386329771FA46FF926 0E54AC35106253EE140449425A8670E1F92B178A02A58EB57540F4BD8110E548 BB584EA6D625C5F5FE0124A98E49915F1A1B95D2125874360EED1C4379FEF3C6 90E5780C20309F11F2F23FAD635C44BA030B39EFF083A3ECCDD2641DC9FC87E4 22764EEA424047F087BE9ECB3A3F9F8537C0E1730E5333430CCEF6C5737D293C CF88359096D9C1F06910274458179A2862E3DDCC4FDA1B2DF95DCFC0398D93D5 8BB64C9AFDEF5519843A6B720209171B4571CD46B05B7F83EE016EC7713603F9 5BF0BD3FE5683BDEF1FE38A5AE385AE29880F640ED81939D1F1B295F8E87E0F8 C333F1E14984F20B8185DAB9BF66A162DA456CFEC3C4AFC3C55B7973C5FC6D5C EF591F17B3BC7958844BFDB89FE2A2282B39973B3A7C0BE07FA3EF586219678F D0136B28F15F96B651ADE7C40B998F3F513D6A033C43524FE50065E080003E1B 56C843620F47147FC6B631F0FD36DCB944649CFC9E16BCE6CF820F93001DD94B C14C0407572560ABAF4214B2877A545DD2CADA79CC176BC280B0BCA8B66CEE65 A5482A39A850CB9BF512350FA6020511284B51FAF5FC63C4435F706608857036 565C28ECE1CED1C147D26FF6C971C7FB007E72CA187F0BD03AC2C37E55F8CAC1 F3795E8B81CBD26DA191A7FDC1354A53DFA6F0CE6FA0AEFD2ADE53C32297C48D 6B47EB275936A00D7BC484B146B90DC369A5E72AEDF0C3530AA79CA25E1809D7 80BE14BCE2EFECFC33EE9A96DD396071A5E28555806C5719BF80BC92D2D0286F 85B73883382C11D000D32C36088B1D2890135ADF9C3CE630D98D39B6E87B5FFB 2A091ADFAEF0B3DF5CA1E04020ACB95F0A6D91591BF8DA47CFF298F9A29DE5CF B805B5F62D72CDC1C670A016DCBD6FEB261FFF04FFD766AF5592E28B72D5EC82 4AB3A365225099B90530254B5576C36BA567F0DF9FCC5A8232BC1D9BDA825685 29F575C58D2138F6D1C8E5640529C1288C95FC7D76A62BA55F235E3FBC413414 82AFBE499514643581244579D55C69050D58484DBE2EFAE8697814E27DBEDBA8 DB4DDE7D8D73471C49EDDB2ACF7CF4D76CE746A0B44037662A6DFBFEFCD34BDB 76A831634889453245433A581AAD3C9E42CD8078B64013AF01C12A45BAD302D0 2FD66E0FA76B015725821B9271C81BB6ECCE1A331203E10B7EFB7E3CF3DC4E86 BD42F6EE8E4677E43ED0CAA8FB9AAC8335DE73729F7D5735FC9019CF013EABA4 A3E3EFF3BC687E8443602D12218ABCE99FC9E04951E61276F147DD3CBAF01432 ECA4EAF347D5DF97F2DD154A8FCC7DA78FEA61F54EA5189DD12EA504B642F9E3 51E7341D3C413607995E35BEF84003B102CA258C8EADFCE967083A9A9A42A21C 80351BCE3C650B78740EC5A9B6737112E4A3D54A6D0619642A62358DD87BE778 870F5AE5C9F415EBC48E69D7CD816ED2A492ABBBC6F4200B4DDF084E7DE8AD12 9F61C2AB2E6783C9A39820F703EA69F0DADEC0ACA2C4DD74EBDC1611F46343AF 8E30423657B16AFB0D030F11540738DDCA0F8B46B18C33249639BE812D14EE98 AF1DE026203F32E8D393577050C5C94B84308EDA90F1963772909CF946481110 474771E65EE2FA6503B9FE746CC36404B47BEB8A54ACF364DC00C4D14F2D34FE 444F9536B154745A2ECC2814F1E19F76F0D4057AB8AF385C09B00D302E8CBD41 2EE64C6A48A31B68557E594A4996F36EAB607A0D7D305F4AF5E8C3D121913991 C5DFE680D5D1C8A003077F7BB149F791B351B323BAEE694D96D4F83F1F936AB7 1D9D152FEAD39E3BFA2042A04887F41D2BB5899E5D33177CF06B38D44B6A4FBF 8913103BA4C1103821F91D2F352974259091361EF4322AF2D24EB88F5A235CDA 1C6288372F4CE2999C6696336430C91B4AFF080466F1B9B0A63D2D24DA0A69D7 24B726C7ED3DC41AFF0B066E3B09E044EC9F22497F46113DF2846224B367FD22 7B7CE501D06F38032A11CBBE47BFEA1C79D275B16F8DFECB1B5451A49569523E A6DC360BE279385D18A36BF280667E65EFD66B26EFF2E5A3C861F2A4FFB86BAB 58230C1E8950F2E0C6EB8FA0FE5406C42B8DCDDBC1E4461A553CBF9310F3A2DF B2DD0119ACB70324D7226C03A6984118F147EE9566746AF8BFCF13FE8998C381 550ED3EAE263F79CB420EE26B9DCFBD8E5407A20282F6E697BCAAC6986BC9E53 751FA783E0C07EE8DEC9C0C5B6FDDF8A6BC18671187FCBF8A90A2AA0A635E120 FF9DC38BF492695AC58E2D6C66F4394A346481991A6BAAD2715AE2251F21CD50 742BFE4F4BA82A31D00AB1BDB104C5E667D8C9 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMMI7 %!PS-AdobeFont-1.1: CMMI7 1.100 %%CreationDate: 1996 Jul 23 07:53:53 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.100) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMMI7) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.04 def /isFixedPitch false def end readonly def /FontName /CMMI7 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 15 /epsilon1 put dup 21 /lambda put dup 58 /period put dup 59 /comma put dup 65 /A put dup 69 /E put dup 70 /F put dup 76 /L put dup 77 /M put dup 78 /N put dup 81 /Q put dup 82 /R put dup 83 /S put dup 85 /U put dup 88 /X put dup 90 /Z put dup 97 /a put dup 102 /f put dup 104 /h put dup 105 /i put dup 106 /j put dup 107 /k put dup 109 /m put dup 110 /n put dup 112 /p put dup 113 /q put dup 114 /r put dup 120 /x put dup 121 /y put readonly def /FontBBox{0 -250 1171 750}readonly def /UniqueID 5087382 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE D919C2DDD26BDC0D99398B9F4D03D77639DF1232A4D6233A9CAF69B151DFD33F C0962EAC6E3EBFB8AD256A3C654EAAF9A50C51BC6FA90B61B60401C235AFAB7B B078D20B4B8A6D7F0300CF694E6956FF9C29C84FCC5C9E8890AA56B1BC60E868 DA8488AC4435E6B5CE34EA88E904D5C978514D7E476BF8971D419363125D4811 4D886EDDDCDDA8A6B0FDA5CF0603EA9FA5D4393BEBB26E1AB11C2D74FFA6FEE3 FAFBC6F05B801C1C3276B11080F5023902B56593F3F6B1F37997038F36B9E3AB 76C2E97E1F492D27A8E99F3E947A47166D0D0D063E4E6A9B535DC9F1BED129C5 123775D5D68787A58C93009FD5DA55B19511B95168C83429BD2D878207C39770 012318EA7AA39900C97B9D3859E3D0B04750B8390BF1F1BC29DC22BCAD50ECC6 A3C633D0937A59E859E5185AF9F56704708D5F1C50F78F43DFAC43C4E7DC9413 44CEFE43279AFD3C167C942889A352F2FF806C2FF8B3EB4908D50778AA58CFFC 4D1B14597A06A994ED8414BBE8B26E74D49F6CF54176B7297CDA112A69518050 01337CBA5478EB984CDD22020DAED9CA8311C33FBCC84177F5CE870E709FC608 D28B3A7208EFF72988C136142CE79B4E9C7B3FE588E9824ABC6F04D141E589B3 914A73A42801305439862414F893D5B6C327A7EE2730DEDE6A1597B09C258F05 261969424F885C6B93B28E3223FDD3B040F5535D6AAE9201E5F49A143F3B65FA 75FDE4E5FB4FDEB79A695E89B66FB385A22222553A72131A7BEAC3F44DD0AC0B 0B566039AC5C1CB0A1304B882DD2497870AA5FB1FD17A704C4668F6F85F6E3CC 814D68758E24D9199B67A9395FD76257FE284913EF1B8897FFA602A54B39EB03 2A783B4A582A33F532481524A8BD8998A93DBFD4804FA77802FF52D5183117CF 80BC1398B9B1F9844EB62E162912873F37005CC29CEB7A2F0D0BD5BB237F61AF 6E8FF7D1D757421F857C2F778A2E085DBE6917A02F30E4953F8005D712111A2E BF289BB9096FC41ED8062C5DA622772223F8DC570C28475EEC18EB537533BE26 3CB50657B9C549C0F7F401E5BE1A544D7ACE8076E40FF3EA68BF62552E378310 2C1BB2E90C0DEB61C7D75D5CA47B0FE9C7F10D1215DC92F6259B7D6234C220ED BA07D0925F7829F9BD8965A8F996EF4DCA338DC1DCBD3886D29E63F283E2E335 D8E2AEEF58DA3415DAB45D24E0F07E1B3D481DC9CDEA84E853509E0DD52B7C4E 95465F6307FEA42A5DCFE4EE150D779CEF81E7591EFFD7465D1209942B37F43B F0996DC9BE0E023C48FED0CA603743BCED6E25BC0CDBA1C9FE9948001A5DDC67 6983F65B566C819AE3EB46ECA01A554483E66BB519C81AD5F4BA99DC5CFE5E7F 88B0C73ADF6BE6A126F39165DCF6177E055DFD0D30F96E964973D9171800DCAF 855EAF7FB3A5CFDF881C01ADE5183B3F48A2560E7EE5F1FB3CBC0E2CC667FC68 25A26D1B134DB08E6FD10AE4473F57727BBECB5C521A465CDD76B2D6D520EB86 D9CFD6CC1005530285102F119396ECF3BFE28ABCDFA39F610AC393FDFABD5756 D9FC0B20A69D540EB4058F70530C381265FBC834BDF927B290EDAD1B7B57458F 702A46C65E73D2159A6F2EC3022C3A008D61244F3C227F863623B47F8182D194 85C0B207A96CDE5D71345E4E0E5B1D8AD8B7B92B12ADF173E91E9CD209DB042B B72B3C85E9D128692DD87B0A2A64BDABBD2E00126668F29978527A3C8DF18BC7 9C9AF64A02838680354A91622A3803739D1C1293208A284E5B0FA66478751117 CC8A35C07B5DA415E06EAE4CC2D1ECDD05E3917C8CA41C9AD355DC28E9D68004 81C24255FF9C3504EF1EE6CD5885DAB765F274EB5C80155083F8D4E2CEDE454C 38CD7DE34238F8FAA5E7995EA7E407EE2F711C55A5C07B614FD0BF57BA2EC65E 8234F168E4487C7457AAE3B10AF4E74F71F313AD51143A9B19411DAF8021DC09 057018BFCB2C3C398BC7ABCFC84800CF9892859418C2EF26A54D0EC5FF184C7F 24E4BF87A5F581C567CC9EDB0156AE000176268100DB810FCBBFC7AA3B498F3A 477A9D7D081425BE5CB57CC0432AE129418FAE34C8F6F0239168A380931B0D22 E1552C5C208F0D79A6F23E13E73493975B0BC6162BA194C1AAFC1DA3BD2A45F6 7B20A78B0ADB64313286A81F185BCB802FB88EEC5A1782696E1A0929954E8EF6 95F5E0CB0049405E6AA2934207DF51017BC189574F687682DEBE0DCA18616EA6 8EF04E5167F0D9818E7E169E2DA1D3D62B7354BCC81054C2A2414A38FD64E817 17A7EC99A2B1ED5405A2227BEE53048EC9CC2EAD90F84107DAC4EC0125F02283 DC2261DEAC6C2B418C7ED7F38192BEA4EE1F5026C7E19D6EB23A96983988ADEB 85A3258D9FD511B6416004DE805B36FA1C811D77E664DE108E6370AE42DC2B79 1417AF1A9EBBD5AC31C374BD1BA3EC12A73F6BBB73A1BAB35C45A85044700697 6512C3C478E40DBF7AAE4CC391A70DA146ED6218DB7C3AD6A93B6757E8C11ACF 1A1052E3D4B63D4EA45FA86116D03865BD5F8359C49FC13960B336D48256182B FD847DF083E99A1E3F1691B83645F636F467453030E5434C31E69EE4FBB47D1F 11C6F93C35289207632D0CDF91781E2F604E70897660EA27DE2224154F8C40A1 F4916EB61A7B78B79DF302436A3743D1EEB5C731E90681C55151A699796B6117 885B8B8910A4D5B30B93531B0A5C68114E587977A23D1C9DA8387AE5AF2F8A0D 6FFC960944EC9352D59AB87FD97125EA7B5B1AE0312F9A4E02313770BE494236 FBD512915D2361955E5D3D4EB3A0F840A89DEDA6E7CFDFC5C7B604B03A941E5F BEF498F8E23B3E4DEFC1E62FEE453D098FC18CDEDFA266299AB88E6FE8D71CA0 ABF4ADCE251E73151374C6C9D741F03EA716E540885A38BF9BAA26B34F6F1304 B53BCAF55E8B5B75A2EDE066C59F9A0B2C1C4D3F5DBBFA4A735B5853258CFAAD 9636576A339138316CAFD23B707C203C3B6C7627D29BB53F11458F6DD53C89D6 46ECC5A76AF729BE35CFE606F68F72BAC779C4DC921C3A3FC905FB716937C6C7 7BB5C58C77EA4899092B9FE47D6A3E4FAD93C62382F6AB104250C30FEE3E3746 8121A49A7F5BAC20D7473070F8B5A2892B4A3ABD0EDAD592BE44BF99277D1C60 C0D538BFAF1B98A070CA1DD0A3DFC4DDB56DB9E4060CE2E6D9C73832C092F83C 4DF55849D43C5FF4AB5F6B30155B85FBCDBAE010E157574C07D23CB626241C01 D7C8324B680FC90F7475ED0B6A27CB2CC3914A0EE988798E5045E691AB1D34B6 AA1ADC30FF5934CDD024A48FED15DE29A5FD8CC7D0AA4D6435ACD75BFAA86A36 3FD6F891DA6709630A1616A6549A5A3F9AA929001C81C19421DB920C09167E81 7CEBAF794D0EEE6F1B1430812EF30CB31BFEBAF710982917E1BB081DE33D6A28 A019A8BCF82EBB6A4082A21CF7DD0E2BE2A542BC0BDAE9CECD7E068FCE31E979 83FD2982A8F7B9931E51777AFAC5FC80325D77D75EBFC151B95CAE4D5515C393 546F308CF8B47DEEBEDF4021DBC815163E5F73751D6CE65D98A5A73F40B5B71A 2532AB2EB3CE375DC7A2C1F1DC1809BA038DFCB8DEDBE914FB17C636844E8166 2DA6E770461132393890AD0F1D46FCB9E3F6E402CE3FE036DC3B188F77435F10 99F55F2C20F52288712BE6121552DFBDD7508056F74508619BBE8412D46A262E 06A8157CE1C6F69882E5BDD71DFD740F15CEE51F17E021ED66FD027A9A08EAFB 3D2E8AF81F83DCD8174D9645238845C38F856393F1F5DAF0B6A4FAD7FD132536 2851CEC1BA1389783CED5D163F6E216106E45619D2C7B058B0636982B97C2195 FE5A6CA1A06CC39CC5F43B90EB9611CDECBF26024D55867D144DDDF9C2281041 EFF469527CCBFADC881B2BA45764BA2E000E9E3F74CC5530304EFEA0430B46C6 D80BBEAD99B0D2D65C4FF31F6C43787AA90EB281E651BDA92355CEF7F81FB693 77C7717B6BDF48FDA9F9CE600B1DB18C3A8B6246CB69F3DAC87829F46A23561D 2CD86266B038384E715476A2E1894D6F3C70201A056DD1DA6F67A5A3297FFD38 6F27C19D65D62DE20D17063E30B13262CB98659DA212A30F116E0C1B523C15AF 7F057FDD228A48989399FC80EDBC8C45448447BD92C99EF376B04D00B42AEB82 4F20DC5C1389AA47B76643AFFF0445820FB6A26DCC23B723E3C6908C373A1B49 C103248B7C43218DF50943CE7D64355FADB73F55B04BDB83EDE43A1AD4651525 4CA1F7BEA0C1632FBAA718221EFC43EF658001B9AF2D1DD58810E5B4370DFE5D 2DF21C2412FA285AD1C5CE8354F365395775CA03C4F1591CF6708126F02EBC29 FDE88C2F92FCB764D4D04E89A6D7C54EC0A3D15A9150EC8653A2D8F3F0A9D1EF 59502EFFDD0EA1AF0C321F878E3431E2DAB47F866642FE6025D4A45FB907E035 FF2F8C0C2B90E77EFD38E65706CCB980F41705320D0A9C3CAB5266AF8E2CDA79 D53CB39FEB4E9FD6D385F270C154B9CDB91ADBFE826053B36CBABE23D277B445 9818D51CF33B99266065609FEE447604536919C50E0CAB001E0E1191DBB0AA6A 8D398F33B6EB5BE2834C751655DE691620A9C8CD83EDCD905220D53754C31128 F81282720E9AEA36C3015425DC37CA041D85F5BA15EC693CA5999AEC3B2BDA8D 4E3CD926E5ED19FA70A3508EE1F2DAC97FCD8508C2C3F41229CAA7B738470E36 02204AB2ECD2628CAE7A1F880C381AFB5821A0E4EBB1EFF2B8478003B2C072A9 DBD1885614A8A83BD9B1AD8B60E12BB119251ACBA34086C83A0E548B83FE45DC 976564F38008FB1BD80858731C34C9AEDB48B8BCC16909BD7FF245234F453116 799F7EE0F760D7207FD046B48AD3A2FF3E64A113A89EA5E8FF0897859FF4C2F3 5B9194597776EE4B83068540BA7E5974353D23C0197CCF010E11916C6A5A87F2 478EF56AE928686E4EB3EE69640B2BD2A9B88D34B8425B9D48F6AD9EC9454220 F328F29793B0E6B761885B09423EC043E75D5B11C1B0874F32564901DB45E07C 902D0761D09645B0CB805ACBFB8498392EDF9A7F9DD715616BAD7CA76EA1B01F B65DA998D43F66E1BC5C412C61A263469D695E018BA341CDB5B6DBC8E2FEEFA9 79C2C8D758F8219E6848F03900940681AE045493E3FB5192CD09D5242A21EA10 F26D96F1F13583811483DB02C07DECDFACB642AB7CA3317117379F0B1046B3F1 BBFD875ABA860F8343E7D65B865D19FA5FA5761D76D8A8D665699EE153A2FFAD 3C55B48945DE888EF3E13986C99E3FB8C6F0AAC19B7EB7EDAF22C6D91D421E70 B3818F8B3703117C0530D68C11C66C9C32B1F2F9482BCB0AD2B44882F3AD8C93 C3832A0DCB86BC0D19F37BC593945229B4DFC44A2E878419E00199838C01CA94 545F26690B2617AA39D1E822BF302F3190F623E365EAD46FDCDB9B2C0887C2BD 1CF20C37BA7565FDAC80E7495652119F8D18DCA03C3D48FAA3E2B2F5C704B628 D927A1E59998724DDC9FBA427759243140FC34A139A18D7042F5343889056B88 4C3653DF149CDFCE115E10CDB0C7779BA64848328ED240D8E33E2D89A50D78E7 1D01191B0CF48E93169E097C9F6A6BCC22D97B6600F387560B2C46BE8AFE390A C542E1ED1FB1CEC6AA9849CF9BDB4B242712316E3FB93894695E9563DCB684E1 6D7AB9C0D968129E3CFA2ECC10A12D678EA667083E444B68EEEA00E48533AB48 65CBC0F205A0D83A5CC3923547F2F5BFC90412CC70FA400196371884261ECDD4 B21DAB78CFF18E059ABBE2E4D3DBE599A6996CE970E6EB2FF21C9F467BC64814 FBE7244B1783F63771B2E8A556C3F158A0230DC6E4B08296631F39DC0B9CD4E6 6BAE65C9C7754D630CAC8807ABEF3C9BFEE42DE2908066552A17EBDDD7C6B1AB AE17ECE8FF389E6E33122451CFF607F388B26C51BD7C7C9B67993EBA231EF503 C8BBA8528B035D2304EC275610C9E80F03379DF31211A992C4C212725AD3C742 9829C2C7F75DCF33C4EB4203ED40236A9979850EA8F390A625C7897188C28A9F 75E5168923DC6742BC2A6506533C16EF8848B4A81B9436A6F9ACB74A4B2A4139 EF35B0CB377D0FD384E038C6DD3D2D05C97D571F640ACD2ABD59AC2A47F0EDCB ADE117F8110189FA09D3DB3D9A782006197D19C90A615856F343D730D2734B28 054C416D3AED8B2E2B5391ADD4FB80FB3D86CF15887AF17EFC10B687F643B908 2BDC95549CAFBF0DCB3B7C91FC8D77C8DC53C459B33AF162A55E996E9CA9C816 B668263C492A77D9DA47F6359D8F94145D782F3E58BD0DEA2990B15F0D12A5E7 D8088F2613271659A65C4321F3F6C1664E170F82988FC86E1D9756F907A2F8AD 847066319A99422B11E4333A154E7812F51D3C917F434F3C482D4C227D15A915 2FE169E00D6FACE67633EDD04FCECB05700C0A5CB1E7E86FE3DBEF6CA92C53ED 61D1B9C82D5D88202697718A7CB549E20E2D8F345A1FD0E8344FED5A4153369A 432E314E4FF3258D6D5E7C88795F9242165AEDB89D542BFCBEBCDD292ADD5D74 ABC3EAF92BA63F8987194952D86D751CCCA4F92C593400A3E3D71BD8380D4C43 994E5EAA77FF2D6E8CBFE893410D06BB5E750289F75D2AD7D14D09F8EC0D8308 0AD338CDD4EC7DFF739F8AF623E0032E1F949B8B16FE3AE8D04082AEC4E82C37 EFAFC0743D8215AD9448DA00685741E7DB7234AC38DACE96FDC42B68E496B294 36D1C944CD38590DF0BD0FCB1493176CB04C150318DF7224AA94FAC7B75B146E 45002B642F383685464040CABB368C75A0B99F724AC943E98AB6902E08043C3B 55610A2E9C0A16C47978ED60AA10457AAAED57EB7092953F8085A27E84366559 F6C05B2B94B0E6D30EF4506FBBD8FBA24606EC2A8FB8CC5BF739844E414FD4BF 1E625E11AB26018B2B7C5ECC49B24CF469D987E17C2F7F42BABB0663B0FFA90F 8C85CA371A0CE15A46C149777A21568EE424F9161C69B0BDADD66B7C90F9B350 96DD73C195A9131C560A64019F89983B9CBF6E96D77F4C1C545EF306D16C21EA 2E345BC1AEC42D5E9C7907BABFDE02A06C63915216C5C979BB972A16BC9E4A6A AF665D7A6F43ACA08A45DEB8596C646CF20E6336E3DF8D5FDB7527B2B62E11BF B7DC7EF14375957C58899055E2BDF079B18B7EE55794CB70494DD907899D6590 6866A37765BC269AED9D171850CEBF4428C937E743D3E17B8E658CCA7E0054C1 A61EF81FDDBACC610703962792CB38F6EB3330C1567CC4AF8191558C013D7004 91231FDA02BF8205E1CE80F9CFBA69188D989325519D18E2BC0548B39509F613 2B87F96B387BE73458BA47FD3696BD93694124CF3C862A13DEB72D3500E0A8D7 1826168C0862DBC6A7885B2E6227DB2E398F552CCF70458F0A2319E169A0C26D B38CEF8AC0BDB3B7F5F8B2BE747E81726F63DDD21B0B00C639037CF5DF4D5150 AA51C6BA989838D80656273223B578BD4EC25F17E5F42719DC49295A2BB96E5E 50E4D79B4DEDA7C96BBDD00FC274AC5F471AD77CFA945BE38682D614C7268DF5 01DD7EAC99DF0FBBFCAAA592244347A75F5BDA82F184826365AC3F0D1B7F9D79 209570C96A833AA7D5519DDCE26E3EDBE1FDB8B22E6FD5F18DDF26F7C5056B1E 5C07A037F38FF4AD103C76AC0C64E09A02A6F669D6F42FAA21A35A98B0D04DDC 838AF76A7E0234D82E9363090152354EB2D9EE62315C8C82F8EED34BF921AC6B D1B272B98F4303EE09D69E6E567A169EC60C7677A9970A33F203D564119524BE 1ECEFF3DAA9CF6960F8B195D221BEBC2866D700231CCCC50C3C68870E467C0C8 731D66566597A097AD9662D9BAF615E706578B7275FB54F91D27E705003FF8CD 3A0508E772CB0D4367FEC5851D289CF94DE599481DFCEBDD533265FB24448730 630398A689BCBBE07A4B9C75E481972B7D5E08259F814B343AEC057E61AB2D08 A1BEF5CC6090DE3AA991F4F69F140E40B44A6BD334ADD89149710D45D48879BD 5A8A72CCE19F014B956CB9AC535C93D6A6EA862262A25B440FC964298675D2D7 C7A30E9B31EEE3D278FCD1E5E91FE2DB91A612DA0DA240EC94323A3823A8FF1E E9ECC21F5C1C6946E219C3E85CBD5207F75FD0F394FE1E88105A65F1E25308D4 00499CC45FDDABCC94BE8556B6FBDB45A766A0DA7E15BE5C2572863D19FBC99B FC2666545D8CFEA6B9F8779BE13FF0BE4722250EE89D143AA4BDBD33B2EE6BEA 46DC8FE9D85DDF80F7A5BD025A2BC857BCEB007F6D9300A95C2BA08DDFE65B37 54A6B05E6D022B83AF122180CE9087F2D582ED92939F055CE6E50AF1E8318B77 E6E51C34B6D1BE705F3088A6FBD423D461836A3AB6706311A6A243FBD9A38B4E 210D108EC5D5BDC044263FC4C63A05F802B95997FD596B2D38A06FFF45DBABE4 A7514918979675E195A5FADE86C76E46B30377FA3D8AC5090231F3E980D6E3E8 5ABBECB1AD2C1C5DC3C33B655428FD3450ED17CD11650C7364FDC64B00D2C393 D617D9BCFEF6015416E4037918498E6472351651B55866A363DECBE06E8419F1 7EC3513D5901E54D8EA53BB749EDAC412C2EF4E20E459DE7958BAC6E9B87EBB1 D7511291C711AAA1CAB6ACF64489BBFCBD6E77DA61BE14A135F639F118D191A1 36DB214837F790244ADC2C6B5FC7570DB1C970E0C7ECBC04C6F3CAD0C651B049 88DD88AC763F137252DEAE748A6BA030FF17FE5C0B0B1DBFEA7D6917ADF6AFE4 98D8079B29B6F21E751631A6DAFD6508522D0987989B98F64D9CBE0FF7F248D2 1127FD79AF23F53596A34E05D48836D926E737993312AD02E906CC28DA49484B 7DE58833A20620D898AB90A1A22F02A204C41CAA09E4F4FA7D5ECAAF197B1E7E 44FB53CE7B01C5137CA79CEE3C9C0D513B74DA45111C16373EBC5B3E5972D89E 943C9A8EE6BC351411A4AF6C24A51683D573753D576F56A1B2EBEBDBD2C5AAB8 36CB04845EF788491FE0A54773C6073C9A7CCBB1A36A717BE7E1F60BF3FF14B0 0F221739BDC9BEC61B6F8603B57DEDE147ED90CDD44BA44CE84A6D55CE68DB96 F0E923EACCF735E5494CDE5026817EFBFAF3D450400DF7D46D0150B4F008675F 566F3B698A26122FCCD2729F82DE4D97776235E36403CEF046AAFB7E79BF958D 8C06EC810F2CD55AEDEC922EB58AF6F924A35CC62B99CAEEC7657D63184AED65 E0A078F9AC5181271558EBC6A226666AF0F49117777F293E4A4FAC7B85BCBCFF F1BB838152E768D10FD5787A152F1621C417D9D7C146E9169DDC690D2F8D3895 175FB027A458981803BAFB68410253ACCB6547376DF85443C0A7804609262B1C 46F5E0F25D82057F9607A3107963D222764DD0019710E98E70368E5207DB2A29 91C1C1B38F09EF0DD7F5ED1B853423C10CEE1866E43966D9A386A4B792BCA4B8 D1D3D0A677F9DEF92C44C432BEBB94283CBC2534CA3F7B7DC561D2BC65A1C284 CE1C28A936118CFF7A3918F568E7528BE579FE901A43836F65BB6B927F53FB19 92B69EB34CF01F9D3CF36AD4A18823EE1082880E0B7CB380FAA924CD9383BAD9 0F3F2F248133CD7168B14EC00A4F9B36BECF82F6DF67B175DCF3A368126E1B44 E1FFC9A1334299FCE8BE0EE47106C5AAAEE08876813428B16483FA19F4AEE06F ACC49CB355EE54986CB5CD2AF64D9F841C1D8681C784AD9AB8B8082A7370799D CC3751AEE4FBCF165CDD5906F198F45A790126C18E611B939764C3F1323FBC40 917F266FDD165831C27109DC1AFCADDDF2EC6931DCEA1BCC48BCF700701D9454 5E45AEBB4BCB6C8927AD88594F2DAB66289530C58706618DD9D2F99572A7A0A3 154499DD7A2F8B2C42346B428F52FD4749C1F6A4100A5A9E0EE15E86F83EC1F4 A60DB177C35587E7736EAB2B851DCEA64BF64C5FD827925747F27D1A79805AE4 BC701DB45941CEF57013A510F1BC29E01B268CA7E5A932E7469578CE92E63BB8 72880EEEAD0FB57550EDB261C21A3DC3AB5D142E3E7E38778EFB9E00B747996F 206BCBD69A2F1FB454FB302B931AD24FBF00E43D9FBC64A1764F70E96C0DBEEC 8F15FB8FA778D444363AB4DD944C10AFD6242F013E24E28658D8D636C1765F42 1B61A4078EA525733A8AF7ED8E9D7D74FDEE80A1170D58FBE798F51DA4762A63 37A373D20B6AE9C7FF6C1FABA1F092CAA05FB45CDD94ABE6C2712DBEA49DEAE8 BAB7F9AC1850F496D35B576832B8F7A034B1B0BC6D1E547865E371DED7585CB0 B8485AC8B73300D24B351B2A904EDB4ABDF0B000AE3CB3D3A5DFA73ED18FD47F A051C4144634E839A3797F21A9C877941EE8A76F3239D56159F41645A119F7F6 A3EE89100531E26305A6AB0289889BC0D7D4BE5390FF1139A1E28962769234DA 6E8A3696A9E4DCF0BDE11CF2B01C1B 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMR7 %!PS-AdobeFont-1.1: CMR7 1.0 %%CreationDate: 1991 Aug 20 16:39:21 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMR7) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMR7 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 40 /parenleft put dup 41 /parenright put dup 43 /plus put dup 45 /hyphen put dup 46 /period put dup 48 /zero put dup 49 /one put dup 50 /two put dup 51 /three put dup 52 /four put dup 53 /five put dup 54 /six put dup 55 /seven put dup 56 /eight put dup 57 /nine put dup 61 /equal put dup 65 /A put dup 66 /B put dup 68 /D put dup 69 /E put dup 72 /H put dup 76 /L put dup 77 /M put dup 80 /P put dup 81 /Q put dup 84 /T put dup 97 /a put dup 99 /c put dup 100 /d put dup 101 /e put dup 103 /g put dup 104 /h put dup 105 /i put dup 108 /l put dup 109 /m put dup 111 /o put dup 114 /r put dup 115 /s put dup 116 /t put dup 118 /v put dup 119 /w put dup 120 /x put dup 121 /y put readonly def /FontBBox{-27 -250 1122 750}readonly def /UniqueID 5000790 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF5B8CABB9FFC6CC3F1E9AE32F234EB60FE7D E34995B1ACFF52428EA20C8ED4FD73E3935CEBD40E0EAD70C0887A451E1B1AC8 47AEDE4191CCDB8B61345FD070FD30C4F375D8418DDD454729A251B3F61DAE7C 8882384282FDD6102AE8EEFEDE6447576AFA181F27A48216A9CAD730561469E4 78B286F22328F2AE84EF183DE4119C402771A249AAC1FA5435690A28D1B47486 1060C8000D3FE1BF45133CF847A24B4F8464A63CEA01EC84AA22FD005E74847E 01426B6890951A7DD1F50A5F3285E1F958F11FC7F00EE26FEE7C63998EA1328B C9841C57C80946D2C2FC81346249A664ECFB08A2CE075036CEA7359FCA1E90C0 F686C3BB27EEFA45D548F7BD074CE60E626A4F83C69FE93A5324133A78362F30 8E8DCC80DD0C49E137CDC9AC08BAE39282E26A7A4D8C159B95F227BDA2A281AF A9DAEBF31F504380B20812A211CF9FEB112EC29A3FB3BD3E81809FC6293487A7 455EB3B879D2B4BD46942BB1243896264722CB59146C3F65BD59B96A74B12BB2 9A1354AF174932210C6E19FE584B1B14C00E746089CBB17E68845D7B3EA05105 EEE461E3697FCF835CBE6D46C75523478E766832751CF6D96EC338BDAD57D53B 52F5340FAC9FE0456AD13101824234B262AC0CABA43B62EBDA39795BAE6CFE97 563A50AAE1F195888739F2676086A9811E5C9A4A7E0BF34F3E25568930ADF80F 0BDDAC3B634AD4BA6A59720EA4749236CF0F79ABA4716C340F98517F6F06D9AB 7ED8F46FC1868B5F3D3678DF71AA772CF1F7DD222C6BF19D8EF0CFB7A76FC6D1 0AD323C176134907AB375F20CFCD667AB094E2C7CB2179C4283329C9E435E7A4 1E042AD0BAA059B3F862236180B34D3FCED833472577BACD472A4B12EBEE7A75 BD0FAE1908F830DFFCCCB67033BC24FC3D56B2B8C3C1414C20B53F1FA71FFC55 02A4164AAB4B6571AF2FD686DAF310FE0BF0231AAE141D32F16CEA1F9DC6B26D 802CBDF15BD67FC1ACDA2D58C624DB01DA6ABCF632081F1CDAC34B748C5137A7 9609EF390129C29415E0EE7E1871B4A83091163688028F0CE828F6DACACE7B2E 4895132F00550E30877CA968D0EFD67BF5C15A31BBE28C632BB3E0083CD03A67 5608493F1E2288F7D766367C8F4846D3B5BF0E1855DB6A750E411A957CB72CD4 8C5DB86BC8D0A2473A79BA64DEAF4CD9566A849BBCE7F50A7E22BBD0BBBCA2D0 DD3BA7205138C39B256DCC6749810427265E36719960D64133C733A1E6C07C32 98620234F4F67D9619FE315CDAC8689DCD9EE0E431E46A3512C0007F804BFC00 6C158E4536DFD9A6381CC322CD994E781B9D251BCA823C762383B84375521D1C 61A0F41F43B75D3184B3C6894030435DD35FF4DCC07A1918E1F8EE9F84269415 32D5E6342C0B8B9559364F2D1271D4B686D83346C3D673917E9EF89CAAA83C26 FB93C9E5FE3B3FB8E9B760B6FE3A3D69F371DB9E060F10179911936A87F44723 7B172BBE234BB1F401F1CC97C105B73C070AE095D4B56B91D4D5291500D8890B 1C0A52D80CB75264D0BBFB02D47C9DCC8569FF816D6A8D144323C56EBFBABF5B C25644064FEB8F10733BFE4593470DB410561FAD669C7F9164F206406EC7FEBD 2CC0457541EB7049619ADCFE8174CAF35B71794FDEC2100911EA3390B87973BA 98B3DD1965CF2D3B00BD69CA402270B62B9409FF48CD282683A0D260A23DD8E7 40A555728D7970C7C0304469F3B3CE4CD3E553B711417B9C87F8E6B49C0C16A5 2CCB71CC23B1312FE06652D88447C9F901F40208ED6F538829AA82BA27788584 4C757D33809E12143DA891517F889AB39E85FC596D9A063B590B22A1191E6DFD CC03FBDCF6D45395C97C34BD37BAFF56F7DE0279015F3797D2C16D4F3A214977 BCD96FB0322D3F4D53CDBC28A272A26EADC98B4CBCEEF6C511042930DF12E3A0 C0B60905E69A87C19B28DFF2320E2F1C54E5B6DF5C03084F1C505E456668B3AB AA81682CF82477616C8187910FCEA36A6FA8CBDF8030917582A78D324157F199 9F87AC3E7C5400ADCF2C071FEFE85501AF5570BBEB2D0F4932C4ABAFA461A18C 4C1AE307F42B19CEFAC3B20ED31E1291354D35A9C39AB9D8D6ED11C1F3BCDB32 98962002AFB05583C0B3BAE8BDC5125148F7EC757ACC3E0518B3FCEE41761E74 5E64266078627F7CD4F9557F417947960F4759CBC847AEEE7623A412BBAF845F 5051D9C7E9103648A91B44CEAD485DF6E2188AEECFB6C8E86D61CF1555AC25DF 3C7103DBB9EBE99FD07573A5CE62164286329AD5222A711F0C2C9DD91936FDA4 A4946BBA3BD3BA33F7266F60688F38534FA2A7B7169218128591B9BFADC476F9 F1A9308D08A73660675DF9457D5C6B963E168FC70C667B684B32DBD6DC460ED8 C3DB6242B834C36783B892DFB3510A0312F5968743B8AEA34433EDC046E4F6D8 EA7FBEAF0EC37E4BAE1BBBCB06FC888842D7B71922CC5E9E71CAC17C3A03CCB4 80D195373FD7419564B8A001F4D6E03AE519965F25B73D43F21BAD8D18C00E65 FD8D6A4FD033CBCC15CEF17238AC0B6CE296EAD22F7B5B5207B73394C7936AA4 91E7B70D2462707A8B1B34A145C4AC457C8C50DFD1BA4DD8009BBF18CFBE2336 303A4A69715B17B304C8CF8B835A95C23669C51192078E68453C3DC05555AD59 778FDD53805BB3934AE8BF115857EC15D3F2D8890B304ECC02876487EB3F876E 175C698E8D5DB7D3CF4C5721E1B33AD062BA07A10837B24AEA8CF4D62AC90234 26CC3E4EECB498A0BDA6C8D07A1EF32AEA62413683FDBB846562DBFFFF2AB2E8 AD622204B0DD5D9E5F762DB75CC467A3867AC358845A6657F26B58C85B43E67E FC21863940767EB78DBED4D6ABC289A9439036BD092F7128AFCD59146B06DCAA 30B4612AEDE3739D05FC97DD40167E83BA53C6FB58A7DCE690FC9CB412B4B88A 5F29CDDD3B68FC6FBD78FF0549334F0135775A57CC717E5980FC9C1BCF12E5F8 40E10DC0ED807CD60C726A17DA696BBF34CB3A3346AFBA3924831EEA2ABCDEA8 12BAD3915751E1417DEFE32964A40ABA30B3B4A495CD5BB2B33CF100F7B3594B E6A6F096734995D2E7F0C7C88882FA7BE90DA86BB1827BEE830A18B25483F53D A368EF5D94648CB1865D6E30D7FAFCCF2C1546776B6866150C511C20725EBB15 38FB5A5BFC771BBBA788776037F0941625DBB666BE66751DA0F6A2E835D9087B E8445E32969C3B1A6084C86E3ECB2A58834B2645FA181506DDC28FC4A43059D1 03C69FAB51A9CEA64F3582A403D80D66BEF42C89DEB37554C308A5A978B63DD8 2B7720A67995129AAAB156B58D01B7C5B348A316FA72CE69DA284AF0D91711DC 4C79B1BBE5FB93E0936B27BBEAC1C0973B68FA3DB840D553656CEFBFD825C4F9 FAA32AD697739399A11C79756016336B2A1428F77083D536215FA634F52D7F9A 69EA116575DF7DEAD174AC47A709B0A40902F4848DB5A5F8D35F3B79024F12B5 C788064E4ECE2F4B65F9F6C1FB32BB0A82C81B179907552E6F0166C11E1EA3C2 3461FFB39ACE3523B3305E646A7960F25841DB05A32E0ECBA6FC5602D1E16F55 1A45F50A667C9D320DE4CBD7C743E720D3AB25C0E81BBAA172D0380F45F5BEB8 063707D6907B2BEC773FA52E488AFE3107E066843BC056D989E49EEC8A731569 65BD43FCF93412BE8040A914EDE5C50BE5F886829BFE5CDA0708EAE98C803755 B4C3E4A9AE0D1077627ADA482C600BA9F081B3F440C048D5E1B7E5DF3D1B9CF2 D1B5697D808734338712A05D43B3849192B593DCA37FAC04AD5AC9BAE6DE80FF 1F6EDAB654476359BD12EAAC478EA296EDA9D3D2EE26B5E49E733E225935A527 D05077E80BE3CFC5EAD72EA12D46E755D3B263A5D32DF7792857B3F9F57A46BB 1BB7119EAE066C9BAEAF40A70D8EED0D880C8163EA3062FCF82F06FA5E221CB2 9C74E416973091D1BDED6A114F0E44F0B73E929FD9E26074CD669B7D0FA88983 D6E22C62DBDB4AC091296568FB29788D73CEAE4E8548ADFA55D55B0C43639827 5728393ACD295694B88785A1F510736E4F7E5E3717598FCBAA032785FDDB8D64 FC8D357A100FE9ECB7F4E0F41C19F17AFD5C192FF1106E531DBE99C85AAF597C AE2AB01155502FC018C5B8AA8080F5A0FF9AF58867CC2A8F2693B8B1A9E598A7 9A66F8D930DC558CB7514FC0B79DCAB221C9949222EA9BE24986B01E4CAA82D8 D22AF2D12F47E5C8F8FA92BDED66EBE18C7D14A462FF660AA2214A48F9F6F00D 91B6AB97984F2BFBC15969EB1409BF59ED47EA758D457F4B61494C3B274AAC68 97D7BE3DA226772E8559C70419294A34C7789901DD57A2F1445681B7F15A7697 9FB1F6844CF63B484A68FB4D7CB173ACD49851C900C1B72F77419A88EE60B265 F8C28D3D76A29CFBF091A808FBDC4827A0BEE3C6E08C83EA064108122210A340 9AC9B61267B8286EA38F63D5BE937120A2FEE3ED339859CC7F0C6128614CC97B C9D55E02343047E1E84943E0149FF876A29BF6F0150B57A94BC98788368062ED B25F01EFA4658E7BE125770A7CDE1E34D9A47983054896B9487CFE140C767BF1 1E0C21C3F8B5477DC4617494021E257A7BDA20FB466D183AD18705E5BD3D055D 2CBD5F68CFF9E091A92F7BE3FA870600080CF4F58D8902D3689CE5438ED16A03 0766023074E1066C2C94D9C6868B8C3852CC3146010A04F0DB24C484DEA898A2 9241F025FAA0CF0296025B298DE3AED606518AAC323614600D0CA4E7DB58C414 1073E86E6868EF974BAE75843EEC715DFDE04586ED366563B707B9882AEA47F7 8B9BABCA98BD802EE696A078902B3D88935F149733420FF44BB4E935E090EA91 6A13C3B8C3A548D3C89B6EB226E48148CD9F72D4F70FC1203B543E16BBA8B42D EF928EC38DE04C81CE301F77F30D06B5E0ABBEAB7260BA5F65D9E5F97266330E F4CE60BF077BDE0E396F679C44FF7ADA64D1ED6339964D622E2D9068723A33DE E821F9170D73EB05A55D3CC84822602097F53E8EC7078AC3AD7A4966CAB3D3F0 02A576B51FA1C7525829293ED3255943251002F3235EBE37D3EC8CB37BA71840 11A8079E6F7FAD6690212BBA6A0455650C5E2BFDB310E6A2F11C2D4BD6D7F6A6 03B9D7919EA6145D98AA1E1F406096A64F88E0846AFD123AB8C014C870710AD5 5857D04E07A22904CEBABC95D99DDC5BF9F182D44461F9C4A369D80A320B3B5A 4D3C71372E47000E8D2960F716C8B2A8D10F0BA48832BA9E2E7F572783310637 00B5491F65F8B8D5A5FC467F98E5C7F95D4E447D9935D2E6DEE62EDF201FC0FE C00D9F96A5CE097160EC91C1BB04C530CD13A83EB2DBEDD805EED7E6C4F15EE9 804E68F670B4E2E5074AE1C01D75D831E1E4C86CD0D90C2EE168DE137114DAC1 556B51D0520DC670C8C3D581049F71D141011845CB6E6EAA48A53986AEA24BED C34984A9C4D7C77B16258E32E0DFA0C3A5DF50AB9773FB23B9285FFEB85DA3EB CFFA1DFA357DC5CDDB6EA68B0B6BF181C7A4E6EB175EDB65F865A9FE7B3B0CE8 EDAD9C4B2636B52615BE7C887DDEDB764A8AF8B7D434FA5E9D5F890AB96FF8A2 DE663B0DBCF88DCF9A3DBA5CACC0954F385C145CEC85F265DFBE63358580CA0C 3E201D3F4B1F6A7DAB64851508FDAF8DB09D34C7559EABC7CD2783183E27C236 E6670C724F626410AAD028E4DAE8EAA9852E302F4F70BFE966CF331F1C55B00D 7E486C9B97EBEFF5B45D0BBEA4AC49288D6F23013CD519CA3E88B57F4B0F1E49 D4902753C3951125417816507C11F1A16C172C837353583C27A0BFBAF775F072 83FADDCDFBEBAEDFEFD930888FA94362D7ABF2B783E1CFCB20800BB6804720C3 60575B1077078F5F993876631E599F31DB33190D6C4FF4E84B4CF301A7A968B4 8774891C8C97A2A054384D91DDC92BC1A0A08266ECF956B9FE64BC587D7E8839 D7958F45BA189A2435F0B5B5900EFA8F6E8DFE497AE630A604A7998FFA7A3001 93812FDD400EEF9A7B350A4AF34DB1818ABCC4C0739EAEE94B6E44300B633771 B4513038593FA385B5A4258312D5481094523C979160D3940D38D2F9E51EC031 78C8EFA45C88AE52BD459BA4A7A33B901351052F75ED7DA48C8B7465CA61FCC1 75746F6BD9D428623F9097F86234B567C3853150F9206208BFB38CA1363E2C7C 0344FC88A592E940764F4D3AD7668CC49C921382636228C5EC8B895035E1ACB9 15FC18ABA4F703D5790A649B4F9CFC0BEC3CF84262294547527AAB980C3619D8 77E4EFE15DD1284CB2E0EBFA6823E83EB73DB54644872689175EEEB485581111 6E3E8D5471187C17E5045E398CF64EB6FBA3962A8E70DA70DD90DB0498AE49E0 237BE3D02B7D62717E551E6E685B460592B50F8C8698549AFBF95BD5154F809F 67B8B7AAA9794CADA40D4B20B2CDB57C3A4F9A8B128BED0110E4C836BBDE00C9 BD6FF5FC90F09CDBCB2B8E062552D9B25B0A5F28D1ED27004DB071188A3928C1 1D88DD2BBC21A92E0563172511BFE3688D8274E5903E175717AE274D95DA82F3 0A7E0905F29B29A500B3E56BC6D7B4CC45E8CB24EB7B05E2121CE27CAA79ADD0 AD45C7D9F2E3A2BD51A2821B559FB8F70C26EB15BDEAC5C2019E00AE472E265C 2082BBA55DD77BD1DEAD907F18825E65429752880984935E7EFDFF6BC529CC0D 7B95D35DF7396A2F4A8C7336755FA11CDEF32C7CAB8ED26908818F337CEBAD50 6E816B76D1760B31872D4738184A06759372DA651EA965B5026DC48CB4246360 D5D4ECEB796E470EAAA8C7997F8E5B17EBEF6AAD3E9E6F883A83D29D5F55BC84 727970ECA93FF4053DDB4DDE234F5B16AA637B24371F83BF2356472579ED1C74 444FF3AD4574B705E742D097785E885C6BE4337DC3D5B66F5548D02DA7AB8699 14EB76165771BE0475238D7A121C691B9F289E2EA8C4DA72CFE91AB27A57B0B7 483507F9B670A0A6DC47EF2E63C8B067E453243453018878148696474B8BAA10 780882D451393B12009BB005F6FE313E730DF0ECD82D479C5081BF6ABBEEB867 B7C9785CF9B91DADBBDD1CDBA0B216D463C90AAA21DE7B1869FC5AEAD62A563E 6EB218EB0B5008FC682A2D371F9416941871926F7D0A5E4EACB779A520E8B868 193D4A0ADCFCF137BEB77B599D95438650AD2087276FA55CDA2B5694EB7ACC6A 046E75BDD381057F8D8C23B916422921512C649740A852CA87A3B858E34990CF 045A4B25765B2F2D0F6A11248273963BCAE8C2127B4AA9C05028C03EB0CD7655 352C41E93ED9C80A98206DF60F71AD3B76C5841FDCDFF525FA4223F37296F4C6 AA5C8323BE645CF2918D238D47917E7109C4BF0D10A8AD257C8FCCDB2420B3E3 C759BDC05FDD98794434AEC24F8F3129EB208804FE38EE9D566A4A32A2B06474 7C33A3D0762060129BEC7B5F52E8906D0C1BA5BBA881085D50F0C334AE24509C 5F45800B18A2D19C72F433D254A172681595855805554E49D2BE22967E775B61 123FF098BC29BF537272442673C1245EF6BD76C9DB66328987BAB1ADF566E16F 649A2303874B88B738F2E611D1854A5932421B0375DAFE97828891A10390086F 887E11AABC787E42D244FBC386381CE52A38DFF3B1313F3AD10C59CFA22FD584 29C141A1719BA0FD1F904AEC531069BCCF9CE18655981ED472074C03522A7A6B CF8CD53BD95286F4EB12DCFB488438275F29CC689A2CB9F63711900359893785 C660CF110A1B82280E388D9B4B3097C2EE47C55F33E92A3349BD4AB8E4A7574F 263501A4F059B3E2B6DC9DA44CA96BFB7A17E8CEE6AD26D1106B0699A583E964 29C46482860A3B124A7EBEC56F5A0EACE1F00221F493B547BB6513FEBF0363F5 50808D776AAFFD064C5A22C7BC2FC8C48FD6B9384B38E2A9F5E7F7331E9D3B78 D259589117A732C729584715F4B4F5E933E3D421638B7E7F1AECE2A84BB77BB4 C48869CE3146C8BD00A3038A6C4DA7910D751DB4B9C9AA1435D862364222292B B85527DC39A8B6F8BE4A2324688B562A81BFC491BB058233D50A963EA0F2BB90 1B0DDD17B31DC778ABD9BD7D0EC43A6DB8835E526947FC580710086563A69CEC B5020353E9B6901FBB677B0CF137C3466B9795666179C6FFC9630993C1ED25B1 8BCBC9B75F215C3CA12F99B494CE35625F72BC2E3E5DDC22DA81DD245F1EEDAD 037FF5690DD24BD6BA60E28CCE5787D4A5DF66E9045D1B2864CE3352C46D0DAD 212976AD4308E340B142FDE6F962069A63F03AD9B1CE12B4EA1617619A0C687F 3A497197CF03A8B76110F4F2D304EC58074EB5883F6007A381C89827678FD3F2 D8B8CC48871A6A13F5FBAA0A32E3C9E8D0BBB3E811F8C8650DF92E538C5E0382 56251F8F2C6DA31D53A2863B188D3B7FFC8B5DF79B84F6903DE5D845D0D554EA 32F6F7996BF771385B058E5B737EA7F637AD38B543A8D182B8FDB4D2F15445CB BB9E67F3746D0CCF754B3DD0930D08105290B94A11283085442239D2C3EE2352 CE237BB3B95D98CB75615EB5A0A7A571FA856950E9093A2101A5655EE23F7DD9 E193AA21E226B40FB9A34569ABB7C6136A4D37CEB5492D3DD62827E0881B7463 48D3714595966524D722023BB6766BF9682930BA046ECB587143755ABA4C4558 A7544674ADD033E56442FD1FE281A5A358EB851A14EDF6C8A5AB7424D682C1EA A93DFF0FDB6C7091E89C30AA3B37749438159F311EC77C75235969A778E83857 C37333E56E38FFF0744879BC2445862E69AF85B52672A666AB2F9488E0715B99 F497488909C825089A209E30CE7EA2D2E7646387DE328D55A6FF5A38052E7979 8BC2C16BC3B0A5CD004874E33F71A9E9F788D5CC803DF0337C3059D5458F5AA1 2F384AC6CB932DF2BE46BD374F04CE600B13E4EEC2068E25433F811C86689D36 D9379AAB67FBA67C70A9289A7A91418FCC5EFA1C45B4083F51E77DE8021B380B DCF0A6C7E8D2CF478009567F7A23CADF48BB03694A8D00AB7FD9C6DF0C06FAA8 0E1334FE76A5EAD0C0FEDE06A6851D7F047197245C35B7F67550224DE8A7419D D49A85FFB2F603DD6F61D4F28257606AA7B41DB3E29A985BAE2FD000DC772A14 6B31C6D09B63E6E74D56E5CD6AA477036623508D5390FA7D036CE0EAD978EA91 9B43317523B9931911C7FA070087CDD6EC257129878DDBCCB3229389B238D34F 10120124671E4E33263AC1D419DB39DAC9234F99BC303CF11DA0E6F4BA64F96E 24DE9FFDEA45F696F21F9AD7CE2F862C1E5428827561764DE500F48E7F367323 F9318696FCE3666C8C9C0688F627697771428C299C857982AB83C6BFDCDDBCBE 97E5AD47D06733E5EA67F7036A3ED879431EC1AAD20AE1D2DDA5B7B5662CA565 A5B3ABFF6CBA03D1FBF3E38AD98EA6C543C27A1AD5DA0AE919EED60F52537F6C D6134DD68F45493B7384262CDAC7E2F20C4D1EEDC2772AE5F731D5304FA02310 B616CFAD1EEE4C217F4EBBF7B437A20CCC3ADE1C3DDB36B697BF2F2A19D609C1 91EFBE68D7089777A7D55D3CD9E7352915ABFD3BD4AC5BC7EF0BADEDB7CAD6C4 410D03BE54B70AE7F9E9CAA1158CA0B0054BA4CA5E58ACDC637F01191321BEA3 90E1B7B9130111A9713D941051E92EF0A056D3E070FCBFB6FDFCEC3323589554 B37295D210CD98C1378D50777D80DE6FEB4EFF71AE810128C204D2A6B6B5A1B6 5258F0928EDE55FF76E12C23F4C0093154F1146A781AB99B752B717039E7891D 59CF9EEDCC93812B0ED94A45ED2A47952AAEC93791F27ADAB10AE1EADCC712A8 253691706CE90374629BB2496AACF1FAF7E7305D43B4641CDC806D8A0E813044 D3E1B1AA8E956C178ECDD2EACA581473AD670310F389BB28027BB825917C3F82 B8B8EAEB6C43999C4533A5687FDE663AC288FF8B5EFBBF8819925A32343D3469 3124A4C875D5B248F2B1CFE5A4B5CB1792FAFDD3E356E5078E39D89F13CF873F 50F247AB016F05D4D66D292C5F78BFE4D8E4CFDC8E7F294B3B9B5A16518124F9 0ED03E31733F75BCC0533882C6AEC0A24B8AB319B0C551C5CB6526EDE8C60757 81A88B0EEFACCA147FC74C2D715C6B30E13A3D48DE391BF6595970A578EAC846 7DB1ECC5F752CB1B259C56FD4ABA9B336E88A6A3506883D377D5C12F5CB71EDF 9E578188FF69BE66E93DE5CDB9C2F01690499096EA9174C95F8B7E71A3EBC08D EFB2C768EC0A763D0C8904C8A11484C3D4B33AF69BD7B11F221A762FEDE639E8 519F3D35C3A6654F53BDFF637E205695457414395A4CEF38AAA5C5346ED16033 6FD6FC922796391ED1F406142C8DDE7511B2B981A464BFACC397E3E84BC5CEC8 A5645D3FEF7F24D2A06D9FB4A7A17C27DE948FCC1127D6665ED0858C1C340FE5 29C9CBEA90343EF2681BBD229605FEB6DC7393A24DFE5FD403B8E1972E8EACFF 94BF159F3420EE93B55BAE2E1B195C3C4557FC6757A196FCA1078DF97F273E57 0061D7E515AFE96BF97DBA984C3ADD8CFB09889C5CFAD1F82E2765D1E5BE5892 FFE083DBF4F48FB44DA7D111DABA8CB4A6376F43185791BE7AC50B20EDB31636 1613D0993782ECF342F01B4C7136BFD7816F8BA5CAF050F65F19D5942D6C3663 81BD5EBA9D00E6AEEEE7F6C05C5E95CB9C97DB31B4D44B54AFF838163A2F6D67 5E21D77A3E55B67204A39F28108F9DB7CA92CCCBC20CD2B18B99E7D01B376E12 679947EC6F9C13961B03DE1C377A527E621520 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMSY10 %!PS-AdobeFont-1.1: CMSY10 1.0 %%CreationDate: 1991 Aug 15 07:20:57 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMSY10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.035 def /isFixedPitch false def end readonly def /FontName /CMSY10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 0 /minus put dup 1 /periodcentered put dup 10 /circlemultiply put dup 12 /circledot put dup 20 /lessequal put dup 21 /greaterequal put dup 50 /element put dup 91 /union put dup 94 /logicaland put dup 102 /braceleft put dup 103 /braceright put dup 106 /bar put readonly def /FontBBox{-29 -960 1116 775}readonly def /UniqueID 5000820 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A 221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A 27D1663E0B62F461F6E40A5D6676D1D12B51E641C1D4E8E2771864FC104F8CBF 5B78EC1D88228725F1C453A678F58A7E1B7BD7CA700717D288EB8DA1F57C4F09 0ABF1D42C5DDD0C384C7E22F8F8047BE1D4C1CC8E33368FB1AC82B4E96146730 DE3302B2E6B819CB6AE455B1AF3187FFE8071AA57EF8A6616B9CB7941D44EC7A 71A7BB3DF755178D7D2E4BB69859EFA4BBC30BD6BB1531133FD4D9438FF99F09 4ECC068A324D75B5F696B8688EEB2F17E5ED34CCD6D047A4E3806D000C199D7C 515DB70A8D4F6146FE068DC1E5DE8BC57034F5E81DEF84AB9E5382F3E6B5715F DF7C70F5A0FBFCD627713545CD2F7BF03BE000B484FBC808AE5D71F2419857EC B194BF5AC776B9AE3C54BE1E828E0E65149BEFFF4D6D90076101D9F63FE3E917 886E40F2678A1544FE2C15862F0401208CBE20A580F8A1CE9B8DCE036969137C 5210057F66657E5162B67C0EF5BCC24509088F80D18DCB5DDB6AC2ABAEC14C88 568CD6945074E3BDC610B5D2E4C0397FD013510F6E370FF82E87753C5DD67B14 A74AC9A6C80ED2A7BD030529A46C962842048377E367003DBEDD0769DF48E2D5 A27E79B9A7D451D9C98478B10214109103BA514154CBD3E44AE9197BCFAA25AE 204B07DAD7C06F012849199A3BA342EF7E27E495503A3CBF703E6BCA70975363 E281C69BEFB4AE958DE6EF1BECDB089DD06AEED6AA8C1475345F4913B0677D27 2B8028FB40ADD6737494BA08E08A3DE897579BD10FE2BDD44331C2C8FDEEC73C 54612182B1BBCD6211C7A23367EDE47EFBA048E3C09408127747CF56A5E99033 BDB8C64E5EF251222F13EBF0C4624B8961F694AF666D4BA5DD121DDDDBCFCE79 ABC0BAD3B168C2255C8B9E53CAF2766B7EE4912B6AC62BDB104E5E2714F1C90A EE2031202C8E8AFFC0FF7F32FA0E0D6F9232F2F791F8050B401DA8BFF77EC443 56646513C72F976B54F3AE51C0DC88A21E2E4DA3C9B1709A907BFF96680E15A9 8EBB74BBFF27F234E77D6666DB6F0F9E7A9F38633F0AB117C98116E04E285B64 052C10CCA44ED14015A8700B3F806C965244D378E195AAF492FAFCD0C83DD4DE DA1F348E78B4CC2A62774697245F30179C288E3762F2FDA54E18DA9A5F0F644D 43990E6E2A2A43D58AD34DFFFFDDA1A48FB8940BE6C2F61030BF10B849E3324F 52165AEAC3AD57801478A6EFCEBB94127EE5CA4DD76EFE0816B194BA97D8258C 4C5AD1271FF6584B0305BA1D853C2F6044A14D5A3E160C58E9D0C115DE1316C9 6BAA892297E26B4CF573316AD3CF86EACBCACF6A35193B45DD7090E38757E664 596749E98EC36CA82B95A725355F12DCE810356331EEA19BCFAC8A5E14E7C41B 03B7D24936B9CAE811A7CDCAA3FDA8DF3D36AE61AB96CBF407FF4166340655B7 5A54B6C0B635D6CEF54F6DD8ED9ABA7DDA5352DA571A5ACDAD0B3D9526158F1F FB5811D76D28216481D5DC6462754B900CDFE618CC9E3D20D14C5FC1FEC60AAD 8F833E517542CF593646E69AE3B30CC122BF7778316A20DAB186B9D2F34BFC52 965EE18076B8C1408BC441665F5CC53450F9E8574988367B91DEEA2BDFACA1E8 E206DB1E68D872E2A4D4DD690636B3ABC7969488F90A701BEF624B66E7D9759B 8855CDCAC60CD5793D0EA1A93B8D7A4BD204969B55A2BC8211F2EBB35EBE6D59 E49873C6300EABB4D250F03F133D0BD4436F25784BE92E9502F3A54DD3AC5F4A 2A8D9489995EC775170D6BDC4B07993DC7CE2751C669759B379248B2BB4AD4E5 B58BEFA2F97C335F7F7ED93160ED076CBB4E475A1592434D8277949E6BE01929 55989C9EC517AF427145BB2185723A649D7EE328A727D5AEC7BC392E5D3F1730 039683650C5078B685EA737AC49E10E8E7AA5A4B804ADF231A65A085BE605047 FEDDB06F638A19ADC40623E5D6026F646B2C7026377D2C039C25AA09C6C4BB9A 2ABA874F4B7B8B304CD83D6E898F3E90A64A9D682BD873C932127361E2CCD278 4DD13C56DC59CCEE843DCBA1730997D3882355A38CDC5ED17659BBD4BBE52E96 F10B8D0A4C2D273F6848FF5D48E23AF4C320B23425D2B545A41B8A566D17ED33 6733D8B32103B9EFE101AC7C4A088BC06B19663AF1D67B0652810F6EB295B407 1B062DAAD432A62B9D77F1B486ED51FBFA7CB7E1CCA25224065FE50C9195C73A A70ABBF033DE256DA1DF2754A4E38AC06CCDEFA9B093C2C3E3337BC0B10043B7 9F0F3A7CCC88188B248960362107BACB1F6F0FC9BF8865CC6E8DF93D5441D6C7 E49D8E72513629655D2FC7A67A48B1E66EFC0B960DDE72B983A60855B721F307 32E69E22D75980115E7EEFA997F106A0828F7E5C0BA51B9E87CD9AE45D2281F7 64FB00FDF652E73CCD72EADDD00F63BBF659F9BB165BB6BB69AC1B7BB5ACD16A 7A7F0C4DDD97B083A16E01A202ADF685B4BC8D79E17864A2FC7088492415BB67 E6B48BB3E6AEC7EBADE21A41E64C52ED5AB4267D0A2597DC26D19878165CBF20 99FC937512D08A46CA237B868BEFFF3A19A3C8856E6662C93116947CD9614EB3 1943C8C9C2D409C48BA7148573DDB03D32406F13F993A89046E320F9818FAB07 CFC7EECCEEC3B0C7356759EBDEA4D3F09F700ED57F58280E62CAA6FF81C0851E 698057D3F36E6D21BC5E0DF18380BCCBD9B7C85FF256FFCDC2646B04F6B592B4 0688DD60DAD6E8C11890FB7CFB18F2B15F2A54907EF0318640CAB5F5639ADDD1 1753A5F5B30C2848C916F4A4A3D5E6D241B91C15BD641A98750DB8741FF56BF9 A9FB0FBEA698A8CD621258A3A5EC389C1FD8F4C2CC0BB5A823B76F8DECE21650 83C50D0EB9F7 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMMI10 %!PS-AdobeFont-1.1: CMMI10 1.100 %%CreationDate: 1996 Jul 23 07:53:57 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.100) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMMI10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.04 def /isFixedPitch false def end readonly def /FontName /CMMI10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 11 /alpha put dup 15 /epsilon1 put dup 21 /lambda put dup 58 /period put dup 59 /comma put dup 61 /slash put dup 65 /A put dup 66 /B put dup 67 /C put dup 68 /D put dup 69 /E put dup 70 /F put dup 71 /G put dup 72 /H put dup 76 /L put dup 77 /M put dup 78 /N put dup 79 /O put dup 80 /P put dup 81 /Q put dup 82 /R put dup 83 /S put dup 85 /U put dup 88 /X put dup 90 /Z put dup 97 /a put dup 99 /c put dup 100 /d put dup 102 /f put dup 104 /h put dup 105 /i put dup 107 /k put dup 108 /l put dup 109 /m put dup 110 /n put dup 112 /p put dup 113 /q put dup 114 /r put dup 119 /w put dup 120 /x put dup 121 /y put readonly def /FontBBox{-32 -250 1048 750}readonly def /UniqueID 5087385 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 9E394A533A081C36D456A09920001A3D2199583EB9B84B4DEE08E3D12939E321 990CD249827D9648574955F61BAAA11263A91B6C3D47A5190165B0C25ABF6D3E 6EC187E4B05182126BB0D0323D943170B795255260F9FD25F2248D04F45DFBFB DEF7FF8B19BFEF637B210018AE02572B389B3F76282BEB29CC301905D388C721 59616893E774413F48DE0B408BC66DCE3FE17CB9F84D205839D58014D6A88823 D9320AE93AF96D97A02C4D5A2BB2B8C7925C4578003959C46E3CE1A2F0EAC4BF 8B9B325E46435BDE60BC54D72BC8ACB5C0A34413AC87045DC7B84646A324B808 6FD8E34217213E131C3B1510415CE45420688ED9C1D27890EC68BD7C1235FAF9 1DAB3A369DD2FC3BE5CF9655C7B7EDA7361D7E05E5831B6B8E2EEC542A7B38EE 03BE4BAC6079D038ACB3C7C916279764547C2D51976BABA94BA9866D79F13909 95AA39B0F03103A07CBDF441B8C5669F729020AF284B7FF52A29C6255FCAACF1 74109050FBA2602E72593FBCBFC26E726EE4AEF97B7632BC4F5F353B5C67FED2 3EA752A4A57B8F7FEFF1D7341D895F0A3A0BE1D8E3391970457A967EFF84F6D8 47750B1145B8CC5BD96EE7AA99DDC9E06939E383BDA41175233D58AD263EBF19 AFC27E4A7E07D09FB08355F6EA74E530B0743143F2A871732D62D80F35B19FD2 C7FDF08105847F13D50934419AC647CBA71DF74F4531DC02BBDA22AEEA3FBBBB 407E0ACC52BDC60D01A29407CC4F93EB8BF6D4813E9BA858D54F38918AC82720 4956D50291F0546E50FCAFA6DBD0099123F5ECD4AB338DB310DB4CAE11337A89 8ED99B6F483940C97544F888EAF0CBEB11094A13C073D0061808662A04A82BA0 AD35E8782F854AF66C20C0FEF18D0ECDD1646321B93D327E53D88CA0E825FA95 05AA57BD76812AC2FC80B948E955B4EB78F9CD1C101EF885E2809AC4FB63E072 3FF2732D6A06D24DA7777CEA111526419E912DA1B5D669AFAE15ED18E3A06AB4 D4DD303EF92234FDD9D578DBFDA2269703E6BEBCC988ED8C6DA1DDBA7F37B07E 42178F41E371A7619090771782DCE0843BC43216D8DAF6A8B90B941C783F942D 3816051C453FDC8743109FF33C4C1E46BEAF0CB5DEB5397A10E70D2AD3E6FA4C F930684C82C2BCB4660940CB88DE42F75E2635AF58077E8C05E6DD0C04B0C64A D713C1448195A1C591BE392C5029C3A5D13E65ABB0152CE98B194F67A5C1F350 E2FBD58B8BC48E1F963B59FAE07749D194BB0AF398B36CC62C2E7057EEA98770 7758D83853397AB2529116DBB3FE2546C2CB4E674550A208FEA258FFED1F57D0 93FD372690FB777E36B23EAF7CB8030478A9BC67CAEF8A28B0DC4AF07EFCF9F8 8F6BD6EF34E18BCF4F2A0CCB1BA5A56B0F0D7DF37E7171D61177C1184418A1EA A8FAC4D53C915E66972AC93E556CD5B16C6E4BC5403B13E74199E3C72A9367A2 9B5D3B26FE12222CACE2E1E239163A4C73CACEAB5B8489DC93CB02DF463F7B5D EB665E5C6A2DACCE6527BB839EFDF8C4F912917B66C8278BAE9894AED68E7718 8CE6A15C599F5C9383574FCD5816E7FB74F63795E2D6E0786A1514D67051B705 81D899CD820CA10B20A0292033E89D7604CADF6121CD2972EF32D14C233B3A68 EBFDEB31B1A51E10226FB3593110D7DF62C0673BF714619D21A31D3386DD7E42 FC986ECA9C5021E4E42896AB630388B80E88D9FBE6B7CB03BE2963EB5B18A751 6EC1CA7462CE4699264BC7C545A77F28CB7BC6ED85874CED66093C0DBBE976CD 7B74E76808CB7ECB8E96AAE55B75C408717B29DC89C2299463318B5CF12CDAF6 78BCBE24997F973ED8E120337BF3B49DCA524D1D7C7C46C66C4A5BBBA2B10AB7 35A65E57FECBD618A7A4F0A846DEDBC054D90F379A293C9D205A1D7B57DF1B84 AA03B17CEB9C7B606193BB09AA831BD5C16C19835AC40F8AB855606B77CADC97 8692467793583677E7A880325348A625345D6A07FB0375DE6D5A690EFD83F87E 8C18E0E8FFCFF80625A6C618EADC6FAE57D490A77AD0A2952CE98FE2712DE291 8F114BB62745ED2F34F1D6A43FE4666D46E525F3B1DA1E514D79E48CF03F151F 76DBCEC97A90CABF8194A49E6E01EB1C06BEC85C95A2E99C4D56EBE5640C9607 D88B1DE7B2451DA8761183E7C7849E96D02B445C8D0CC4ECED5DD9E110A9A8C9 6A9E3C457A729F1DEE5C14D13270AFC9FED8A1C12EF387F655DDE1CB1D821D6C 36564597BE88993D0FF600EA179F1146635172EA4D94B589988D70CC8C271235 547B36605BA045A8BD4F62AC5C57DC46F656C080B14E7DDF6F7DE2644DD64301 BBA4C31FC5B8F3A626FC617C6E66F25A1B466264424E91A1F7E1594503488D57 92AA14F6615D82DD080ED86347AF17DF38AA311C125CC1251E5E194F8EEBB43B B27BEB0754AA2EDD919AC89B89AF0A5E103601DF8A17109B84B988FD560D23E6 A34FF1780FEB597603BA6AFE13D02D049B39BA2B77F9748CC3E4649390CDB129 FDACC5A87793ADDFAF590A45077833B2E6E339AA7BDBE8D7927C4E86B551827B E1BEB1B49B5E541001925A4295D2FC245EDE4B672F4A8C4C754149D45797E1E8 3FD88D7B19E3D42B7C7D9D83032805355BF55C95B940D735CB55D42C3BFCA4C8 CB42A798B1AA9E86907A09BA281013F5A69DC737E4E0F022AACFA597F7DB26C0 47C3B662D1A1760351D125D5453EC78671ADFFC997536856BAE90118C3431356 0393C7295E619336BBA5C52A62D1588C566CF588E37CAD1CABD72B85C1153B29 481CE5C00FD452191016EC236C354296F22BB8EC660A8E1488DCEF835EA9E73A AFA7308708ACE95D8420934B15FB3195490CBA5A7CB6DFC4F4E1651D54E97FD8 F2403F4D14BC1E93FC55A3191E01A1EE00506BAE00F6F7ED15F2BB754D79BC4F 0C2474306414FB732E5A15BE1C26C680961F33979D1B0D6F6ECE8118F8250FC8 D1D16B81F6D69E4B7F8008E7E06825511242881FD179E4ECA80F1E8CD8C0A426 B323391657E3339FA734837B4C35DD5F8442AB12B35523D273C9110000EF90CD 33A39096E8145B7F60B345E449DDF7D713FD0569541796088F2569213A2C78D0 49331C9A28AC343E185D251C1AAD70F8EFBC43513C4CE9701C3D60DFE004C972 2320FA399DE5ED14C6AE81B275F7B94B99F87F623BC2B6A4A4C99E195A423337 169F5A125345DE642A8FC15C1502A0C5FAAB92609A05FCB3B15FC8EF1579E03A 95B746151F34D73C87B4DFF9AE5E33B71C737E4A96CBC7681A881421DDFCF644 CF6DFA37A06C09E0BC4FABF17DAB1B5FA19C6E1E467725A39FAF9489FD4D2698 313D2363F5A69C921322F134EC7E27D0DB09F1F0C6E3F707C1B0C28CB8482C7F 95379895F185EF4EB581544523B9CF37CDEBE8DEDCDDAD870029B746EBEC8FEF 995E30C2C7148458BFA612E54C02E02D195C3A107C839C6069C1645FBF2B189D 689C8934EDB8DD844631584D36C4391E2EBF007C4E8BEEC92F26CD4C351B19AD 94788C6DC4B0618E10DA11599C56F6630D2D1BB58FFAB702D5DCFAA9E42C6E9C 75759ECCAD8B22E371A27B6E4C0EDECB369DD5A167FF928A3E3C0EC2C6E81D94 1224C36EE432A4ABD4013518662DBBD0F8BBA3DF769BF9CBFABE0E043DE0C02A 4054368A35FC02964CB04AB4AEA111BAE8D12BA48340BA7685F6959E727A4A0C CE7579F2659D27841E4DC8FD2F0C060A7A230E137DF28EB7F3419079F7388D6D 33B321E6117712B25C5E8F845CB5547ACC667BB37130D2632B3F3D1F7E0E4A95 1D3A4BA3940E6D1FD47DDAB46F00CFDAD8D5A64BC657BD1C5F175C9155DA8395 6BF408D7378879B91AFCB3443060BF85EAEA80723F7C99D2AAFD5990772A8376 2977A2E61DB7B443CEE883F89A307B721BD913C1D9B85C3619A1DBF8F80A2A3F DC180CA14F87C6D05939ADAFE17F01235D6FBDE4BEB054BB29473FBB4EFD6F37 5714472F3035935D5B59D905C34A9A868AFB602FFBBB6B095230097C4C8C755F B2E24C50B534B8A7B90028C58C9D1C5DB7E115C4738A97D179174A04B3F736BC 457CFECCB9A2B2B44662D5EAB6D01343912DB18D8BD990FB670D83C7E8654B72 58761416A1A7F3C01070E0040D496C47E1385A41354AD2FD539C9DD740654FCB 7E72A55463DE3C06E09D3E8CF365E4EF5DC27294C99B193869671F4452D5C37E A08315B5A39938DC4C9B25F1233DBF49E1A6FE1EFD40451E512A703EDAF83078 5200137B637258FEE6018F208EBF25F0AB0DD66694C9DF310F2975920F325229 4AAF78934221363EA050CEB9708240E4D6ABA7A743E0AE0742638CD5D90C34EB 274BB4D0E4C747F5C655780595E063877C4E11390382073A5D9A4B918DD7DC8F 867FC876F8009C3EDD038BFF79EFFCEF3BA6EF73535C5FCC33677FFFC800BE49 0056DF3C6CD419B08DFB50C47A5F3F65B5DD8DC73307A7BF5D8C198880356DF6 8D0953FBF93A74B0114B191463198834E09AE1EA1B1A7FA48F4C0B35912E42DD A8AE9A74A212BCFECE056B158846945B3C923C2B2CA3872EB2CF1E1599477EF7 930E37F689E46A45C03A65EC684AF7067834E7A2CA61D97F18DB4D36EC7C1B51 B1E952E68733F0F3F46558F06332599FD0227B24628EF22867F03DAE1B8946D9 2E97A283A9CF614150B92665D2F4C9DBA2F3C1114FDCDC69A0C454B3A678B2EC 6DB56469254D6E0A168662AE4128DB732071F83BE470A55DCF011C3EEBD7E728 5A222180F3905D6846C98CA62F5455A11C38667D7287457C4BCE43843B9BCC02 3EB237D198F3889E72262D93812C33591CCE90252133A05A7039E93D71407C3E 02296AA5D039129CCEC1EF62ECCBD023EDC9E6CEC684C462E3C4B87C020AE6D6 621DE4EC6CC72D3389CF339FFAD7985543585B85757DB0928A9F50A4D626A24B FE40422F0CE1A7557076291515E6748E308B96C593A3B6C00B15686EBAEFD733 EF7794D56E944D432E9BF6176491E9C9F11DCDCA310C828839950B70E63DE612 A65300D54BBBB131EFBA074D00A645F1705BB57F927DE479222897EDD138D70D D7765365358C76EF379E097A3A660AC57CBE27A09BCC376E04F9D1A857346795 3FCEFDD45B0BD6670FE60AFC9DAD8BA4B719AB442A2C6DA55718F618371829B1 C83277D2376963C154A98D63A933AD360291DCDD0A4129A52D285FE4B5E21F1E EE67E61FB02F5C875DA52897CD54EACB62F826C5F6FEBC54739B6643C24883F9 7B0A0F6166CB275BB2949292854A21A90F6D1B102D7F0D9B8A0B5BFA87F09BF4 FB3735B728CF03F3FCB40E33737C2D3E721E525243C9E9A5ABF46F29825C94F2 F9C61B0B088A75F78E43084B49A5B5D6ECE158ADEE824C47F4CFF5033B9F6495 9662724542DFE22219A81BB59857E3022A9CA25EA4B5B5BEB4AA778B8D04C3BB 2D59499171ADCEC92ABD163E4978B8FED7C203F622630AFB869743133246D6ED 9C6F03423CDE473D6CFBCA4CD0E69D606B6193D95D0DDB031D075B8E42215CF1 0E845E613F0192D4D3F8BCD542683DCDCC8D825456B5AAD7344D23B2BF674917 8F4D78D82DF20AA18ACBEF31187CF7905A401D0D192222DEE24DB71DC4432654 8F4F8F593C74C46FA72F41952FB6BDF6F28AE97B093A2364040982CB209DC647 43775A8D18FD95B78677EA243A909A9DBE647A58EEC72FD83B94066B3D621F0F 80C27A71916571A73B06A8A82FB110EB8A625684B93F6B87DCB235CD9FF20901 CF2B9EA52A1B7E355932EE3C0AF8B77E5DE8CA09883EBA29000AC925F8BCD5ED E7B67CEDB70D897D5D5160D62E9229AC6E114CBB05C4B320AE540D768464497D D343A8B18EC5F3C7B40E4565C9F9B43B04872665B3E2D766A55FA4680C17FD28 A964E35045E65ABBA5E6A28A38707979CE3ABE5C0C19087890A4D8D74B8C1FDA 2CE6A776A584F16C90B60197AAF455E3AF0B9EC4E57D3EC3DE8ED83BEF3A1604 59EE46BED335A4D0E48424F4810DB22D45FC937A3CF99460414FD1B33091CE09 5EEAD85480897EB8C992EED4F3FCF07BB061774DE786F337AD947AAE1F43BF27 41C072C51D7474779A8E00554A8A4D06BAA48CA31A5BF54D35CC00449A824FBA E4CC236462FC31C81BD73D8D52B55C35DBFECF0FCB53A59E7D2B7E680B9A59F0 663B69E5A2272C5077A4BEBD975D01A8BBD65ED614481A7C46D9CFF9D461FBBA 2D1600EFE972CC0883E909FDD8A2C23B156CFAC36FC86C25ED6394C4B1A5FEC7 59BC46127A6960E4FFD6A5FCECC63FCA3FA15259E832425971E84BCD0FE00CC9 4EA23824F2BA44AC192A0BF23AD3FD28DBB94FB43781940049F97C859C8A104B B087D7843F1606FBF7D494A7A43A92C16D7431026C00D951F407672A9CA38036 E0DA30102AF93163F52B94BE426937F9FC61795FA5AE51046FA3891DA4C0625D F4A6AD00E25A29FAD5BF99F5AFE5BD47B7911EBB437A09DEEEAB97C71C1782A1 7EB134ECCF2362D8CF829BBC1C701826D8325E8BD6FBDFC3D3ACB0C1D126297B 715F334616210053D3F6AE32BD18FC610C1BD61977AD09EA3EBC0B74FEF4D793 4DF2BB8ED0C09FA9BC344AFB2C006EC7711A3CFA4368827B74A7A68FA9AD9FDB 9B9A58B30D074A5F0338D47EBD1010E0971A80133C3CEB7487D269F07F7032C4 1BFB772C2DB9DCE59D07411628AF3749FC060EC8CC275AFC21CABA0ABDFD1912 015F4CF99CF4CF25479DB5AF45903D3344ECC0B7E42A146B790AC0D48DD21015 FE8465D95A3B74EE90238D07BA220FAAC6DEE6406A8522FDA7EBFC79DD0D977F 606BD685DE8FAA3A38366AA7BA497E3BAC2E1ABD0DE4833A63B3CC6FA035AEA8 E02F6D4F4124637B65CA2CD55A6D1FD527BB76BB4B3FF23353F754E84418DD9E E02AB1ACEE30046FE19B0976094BDD7AD085DB20DC72E8A23D65B12324F6B89D B042B569AFDBEADF0C01D428552C7CBBC85C75B76224ED0168DACEB0301841DC 936E9835CAFDB868C952D798D08846AD5A4C480AC97AA57ACF36022E00862C0C 35BFF5BE38FEDA253785A7CEEF65E62D25996D694AF567B7B6A76D45C6E91822 D62F07853DEE9C614F726E175C6633077FAE47EB51BDB0757B137C5E3EAF6585 7F14AF080B59B89712C91265BE5DD472B929154AE09430B67C4689CCB46AB933 6966C0837B67D496117BC5DEF1604BCE91C044F4D8091AFE1D2F508B9FF66D17 155911B771422988F304223DEE63803E95480C2681A2B0B2DE7A0A982B78A733 7F749DFE788DFB1F736A2AEE3D70EC867881709BEF4040DF6C821987633AF5DD EDF699F017909865B67CBF6AD96B266BD43EBE7F90B67E595F5E8B3B5A8AAD59 716A81447038563949F756E8D817D621D790E30196B59A2C8F33FDE664BCC878 6A0899E6380FDBC5FB69DF2CCC720A15E9E9637B81256FF4F4AFBC12878416A0 D6FA5E03DFD48367CC4459731C70402E12B383672BC86E712B7AC4E2F86873D8 8A67B24D64A6F87522E108C7C056C31AFF8C28C8B8EE8CF9BA90F93DAB3C9103 0D1B8574D89EBE9FC03075E1B6FE77032E5E5FF4F38FD0621B6E4FB3C8269955 5110DCF0F90E2517F79EA1E11756EBAB1F5244103CCF5953F3DB4A4201AE2EC9 D62C07219C06BEB80B84B8EA4887A990713E913518CFD522FE5922843A762B81 98F0EADDB9C8DA4D0FFCDC1E95DD9AB44828F5D3D07903F2130F3CF1CBD2B426 650D70C8FDD877F03E0300E4C6AB388855C7490C12BC1B2A5DE1C516D8DD15C1 D3EDE832CE4DC8AC0E2E53C18B0759CA9863B56E11DBEA7274259F7008219566 F502F9D70494AED28FA6976750C9E1BA07183F4AA6CA7AA7E16800427BA9A77B 8C4D4FED01C028F992E661240A99768D6FD0A4B0955D089D786F382925E6D0F9 F97F6D315B7BD016927B3B9A02A10C20AD6DF434DD351D743D66240D2B420D50 5FA6F6517223D7310E913B6A7FD395BCD5033948C88A4AD91ADEB11768624612 2A7FF822BA6CF282FD74D6904F7E387EB9DCA7463F0899671BD13DEB8BBB66F1 33F3B59AE4CF507A007CE8DBA09F0C93756B16C6EE0021E3D779854847D5F1CE F401A716E2E82E0EFF24222F937CDFAB10B19A2AEE108FD06B8A951A5DDF619F 9A237B9E10D7602654F55447A36C1CC46E7E5FA6020C6DDD9268D20DD4E61945 CD872162FE8225EDA33A76E0A1407F5E8923AD4D05175DBB9BE59009268682F3 ECE0A2217FFCE71BDD025EC741F6941E93C201CABC119C2C3F60461C95BAB3F7 62AB46766EC7F19659CFA3ACCECD9E2FE3BC7325188ABB8DEDF254A2AA104BF5 B329349552F4E33A7EDBB28FDAF25DAC0CC1FF73688F4A1FA4860A4772A4B3DE AC83262DA028AC3F6F62481B902A33459384D8BE5C9343BC949409FB6BF169FB A1FED9F14DF80D34EFE33E714DE9845D9FF7D49B09BF9A98F56FF1AEDB885CBF 58E996B2C3BDD0637E811AB8164513332FF7B94AB5391081EDE4B0C9B70F5C84 00888079BD3F92DF96ACA80D8668BD3766B20751128CE2F0244D69D6165CBB6E DBEAB452C3A4B88B57B782945D0C72B0EB33DA3B49BFEE511CCAA08096F53D24 33C3795756106C0E481031F999725A1F4F35CD586E15466054EE4441E84392FC C4F97A16FDBF3DF50A6F42A35A2699E5DA571A46701CA8C0F4BFE2C41482DDAD B2200DADEC51FCDA864CD5EDBE302C80BE3C5C2D8C922472A4407398D63944F8 9BAE0D5D01DBF24D57F39DDE1712D65EDF4F9587A155434142064A01A48873E3 6AABF2DBB05A052D35924C7CB849681B187723A045DFBF036320B0CF9945825C 52F9EF289C9EB1B69C139D3B4FC3D3B37B8E676E7A7C25E4BB1E70E8A6B2FBB8 198A79B198956121503F44378CACFC286ECDC7C02A6B8C36CC24F23448259734 36D5747B6B625CD83BF95D38FBB200CFC4462ABAF063D57C9CE712CE5E09A40F 91553C46C4D0D6763244C40626B7717F2A846A6EFF6E26AE690A76B765E7437C C43619FC64A3F9FE65B2BF54C125B438B8640A90FA8F131731C273CF3071698F F68886A93B079498B56BCA76EA900C209AAE8B11A4A5536BA070694594D5BC3D 700F12362305C47D84910F40D3A0E4763B9FAC0F56F32DB1E71F166C1F8D3FFE 853D3CD4341E82EB225C359F504897EC718237577D587E80B453863DFD4BBDCB 1F401E3C4B51C397920E9FA682191CDD9AC1D755F043024D411721D73787DE10 677EA94C7D1322FCDDBCFA4E764F18138AB7415B139C80F23833944AE11494AB E89678DAAB85E354048BC841F3D1F1D7A70B7F9B9D2C705D3C4F74B0B0FCB645 BC0FF8EAEB6F4A33106BCBEEBAF61C984F60CA8D1C73A635E6396C74AE8AC1B9 721C8E8F7A66D79E53425218544F1F03CA9DB62FB42FC7E126FF5CCAB035C062 C9468EDFC09F61F8CFFD953244939EE5F113865A39E6827DC3FD83BDE38C9D0A 8681ADC67C41BDEF494EA4BD09E030EB6AFCC595F9C4274E37473F619D8AEF32 E0645B39C7CBD4E2CC1E76BA45BC14188CA6318083AD223DA089AA1C04809CAC 47C06D6445278DCB76AEBB84768D6ED7165D75A8AC97E60F1AD271F4EF23B17B F0250A52C979795233C68C4C7DFEC4B83E4693F4BFC325DC6B033C96344F7098 1225214982F74514A7C750476398C914EFB4935F4CA4D209E48A6A381AF56160 37CEFFCAA205C54E7A63594F5469BD472E1FABE2296723D387D098BF523479FD 9497C9FB3552A196F3B335ECD7EF2031C110445FA6600D434219A87196956F7A EE44FD1DEC0A87D74B4946DB3B7149E32C9BF1B1E67E9462A95B93E554AEACB0 F5C60649054F6C84493E6BB16400F0B465C083A9D18C5F062E795FAFE7EEF4B3 2CA59A8B75AFF6820ED91F8B5AFDC0649E1165504BE5DE3DFCCD20BC07DF004B 7FC488F3D8168EDD535CBB86FCFA5921A856AADE2DADA770129D8BC7D3C71DB0 68782D13EE593FE2B4F3480D86D7EA1D7C6213CF65D572706BAADF8031BB4418 69EC1EA2131CCC2D4AD1133825C951842C488706F5B25806AFDF95259D620A6C EDFDBBC1E65B1F6B818ACA80A219455AE8DD5BEA8FD7F3213347CA5D3DAE120C DFFA7899ECBCA0A280A92CBF69910D1249A3164DFBFFB9AA1D149A2D11814274 AB067D6A2C8A9D24E0919C0F3FA5A91619A7E3ED2E18DFEB17D930F224C7936B 12A448D098CBA57E56A94E85A72908AA2CE40583797BBA4B55C473834E87635E 980C5931550366D5F3579E133BB879DC9ABCEBB865D897DDDFB022656A7186BA 24E5EFB2F6D0F945F25DDF3F20E211DDCF9940134F0226D681C98A58B4451363 662213E222D128ABE22CB6682CD1F3E446B0933EC17A7A649D5B7AA9A4977167 B22BCCE5AC790E753965C60A9D5F35BEC7E450F17925959F5F8725B5B6AD1054 88DD9F51194A5538089CE4289490EAEFBD317DA410DB57DC0BC93D9838D46D07 9E9017ACFE63E2907FC07A7BB563AD676F1969DF51444695F7D18D70EC8FB9D9 6BF5A76CC932D0A8A881FB17693712E2C8492DF6906522EA5CE75B061B762636 855D002C154E081C33887C5D472F501733C02DDE797D512FD63DA4F6C9D24D89 23C6ACC95F29E0600A2DE4E6325B453C8649F5B5DE9E80F00B83760DB1A7B9F1 A5055F35EEA6D9926EEF432C79264DB8F5CEF12904A498133F5457439A7ACA32 8E2D027B12ECCF3A57E30A615F2805B5706092848E69896E055BEC44060DCDF1 E0AFD11B95119CE560242DB88D7668B782AB505A934542E8CAA6ABD0A638C55F 32252EA7D1056738A52654FB3D2144472A53358DED7C7750F75B556AFCD4D209 65219DEDD921C2594D405EAC2336DED354B8C63F217B508E5F034406462A0083 C8B3AF5FCE74F7A03D00CE3B6B64A0E5A1FDD488202608309B18F195C5CED088 DE397583C803A245E9B327E039E46C722C7FA99ABD6EF5E16FD25EC7B1C0BD6F AE82F050D2C3819E61684790D445D69BC149037D7CF6F8D14FFAD9A893C979C7 A62745C1140982D49EDE13DE8957588A8BAC92FCCE2D61B0D1501CE511913CE5 36AF47D2BED3243190B4964BC66627F49D33418BFA36B81FC25E9D79F8E719A6 62CDC44D426FF5DC8D25B3A0226970D214F379DD237FDCB2FBDD994CCBD68A54 6A776A3DCF5059EAD0A8F4FB00C3EA214E444CE85FC03205E9C22D6148AFF074 55314B3DC4FA89E6B63D829F7EC79D099195E9194553999C7FD0733BB98A3B55 CC8B823D4FFC7FE2DE92C38C69454858D915DA621C3F133CB52043436DAB4B2A 52D12B1F93DB4E87B86E3333A7965CE05F084ECE5E8DCCD8CC1B50E08F99D3ED 3DE065EE57F551139DE4ADB010CC9C2072CE0B081E4D4724AC0907567C93C98C 038EA162FF12F33086AF539F9B753DC77DE18DC32159C9A50A7A6A356939DCD7 21E4CB933E8099430BAFDD29131A313156A8B21F85B4890E8E87B23EBF1D63DE 798BA22EAC2F50A8029BEF24F54AFA9C140C225567A7D2DFFAD862ACFC67EA07 A414D0A397D4532FA58C97097FC2397107B1D545FBA98899F18464E46A58AA46 B83735E4D1C3D710A88004DA942E9F33C21A1CEEB2E05775EF72523A02D232FF 42D5C6EA6D73539AAE4378F257528E7EA4D2D27C3C240E8E0AE2B1C19F1316A4 610701DE586113BBF85262588C18581CE620CF5639D12CFC071921FD139E2E19 4360703EE14034C534E509EE239F830EA558A0E00FC43D84F9275495697D284C 353765E7B6E5247F8B2F9983090A630F8F6B793FB36EC45ACC243E92761F3210 9377D73B875FE5D1C74A8CED1EA61F264C5700B5B11270355C2E948056FA659C E74CE534E03AB8E17D7FCA5FCEDE49455713DD78A63761CFE4EDA8E00C498974 4401C799970350506BCEEBC6AC166FF02C131DD253E151653407DBE4FD7CD719 F0EEAB8A7A2E758D76F55DF6EE4AE0A81057E32D1AB0680F13FA5640607B6150 2AB35ED455F9E9422525C092F956C34DF72418EAA2FA7F7BD9A46D3BA891995F 117D51C17608F5EC05A95A686E7B08E518EF5F735C296EC8B04A3749B46D2F4F B93425CF1BD1AF87C6B986054CAC23CC38D8ADCFF08097357863E28748BF7F31 6BFD7487DB11B37738AC175BA96BC89D5C7B6FAEE0F30E3F01F02DB8991C71F0 5796143DE96E6A629EAEED895BC80779F4B64920E09A7F54838A0D37F57265CF A9672BDF64EE7F0FAC47FB57DDBFA280AACBF793CC92E767FFD625558E865589 B32562D80C8C384AEAA2F75F9AE0241986F2C9735E1B99079D08F0715DC2B22D 163F4CE59C732E1F1772A132BCB2D6484E771934719E4CCADB1E801597DDACB0 766D88C97D091E0774FDD5DF7C58FA8E068D9BCC45D5A0E16AB3E270E855BC4D 765308A5F544F421D92BFD84A6B0A2495F8DB5BF3AE2250A04E24FBE29C41E92 D9B5119E0F47727C71BE84D62CABC90200A03B1AAB710FE71868338BAD5A7DD6 DF819C5E623AF31DCEB1FAF0ADA805FF46C80D9F8E7392AD309963B0BB0D213C 93529045BCA5B3DFD742F1974A2372742FA74560421DC639DF259FEC912B7ACC D57E24204981DC301D6526191A826A00C0F97C01FAAFB79314E66F17BD07BD5A BE814355EA01DB4AC5FE26ECBEED3D2074DC93F0C9A44C5CAF4EE65B1BC163A2 1A95217BD096370621AD6161F46904D7642D5B21D310C94D7C6902D93636D0FC E1D2C3141AF7201F0B305F2BFFFD5D72B20E850986420DDB30A23008D8260B5D A2F80FEC463EEAFE632BB41A6D381EA80A941C6A6C236701F88075F421139666 BB0A44C61C0918A6417B762DD56D4928DC58EDF3EB2CCBB415899F72D86441B7 E4D09FF17AE8312F972F93F81FA4FF47E8773EA72EC03944EEBC3269F5B34DC8 725C9D66C48F6C851770B96E62C2DCBB2F990A4F9ABD3181CA4DFD7852F8C509 2B516B9F8F0C784ACEA597E9FE941E86286370A3EA5B870C012D6D63BB8C3C89 1E271D5668061F96455C991696DB06FA9BCDBFD758FF76A51DFA98F2596EE926 C5BB817FBF860652A2CAC79FCDB3EA98C803673D4FE3651BA9B7A7417B104D9B 236A7A46F6F3E70F65E23B89D02C9D8404CA6544E01D46789F242B8208926F80 12B1BB3E39B66CA011339DB1C67E6F06B1C63EF69EA1612822B0E1DA17175109 9C4398C83F1236D6F10D0635A7C132FB9773AE0F5724E70B8765843C96941495 598F60655DF8C51C7552FF9C57B9984354337A43BA80D698BB317884657DE5FF 5608A0EEFEB22BB07A15EEE53CB07F9B20CF9F3EB5744CABE703F5E86609F5F2 40CE6C39535307735BC61DC3A7FD7290F2FAB76D0D000FBC0C2AE3960C364208 10149CA5F3598D4A3D12C587E43FFE8C81FA6EA36F2285A4D44A027C59E74F47 89DF379234D1791F4482ADF03E8972C51CBC5EB8 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMTI10 %!PS-AdobeFont-1.1: CMTI10 1.00B %%CreationDate: 1992 Feb 19 19:56:16 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.00B) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMTI10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle -14.04 def /isFixedPitch false def end readonly def /FontName /CMTI10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 12 /fi put dup 44 /comma put dup 45 /hyphen put dup 46 /period put dup 58 /colon put dup 65 /A put dup 67 /C put dup 73 /I put dup 76 /L put dup 77 /M put dup 80 /P put dup 81 /Q put dup 82 /R put dup 83 /S put dup 84 /T put dup 85 /U put dup 97 /a put dup 98 /b put dup 99 /c put dup 100 /d put dup 101 /e put dup 102 /f put dup 103 /g put dup 104 /h put dup 105 /i put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 118 /v put dup 119 /w put dup 120 /x put dup 121 /y put dup 122 /z put readonly def /FontBBox{-163 -250 1146 969}readonly def /UniqueID 5000828 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 9E3948FFB0B4E70F212EC976D65099D84E0D37A7A771C3101D6AD26A0513378F 21EC3643079EECE0C9AB54B4772E5DCA82D0D4ACC7F42FB493AA04A3BF4A1BD6 06ECE186315DBE9CFDCB1A0303E8D3E83027CD3AFA8F0BD466A8E8CA0E7164CF 55B332FAD43482748DD4A1CB3F40CB1F5E67192B8216A0D8FE30F9F05BF016F5 B5CC130A4B0796EE065495422FBA55BEE9BFD99D04464D987AC4D237C208FA86 0B112E55CE7B3782A34BC22E3DE31755D9AFF19E490C8E43B85E17ECE87FA8B9 1485831624D24F37C39BF9972D74E6EC4784727AC00B9C4A3AD3DA1C22BD6961 7E0ADAF55422F22ACA5E4DCD4DF9FCD187A566B7FB661D0530454D0DD6C6C50A 7A3875C6CBF8EC7769F32A1F3F7FC1C072BADEC97794D4E90E0035282A170402 356E5A9CD9ABD80AC4342A5283E458A7269252F4541CBB6452B39ED54D336D0B 19928E9CD1AB26AD83EB209E2EC75011A2643813053B5DBB0246097C4821B5F2 C92554E9140BE35B2DBFCD98809A8EC9FC910FDE9E0D86457C70ACB056EBF90F 244DC0A5BBD455E15D6E3180311D52CF50B0BF7D0A7F64F3A1821E0AEDBC2E7B AEB549FE1D51088C153799C6E089B5D5D65E1C4E2D2B430CDF1FFA23CCB25D95 5C4DD885310A706B320AB25C8D742C6F29953254FA54DAAEE60ED477877D19BC D28E9AB576B0EA088171FD000B60D73B3C57F754BC07EBC9BF751B7D2B32459D 993861B7C4B0D98C422A11BECEF76F4EFC0ECAEE89723E6CED53E3678D733363 2DF068AEF0FE7DFB57393BDAA439A6A4C396F86032A98009EAE1247B7DE83B3B E46DF2898598FF5E6CA6953127432A967E4FD41CDD60D6E413059A58FA556EF3 309178B57C16A763CFC9BEEC276944BDEA255789EF4E1ECDE1EA43EEDB955513 F42EDDCF39AE522A1DC2DC523F046EEC4CCAE25792B702C288732F5B13B5CCE7 E8B6A1A1DB86B1EA38883E481BEAB54023EDD9BB94E7780DEEA577ADAA169E66 AB7D8607B409619E79F242CF52E618AC0DAE43317C507CDB27EA8A1472D4E8D9 17E62C98DFB049C78AD15560CE44A39581BD6B555165091C5D41071212A9D2E3 05965AA02B8A67AEB04D915DADC1B84A531A1D672AAA06E9F720BA88419A3183 63D1F9A3BEF8CB2E23CD1F9C003BD7849F093D3B4C83C153A5A790C1F9E37948 5799C02F004C61A6FFDEAA1F9AE884DDD40DEB1539CFE3C3BE03C7C33CB54D56 2C2A0F467049797B56D407AA43EE6B8C3F978A7D945A80BF711C12D6BFFA3DED 35FA8B22E68BBE4FEC59E4C56D3C57E14995A8ADFA51CC6C3A84D3D775CAFA87 A1A0F45C0283139FB485B8FB0BEF5232494C0CB564F966DFE0D0566031392619 3FE8F0BB6747BDA591DFB26132947872D3B209FFD838A17EB1D5047FFE562781 C7393D727F2144978FD89C779CBE3398FB5881C5D9896F2B900B213C714829C8 3F23EFAD3842AC04445FF60A74F6D1EAC52FB9A26DD6E739495F184E42D924E0 F2614FCE874C455D141042D7655849CEB5B1D20828C4682E732DB6DBFECDF320 F3CA940F0365413F8302EE4A2642359B46D2FB11B4F432F3EC7982E7E4B22172 0C0B3919060BF6CEEC79BC61ACBF571E11BF662DCED0BA54353F26F73E1F65E9 EC2A63F2B8A27038270D316AF51CC08B9B6573BB8354C83BDC188BB375FFB5E4 CBC85892773EC0806F94C08FBD1C1082760A122BEE801FF7E45FDDFCE5E50646 54C31A78EE2087F17551AB58480746EC369A28FA8B0FF8F08E1402D3BD4A5685 4358F0F7F56101F04457259802676C4257EAA77CEC17D1687925C1134DC8DE1B 2906B73B38872E5324B1E3ABB95BD47C3240D34556653B185619B3C7A2AA92E7 EA341363E791527F4FA1B20A98ABEA7593277CDDBCDE303F1B9DD8A6384FC292 A2E87D32D11C02099C0D153EEF4645519E1204398BB6B749EAEF7082A76EB2A3 2E828A0CD79C2E6827BA31809D8FF390848A3A82A962C3D4FE8C87C0C5BA38D9 378233CC20AB65685EC725C34127CD9B842E168F9F12069C02C29F4DECF5D273 E5521279D3F9C6D1089EE6959F4082A8FCD53EA1C1AFADF65B8D761EC38DBD50 EEEB8CC8C76C5474648FC5E318E66D6DA58AD4BCB75374AFF90DCDCCFC392D79 4D83FF040FF09C6989B1CD7E4277653921E75C0E088D1E635DA15E8538353CB4 DFF3D5EE928D24C86CBDA6B8C86C10AA1835015285083359CAB8401D03E53B55 4ED9BE6549E1DE894155941FC4642F13425FF261CD1716A7BCDDEB7196E2378A 268467D279CF2064F0336B749805A070B7DF3106FB56E1A94B20E53640D53D1A 83C03C9495F9EBC163F9C7D34160DD3336376D1BF51793EA17160F2C33404198 61DFB6D964DC0F58A63868D30273C5CD3B0C556F1695413ADA14724820835FE0 704FD131A257D17EA4693DD6F10BDDEC6F573E8AFB9E701D2690C418151ACC92 26B990E872D7853CA985D6EFA70EB2243FDE7F441D5061BDF02EFB1E599B180C 96F772A87F3AAEA27CB5428D41964126479D3696B5F2660391558678CF0D3125 B5E0089F261D89590844D94B178DAAA8121DD16052D595BD1024A83DA775502F D89A20CEA9F7B9A1E806EC00E2C9DD754A55F180B242EEE6A0E2087DD6AC7D98 6533FE9B0EB5054E48ADA07C5FCE93874E26B7CF4ED829BE590733D619613DCC 9A5E1CFB53EBEE911F7A7B922C2482508A159E8682730B8E2A99333B87E560FF CB160CFFB08DC7D801BFE12C4080C91E44BD00DF6C2E3AE65A80C25F0F5D3CB9 15272055FDAC85014D059A47C9CBB4476DA7A69BC22149BA107456EF78F85616 CB40CB79F0E34B661095B627A1E5D5204576DE1324A5779EF03DC537A3F225EE B446AE13EC6B71DADA9C0446F5483BC9A8ECF3C2DE4A6B11E59E24FB6553E34C 1E820DC9CA68F72B2C79CF7954C256EFD47EC22CC5E98CE97E591288B373E4DC 0A62784DB86AD6DD079D74162DF315C6A5FB3D59842CA0003146D2938097406D 604FEF01751B82474C32BD65D7FA37C350CCEC4638F4730BCBD60AB8504BBAFA 1BE0CF8FCE80B95976B26B231A1F698A6A83E8848C913F345AC794AC3DD5A3BA BC08C19114E33B1D853D5AA1328AF438CF13ED8218E9405B783C3F3D3D1965C9 3BFFCB3D02A596F68A07CF180C2A5093ADF236A41038B38EB421B3A121F37593 67DF1F073E47EF3D2431FB1D13F7A7463B2A957B957534D8A47F411A550F9C8D C566F635668E593F6F9F08AF06A541462E96BAA22E50688FD14138DF1D62362C 44E84E2F4324E0A3C93D10C4E02816F2EB2240EADD63F0F6B110A108FD3A8FED F141CE51F7923D8C955D673777D138A73624032D9B27F3B1B027662540834AA5 AB2E3E3315736F0EA47DB50527A55553A55C2BF215832D6967CDB2EC991C2E80 30FD3949D56DC6293CB09CC7BCFE83FE571F1969AF30E89F01BF7BC423E3704D 762A73224C950B83D5247E6F6169C28C3957E9426D5DEFFE512E5FE205DDE447 25E586792FEF2001204F6741CBF3DCE29524E66B2D168F7737DAA925A42FB5A8 A19CC0BAB2A3D7C30A6D1ECAE080101677D6DA989F0997CF636879E4A35A445E FDBDB003D3B17DD3DEB36E30CA20BF81EB5BF41ABF46CC28B6530E165E87608B 75DB1C98F4BECFB7A4843A431E6E337752E3D5293B93ABF5AAEFBE19287DBAB1 6031943AB8718281F84D3EE41A6D522F49BFB6AC22141A16FD9A25FEDB555DC8 7DBB0E8ACD95F34BA7D53EDBEA732C01D00B4D65B1BD13D99033CD4C3C16EBA6 1920A2EECF4DFAACEBD41FEAE93F70E32CA3422875A4D467389F555200AA2D49 7108DC27E41D5132672A54F4FCB7B3DB9600E915C6ADD9881ABE179DEE0BFAF7 A920929DB8E61024BE6A9D0F9F9E160F28B45CEF0FD2A55DE6E17EE8D2773669 A538C331672E1EF1E3E3F0C29EAEA2BCC149B4624DB5A00D304BEBEDC29D3DDE 9F3B246F4D36A9743DF0C736977DACA586EC6C9F7415EC5286190E13F04EF7BB 0C966008C0637AD125DA6CB099844E7159DE31AD6597643AB8FD9EB861A90317 6C558B83874D6A5775FF8FF8BD5C8CC16CA3B5FAE93302B326A636AF83DBB0BE 2E9C6B673E40E9C75C70EC4AAA13DF618E1BE879769F407A80D442AA3DBA672F 2BF7D16113C57229CA0511D6955C551BFCC1ECFA027CCFD984BC4950889C8BF3 B2C119449EA7FBBD3BD5635CFF3836670DFEF5609602C20261DD450FFC7DC33F 686C296C75D673D6E1C2BB3E2354133CF4941C4A57369FDA2524495D56EC9707 7D87E27E333FF05182015F8CBFB53961D0384D9223B774333B1E31BA6228B35D C8FFB93AA7C2F5E79B6546ECBC0FD8A468BAAEAF4F35A55986D84DEAE983BD21 E12842A8F09FEE754823795F8BB28B4758813736B6EA60EC63EA5B122D094749 58CFF0477A9FA4A460D640B333EBF643B8920CB8917E8D9214A9FA533BDD1370 74D207E7B793E6745A10E5A471EBF1081D8DE8B8CE6B3AF621E9971E4ED8F733 BD17FD4EB86AA7EB7BBA576F49E8C90ED8C8C4062F1897CA00476E37A596A503 2B84FDE662754ED5DC791772F9A10306E85D864EA860E40C78A628758627AEE5 2F855049AD9F0EA2E98A072B3A855D835E226C840F2CC82F44C4792A4276EF42 943A78F34A1F91483EC93AE0ABA8657414D7240656403D093C19AA84054A9C6F B268FEB2412868094B8A1C476A1F85DB7D9B41EC639E98CAE16BEBC232AF3A3E 4E700C60216A29D3BD7F8A5B3A65991C475984B508399FCE0B247F02A1614473 B65DA0F9635FD36170D72A71C815410C7EBF1E8BF45227CD982ECA1168230629 0A04CC4B6E54B30C953AD48DCC6BCC6A70A3EF655C93278C9C3A89092FA1E0A4 1883D708CE6F7750A10D68AA111DE598086777E5331E7B1F8E87E2C601E21A94 F998683BBD1BB425851FB8C17E6627EC1F90D058AF7AA9D66C15341AC40FDE8D 1D33F0AE0795959DE33A127D21B8BA2AB183659FD8C2C3E81A19E932523C5AD9 CAEC6D1A4DCC4570CB415AF86A85457B4AC993FA40486F9E200F76415A762FE6 CEBC932078C4793F8D6F25D8A03E5181B6BE4D5232BA53D3EE480340EFF316EF 0B66FB18C8B8602BD343F28FD8286B3ED77E702C7988BD6D0AACFC22CB5B41D8 2F9F6BFB19406AE94570A219BFB4D3990D3DEEB05C83E199ECAAAAE0F939979D 36206634B78D0BC15F68561296F9A40A29C1D650C2F2FD240C1367145462A3DF 2C047B5CEE9571BA2D921C363FD26953DECBA33797323C7A2E01DD1478919FB7 E08A741FD27725AAAD6F76E53CE498EE90266E5AF5E7E07440ECFDE976E91BDB 8B125FC25E49A42CE9D189532259C42DFF23C58350BF82A99DBA256E945C37A6 CFBA2F67EFDA15FE3E0530A43787D2FF16FAC142EA0A663E7D055BE5E0CA7998 016F5CB860B5238A83B6F2F44017846873FB6FD47373EDBE91FF8163B887E79F FA0A9053D343DCC2FD07E0DCA9A32385FF105C4B404E1FFCA88AAC899C122B21 2A48BEE62541AC8AC840956370F65800CAABCFA04D1A5947526B6F345AFB91D2 E09C5DFCDADED3E6B2EC448A9E26146EC09AF99E57E33A709C60AB23A9FDBEF2 10126E8908639D6AE8F7F0D6BA8C10323BD4192F21B7F2BAB4608F5B025CC563 2398413CFF74118813067328FF79752946411093D2E7AE3855AED5664EC43CFE EED54A89CD9CC15954320AB4F3CD86CFBB95F472A366F3908A42267B8CC6AA17 74F72841F38CC928A5ED4942E9695B1D9A7BC8722A289CF43489BA17DCBD0455 C258E7C356BDE13E15ADCBF38040C20F01E8AD4EF5DD2121AEC90EF25A2D40C7 07F6A88CFA926F9C2DDB30DBE9A96F4E1BA219327D03ED7DEFAB63316504A1D9 0BCEB5D3935A08FB32D3C144E069E80FD2F8A2389D43EBFB794E135E3AF19766 105964FC105B2030CD5AA7E99F278C2FC22D7D152DD559E924CBBAD9C2D766AD E0D96D08FFB78C18DA6D0D831CF2A54F2C194903C95A40246833FE1BFF77B5FC 4503610859F597E804102BA589B00B52D70C05E431BCFA2B321704535CBB681D 93E2E691724BF3B5E9DE8007BDAB540D995B1D1B046CF1DB67C98AB3029FD42E 906649745A4E3B05364E7F1A3BA977FF713001298EBB7CA1CA1075BBC7613F99 CD6FC69D080A6FAA6C8336F0E5B46EF0B72B344BC2E20EFE5CD138FEB4308E47 F6BE2B976640844930B13DA21FA48DFCCE8EF3FD7F42EF5C1C77A707DF6A79C3 68724305800F62706AD0A081F56AA025C81C8FDDF6D0E09E65FC721517A0C285 187792657BF4A901D4D5062F40C84D53A36FB17CA5EE465A3E85D5FBA48A51EB B92C0486DF9C447EF595CB54651FEF8B310EB8C574C2648303F2C3875A40BFC6 7FB6D56330E7E7EA3F89A2994C2EC205BE4634E49906C4FDAB9A9122A20E41D2 EEDF56D6E354CFA77C57AC6B6100CFFB75F1F7FBC125610E0043BD151F431198 367316F55BEA54F6069407BF3F9105F761A53FE36C9AE9A8D5C7F835BFC4BC9C 3FAAEA0E33016B9791D4F3F479722B897DCBB54E69FEA82874EA533861905881 A97FF570A8AA5B3B0E0C13DA08D451665A14B2B930625C3DF50C5D5F5EDDF14E A73FDEA6F4132A8424AEA5CC84DFEF0565A672FAC0E00D0108ED94A028A68226 89F876E39B3A327E68D8934980081B8762E9973AFA0A1D7CE3F92436450EF05F DCF05FECCF7E4D7454AC20DE2ED2163FA43E8D74A7EA9FB6F71CFFECE312BD3E D3EBA0D03FF50610F6749BC3DC2CAB9DAC74DDA46ADDCF6963561211748C6B46 EAFD633F71D4559876EDF3F7CCA6B522C6F4FCE306B5534AE7015B2412742E34 F5D4D6427D084D86A0502560ADF1F2E8A8DB30BF6509AD2B2761F151E9CC338B 32604D6ECF8FC727B37F86CB4869306117EA5054E1F5F8D5A148C0533CCB4C04 747E414936AF4EC46BEF3B67F3F0EFE849ADD86B3FD864C1D02F9EA0031FB2F8 6A48BF1AEED70DE96649F595131C0D1FAA90402FEA2140B90B35DABC1EE402C0 2DC08E84E4702802D3B8AB0141F9747FDC56E6F3584D04E21A5B0A540DD23878 BF4C332EB7A1B75045EAD4DB1F5D2D85D101F7CCC19F71DB0FF77A67D00C0519 ED5764AD30624462DA75DA9E71FD45678076CFDD9DE4E1AC20E98582A2CD034E FB0A6114ED351849FEB6D1AB4CCDD0C07D3498D964399E87453CBB4065144331 E04EE8E4AA7ED6F646D0415A1EBA5ABE51EF4F7569554E44A02C1DD82FDA4717 20F66D41F4A1C5E64FDBA4E16CDC84345A04CCFF01B92E989657060524306108 32BD44085BE330C681D0DFDBF9780ACC0ABA9F1069E6F4FDBB3499657CBC5224 CC71D2E8CA4420CB9D52790E589129FBF90D5A327FC410D9E78936687D4EE11E 61259504E0AAECC4E0CE87C6A013A508ADBFAE166645624D91070DA43D790057 BDEA98B55E20AB56E2296FC643116B2F7220F8F357C3B81D6D54F2C9B9F3ECE6 05EE0C64B53C22CF5D5D94DCF706D9DD4F52E20DEB27C83F03DEC6EEA2BE9E3D 4D08C198EE5E73CA103360942E629F803DB7B7B9260807BADCA54E297EF325A4 3B0DA265181A35D9075694BC9758EA82AC804DA42164CC1257193118D5F24563 3D3FD6A96C03293EC2726B6A4CDE9D644CAD7D42DEC81E924EA160E4285D018C 7FC1EAB5A0386894934F84CE5932B2AC67064329320D1F1E4313BB312C2505B6 82BAE134D6BE2A04F97AF922FEBD730BA45778736305BB12E48FFC86126EA5D8 D654A9319BB1CB181972290BD97652C4778A8125E930EF86A83E5F8186296C96 BEB4C8EA66FEA793380FC001E631B64EBA78239DB9DEF161932736B596B97F87 D7CBED18AE125A5D401479D4898A50204C836F1189C6707A74B93EE61C666F2E 1AD51091AEE9F050D4443DDAAC77B2B97D5F17F66A3672F26AFD529280618352 0221ACC88E9DE50ABE8B4B89C9510ACC8480B9D2316F6B4C9F63E50312909AA8 E1CA04B9CC9F12F0975CC542EB135B3B1B3120E49B40AA218FEF9CEAA8F7222C E50B22C32A2E5FD57D24CAB7721F966A19CC9EC23740EC688530A35BD103AE89 58A980403CC5EA40C8D027C42031C73CD70C55C0AE8697F5687D1EEA2F6B549A FB84FCE703EEBF0E3F150EAB03F06E7EA97E11A609A380C7E48531D58CC96859 0F0A6E623511D5341E776E7B26EBE1F12E07408C269EECF506DCC418CB67E6B4 48D8FE1D3EE3D81F3733B112E42CE7017D0D2AB3F0D982DB8518608094849C05 2D698984E8A212536B90C1F74236B869C09AAE617FEAEADB345F363D66764776 A93C4058A7CDCACC20E56B30CED9BC678F1E47F002B4C8342BCC8B355B5EA76B 29B34B20E3792028E34C89F167F438598337286A4D98286B80370514AD76E0C3 A77D533F7AD3CF9F6F9EC9D5860522B5054E9069DD88DF3AFB5A1A004A3094C4 FDD550F87C796A5460C2CA2F00D473BA52EED62C929890AB3AB390D77A1DF558 EAE7DD3701EB78E3556EDD82BD5BB85369B1DE6A700E5A5C8F33DCD6B8DE98BC DB7FF0AABFBBA6B2AA4DFADBB696D335BE57F4C90B9C46BFFEE9D42C6EB521E8 B020602943CF169D6A16864CCD887B44F68A12EA0907D16D85B0F58338AB2087 AA892A6D097FAB604E5343336E872E997F9F313278E750F8374EBD41D2C8D148 4AD849D6DE7A120C2BF6D21C9C5A0CD98D79FF77DED2585B9A9D118B4049BBE4 485C90984424E199DB59F2F826F8853045BB18F890210D9A576DBA1E706FEF29 9FAB3016AC502859513D6BA65B46A2A06922A90FE535980F6C724CD6A2B7D74C 9B597E07DC2E4F0C6BD214AF46A5568FDE27190C92A29CA4929443E480C86652 BD86218E0126ED4E85400968E53AED331CB40818820F4EE1C3715C319AFBF182 AFBBCF1226AB763987380B77503C0BFDEB3EF782FAB3B5292208CCD3A9D5D405 9EC12C13602D1B41E2CC8EAF1337861EE951C9992E403B8F46AFF9175E1B396C E4E4E953DADC36A79DE5A95F3797B4AFEB06C4D8B9C8A9D16F31AA076C0C92C5 125FFBD713839BD444F52CABAFC063F2801419B78F2E4FAFCB325B109026688F 93B3E9B2965FE30E1C8BED6CC0C1CCB431505A26EE09899FDA75C1A91FFFCEAE F3FC43DE894396CA74842A7ECB1475DBD7C35DC04F6370ECD1273046A498BF60 5BC64018B428F15E53588BF2826A14D0B63DCFB500F69D043BB9C4933AFCD825 297D57959B2992D5AF88D137B6A478349992CCA24BCDFCD5F4677ABDDF69A162 644CDDF31F6CC205ECB60547085408973640ED2F41BD3617AD77C8FC57B7F2F6 67A568F237EE345FB8611D2C98BB9AC898EDE6C0079BE3A96522B12776707904 1DCC654CE5C7648FB08CA8DA30ED1C09AD2765F9B195FCC3C3A53AEDD63D1463 E143E98FA7F6217FCC9F32C527D408B256034F83AF2665DB76FE99FC3FABE9E2 7ABAA48379F2E70073F74106399A6A7D89B3EEC872F259324BA2200EC4FE0BB5 F47C8D7671D3EBAD8FF88C2D47B91F159FDA08680C5342DD3EAA79F809E65D8D 18E2F091D5A8380A6FEF08FB2CFDFA1F1194A99D46A8C7A727CBCDA326677683 9D9B49F07C214DE0D635340543F5282A361BEC722BA7895EB548161406FE22B8 A955115F4386A6D4088A1751CACBD9EC93A62E4539A814EDC7432965B063DAE3 831F4FE688721EFDE5B9565DDA16698B26DFF7DFA8E7DEFF313E241925AB516B D01A8328DEAC4C7D2EB43646AAEA71EDB98AAA7C030FFE4C62991BE094FA125A 69D54AE775856B64D3D72B9630F4A115D149EE34E9CF3634F039086200A916E3 92786C911F41BED748076962EF98A5C0454C9061E41AA4E7666A061F466096AC 61D2B31BF32CD410E0FB6725791B2602DF939D112D9390502C85E610DB75B72B 9994599C93A5F2C39598565FEFA1AFAA42888EFA261280CFE0394DB2FDA4C866 B123964CEBF875458D1715EFC0F45FAAA22BC89EB21192EEC887534E096D0CB9 65E7FA75D79D1120BE70F672B94F9E08880AE05985D8C4FD7AE8DFBC8C5F1067 BF4A672AEB4D466C2EA0DFDAF4FACFAE4A34392502EDAC6EFF6D098652646AD3 7845011A731F157DEEFB04E12BFA4D85C72FB0ACC77701FEA8C222D6AC3D470A D937238408CED8EE2FAC4CB734FA6F999FC17C8FB7171632700A986B9AE296BD DE0BDB0C38B133D96632AA965E557EAC1ECC189CBE682BF4C989B85D568A6F04 62435CAF824DB9BC3D39601CEC469E4D401370927CF33850EE64038F182BD2CC BF9D4BE0402050865C66E29623031D5CB3EC36FFBFA626B4D93BB8B13407C0B5 F65D0C7B26A691691DBA3D30461B25C34A1E3FC26AC7609C52D50B6268C2BAD6 F69824DA5D7B923A3FE0C4F0278B1071D1E5DC67784C2A2BDE06B44D2F50AF2D FDCDB50401F9C6CA1A1D1DD2527C17978A690A2713E4D274A64D7CAFB6AB2BF0 2E8BA0293B07EE58041067DADFDA30997D2F91C153E7E4CB1932F7673723C1D5 9290AD417317F866E2258DC317C9F156699456E167DDCDC22DF6A9820A03B73F E51F7ED41A2AAB8016DF38569F04836DAF24B0A2E5F9C65D49E030240E25F482 5EA5D285FE8BBA66FCBB22E2155586FF2C6135206C61394DA06795C5F012CEE6 B20BF10D0140A02E5B86237ED06339557BA942730E5C9C159A60D21DE51A17A3 4A83A1521B1098B14E59E9A2D815458C69D55436A52CA07DFCFDCB225C25CA45 EED1E45BADD69744CBE46983E43CD1B2607E89B9D391F53E233D068181C2D650 6630C764ACC0EDDD1B6ACFB498A2DE892A773DB47BF97D4AB619E82D5BC18089 C23A0EED52E25C1750C2207A2AE4998B893F1D3A00F9EC9B672D86B17F02BF39 9743D3344B4D8D2FF02037C0EB3AF10F79186F2D657B53FD539D7EF4A2FC4D26 6CD343475B79A82FB4A9AE5FB4A910DD1D80A3FEA313A4A9C655574078A118F5 F986E2FD023814CB650B1C426916AD1638C89576A0990EF4DA06A687FAA60881 7E53A50A02E34D31F956CEF8C7971F4CFFA09F49B145BFA6395FE8406B409202 0217F9687258D6635D8B5A3CE2019F5EE5758AFF0A7946E63B7239ACE933E3B9 E25101AC17F11AEB2DA5F896FA7F9B30CBC9A7CF6BF8E4B6A42C3A08A3F0B5E4 2FC2E497BF7F5916FCC95F88D45C724BDF62230AB57B88567C9BA064F87514DD AB59F32B05B11F9D7A88BEC226A1E1CFE1764EC449C57AE4C998D614E4153A25 EBCA63C1B350558FBB0DCF2AF2953DC3C04A93B21753B23374CFF88EF645859C 99F88B354C6E15AC1AAADE9285E0D407FC00F9C31FBB53BBCAE095413C67E2DD 065B0341368B3E52839ADE62A03992BDE5E1BE12D3E5FDEB9CD1742740DE8B56 E9D11A65EE31F6C23B96479E425413E16AEE4182C99BEDDC12DF5678362E6C18 8F6988D3EA782EAE038B5B664C8140B26E5A442805EF65CFB9E2C98C7F8B8E6E 753DB0A13DD97B03E12B522367EDDBE6FCEA8D84D4DB0126E85CC8E0A9F79144 D6ED200C8060EB5ABE935FBAB0A99E7530FB4B91B9A891788249A530441DAB4D 76A8D04FFBAB671485E31A5127AA8D3A004FEADC840F3F9887BCE4B1542E2771 241C46CB543C67902C8147C649039C8459928DAA81E21DAE57A9683A38AF15AE 59D9740CAA504B82E1F2FA8A1545478E062FAC0EEF92CB5D8666A42C4EB48E80 391CA9CF3A46E734A12A490E26572BBD7EE3A89C866C972FD9483BADDF712670 118FC9665C4325F9DC0B6EDB541D019813995750A71667FE40FA106F044E5830 B24C82998232575B0EB3AD4FD0714C05376B49B66082C079816C4F93DF979211 B838692CB650BA770DD4594D72105989C7ED0D0AEF92134F6E9702E186A197E2 2B8F644FA4676424FE815EAB2E2CAF6AEF4D1EE8F6C3CBD3275AE6F857DFAB00 6C57C85BA3C45795591F74D0AA47BED89F3E12BDCF3AAA3C7E5BA7F972AFA941 E168B9298B56DB5B5CD6401D290D0447986FED52FD48838A9D89D34B9C2B3857 F05BEDE4C7B14DC46B7DC6266803949BB394F14C6072DC7F67F593046B705C95 904B8F6F2518A08FA20E00741B786ED68B9D98CC1A046D53CAEC900A6DBE9200 8D8809E8398A53B6D969C30E634E8300E8FAA8833A4A48535C3FF34BCABE071A FF7A701DE832E527908DE1D1656F422D5B8723F3CA2DFD8896574A8D5689BFD3 500407A057C7C99A2C3DE20D8830E4805BF3FB7DC9085C630A673A6873C39C77 FD3AAF76640A5780748100FB1FE42429F0640DD1D7EC85B472383F7EE118FEC6 81C19367366021EDA1F0A91D0E4486347DCE1A28EC17C8E9949DC6E4C9D44892 A9DF6DFF5C9F73A9312ABF0FCCACAC71084FE0803E39C813364265310D59CE15 E2315192C850C705A93491925E1331250DD4C067B48FE5EE48 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMR10 %!PS-AdobeFont-1.1: CMR10 1.00B %%CreationDate: 1992 Feb 19 19:54:52 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.00B) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMR10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Medium) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMR10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 11 /ff put dup 12 /fi put dup 13 /fl put dup 14 /ffi put dup 34 /quotedblright put dup 39 /quoteright put dup 40 /parenleft put dup 41 /parenright put dup 43 /plus put dup 44 /comma put dup 45 /hyphen put dup 46 /period put dup 48 /zero put dup 49 /one put dup 50 /two put dup 51 /three put dup 52 /four put dup 53 /five put dup 54 /six put dup 55 /seven put dup 56 /eight put dup 57 /nine put dup 58 /colon put dup 59 /semicolon put dup 61 /equal put dup 65 /A put dup 66 /B put dup 67 /C put dup 68 /D put dup 69 /E put dup 70 /F put dup 71 /G put dup 72 /H put dup 73 /I put dup 74 /J put dup 75 /K put dup 76 /L put dup 77 /M put dup 78 /N put dup 79 /O put dup 80 /P put dup 81 /Q put dup 82 /R put dup 83 /S put dup 84 /T put dup 85 /U put dup 86 /V put dup 87 /W put dup 88 /X put dup 90 /Z put dup 91 /bracketleft put dup 92 /quotedblleft put dup 93 /bracketright put dup 97 /a put dup 98 /b put dup 99 /c put dup 100 /d put dup 101 /e put dup 102 /f put dup 103 /g put dup 104 /h put dup 105 /i put dup 106 /j put dup 107 /k put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 113 /q put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 118 /v put dup 119 /w put dup 120 /x put dup 121 /y put dup 122 /z put dup 123 /endash put readonly def /FontBBox{-251 -250 1009 969}readonly def /UniqueID 5000793 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4 87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0 92A36FAC8D27F9087AFEEA2096F839A2BC4B937F24E080EF7C0F9374A18D565C 295A05210DB96A23175AC59A9BD0147A310EF49C551A417E0A22703F94FF7B75 409A5D417DA6730A69E310FA6A4229FC7E4F620B0FC4C63C50E99E179EB51E4C 4BC45217722F1E8E40F1E1428E792EAFE05C5A50D38C52114DFCD24D54027CBF 2512DD116F0463DE4052A7AD53B641A27E81E481947884CE35661B49153FA19E 0A2A860C7B61558671303DE6AE06A80E4E450E17067676E6BBB42A9A24ACBC3E B0CA7B7A3BFEA84FED39CCFB6D545BB2BCC49E5E16976407AB9D94556CD4F008 24EF579B6800B6DC3AAF840B3FC6822872368E3B4274DD06CA36AF8F6346C11B 43C772CC242F3B212C4BD7018D71A1A74C9A94ED0093A5FB6557F4E0751047AF D72098ECA301B8AE68110F983796E581F106144951DF5B750432A230FDA3B575 5A38B5E7972AABC12306A01A99FCF8189D71B8DBF49550BAEA9CF1B97CBFC7CC 96498ECC938B1A1710B670657DE923A659DB8757147B140A48067328E7E3F9C3 7D1888B284904301450CE0BC15EEEA00E48CCD6388F3FC3BEFD8D9C400015B65 0F2F536D035626B1FF0A69D732C7A1836D635C30C06BED4327737029E5BA5830 B9E88A4024C3326AD2F34F47B54739B48825AD6699F7D117EA4C4AEC4440BF6D AA0099DEFD326235965C63647921828BF269ECC87A2B1C8CAD6C78B6E561B007 97BE2BC7CA32B4534075F6491BE959D1F635463E71679E527F4F456F774B2AF8 FEF3D8C63B2F8B99FE0F73BA44B3CF15A613471EA3C7A1CD783D3EB41F4ACEE5 20759B6A4C4466E2D80EF7C7866BAD06E5DF0434D2C607FC82C9EBD4D8902EE4 0A7617C3AEACCB7CCE00319D0677AA6DB7E0250B51908F966977BD8C8D07FDBD F4D058444E7D7D91788DEA997CBE0545902E67194B7BA3CD0BF454FCA60B9A20 3E6BB526D2D5B5321EE18DD2A0B15E53BCB8E3E01067B30ED2DD2CB9B06D3122 A737435305D42DE9C6B614926BFD44DF10D14402EBEDFF0B144B1C9BD22D7379 5262FEEAFE31C8A721C2D46AA00C10681BA9970D09F1EA4FA1566B96E221864A 45A24ADAEC63F61C9FD18376D3984449A1F998C318A8FE36D0D5020E18A49625 0F3BB603BA1F3E66FF412F6A32433FF8BD2968D79CE4273AD0E0CDDA5153C2BF F8A46A2244F9394A49D339F763F5A7411A3C29336B21CCB01723705AF589B078 3763035411FE36AB5D744E81379106890688CB5BC41184548B7FEBA08DE7288E E6570FEA20C51FACE8E8F824BB61A4A038AB817C47B87391611B77928B2565A9 3B27A573C05D36ED01D8F27CB2C793370FA9B90021B5696280A55F2CB6117B64 293EAE0EA5A243F56FD007773CA35DF71B3D28643C25210CCE25F37A5095D6E5 9CAFD99DD1DB0D7EAD454C13464DF6FF5DD42339797AE5AE467084550FC00139 6EE818C6365007B2FD6E26285B832CFE6EA7E99665A224C9813C036CED262639 3FB39C1F05FF8F31D2DEF37BB9B883334F51EA1243332FE1E3FC91864C8AEA79 16A726F924AFD84F2F4215FB795FC41DCFFC835C90B9E31D291E47AA4BB8C05C 620F69DF31E91A0FBA8E217CDBFAD7C4D480EBC1EB396029CDE615C227A367AD 72834BA95539D39A38EA0CA3CF7F1123F70792CF315BAAA38BBCB6DFA80B4493 5025F33C3696DAD6A0ADF584C71BCB1D29E523EA4B81FFCE15F3204022BBBEA0 A9483EE8EAC07D581162672A0D66199174821ABD097561A263C0C0F24066FBE6 0951F31FBBF2675141F3FB4457CC2A94A40191EA0AB2A606CF540BBB8887B6DE 715EDB1041EBB9D05D0F4A4672F534397B9529EF8743BE88BBA10C81E0A46259 2F2AA7B638E20C9C8A3A827977AB58ABF7525BE15DB66CE8E9B81457552073B5 85DF3FA70B5231C447C5724E14730B90FA35ED1B5723036F1658CA8E19EF5A6D D333B78E91E4D7032EFBFD40A5A2269B0DFD9F7C3438DB58F94B507EB93032F9 99E5F15D9F5D8CB031BBBFBCA8A15A617ACEDDE70DD9C2D9EE21179FB17AD913 B4BF577A9046994689D1BC6A6985FF5F5A67D699C2FD288FD9E5BCAD5453EEC5 68287BD7B8872726C28CD288B4DED2246B843577173450B6E5760852CF2E1727 01FDB0FFFBE12CA13ACF6434AEF4B59EFF3E0DB1E87D35075B1D55AC12633167 5A83A39056C077EAE6F2F7D1DDED300BA43830B8034F0A6AEC562D3023270601 6C594D0359DF6F230F7B80B54EBAE4880AF338956B813E3B8DB8BC778BE0F612 7D84939C2878B43EAA45BF10E257F22C28C2C148FF48843D2B52626148E3CAA7 4527B9F246C17BDE21C6E7EAB4906BB6D9E84906CD1832C4BD9E405AFFE33AA2 AE086C25EA26BC23D68986639366B99C87359915EBB76D7162AA667ADE4954D0 B1E18027FAC2468CB2FEA2568E23DBC201E9B6A1151FBF21129A088D89E3E728 28B2785C1A8B2637F368A93EAB459F80506435BE23A85396969E2AC4E0D6E4B0 8B12EACD150049EF8942C108B96843159D4408424394B33603F565D1622FCB78 035FCF32248D771BFC89A805780497538AB2B03A494B1E02D14E4FB90B09FB34 4C3E5F4B2AA00EE0C5765CEA78309A7BD009050114235660BD7135CDFDAEEF42 02B0E1B0B6F9E40D4349DAFBD3AB69E8FCBD4B4956745C0CE9719EC232CF9474 A96A617BE90E46E973B91572DB5EE90CA654EB1AD526450706C1D0F326C8EF12 D5A692294EE3662E406C4B530D9CB343ED6B3859BBE21DCF7CB0AD9936215E28 3E6CEA892F54ECF9FAB361EFC593FC0F8A5F3C53DD3312802CD44FC934C65757 255E4A21FD9D2CBE9160C8D199AEA75554D5EADFB099F60090FB657324F4C3BC 6A2A1794215571AED485957C15E4F8CD9362D80E8D8FDAA701B50F7E8E6F7DF2 35169BC317E272214F0C9780F65C422493C38DAE2665F1DC187413F785310E2D 4C15E4183314D043DC6FB8444F6D4879CBF3182D0A2594E84ED38BDF2394997C 35A581F24C675F9F6B4F0C57C4EABEBFAEE4C533F9193363DF8D6943407C1456 73FA93308A9F96ED6BE1ACCDBC533281FA771907D82C7430356216F96B799E1D BF937EA3C0C738A4E60C20955B48EE53F69CD95BEC170C9C21CE1344044A0C99 12211734C5FED9793B4F4351B4FAF3482BA3F3E75DD996FE164551E58800BE5A 1A7640B72A9B576DD2D1934668F9FE058AF500CC8BBD39144E31A995BC92F55C 6ADAD7A104840F14F1F8E191C1BC3D4EFB2AE90707930ACCD71D7290B5307C7B E4C95C38D0195D67D7BC9B9B64930B2CB9DB1B409D61302726DDA890A4D2A51C F7AEAC9E5A756E0625A90ED7738C470FD918200D220E7AA531C3F32F53DD2554 6A91B01894CF66E239534057C3259147C11267F296A56EE6675245F298B4BFBC 1660E6A64143DAC4A31F3ACEF96DE9B7DDD8ECAF8DAAC6C420FBFA2B7F9CAF75 7BC47D1AFB72C068CC56B493AE6CA71948C38D52FCA4B5AABCEFD9077990ECF5 28EB8DC3AB5875FA98A5BEDB2A599A3D9927BB796B000E0A7B33A9A8193E43FD E75A71BC53BF38A10D35265D69652FEF8786BA4A63EE59D53DD67E65124EDB22 6ADE8C6931F31436B1FD61F6C2C1BD66B34269CDBEBF6E4C44D0E43891DF145F DBDE22C6E5FE7736EF2665837722324CC7AE2047FF6C4DB6EBCD8F07F0D1AC75 C997DAB1A014FAA345F2196DF5DE4FD2DBB3B635DE55749FE3C78088563E5A3C E9AB3453AE7CF93CE30EE33746D2D7617359D5B99B0C2C31A00AD0172D9EA783 6011F0FF34185A919A4B40059B9C6076799C505DBDD34C0C40DD21659C7596CE BD1C2F5071C8A7693C0E7D7246D3BA528A815229937B6E27F202C0F5FD03D0F4 CAFBAA85CC775B558CAA355DEC050007A9FB39C912EB8E47E5CA72C7B6A648FA E42B27E639745E507D1BAC76C2B24667068C75EE877C68E89405747C5F769298 929EA639D58D4594F908AA898D3556E93FC73310B17B09EF2D958ED93F34EF29 E8C0B9120CFCFD0F949C3223DBCBF47A29E255960B158D20C8D725BADC24AEE3 57E90E72593EEB6CFC50D4F61F37E7BD258C49D682586F28BE69750C5A8A5E85 59212F89781E915088633E83E731EE5941148EF15C018CFD4E3CD89DFB529982 49C83CCA74C0DB41ED35EF65FF94D8558E950490EBB50C8639F15094DBBA8852 A9AED1C824E9AC7E0C5083D59167A7D4FA77A2DE1990A0C6BCE8FE59B4BE8611 46B3E1BB33BE2E7EA3688218F30239EA223DA80CB2B3A778B23DB0261B7A1988 8FBC6F4F3BAAD948C75595EBE81F9CB3E54713C1C0D95B5F98B1E6E3E52A6227 90F87CE8BBF6E00DB178F4609215E4AD3E849BED1AB910FF7758C6DBDE6AEF76 08EBEF62C3EACFEB328C5D5F511ED01ADEF700651B896DCD102A514336943DD6 DC1A8BA5E92C645D26A80588439CA6AA5C6367F0BE5D32A35AFB2594932DB8A9 D4E15E7D0B334709CC1445F861C0E0D54087B0F4684155E78625BC0836305243 D08F7957F1C76FF63612A73EA8FAC54C67395CA3E9B34EFC91A40ED5645BF8B9 D7DDC7D451274FDFD33D3F80A0C22FE7BBD0088709CAE2BA22A092DA64CA0E4E 49E60C2EDF4362565CD46157ADC8E8E44BD53E71507F330AFC277B99DD1B0045 84DFB20C6BBF44439A5684F685BAD6E9EA944860BC506C91B70FDEC80AF39836 AF5D87F52CE6087CA86FADD36F50F9924057555D93E58EE113B0715D375C9624 F74BC7223D180EABBCAE3686ABED1021F3D1F1D2C7F70EC13C8FA32F81B1000F 3F86F51B88972A61727596E570CC6E6064A8A63079F06DFA25FA827DE6ECC7CF 542632320AD67B2A98BBB764E73A2E550C7EEE29705585D75EB88742EB6F4159 2824BBB051BBE9F1676AE2584B5F74D321DDABABA91593CF5873F061ECE9D3BC DFC727EDBF07E74BA8E80E218A345B8C3D15FFCB6A3BDCBF871547883F99349C F7EE6A15117E492C36B257647DA0E3B008D629C56788790D638641FB25998ECC 174D735E28C8FC364EB26FC0DC23B727A1AA28A124AA8C1F1C3C1EF026EF3711 B5A161413F5EC99C18C17F3F0DB385FE2ED3AEE3C76B56A8E6B38E5C92509B30 857936E82A4C5A15730885D36E29FAFD5548C5A2A563B7A5DF733032316AFCE4 C301A4817EB274EE64E0168C3BC7D929CA42C1B6EE33F2A398851875E1012B4D 0F570DB0F6E95D57FE1B95A79D941AF0B0201539E6CB285D96B3C4F5F5AED326 CC6C741C4E30E64F8213747BC44554B8087E397540E15CCCB442DE2AFBE2EB71 56875E406489444EE400F044E26476062DA098AEAF84480EF0C12675F058EC9A A1381A1A92C77C28D71476F762A014955770530BB9127D8A985E238F8FB19EBD BB291AD8CDFFC1D3ED771F72B40A1004C756F76337167E83F7067AAD2D0D82C9 BE0AA384D3DCC5CEA3F471B93F0149CEDFB0311F1E312F76D307F1CF3EB2AA8B 3CCDE803F68E3D3D322EE01F0F29D01163BD27205AA2581D619F23E118BAB829 DBA35917AA26EEE53EC71497234C435302368AF1EB81EE01A3308F1684A47DD1 02EAEE1B6C2CC388ADF9727A635E3273683AB13381460D4DA50B8400624685A8 BFC3B421106B9507C3C0724503F220C4AAFF74DE7C92BCB8B6DAA5A1FE191C46 F0F0A0AA415F75DFB545CB00FA78E1F8A033118CD289294B2DA17206AA50498B 0C6CD68717269D6E7FDD64C028A522FCB2735B1841E00CCF33F5FC045673D97E 2A51689645F6CBB54750E4263229E3171D12B9893AB236C93C359A592920F3D9 FCD51A4E3245B45FCF1CFE2039806E7804B471E565652763888FF23666A343E2 40354B86935F9D9DA051D2EABA81CD2881F0052BC47328DBD742ADA8E4A3E707 1B2494381E17396B4ADA717C2506D879A9BF2DA5411C1534DA4CE765B470C413 E2C94833B2F5970996398CD35685CCBF0F786D166F4940E60005E4EC6133F954 D1325EFCEF8BCC5FC201A6CAAB057899E558745C853455FA821040B88194E891 A27F147138CC17641B635079B5D62CEAE57D65DA625F19CDA5849409F9C9C91D A6968200B32D1C949EDB9563BA3991FE615977FCDE5689874B62BD474E9815CC 27C9D2A66FAB6EDC21433655C5CE27743960E212A277D1A3FE83DAD8855CA857 2F2D2E36EAF8CFC8B7E172A483AF295EE5B40BD8797C9949A90A68A9E451CF8E 94EAE006AE5B9CC5B269C9E432644EB2D8EAEADCA6D2E529EA31BD8EA8C212E5 CBA23CACF45415E26D414F3B46BA3E7062E1EF055971A2A27F3FE988AACB3567 0E6FB2E8F11F7A81C3F9AF82087666E9C3328CDC650D52F36F5290B9DA2D2285 EA1B643EFB7D01F6115FC1DCBE0D9E24F0BA9EDD97EC6F424279281F498DC75D B78CEDAF4102D854ED6F92A3D0042861FCF00C3EE34C3D31B2B21219C3985945 C87069439C2CCCD741A0006BD92BC3F0DC2A90B68812425CF8C33AC235AC8385 173E1BAA5C44E8818971C8ED75D24DAC3EE393BF0EACE5AB866C56EE01AD816F F49D244384B0A9D9C2AF71D78BE1D7C9DFC40EA0FA201165E9D8BDDF8BEDA2B2 46F6ECF489937113A7A0D362AC7F82A7152D8DB1A83E86922ADA61BA7B4795DF 82D35326D818FCE796292A7492B7CCD2F5D2BA4F81A89C432AAB3700876A5F2F 1A2ACEA4F9E94B467B1E3231BBA9DBCAAA112E8B2C42C520E2953EF00DC8D16F E3F90CABEFF55D6B1C0904DC3B78206CF86C1517EB6908BA6FE333152E5328A2 04C09E1D6323442879EFDFDB59E5463E900E171C3094ECB85D09D1FCE9BA414A 1384C85206D2D445ABEE53BCB33841B8D9387375AD3CCF0FA9F954095918D596 16A6BFF7E316E312768BF78B5DA120B21DA3D65DFFD750D2B50D954FAD9ADB04 35BEBB1F77E961DA93255AA567387EEADCD3D55B252105616935AE729893A0F3 6E736402A47A8A524CF034E8D42E36BF8289A089F16EE22A4102D1412C59F9ED 1CC05F49EE5BB2B946AA5F6C4FE6AB641031E37734669D01D2FF8410FACE4EAB 4786717C5949CA953B0964BC0F015929C05F5816333892BB50C567C51F5B1F48 0C1B42BF8D9C9F58B0763F73699BD01C3ECA132F01179461D76305DFC34E16D1 5B602EBFC9F316EA08E601D3617E283CBFED97D4CE420A34CD2C53EA566EF763 705D9529F217B6221AA4990EC890353E5AA5A7438AA9321296D13BA34F87FE06 A9F60C5C84C7BF1CFD23AD97F05D07E9630DA11B3544B431462D992862F5ADA4 7F11DCA1FC92A5717DD406239CD392A2A6395F7954FB6F9FBA388CB210FFA87F 74ADC3D2C25F4EB39F7F48EB5C975E4D442C2493EB3DED3FEECEC29D0AF020A1 48BCB2E70856038DD1035240A03CA307FD818FFB3D98198C12E4C18F0D9DA770 D09F7F8098A6182DCD67359175315B122F259889916497D0155F0606D78FA723 5E04EE9909EE91D0EFC8F771FBFF108D22A30FF3E1C752D09BB6C4374ED000F3 2DEEFD6EC3F82AA64B6493441E72940C8058DFA868DA90FDF83E225F8552DCA4 A66617DBF0DDF5DDF8CCDCEDE398FD9A6160451BA2A658B03621EF999B5C862E 6F82C33EB79A0AD4378A62FC6E6104DCDC3C93EC3931B6CC9C47F96C0AA8ED0F 054B9AD1BDDE8D6AD477C406CB8CA5C4CCF5E86585C06431EBAE65ABBCD5B1F3 59011BC834A1536D2ADF66E50A49BC00CDBE672AB1F6F4D94025A3FAF9D4F223 9382BFF8ADF75B6D7E40EDB8375107555F5272A4DB71A3027E25D98D8123838D 61B91C0BEAB7A40D65814F8F207430936C6FB0708DA283F2A9F3A3707E030513 0A77DBD5A209823917FC77FF48DE6192028CD056F47A2999F0AE601F66D909AA 162480733211674F4C02F78FF5B3822A8DA3D5060096C5ECB42845E0425DD134 9BEF79DB856106739D2368898BA05CFD8F5351EBA48B2C7FFF202E68F933672C AEA5C5B56FDBE06FC0D8CB94EC568890305C574489E970D0750FA5CCCF8184C6 B4B3D33141B1EDCD699C49F14EEC6056A9F2BD8D44021BB80890E8D9B3418323 EEE9961AFC52C7BDC708D2A251E361E7BD866BC183D363501CC97BC7596D502D 05FFEAFE2CF10C3A9DD2A9521BE1292FA5FD1ED6077C936CAA5D11E0CC1D3E8D FB9E0F4B1A88F27E297B036F8BF4B517CED199ACE95A7DD6B8ABA6157614CF6F DD3FD88C2A1782A047FDE7C0DC0E81AD821A0C208E06C4489DB72FEC70A39D89 52CD999BD638D775BCEAF3B878C5775517DF98CB34A8F0777DDB582AB17ACA34 59C5156BDB8ED0DB564B8977982A4DBF19558879F9BED4C04E80F3F57255CDF8 E0CBBB8374A234C392D8F83672BC405159269CD497FABC2EF6980BE7182A5322 A9516DB6B9890EA33B79E3BB6CB69E0037EEB514B0E1E1C275C62645FA943EB5 3539EB88DFE8AF63724FB720EE990CC5D7EA2E8D56AE6C7FE4EBEED0F4297DF2 54CC5E7FD8124C532A298868AFBE6549E9D486104494976126B2542610B426A7 D756414C6ADCBAFC2B53A1AE05F014BFD39BC60EED1C153E9028D32B286D4359 F473A3D7C737A7A2ED2987C4F0D3D23D1326EEE6C73C843E200170C66FCA9215 A7F013938111965CB0C8B3E2E3A382E0F98E08DBCA29AEDB7409C0F6E0EB1C1F 83043294A762E06E3CBC097F228B910035F8F6B77B12DDD2891B83DDF56A3965 A227270B738AF9DE5E9C0AA8513EDA872E5F1BBD3FD6A36C6C51980F7A0AA877 776D2942ED402A69B12B50304F9E9E317A79B39B0554E1D8AB3733FB1B626FC1 4250C839D58494FBC53A8544648D38645A192A5ED1A2166839145C1D4AA17C6D 79FBBA7816EEC6CCE92E685CEA02C9BD653F69B9E416DFFE27F4DBA486BBE940 4488A863F8A1ED30E0AC2A69C42EF4AE3D8D0A624EDD9E0E4D30452BE9D96898 EC985BEC8DAD3530B078097F185B50D7BB7694A3D672D799A0A459FE9A5F19D7 47F6A4A476C403C41A67E83CCBE87F654DF5B3ED65CAF68E6F525A6BC395BB7A 5C4B2FFCCCEF4DDD08513DA6224820E6618E75B3D93004F14451EBEBBAB102BB 30782EB5E58C71BFFB4D909F9229F56704E957108626378DFCB8B796EDD017A2 8140568EBDA20991776C8834471FF9933EB561713ECC9EE9209EE1390ED5C31C 8BE49192337974B420B6A0389830ED38ACCB814E0FEA3FACF933AF14C27AC0F7 781AF1898A30AF834538DEDF6742FF2881A3F199BA7897ED99334F050C5D4D42 D5E2A29DC50A1E943F3671B9EF970D9BDED5E30EDBE368B064C50C83053F4BE6 F8A751C2242ADA89056F8D4AF62992D45DB68B7136F11D3A11F776CE67CBE6FA B6B1359B0883C78902F304EE03D3D7E2B2919052BF7B0BA57E6F98A3415392E0 9E9FE648E87F0FE09CCF4B423381613A845930C92E7F4F5F667903A591EAFF72 05572592E7768BAF46E2F43DDEDF2F1D9120F06D6F299BF6E1CDD4419DD9E644 44445F4E631DC6734B8AB12E03D0337716E7353B46C0C5A5E91425916A619797 8ABDA5EEF3753B2CE73C1DAD70A8B684C7F20358D7004C779718D513EA9FDBAE B98F3EC31313E23BC28E7E40A2F97A78320E856F1BB23A3DC921B6E52A5EB61F 63F1A78492E9AC5AEA74201528CF815EE6A6DD579092BE386BD53DEDDEECCF5E 603F466260AB754343CE89CB2B81AA09335B4A241E51574F1EE5C99D5E72EB02 DF2AF3DC95B62ECEB3830F4B350F26EA40BB55C7843712739F12D10A17496C01 EE41A5F27B9ECB11219CAFCB6E404B5839F3301933AF19EA767430025438ADFD 4A87FFAEEBE49956267EC1836377735EE47317A38045C14819F464F378FDEA24 23A7BE38AB8D128186FDACEBE917299B3F1BB292F841625680EBA2433CA9989D 32FA1F732F78D6C1F873DCB3EAF66E7F934132C7F8235C3E57ACDB6AD888D56C D3EED8D27442B6E3DAA302BFD282D2F8D2C9CDFFC8F6B10717DAA3A0AF88A525 D82F7D28FF4D25246BF82184929110DA0D34EBF97A8FB2E603EA815EE9141780 73B86C06B268539F6CB505743980C0B64DA4241239E0FCB3B579CD06BB4A357D A9EEDD5D6D68FC11FDC02A3C5A8F4316AF0A718B0CD6176E388E1A06CF5A763D 3405D8D18B44195786C40D0E73E61C9F8F06B0EDF142A96BB0E2F3F7043C56A4 311A663F835175BDFC076FCF9F3A70C18238AABCD5AEB694AE87782C78B9062D 768FE4D6A0DF9550C9FF77E937398DF0BAEB49A953FA991645659C23028C77E2 F11004A8FB6641350AB037705870382F1DE3A25A7497872B3D3BF46FA964F861 7FC3B8CBAE6C48EE1E6ECD5C055F7A1445CF8B2B387851FA9494A554F8117953 4ED84E567EE8FB36221DB24C2DA198A851459E4D78678148BFC319F0FD20808B A418798E5C6477B8E56B8F4F61AB3C77D009DB696EDA8C833C01BE14C83458A5 84CD5132DEA00C7BC2FB57F30F4CA89F8D477F26FB2510C61868A7632FD7A169 9D055B9238A6B592592E39BFDB8C8B22E9E93E9271E699E646790B5150F5AB11 EBB57BA952B7E04458C1C750358D62D197787A085F6D21041960B0CEE1BA36C1 5329209A77E083E550BA3794C8EE13BAE40ABEE1E21CBDCE57B558F717992214 760DD84F5566DF415A59CFD84B483094EA85C8A190D3925663E13BE6CC5A09A7 BD773876F9097C0FCF68EAEFAD75E424BA623BCC4F4D4FD4C9B508B18FA93BA9 35CC8D2F231C3A3CB2AA0B5D844706F09A495542BA51B0393A3A798709E27206 1F7F7E9B5C4515DB071BDD771BC483040F1D7C5FE8DBE6FE2082FFA892121092 7C5F9A5A96EAFD15DFB0EE436A7ECF20FC5DBF60D7B33C8DAF54B69CADB0B73D E84684A7EFE4E8A40B2C214F29B6D5FD4A9F94C0DC939FEC4C2E9CA188A76637 AB4EDED9823DF406E892DE9EC7CD3F0C8B9A04B80FB1C0B0618CB4A79A2E20FF F78599F259D5D5401B9B6D3C8F339760C212F9BF6C522FA5DCF08F9FD825DE30 634309B96BAA90B8EE90ABB0E248A487078A9F014AFBD47067FC94EE5F97B6CD 309B1C8C0283B7EEE7E843AB983EC327EB329AD042FB4D334D69A7C6B153BFF8 F16E7FD5284A009F1A83A127D0D687152ED46D5D64F695655A208BAB58D0557B 492F14C076BB0B30B683E3FE959651FE38408D6A6D18CAC67472793EC479F4DE 68E64DB15CF4456A2A9D2FA251F2ECE97632E69000F0A3BD80E7CCB9622D4196 0C69D043A999094346A39A15992B7FC9507822D877025E82BBD95E0F17833A21 C62153AD4EF1E1DD5F896C810E48813EC5B84E9EAE5DB91FF482A86E35FA17CF 4E8A03AA04858CFED63CB5B6718204C159073E0413272F8303B723C6E52078C1 B1E1A219A894937AA930FC064F083218DB61F8F7FB60E2F6F4FE164111BE217E 294CCBF561043320994D0D93C8CA3F6A510A2F1E6EBCD86BB41399198993310A 2BC2AA17E5562BBF3F84CB14F12477AB1A2DF33AC26F6364C0BD110C0918753D 168F51C7FF8EE17DE32DABD530C8D98BA66C2361697D109975263EF9FA396650 69846AC070E032A01417722CEA6A97B53826EA6AA001A8B80E88311CB6593938 9B0799DDCEC3584683FDE377A20D5883C452483ECD1B678FA6B7BA6DCB4AFB3A 9491A11C90279AC39173DB4DF7C852A86A72D5C31D784714B8542FE20A8E35CC DC7689184914E3ABB312BB65849F84E174BEB557A28C92610E0846CE9AA3D03D A1D3AA20799FE25FB585AEF9FB4ACA85EF8D8B81BDCB3ED5D3BFF1F43BEECEFD 29F8B91B14426D525D83869F8CDC401A1CF43CFD6C3C0872F88006CE89455103 FBE6814CDBB87E5609A934163D9A2AA59EEE2454A559941960B298DD692B62E0 911F54E9E5BE1E56F66B2C8349619ADFB25022BF55E433E26C032CFA876DB106 CFC4219F1C69B7D853558AF1E20650D8A9565B131B64296D7977FD2D11E0292F 5FA76CADDB5738E030491266CED8E20E32E8B78084750C31D6FD0BA12679E477 AD9524B6D27FBD76C88E111A9306335952CE3D8F4DCCCAF1345C6ABB8BDDB1B9 9B81FFFF752A3B31FC29D075B6F9B17DDA13B58EE234494839AE373E474F2B8C 5D4AA1F8897D563CA86B4FF942051AC80D26460EB2903115635B9993C9A3C849 0C1FC0A297F5E9E17F6AB4DE797ADB5A793E0A60B9454FB022126DED558DBE0F ED3D1D8D5A0FC35AD44ECF71A918257ECE8258896370C471611F60F1466B31CC 6EEA0F1A369B016AE8EDC0A5EC0848498C6C1003316D60E0A29E4F047E468C8F 93515DEAA5950DAAD1C372142FF7D0CA403BECF4BF9D4F012343AE0B4BB1B593 14DC6F626E59CF89CCDFF18D9EAD65037859F91F24551F88BC23626108DAC3A6 E4C14097529765910EDCE45BF9B5EEBE4360F1313781F3EF1A80D62E5A9EB89E 5B9AFCFE21F40E191F22EB5A37BB1176FEB4CF8326CE3D321ABD4C817C972D3D EF8E49C68EE8CA29F5414B0B9DD98584F4EBEA2316045614777DC37943C2A460 877D2EA1449673E79BCB0D0E5BCB9587EE7C01E5B9F978144D479E246D639C49 B69F0477083E122F81F568CD4B29E20B476E94633406CB5DAE46D7DB1F642EB2 739A8E67847B85D1305C68887C27308C5B5AAA29C7DE874367FFE5BF426E7F58 DD06BF1C027C661903F701182BDB97254DDD8D7216B6CE263BF6E2A8E2897635 13FDAB9F0F7E005724A1C65D87FA020FF23CC35661AD774B2FED8A5980A69382 F887D01F53AC138994990F9EF3551888CCD6D4C9CC26E5F7EF5436D996813725 8B25E4D363C7295B937FA1CC48781E6F39684C440533785253E6FFBA22056FB1 77E5E28038D9150EC475A0B54227619DB6F320EDF73317ED46BF1A4B7750AC9D 03AB3A0E00263F06379BDE9EC7196FF51AE387F2E28F639998A1A24E4D20CA5C A9FDCB3A74953AB2ADF422C50C480343D6D2DB4F45B1CD985E87C2CDC0D7DF0D 5CDABEE105899F1D12F93C6534176421890B5F2DCA9CA476DCF3A71464C8BF82 07238E5B8DC8B90659CE06E46B1C39F3B55F532904F319F0D06A457EFE98BDA9 8CF51769DF120D1BCC481DC527AD95B1FBEE9018A44415BBB47DBB4FEC4DDC1D 9AA85490768F4F2AAF50DC3F4C3B392842052562A91D5CA0E4D91BC676C356F2 43E0E7C208BB09DEA7C146E7A838390A70F78FB455982B5D68EAD4BF46A26F44 1DFB11300B825FB711BED394C7A7E105C65F6CAA3649D01DE67350D7A3165C95 CAFEB3BF3C548487E77537A8C58BAE7092A58E3AEC06FED319E9D5E431088EC0 72723B7D5F271CD6208D2D1EDA44BFD8F5A4D9E3ACA38CCDE92BAC95DFC74210 935C3A7FA4ED175EA97A89374DE984614596C20A76D66DDC9142E589BA8CEF21 3445888AF9AC9D7ED189E636C50FE39A2433C79ADECF0697A14C895CAE7FFDF4 AF0C8E7FC06FC62D731B4BCB9B32C25AF6DEF8F06432BC2B020D7CA2D5E1734C 526BD4A52E99682210B0E90B8B8D3DA8E85875D401233D3695D8F847CB33BB11 C6F1CADA6803912C06F0AC4B49A45514693EFEA964C479B935586B3DE756B965 39D8BC1A3BA000439D2D02AE5487B31CABD9DBE69B7BFB96F984230E257569B4 85FC4E16AC3D1831400A051B74463D59F683BCB92F89D3614F27DF96AD08D675 B156DC651ED9F864D37BD9BB2C47A88794E1373BB5C17E37474EFE4CF5DCA7B3 58D295732E435CA8761C3A5B2D0EC52EAB991A09D8670A9BA5D5B7AB11262B7C 7A8BD841F6DE2B6FC9BD6803D06DF147FA8F6DD20E8AC2569734E6FD54691153 550286199D7F6BC6903875A1F1DFD8C48F7DA51A33FF89CEA58455DA72EB58C8 1550134A8E98460172504250BEA8E6B97ABDE5ED3C1419B94386B2CE74CACDB7 3543A8CC83DEFD8975987B85F33CF6232437B27B2CFDE07CB90840B9B129CF43 9BD41C5C0DA9BF14F5A6190B3C714929A12575213DE6D6B1AC324A30F23D0E1F 45B82122427D2CFE45A9A6739CBAD41CA6C1F3AFCC58260B6F0A1203722AD2BE 217EDD7470F0F60CF0FD93332A28995D8CB0D5152C08C8FA9C30713C88B4B8F5 A323C96FA463326E24C4E7CF68885F5B65ECE59DFEE2B04EDBCB3032D70DF5F3 8BCB62B7F40A0D8AA75097745E2E775EC63A3889233C00EE8961FDBCC89A7910 ED447C270D053F3C3E0D08D118C9D2608A86DBAABEE90CD899F9A6E024212180 5D5994B21DA78EB968EBA81E3A6398F58CA67459E8A5305738F71D578B3478AE DE42C11D71F4295F6875D8D08DECACF5CAAE514D32D8A658CA764A9642B934F4 AE1D201D4D4F44A58B1A677530165B8F551F1FC4612F4F30260E39F30ACE5993 4F63BEF4B4885A2DA230C8BE9D0D599702C2464C0ADCCB01C32E41548E9D6BAF 87ABAD37EC7358E498887A1041510A834177AEF0DB40CD2D6769DD85EADE44AA 1B022174BF534A0DE82D7EE1173C8F3FE3D19B0AED6111DD915ED650571B5B2E EC1B317ADE5737F2176EADFF43FDBF5BE3A36173CBEDE24B8C9D394A8740B12B 6452969CB4102387F927B76809DC67571545B3CFE87EEC2001E3B53DF59A6CF4 A63A40E38470D02646884733A7AB4A7A64F009FE4CCA7A51D41020D9A0A2FB71 62E26CD3A79C6BE349EA3906AEE86CB7E68ACB70590F0F052338B74500B19D6F F3E315E2860091FF229733ABA5944FABCDECA90556659520DBF2B2E856861A1F 2B1E99FD695816170272025E465B9171696864DD31176E2008CFA34F80F96FB2 EBDA851FEC7F7BCFC00D3C80688DEBC043F4F61B76D70A82E8EEB20024A31CEE 5CED5CDED2DE59B9986FAB55DA25A803FD1693C3C4E515E894094E7EE7DDEC4E E42559A9AE9B2A0E02511ACB4595210302A0F4A8B98443F89BD3ED38DA299F57 6CDB0711104A3AC1CE479F44F1348E77D4A1C66419368674F044345AA1A4B243 51017A2DD41938F3025DAFEC38B0EB78A603A23F6C34193BF0C92B0C8180EF02 3AC4985BC08AD9A9BB11F53DB791D277446ECE01AF00B8E88E8B8FAC078242AE 715AF6068155B7E619E4CD7B009B403633285A5359ADDC5919005418023E912B 4B12773EC892642D9EE3F706174803194C8872EA8737DCDA531D1DCB699E2065 368E8286B90FF73C7BFB49361E56E47982ED9D63D14FDD032E3C8F5952297A6A 0B70126072BB34AD1DAA58F12DB9D8940F6DC18BA5315BAB5DF7DB6CD6DAB8AD A1AA2D58717131D6A4E5FE02EDC175A860040CE9ED293FEED76C3B1F248A01D4 2945483639D807489E3001A8ED02A4985D8EBDF816AA5C3E4E0CBFDBC3007489 974A59E9B9430BCC47C688DA016CD7BAD73B69365F3ADABB4FA346716E7440CF 38195487B7BFDD6DC1B5366BD6821BD34B674C420609BBABBB00634CC690A2AD 1C1CB6799A438CBC634D764328C0751BCE91EC6E82B65AB60AADCFEF9881531A 92189F6B97C34090E3375043EE1DF7431507960C9BC44C7B3AF8DB2CCB6CA312 264277A58DB4B6326D05D37C09285BC6A2ED8E5F436C16C4D6B727E2E4BE3463 D30B9AAD3125F80D313ABB89F14F6DA581F207529298B3A34E7A4D04DE7EABB0 E9D78DE9F1EDE4B3D5F1D87E64C39D76C410E34EECB0072232A38C6AF5E78891 8F67D99BBBDC998E44E4DEE824B1B11CFA7E26B1B8A5F1ABFA742EB1CA07487E A81A178EEA27ADA722EAA56B7F1D52D10C00101E4735BEBD0A5338890BF9330A 00013905F042218225CD28B4B7A9B5528D0BB680CF56F7C9D5C330EBB236F8EC 373D552C5BC511ECF705082846D8DAA9E96EFD3818E21938474D51A799F3FEA1 2A3AAF5310208A973EB0E21BA3641E5AEB400334B2C5E9D16972FACA30D5562D 26E4E8EE701C5608875C9169AB4DD5A2690629FDC4A214EC4087D117D5A1E9EA 5739B4F02F67831076D6AAF266C307458589A551A03C00510DDFFFE1433E96C5 74C87854254FA44BF7DEFC9CA8F57477839CD6B0D307022C6A1162F2A5108426 BC1730F605F8022F1EFBB087215C4667F19AE9D557748EE7C0E5D87350D0C2E1 C12D4DE7B46EBB8B5444C39CD00E32A556510D0BFA4A64F23F3AFE9271FFCA7E E0B8DAF2C65C29D6F0DDC42B08D7793207448546AFA222A1BDEF7A2075FD159D 915F6FA63C31AE359B1F1BEBE11AE8EC0D5AB1DF14AAFD9A5076C9615265868B 225D62965284E909A0DDE59553ACB6A7B5F4E12404A63E65E270239F8C6C02BA 353DC2052A1B9624901CB487F709A95DD183341E71A8F22DC95D93CB28163E72 95DEC31B9C315833659F4ABA8D0F78A0E0B70E9B63E69D0589BE0211C5A025FE EF7AA56D7E8A0B311A35359704E592E34CDB3893986BEF8CBF44CEF3BB8C1783 4F9739CA81DD92A870484A617E1163B2F0C52FD9FC05FEE10637B39651ED3237 CE33964340990AC346A95DCCD8E22BA0345DE2635934FEAD1605839F5F600CCA 70F0AF48F2F662318681057CE1A45D2F6DC257D109E5160687D4E6D7E1826BF8 268AAFA9E1C1C0902B8522CD97264907CDB680EB34244C3F266BB1ED99BB5AC6 2FE0FEC3F891DBF79A64BA5CF285A00E93BEA15EB81FA2F58FA43E3C2388D340 2000C55338085D333230B7F05CD7BC33177A82C058EDF4CF0F1FF0663E77AA1A 80A51CAAF09C3CAB936F9DD2F9BF3D5E0365979B7E5DFF1C03BA539AB0D5C74C 13204E62659C3871ED16C97515788616D93601A4712ADE973463D04EBF0BD5C8 B91660780642E66C1C3AF9D7FD2718FBD11A2914AEF5E574B8434517F23C7C7B 544FDCE3AF6F804028BDD5FC10564ABAF79FE810F5FAE9480EC4521BCF09969F E7F9400364B76CC30DA241E5D761EC4EC20BE62609AEAF7D48834C27DCB1410E 36923767C8919AB3577471F75B762A893C7A973C36F54FF27856A10E5F41953D 71498D411EEAEC3C542B9070D923741CA30BF4AB2200CE929A7C24E7515521BD 2355728C2E6A167BFA73DC46243370DF9248C8732357CDE7CE5DF0CD053CD5CB BDC265553A0A43C3AE44BA570C44FE11A1701A51787C5D5C29DF62D54D336604 3AA185F3F8C3978B41DB8CF325AE0A074AB234E76C0B918F08A7B619D8C67BEE A601BE07036CE19A84C88839A4A66C393939CF506A28762FB52AFCCF1A8DB5B6 01500FF69CD6F6036BF1C4CF7A4927AB7C44396614DF20A803A7AC058EF41C93 497E32CBE8EA25CEF64D3EFC7823BB545BAC9653388B6C907EAEAFD1D0525F88 B2831B188EE1C821EFD71FA3FF72FF6226EE5E6C546F2D8DD985AD4A47E53645 C774E07B8DF4D30C1DE252DB9359102E8A54E687D2CC7817F8FE1473CC612EB9 C442B184B113BF3888275317897ABE25E6917BFE530FB66C87E9302239B3D0CB E77F143FAB9FFFD8F5FD7BA740D2B5EFA0D82FC029E1825EB1BA3C069ACBB2D7 AAFD4E0EEE35191C6B2CCA994226CE8AFB50986742ACA5D3DEB6CAD8C76AC0E7 2C508FFBD62361468BDEA44A3C6FB2CCA04957ACB828C16CB9B2EF2018E986DB 50F0EDC332D2B33C6E5B75A12025C64B0E61CC8A5EA890B7F46F22729F994C89 8400524537333A267C53C582D9112609CF39C53CA4B5D32F6E1491AF96F50D74 F978432DD8700496923D7A5A60B39D8095C642A815F2B905753B9E76DF3F4858 6580E49CB6B10FA8815F04CECC59A5D91E6655ACDBEDAE057C3D33DF39174C3D 5713C8E87EF52D1A94F005EA7DF3DA71F37EA78F2E949B80A489BBC5760C0300 DF38CAAD8451CCBFFAA506C29586493950F191529AA46F541DCD51A1E7B91B39 F76DA27D71B269F5E4CC3ED8F5685C5A6E6709FDFB3EE7F2CDF02C4FB6905C5E A471A8520FEBCACA1254D707097D2481D016608DA5C355C4538A5CB61F0133D0 9350470D8152CBA65EC5B928979F51F5EB19E30521B4E3D8380E213458AB76D1 3CA45E754C99F0AA2EBF81860C384B53982385996E430A0B3261AC6664755566 F6DF1EF0C94DF4447CF33B5B52714B50B0175878C0DB255FA9F092E404E4DCD2 CD143405779173C1727602AB02209B95B61F2101D80AF0CBF83371A858DE60E3 7831497029D92FAC50A45B918653BBE4EBF3C336217BDBE11638C2C95A00B81F FDABB82B817B1F97FB8CBD3CADE67EEB4425763E2F7BAD2F8F5F778BF60B39E5 A7D6F695FB57A660E7E9E4456B259525FA25A5EC2E48251E1CA1B0F26FD1EA14 69C7E0297B6E32C8E3CAF443316EBC57218EFC9A0B7E612FB255B3E38C30B0C2 0D0E67CC798A20F48A8B2DA885FB6207313865106047B7356973ABB35E30C2BF 1953F8D44127A6C492716FD80745CB11D682DF7BAD5AA963B01819F0DD83C594 394A3DD93D13AD6F88C2BA215B9545E1D7BDFFD1882C015C5E9BAF183E4CD753 006239605AAA4260230F49720566B1A18AABC274165E0D558B18C38ADCD770FE E103A522EC336A5C5D4F69A67B1ED5251182424033C39A2FE1D71D01DC6F91A8 4D0D4A1A56C4CFA58B75AA00F95151C1CA0A04BBE3C831388798FDAE4B49A643 CED60EE37C78A9AB5CACA31ADCECCEF830C376A09DBDF689BC7DA30B39C82D78 23F89C6CC2EF0CDE595AB43FF809ED7E6475C1DC9C0F64DFA58BE01A24A97671 5A2C0211B0F78231B3932D184422DBFBB255A428A9172C862766A37BD6AC41BF 914582E3FDA2429025B41ABFD320F1028EDAF933AACC924E4AB477CCC510B65D 7EFD993230777A9AFA88516FD212493034F409094A5CD04F001606CD41FB7765 E7BD95AB449018095CEF2F4BE3C02673725DA34E40C3ABE73AFBE68E88C454EC 8379E07125925C38B2C6713C2C9E51A76927C81A61F377438EBF62547BA0F0C1 74E832210F01E3F08C7C0FD06155CE7FA3E728D378E630E3140DA9BC5832E6EC B50E355121B0235E23D438A1E180205184F60990078E86ED70028A39D755F615 29CD892F0E385EC6D5AD019AA16B3EDB3462DAE2ECA91E3881C82E83D8A76D01 21C14BE17532965E45DC451E55A8202DCB33354C01718FAF7D02D559BB722475 E1F5096051CCB8B12FA8E72B6D25CA87F7E8A7D01EDA0B66CD8D82D2977CE85F FBE49B995E00C30CC18A809DBAA35BDC083B668AD1DB806AB5745505E4C947B2 3AC69A4DDD57F1BC5354F2768CC316A584B7178ABFEC112BF6E3B458A2DB4596 BA2F67849BB5AEEBEB622B41C7EEB17958C64373F667BC7B39CB03B8A1B14C32 C7EFAC8A3BA61D53CC6B12E7823D07DC76BAED9E2DE9375BA0E50A92EC0AFCD5 E3243A6F02E5EE705C85039AAA48CE2B594A3E8B67B7B16B1A831C2F5DD712DD 3EEA3FE6D435007A1C62BF970C0B4D24BB6D14DA64AE52715183B7CBEB5D7FB5 ACFBD39927525F8B9CA0D0CFD03EB35888F3A05A6E11832EC3DF21B15B6AE662 6E90F6CF2D5ABE8FA50278D9CB0C1D8FB165440732F8AC18544EFE5781B08B7D 07314739886BAAE26D2B97A20D44F62BFCD6143F54BDB57E74082D123DB5B0B4 9E451405C308D374EB0B11AC4BF8339FA9E4C192002B104EBB7CBB54C439147A 83F5EC1ECCC19FE61532F7DBB1DDB6CDE7DD50AF209188C443C297DC29CFA1E4 6C1E9464850734E81B3C6E58621F4A8DBCAB8F9AA19CD7262C40EA428BA170B4 7474E428FA75DE9311FE2BEFB8A03E468C9EBE5D55A8161C07C47AC5887A7AF4 C0FFB985E167B1BB27BAD37052AF2DC7096CE0D257EEC7041D7FC6E8C65AE291 D25001783ECF43EDE1F1E8E248C0FFE1F99CCD01EC726C23AA969CD4C5381F12 43F0ECAD5157F845CA6A63B2EB7492FABC2C254E2CEF899F7DF969C75D6EB5B4 048B3FF0A460B4F951EBE7696DE26F208A8409AD0877F7EA298C315FE31C4ADC C918BF43296916B4B8FB60AD0FF4989727B5BAFA4F8178B028A5EAC794029917 2574B08256D4B1E2BF8FBEA96F2709BDAEFC20A670A344A0E22ED8AAC9C69C28 A37ED2510C135C6E5EBF38C1204ECA031DE2596C01A64CC9E141ADAF2BF6118F D9231BEC63F902061B264ED222D77FC4C67BECCC5584EFA481AB6D6E55C917EF FE44109C86382A1D411C611E9F7A771C6757D140B748AFCB2C7033A680AF9909 5CED253FC0488316DC8ACAC1D29B83808A4CD84883DBA006F4A242AB6E28BBF0 229B3F1E6D678FC527626C7D3CEDA20B1DB0450CAB2863D4B517ADE4CE7A1BC9 65D4197C3986B18FFED160CA7D74EA3FA9EB6268775A97720E6D3802AE64CD4A 161012A15F410A6197671CD439F227F2BD45F6F602B482D9E1848497F8647971 114D402C18CDBBE67310352A955EE6353D01B0DA0279B7363097DD70613D0A8C BCB5549CAA7D7F55C1D16ED60BFEEAF1FE054F1C852DAC64CFF00637901F1925 CF3D186DE5A1BBA933DDB3B5400929EDCE5AE9901E42D59F5B555FB9538B29FB CA11D557D58F12FECE0AB20C5C14A15D06242BA2BC266234C1993FDCD01A86BD EE337C9D24EE53D8BCACBAB877B50A65902DC05813E88E09B805488600BEE642 06677915995C694B242E9867060FE4882BFDDF9711F8D26D0BC2616C5F7CF79D 812B165B515D8203C8E8D50FD07DEBBBA87166D08E724650FE7E8E88DA8AEDDB 174EEBC905AB660A611837B2C383B4D4139932733330E37CE6F3E0CF43ABDC78 C96219560627EF52CBB402DEDB065142CB737F4B2FED0E6397A9791D522DDB1B E370C8C3ECCFFA21767739810B8299A2D8E3317F8C11F3A2B2DB82DFFF8A0EA5 94090A4E7A25524B08A3F2867D9581A402FFE90B1121A213757EC67405741570 FD8F05804157F34AD3F21F9169CB4DFA0EA33F0D0EF3954397E958591F93912A ECF385ED3033B2AC4622EAADAE53AD18FC04388BE2D857D22282D57FF13067EE C8D982CF4E09420FF913BC568530A3A53C4A6B3A6276D7007E283F 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMBX12 %!PS-AdobeFont-1.1: CMBX12 1.0 %%CreationDate: 1991 Aug 20 16:34:54 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.0) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMBX12) readonly def /FamilyName (Computer Modern) readonly def /Weight (Bold) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMBX12 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 49 /one put dup 50 /two put dup 51 /three put dup 52 /four put dup 53 /five put dup 58 /colon put dup 65 /A put dup 66 /B put dup 67 /C put dup 68 /D put dup 69 /E put dup 73 /I put dup 76 /L put dup 77 /M put dup 78 /N put dup 79 /O put dup 80 /P put dup 81 /Q put dup 82 /R put dup 83 /S put dup 84 /T put dup 85 /U put dup 88 /X put dup 97 /a put dup 98 /b put dup 99 /c put dup 100 /d put dup 101 /e put dup 102 /f put dup 103 /g put dup 104 /h put dup 105 /i put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 120 /x put readonly def /FontBBox{-53 -251 1139 750}readonly def /UniqueID 5000769 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5F0364CD5660F74BEE96790DE35AFA90CCF712 B1805DA88AE375A04D99598EADFC625BDC1F9C315B6CF28C9BD427F32C745C99 AEBE70DAAED49EA45AF94F081934AA47894A370D698ABABDA4215500B190AF26 7FCFB7DDA2BC68605A4EF61ECCA3D61C684B47FFB5887A3BEDE0B4D30E8EBABF 20980C23312618EB0EAF289B2924FF4A334B85D98FD68545FDADB47F991E7390 B10EE86A46A5AF8866C010225024D5E5862D49DEB5D8ECCB95D94283C50A363D 68A49071445610F03CE3600945118A6BC0B3AA4593104E727261C68C4A47F809 D77E4CF27B3681F6B6F3AC498E45361BF9E01FAF5527F5E3CC790D3084674B3E 26296F3E03321B5C555D2458578A89E72D3166A3C5D740B3ABB127CF420C316D F957873DA04CF0DB25A73574A4DE2E4F2D5D4E8E0B430654CF7F341A1BDB3E26 77C194764EAD58C585F49EF10843FE020F9FDFD9008D660DE50B9BD7A2A87299 BC319E66D781101BB956E30643A19B93C8967E1AE4719F300BFE5866F0D6DA5E C55E171A24D3B707EFA325D47F473764E99BC8B1108D815CF2ACADFA6C4663E8 30855D673CE98AB78F5F829F7FA226AB57F07B3E7D4E7CE30ED3B7EB0D3035C5 148DA8D9FA34483414FDA8E3DC9E6C479E3EEE9A11A0547FC9085FA4631AD19C E936E0598E3197207FA7BB6E55CFD5EF72AEC12D9A9675241C7A71316B2E148D E2A1732B3627109EA446CB320EBBE2E78281CDF0890E2E72B6711335857F1E23 337C75E729701E93D5BEC0630CDC7F4E957233EC09F917E5CA703C7E93841598 0E73843FC6619DE017C8473A6D1B2BE5142DEBA285B98FA1CC5E64D2ADB981E6 472971848451A245DDF6AA3B8225E9AC8E4630B0FF32D679EC27ACAD85C6394E A6F71023B660EE883D8B676837E9EBA4E42BA8F365433A900F1DC3A9F0E88A26 326DA307525B9542977147464756D5B9E2F79498A7DEB3FC3F28B42945BF6C82 64A8825F73D36C2FA684F327BBE0F20D62EA7F44DD388A5A45FAF227BFC7B546 47F78B35D78DF7814B9EB9483FF2743DA2759F71B1EF3493444F406962D5B3AC 864CC5F3BE02507FCCAF7DE8115D8961EDD86404B7C3C90F717FCF90891681AE D94719F676FCC22BC3435A76E877410E59F5D9C2C028ACC1BE288B19A19EA9C8 F3C53D28E4D123E658742864D63397545340E3C26BFB873BABBE4C8FB1549F6E FA4722E3C9804DFAD658BE8B0BCEF49EA23C9536F200D148BE0BF026F25B572F 2F0BEE370DC36910711721EB6F9A0A365094889230EEF52BA2390B1CC8D7DFEC BA06E60F699B3FE3E981B13600A871B9C7365D7C2EA682FD9A332BACBD9BBD9A 7585665EEAE2903C5FD2DC22DB57CC5239391458414E48D6D3438089C4243EE8 52ED6742785CC57AE76B0ACEF89725514444D2C50D13279D0DF1EFC13FC9ECA3 65D215503920A4A8FA2FCF89C92676F5B55759D142210A48358D7DCD84F2ABC6 05E6D11B12E19AA9E7DC9C012B8D59FEA211E163EF051070D50FA119D4A3BE9A 8BE949C2C5C5A8E5B3DB9F31E5FF591E0CE7737DEF07CEEC8846B33FDF0DFC0F 53A37D284B377FB5424A15CF313EC15C4BCBC65293B4AA8CCE6F94842013EF86 BE8112909744466F63B2CEBE5D0D3BCECE26A8E69B438E46492A183DA1665261 3DB0ED1389A0E4D84424F3F542041AA24B14A86013AE1D9F5FC5D4085D11FF9F 997F2DE644F693BC2CFF4B52B52E5918FC254E9C66A467CC4E9A10334EA7F893 4B91DD7B299B63CF65400ED294AE0E637A431EDC550C4A6707EA329608526564 E3635974D011C382571B922F226D10A4C28E973F4DEE85CC9A139C2C8F787D12 019713458F8889D079550444458AD3A7D94124304DD2804FE18200375F2BA524 75F782D49AA6707B8D00387795CF270ECE0445619BB5D99E8F052E399DC6DDD6 427C23ABD47C40C321D2253520B54200CD3EEF25C3BA5553B679BB08098525B5 07DE8B9CE2B3A13F7A386B4C3A08E989C1F3C608E266A7005A8D097019C6A1D3 A833874FA31908B612A0AC4761FF8C3E5BDD2CD8BB3566D4F9B5F56E24E4003C CBB89E3988BB00B67A1F980F179544DF49E4E6CE5E23BC57452B4DAC221242C6 BA70FC768FE3746FA58590CC96B1F28D9EB8C50846E2C26774D3DAC0D49B4455 8A059E3EB9BC48D10BE32E14704AFE2D9D05DA666D9C3CD0E05E2A56053EE209 15EC1BCB7C8DA43E88461B37F19C14D142D01EA13920AA3705647027023C15DE B699EB78E8D826D9D7132326FE61896A1FA49EF1879012F666611B8A8B6061CA 8BF82B15E22F15F10474C7BEA2F5A83202BC1F72C664A9F956F0C10610690ED9 3B5F6300D9A1976C21FAB6260B8FB5FB8262C0E08D7B73FE3ADE2B1FB49949CF 681F618B110DA841FBD067D25FABAE3B227DFD34713864549715F05F1C9C2D57 DE29A5CF3ABC86ACA7409DEDB490603A2E3A18C485209BD2BB05F91923155186 F4A35502FC3ECE9AEA4A4FCCF1FD8B709309068E56561C8E9CC64572276EDEE9 CF3E46F40DF80A289F1E74D6BC7197B0C23D426EE55DAE9D3DDAD7293C13FADE 3BED4580860999A0C714D2FFD99E301E5AD17A1DDCDE5929F974F2805300F53B 768063B7E1CDE3EA56A6CD2535F537C2AD4B54ABAC1784CDDEF6ABB8D7457634 EB6D3847724B005C89301EE94C07446532788935F47B5F6BD21683223494DEA7 90A364535A87383025F891E529F433C1209674B4F40B3D596F8C352DAA39DFF4 13661518BC10576D1107384828D0FB399ACE1082B8810EE5F0B8FE032211E34E E367899FB9BBBA4D26EA383F96BEA5C75FE90085E96891F4986CFDE8DEBA5EC9 1EA159F58F188D91B4B06E3758D07C2E3EC9149F30BF5A4BDF5FF66B7AEFAF53 817953053D4C97E34D061F368F5916986B40F3A3A93075EB5979B470F0397B1F 91BC1460D1BD981DD0A5F445A11AD2EF295E575CBC3E85F32DE68B5EB24844F2 53196A235657AFD64A62A020333118F61DED378B6D1C3C735342BFC6445A1213 582D9C1216772506B5F47201674C548AF6AA746447062C6155FD03024C65C588 531A72A6C01DB2C4728BA4F45BC6C814ABFD8859436837F4833ADC870265C441 DB18D8BA87C81DC4983BB3C56B977DB75DC79292F737076FAA65E5CEB9776A74 36B03379968F22823A73C03E07D19822F06D1BB16FA4E28F31BC209E262B26EB 980D7D7074C784B29F463890DDDB6EF65F8F75FCB641B0D572E39AA72270F295 FAA6075363C476B63422D03D5EEEAC5D8DC3ADB09DCFBD97DA7223B86CE20EFF 8602FEA584A89AF39F2FC363DCFCACA3558EF929DAD87EFF25056DEFEC02F2BA CCF2230C2D130E69FE5DFAFA1B2BDABF74F971775F67D137A5BEC7C7A4BF0FD0 425009929B7E9E165253D707E0AAD7C9F638FF3B05A36669613301D376B65427 246125EA05DC451A75A6A8C0710E40949896CC7660D5A6B9CD8E4EDFECC8C240 6E25C762D647A5EF472187BD3414670BC36605C70C9BD557570FE4656E359E8E 6E0037164C48706CCAFC66DE4577E7F8BA3BA49E80861A7FEEED13600A45F160 70CB476131DDBF357A2DB8D1BB0BE701171B89883E7C6635B8635D91CEB5E3BD E18F541FB38A01556CA5AF88886B7C41467E79C365B3543AC0E63F7075AB819C 71295E8CDF502F8161F56C4ACB3FF6FCDC103E5DC91B141157AADB9C0352468A A5063AED47FE611666E31FE69E1732533C46FA602CF5F7B5B46D0746021A025F 6C951D7684141A387732971939353BC8D417BAF1DF25246131B9CADF319FE4AB 483D9D013F3D2B85209858C9DED15D0A58C7BEE73154A1A47CCD63ACD9DDC04F CE316FA0AA363234B5807BAD484BC32B63706D20A6622BB7BAF845E6AA1CBBF5 6410DC12456DEEA6EB5C228F67AB1086CF855E96E0133BB163239BCA2690C551 C173103C79FF2A0F5C0431BAE5F4A4787E9F7350BD1457605D97F587E12D9630 FAB269CD14B773D6FAE7636742121C01E07A9EE73BEF8829983FB8505B539650 0F6A56BA00080B0C1C9902AECFCE246188E97AD43A69F403B9C3C7F559362334 DEA507764A9BE83027EDD09E9E25B4C083AD72150ADBB93EC17889F2AB4E1512 541FBADD90405632999E4D922CB9DA5DE62084B278AE9E8209C3FC6377A8799F 26DADEC9C8DDFE6EC2D09470D2F90E94094F10C9170836EB1F4D5267ECC80476 450D3C798E6BB8DF347692AC9789190B83CE4563189B0C412EE61BB2F5E6B703 0B0596CF7438CE1856B86AFBD255BB659376B873AA3B589DDD7DED36309D2178 6D22377DC2845C5DADC94A5A30AF6393ACB58324E49905694159A5DEAE2FD4F6 0A658B7B104B4884EDA573797E1DC64703C5B651813BBEADC5724D4DB1FD4901 75DB7C67C39A229B72A099E02A2610CCEAE0DAEE4B12638621E50A41FDC3A3E4 BFAA128AEC9328621B8BBF089916EB355921A92EB00CC84386F04B418ED88EE0 505FD2D2BB594A929407B029CB989C3A3F6AAD5EF460CEB1EC2F7736905A9D12 1657DB4F01A477851328C0B7030C2CA21DCF7B5D6010EDFD90DA3BF233892BB5 0A2EA6DC710D261C96357DB9A80CA8421C471182778536B99F96BC11B4312102 C1DEAA24F20BA41EE5EFF7D7A1095CDC8C0A561DC711CF2F30E26C9020CBA4EA 576C8A969E06EABD96452F8D7A517482C4D5BEFED3799978DDD48ABF6EC0294F 786E4A4B78383C2848FBED7EAF268E605E293D1DACE4AF470A0B37AFD31EA0F4 0B0509BEC6CB7210C15B3BA8ABF7E8E1111163E50440C4284586D1233D6522CA 0E7CF72CDF179D6BA92859EB57E8C6FA6ACFE93111503D81009E329B3507C8D5 B0ABF4EDEC9B40444961601EC2806BFDB10340DC9F24A5F8FE6AFBF4B583A533 D6BF7075B1EA1B6E5E44D078E8523D75903DE5AC1FBC5EE16175D16C34137C5A D57806F7AA98FF5C275ECF454EFD2A030651F8D6C8B423B64BD3B7258E0980B9 FDCDD7D4C35DE3566ED7532384D74F17BECFD36058E997389E9F1442F1009C13 B38E866192FA881C3E787A0F2B1CE6BCFDCD2C1F67423DD3E37A09180AB911E2 DED5A83E41FC990E08BF2FF927FFBBADBB7FF72E2777FD3469748EB35E04F208 8153BAF49514DB35A67E149F4CCE36722593306C42A3EE44DE09CA9F5D8D5A75 61F5A9831626B3479F12C913BDC503008FC4C6BEA742E33F622F9BF16EFD8824 3C9033654A4684AFAA45D271DA66C23EC7EA3DE94BDD23CE49F20824170DB00F 72EBF04A11B56396CADACA5156F8C4784417FB39ED559E747C5C4CDD5FCDF801 334F1036FD725E22FE1FECF6F3987632641B02174CB2B734985539258F59D4B3 123AFDF29F7C776F5F025CE662259F3D50C04B333C66E6D1488F623FA6C7B2EC D2863AC5A959AB7521E5A2D6EE53D14C053A834FAE0FC1B6ECB300F903DA1ECF 3FA37E24950922751D8BFCB1967D83CFE3CF4873A570E9D7EDB2DECCE9522324 30D6BF9845C3816539045CB46CC7D5B04248533EC9FD57E99EDC9BF039E50C6C 8C0F3323809DE156AF4BACB99A177761ADE30418F5A26AC34C7A2B9BA0F1164B 2F78298B3FF6C1F5CEA0D16925CCD3E3C94627FB58204DBF2FEB648E513860AC 5CB274222C23B92C3CFBB85880F90C7AC4B999F2711E4381B2E80E451966878A 82D5379E3C9E3218F6B21B2D09BA4ECD904DEB13CE569878E251FF64198FB1ED 6F60D5C40D619176A2632EBC51E0AC7C28FC00C040433B29C2D1F07786CDBD57 5028B34E553B00C7BC26B301805692FF3A0E3E2A837572F973004D094ED0A538 6132FA951E5112C8A4F92A166F4C417557454D94C87EDD2319530730BDEE702F 70076412CE8003D2EAACA821A1E41A53AD2CF714226CEE036630FBE683206586 D0C9E620FD128ED4F779D89F835C38FD6BF67B91AD7B3DDA0422887626F817D0 B070407D892907541D21C9B21B2D74116404739787FD1B6916F8990A706CB4F3 6A592567A20599EA456EEF1F0F4D5CCBDC4958CDFDD54EA715E21C1F4DEBDB5E 0AE6D0887537264BBB1B0103F60C1DC247C21D38D64C83C0975F1EDF17FAFCFA 2142CE3E38B1428248A8457307B1D223C44FF9F0F79E1172F5E209068490F3D6 C285B6F5A5EED4AE47F6FE8016846E92D4C8A4EC43BDA10142B271870E421B23 827C90A1A6148C02D08954FF1B2DCFB91871DC5297A73BDC5C7323B1B3879AFD 5DAD0EB94BFF3C52C9F8470DC95CE052AF1D74C228FA19ABFF9B8972EA9622E8 1561D92CE5676FFCAB64B8F786D2F7149542D085DC3DE0770D661F149EB0C5F6 1FFE1D61A33946B8F363CD2A0A3049F02AD33E0CF3ADA0F2F86FBCABFC4AA010 906883E6ACB4B42A33DB42579B7BB6B2C4E106E59131A8EC1B1964F031FF2A0D A88741394E652204A0C39677DEE6C14B75A1D18BC310B261DC753DE2786FAB74 60990F36E49751A7198122D4EFD04E660954F91F734DFC7592D55935AA31D978 9F702BC8E3FEE768DCB26B0E188A7649F8D884C3EE4976ADE7A44DD0DA7AEECD 67FE2AF35EB21089CD2B41FF058B8D791755865DFC2836FEF5FBBD304F1943D2 02C4646E9BDB4EF51C07C2DCFA02E9D4285421DD9D9B490463CEAC61923932A6 B5B6DB9A1BA5BADA7ACCCB5941362B3EBB27250E3E28AAE022FA902F78193659 42E8BDC253B831F92C40980217EB42BB3B617D0C53D46792D8E2F53BC08219E5 3651301D01B232E0D45114001D1C68C6C7219245F616BB1C09A4298EB8538B01 5C63AEFAE85B17E88F2C5EA0CF6629155AA7AEA7BA5DA1A5CA76BA4622D963F0 052B2B62F9674FB0FE15ADDB50CDF8CA44D7C95129B611AD766F0ADF26EB5377 B9598FB85122E8A4AEAEC42770CD958A7C67E662345143B9AB036DC0A8BCD579 AD2EF6BF07644BC3F3F609513797C47D6932666EC3878D1D56F22199AC655D1E BDD75D3E4509E32F2BDA29990BDC519BA7DA79649B84A7085415D760C1DF9C9A 7AAE58B80D9280E1D044165889FAA4D9E5320C95A7F22A2045219C0E135265B2 7EED23C0A1980FFB8B53C43A716A88322B40D2BB2025A576BA6B6E78F9BBE99D C913683625B01B8F06F8D48BDBD3E5594FEDEDFF82024F248FDFB5BA2C022023 52105F8677CD7648542F3732A0F095AFD8F7D013663F90D7E233559A67E378EF EBBCA1559E9F33E0A4E0A8BA5DB7F685D0FB88421C8521E00569624B86FE17CD 5CCE1330C95C07495E8C25BB3118FD1C38707FE5EE9BDF2DB118578379F71C6F DC5215BDB5FDCC1AA6DEC2ADD8A664CF1BF4A03661F7D245D279AB789DB0486E 7CC1ABBAC58462C4FFE19851B333AEF58C9CBF6CD42A1CD086BCA352323F3605 BD0F4C8DCD6AF3D805F180E749DF6A70727A8B09CCBF67834BD2438C871931F4 8D7B92E891DAB946C854873CF03F2A65D14FF4C314E0D014F5F1EC6255FAD368 9156082D5755EE27CAF6A725F52959552549D4BF0DAEACAFEA066D19136794A8 48A156605FBF722B06AD072E78208FA057E1755EAF85836B2267F47ABDE2299D 20FF27E3436D3C5739297689EFDE9DDA4FCCEE1F1134179AF016DB373D3ED164 C548AF819A95E85D13F272E14EB5F3B3AC4E2D43986E41ED594F5FE8BCF46A6F DE05765B7305A2142408506F94BB3090BC8533504666508F61BB32ED0C2C77BA 3436559C786C2CA83432F3ED00C0184BBBA81A47BD4D33919EF3F52697588E54 7FD2079A8800E8C0B591887B21AC8FAC65141715431A092E9434EEE00CFD83D4 130713E7A157407D0BA4A90DA36CB6BA3A2F6458E6E2CEB056A32BE6AF87242D AC9AD8D5B789AA8986CF807B6E94EEFC5D55D4570562FE67830F0DD169CA4173 F9656448587864FD408DEA84E10C5661DDAC0A3A31204BD7DAA5E01C4FC0F8ED E36091DC49FA01A066F7FF4B93C3278C30C20E549D0C888B16AE322CA4B87B72 1C9AAB802169E1BB91D6C79B5262C4DE14E5AA8AD05E5FF144F645D759EE96EA 4B5C60D25CBCFFCE28F65AE9603744C66FAE240C096EC4C488EE2924DCEE1B26 566BE1D2DFD7839F9E74073D31A9E90B3283BA5B8D2A56618C860F7011AD175A 2856F4E5E45A2E9F64CD5064F4F0CFEE6AAFB3A601F161BE9ED98A0DB2D95ACC E5B559AA24D2C537F9153F6B3A8E6E398F4047597735D5A33782AD606E637ADD 61E338C5554EAA9DEFE484700D904E9A70AAB8262EB22173B232FA016846B981 278E2F6CACBC6FD5B8863E3311350CAE8E2345C5A90445B95842E7446879C97F A68963037C3A7B6CC8C706812D340B490DF6838AD38FC7627734DFC3985DC828 CDCCFD3BF40AE99490535CBCBA0A235DBB08AE928B6BF6104C254020BF91EE87 8F04259573D89280F6C3495A3CE3CA15D06DDFF57687BC69B31338442C8F2D1C D110C27654FBB56EA54F7EE7CAB28C284293FD93A7ADB80B944D693D16894432 2E6DDE59BC16895C07D03C99557B826A654D6EF49213BBBC59FBBA2BB22B78A4 157651C89A8321052A5A7ECBC36C1089546C81C73031047AF5B13C2469AF86E6 361F50F7D50F561C2CA550B798C02ABD3207AC86866012229BBD8951F52C128A F41E039F1D4E34E066AA22449D8ACCBD58CDECDDDE60536413E0A3FD31573C3C C1911B71A944FEBA7574696B1D24C91DD63A43189B151BA6CC26E749F6330DE3 7A7F738EA02306F8B28151B640384A705ED56FE95AD0EA44D405EDC5FC91A864 9C69AD93E75D8088B879DABDA85009A74CF0813D7321BC53777A1E6543D3857D 8A3697ADD8C91A7A5B176569FCBD2216121CF4993116E0D9DAC96DD828427BB6 E788DCCAB9C34C2CC646400BD80ABF6D1165C06C899B2706AC7EF2C08675FD38 003604B6DA507D3F8E2BAB6DC94588A1F9C18C7A56E7F46E90FF055830E97E7E 908CA97980B09F496D3FEFB47263B727C0BD996E28466C94C42F7F25670A3B71 FF035B812BB4DA59261E02172ABC03434C29A046715347D6B3E329FE24FB8FDC 9347C251373FA8B97C08B2DB58A6A0445D1E1203050F3DFDC5CC62FBE4AAF265 6E3F158B1A8B75BAFDB5D74B16E2F11D7122C439E6119A59B79D2B88662DD9E9 E30DC576E52538329D7A11E87D4AECC2233C966B7F2AA91BD5AB29C772F770EA 85A0EBED21E396A87DF456B586D7404C128738D6D52EBCF94641D053D38A2E33 84BE8D6250870ACB33B8058195D6711C9769387E2CA4D33F05DD63A4F0F393A9 9A32443485DC84E399F4D8C7F9122C22A8D50051079043F2B016482BB41D4E5D D26E83723543DD005D0655F0D056B3CC65F243BD7D82E7379A90378B193261C6 00DAE8C5275D28EB29244EDDDBDA62F6001BFC23D4871B5EDE919672F76B843E 6ED0237B26EB39030F2A5795EB0E129CD874DABC8BBFBB20AF4465B7874D83B7 2E49A99AC5F76B13520DBF9CBCC305DADC4D24A00B0C6217907E4CA017634D7F AA9B5F75DF15D27B8D5F7544D97B57DAD79BB9DE14BAD37764C59E06106301FC 2139E2E47249DB6F3681AACEA4B70C92ED65330FCCC7FB80A3DA25A24C17ADF5 24EF5FDB5EAF3AD7E582243F64A1C2780831EA2A8336FF46619C7F100FA52AC4 9D554D9DCE2FDDAFAFCF4F9D987895A2DF3206661701608172C598B01F7F755D 81076D753E98866F32B89C0532BA794A345FAE61219DDC946B037E2C0E367CC0 6018F827FBB11CAE2C81FFCCDDF61BBE3E9B28B03920A28061CD827249E0A1B0 DEE72257297F6F0CB237C2DCF59B9A2D77DD7A5DC2F55C3C98DF8D8C3D752775 5E40E90649CEC6361643000BAC8B8983615B518786B9BEBE94802908F7C1EADE BE6CBAB0EE9EBF70B710C53E8AAAB5163EE527D3ED3243F0DD34B72F6EF855D7 E3D2C097185A82295AA7D60E2B3C499B65B46DB4E284D922B1A0718518830396 DB0407FA0F65CC177BA7D490486222BF9AB9427026183B3693C30B04C4899101 D35E795E0E7D4CC30695CD632BDF7A7091ADB01239918ABC1432F3F585688FC7 23797E1A40E6AB12047A729706B55031CAC91682C5EFD65D93C445D214C5525D 834D289A9F6861CCD3CA9A857C9FABF5BA61D293E98EC23F160CE122DA3F468A F6065FA19AA30A36600ACB11D1DE574C937339DA6317D3159ED7EF215E5590E5 A20177A74860F6B1BC484659D2E5D5493559CB8C85F0955A14C6479E8D6AFBED EACA7270A4023FD064F3D4524528650A22A6A561F84C44BF27A7C0 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont %%BeginFont: CMBX10 %!PS-AdobeFont-1.1: CMBX10 1.00B %%CreationDate: 1992 Feb 19 19:54:06 % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. 11 dict begin /FontInfo 7 dict dup begin /version (1.00B) readonly def /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def /FullName (CMBX10) readonly def /FamilyName (Computer Modern) readonly def /Weight (Bold) readonly def /ItalicAngle 0 def /isFixedPitch false def end readonly def /FontName /CMBX10 def /PaintType 0 def /FontType 1 def /FontMatrix [0.001 0 0 0.001 0 0] readonly def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for dup 12 /fi put dup 45 /hyphen put dup 46 /period put dup 49 /one put dup 50 /two put dup 51 /three put dup 52 /four put dup 58 /colon put dup 63 /question put dup 65 /A put dup 66 /B put dup 67 /C put dup 68 /D put dup 69 /E put dup 70 /F put dup 71 /G put dup 72 /H put dup 73 /I put dup 75 /K put dup 76 /L put dup 77 /M put dup 78 /N put dup 79 /O put dup 80 /P put dup 82 /R put dup 83 /S put dup 84 /T put dup 86 /V put dup 87 /W put dup 88 /X put dup 97 /a put dup 99 /c put dup 100 /d put dup 101 /e put dup 102 /f put dup 103 /g put dup 104 /h put dup 105 /i put dup 107 /k put dup 108 /l put dup 109 /m put dup 110 /n put dup 111 /o put dup 112 /p put dup 114 /r put dup 115 /s put dup 116 /t put dup 117 /u put dup 118 /v put dup 119 /w put readonly def /FontBBox{-301 -250 1164 946}readonly def /UniqueID 5000768 def currentdict end currentfile eexec D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 2BDBF16FBC7512FAA308A093FE5F00F963068B8B731A88D7740B0DDAED1B3F82 7DB9DFB4372D3935C286E39EE7AC9FB6A9B5CE4D2FAE1BC0E55AE02BFC464378 77B9F65C23E3BAB41EFAE344DDC9AB1B3CCBC0618290D83DC756F9D5BEFECB18 2DB0E39997F264D408BD076F65A50E7E94C9C88D849AB2E92005CFA316ACCD91 FF524AAD7262B10351C50EBAD08FB4CD55D2E369F6E836C82C591606E1E5C73F DE3FA3CAD272C67C6CBF43B66FE4B8677DAFEEA19288428D07FEB1F4001BAA68 7AAD6DDBE432714E799CFA49D8A1A128F32E8B280524BC8041F1E64ECE4053C4 9F0AEC699A75B827002E9F95826DB3F643338F858011008E338A899020962176 CF66A62E3AEF046D91C88C87DEB03CE6CCDF4FB651990F0E86D17409F121773D 6877DF0085DFB269A3C07AA6660419BD0F0EF3C53DA2318BA1860AB34E28BAC6 E82DDB1C43E5203AC9DF9277098F2E42C0F7BD03C6D90B629DE97730245B8E8E 8903B9225098079C55A37E4E59AE2A9E36B6349FA2C09BB1F5F4433E4EEFC75E 3F9830EB085E7E6FBE2666AC5A398C2DF228062ACF9FCA5656390A15837C4A99 EC3740D873CFEF2E248B44CA134693A782594DD0692B4DBF1F16C4CDECA692C4 0E44FDBEF704101118BC53575BF22731E7F7717934AD715AC33B5D3679B784C9 4046E6CD3C0AD80ED1F65626B14E33CFDA6EB2825DC444FA6209615BC08173FF 1805BDFCCA4B11F50D6BD483FD8639F9E8D0245B463D65A0F12C26C8A8EE2910 757696C3F13144D8EA5649816AAD61A949C3A723ABB585990593F20A35CD6B7E 0FA0AD8551CEE41F61924DC36A464A10A1B14C33FAFB04862E30C66C1BC55665 6D07D93B8C0D596E109EE2B1AAB479F7FAA35279ADB468A624BE26D527BFF5ED E067598E1B8B78188FA4BCFB0B51692D07B0BEBB930C6F0997B437E2C51B876B 61A563A2673932C2045833FAA35DB22ADE12102335D5DC734AE3AC5EEE6658D7 92EB62131E1DFBA441F53EFF9021D9D4C491F26BE8F54C61165CAD778CE8695C EEAF70E3B20C64D4C2B34A084B5770BAB2A974E898F62BFE90F132A37E2DCA4F 43E13DB13C94DFA8ECE2B7374827AE168634FA007F8981ADA046CED3448BF453 FCD9A4F194FA648F9FC0971734BB69CB73439CB0DD021D44A7C11BF295E81733 4DFBA460FF3D654F9FB337E99E6D66FBA87A817EB9CA1536C84833870E3626DA 55D48DE850D3E6F6B29DA0E7C9D681283586F208DB8D58042E3A7CE55BE84822 C98237911453E479EAB0B483D222394299B2E316A364801A09F2A1A3B0A8AA8B DBFA82BD9A0A1E60FC5F7F3EFA1DBEB4DA5200E2F29D25BC8614D6C29F336C5E 9F60656D2F7CC4631005135EF22BFCDD25E2C8CEFD0151FF96E6C9AA83556F53 7B440CDA14BC161005456ECA6F07040973D7B75AD2F840CD8E54FB8436165E85 D442D6F6CE706E77C30D1036B2DDC7B421B9DC4FB5F46FF553E1BC2B5216575B 62167F2C7307EE45EF3C791B051653E24FAA0C1916817F941E6CC1EBD3FC64E3 6904F30D21F88309FCCBD2CCC4A797DA8B43408003FA7386312D6ACB7347D643 E711A27B7A11B892011AA4897527EAE3DF4FA7A938555F390C04FA7BB9CC2F53 D054AAF95DC58EE4F87B18B5F7B07DFB6A1723D41C7DC651D115457F264D28F6 C7AC79A0877D1A660D5056FFD5C14AF62EAF7947EACB24C61A1B305CB312121B A9CC21C956B5867A716446F438B83452AAAE1AF13B492C53C6213212E127B968 C9D09176613CDBBF70DD34941C557D4E5983D415815FEE676DBE9684F5EEB6AA 592344153D70F1F5F694812052F180343DA29EB6D490818F7F0FFA491B29DF16 867D5060FAC0FA5D854C79849BFC0253E2DAC57B4D0F7E32DEED5C9FB49D27E4 610A088D02E2EB163937A22DFC943CDBD58E563A5DE5CFA42D7896DDF3A196DC 05DB4695F67A192CB34D37D12698BC9F8E875DD965A7279ADA1C7E86A2E1F7E8 E8BC6B93E8F51FBEB42C5901EEB8F3DDC554ECFECA53485ECB7515A0F24F80A2 4A92948138AAAB0047AA45D4ADB9FBC353A18DF94EEDDE8B75498622C8E12F61 C371D29A74A310287E56CD446FA24B19A8EE6954FBC1802B61A329976ADF07DA 841F8E8C9AB0FD531CCC1D90C5C8294E49F4B99A397F6321C1255EC0799F594B EEEF5AB38C57C50D08161A88179AEBC71E296928E22DF43E87AD00D2E820C26E 0C929A5E6E9308ADE89729F8069D0607230436F025298ED2A36043F7E7DF68B4 1BDCE88CC35335D6837CEB8920A0253759184B933E19DBEA1BD2258DBBF70157 52AAEB4E578B9B2C3BAC419B073BDA427BA56C5D9812FB9D9682B78BD2C6109E 3D52508871FD95D34C4348FAA3F838C1107258F7E8683BBB1949A5DD4C43F8C1 666430E4FEC39C4746C689FA154AD04DA03A1F67E7FD32BE278C27107F0213A9 12685C51407C96840957E36A22F5FDDC3381FCC99ACB2EFCA2CE8CD76ACE33C1 3B4AB938D214095D7CE64DD6E501AC6C133194868F1656B1A8277DCD54A4C28F 86A22177CAD47138F6F818050D5E9326DE671ACD4F91E2A5741BF737AD852867 16650C92FCF33FC0BA25B290F0FF38C2E2A22CF0160429F8694424C15DD85655 038D6D30895F5B2CB103D896B9B767DA11B3036AC6AF6D239000A64C9A0F0FAC E9660EF7A957AF5873F9EAF45396D8831021DE8CD806F795889E4F9B0C31F48E CA91371FB589A08E68E876057F34C8C3B86C862EE2396A0FD2026BDA95B7618D 1CDEA408C1E423A0893733F27974F6C405EB5C6AE81AE822BC89587351FDF2B3 532DA54F8D19ADA7A42DA785835083F84F8CC5365ED584384B98BE14F3C58B41 B8634B199D10D01870CB03409D26EA9D50980740BD45240FD1C442486E78AD9B 1679E562FBAC4801087E4DB0B4E7550BBD537A181623F6FBF55DE537657A4E16 09D7F2D097E89F492BF20672DAC650120D50599496E3433DB33F8D950946BFA6 69E71B800DC21C7DC9D27D6BC9ED16AA7EBDCE30AFFA69B4ED74AA4CA8D25AC7 08AE682D1A7E9B63CCC4A8D3E948259E0D98ACB5E2D4E17FBC9DE203E8F248E0 7DA9576ED7B48DC1C40B6565976FE920614AEDA759459D7D9A7645D2F4F3BA50 EB7619BF1B1781BB9611D4E283FDE4441DEC53A94949AAE1AD9F6991AABF3339 132A62544CB384D797EBFFB8019FA362D85EB869D0D83411F0D69EB5626CF8D9 15FAC29E3392FECAF43BBFF11C35549063D8CA922844984712CE069193FE9703 023B1C88353ADC01446F783E521F9A799B9E8FD025CF5E5CCBC3E502D836E92C F7A7FBA8C6D1681A6538DB708320B3B066B52F4C91981342FD7247D4767368BD 9903698E6EBE249F9F3C4538F63A32714BDBB8CD6A0B12C66C1D2FA95022AEE6 30A2F5C991B842F257BDFF06026F133AFFB31CD58BA491A29756CFB7880E5920 100F2BB2E7F36E0E252C103894C808FE7ED184ED0C203F695455ED2E28A93AE3 5B5769DF9DF1B72B060F4C4A3D95822BD41BFC4A86DE79C000D0FAFC96884840 05FF630C497C7185C09DB0A17F9552301B032DB8DD7C0D0FDCDE722D9097654A B274CD5421108F4F40C4C5460A5E1648688C46577CAC34B526B50C9A815DBA64 00E24E1631CD9882E93F0FF738ECEA637568E0C02DA2155647D7BAF92A8D036E E8923E6D28058FA04459149BF5E3D83E5612700342C33384A5D88322F40FCFAF 4280580194F6C8E39F20737980A4DF7D810AA408D67287BFA8AD1D8E6F005250 B2A3065F17068D6B185ABD97D65F88FD6F2FCB84A38CA287FF15DF3D669360C6 0488A6EE566EF09D68B2BA1578E80ED52BA759FD2326FCB1B6540E7EDF3646B6 E895D9F100C10F703D8CE7104D137EA5D63B6EBC14B49C4C1E8D23B39ED30DEE 66DDED68234541B96A3E7540A8F029C45C3500CDED9CF84A205F4DE033513B10 01BE21AB3D5A2E33354FDE0342A7A7F034422C68EBD6734F8102C58684059A84 47A3BFF22C94C36020BA01EDBB715558437C7EF78C556F6C7FD4FC409178E52F EA4FEA6320B44A4163767D7E3951A10BB8218B17D5056E43D35D419E706E5F95 A75155E992B11F36FEA897E67F6BC3EBAD4ED557B526AA4E3106F951A3754F34 16C88D91B21178A7BE39A6711FA056CEB6F21B3C7D09AB8E69E267B42695CDFA 705066854D7327BBB37EEAF1718A497B973D383C806EB53E8ED43A1E65796240 78C2AEC0966529F6AAE58451D00F5D0C94AA0C0496BBCED12B198C0480E0E6C4 B0597DDCDE38C8D12CA6A3A2C198B9FCC4C26BAB2142E69E0833B33EFB38F6F7 3276282F433FD51AD447829CDC63E29E07DF9F9390F039665648C23F30F7DF37 EC9518F4DC8280EC9A2B0C3D37A314F6B6AE6627B0CDD05C6B9BFB610BA37DAC 8DF024019402172AEF00D553D3ECE8AE64B874A032D897C278545C3CBDF3F7C5 058E336504E04A8CB323F8A3D4F34FABC1AC7051343AFE4BF74008AF156B8E99 3413394472D7F9F277D7AB4D69E1729C63C6AF83CD89051665121BC501F95A05 343014A0F5D3C3487A743A4A72C8E7B203074A216776EA49B1CAC8AED7A26F21 C36587DEB6496F1E96D037677E6B6B8EE5AAA6C919EA13F31A0CCDEE65B08783 162258228C9D651576EBE55D9C549ACC5CD6AE44DA9D0D654DE16FE6A98CA121 B09E81EEDEAA415FC596661DF7E8C9454A6ADED91648033CB5C2E84B5A33AF4A 7CCF6ECB9AD5DE0869BFCD20DD10694D87888329BEA53F4510CBBA163827664E C00CB94859CC9ADC9F0D18C14C38094A963630E96776BC2F3C0081AE8C869AC0 D57C4DE4B458FBA8F3D771CD66913250341C0C7ED4261A200782A6C7A825ECE7 5117B79D46D068BC6A04891AB4E06E77D743DB514DAD250C25EC118E6B3F7797 C4BABEAB6A24D2E9587C1974EF59A47B1E21AECFE332E6ABFFB14AA036F9BA1B D512F437F104836FBF6EF071BEF814D4AF27F6E66A3CDF4CD9F86AF7E7261479 EC5ED22DD9CE5E011E983DC34878463B93F5B419CBEDAE970FF04F09693E7D42 07D59130544DB69134A949BF6C43A462C5433D9864E9626EEB35264092C883CF D787F63AC60AC13FFFDEC2A1F35F8BF26026A86690F49588E7BB1CBAC095B4EC 1A6EC320B31735C85AC8E4B3417DB6DB4373F5D19E565AA5E0A29E6598ABAE05 928BDC29713A6D094F484C3729F448E0FE52A74852813B792AD44CF4E3077EB9 2FC5680101725DA83079AE0FDAF0A3ECA6A133432F57CE14DA9670C5EC99560F 30691A185A94FA667A1D9E4B075F6B7E01E5B64ED316BDC834D883C9F7F354F7 B133681AA16AB59351CC36D77917FFCB1204F5F1780C95CCD6922804E32EE28B F0F7097A4EEE263CD117E366769CF3ACDCD598DF1220390B98F5077F86AF9A86 4EE5C7364C9E5554ED9008FC4EF706DB000FA6AC6726476D191F2F735AC1C2A3 8BA2C901EE934D42393BB7B600F407CDDD3A9EFD11739791163A71CA14F198DA E6D6C0F745AA8A221572BC506EC003F2CF6B5FB3F162DD6BEC5EDBBFD03B3A37 859F208A1F69E7812417A748C27920A1F7C27317D73A0D94830617C161656D60 5E28D92F4A8755EAD3D2C4A4A1FB92F96841C59487D9254D1E19022FD9507BDC F9FAB874FBE62EBD7F672BF6CC6436FF851A764C5AD42CE2DBA5B29485A10664 331BB8A395976BF12BC063EC80D4CBB6EE99B3268BE34C99FE78F5F5FCFE036B 529F689DC6DB4C1E01288A815FB0F7AAE8D5254ED2016BABA5E7B78BB9F29B82 9CAB5D55DE4001444239254CD1B57589483C95D23DBF37A8FA99DB2BDE386429 AA1FBDD79217F46159800F5224BA00521973602766793152D0E2B069BCC4346F 033F7695D4B3E97C7C5098068A028A906864F4AF1F4F110943A4E8190080217F 2EB801E47CBF1808D58237606F59DA35FC3AC37AD1F8F6560FCF7F67FD445710 E50E3B79045A58AD95660C38D9C73C67B5842E62D584266EC473B25B2CA6EC64 37A76FA172584EC4C03A2B1EB430FB49D6C9E5B4F04633CADEB64CA2051BB87F E320AE8B0757594F60A54F717A55BB2EA744B86922AD8EF1E9C8C6314CD3B215 4F125C51B932C0E880B1628E40B46167638270B7AD85BB1067EA87DA324741E4 56A52A907B85B60F823D223C9EF2821DA8BCB5A7193A1BF3062D3DD059C91FDA 091B7F7A647597B338F3438890E7FD05B098EC69CA9A1A5E3A2D2067235D7D5F A0653222FBAB50C019AE22C2D13C897CF6A3B30C94A1D773A1D1E84B2E66B268 CEB907D0B67948FBCB739F9E028D9F05133A98BAB3AE1BAD5CF54CD8DF6FE66B 3FB96F233EE6F8E346A3F1A2D0BFDBA020E3A498662A7899AD109F2C0B6E24CD B3C52F4FB8E56C6B2E6CA0C0C253249D2113A1BD298CB013E853BCCF2B702302 3531CB49BD2180CBA22889118E3CF56053C05FD11D914D81EA16578F3D7BDA6C 0F9656822A03051D69296BF090C21A82B6B67E1E803C6688580FC085202F6785 18F1AD23F7C31BF977D3462B874E55CB77C5C60CB694626DD67E8B68AE366746 ED4031878A9548996A9ADF5C91F06B4B5456EBEE10DB963D2C7BB5971783E6A1 D8449AEFDD48271794C9BA1CC70AB95B6B7D1F66DA87213AE9DAD453803015E2 2C94F5009E36D50D785F05981B22DA9B5E3D514D2BCED90754452A799A0F775C 59C94213F6E291AD0CC85E49D4384E70AE8080FAD2644373E332FEA9BBBD1108 4A623834BEA96035AA15F1863F1807E3EE7CB494AD94E56A83063446C975A16E 7CE74F2A9D7771FC95ECC06BB6B635BA10BF3788730D00C3918D23CAD55DA92F 31130BFE012E7E9CB4983A54D390FFF5A829D064EDF551268F3EC00097726378 4EBA96268C7FB8EA1F49B9FEBBED38910D058B96414D4EE4E7D9DFE16CA6FD20 791AC2DDF8E50CCD4181914F8EF75B0BE5077AB458D0CC79B6D0455C55E8DC7D 4540F6F2002B8C98BD5E655035876C74F76565688305ACB2FDB9F3ED746E0304 100407B37D511916064DBA37954046056D96BA9712B072852DA2EA9D5DC7BEE7 A107CBEAB37030D7C63AA746AA3000D7D7EE6958D7A93724E7B7FED8A563A077 8F658EEF3B04B68D4772644336DCBA5E861D5702455F7A9F5C99C10151F7426D B2B268633E58235BE60883A2233E40AFA71E6D0827C8BA28DB9D4C1505F4FC0A 857D25CFA597FE1870466C546E825C4FA00D3D4641C7A52FEC430C2E1F85716C 1E2E7B24799B36B49DEFEB378C86BFC5C31E86A3ACADB9E965EEA6CB7820D0CD E49429BC9D2CCCFA3FB6B9D60E410705A9D3C2EC2A01A8166E391E722EEDCDFA B1F1CA2D1B5E276A78953BCCF1CBB3FAD4EB4570B0FF2280FEE1009E33BD58F5 013466AA06837816E6CD1E9BF1DD5AF6F64373FA3032DB2CB2C54AD574A62BCD 217A09CCC097DD3F6E730564FE357B4E53E8CC95B04028A1010DCB7A93987190 64B55C6F968978898EA85DD54DB43CF4B38DEB315AE7AE9362714C4B27AA93E7 8EFD8183FA406DE796012E49F720D99B50CB48FB245C02EECB2C008032295F7F EB3419FF367EFFA47767346259840D4AD45F23480310BA629A82CCCA11919EDC 4C922BFD812AB77899299B4DDE1BEA7358D652F3531D4C4B36438D91C4EA106F C3F3D6F9D342EED64DB74435B32E16A90521357C7497E24F51C1A1B69EE58720 946FBA6B82B5155FEF4C01B3DDEBE3FE7222AD9E7102C841181938855C263802 B142BE61EDC0CEDCC20943CF52CB945357BBD0BC208CAC45808495D43F8A7F47 6C28A3BB7999E0B60975852C9CD679D3025BC8CE6018EED5DA84B1E63D2753EA 11AAF1E1EDCC664A8D8ED57F61C39D6E5248D22C4A376D22F633441949A54FDF A856640152FD7424BF751529D3574E80E3149D03FBF0327425035ED9AD4C72D5 2E68A6709C39C50624581D0A006E7C04CFBDEACCA1AE7D519877B5F376FFEF96 A20D1369B7D86F6B03BB8B82FE97CC58C05CEDF57DC1B9BD7AC7DFEB8A95800A 5A6763D459BD1FD61C85B5E5ACAB76E0F0CC3004AED38CE59EAF1C186223EDAB 956B4C15C0D4661744C13F0F735E40F6EE8EB5CA430DC77CD70452336309C7CB 0F1102CC0077838CFA217AFF0ADACA7BAC9F715DC9AAE9AF2DA929B96A4C7AB6 01F7F0165247949D30C0A021B5488409C49E5D5A49A30F39883F6F67425FBFBD E2A3E4EB6375FAA4B86D755D057B01830A515522E05F082D623813D1243DF4D6 EA88F59B2CBE45947EAFE71733D13F7DB55FE00357423B694C2C3977F56A8448 A14A01E5E1BA627A2A728BF89FDECD4B2FD20A7B37AD42BBC2BB077C1C3D3662 95B54797DDB6B7F0D6DDDE41083DDEB71FED57EBEA28FECE5D92799F33396649 63E43DBD2C1413E2890CBC4F36407A232D5D5FE6E45AA069D7EA716D089B62B6 E8ECD8708559519C8BA4D939CD2E3E29E526255512CD0855B548071A8606038B F02A050F25092DEC65505940D673C564642D79EEA1924E39269DCC6EAC4D2579 C960D59F7CE907B958811EA20C2F3C4321C04AC8B9212FA41AF5B87E027C85D6 84E7102908555D7F0C4CACB7E4B0270AE859F3A215F7FE240C6345EB7C54C87B B18CB793D4D5119EC2B5C55571ECAD74C3DE0045F56F38200328ED9B5422AE11 6F87F353191BA38FAFDB260E9B2BC02BF8FDB7EDF375BA0197AA1C89472AFA53 708A4A33B65896D4E6F7D0DAF8B347CC927106A6F4E2F01A7353328A76DA4962 B20AFD0C45868D79CBC7C92311A77C05E6611B02D1B8C1A6802451BDF08429CF AFFA0363B25A69BB5A46BC40A1A525BFE01DE8A6D0A364E65B9B6A836E14F49F 872696655B675BF96CDBB970ED712C4B4CFA2D9DE81F64397F2169BAF8685960 16FEC6573162E0279C144CF3907D2E419D26CCC83E1D27C18058DB5D913EAC74 B72347ABB5E14B116F71F7B44C09D42407F74F54BFA8BF821D0F77F1A80E7914 C165850E54D221ADCD0C0A63D6CBF60A57A7549D27930E7725027AEF0BC1BB30 2BAE148B5CE5E1F1289F335026D204B39B918C512EC9529ECF5FDE0D21858479 3B94FE69D8E736AEF98A1735296F7BF7445A3501022FD2156C7A3CEB96F99F61 91C3C984A14F90406AF105BAE209E0EFA2F28A86B7BC26734AF8904860AAC3FA 3F34F44BF5FB77F3455E802236D7D3AA0D6CCDE4747397CB50A8217934B2398F 7FCE9F5E71763D580700D3690903E2E4816F48CFFC9D1EE812DA485F6A74FD1E 9978CB1338BC53A352EA6B4751EB2F81491F2F95D2BB9B76027090BD086FD241 3CB3D5F7C952FBD3B4D0D2B29DB9D59FDCF54B87157370D496DD67FDA9D1B7A9 79A71A23799096CF6B7DA844237D6FE0674007067DD8705F5EABD6CC53D39293 3C72E0F78E40541DEC74115353ED2F0692CCC0F537320B2FB00F6C0B3D890BD8 0B7B5EC7669F394EBF0D6D6DDF65C77B9033D18C3E0E68757B9243A126C8ACC5 08606E9F24E2C606327DBE29BEF65FD26BC70ECB981F81134BB48D885F18DAB4 AE666E190A80A87C02DDD489A5738C49C03448EA6913017C5F38E2F454347D05 39E11E1440B16CD83B128AC01DFBB258A25DD56C15E5C48AA25E278EA79FF9D4 E75806FE710A61E73F6C9EBCB281163007CDB57BDF723588C707C985B4EF7186 A17316015131653F49E3E822BFE85C52651163C8B8DD07FF56635EB90F3AB941 A6E4F81A4BF84D249C40FC456DDE33A6EF04AF8683AAFA4B56A015FE5FE7BDFE A523EE164D87910C9EC81256EA15ECD4330C9BAD185776DBBA2C5017C47CD939 E692BDD3FDBA51E7B3C02475027A8E49EAC41C57F803B973517D5E62F689D016 D9A5720964C9E71D4F9BA145FC0062277E211F263A057993172CA50C0CBC80B5 3E70B66A6C6DCAABB6FD40F37C6DF0BC9B4CF329E6212293CA12CE8FE8E60552 3A67D55991DB33FC439224DC7640C4C24201B0BD7534CDFBE2E70865F18B3A98 D5DEC6B9B9303CE6E36ACA15FAEA6711BDD5187DA7BEB1D4677A6D6FB9C6FF35 7DCA6E1BA4F6CE6E021599B57157726339A7609FA5584F8E931D00EBDDE3D42A E429D9981AB9399A89DAA5E746D63FF02B59291ECA7FCAFAE479BD6EAA52A587 BD7910581D53FFFDAB4BB11D37B155EDE21C35C0F6331767C0FE686B74FC2A98 41DA404E5C52556AA450F533713BDB461A1D798097218E4C1B9DE4F443429EE6 B413E12D3CCF5D09E1E689A36864AC847C816DC07B76A1E0848CF66BB0F17728 4A74FAFFF11C3694F6E075F19822443DDA86463317A78767DA742CECC7E6C19B B490928211CA95B714617539FCBA254DDEF1D084CB0494E259C85F7DB8D42F19 5F65E4767672834B058C9208B16069A00D5F779B33E1AF23804B2C0AA759957A 221E87C63ACE18A12FAA899C270CC2350767D70BDED70E0A26DDD34BE84618A7 75C8A478A58FDB88E968D81D3419E2B7C58F3058D9E4F8CEE08A7425022D02A8 4241AEE211F727819515B13607C936E4D0794349C468275119083B82584406E5 20975DBB7DF0F346E55435C293A068E866EE2407A44A9F82E9F4670F8F43866E B172F86D64AA3E92B1675974A352C69D26E50D41D802B1914E87474A52EF5D8E D1940898169AD270937AAB6A950FE168E42CDE3E1A185414A2A128E6EBB1D7C4 D4E9D3728A0E6A7A40BC3E22EF7B0E4E7BB933A68F1F1D6FF0A571826BB0CC5D DBAF48A4BB97232540F7685A19B1409492D9F8B000E14F6C281FCEEEF035C6A4 0502E5D045761802468109BAD31E186126C6D06EAFD10EF1FC5FE9DA4873D379 A887A108E1E298BBEF67D48976E0819D205D0B415AA379FB146B62967032A2CB 2B05D7A64AB7E658CCDBB5B67509062FC1681903B12B76FAFD286B256F7DA8B1 091F804B320F31EB583E3027442CCEDE87A0BADE36B4413001F4876F6A806FD3 6806B5709AADBDB3776365299F3B6D7659E0DEAA16595271F692E8C8F70248D6 BEA911ACBD659A4944A43FA590BA61011FFEC985D0DAFCF62E3C9141C8F5AE61 38C5462E5CAA8F947AE151495D4DF67C5D5406FDB68704807D46F02B713FB018 5BBB516C805A6681FCC802E8E3C78C1F48E085C086B74C9FAA706D95FC61D1DD F95C6EE29730C0B865B8E467813846C9D446E424EC612A56CC0A1E199B83BC1F BB780CABBC4BEFCEF0B840A4A739F6ED8BDE70EC1EE33A1267A285606BF5995F 262E7128C2E21A32095DB9ADF182C1E98A620A29082A24EAE295BFAE592D6DBC 1F6C41E09741E8E2FFB726C9F2340E3413DA21F4EDE8E664528A234BB6B4E5A4 039CF7E08A6B346E5677A2C44CFF79A5A499A45E18F5E98E3550B3BA9BA3C6D4 D25E17824D6AF208AE4A59369FEF1CDB28B39D7EBA4FF9A7945B70D1DB738E64 3B5AA6871C505E30BEFF446D5A9167C595BC058C722EE2CB3D2B530C0168846F 5916BBF1B4695BDE80B32C131A896CFAD0032633619E413AAF3D7B8B06694032 1A9903C8945E53BFB83D273962FCA61BEAEFD5339647E94197DA164766665D0C 3AB4E58798A90F5490873A72D3252F7355A414A0AFCFA584EACEA0908F2C1B4D 384B0B14746EEDDA4C3F4BB3A3EC86124631AE86BBEC646F24A919965F1965F1 218B658A5176FD5EF5705D30044AD34D142871907F2C4BCBC59508D7871620ED F8AF7AACE1F8A2D9F1CBF52F9BA1D3326B7B4D720877C436EC1B3C1BAD1B35C4 0515CA82EEF4BC0C993B099871149D6579BA16D438D9E8FE07C12DC0EF9841FB F97F9D834CBF864FDDB86F345625CFA9341D2149B0E90E318A74B5A98AD787D2 16EC6AD9161ABEF947DC78A2C99DB2CAE6809A4E00E95B2C909431C5167D3870 B52D35F969CE171560D5F0B9DD41D5076FA190E845F8B3F69F572423837425D2 73CF244F93FFD11EDFD0B9F651D5F57E5086F510BBFFCA6846E8727A7F7EA436 2697CB46C6BC01C1C8C034A6818099A9C173706FC48BF529BD983F08D6477049 1F92BE9D58DD50C88344D1D9D7B8A9CC39CA000B680BB175573B845CAFAAF498 3A32EDE633614F4F46B50B53CAEBC49E25E366BFD9269A5EE94FD9A71FC7A8D6 D3BCA1F096430FBBA978DA89C7E6D88C909712469DA3A9FCD3EFD9B763A1791D E335687C2045CC807D2D1F1B7BD6189289200C60D1062E5E77EDAA888EAD45F9 458E8A4F9591741544E998CC83FAF9C8199C49757BF5651FA7EFF398BF1052A5 7F3570071A46EEB9102CE1686FA311E34E3E0ECE8D406E92774600B093F90304 E2EA20C4A8E2476B78EA364322C5FFE5A7AA57EF1E65ECFB7A3CB02A38277571 39BB289D17B1B7BCF4A5C5B85D6A30F7DD50B7A7E2F8C2C481B177ADCB8B4E8F B0E0E8D03AD43F23383BDCBBA0A54098D741EA1DF60E8E0F659322479F0B471A D2DFBE13E067F2D65F6BEAA3FEA127AA39DC62E79E955F16D6A1147F6726662E 0F62019AC7D36EFDB1A99064D1C2AFCB137F813ACAD350E922C235E7738DEC41 CC6E1AE63C3F08B0475BBA8AC5824DBADED8721195E342F862945E1D89E2F949 13BF1DB902AADC0D4B70C843C0E3FFE814D1BD54291CECD6CB594AF2583885E1 7D37999C832721E8EE895E3137CFC2420DBFDEB5B32C6D22A7409DA9BA8F8288 8E8E602751A9B6AC67ACA3FD609A832439BDB8C9239CA8F80F27A7B990F848E8 34C89D18C536398DD76B19E597604A31613AFF4398358BDE08FE162E1FEBCD0D E9FA9AFD77DB33FB53D084162D13921DDA1CC56B1780418A25B28C7E54D9136D 8E9F9460F68C2B1A94A85ED0DCB57451D4818CC452ABD896F0711EECAF0D8C0F D0AA77B01EFD27A8CF85BC4B56506EB5E5138A86708AE8F068BC74FB33C7280F 71146885C05F38928A841EFCCAB7866D459F0124B83F6BA78DE5A8AB7008749C 2F6B3BCC2E1B2AA193062E9B532CF9712938F378444B70B32A09E9DF4CEB2087 CA8E7BF3382E82F72E2E68F0C4CFE50C6A96E4209D0BDC2776604FE73645EA9A AA4240965C3ABB613C5F7AEB917F6737DF5C81512C685E2F50BA6B0FB895844D 65DF96531B66DBB1F42FDE98A606107583CFA908402246286383F82C3131A382 E9635FA035BDB0059803773291926113D66CCD3DE6B2509974563ABB7DDC9F07 99B25A0124C914E8D7F6111AB2615B51C5116BF2AB9C400E98A1F7AC3CD6FE2E 3093887A3B31E0CD1A61348D944964996E7E05532AF0784EA4C0139F18E9FE82 13E1981AC8FE82AA45C63ADC6ED0002D0E77BEC9D9FFD3D1EF056958E2656542 B677E3DD2FE53B890CAC18CF78B862C11AE24A73F504C6EB97DD403782841815 50E7C411BF29CEC7E33D997FFA5A99EC5AD0E31B43075326305802CF15CD9277 ED614AC16C57FACB0F6B218B4A17E34F62AC5C242F400C2A26DCBB1AD9130112 2937BF26E84DF72267CFD55F8D1BFE3D7F611A8183A5965D9E962D4049102CF3 64A8929E2BF2065049CAB1CC8E6061E825DD3A6C0F30B72B2E1F227516A1DC89 835B9DE9DFAE6A707C8A7A755DA76C5B17E7A2AFBF4F8ED4C3FF5B5662AE30FF C9AF8F15E122A6DD77538D4E4F1A0405A0F306D3F1686FA8EE26F7EE099561EF 93734F348B17A9FAEF87A2497B46753806B8F23AF1890713B64C4581B8E886AC 6597DFF77C0E6BEA7F3F37E96EAAE066588C21BA7DFB87B18EF43E6475EAB97E 830FC431F71C45F8363C828B05A174AF11634AA43A7E8E07F8F8AB 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 cleartomark %%EndFont TeXDict begin 39158280 55380996 1000 8000 8000 (ApproxDecomp.dvi) @start /Fa 205[827 50[{}1 1106.96 /LASY10 rf /Fb 152[424 424 51[553 49[640{}4 664.176 /CMSY6 rf /Fc 135[464 5[385 379 3[726 2[340 296 2[399 13[665 11[562 5[515 70[{}10 664.176 /CMMI6 rf /Fd 133[523 523 523 523 523 523 523 523 523 523 523 523 523 523 523 1[523 523 523 523 523 523 523 523 523 523 9[523 3[523 2[523 3[523 2[523 2[523 1[523 523 523 7[523 6[523 523 523 2[523 1[523 2[523 523 523 39[{}43 996.264 /CMTT9 rf /Fe 135[622 2[655 458 465 486 1[655 589 655 982 327 2[327 655 589 1[541 655 524 1[573 12[820 3[805 886 1[1117 3[445 4[903 2[890 6[327 58[{}25 996.264 /CMBX9 rf /Ff 202[406 2[406 406 49[{}3 664.176 /CMR6 rf /Fg 149[284 2[512 512 10[683 34[569 1[0 3[683 28[796 796 7[796 1[796 8[284 796{}13 996.264 /CMSY9 rf /Fh 133[455 540 540 740 540 569 398 404 401 2[512 569 853 284 1[313 284 569 512 1[455 569 455 569 512 12[740 2[796 697 2[938 640 3[768 2[697 782 1[725 768 3[796 2[284 512 512 512 512 512 512 512 512 512 512 1[284 341 1[796 1[398 398 40[{}49 996.264 /CMR9 rf /Fi 135[580 11[306 2[350 2[497 11[697 1[846 1[597 5[654 3[697 4[802 654 753 1[731 775 768 2[796 512 1[284 284 36[597 5[415 15[{}21 996.264 /CMMI9 rf /Fj 207[244 47[600{}2 553.48 /CMSY5 rf /Fk 206[377 49[{}1 553.48 /CMR5 rf /Fl 152[454 454 10[597 36[0 3[597 1[255 44[454 2[692{}8 774.872 /CMSY7 rf /Fm 174[1045 1168 80[{}2 1106.96 /CMEX10 rf /Fn 142[365 5[420 326 295 28[529 6[557 69[{}6 553.48 /CMMI5 rf /Fo 134[449 502 5[411 406 456 1[547 786 1[471 366 313 518 1[432 4[480 6[603 1[726 2[603 1[544 667 697 2[701 844 607 5[561 650 3[666 5[263 263 36[525 5[369 15[{}29 774.872 /CMMI7 rf /Fp 134[465 465 632 465 1[346 351 346 2[441 1[727 251 2[251 489 441 1[394 489 394 1[441 12[632 2[680 595 2[796 547 3[653 2[595 666 1[619 653 3[680 3[441 441 441 441 441 441 441 441 441 441 1[251 298 1[680 1[346 346 40[{}43 774.872 /CMR7 rf /Fq 149[307 2[553 553 7[738 2[738 40[738 28[861 861 7[861 1[861 8[307 861{}12 1106.96 /CMSY10 rf /Fr 134[543 633 792 4[499 494 557 1[664 972 330 576 1[381 638 1[542 1[576 479 1[585 6[756 1[917 2[756 1[679 841 875 711 844 889 1074 753 3[920 870 712 817 916 791 840 830 3[553 1[307 307 36[646 5[449 3[708 11[{}41 1106.96 /CMMI10 rf /Fs 133[453 537 514 736 509 594 368 453 467 1[566 566 622 905 283 2[339 566 509 339 509 566 509 509 566 11[823 792 622 807 849 751 2[993 694 2[427 5[792 1[823 6[339 11[339 396 339 31[622 12[{}39 1106.96 /CMTI10 rf /Ft 132[553 492 584 584 799 584 615 430 437 434 584 615 553 615 922 307 584 338 307 615 553 338 492 615 492 615 553 3[307 553 307 676 1[830 1138 830 830 799 615 815 861 753 861 830 1015 692 861 569 400 830 869 723 753 846 799 784 830 3[861 1[307 307 553 553 553 553 553 553 553 553 553 553 1[307 369 307 861 1[430 430 307 4[553 19[922 615 615 646 11[{}80 1106.96 /CMR10 rf /Fu 139[581 589 610 3[830 7[457 682 1[664 830 726 8[1128 2[1148 1039 830 1115 1[1021 1122 1168 1418 898 2[557 3[981 1145 1079 1062 1128 11[747 747 747 747 747 49[{}30 1328.35 /CMBX12 rf /Fv 136[919 672 707 495 502 524 1[707 636 707 1061 354 672 1[354 707 636 389 583 707 566 1[619 8[962 1316 962 1[886 707 955 1[870 956 996 1208 766 998 1[483 996 1001 801 836 976 919 906 962 1[601 4[354 5[636 636 636 636 2[354 424 32[707 12[{}50 1106.96 /CMBX10 rf /Fw 135[946 2[996 697 707 732 1[996 897 996 1494 498 2[498 996 897 548 818 996 797 996 872 15[1347 1225 2[1701 7[1177 1374 1[1275 1354 6[498 58[{}27 1594.02 /CMBX12 rf end %%EndProlog %%BeginSetup %%Feature: *Resolution 8000dpi TeXDict begin %%BeginPaperSize: a4 a4 %%EndPaperSize end %%EndSetup %%Page: 1 1 TeXDict begin 1 0 bop 400 443 54000 443 v 4272 3550 a Fw(Appro)-50 b(ximate)600 b(Decomp)50 b(osition:)799 b(A)598 b(Metho)50 b(d)598 b(for)g(Bounding)g(and)7276 5321 y(Estimating)i(Probabilistic)f(and)f(Deterministic)j(Queries)p 400 7742 54000 111 v 23721 13581 a Fv(Da)-35 b(vid)424 b(Larkin)10544 20107 y Fu(Abstract)2614 23317 y Ft(In)353 b(this)h(pap)31 b(er,)357 b(w)-31 b(e)354 b(in)-31 b(tro)31 b(duce)354 b(a)g(metho)31 b(d)355 b(for)f(ap-)2614 24645 y(pro)-31 b(ximating)301 b(the)e(solution)h(to)f(inference)f(and)h(op-) 2614 25974 y(timization)459 b(tasks)c(in)g(uncertain)h(and)f(determin-) 2614 27302 y(istic)385 b(reasoning.)539 b(Suc)-31 b(h)385 b(tasks)g(are)f(in)g(general)i(in-)2614 28630 y(tractable)355 b(for)e(exact)h(algorithms)h(b)31 b(ecause)353 b(of)h(the)2614 29959 y(large)400 b(n)-31 b(um)g(b)31 b(er)399 b(of)g(dep)31 b(endency)399 b(relationships)i(in)2614 31287 y(their)311 b(structure.)473 b(Our)310 b(metho)31 b(d)311 b(e\013ectiv)-31 b(ely)313 b(maps)2614 32616 y(suc)-31 b(h)363 b(a)g(dense)g(problem)h (to)g(a)g(sparser)d(one)j(whic)-31 b(h)2614 33944 y(is)521 b(in)h(some)g(sense)f(\\closest".)951 b(Exact)523 b(metho)31 b(ds)2614 35272 y(can)399 b(b)31 b(e)398 b(run)g(on)h(the)g(sparser)e (problem)i(to)h(deriv)-31 b(e)2614 36601 y(b)31 b(ounds)364 b(on)h(the)f(original)j(answ)-31 b(er,)366 b(whic)-31 b(h)366 b(can)e(b)31 b(e)2614 37929 y(quite)439 b(sharp.)1396 b(On)437 b(one)h(large)h(CPCS)g(net)-31 b(w)g(ork,)2614 39257 y(for)361 b(example,)k(w)-31 b(e)362 b(w)-31 b(ere)361 b(able)h(to)g(calculate)i(upp)31 b(er)2614 40586 y(and)432 b(lo)-31 b(w)g(er)432 b(b)31 b(ounds)432 b(on)f(the)h(conditional)j (proba-)2614 41914 y(bilit)-31 b(y)340 b(of)f(a)g(v)-61 b(ariable,)346 b(giv)-31 b(en)339 b(evidence,)345 b(that)340 b(w)-31 b(ere)2614 43242 y(almost)371 b(iden)-31 b(tical)372 b(in)d(the)g(a)-31 b(v)g(erage)371 b(case.)400 47385 y Fu(1)1495 b(INTR)-42 b(ODUCTION)400 50090 y Ft(Belief)541 b(net)-31 b(w)g(orks)8484 49995 y([)8791 50090 y(P)g(earl,)584 b(1988)14402 49995 y(])15251 50090 y(are)539 b(a)h(widely)i(used)d (for-)400 51418 y(malism)348 b(for)e(reasoning)h(with)h(uncertain)-31 b(t)g(y)348 b(in)e(Arti\014cial)i(In-)400 52746 y(telligence.)750 b(Unfortunately)-92 b(,)478 b(basic)455 b(computations)i(on)d(b)31 b(e-)400 54075 y(lief)418 b(net)-31 b(w)g(orks,)430 b(suc)-31 b(h)416 b(as)h(calculating)j(the)d(probabilit)-31 b(y)419 b(of)f(a)400 55403 y(query)338 b(v)-61 b(ariable)339 b(giv)-31 b(en)340 b(evidence,)345 b(or)338 b(\014nding)h(the)g (probabil-)400 56731 y(it)-31 b(y)458 b(of)f(the)f(most)i(probable)f (explanation)i(consisten)-31 b(t)458 b(with)400 58060 y(a)423 b(certain)h(v)-61 b(ariable)424 b(v)-61 b(alue)423 b(giv)-31 b(en)424 b(evidence,)437 b(are)423 b(NP-hard.)400 59388 y(Clique)564 b(tree)f(propagation)12825 59293 y([)13133 59388 y(Jensen)e Fs(et)575 b(al.)p Ft(,)611 b(1990)22684 59293 y(])23556 59388 y(is)563 b(the)400 60716 y(most)265 b(p)31 b(opular)265 b(exact)g(algorithm,)288 b(whic)-31 b(h)265 b(requires)e(time)j(and)400 62045 y(space)536 b(exp)31 b(onen)-31 b(tial)538 b(in)e(the)g(treewidth)i(of)e(the)g(net) -31 b(w)g(ork's)400 63373 y(in)g(teraction)548 b(graph.)1024 b(V)-92 b(ariable)547 b(elimination)20750 63278 y([)21057 63373 y(Zhang)h(and)400 64702 y(P)-31 b(o)31 b(ole,)602 b(1994;)555 b(Dec)-31 b(h)g(ter,)600 b(1999)13899 64607 y(])14762 64702 y(is)553 b(a)h(simpli\014ed)h(form)-31 b(ula-)400 66030 y(tion)400 b(of)f(this)g(metho)31 b(d,)407 b(whic)-31 b(h)399 b(only)h(computes)f(the)g(answ)-31 b(er)400 67358 y(to)523 b(one)f(query)-92 b(,)559 b(but)522 b(whic)-31 b(h)523 b(is)f(easier)g(to)g(deriv)-31 b(e)522 b(and)g(un-)400 68687 y(derstand.)1043 b(Its)552 b(complexit)-31 b(y)555 b(is)e(also)g(exp)31 b(onen)-31 b(tial)555 b(in)e(the)400 70015 y(treewidth.)457 b(Appro)-31 b(ximation)261 b(algorithms)g (include)e(iterativ)-31 b(e)400 71343 y(b)31 b(elief)383 b(propagation)9530 71248 y([)9838 71343 y(P)-31 b(earl,)386 b(1988)15251 71248 y(])15560 71343 y(,)g(sto)31 b(c)-31 b(hastic)383 b(sim)-31 b(ulation)400 72577 y([)708 72672 y(P)g(earl,)288 b(1988)6023 72577 y(])6333 72672 y(,)g(v)-61 b(ariational)270 b(metho)31 b(ds)16695 72577 y([)17003 72672 y(Jordan)267 b Fs(et)302 b(al.)p Ft(,)288 b(1999)25783 72577 y(])26093 72672 y(,)400 74000 y(and)426 b(mini)h(buc)-31 b(k)g(ets)9216 73905 y([)9523 74000 y(Dec)g(h)g(ter)426 b(and)f(Rish,)440 b(1997)21029 73905 y(])21339 74000 y(.)661 b(Iterativ)-31 b(e)28400 20107 y(b)31 b(elief)488 b(propagation)j(pro)-31 b(vides)488 b(an)f(estimate)j(of)e(the)g(exact) 28400 21435 y(answ)-31 b(er,)522 b(if)491 b(it)h(con)-31 b(v)g(erges,)522 b(but)491 b(there)f(is)h(no)g(guaran)-31 b(tee)492 b(of)28400 22764 y(accuracy)-92 b(.)578 b(Sto)31 b(c)-31 b(hastic)399 b(sim)-31 b(ulation)401 b(also)d(pro)-31 b(vides)398 b(an)f(esti-)28400 24092 y(mate,)464 b(along)446 b(with)f(a)g(lev)-31 b(el)445 b(of)g(con\014dence,)463 b(but)444 b(it)h(can)f(b)31 b(e)28400 25420 y(exp)g(ensiv)-31 b(e)276 b(and)g(there)g(is)f(alw)-31 b(a)g(ys)278 b(some)e(c)-31 b(hance)277 b(that)g(the)f(an-)28400 26749 y(sw)-31 b(er)459 b(is)g(signi\014can)-31 b(tly)462 b(inaccurate.)763 b(V)-92 b(ariational)462 b(metho)31 b(ds)28400 28077 y(pro)-31 b(vide)492 b(guaran)-31 b(teed)493 b(b)31 b(ounds,)523 b(but)491 b(m)-31 b(ust)493 b(b)31 b(e)491 b(tailored)i(to)28400 29405 y(sp)31 b(eci\014c)456 b(classes)g(of)g(net)-31 b(w)g(orks.)755 b(They)457 b(cannot)g(b)31 b(e)456 b(applied)28400 30734 y(systematically)524 b(to)d(general)g(net)-31 b(w)g(orks.)948 b(Mini)521 b(buc)-31 b(k)g(ets)521 b(is)28400 32062 y(a)526 b(simple)g(algorithm)i(that)f(w)-31 b(orks)525 b(on)h(general)g(net)-31 b(w)g(orks,)28400 33390 y(whic)g(h)454 b(also)f(pro)-31 b(vides)453 b(guaran)-31 b(teed)454 b(b)31 b(ounds,)473 b(but)453 b(in)g(prac-)28400 34719 y(tice)352 b(these)g(are)f(to)31 b(o)353 b(lo)31 b(ose)352 b(to)g(b)31 b(e)351 b(useful.)487 b(Mini)352 b(buc)-31 b(k)g(ets)353 b(can)28400 36047 y(also)276 b(pro)-31 b(vide)276 b(b)31 b(ounds)275 b(for)h(the)g (MAX-CSP)g(problem,)295 b(where)28400 37376 y(it)413 b(compares)f(w)-31 b(ell)414 b(with)f(state)g(of)g(the)f(art)h(metho)31 b(ds)51657 37281 y([)51965 37376 y(Kask)28400 38704 y(and)369 b(Dec)-31 b(h)g(ter,)370 b(2001)37180 38609 y(])37489 38704 y(.)28400 40696 y(In)518 b(this)h(pap)31 b(er,)556 b(w)-31 b(e)519 b(in)-31 b(tro)31 b(duce)519 b(an)g(algorithm)i(called) f(ap-)28400 42025 y(pro)-31 b(ximate)334 b(decomp)31 b(osition)335 b(whic)-31 b(h)333 b(is)f(designed)g(to)h(pro)-31 b(vide)28400 43353 y(tigh)g(t)524 b(guaran)-31 b(teed)524 b(b)31 b(ounds)522 b(on)g(probabilistic)j(and)d(deter-)28400 44681 y(ministic)462 b(queries.)766 b(It)461 b(w)-31 b(orks)460 b(b)-31 b(y)461 b(b)31 b(ounding)461 b(a)g(large)g(com-) 28400 46010 y(plex)306 b(function)h(with)g(a)f(com)-31 b(bination)309 b(of)d(simpler)g(ones,)318 b(suc)-31 b(h)28400 47338 y(that)312 b(the)f(exp)31 b(ected)312 b(loss)f(of)g(accuracy)g (in)h(a)f(query)g(in)-31 b(v)g(olving)28400 48667 y(the)369 b(function)i(will)g(b)31 b(e)369 b(minimized.)28400 50659 y(The)327 b(pap)31 b(er)327 b(is)g(divided)h(in)-31 b(to)329 b(sev)-31 b(eral)327 b(parts.)479 b(F)-92 b(ollo)-31 b(wing)329 b(this)28400 51987 y(in)-31 b(tro)31 b(duction,)361 b(w)-31 b(e)356 b(de\014ne)g(basic)g(concepts)f(in)h(section)h(2.)488 b(In)28400 53316 y(section)410 b(3)f(w)-31 b(e)409 b(describ)31 b(e)409 b(the)g(appro)-31 b(ximate)411 b(decomp)31 b(osition)28400 54644 y(algorithm.)929 b(Finally)284 b(in)e(section)h(4)f(w)-31 b(e)283 b(describ)31 b(e)281 b(our)h(empir-)28400 55972 y(ical)415 b(results,)424 b(and)413 b(in)h(section)g(5)g(w)-31 b(e)413 b(conclude)h(and)g(discuss)28400 57301 y(p)31 b(ossibilities)371 b(for)e(future)h(researc)-31 b(h.)28400 60564 y Fu(2)1495 b(BASIC)499 b(CONCEPTS)28400 63328 y Ft(In)368 b(this)g(section)h(w)-31 b(e)368 b(review)h(basic)f (concepts)h(whic)-31 b(h)369 b(will)g(b)31 b(e)28400 64657 y(imp)g(ortan)-31 b(t)371 b(in)f(succeeding)f(sections.)28400 67603 y Fv(2.1)1274 b(BELIEF)424 b(NETW)-35 b(ORKS)28400 70015 y Ft(A)494 b(b)31 b(elief)494 b(net)-31 b(w)g(ork)495 b(is)f(a)g(tuple)g(\()p Fr(X)25 b(;)184 b(D)31 b(;)184 b(G;)g(P)154 b Ft(\))498 b(where)493 b Fr(X)581 b Ft(is)28400 71343 y(a)425 b(set)g(of)g Fr(n)g Ft(v)-61 b(ariables)425 b Fq(f)p Fr(X)39683 71509 y Fp(1)40180 71343 y Fr(;)184 b(X)41588 71509 y Fp(2)42086 71343 y Fr(;)g(:::X)44415 71509 y Fo(n)45020 71343 y Fq(g)425 b Ft(and)g Fr(D)456 b Ft(is)425 b(a)g(set)f(of)28400 72672 y(v)-61 b(ariable)426 b(domains)g Fq(f)p Fr(D)38507 72838 y Fp(1)39005 72672 y Fr(;)184 b(:::D)41333 72838 y Fo(n)41938 72672 y Fq(g)p Ft(.)661 b(W)-92 b(e)424 b(use)g Fr(x)48022 72838 y Fo(i)48815 72672 y Ft(to)i(denote)g(a)28400 74000 y(v)-61 b(alue)501 b(from)h Fr(X)35057 74166 y Fo(i)35425 74000 y Ft('s)f(domain)h Fr(D)41653 74166 y Fo(i)42022 74000 y Ft(,)534 b Fr(x)501 b Ft(to)g(represen)-31 b(t)500 b(a)h(v)-31 b(ector)p eop end %%Page: 2 2 TeXDict begin 2 1 bop 400 1107 a Ft(\()p Fr(x)1463 1273 y Fp(1)1960 1107 y Fr(;)184 b(x)3084 1273 y Fp(2)3581 1107 y Fr(;)g(:::x)5626 1273 y Fo(n)6231 1107 y Ft(\))327 b(of)g(v)-61 b(alues)326 b(for)h(all)h(v)-61 b(ariables,)336 b(and)327 b Fr(x)22213 1273 y Fo(S)23180 1107 y Ft(to)h(rep-)400 2435 y(resen)-31 b(t)312 b(a)g(c)-31 b(hoice)313 b(of)g(v)-61 b(alues)312 b(for)g(a)h(subset)e Fr(S)376 b Ft(of)312 b Fr(X)87 b Ft(.)474 b Fr(G)312 b Ft(is)g(a)h(di-)400 3764 y(rected)258 b(acyclic)i(graph,)282 b(and)259 b Fr(P)411 b Ft(is)259 b(a)g(set)f(of)h(conditional)j(prob-)400 5092 y(abilit)-31 b(y)298 b(tables)f Fq(f)p Fr(P)154 b Ft(\()p Fr(X)9666 5258 y Fo(i)10035 5092 y Fq(j)p Fr(pa)11484 5258 y Fo(i)11853 5092 y Ft(\))p Fq(g)p Ft(,)311 b(also)297 b(called)f(CPTs.)469 b(The)296 b(par-)400 6420 y(en)-31 b(t)370 b(set)g Fr(pa)5147 6586 y Fo(i)5885 6420 y Ft(of)g Fr(X)8063 6586 y Fo(i)8802 6420 y Ft(is)f(the)h(set)g(of)g(no)31 b(des)369 b(whic)-31 b(h)371 b(are)f(sources)400 7749 y(of)d(arcs)f(p)31 b(oin)-31 b(ting)368 b(in)-31 b(to)368 b Fr(X)11462 7915 y Fo(i)11830 7749 y Ft(.)492 b Fr(P)154 b Ft(\()p Fr(X)14841 7915 y Fo(i)15517 7749 y Ft(=)307 b Fr(x)17318 7915 y Fo(i)17687 7749 y Fq(j)p Fr(pa)19136 7915 y Fo(i)19812 7749 y Ft(=)h Fr(x)21614 7915 y Fo(pa)22550 8026 y Fn(i)22956 7749 y Ft(\))366 b(is)h(the)400 9077 y(conditional)322 b(probabilit)-31 b(y)322 b(of)d Fr(X)406 b Ft(taking)321 b(the)e(v)-61 b(alue)319 b Fr(x)22874 9243 y Fo(i)23242 9077 y Ft(,)330 b(giv)-31 b(en)400 10405 y(that)256 b(its)f(paren)-31 b(ts)254 b(are)h(assigned)g Fr(x)14543 10571 y Fo(pa)15479 10682 y Fn(i)15885 10405 y Ft(.)454 b(The)255 b(seman)-31 b(tics)256 b(of)f(the)400 11734 y(net)-31 b(w)g(ork)498 b(is)e(a)g(factorized)h(join)-31 b(t)498 b(probabilit)-31 b(y)499 b(distribution)400 13062 y(o)-31 b(v)g(er)476 b Fr(X)87 b Ft(:)704 b Fr(P)154 b Ft(\()p Fr(X)570 b Ft(=)484 b Fr(x)p Ft(\))g(=)11911 12232 y Fm(Q)12956 12506 y Fo(n)12956 13394 y(i)p Fp(=1)14630 13062 y Fr(P)154 b Ft(\()p Fr(X)16842 13228 y Fo(i)17694 13062 y Ft(=)484 b Fr(x)19672 13228 y Fo(i)20040 13062 y Fq(j)p Fr(pa)21489 13228 y Fo(i)22342 13062 y Ft(=)g Fr(x)24320 13228 y Fo(pa)25256 13339 y Fn(i)25662 13062 y Ft(\),)400 14390 y(where)369 b Fr(x)4234 14556 y Fo(i)4971 14390 y Ft(and)h Fr(x)7757 14556 y Fo(pa)8693 14667 y Fn(i)9468 14390 y Ft(are)f(consisten)-31 b(t)370 b(with)h Fr(x)p Ft(.)400 17332 y Fv(2.2)1274 b(BELIEF)424 b(NETW)-35 b(ORK)424 b(T)-106 b(ASKS)400 19742 y Ft(The)612 b(b)31 b(elief)612 b(inference)g(task)g(is)f(to)i(compute)f(the)g(condi-)400 21071 y(tional)557 b(probabilit)-31 b(y)558 b Fr(P)154 b Ft(\()p Fr(X)11781 21237 y Fo(q)12887 21071 y Ft(=)617 b Fr(x)14998 21237 y Fo(q)15487 21071 y Fq(j)p Fr(E)681 b Ft(=)617 b Fr(x)19403 21237 y Fo(E)20151 21071 y Ft(\))555 b(of)h(a)f(query)400 22399 y(v)-61 b(ariable)495 b Fr(X)5596 22565 y Fo(q)6579 22399 y Ft(for)e(an)-31 b(y)495 b(of)f(its)h(v)-61 b(alues)494 b Fr(x)17721 22565 y Fo(q)18209 22399 y Ft(,)526 b(giv)-31 b(en)495 b(some)f(ev-)400 23728 y(idence)565 b Fr(E)698 b Ft(=)635 b Fr(x)7622 23894 y Fo(E)8369 23728 y Ft(.)1081 b(Ba)-31 b(y)g(es's)566 b(rule)f(allo)-31 b(ws)567 b(us)d(to)i(expand)400 25056 y(this)676 b(as)g Fr(P)154 b Ft(\()p Fr(X)6743 25222 y Fo(q)8051 25056 y Ft(=)819 b Fr(x)10364 25222 y Fo(q)11303 25056 y Fq(^)450 b Fr(E)883 b Ft(=)819 b Fr(x)16504 25222 y Fo(E)17251 25056 y Ft(\))p Fr(=P)154 b Ft(\()p Fr(E)884 b Ft(=)818 b Fr(x)23542 25222 y Fo(E)24290 25056 y Ft(\))h(=)400 26384 y Fr(\013)t(P)154 b Ft(\()p Fr(X)3324 26550 y Fo(q)4364 26384 y Ft(=)551 b Fr(x)6409 26550 y Fo(q)7241 26384 y Fq(^)344 b Fr(E)615 b Ft(=)551 b Fr(x)11800 26550 y Fo(E)12547 26384 y Ft(\),)i(where)515 b Fr(\013)k Ft(is)d(a)f (normalizing)400 27713 y(constan)-31 b(t.)857 b(By)490 b(the)g(de\014nition)i(of)e(the)h(net)-31 b(w)g(ork)491 b Fr(P)154 b Ft(\()p Fr(X)24541 27879 y Fo(q)25539 27713 y Ft(=)400 29041 y Fr(x)1033 29207 y Fo(q)1783 29041 y Fq(^)261 b Fr(E)410 b Ft(=)346 b Fr(x)5849 29207 y Fo(E)6597 29041 y Ft(\))h(=)8581 28211 y Fm(P)9749 29373 y Fl(f)p Fo(X)60 b Fl(\000)p Fp(\()p Fo(E)43 b Fl([)p Fo(X)14043 29484 y Fn(q)14481 29373 y Fp(\))p Fl(g)15521 28211 y Fm(Q)16566 28484 y Fo(n)16566 29373 y(i)p Fp(=1)18240 29041 y Fr(P)154 b Ft(\()p Fr(X)20452 29207 y Fo(i)21167 29041 y Ft(=)346 b Fr(x)23007 29207 y Fo(i)23375 29041 y Fq(j)p Fr(pa)24824 29207 y Fo(i)25539 29041 y Ft(=)400 30532 y Fr(x)1033 30698 y Fo(pa)1969 30809 y Fn(i)2375 30532 y Ft(\))p Fq(j)3112 30698 y Fo(E)43 b Fp(=)p Fo(x)4987 30809 y Fn(E)5684 30532 y Ft(,)437 b(where)423 b(the)g(sum)h(is)f(o)-31 b(v)g(er)424 b(all)g(assignmen)-31 b(ts)425 b(to)400 31861 y(the)349 b(subscripted)f(set)g(of)h(v)-61 b(ariables)349 b(and)g Fr(f)119 b Ft(\()p Fr(x)p Ft(\))p Fq(j)20233 32027 y Fo(E)43 b Fp(=)p Fo(x)22108 32138 y Fn(E)23153 31861 y Ft(is)348 b Fr(f)119 b Ft(\()p Fr(x)p Ft(\))400 33189 y(when)352 b Fr(x)f Ft(is)h(consisten)-31 b(t)352 b(with)h Fr(E)372 b Ft(=)307 b Fr(x)15976 33355 y Fo(E)17075 33189 y Ft(and)352 b(zero)f(otherwise.)400 35181 y(The)440 b(MPE)f(task)h(is)g(to)g(\014nd)f(the)h(probabilit)-31 b(y)442 b(of)e(the)g(most)400 36510 y(probable)j(assignmen)-31 b(t)444 b Fr(X)517 b Ft(=)429 b Fr(x)442 b Ft(whic)-31 b(h)444 b(is)e(consisten)-31 b(t)444 b(with)400 37838 y(the)300 b(evidence)h Fr(E)372 b Ft(=)307 b Fr(x)9617 38004 y Fo(E)10664 37838 y Ft(and)301 b(an)-31 b(y)301 b(v)-61 b(alue)301 b(of)f(a)h(query)f(v)-61 b(ariable)400 39167 y Fr(X)1317 39333 y Fo(q)1806 39167 y Ft(.)543 b(F)-92 b(ormally)g(,)392 b(again)387 b(b)-31 b(y)387 b(the)f(net)-31 b(w)g(ork)387 b(de\014nition,)393 b(this)386 b(is)400 40495 y(max)2460 40695 y Fl(f)p Fo(X)60 b Fl(\000)p Fp(\()p Fo(E)43 b Fl([)p Fo(X)6754 40806 y Fn(q)7193 40695 y Fp(\))p Fl(g)8232 39665 y Fm(Q)9277 39938 y Fo(n)9277 40827 y(i)p Fp(=1)10951 40495 y Fr(P)154 b Ft(\()p Fr(X)13163 40661 y Fo(i)13839 40495 y Ft(=)308 b Fr(x)15641 40661 y Fo(i)16009 40495 y Fq(j)p Fr(pa)17458 40661 y Fo(i)18134 40495 y Ft(=)g Fr(x)19936 40661 y Fo(pa)20872 40772 y Fn(i)21278 40495 y Ft(\))p Fq(j)22015 40661 y Fo(E)43 b Fp(=)p Fo(x)23890 40772 y Fn(E)24586 40495 y Ft(.)400 43437 y Fv(2.3)1274 b(MAX-CSP)400 45847 y Ft(In)389 b(the)g(MAX-CSP)h (problem,)395 b(w)-31 b(e)390 b(are)f(giv)-31 b(en)390 b(a)g(set)f(of)h(con-)400 47175 y(strain)-31 b(ts)398 b Fr(C)433 b Ft(=)354 b Fq(f)p Fr(C)8193 47341 y Fp(1)8690 47175 y Fr(;)184 b(:::;)g(C)11384 47341 y Fo(m)12228 47175 y Fq(g)398 b Ft(o)-31 b(v)g(er)397 b(the)h(v)-61 b(ariables)397 b Fr(X)87 b Ft(.)576 b(Eac)-31 b(h)400 48504 y(constrain)g(t)467 b Fr(C)6493 48670 y Fo(i)7327 48504 y Ft(is)e(a)h(function)h(de\014ned)e(on)h(a)f(subset)g(of)h Fr(X)400 49832 y Ft(called)549 b(its)g(scop)31 b(e.)1028 b(It)548 b(maps)h(assignmen)-31 b(ts)549 b(to)g(the)f(scop)31 b(e)400 51160 y(that)494 b(satisfy)g(it)f(to)h(0,)524 b(and)493 b(unsatisfying)i(assignmen)-31 b(ts)494 b(to)400 52489 y(1.)f(The)369 b(b)31 b(est)368 b(solution)i(violates)h(the)e (minim)-31 b(um)371 b(n)-31 b(um)g(b)31 b(er)368 b(of)400 53817 y(constrain)-31 b(ts.)532 b(Giv)-31 b(en)383 b(a)f(query)g(v)-61 b(ariable)383 b Fr(X)18840 53983 y Fo(q)19329 53817 y Ft(,)i(the)d(goal)i(is)e(to)400 55145 y(\014nd)422 b(the)h(cost)f(of)h (the)g(b)31 b(est)422 b(solution)i(consisten)-31 b(t)424 b(with)f(an)-31 b(y)400 56474 y(of)370 b(its)f(v)-61 b(alues,)370 b(or)f(min)10009 56674 y Fl(f)p Fo(X)60 b Fl(\000)p Fo(X)12667 56785 y Fn(q)13106 56674 y Fl(g)13800 55643 y Fm(P)14968 56806 y Fo(i)15521 56474 y Fr(C)16312 56640 y Fo(i)16681 56474 y Ft(.)400 59415 y Fv(2.4)1274 b(V)-141 b(ARIABLE)424 b(ELIMINA)-106 b(TION)400 61826 y Ft(V)-92 b(ariable)325 b(elimination)10459 61731 y([)10766 61826 y(Zhang)g(and)e(P)-31 b(o)31 b(ole,)335 b(1994;)325 b(Dec)-31 b(h)g(ter,)400 63154 y(1999)2612 63059 y(])3394 63154 y(is)472 b(an)h(exact)g(algorithm)i(for)e(probabilistic)h(and)f (de-)400 64482 y(terministic)586 b(reasoning.)1139 b(It)584 b(can)h(b)31 b(e)584 b(applied)h(to)g(an)-31 b(y)585 b(of)400 65811 y(the)393 b(tasks)g(men)-31 b(tioned)395 b(ab)31 b(o)-31 b(v)g(e.)564 b(The)393 b(basic)g(op)31 b(eration)394 b(is)f(to)400 67139 y(transform)331 b(an)f(expression)f Fq(\012)13101 67339 y Fl(f)p Fo(X)14281 67450 y Fk(1)14713 67339 y Fo(;:::;X)16754 67456 y Fn(k)17237 67339 y Fl(g)17913 67139 y Fq(\014)18774 66737 y Fo(m)18774 67427 y(i)p Fp(=1)20431 67139 y Fr(f)20973 67305 y Fo(m)22143 67139 y Ft(to)i(an)f(ex-)400 68687 y(pression)341 b Fq(\012)5492 68887 y Fl(f)p Fo(X)6672 68998 y Fk(1)7104 68887 y Fo(;:::;X)9145 69004 y Fn(k)9 b Fj(\000)p Fk(1)10605 68887 y Fl(g)11305 68687 y Fq(\014)12166 68285 y Fo(m)12952 67951 y Fj(0)12166 68975 y Fo(i)p Fp(=1)13847 68687 y Fr(f)14508 68285 y Fl(0)14389 68975 y Fo(i)15160 68687 y Ft(whic)-31 b(h)343 b(is)f(equiv)-61 b(alen)-31 b(t)344 b(and)400 70015 y(do)31 b(es)485 b(not)h(men)-31 b(tion)488 b Fr(X)10405 70181 y Fo(k)10949 70015 y Ft(.)841 b(This)486 b(transformation)i(is)e (called)400 71343 y Fs(eliminating)555 b Fr(X)7273 71509 y Fo(k)7817 71343 y Ft(.)750 b(W)-92 b(e)454 b(assume)g(that)i Fq(\012)f Ft(and)g Fq(\014)g Ft(are)f(com-)400 72672 y(m)-31 b(utativ)g(e)524 b(and)e(asso)31 b(ciativ)-31 b(e)523 b(binary)f(op)31 b(erations)522 b(o)-31 b(v)g(er)522 b(the)400 74000 y(real)412 b(n)-31 b(um)g(b)31 b(ers,)423 b(and)412 b(that)i Fq(\012)12925 74166 y Fo(X)13651 74277 y Fn(i)14057 74000 y Ft(\()p Fr(f)15029 74166 y Fo(j)15770 74000 y Fq(\014)274 b Fr(f)17447 74166 y Fo(k)17992 74000 y Ft(\))379 b(=)g Fr(f)20583 74166 y Fo(j)21324 74000 y Fq(\014)275 b Ft(\()p Fq(\012)23751 74166 y Fo(X)24477 74277 y Fn(i)24883 74000 y Fr(f)25425 74166 y Fo(k)25970 74000 y Ft(\))28400 1107 y(if)463 b Fr(f)30050 1273 y Fo(j)30979 1107 y Ft(do)31 b(es)462 b(not)h(dep)31 b(end)462 b(on)h Fr(X)42115 1273 y Fo(i)42946 1107 y Ft(\(in)g(other)g(w)-31 b(ords,)487 b Fq(\014)462 b Ft(dis-)28400 2435 y(tributes)363 b(o)-31 b(v)g(er)363 b Fq(\012)p Ft(\).)491 b(The)363 b(transformation)i(is)e(done)g(b)-31 b(y)363 b(writ-)28400 3764 y(ing)298 b Fq(\014)31034 3362 y Fo(m)31034 4052 y(i)p Fp(=1)32523 3764 y Fr(f)33065 3930 y Fo(m)34202 3764 y Ft(as)f(\()p Fq(\014)36780 3362 y Fo(h)36780 4052 y(i)p Fp(=1)38270 3764 y Fr(f)38812 3930 y Fo(i)39180 3764 y Ft(\))101 b Fq(\014)g Ft(\()p Fq(\014)41964 3362 y Fo(m)41964 4077 y(j)45 b Fp(=)p Fo(h)p Fp(+1)44750 3764 y Fr(f)45292 3930 y Fo(j)45759 3764 y Ft(\))297 b(where)f(only)i(func-)28400 5092 y(tions)347 b Fr(h)198 b Ft(+)h(1)346 b(to)h Fr(m)e Ft(dep)31 b(end)345 b(on)h Fr(X)42782 5258 y Fo(k)43673 5092 y Ft(\(ren)-31 b(um)g(b)31 b(ering)346 b(if)g(neces-)28400 6420 y(sary\).)474 b(W)-92 b(e)311 b(can)h(then)g(write)g Fq(\012)41539 6620 y Fl(f)p Fo(X)42719 6731 y Fk(1)43151 6620 y Fo(;:::X)44929 6737 y Fn(k)9 b Fj(\000)p Fk(1)46389 6620 y Fl(g)47029 6420 y Fq(\012)47890 6586 y Fo(X)48616 6703 y Fn(k)49286 6420 y Ft(\()p Fq(\014)50577 6019 y Fo(h)50577 6709 y(i)p Fp(=1)52067 6420 y Fr(f)52609 6586 y Fo(i)52977 6420 y Ft(\))131 b Fq(\014)28400 7880 y Ft(\()p Fq(\014)29691 7479 y Fo(m)29691 8194 y(j)45 b Fp(=)p Fo(h)p Fp(+1)32477 7880 y Fr(f)33019 8046 y Fo(j)33485 7880 y Ft(\))523 b(as)f Fq(\012)36811 8080 y Fl(f)p Fo(X)37991 8191 y Fk(1)38423 8080 y Fo(;:::X)40201 8197 y Fn(k)9 b Fj(\000)p Fk(1)41661 8080 y Fl(g)42170 7880 y Ft(\()p Fq(\014)43461 7479 y Fo(h)43461 8169 y(i)p Fp(=1)44950 7880 y Fr(f)45492 8046 y Fo(i)45861 7880 y Ft(\))349 b Fq(\014)f Ft(\()p Fq(\012)49140 8046 y Fo(X)49866 8163 y Fn(k)50754 7880 y Fq(\014)51615 7479 y Fo(m)51615 8194 y(j)45 b Fp(=)p Fo(h)p Fp(+1)28400 9209 y Fr(f)28942 9375 y Fo(j)29408 9209 y Ft(\).)468 b(W)-92 b(e)292 b(then)g(de\014ne)h(a)g(new)f (function)i Fr(\025)308 b Ft(=)f Fq(\012)48295 9375 y Fo(X)49021 9492 y Fn(k)49653 9209 y Fq(\014)50514 8807 y Fo(m)50514 9522 y(j)45 b Fp(=)p Fo(h)p Fp(+1)53392 9209 y Fr(f)53934 9375 y Fo(j)28400 10537 y Ft(whic)-31 b(h)591 b(do)31 b(es)590 b(not)h(dep)31 b(end)590 b(on)g Fr(X)43435 10703 y Fo(k)43980 10537 y Ft(,)646 b(and)591 b(the)f(expression)28400 11866 y Fq(\012)29261 12066 y Fl(f)p Fo(X)30441 12177 y Fk(1)30873 12066 y Fo(;:::X)32651 12183 y Fn(k)9 b Fj(\000)p Fk(1)34110 12066 y Fl(g)34981 11866 y Fq(\014)35842 11464 y Fo(h)35842 12154 y(i)p Fp(=1)37694 11866 y Fr(f)38236 12032 y Fo(i)38967 11866 y Fq(\014)362 b Fr(\025)543 b Ft(is)g(then)h(the)g(desired)e(result.) 28400 13194 y(After)414 b Fr(X)32255 13360 y Fo(k)33214 13194 y Ft(to)h Fr(X)35529 13360 y Fp(1)36439 13194 y Ft(ha)-31 b(v)g(e)415 b(b)31 b(een)414 b(eliminated,)428 b(w)-31 b(e)415 b(will)g(b)31 b(e)414 b(left)28400 14522 y(with)282 b(a)f(constan)-31 b(t)283 b(or)e(a)g(function)h(on)f(the)g (uneliminated)j(v)-61 b(ari-)28400 15851 y(ables)257 b(whic)-31 b(h)258 b(is)f(equiv)-61 b(alen)-31 b(t)259 b(to)f(the)g(original)h(expression,)280 b(but)28400 17179 y(whic)-31 b(h)370 b(can)g(b)31 b(e)368 b(ev)-61 b(aluated)371 b(in)e Fr(O)31 b Ft(\(1\))371 b(time.)28400 19171 y(F)-92 b(or)484 b(b)31 b(elief)485 b(inference,)514 b(w)-31 b(e)485 b(let)h Fq(\012)e Ft(b)31 b(e)484 b(summation,)516 b(and)485 b Fq(\014)28400 20500 y Ft(b)31 b(ecomes)479 b(pro)31 b(duct.)823 b(F)-92 b(or)479 b(the)g(MPE)g(task,)508 b Fq(\012)479 b Ft(is)g(the)h(max)28400 21828 y(function,)394 b(and)387 b Fq(\014)g Ft(is)g(pro)31 b(duct.)546 b(Initially)390 b(the)d(CPTs)h(in)g(the)28400 23157 y(net)-31 b(w)g(ork)524 b(are)f(simpli\014ed)h(b)-31 b(y)523 b(instan)-31 b(tiating)526 b(the)d(evidence)28400 24485 y(v)-61 b(ariables)558 b(with)i(their)e(v) -61 b(alues.)1058 b(Then)558 b Fr(f)46639 24651 y Fp(1)47136 24485 y Fr(;)184 b(:::;)g(f)49581 24651 y Fo(m)50983 24485 y Ft(will)559 b(b)31 b(e)28400 25813 y(the)343 b(CPTs,)350 b(and)343 b(all)i(v)-61 b(ariables)344 b(will)h(b)31 b(e)342 b(eliminated)k(but)e(the)28400 27142 y(query)-92 b(.)781 b(F)-92 b(or)464 b(MAX-CSP)-92 b(,)466 b Fr(f)40621 27308 y Fp(1)41118 27142 y Fr(;)184 b(:::;)g(f)43563 27308 y Fo(m)44872 27142 y Ft(are)466 b(the)f(constrain)-31 b(ts,)28400 28470 y Fq(\012)355 b Ft(is)g(min,)360 b Fq(\014)355 b Ft(is)g(summation,)361 b(and)355 b(again)i(all)g(v)-61 b(ariables)356 b(but)28400 29798 y(the)486 b(query)g(will)i(b)31 b(e)486 b(eliminated.)847 b(The)486 b(result)g(of)h(v)-61 b(ariable)28400 31127 y(elimination)319 b(then)d(will)i(b)31 b(e)315 b(a)h(unary)g(function)h(on)f(the)g(query)28400 32455 y(v)-61 b(ariable,)394 b(giving)389 b(the)f(desired)f(answ)-31 b(er)388 b(for)g(eac)-31 b(h)388 b(of)g(its)g(v)-61 b(al-)28400 33783 y(ues.)28400 37063 y Fu(3)1495 b(APPR)-42 b(O)g(XIMA)-125 b(TE)30642 38613 y(DECOMPOSITION)28400 41387 y Ft(In)354 b(this)i(section)g(w)-31 b(e)355 b(describ)31 b(e)354 b(the)h(appro)-31 b(ximate)358 b(decomp)31 b(o-)28400 42716 y(sition)371 b(algorithm.)28400 45678 y Fv(3.1)1274 b(THE)424 b(MAIN)h(ALGORITHM)28400 48097 y Ft(A)322 b(collection)j(of)d (functions)i Fq(f)p Fr(f)41459 48263 y Fp(1)41956 48097 y Fr(;)184 b(:::;)g(f)44401 48263 y Fo(m)45245 48097 y Fq(g)322 b Ft(o)-31 b(v)g(er)323 b(a)f(set)g(of)h(v)-61 b(ari-)28400 49425 y(ables)470 b Fr(X)556 b Ft(can)470 b(b)31 b(e)469 b(represen)-31 b(ted)469 b(b)-31 b(y)470 b(an)f(undirected)h(graph.)28400 50754 y(There)412 b(is)h(a)g(no)31 b(de)413 b(for)f(eac)-31 b(h)413 b(v)-61 b(ariable)414 b(in)f Fr(X)87 b Ft(,)424 b(and)412 b(a)h(pair)g(of)28400 52082 y(v)-61 b(ariables)302 b(are)f(connected)g(b)-31 b(y)302 b(an)f(edge)g(if)h(they)f(b)31 b(oth)302 b(app)31 b(ear)28400 53411 y(in)434 b(the)h(scop)31 b(e)433 b(of)i Fr(f)36649 53577 y Fo(i)37017 53411 y Ft(,)451 b(for)434 b(some)h Fr(i)p Ft(.)687 b(The)434 b(undirected)h(graph)28400 54739 y(represen)-31 b(ting)412 b(the)f(CPTs)i(of)f(a)g(b)31 b(elief)412 b(net)-31 b(w)g(ork,)424 b(called)413 b(the)28400 56067 y(moral)463 b(graph,)486 b(is)462 b(found)g(b)-31 b(y)462 b(connecting)h(all)g(paren)-31 b(ts)462 b(of)h(a)28400 57396 y(common)408 b(c)-31 b(hild)407 b(in)f(the)h(net)-31 b(w)g(ork's)407 b(D)-31 b(A)g(G)406 b(and)h(undirecting)28400 58724 y(the)369 b(edges.)985 b(See)369 b(\014gure)g(1)g(for)h(an)f (example.)28400 60716 y(When)340 b(a)h(v)-61 b(ariable)342 b Fr(X)37537 60882 y Fo(k)38423 60716 y Ft(is)e(eliminated)k(b)-31 b(y)341 b(v)-61 b(ariable)342 b(elimina-)28400 62045 y(tion,)282 b(all)259 b(functions)g(men)-31 b(tioning)261 b(it)e(are)e(remo)-31 b(v)g(ed)259 b(and)f(a)h(new)28400 63373 y(function)383 b(is)f(de\014ned)f(on)h(all)h(of)f(its)g(neigh)-31 b(b)31 b(ors.)530 b(This)382 b(corre-)28400 64702 y(sp)31 b(onds)366 b(to)i(deleting)h Fr(X)38517 64868 y Fo(k)39428 64702 y Ft(from)f(the)f(graph)g(and)g(connecting)28400 66030 y(all)299 b(neigh)-31 b(b)31 b(ors.)470 b(The)298 b(cost)h(of)f(calculating)k(the)c(new)g(function)28400 67358 y(is)292 b(exp)31 b(onen)-31 b(tial)295 b(in)e(the)f(n)-31 b(um)g(b)31 b(er)293 b(of)g(neigh)-31 b(b)31 b(ors.)934 b(In)292 b(general,)28400 68687 y(as)439 b(v)-61 b(ariables)440 b(are)f(eliminated,)459 b(the)440 b(graph)f(of)h(the)f(remain-)28400 70015 y(ing)348 b(problem)f(gets)h(denser)e(and)h(denser,)k(un)-31 b(til)348 b(all)g(v)-61 b(ariables)28400 71343 y(ha)-31 b(v)g(e)386 b(more)g(than)g Fr(i)g Ft(neigh)-31 b(b)31 b(ors,)390 b(for)c(some)f(\014xed)h(a\013ordable)28400 72672 y(complexit)-31 b(y)297 b(limit)f Fr(i)p Ft(.)468 b(A)-31 b(t)294 b(that)i(p)31 b(oin)-31 b(t)295 b(the)f(algorithm)j (cannot)28400 74000 y(pro)31 b(ceed)369 b(without)i(an)f(unacceptable)g (cost.)p eop end %%Page: 3 3 TeXDict begin 3 2 bop 400 12000 a @beginspecial 0 @llx 0 @lly 524 @urx 319 @ury 2376 @rwi 1079 @rhi @setspecial %%BeginDocument: Network_Figure.eps %!PS-Adobe-3.1 EPSF-3.0 %%Title: Network_Figure.eps %%Creator: Adobe Illustrator(R) X %%AI8_CreatorVersion: 10.0 %AI9_PrintingDataBegin %%For: David Larkin %%CreationDate: 3/26/2003 %%BoundingBox: 0 0 524 319 %%HiResBoundingBox: 0 0 523.4747 318.2369 %%CropBox: 0 0 523.4747 318.2369 %%LanguageLevel: 2 %%DocumentData: Clean7Bit %ADOBeginClientInjection: DocumentHeader "AI10" %ADOEndClientInjection: DocumentHeader "AI10" %%Pages: 1 %%DocumentNeededResources: %%DocumentSuppliedResources: procset Adobe_AGM_Image (1.0 0) %%+ procset Adobe_CoolType_Utility_MAKEOCF (1.13 0) %%+ procset Adobe_CoolType_Core (2.12 0) %%+ procset Adobe_AGM_Core (2.0 0) %%+ procset Adobe_AGM_Utils (1.0 0) %%DocumentFonts: %%DocumentNeededFonts: %%DocumentNeededFeatures: %%DocumentSuppliedFeatures: %%DocumentProcessColors: Black %%DocumentCustomColors: %%CMYKCustomColor: %%RGBCustomColor: %AI7_Thumbnail: 128 80 8 % %%BeginData: 7614 Hex Bytes %0000330000660000990000CC0033000033330033660033990033CC0033FF %0066000066330066660066990066CC0066FF009900009933009966009999 %0099CC0099FF00CC0000CC3300CC6600CC9900CCCC00CCFF00FF3300FF66 %00FF9900FFCC3300003300333300663300993300CC3300FF333300333333 %3333663333993333CC3333FF3366003366333366663366993366CC3366FF %3399003399333399663399993399CC3399FF33CC0033CC3333CC6633CC99 %33CCCC33CCFF33FF0033FF3333FF6633FF9933FFCC33FFFF660000660033 %6600666600996600CC6600FF6633006633336633666633996633CC6633FF %6666006666336666666666996666CC6666FF669900669933669966669999 %6699CC6699FF66CC0066CC3366CC6666CC9966CCCC66CCFF66FF0066FF33 %66FF6666FF9966FFCC66FFFF9900009900339900669900999900CC9900FF %9933009933339933669933999933CC9933FF996600996633996666996699 %9966CC9966FF9999009999339999669999999999CC9999FF99CC0099CC33 %99CC6699CC9999CCCC99CCFF99FF0099FF3399FF6699FF9999FFCC99FFFF %CC0000CC0033CC0066CC0099CC00CCCC00FFCC3300CC3333CC3366CC3399 %CC33CCCC33FFCC6600CC6633CC6666CC6699CC66CCCC66FFCC9900CC9933 %CC9966CC9999CC99CCCC99FFCCCC00CCCC33CCCC66CCCC99CCCCCCCCCCFF %CCFF00CCFF33CCFF66CCFF99CCFFCCCCFFFFFF0033FF0066FF0099FF00CC %FF3300FF3333FF3366FF3399FF33CCFF33FFFF6600FF6633FF6666FF6699 %FF66CCFF66FFFF9900FF9933FF9966FF9999FF99CCFF99FFFFCC00FFCC33 %FFCC66FFCC99FFCCCCFFCCFFFFFF33FFFF66FFFF99FFFFCC110000001100 %000011111111220000002200000022222222440000004400000044444444 %550000005500000055555555770000007700000077777777880000008800 %000088888888AA000000AA000000AAAAAAAABB000000BB000000BBBBBBBB %DD000000DD000000DDDDDDDDEE000000EE000000EEEEEEEE0000000000FF %00FF0000FFFFFF0000FF00FFFFFF00FFFFFF %524C45FD0EFFA8A8FFA8A8A8FD27FFFD07A8FD27FFA8A8A8FFA8A8FD1DFF %A8A8FD06FFA8FD25FF7DFD07FF7DFD25FFA8FD06FFA8A8FD1BFFA8FFFFFF %A8A8FFFFFF7DFD23FFA8FD04FF7DFD04FFA8FD23FFA8FFFFFFA8FD04FFA8 %FD1AFFA8A8FFFFFF2752FD04FFA8FD22FFA8FFFFFF7DF8FD04FFA8FD22FF %A8FD04FF2727FD04FFA8FD19FFA8FFFFFFA8F8F8FD04FFA8FD22FFA8FFFF %FF272752FFFFFFA8FD22FFA8FD04FFF827FD04FFA8FD1AFFA8FFFF527D52 %7DFFFFA8A8FD22FFA8FFFFFF27FF52FFFFFFA8FD22FFA8A8FFFF52A852A8 %FFFFA8A8FD1AFFA8FD08FFA8FD23FFA8FD09FFA8FD23FF7DFD08FFA8FD1B %FFA852FD06FF277DFD24FF7DA8FD06FF7DFD25FF7DFD06FF7DA8FD1BFF7D %7DFD06A8FF27FD24FFA8FFFD06A8FFA8FD23FFA8FFFD06A8FFA8FD1BFF27 %FD09FF27FD23FF7DFD08FFA8A8FD22FFA8FD09FFA8FD1AFF27FD09FFA827 %FD21FF7DFD0AFFA8A8FD21FFA8FD09FFA8A8FD18FF7D52FD0AFFA827FD20 %FFA8FD0BFFA8FD20FFA8A8FD0AFFA8A8FD17FF27FD0CFF7D52FD1FFFA8FD %0CFFA8FD1FFFA8FD0CFFA8FD17FF27FD0DFF527DFD1DFF7DFD0DFFA8A8FD %1EFF7DFD0DFFA8FD15FFA852FD0EFF5227FFFFFD04A8FD16FFA8FD0EFFA8 %A8FFFFFD04A8FD17FFA8FD0EFFA8FFFFFFA8A87DFD0EFF27FD0FFF52F87D %A8FD04FF7DA8FD14FF7DFD0FFFA8A87DA8FFFFFFA87DFD14FFA8FD10FF7D %A87DFFFFFFA8A8A8FD0BFF52FD10FF7DFD07FFA8FD13FFA8FD11FFA8FD07 %FFA8FD13FFA8FD10FFA8FD08FFA8FD09FFA852FD0FFFA8FD04FF7DA8FFFF %FF7DFD12FFA8FD10FF7DFFFFFFA87DFD04FFA8FD11FFA8A8FD0FFFA8A8FF %FFFF7DA8FFFFFFA8FD09FF27FD10FFA8FFFFFF525252FFFFFFA8FD12FFA8 %FD10FFA8FFFFFF275252FFFFFFA8FD11FFA8FD10FF7DFFFFFF525252A8FF %FFA8FD09FF27FD10FF7DFFFFFF27FD05FF7DFD11FFA8FD11FF7DFFFFFF27 %FD05FF7DFD11FF7DFD10FFA8FFFFFF27FD05FFA8FD08FFA852FD10FFA8FF %FFFF7D2752FFFFFFA8FD11FFA8FD11FFA8FFFFFF522752FD15FFA8FD10FF %A8FFFFFF7D2727FFFFFFA8FD08FF27A8FD11FFA8FD08FFA8FD11FF7DFD11 %FFA8FD08FFA8FD11FFA8FD12FF7DFD07FFA8A8FD08FF52FD12FF277DA8FD %04FFA8A8FD11FFA8FD13FF7DA8FD04FFA8A8FD12FF7DFD12FFA87DFD05FF %A8A8FD08FFA827FD11FFA827FFFF7D277DA8FD13FFA8FD12FFA8FFFFA87D %527DA8FD13FFA8FD12FF7DFFA8A852A87DFD0AFF27FD12FF52A8FFFFFF27 %FD15FFA8FD12FFA8FFFFFFA87DFD14FFA8FD12FFA8FD04FFA8FD0CFF27FD %12FF27FD04FF27FD14FFA8FD12FFA8A8FFFFFF52A8FD14FF7DFD12FFA8FD %04FF7DFD0BFFA852FD11FF27A8FD04FF27FD14FFA8FD12FFA8FD04FF7D7D %FD14FFA8FD11FFA8A8FD04FFA8FD0BFF27A8FD10FFA827FD05FF27FD14FF %7DFD11FF7DFD05FF27A8FD13FFA8FD12FF7DFD04FFA8A8FD0BFF27FD11FF %52A8FD05FF27FD13FFA8FD12FFA8FD05FF52A8FD13FFA8FD11FFA8FD05FF %A8FD0BFFA827FD11FF27FD06FF27FD13FFA8FD11FFA8FD06FF7DA8FD13FF %A8FD11FFA8FD05FFA8FD0BFF27A8FD10FF27A8FD06FF27FD13FF7DFD11FF %A8FD05FF7DA8A8FD12FFA8FD11FFA8A8FD05FFA8FD0BFFF852FD0FFF52F8 %7DFD06FF27FD12FFA8A8FD10FF7DFD06FF52FFA8FD12FF7DFD11FF7DFD06 %FFA8FD09FFA8A852A8A8FD0DFFA87D7DA8A8FD05FF27FD10FFFD06A8FD0C %FFFD05A8FD04FF27FFA8FD0FFFFD06A8FD0CFFFD05A8FD05FFA8FD07FFA8 %A8FD05FF7DFD09FFA8A8A8FD05FF7DFD04FF27FD0EFFA8A8FD06FF7DFD09 %FFA8A8FD05FFA8A8FFFF52FFA8FD0EFFA8FD06FFA8A8FD09FF7DFD05FFA8 %A8FFFFA8FD07FFA8A8FFFF7D52FFFFFF7DFD08FFA8FFFF7D7DA8FFFFFFA8 %FFFFFF27FD0EFFA8FFFF7D7DA8FFFFFFA8FD07FFA8FFFFFF7D7DFFFFFFA8 %A8FF52FF7DFD0DFFA8FFFFFF7D7DFFFFFFA8A8FD07FF7DFFFFFF527DFFFF %FFA8FFA8FD07FF7DFFFFFFF87D27FFFFFF7DFD06FFA8A8FFFF2752277DFF %FFA8FFFFFF27FD0DFFA8FFFFFF275227FFFFFFA8FD07FFA8FFFFFF275227 %FFFFFFA8A87DFFA8FD0DFFA8FFFFFF275252FFFFFFA8FD06FFA8A8FFFF52 %522752FFFFA8FF7DFD07FFA8FFFFFFF82752FFFFFFA8FD06FFA8FFFFFF27 %FF7D7DFFFFA8FFFFFF27FD0DFFA8FFFFFF275227FFFFFFA852527DFD0552 %FFFFFF27FF27FFFFFFA8A87DFFA8FD0DFFA8FFFFFFF85252FFFFFF7DFD06 %A87DFFFFFF7D7DFF27FFFFFFA8A8FD07FF7DFFFFFFF82752FFFFFF7DFD06 %FFA8FFFFFF272727A8FFFFA8FFFFFF27FD0DFFA8FFFFFF272727FFFFFFA8 %FD07FFA8FFFFFFF82752FFFFFFA827FFFFA8FD0DFFA8FFFFFFF82752FFFF %FFA8FD06FF7DFFFFFF5227F87DFFFFA8A87DFD07FFA8FD08FFA8FD08FFA8 %FD08FF7DFFFFFF27FD0DFFA8FD09FF7DFD07FF7DFD09FFA87DFFFFA8FD0D %FF7DFD09FFA8FD07FFA8FD08FFA8FFA8FD07FFA8A8FD06FF7D7DFD08FFA8 %A8FD06FF7DFD04FF27FD0EFFA8FD07FF7DFD09FF7DFD07FF7DFF52FFFFA8 %FD0EFF7DFD06FFA8A8FD09FFA8FD06FFA8A8A8FD0AFFFD07A827FD09FFFD %07A8FD05FF27FD0FFFFD09A8FD09FFFD07A8FFFF7DFFFFA8FD0FFFFD08A8 %FD0AFFA8A87DA8A8A8FFFFA8FD11FFA827FD0BFF7DFD08FF27FD17FFA8A8 %FD0BFF7DFD04FFA87DFFFFA8FD16FFA8A8FD0BFFA8FD05FFA8FD12FF7D52 %FD0AFF7DFD08FF27FD18FFA8FD0BFFA8FD04FF52FFFFFF7DFD17FFA8FD0B %FF7DFD05FFA8FD13FF527DFD09FF52FD08FF27FD19FFA8FD0AFF7DFD04FF %7DFFFFFFA8FD18FFA8FD0AFFA8FD05FFA8FD14FF27A8FD08FF7DFD08FF27 %FD24FFA8FD04FF52FFFFFFA8FD19FFA8FD09FFA8FD05FFA8FD14FFA827FD %08FF52FD08FF27FD1AFFA8FD09FF7DFD04FF7DFFFFFFA8FD1AFF7DFD08FF %A8FD04FF7DFD16FF7D52FD07FF7DFD08FF27FD1BFF7DFD08FFA8FD04FF52 %FFFFFFA8FD1BFFA8FD07FFA8FD04FFA8FD17FF5252FD06FF52FD08FF27FD %1CFF7DFD07FF7DFFFFFF7D7DFFFFFFA8FD1CFFA8FD06FFA8FD04FF7DFD18 %FF27A8FD05FF7DFD08FF27FD1DFFA8FD06FFA8FFFFFF7DFD04FFA8FD1CFF %A8FD06FFA8FD04FFA8FD19FF27FD05FF7DFD08FF27FD1EFFA8FD05FF7DFF %FFFF52FD04FFA8FD1DFFA8FD05FFA8FD04FF7DFD1AFF27FD04FF2727FD07 %FF27FD1EFFA8FD05FFA8FFFFFF52FD04FF7DFD1EFFA8FD04FF7DFFFFFFA8 %FD1BFF7DF8A8A8A8527D7DFD06FF27FD1FFFA8FFFF7DA87DA87DFF27FD04 %FFA8FD1EFFA8A8FFFF7D7D7DA8A8A8FD1BFFA85252FD05FFA8A8FD04FF27 %FD20FF7DA8FD05FF7D7DFD04FFA8FD1FFFA8A8A8FD05FF7DFD1CFF7DFFFF %A8527DA8FFA8A8FFFFFF27FD20FFA8FFFF7D527DFFFFA8FD04FFA8FD1FFF %A8FFFFA87D52FFFFFF7DFD1AFFA8FFFFFF7D5252FFFFFF7DFFFFFF27FD1F %FF7DFFFFFF277D7DFFFFFFA8FFFFFFA8FD1FFFA8FFFF7D527DA8FFFFA8FD %1AFFA8FFFFFF7DF827FFFFFFA8A8FFFF27FD1FFFA8FFFFFF27277DFFFFFF %A8FFFFFFA8FD1EFF7DFFFFFF522727FD04FFA8FD19FFA8FFFFFF7D2727A8 %FFFFA8FFFFFF27FD1FFFA8FFFFFFF85252FFFFFFA8FFFFFFA8FD1EFFA8FF %FFFF7D27527DFFFFFFA8FD1AFFA8FD08FFA8FFFFFF27FD1FFFA8FD08FFA8 %A8FFFFFFA8FD1FFFA8FD08FF7DFD1BFFA8FD08FFA8FFFFFF27FD20FFA8FD %07FFA8FD04FF7DFD1FFFA8FD07FFA8FD1DFFA87DA8FFFF7DA8A8FD04FF27 %FD20FFA8A87DFFFFA87DA8FD05FFA8FD20FFA8A8A8FFFFA87DA8FD20FF7D %52FD07FF27FD23FFA87DA8FD07FFA8FD23FFA8A8FD24FF27FD07FF27FD24 %FFA8A8FD07FFA8FD49FF7D7DFD06FF27FD25FFA8FD07FFA8FD4AFFF8FD06 %FF27FD26FFA8FD06FFA8FD4AFF7D52FD05FF27FD26FFA8FD06FFA8FD4BFF %27FD05FF27FD26FFA8A8FD05FFA8FD4BFF7D7DFD04FF27FD27FFA8FD05FF %7DFD4CFFF8FFFFFF7D277DFD27FFA8FD04FFA8FD4CFF7D27FFFFFFF87DFD %27FFA8FD04FFA8FD4CFF7DF852A87D7D7DA87DFD25FFA8A87DA87DA87DA8 %A8FD4AFF52A8FD06FF7DFD25FF7DFD07FFA8FD48FFA8A8FFFF7D7D7DFFFF %FF7DFD23FF7DFFFFFF7D7D7DFFFFA8A8FD47FFA8FFFFFF527D7DFFFFFFA8 %FD23FFA8FFFFFF277DA8FFFFFFA8FD47FF7DFFFFFF272752FFFFFF7DFD23 %FF7DFFFFFFF8527DFFFFFF7DFD47FFA8FFFFFF52FD05FFA8FD23FFA8FFFF %FF52FD05FFA8FD47FFA8A8FD08FF7DFD23FF7DFD08FFA8A8FD48FFA8A8FD %06FFA8FD25FFA8FD06FFA8A8FD4AFFA8A87DA87DA8A8FD27FFA8A87DA87D %A8A8FDFCFFFD32FFFF %%EndData %%EndComments %%BeginDefaults %%ViewingOrientation: 1 0 0 1 %%EndDefaults %%BeginProlog %ADOBeginClientInjection: DocumentProlog Start "AI10" %ADOEndClientInjection: DocumentProlog Start "AI10" %%BeginResource: procset Adobe_AGM_Utils 1.0 0 %%Version: 1.0 0 %%Copyright: Copyright (C) 2000-2000 Adobe Systems, Inc. All Rights Reserved. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Utils 60 dict dup begin put /bdf { bind def } bind def /nd{ null def }bdf /xdf { exch def }bdf /ldf { load def }bdf /ddf { put } }bdf /xddf { 3 -1 roll put } }bdf /xpt { }bdf /ndf { exch put }def /cdndf { exch dup currentdict exch known{ pop pop }{ exch def }ifelse }def /bdict { mark }bdf /edict { counttomark 2 idiv dup dict begin {def} repeat pop currentdict end } }def /ps_level /languagelevel where{ pop systemdict /languagelevel get exec }{ 1 }ifelse def /level2 ps_level 2 ge def /level3 ps_level 3 ge def /ps_version {version cvr} stopped { -1 }if def /makereadonlyarray { /packedarray where{ pop packedarray }{ array astore readonly }ifelse }bdf /map_reserved_ink_name { dup type /stringtype eq{ dup /Red eq{ exch dup where{ pop pop pop }{ xdf }ifelse }{ pop (_Red_) dup /Green eq{ pop (_Green_) }{ dup /Blue eq{ pop (_Blue_) }{ dup /Cyan eq{ pop (_Cyan_) }{ dup /Magenta eq{ pop (_Magenta_) }{ dup /Yellow eq{ pop (_Yellow_) }{ dup /Black eq{ pop (_Black_) }{ dup () cvn eq{ pop (Process) }if }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse }if }bdf /AGMUTIL_GSTATE 22 dict def /get_gstate { AGMUTIL_GSTATE begin /AGMUTIL_GSTATE_clr_spc currentcolorspace def /AGMUTIL_GSTATE_clr_indx 0 def /AGMUTIL_GSTATE_clr_comps 12 array def mark currentcolor counttomark {AGMUTIL_GSTATE_clr_comps AGMUTIL_GSTATE_clr_indx 3 -1 roll put /AGMUTIL_GSTATE_clr_indx AGMUTIL_GSTATE_clr_indx 1 add def} repeat pop /AGMUTIL_GSTATE_fnt rootfont def /AGMUTIL_GSTATE_lw currentlinewidth def /AGMUTIL_GSTATE_lc currentlinecap def /AGMUTIL_GSTATE_lj currentlinejoin def /AGMUTIL_GSTATE_ml currentmiterlimit def currentdash /AGMUTIL_GSTATE_do xdf /AGMUTIL_GSTATE_da xdf / /AGMUTIL_GSTATE_sa currentstrokeadjust def /AGMUTIL_GSTATE_clr_rnd currentcolorrendering def /AGMUTIL_GSTATE_op currentoverprint def /AGMUTIL_GSTATE_bg currentblackgeneration cvlit def /AGMUTIL_GSTATE_ucr currentundercolorremoval cvlit def currentcolortransfer cvlit /AGMUTIL_GSTATE_gy_xfer xdf cvlit /AGMUTIL_GSTATE_b_xfer xdf cvlit /AGMUTIL_GSTATE_g_xfer xdf cvlit /AGMUTIL_GSTATE_r_xfer xdf /AGMUTIL_GSTATE_ht currenthalftone def /AGMUTIL_GSTATE_flt currentflat def end }def /set_gstate { AGMUTIL_GSTATE begin AGMUTIL_GSTATE_clr_spc setcolorspace AGMUTIL_GSTATE_clr_indx {AGMUTIL_GSTATE_clr_comps AGMUTIL_GSTATE_clr_indx 1 sub get /AGMUTIL_GSTATE_clr_indx AGMUTIL_GSTATE_clr_indx 1 sub def} repeat setcolor AGMUTIL_GSTATE_fnt setfont AGMUTIL_GSTATE_lw setlinewidth AGMUTIL_GSTATE_lc setlinecap AGMUTIL_GSTATE_lj setlinejoin AGMUTIL_GSTATE_ml setmiterlimit AGMUTIL_GSTATE_da AGMUTIL_GSTATE_do setdash A AGMUTIL_GSTATE_sa setstrokeadjust AGMUTIL_GSTATE_clr_rnd setcolorrendering AGMUTIL_GSTATE_op setoverprint AGMUTIL_GSTATE_bg cvx setblackgeneration AGMUTIL_GSTATE_ucr cvx setundercolorremoval AGMUTIL_GSTATE_r_xfer cvx AGMUTIL_GSTATE_g_xfer cvx AGMUTIL_GSTATE_b_xfer cvx A AGMUTIL_GSTATE_gy_xfer cvx setcolortransfer AGMUTIL_GSTATE_ht /HalftoneType get dup 9 eq exch 100 eq or { currenthalftone /HalftoneType get AGMUTIL_GSTATE_ht /HalftoneType get { mark AGMUTIL_GSTATE_ht {sethalftone} stopped cleartomark } if ne }{ AGMUTIL_GSTATE_ht sethalftone } ifelse AGMUTIL_GSTATE_flt setflat end }def /AGMUTIL_str256 256 string def /AGMUTIL_src256 256 string def /AGMUTIL_dst64 64 string def /AGMUTIL_srcLen nd /AGMUTIL_ndx nd /rdline { currentfile AGMUTIL_str256 readline pop } bdf /rdcmntline { currentfile AGMUTIL_str256 readline pop (%) anchorsearch {pop} if } bdf /filter_cmyk { dup type /filetype ne{ 0 () /SubFileDecode filter }if [ exch { AGMUTIL_src256 readstring pop dup length /AGMUTIL_srcLen exch def / /AGMUTIL_ndx 0 def AGMCORE_plate_ndx 4 AGMUTIL_srcLen 1 sub{ 1 index exch get AGMUTIL_dst64 AGMUTIL_ndx 3 -1 roll put /AGMUTIL_ndx AGMUTIL_ndx 1 add def }for pop AGMUTIL_dst64 0 AGMUTIL_ndx getinterval } bind /exec cvx ] cvx } bdf /AGMUTIL_imagefile nd /AGMUTIL_imbuf nd /read_image_file { AGMUTIL_imagefile 0 setfileposition dup /DataSource {AGMUTIL_imagefile AGMUTIL_imbuf readstring pop} put exch load exec }def /write_image_file { begin { (AGMUTIL_imagefile) (w+) file } stopped{ false }{ Adobe_AGM_Utils/AGMUTIL_imagefile xddf Adobe_AGM_Utils/AGMUTIL_imbuf Width BitsPerComponent mul 7 add 8 idiv string ddf 1 1 Height { pop DataSource dup type /filetype eq{ AGMUTIL_imbuf readstring pop }{ exec } ifelse AGMUTIL_imagefile exch writestring }for true }ifelse end }def /close_image_file { AGMUTIL_imagefile closefile (AGMUTIL_imagefile) deletefile }def /consumeimagedata { begin currentdict /MultipleDataSources known not {/MultipleDataSources false def} if MultipleDataSources { end }bdf /addprocs { 2{/exec load}repeat 3 1 roll [ 5 1 roll ] bind cvx }def /modify_halftone_xfer { currenthalftone dup length dict copy begin currentdict 2 index known{ 1 index load dup length dict copy begin currentdict/TransferFunction known{ /TransferFunction load }{ currenttransfer }ifelse addprocs /TransferFunction xdf currentdict end def currentdict end sethalftone }{ currentdict/TransferFunction known{ /TransferFunction load 1 dict begin /flushbuffer Width cvi string def 1 1 Height cvi { pop 0 1 DataSource length 1 sub { DataSource exch get dup type dup /filetype eq { exch flushbuffer readstring pop pop }if /arraytype eq { exec pop }if }for }for end } { /DataSource load type dup /filetype eq { 1 dict begin /flushbuffer Width Decode length 2 div mul cvi string def 1 1 Height { pop DataSource flushbuffer readstring pop pop} for end }if /arraytype eq { 1 1 Height { pop DataSource pop } for }if }ifelse }def /doc_setup{ Adobe_AGM_Utils begin }bdf /doc_trailer{ currentdict Adobe_AGM_Utils eq{ end }if }bdf systemdict /setpacking known { setpacking } if %%EndResource %%BeginResource: procset Adobe_AGM_Core 2.0 0 %%Version: 2.0 0 %%Copyright: Copyright (C) 1997-1999 Adobe Systems, Inc. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Core 205 dict dup begin put /nd{ null def }bind def /Adobe_AGM_Core_Id /Adobe_AGM_Core_2.0_0 def /AGMCORE_str256 256 string def /AGMCORE_src256 256 string def /AGMCORE_save nd /AGMCORE_graphicsave nd /AGMCORE_c 0 def /AGMCORE_m 0 def /AGMCORE_y 0 def /AGMCORE_k 0 def /AGMCORE_cmykbuf 4 array def /AGMCORE_screen [currentscreen] cvx def /AGMCORE_tmp 0 def /AGMCORE_&setgray nd /AGMCORE_&setcolor nd /AGMCORE_&setcolorspace nd /AGMCORE_&setcmykcolor nd /AGMCORE_cyan_plate nd /AGMCORE_magenta_plate nd /AGMCORE_yellow_plate nd /AGMCORE_black_plate nd /AGMCORE_plate_ndx nd /AGMCORE_get_ink_data nd /AGMCORE_is_cmyk_sep nd /AGMCORE_host_sep nd /AGMCORE_will_host_sep nd /AGMCORE_avoid_L2_sep_space nd currenttransfer }ifelse addprocs /TransferFunction xdf c currentdict end sethalftone pop }ifelse }{ All Rights Reserved. /AGMCORE_distilling nd /AGMCORE_composite_job nd /AGMCORE_producing_seps nd /AGMCORE_ps_level -1 def /AGMCORE_ps_version -1 def /AGMCORE_environ_ok nd /AGMCORE_CSA_cache 0 dict def /AGMCORE_CSD_cache 0 dict def /AGMCORE_pattern_cache 0 dict def /AGMCORE_currentoverprint false def /AGMCORE_deltaX nd /AGMCORE_deltaY nd /AGMCORE_name nd /AGMCORE_sep_special nd /AGMCORE_err_strings 4 dict def /AGMCORE_cur_err nd /AGMCORE_ovp nd /AGMCORE_current_spot_alias false def /AGMCORE_inverting false def /AGMCORE_feature_dictCount nd /AGMCORE_feature_opCount nd /AGMCORE_feature_ctm nd /AGMCORE_ConvertToProcess false def /AGMCORE_Default_CTM matrix def /knockout_unitsq nd /AGMCORE_CRD_cache where{ pop }{ /AGMCORE_CRD_cache 0 dict def }ifelse /AGMCORE_key_known { where{ /Adobe_AGM_Core_Id known }{ false }ifelse }ndf /flushinput { save /CompareBuffer 3 -1 roll def /readbuffer 256 string def mark { currentfile readbuffer {readline} stopped {cleartomark mark} { not {pop exit} if CompareBuffer eq {exit} if }ifelse }loop cleartomark restore }bdf /getspotfunction { AGMCORE_screen exch pop exch pop dup type /dicttype eq{ dup /HalftoneType get 1 eq{ /SpotFunction get }{ dup /HalftoneType get 2 eq{ /GraySpotFunction get }{ pop { abs exch abs 2 copy add 1 gt{ 1 sub dup mul exch 1 sub dup mul add 1 sub }{ dup mul exch dup mul add 1 exch sub }ifelse }bind }ifelse }ifelse }if } def /clp_npth { clip newpath } def /eoclp_npth { eoclip newpath } def /stkpath_clp_npth { strokepath clip newpath } def /stk_n_clp_npth { gsave stroke grestore clip newpath } def /npth_clp { newpath clip } def /graphic_setup { /AGMCORE_graphicsave save def concat 0 setgray 0 setlinecap 0 setlinejoin 1 setlinewidth [] 0 setdash 10 setmiterlimit newpath false setoverprint false setstrokeadjust Adobe_AGM_Core/spot_alias get exec /Adobe_AGM_Image where { pop Adobe_AGM_Image/spot_alias 2 copy known{ }{ get exec pop pop }ifelse } if 100 dict begin /showpage {} def mark } def /graphic_cleanup { cleartomark end AGMCORE_graphicsave restore } def /compose_error_msg { g grestoreall initgraphics / /Helvetica findfont 10 scalefont setfont /AGMCORE_deltaY 100 def / /AGMCORE_deltaX 310 def clippath pathbbox newpath pop pop 36 add exch 36 add exch moveto 0 AGMCORE_deltaY rlineto AGMCORE_deltaX 0 rlineto 0 AGMCORE_deltaY neg rlineto AGMCORE_deltaX neg 0 rlineto closepath 0 AGMCORE_&setgray gsave 1 AGMCORE_&setgray fill grestore 1 setlinewidth gsave stroke grestore c currentpoint AGMCORE_deltaY 15 sub add exch 8 add exch moveto /AGMCORE_deltaY 12 def /AGMCORE_tmp 0 def AGMCORE_err_strings exch get { dup 32 eq { pop AGMCORE_str256 0 AGMCORE_tmp getinterval stringwidth pop currentpoint pop add AGMCORE_deltaX 28 add gt { currentpoint AGMCORE_deltaY sub exch pop clippath pathbbox pop pop pop 44 add exch moveto } if A AGMCORE_str256 0 AGMCORE_tmp getinterval show ( ) show 0 1 AGMCORE_str256 length 1 sub { AGMCORE_str256 exch 0 put }for /AGMCORE_tmp 0 def } { AGMCORE_str256 exch AGMCORE_tmp exch put /AGMCORE_tmp AGMCORE_tmp 1 add def } ifelse } forall } bdf /doc_setup{ A Adobe_AGM_Core begin /AGMCORE_will_host_separate xdf /AGMCORE_ps_version xdf / /AGMCORE_ps_level xdf errordict /AGM_handleerror known not{ errordict /AGM_handleerror errordict /handleerror get put errordict /handleerror { Adobe_AGM_Core begin $error /newerror get AGMCORE_cur_err null ne and{ $error /newerror false put AGMCORE_cur_err compose_error_msg }if $error /newerror true put end errordict /AGM_handleerror get exec } bind put } }if /AGMCORE_environ_ok ps_level AGMCORE_ps_level ge ps_version AGMCORE_ps_version ge and AGMCORE_ps_level -1 eq or d def AGMCORE_environ_ok not { {/AGMCORE_cur_err /AGMCORE_bad_environ def} if /AGMCORE_&setgray systemdict/setgray get def level2{ /AGMCORE_&setcolor systemdict/setcolor get def /AGMCORE_&setcolorspace systemdict/setcolorspace get def }if /AGMCORE_distilling /product where{ pop systemdict/setdistillerparams known product (Adobe PostScript Parser) ne and }{ false }ifelse def /AGMCORE_in_rip_sep /AGMCORE_in_rip_sep where{ pop AGMCORE_in_rip_sep }{ AGMCORE_distilling { false }{ userdict/Adobe_AGM_OnHost_Seps known{ false }{ level2{ currentpagedevice/Separations 2 copy known{ get }{ pop pop false }{ }ifelse def level2 not{ /xput{ dup load dup length exch maxlength eq{ dup dup load dup length dup 0 eq {pop 1} if 2 mul dict copy def }if load begin def end }def }{ /xput{ load 3 1 roll put }def }ifelse /AGMCORE_GSTATE AGMCORE_key_known not{ /AGMCORE_GSTATE 21 dict def /AGMCORE_gstack 32 array def /AGMCORE_gstackptr 0 def /AGMCORE_gstacksaveptr 0 def / /AGMCORE_gstackframekeys 8 def /AGMCORE_&gsave /gsave ldf /AGMCORE_&grestore /grestore ldf /AGMCORE_&grestoreall /grestoreall ldf /AGMCORE_&save /save ldf /AGMCORE_gdictcopy { begin { def } forall end }def /AGMCORE_gput { AGMCORE_gstack AGMCORE_gstackptr 3 1 roll put }def /AGMCORE_gget { AGMCORE_gstack AGMCORE_gstackptr exch get }def /gsave { AGMCORE_&gsave AGMCORE_gstack AGMCORE_gstackptr AGMCORE_gstackptr 1 add dup 32 ge {limitcheck} if Adobe_AGM_Core exch /AGMCORE_gstackptr exch put AGMCORE_gstack AGMCORE_gstackptr AGMCORE_gdictcopy }def false }ifelse }ifelse }ifelse }ifelse get get get get }def /page_setup { /setcmykcolor where{ pop Adobe_AGM_Core/AGMCORE_&setcmykcolor /setcmykcolor load put }if Adobe_AGM_Core begin /setcmykcolor { 4 copy AGMCORE_cmykbuf astore /currentcmykcolor exch AGMCORE_gput 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor pop }ndf /currentcmykcolor { }if /currentcmykcolor [0 0 0 0] AGMCORE_gput /currentstrokeadjust false AGMCORE_gput /currentcolorspace [/DeviceGray] AGMCORE_gput /sep_tint 0 AGMCORE_gput /sep_colorspace_dict null AGMCORE_gput /indexed_colorspace_dict null AGMCORE_gput /currentcolor_intent () AGMCORE_gput /customcolor_tint 1 AGMCORE_gput end /grestore { AGMCORE_&grestore AGMCORE_gstackptr 1 sub dup AGMCORE_gstacksaveptr lt {1 add} if Adobe_AGM_Core exch /AGMCORE_gstackptr exch put }def /grestoreall { AGMCORE_&grestoreall Adobe_AGM_Core /AGMCORE_gstackptr AGMCORE_gstacksaveptr put }def /save { AGMCORE_&save AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gstackptr 1 add dup 32 ge {limitcheck} if Adobe_AGM_Core begin /AGMCORE_gstackptr exch def /AGMCORE_gstacksaveptr AGMCORE_gstackptr def end AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gdictcopy }def 0 1 AGMCORE_gstack length 1 sub { AGMCORE_gstack exch AGMCORE_gstackframekeys dict put } for /currentcmykcolor AGMCORE_gget aload pop }ndf /setoverprint { pop }ndf /currentoverprint { false }ndf /AGMCORE_deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt def /AGMCORE_cyan_plate 1 0 0 0 test_cmyk_color_plate def /AGMCORE_magenta_plate 0 1 0 0 test_cmyk_color_plate def /AGMCORE_yellow_plate 0 0 1 0 test_cmyk_color_plate def /AGMCORE_black_plate 0 0 0 1 test_cmyk_color_plate def /AGMCORE_plate_ndx AGMCORE_cyan_plate{ 0 }{ AGMCORE_magenta_plate{ 1 }{ AGMCORE_yellow_plate{ 2 }{ AGMCORE_black_plate{ 3 }{ 4 }ifelse }ifelse }ifelse }ifelse def /AGMCORE_composite_job AGMCORE_cyan_plate AGMCORE_magenta_plate and AGMCORE_yellow_plate and AGMCORE_black_plate and def A / /AGMCORE_producing_seps AGMCORE_composite_job not AGMCORE_in_rip_sep or def / /AGMCORE_host_sep AGMCORE_producing_seps AGMCORE_in_rip_sep not and def /AGM_preserve_spots /AGM_preserve_spots where{ pop AGM_preserve_spots }{ AGMCORE_distilling AGMCORE_producing_seps or }ifelse def /AGM_is_distiller_preserving_spotimages { currentdistillerparams/PreserveOverprintSettings known { currentdistillerparams/PreserveOverprintSettings get { currentdistillerparams/ColorConversionStrategy known { currentdistillerparams/ColorConversionStrategy get }{ }{ }{ /LeaveColorUnchanged eq true }ifelse false }ifelse false }ifelse }def /convert_spot_to_process where {pop}{ /convert_spot_to_process { dup dup (None) eq exch (All) eq or { pop false }{ AGMCORE_host_sep { gsave 1 0 0 0 setcmykcolor currentgray 1 exch sub 0 1 0 0 setcmykcolor currentgray 1 exch sub 0 0 1 0 setcmykcolor currentgray 1 exch sub 0 0 0 1 setcmykcolor currentgray 1 exch sub add add add 0 eq { pop false }{ false setoverprint 1 1 1 1 5 -1 roll findcmykcustomcolor 1 setcustomcolor currentgray 0 eq }ifelse grestore }{ AGMCORE_distilling { pop AGM_is_distiller_preserving_spotimages not }{ Adobe_AGM_Core/AGMCORE_name xddf false currentpagedevice/OverrideSeparations known { currentpagedevice/OverrideSeparations get { /HqnSpots /ProcSet resourcestatus { pop pop pop true }if }if } }if { AGMCORE_name /HqnSpots /ProcSet findresource /TestSpot get exec not }{ gsave [/Separation AGMCORE_name /DeviceGray {}]setcolorspace copy known false currentpagedevice/SeparationColorNames 2 { not }{ get { AGMCORE_name eq or}forall pop pop pop true }ifelse grestore }ifelse }ifelse }ifelse }ifelse }def }ifelse /convert_to_process where {pop}{ /convert_to_process { dup length 0 eq { pop false }{ AGMCORE_host_sep { true exch { convert_spot_to_process and } forall }{ false exch { convert_spot_to_process or } forall }ifelse }ifelse }def } }ifelse AGMCORE_host_sep AGMCORE_will_host_separate not and { /AGMCORE_cur_err /AGMCORE_color_space_onhost_seps def AGMCORE_color_space_onhost_seps }if /AGMCORE_avoid_L2_sep_space version cvr 2012 lt level2 and AGMCORE_producing_seps not and def /AGMCORE_is_cmyk_sep AGMCORE_cyan_plate AGMCORE_magenta_plate or AGMCORE_yellow_plate or AGMCORE_black_plate or def /AGM_avoid_0_cmyk where{ pop AGM_avoid_0_cmyk }{ AGM_preserve_spots userdict/Adobe_AGM_OnHost_Seps known userdict/Adobe_AGM_InRip_Seps known or not and }ifelse { /setcmykcolor[ { 4 copy add add add 0 eq currentoverprint and{ pop 0.0005 }if }/exec cvx /AGMCORE_&setcmykcolor load dup type/operatortype ne{ /exec cvx }if ]cvx def }if AGMCORE_host_sep{ /AGMCORE_get_ink_data AGMCORE_cyan_plate{ {pop pop pop} }{ AGMCORE_magenta_plate{ {4 3 roll pop pop pop} }{ AGMCORE_yellow_plate{ {4 2 roll pop pop pop} }{ {4 1 roll pop pop pop} }ifelse }ifelse }ifelse def /clip AGMCORE_key_known not{ Adobe_AGM_Core/AGMCORE_&clip /clip load put /clip { current_spot_alias{ currentdict/InksUsed known{ [ InksUsed{ dup map_alias{ /Name get exch pop }if }forall ] /InksUsed xdf }if }if AGMCORE_&clip }def }if /eoclip AGMCORE_key_known not{ Adobe_AGM_Core/AGMCORE_&eoclip /eoclip load put /eoclip { current_spot_alias{ currentdict/InksUsed known{ [ InksUsed{ dup map_alias{ /Name get exch pop }if }forall ] /InksUsed xdf }if }if AGMCORE_&eoclip }def }if }if AGMCORE_in_rip_sep{ /setcustomcolor { exch aload pop dup 7 1 roll inRip_spot_has_ink not { 4 {4 index mul 4 1 roll} repeat /DeviceCMYK setcolorspace 6 -2 roll pop pop }{ Adobe_AGM_Core begin /AGMCORE_k xdf /AGMCORE_y xdf /AGMCORE_m xdf /AGMCORE_c xdf end [/Separation 4 -1 roll /DeviceCMYK {dup AGMCORE_c mul exch dup AGMCORE_m mul exch dup AGMCORE_y mul exch AGMCORE_k mul} ] setcolorspace }ifelse setcolor }ndf /setseparationgray { [/Separation (All) /DeviceGray {}] setcolorspace_opt 1 exch sub setcolor }ndf }{ /setseparationgray { AGMCORE_&setgray }ndf }ifelse /findcmykcustomcolor { 5 makereadonlyarray }ndf /setcustomcolor { exch aload pop pop 4 {4 index mul 4 1 roll} repeat setcmykcolor pop } }ndf /has_color /colorimage where{ AGMCORE_producing_seps{ }{ }{ d def pop true systemdict eq }ifelse false }ifelse /map_index { 1 index mul exch getinterval {255 div} forall } }def level2{ /mo /moveto ldf /li /lineto ldf /cv /curveto ldf /knockout_unitsq { 1 setgray 0 0 1 1 rectfill }def /level2ScreenFreq{ begin 60 HalftoneType 1 eq{ pop Frequency }if HalftoneType 2 eq{ pop GrayFrequency }if HalftoneType 5 eq{ pop Default level2ScreenFreq }if end }def /currentScreenFreq{ currenthalftone level2ScreenFreq }def l level2 /setcolorspace AGMCORE_key_known not and{ /AGMCORE_&&&setcolorspace /setcolorspace ldf /AGMCORE_ReplaceMappedColor { dup type dup /arraytype eq exch /packedarraytype eq or { dup 0 get dup /Separation eq { pop dup length array copy dup dup 1 get current_spot_alias { dup map_alias { begin /sep_colorspace_dict currentdict AGMCORE_gput pop pop [ p pop ] dup Name end /Separation Name CSA map_csa dup /MappedCSA xdf /sep_colorspace_proc load }{ }if }if map_reserved_ink_name 1 exch put }if }def /setcolorspace { dup type dup /arraytype eq exch /packedarraytype eq or { dup 0 get /Indexed eq { AGMCORE_distilling { /PhotoshopDuotoneList where { pop false }{ true }ifelse }{ true }ifelse { aload pop 3 -1 roll AGMCORE_ReplaceMappedColor 3 1 roll 4 array astore }if }{ AGMCORE_ReplaceMappedColor }ifelse }if AGMCORE_&&&setcolorspace }def /DeviceN eq { dup length array copy dup dup 1 get [ exch { current_spot_alias{ dup map_alias{ /Name get exch pop }if }if map_reserved_ink_name } forall ] 1 exch put }if }ifelse } }{ } }if /adj { }def /mo{ }def /li{ }def /cv{ currentstrokeadjust{ transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform }if adj moveto adj lineto 6 2 roll adj 6 2 roll adj 6 2 roll adj curveto }def /knockout_unitsq { 1 setgray 8 8 1 [8 0 0 8 0 0] {<ffffffffffffffff>} image }def /currentstrokeadjust{ /currentstrokeadjust AGMCORE_gget }def /setstrokeadjust{ /currentstrokeadjust exch AGMCORE_gput }def /currentScreenFreq{ currentscreen pop pop }def /setcolorspace { /currentcolorspace exch AGMCORE_gput } def /currentcolorspace { /currentcolorspace AGMCORE_gget } def /n_color_components { dup type /arraytype eq{ 0 get }if dup /DeviceGray eq{ pop 1 }{ /DeviceCMYK eq{ 4 }{ 3 }ifelse }ifelse } def /setcolor_devicecolor { dup type /arraytype eq{ 0 get }if dup /DeviceGray eq{ pop setgray }{ /DeviceCMYK eq{ setcmykcolor }{ setrgbcolor }ifelse }ifelse } }def /setcolor { currentcolorspace 0 get dup /DeviceGray ne{ dup /DeviceCMYK ne{ dup /DeviceRGB ne{ dup /Separation eq{ pop currentcolorspace 3 get exec currentcolorspace 2 get }{ dup /Indexed eq{ pop currentcolorspace 3 get dup type /stringtype eq{ currentcolorspace 1 get n_color_components 3 -1 roll map_index }{ exec }ifelse currentcolorspace 1 get }{ /AGMCORE_cur_err /AGMCORE_invalid_color_space def AGMCORE_invalid_color_space }ifelse }ifelse }if }if }if setcolor_devicecolor } def } }ifelse /sop /setoverprint ldf /lw /setlinewidth ldf /lc /setlinecap ldf /lj /setlinejoin ldf /ml /setmiterlimit ldf /dsh /setdash ldf /sadj /setstrokeadjust ldf /gry /setgray ldf /rgb /setrgbcolor ldf /cmyk /setcmykcolor ldf /sep /setsepcolor ldf /idx /setindexedcolor ldf /colr /setcolor ldf /csacrd /set_csa_crd ldf /sepcs /setsepcolorspace ldf /idxcs /setindexedcolorspace ldf /cp /closepath ldf /clp /clp_npth ldf /eclp /eoclp_npth ldf /spclp /stkpath_clp_npth ldf /f /fill ldf /ef /eofill ldf /s /stroke ldf /sclp /stk_n_clp_npth ldf /nclp /npth_clp ldf /gset /graphic_setup ldf / /gcln /graphic_cleanup ldf currentdict{ dup xcheck 1 index type dup /arraytype eq exch /packedarraytype eq or and { }if def }forall bind }def /page_trailer { end }def /doc_trailer{ }def systemdict /findcolorrendering known{ /findcolorrendering systemdict /findcolorrendering get def }if systemdict /setcolorrendering known{ /setcolorrendering systemdict /setcolorrendering get def }if /test_cmyk_color_plate { gsave setcmykcolor currentgray 1 ne grestore }def /inRip_spot_has_ink { dup Adobe_AGM_Core/AGMCORE_name xddf convert_spot_to_process not }def /current_ink { dup length 0 eq{ pop true }{ xddf Adobe_AGM_Core/ink_result false put { dup /ProcessCyan eq{ AGMCORE_cyan_plate ink_result or Adobe_AGM_Core/ink_result }{ dup /ProcessMagenta eq{ AGMCORE_magenta_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessYellow eq{ AGMCORE_yellow_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessBlack eq{ AGMCORE_black_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /sep_colorspace_dict AGMCORE_gget dup null eq{ pop false ink_result or Adobe_AGM_Core/ink_result xddf }{ /Name get eq{ 1 setsepcolor currentgray 1 ne ink_result or Adobe_AGM_Core/ink_result xddf }{ false ink_result or Adobe_AGM_Core/ink_result xddf }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse pop } forall ink_result }ifelse }def /map255_to_range { 1 index sub 3 -1 roll 255 div mul add }def /set_csa_crd { /sep_colorspace_dict null AGMCORE_gput begin CSA map_csa setcolorspace_opt set_crd end } def /setsepcolor { /sep_colorspace_dict AGMCORE_gget begin dup /sep_tint exch AGMCORE_gput TintProc end } def /sep_colorspace_proc { Adobe_AGM_Core/AGMCORE_tmp xddf /sep_colorspace_dict AGMCORE_gget begin currentdict/Components known{ Components aload pop TintMethod/Lab eq{ 2 {AGMCORE_tmp mul NComponents 1 roll} repeat LMax sub AGMCORE_tmp mul LMax add NComponents 1 roll }{ TintMethod/Subtractive eq{ NComponents{ AGMCORE_tmp mul NComponents 1 roll }repeat }{ NComponents{ 1 sub AGMCORE_tmp mul 1 add NComponents 1 roll } repeat }ifelse }ifelse }{ ColorLookup AGMCORE_tmp ColorLookup length 1 sub mul round cvi get aload pop }ifelse end } def /sep_colorspace_gray_proc { Adobe_AGM_Core/AGMCORE_tmp xddf /sep_colorspace_dict AGMCORE_gget begin GrayLookup AGMCORE_tmp GrayLookup length 1 sub mul round cvi get end } def /sep_proc_name { dup 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or level2 not and has_color not and{ pop [/DeviceGray] /sep_colorspace_gray_proc }{ /sep_colorspace_proc }ifelse } def /setsepcolorspace { current_spot_alias{ dup begin Name map_alias{ exch pop }if end }if dup /sep_colorspace_dict exch AGMCORE_gput begin /MappedCSA CSA map_csa def A Adobe_AGM_Core/AGMCORE_sep_special Name dup () eq exch (All) eq or ddf AGMCORE_avoid_L2_sep_space{ [/Indexed MappedCSA sep_proc_name 255 exch { 255 div } /exec cvx 3 -1 roll [ 4 1 roll load /exec cvx ] cvx ] setcolorspace_opt /TintProc { 255 mul round cvi setcolor }bdf }{ MappedCSA 0 get /DeviceCMYK eq currentdict/Components known and AGMCORE_sep_special not and{ /TintProc [ Components aload pop Name findcmykcustomcolor /exch cvx /setcustomcolor cvx ] cvx bdf }{ AGMCORE_host_sep Name (All) eq and{ /TintProc { 1 exch sub setseparationgray }bdf }{ AGMCORE_in_rip_sep MappedCSA 0 get /DeviceCMYK eq and AGMCORE_host_sep or Name () eq and{ /TintProc [ MappedCSA sep_proc_name exch 0 get /DeviceCMYK eq{ }{ cvx /setcmykcolor cvx cvx /setgray cvx }ifelse ] cvx bdf AGMCORE_producing_seps MappedCSA 0 get dup /DeviceCMYK eq exch /DeviceGray eq or and AGMCORE_sep_special not and{ /TintProc [ /dup cvx MappedCSA sep_proc_name cvx exch 0 get /DeviceGray eq{ 1 /exch cvx /sub cvx 0 0 0 4 -1 /roll cvx }if /Name cvx /findcmykcustomcolor cvx /exch c cvx AGMCORE_host_sep{ AGMCORE_is_cmyk_sep }{ Name inRip_spot_has_ink not }ifelse { /pop cvx 1 }if /setcustomcolor cvx ] cvx bdf }{ }{ / /TintProc /setcolor ldf [/Separation Name MappedCSA sep_proc_name load ] setcolorspace_opt } def /setindexedcolorspace { dup /indexed_colorspace_dict exch AGMCORE_gput begin /MappedCSA CSA map_csa def AGMCORE_host_sep level2 not and{ 0 0 0 0 setcmykcolor }{ [/Indexed MappedCSA level2 not has_color not and{ dup 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or{ pop [/DeviceGray] }if HiVal GrayLookup }{ HiVal currentdict/RangeArray known{ { /indexed_colorspace_dict AGMCORE_gget begin Lookup exch dup HiVal gt{ pop HiVal }if NComponents mul NComponents getinterval {} forall NComponents 1 sub -1 0{ RangeArray exch 2 mul 2 getinterval aload pop map255_to_range NComponents 1 roll }for end } bind }{ Lookup }ifelse }ifelse ] setcolorspace_opt set_crd }ifelse end }def /setindexedcolor { AGMCORE_host_sep{ }ifelse }ifelse }ifelse }ifelse }ifelse set_crd setsepcolor end /indexed_colorspace_dict AGMCORE_gget/Lookup get 4 3 -1 roll map_index setcmykcolor }{ setcolor }ifelse } def /ignoreimagedata { currentoverprint not{ gsave dup begin 1 setgray 0 0 ImageMatrix itransform Width Height ImageMatrix idtransform rectfill end grestore }if consumeimagedata }def /add_csa { Adobe_AGM_Core begin /AGMCORE_CSA_cache xput end }def /map_csa { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_CSA_cache get exch get }if }def /add_csd { Adobe_AGM_Core begin /AGMCORE_CSD_cache xput end }def /get_csd { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_CSD_cache get exch get }if }def /get_csd_by_name { dup type dup /nametype eq exch /stringtype eq or{ Adobe_AGM_Core begin /AGMCORE_CSD_Name xdf AGMCORE_CSD_cache { dup /Name get AGMCORE_CSD_Name eq { exch pop exit }{ pop }ifelse pop }forall end }if }def /cachepattern_level2 { 4 dict begin /comparebuffer exch def /holdbuffer exch def /readbuffer 1024 string def /LZWFilter holdbuffer /LZWEncode filter def { currentfile readbuffer readline not {pop exit} if dup LZWFilter exch writestring LZWFilter (\n) writestring comparebuffer eq {exit} if }loop LZWFilter closefile end }def /cachepattern_level3 { 3 dict begin /comparebuffer exch def /readbuffer 1024 string def /DoEOL false def { DoEOL { (\n) /DoEOL false def } { currentfile readbuffer readline not {pop ()} { dup length 0 eq { pop(\n)} { dup comparebuffer eq {pop ()} {/DoEOL true def} ifelse } ifelse } ifelse } ifelse } /ReusableStreamDecode filter end }def /add_pattern { Adobe_AGM_Core begin /AGMCORE_pattern_cache xput end }def /get_pattern { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_pattern_cache get exch get }if }def /make_pattern { dup matrix currentmatrix matrix concatmatrix 0 0 3 2 roll itransform exch 3 index /XStep get 1 index exch 2 copy div cvi mul sub sub exch 3 index /YStep get 1 index exch 2 copy div cvi mul sub sub matrix translate exch matrix concatmatrix makepattern }def /set_pattern { dup /PatternType get 1 eq{ dup /PaintType get 1 eq{ false sop [/DeviceGray] setcolorspace 0 setgray }if }if setpattern }def /setcolorspace_opt { dup currentcolorspace eq{ pop }{ setcolorspace }ifelse }def /updatecolorrendering { currentcolorrendering/Intent known{ currentcolorrendering/Intent get }{ null } }ifelse Intent ne{ false Intent AGMCORE_CRD_cache { exch pop begin dup Intent eq{ currentdict setcolorrendering_opt end e exch pop true exch exit }if end } forall pop not{ systemdict /findcolorrendering known{ Intent findcolorrendering pop }if }if /ColorRendering findresource dup length dict copy setcolorrendering_opt }if } def /add_crd { AGMCORE_CRD_cache 3 1 roll put }def /set_crd { AGMCORE_host_sep not level2 and{ currentdict/CRD known{ AGMCORE_CRD_cache CRD get dup null ne{ setcolorrendering_opt }{ pop }ifelse }{ currentdict/Intent known{ updatecolorrendering }if }ifelse }if }def /setcolorrendering_opt { dup currentcolorrendering eq{ pop }{ begin /Intent Intent def currentdict end setcolorrendering }ifelse }def /cdndf { exch dup currentdict exch known{ pop pop }{ exch def }ifelse }def /cpaint_gcomp { convert_to_process Adobe_AGM_Core/AGMCORE_ConvertToProcess xddf Adobe_AGM_Core/AGMCORE_ConvertToProcess get not { (%end_cpaint_gcomp) flushinput }if }def /cpaint_gsep { Adobe_AGM_Core/AGMCORE_ConvertToProcess get { }if (%end_cpaint_gsep) flushinput }def /cpaint_gend { newpath }def /AGMCORE_ctm_stack bdict /push_ctm { stack length size le{ stack dup length 2 mul array dup /stack exch def copy pop }if stack size 3 -1 roll put /size size 1 add def } /pop_ctm { /size size 1 sub def size 0 lt{ /size 0 def }if stack size get } /stack 1 array /size 0 edict def /save_ctm { matrix currentmatrix AGMCORE_ctm_stack begin push_ctm end }def /restore_ctm { AGMCORE_ctm_stack begin pop_ctm end setmatrix }def /path_rez { dup 0 ne{ AGMCORE_deviceDPI exch div dup 1 lt{ pop 1 }if setflat }{ pop } }ifelse }def /rdcmntline { currentfile AGMCORE_str256 readline pop (%) anchorsearch {pop} if } def /set_spot_alias_ary { /AGMCORE_SpotAliasAry where{ pop pop }{ Adobe_AGM_Core/AGMCORE_SpotAliasAry xddf true set_spot_alias }ifelse }def /set_spot_alias { /AGMCORE_SpotAliasAry where{ /AGMCORE_current_spot_alias 3 -1 roll put }{ pop }ifelse }def /current_spot_alias { /AGMCORE_SpotAliasAry where{ /AGMCORE_current_spot_alias get }{ false }ifelse }def /map_alias { /AGMCORE_SpotAliasAry where{ begin /AGMCORE_name xdf f false AGMCORE_SpotAliasAry{ dup/Name get AGMCORE_name eq{ save exch /Adobe_AGM_Core currentdict def /CSD get get_csd exch restore exch pop true exit }{ pop }ifelse }forall end }{ pop false }ifelse }bdf /spot_alias { t true set_spot_alias /AGMCORE_&setcustomcolor AGMCORE_key_known not { Adobe_AGM_Core/AGMCORE_&setcustomcolor /setcustomcolor load put } if / /customcolor_tint 1 AGMCORE_gput Adobe_AGM_Core begin /setcustomcolor { d dup /customcolor_tint exch AGMCORE_gput current_spot_alias{ 1 index 4 get map_alias{ mark 3 1 roll setsepcolorspace counttomark 0 ne{ setsepcolor }if pop pop }{ AGMCORE_&setcustomcolor }ifelse }{ AGMCORE_&setcustomcolor }ifelse }def /begin_feature { Adobe_AGM_Core/AGMCORE_feature_dictCount countdictstack put count Adobe_AGM_Core/AGMCORE_feature_opCount 3 -1 roll put {Adobe_AGM_Core/AGMCORE_feature_ctm matrix currentmatrix put}if }def /end_feature { 2 dict begin /spd /setpagedevice load def /setpagedevice { get_gstate spd set_gstate } def stopped{$error/newerror false put}if end count Adobe_AGM_Core/AGMCORE_feature_opCount get sub dup 0 gt{{pop}repeat} {pop}ifelse countdictstack Adobe_AGM_Core/AGMCORE_feature_dictCount get sub dup 0 gt{{end}repeat}{pop}ifelse {Adobe_AGM_Core/AGMCORE_feature_ctm get setmatrix}if }def /set_negative { Adobe_AGM_Core begin /AGMCORE_inverting exch def level2{ currentpagedevice/NegativePrint known{ currentpagedevice/NegativePrint get Adobe_AGM_Core/AGMCORE_inverting get ne{ true begin_feature true{ bdict /NegativePrint Adobe_AGM_Core/AGMCORE_inverting get edict setpagedevice }end_feature }if /AGMCORE_inverting false def }if }if AGMCORE_inverting{ [{1 exch sub}/exec load dup currenttransfer exch]cvx bind settransfer gsave newpath clippath 1 /setseparationgray where{pop setseparationgray}{setgray}ifelse }bdf end }def /lw_save_restore_override { /md where { pop md begin /pmSVsetup{} def /endp{}def /pse{}def /psb{}def /orig_showpage where {pop} {/orig_showpage /showpage load def} ifelse /showpage {orig_showpage gR} def end }if }def /pscript_showpage_override { /NTPSOct95 where { begin showpage save /showpage /restore load def /restore {exch pop}def end }if }def /driver_media_override { /md where { pop md /initializepage known { md /initializepage {} put } if md /rC known { md /rC {4{pop}repeat} put } if } }if Adobe_AGM_Core /AGMCORE_Default_CTM matrix currentmatrix put }def /driver_check_media_override { Adobe_AGM_Core /AGMCORE_Default_CTM get matrix currentmatrix ne { Adobe_AGM_Core /AGMCORE_Default_CTM get setmatrix }if }def AGMCORE_err_strings begin /AGMCORE_bad_environ (Environment not satisfactory for this job. Ensure that the PPD is correct or that the PostScript level requested is supported by this printer. ) def /AGMCORE_color_space_onhost_seps (This job contains colors that will not separate with on-host methods. ) def /AGMCORE_invalid_color_space (This job contains an invalid color space. ) def }if end fill grestore end end systemdict /setpacking known { setpacking } if %%EndResource %%BeginResource: procset Adobe_CoolType_Core 2.12 0 %%Copyright: Copyright 1997-2001 Adobe Systems Incorporated. All Rights Reserved. %%Version: 2.12 0 userdict/Adobe_CoolType_Core 60 dict dup begin put/Level2? systemdict /languagelevel known dup{pop systemdict/languagelevel get 2 ge}if def Level2? not{/currentglobal false def/setglobal/pop load def/gcheck{pop false}bind def /currentpacking false def/setpacking/pop load def/SharedFontDirectory 0 dict def}if currentpacking true setpacking/@_SaveStackLevels{Adobe_CoolType_Data begin @opStackCountByLevel @opStackLevel 2 copy known not{2 copy 3 dict dup /args 7 index 5 add array put put get}{get dup/args get dup length 3 index lt{ dup length 5 add array exch 1 index exch 0 exch putinterval 1 index exch/args exch put}{pop}ifelse}ifelse begin count 2 sub 1 index lt{pop count 1 sub}if dup/argCount exch def dup 0 gt{exch 1 index 2 add 1 roll args exch 0 exch getinterval astore pop}{pop}ifelse count 1 sub/restCount exch def end /@opStackLevel @opStackLevel 1 add def countdictstack 1 sub @dictStackCountByLevel exch @dictStackLevel exch put/@dictStackLevel @dictStackLevel 1 add def end}bind def/@_RestoreStackLevels{ Adobe_CoolType_Data begin/@opStackLevel @opStackLevel 1 sub def @opStackCountByLevel @opStackLevel get begin count restCount sub dup 0 gt{{pop }repeat}{pop}ifelse args 0 argCount getinterval{}forall end/@dictStackLevel @dictStackLevel 1 sub def @dictStackCountByLevel @dictStackLevel get end countdictstack exch sub dup 0 gt{{end}repeat}{pop}ifelse}bind def /@_PopStackLevels{Adobe_CoolType_Data begin/@opStackLevel @opStackLevel 1 sub def/@dictStackLevel @dictStackLevel 1 sub def end}bind def/@Raise{exch cvx exch errordict exch get exec stop}bind def/@ReRaise{cvx $error/errorname get errordict exch get exec stop}bind def/@Stopped{0 @#Stopped}bind def/@#Stopped{ @_SaveStackLevels stopped{@_RestoreStackLevels true}{@_PopStackLevels false} ifelse}bind def/@Arg{Adobe_CoolType_Data begin @opStackCountByLevel @opStackLevel 1 sub get/args get exch get end}bind def/doc_setup{ Adobe_CoolType_Core begin/mov/moveto load def/nfnt/newencodedfont load def /mfnt/makefont load def/sfnt/setfont load def/ufnt/undefinefont load def/chp /charpath load def/awsh/awidthshow load def/wsh/widthshow load def/ash/ashow load def/sh/show load def end userdict/Adobe_CoolType_Data 6 dict dup begin /AddWidths? false def/CC 0 def/charcode 2 string def/@opStackCountByLevel 32 dict def/@opStackLevel 0 def/@dictStackCountByLevel 32 dict def /@dictStackLevel 0 def end put}bind def/doc_trailer{currentdict Adobe_CoolType_Core eq{end}if}bind def/page_setup{Adobe_CoolType_Core begin} bind def/page_trailer{end}bind def/unload{systemdict/languagelevel known{ systemdict/languagelevel get 2 ge{userdict/Adobe_CoolType_Core 2 copy known{ undef}{pop pop}ifelse}if}if}bind def/ndf{1 index where{pop pop pop}{dup xcheck {bind}if def}ifelse}def/findfont dup systemdict begin userdict begin /globaldict where{/globaldict get begin}if dup where pop exch get/globaldict where{pop end}if end end def/systemfindfont/findfont load def/undefinefont{pop }ndf/copyfont{currentglobal 3 1 roll 1 index gcheck setglobal dup null eq{0}{ dup length}ifelse 2 index length add 1 add dict begin exch{1 index/FID eq{pop pop}{def}ifelse}forall dup null eq{pop}{{def}forall}ifelse currentdict end exch setglobal}bind def/copyarray{currentglobal exch dup gcheck setglobal dup length array copy exch setglobal}bind def/newencodedfont{currentglobal{ SharedFontDirectory 3 index known{SharedFontDirectory 3 index get /FontReferenced known}{false}ifelse}{FontDirectory 3 index known{FontDirectory 3 index get/FontReferenced known}{SharedFontDirectory 3 index known{ SharedFontDirectory 3 index get/FontReferenced known}{false}ifelse}ifelse} ifelse dup{3 index findfont/FontReferenced get 2 index findfont ne{pop false} if}if{pop 1 index findfont/Encoding get exch 0 1 255{2 copy get 3 index 3 1 roll put}for pop pop pop}{findfont dup dup maxlength 2 add dict begin exch{1 index/FID ne{def}{pop pop}ifelse}forall/FontReferenced exch def/Encoding exch dup length array copy def/FontName 1 index dup type/stringtype eq{cvn}if def currentdict end definefont pop}ifelse}bind def/SetSubstituteStrategy{ $SubstituteFont begin dup type/dicttype ne{0 dict}if currentdict/$Strategies known{exch $Strategies exch 2 copy known{get 2 copy maxlength exch maxlength add dict begin{def}forall{def}forall currentdict dup/$Init known{dup/$Init get exec}if end/$Strategy exch def}{pop pop pop}ifelse}{pop pop}ifelse end}bind def/scff{$SubstituteFont begin dup type/stringtype eq{dup length exch}{null} ifelse/$sname exch def/$slen exch def end{findfont}@Stopped{dup length dup 21 add string dup 4 3 roll 0 exch 128 string cvs putinterval exch 1 index exch (_was-malformed-so-was)putinterval cvn{findfont}@Stopped{pop/Courier findfont} if}if $SubstituteFont begin/$sname null def/$slen 0 def end}bind def /isWidthsOnlyFont{dup/WidthsOnly known{pop pop true}{dup/FDepVector known{ /FDepVector get{isWidthsOnlyFont dup{exit}if}forall}{dup/FDArray known{ /FDArray get{isWidthsOnlyFont dup{exit}if}forall}{pop}ifelse}ifelse}ifelse} bind def/?set{$SubstituteFont begin/$substituteFound false def/$fontname 4 index def/$doSmartSub false def end 3 index findfont $SubstituteFont begin $substituteFound{false}{dup/FontName known{dup/FontName get $fontname eq 1 index/DistillerFauxFont known not and/currentdistillerparams where{pop false 2 index isWidthsOnlyFont not and}if}{false}ifelse}ifelse exch pop/$doSmartSub true def end{exch pop exch pop exch 2 dict dup/Found 3 index put exch findfont exch}{exch exec exch findfont 2 dict dup/Downloaded 6 5 roll put}ifelse dup /FontName 4 index put copyfont definefont pop}bind def/?str1 256 string def /?str2 256 string def/?add{1 index type/integertype eq{exch true 4 2}{false 3 1}ifelse roll 1 index findfont dup/Widths known{Adobe_CoolType_Data/AddWidths? true put gsave dup 1000 scalefont setfont}if/Downloaded known{exec exch{exch ?str2 cvs exch findfont/Downloaded get 1 dict begin/Downloaded 1 index def ?str1 cvs length ?str1 1 index 1 add 3 index putinterval exch length 1 add 1 index add ?str1 2 index(*)putinterval ?str1 0 2 index getinterval cvn findfont ?str1 3 index(+)putinterval 2 dict dup/FontName ?str1 0 6 index getinterval cvn put dup/Downloaded Downloaded put end copyfont dup/FontName get exch definefont pop pop pop}{pop}ifelse}{pop exch{findfont dup/Found get dup length exch ?str1 cvs pop ?str1 1 index(+)putinterval ?str1 1 index 1 add 4 index ?str2 cvs putinterval ?str1 exch 0 exch 5 4 roll ?str2 cvs length 1 add add getinterval cvn 1 dict exch 1 index exch/FontName exch put copyfont dup /FontName get exch definefont pop}{pop}ifelse}ifelse Adobe_CoolType_Data /AddWidths? get{grestore Adobe_CoolType_Data/AddWidths? false put}if}bind def /?sh{currentfont/Downloaded known{exch}if pop}bind def/?chp{currentfont /Downloaded known{pop}{false chp}ifelse}bind def/?mv{currentfont/Downloaded known{moveto pop pop}{pop pop moveto}ifelse}bind def setpacking userdict /$SubstituteFont 25 dict put 1 dict begin/SubstituteFont dup $error exch 2 copy known{get}{pop pop{pop/Courier}bind}ifelse def/currentdistillerparams where dup{pop pop currentdistillerparams/CannotEmbedFontPolicy 2 copy known{ get/Error eq}{pop pop false}ifelse}if not{countdictstack array dictstack 0 get begin userdict begin $SubstituteFont begin/$str 128 string def/$fontpat 128 string def/$slen 0 def/$sname null def/$match false def/$fontname null def /$substituteFound false def/$doSmartSub true def/$depth 0 def/$fontname null def/$italicangle 26.5 def/$dstack null def/$Strategies 10 dict dup begin /$Type3Underprint{currentglobal exch false setglobal 11 dict begin/UseFont exch $WMode 0 ne{dup length dict copy dup/WMode $WMode put/UseFont exch definefont}if def/FontName $fontname dup type/stringtype eq{cvn}if def /FontType 3 def/FontMatrix[.001 0 0 .001 0 0]def/Encoding 256 array dup 0 1 255{/.notdef put dup}for pop def/FontBBox[0 0 0 0]def/CCInfo 7 dict dup begin /cc null def/x 0 def/y 0 def end def/BuildChar{exch begin CCInfo begin 1 string dup 0 3 index put exch pop/cc exch def UseFont 1000 scalefont setfont cc stringwidth/y exch def/x exch def x y setcharwidth $SubstituteFont /$Strategy get/$Underprint get exec 0 0 moveto cc show x y moveto end end}bind def currentdict end exch setglobal}bind def/$GetaTint 2 dict dup begin /$BuildFont{dup/WMode known{dup/WMode get}{0}ifelse/$WMode exch def $fontname exch dup/FontName known{dup/FontName get dup type/stringtype eq{cvn}if}{ /unnamedfont}ifelse exch $deepcopyfont exch 1 index exch/FontBasedOn exch put dup/FontName $fontname dup type/stringtype eq{cvn}if put definefont}bind def /$Underprint{gsave x abs y abs gt{/y 1000 def}{/x -1000 def 500 120 translate} ifelse Level2?{[/Separation(All)/DeviceCMYK{0 0 0 1 pop}]setcolorspace}{0 setgray}ifelse 10 setlinewidth x .8 mul[7 3]{y mul 8 div 120 sub x 10 div exch moveto 0 y 4 div neg rlineto dup 0 rlineto 0 y 4 div rlineto closepath gsave Level2?{.2 setcolor}{.8 setgray}ifelse fill grestore stroke}forall pop grestore}bind def end def/$Oblique 1 dict dup begin/$BuildFont{currentglobal exch dup gcheck setglobal null copyfont begin/FontBasedOn currentdict/FontName known{FontName dup type/stringtype eq{cvn}if}{/unnamedfont}ifelse def/FontName $fontname dup type/stringtype eq{cvn}if def/currentdistillerparams where{pop}{ /FontInfo currentdict/FontInfo known{FontInfo null copyfont}{2 dict}ifelse dup begin/ItalicAngle $italicangle def/FontMatrix FontMatrix[1 0 ItalicAngle dup sin exch cos div 1 0 0]matrix concatmatrix readonly end 4 2 roll def def} ifelse FontName currentdict end definefont exch setglobal}bind def end def /$None 1 dict dup begin/$BuildFont{}bind def end def end def/$Oblique SetSubstituteStrategy/$findfontByEnum{dup type/stringtype eq{cvn}if dup /$fontname exch def $sname null eq{$str cvs dup length $slen sub $slen getinterval}{pop $sname}ifelse $fontpat dup 0(fonts/*)putinterval exch 7 exch putinterval/$match false def $SubstituteFont/$dstack countdictstack array dictstack put mark{$fontpat 0 $slen 7 add getinterval{/$match exch def exit} $str filenameforall}stopped{cleardictstack currentdict true $SubstituteFont /$dstack get{exch{1 index eq{pop false}{true}ifelse}{begin false}ifelse}forall pop}if cleartomark/$slen 0 def $match false ne{$match(fonts/)anchorsearch pop pop cvn}{/Courier}ifelse}bind def/$ROS 1 dict dup begin/Adobe 4 dict dup begin /Japan1[/Ryumin-Light/HeiseiMin-W3/GothicBBB-Medium/HeiseiKakuGo-W5 /HeiseiMaruGo-W4/Jun101-Light]def/Korea1[/HYSMyeongJo-Medium/HYGoThic-Medium] def/GB1[/STSong-Light/STHeiti-Regular]def/CNS1[/MKai-Medium/MHei-Medium]def end def end def/$cmapname null def/$deepcopyfont{dup/FontType get 0 eq{1 dict dup/FontName/copied put copyfont begin/FDepVector FDepVector copyarray 0 1 2 index length 1 sub{2 copy get $deepcopyfont dup/FontName/copied put/copied exch definefont 3 copy put pop pop}for def currentdict end}{$Strategies /$Type3Underprint get exec}ifelse}bind def/$buildfontname{length $str 1 index (-)putinterval 1 add $str 1 index $cmapname $fontpat cvs putinterval $cmapname length add $str exch 0 exch getinterval cvn}bind def/$findfontByROS{/$fontname exch def $ROS Registry 2 copy known{get Ordering 2 copy known{get}{pop pop[]} ifelse}{pop pop[]}ifelse false exch{dup/CIDFont resourcestatus{pop pop save 1 index/CIDFont findresource dup/WidthsOnly known{dup/WidthsOnly get}{false} ifelse exch pop exch restore{pop}{exch pop true exit}ifelse}{pop}ifelse}forall {$str cvs $buildfontname}{false(*){save exch dup/CIDFont findresource dup /WidthsOnly known{dup/WidthsOnly get not}{true}ifelse exch/CIDSystemInfo get dup/Registry get Registry eq exch/Ordering get Ordering eq and and{exch restore exch pop true exit}{pop restore}ifelse}$str/CIDFont resourceforall{ $buildfontname}{$fontname $findfontByEnum}ifelse}ifelse}bind def end end currentdict/$error known currentdict/languagelevel known and dup{pop $error /SubstituteFont known}if dup{$error}{Adobe_CoolType_Core}ifelse begin{ /SubstituteFont/CMap/Category resourcestatus{pop pop{$SubstituteFont begin /$substituteFound true def dup length $slen gt $sname null ne or $slen 0 gt and{$sname null eq{dup $str cvs dup length $slen sub $slen getinterval cvn}{ $sname}ifelse dup/CMap resourcestatus{pop pop dup/$cmapname exch def/CMap findresource/CIDSystemInfo get{def}forall $findfontByROS}{128 string cvs dup (-)search{3 1 roll search{3 1 roll pop{dup cvi}stopped{pop pop pop pop pop $findfontByEnum}{4 2 roll pop pop exch length exch 2 index length 2 index sub exch 1 sub -1 0{$str cvs dup length 4 index 0 4 index 4 3 roll add getinterval exch 1 index exch 3 index exch putinterval dup/CMap resourcestatus{pop pop 4 1 roll pop pop pop dup/$cmapname exch def/CMap findresource/CIDSystemInfo get{ def}forall $findfontByROS true exit}{pop}ifelse}for dup type/booleantype eq{ pop}{pop pop $findfontByEnum}ifelse}ifelse}{pop pop pop $findfontByEnum}ifelse }{pop pop $findfontByEnum}ifelse}ifelse}{//SubstituteFont exec}ifelse/$slen 0 def end}}{{$SubstituteFont begin/$substituteFound true def dup length $slen gt $sname null ne or $slen 0 gt and{$findfontByEnum}{//SubstituteFont exec}ifelse end}}ifelse bind readonly def Adobe_CoolType_Core/scfindfont/systemfindfont load put}{/scfindfont{$SubstituteFont begin dup systemfindfont dup/FontName known{dup/FontName get dup 3 index ne}{/noname true}ifelse dup{ /$origfontnamefound 2 index def/$origfontname 4 index def/$substituteFound true def}if exch pop{$slen 0 gt $sname null ne 3 index length $slen gt or and{ pop dup $findfontByEnum findfont dup maxlength 1 add dict begin{1 index/FID eq {pop pop}{def}ifelse}forall currentdict end definefont dup/FontName known{dup /FontName get}{null}ifelse $origfontnamefound ne{$origfontname $str cvs print ( substitution revised, using )print dup/FontName known{dup/FontName get}{ (unspecified font)}ifelse $str cvs print(. )print}if}{exch pop}ifelse}{exch pop}ifelse end}bind def}ifelse end end Adobe_CoolType_Core/findfont{$SubstituteFont begin $depth 0 eq{/$fontname 1 index dup type/stringtype ne{$str cvs}if def/$substituteFound false def}if /$depth $depth 1 add def end scfindfont $SubstituteFont begin/$depth $depth 1 sub def $substituteFound $depth 0 eq and $doSmartSub and{currentdict/$Strategy known{$Strategy/$BuildFont get exec}if}if end}bind put}if end end %%EndResource %%BeginResource: procset Adobe_CoolType_Utility_MAKEOCF 1.13 0 %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. %%Version: 1.13 0 systemdict/languagelevel known dup{currentglobal false setglobal}{false}ifelse exch userdict/Adobe_CoolType_Utility 2 copy known{2 copy get dup maxlength 25 add dict copy}{25 dict}ifelse put Adobe_CoolType_Utility begin/ct_Level2? exch def/ct_Clone? 1183615869 internaldict dup/CCRun known not exch/eCCRun known not ct_Level2? and or def/ct_UseNativeCapability? systemdict/composefont known def/ct_MakeOCF 35 dict def/ct_Vars 25 dict def/ct_GlyphDirProcs 6 dict def /ct_BuildCharDict 15 dict dup begin/charcode 2 string def/dst_string 1500 string def/nullstring()def/usewidths? true def end def ct_Level2?{setglobal}{ pop}ifelse ct_GlyphDirProcs begin/GetGlyphDirectory{systemdict/languagelevel known{pop/CIDFont findresource/GlyphDirectory get}{1 index/CIDFont findresource/GlyphDirectory get dup type/dicttype eq{dup dup maxlength exch length sub 2 index lt{dup length 2 index add dict copy 2 index/CIDFont findresource/GlyphDirectory 2 index put}if}if exch pop exch pop}ifelse +}def/+ {systemdict/languagelevel known{currentglobal false setglobal 3 dict begin/vm exch def}{1 dict begin}ifelse/$ exch def systemdict/languagelevel known{vm setglobal/gvm currentglobal def $ gcheck setglobal}if ?{$ begin}if}def/?{$ type/dicttype eq}def/|{userdict/Adobe_CoolType_Data known{Adobe_CoolType_Data /AddWidths? known{currentdict Adobe_CoolType_Data begin begin AddWidths?{ Adobe_CoolType_Data/CC 3 index put ?{def}{$ 3 1 roll put}ifelse CC charcode exch 1 index 0 2 index 256 idiv put 1 index exch 1 exch 256 mod put stringwidth 2 array astore currentfont/Widths get exch CC exch put}{?{def}{$ 3 1 roll put}ifelse}ifelse end end}{?{def}{$ 3 1 roll put}ifelse}ifelse}{?{def}{ $ 3 1 roll put}ifelse}ifelse}def/!{?{end}if systemdict/languagelevel known{gvm setglobal}if end}def/:{string currentfile exch readstring pop}executeonly def end ct_MakeOCF begin/ct_cHexEncoding[/c00/c01/c02/c03/c04/c05/c06/c07/c08/c09 /c0A/c0B/c0C/c0D/c0E/c0F/c10/c11/c12/c13/c14/c15/c16/c17/c18/c19/c1A/c1B/c1C /c1D/c1E/c1F/c20/c21/c22/c23/c24/c25/c26/c27/c28/c29/c2A/c2B/c2C/c2D/c2E/c2F /c30/c31/c32/c33/c34/c35/c36/c37/c38/c39/c3A/c3B/c3C/c3D/c3E/c3F/c40/c41/c42 /c43/c44/c45/c46/c47/c48/c49/c4A/c4B/c4C/c4D/c4E/c4F/c50/c51/c52/c53/c54/c55 /c56/c57/c58/c59/c5A/c5B/c5C/c5D/c5E/c5F/c60/c61/c62/c63/c64/c65/c66/c67/c68 /c69/c6A/c6B/c6C/c6D/c6E/c6F/c70/c71/c72/c73/c74/c75/c76/c77/c78/c79/c7A/c7B /c7C/c7D/c7E/c7F/c80/c81/c82/c83/c84/c85/c86/c87/c88/c89/c8A/c8B/c8C/c8D/c8E /c8F/c90/c91/c92/c93/c94/c95/c96/c97/c98/c99/c9A/c9B/c9C/c9D/c9E/c9F/cA0/cA1 /cA2/cA3/cA4/cA5/cA6/cA7/cA8/cA9/cAA/cAB/cAC/cAD/cAE/cAF/cB0/cB1/cB2/cB3/cB4 /cB5/cB6/cB7/cB8/cB9/cBA/cBB/cBC/cBD/cBE/cBF/cC0/cC1/cC2/cC3/cC4/cC5/cC6/cC7 /cC8/cC9/cCA/cCB/cCC/cCD/cCE/cCF/cD0/cD1/cD2/cD3/cD4/cD5/cD6/cD7/cD8/cD9/cDA /cDB/cDC/cDD/cDE/cDF/cE0/cE1/cE2/cE3/cE4/cE5/cE6/cE7/cE8/cE9/cEA/cEB/cEC/cED /cEE/cEF/cF0/cF1/cF2/cF3/cF4/cF5/cF6/cF7/cF8/cF9/cFA/cFB/cFC/cFD/cFE/cFF]def /ct_CID_STR_SIZE 8000 def/ct_mkocfStr100 100 string def/ct_defaultFontMtx[.001 0 0 .001 0 0]def/ct_1000Mtx[1000 0 0 1000 0 0]def/ct_raise{exch cvx exch errordict exch get exec stop}bind def/ct_reraise{cvx $error/errorname get (Error: )print dup( )cvs print errordict exch get exec stop }bind def/ct_cvnsi{1 index add 1 sub 1 exch 0 4 1 roll{2 index exch get exch 8 bitshift add}for exch pop}bind def/ct_GetInterval{Adobe_CoolType_Utility /ct_BuildCharDict get begin/dst_index 0 def dup dst_string length gt{dup string/dst_string exch def}if 1 index ct_CID_STR_SIZE idiv/arrayIndex exch def 2 index arrayIndex get 2 index arrayIndex ct_CID_STR_SIZE mul sub{dup 3 index add 2 index length le{2 index getinterval dst_string dst_index 2 index putinterval length dst_index add/dst_index exch def exit}{1 index length 1 index sub dup 4 1 roll getinterval dst_string dst_index 2 index putinterval pop dup dst_index add/dst_index exch def sub/arrayIndex arrayIndex 1 add def 2 index dup length arrayIndex gt{arrayIndex get}{pop exit}ifelse 0}ifelse}loop pop pop pop dst_string 0 dst_index getinterval end}bind def ct_Level2?{ /ct_resourcestatus currentglobal mark true setglobal{/unknowninstancename /Category resourcestatus}stopped{cleartomark setglobal true}{cleartomark currentglobal not exch setglobal}ifelse{{mark 3 1 roll/Category findresource begin ct_Vars/vm currentglobal put({ResourceStatus} stopped)0()/SubFileDecode filter cvx exec{cleartomark false}{{3 2 roll pop true}{cleartomark false} ifelse}ifelse ct_Vars/vm get setglobal end}}{{resourcestatus}}ifelse bind def /CIDFont/Category ct_resourcestatus{pop pop}{currentglobal true setglobal /Generic/Category findresource dup length dict copy dup/InstanceType/dicttype put/CIDFont exch/Category defineresource pop setglobal}ifelse ct_UseNativeCapability?{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering(Identity) def/Supplement 0 def end def/CMapName/Identity-H def/CMapVersion 1 def /CMapType 1 def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end}if}{/ct_Category 2 dict begin/CIDFont 10 dict def /ProcSet 2 dict def currentdict end def/defineresource{ct_Category 1 index 2 copy known{get dup dup maxlength exch length eq{dup length 10 add dict copy ct_Category 2 index 2 index put}if 3 index 3 index put pop exch pop}{pop pop /defineresource/undefined ct_raise}ifelse}bind def/findresource{ct_Category 1 index 2 copy known{get 2 index 2 copy known{get 3 1 roll pop pop}{pop pop /findresource/undefinedresource ct_raise}ifelse}{pop pop/findresource /undefined ct_raise}ifelse}bind def/resourcestatus{ct_Category 1 index 2 copy known{get 2 index known exch pop exch pop{0 -1 true}{false}ifelse}{pop pop /findresource/undefined ct_raise}ifelse}bind def/ct_resourcestatus /resourcestatus load def}ifelse/ct_CIDInit 2 dict begin/ct_cidfont_stream_init {{dup(Binary)eq{pop null currentfile ct_Level2?{{cid_BYTE_COUNT() /SubFileDecode filter}stopped{pop pop pop}if}if/readstring load exit}if dup (Hex)eq{pop currentfile ct_Level2?{{null exch/ASCIIHexDecode filter/readstring }stopped{pop exch pop(>)exch/readhexstring}if}{(>)exch/readhexstring}ifelse load exit}if/StartData/typecheck ct_raise}loop cid_BYTE_COUNT ct_CID_STR_SIZE le{2 copy cid_BYTE_COUNT string exch exec pop 1 array dup 3 -1 roll 0 exch put }{cid_BYTE_COUNT ct_CID_STR_SIZE div ceiling cvi dup array exch 2 sub 0 exch 1 exch{2 copy 5 index ct_CID_STR_SIZE string 6 index exec pop put pop}for 2 index cid_BYTE_COUNT ct_CID_STR_SIZE mod string 3 index exec pop 1 index exch 1 index length 1 sub exch put}ifelse cid_CIDFONT exch/GlyphData exch put 2 index null eq{pop pop pop}{pop/readstring load 1 string exch{3 copy exec pop dup length 0 eq{pop pop pop pop pop true exit}if 4 index eq{pop pop pop pop false exit}if}loop pop}ifelse}bind def/StartData{mark{currentdict dup/FDArray get 0 get/FontMatrix get 0 get .001 eq{dup/CDevProc known not{/CDevProc 1183615869 internaldict/stdCDevProc 2 copy known{get}{pop pop{pop pop pop pop pop 0 -1000 7 index 2 div 880}}ifelse def}if}{/CDevProc{pop pop pop pop pop 0 1 cid_temp/cid_CIDFONT get/FDArray get 0 get/FontMatrix get 0 get div 7 index 2 div 1 index .88 mul}def}ifelse/cid_temp 15 dict def cid_temp begin /cid_CIDFONT exch def 3 copy pop dup/cid_BYTE_COUNT exch def 0 gt{ ct_cidfont_stream_init FDArray{/Private get dup/SubrMapOffset known{begin /Subrs SubrCount array def Subrs SubrMapOffset SubrCount SDBytes ct_Level2?{ currentdict dup/SubrMapOffset undef dup/SubrCount undef/SDBytes undef}if end /cid_SD_BYTES exch def/cid_SUBR_COUNT exch def/cid_SUBR_MAP_OFFSET exch def /cid_SUBRS exch def cid_SUBR_COUNT 0 gt{GlyphData cid_SUBR_MAP_OFFSET cid_SD_BYTES ct_GetInterval 0 cid_SD_BYTES ct_cvnsi 0 1 cid_SUBR_COUNT 1 sub{ exch 1 index 1 add cid_SD_BYTES mul cid_SUBR_MAP_OFFSET add GlyphData exch cid_SD_BYTES ct_GetInterval 0 cid_SD_BYTES ct_cvnsi cid_SUBRS 4 2 roll GlyphData exch 4 index 1 index sub ct_GetInterval dup length string copy put} for pop}if}{pop}ifelse}forall}if cleartomark pop pop end CIDFontName currentdict/CIDFont defineresource pop end end}stopped{cleartomark/StartData ct_reraise}if}bind def currentdict end def/ct_saveCIDInit{/CIDInit/ProcSet ct_resourcestatus{true}{/CIDInitC/ProcSet ct_resourcestatus}ifelse{pop pop /CIDInit/ProcSet findresource ct_UseNativeCapability?{pop null}{/CIDInit ct_CIDInit/ProcSet defineresource pop}ifelse}{/CIDInit ct_CIDInit/ProcSet defineresource pop null}ifelse ct_Vars exch/ct_oldCIDInit exch put}bind def /ct_restoreCIDInit{ct_Vars/ct_oldCIDInit get dup null ne{/CIDInit exch/ProcSet defineresource pop}{pop}ifelse}bind def/ct_BuildCharSetUp{1 index begin CIDFont begin Adobe_CoolType_Utility/ct_BuildCharDict get begin/ct_dfCharCode exch def/ct_dfDict exch def CIDFirstByte ct_dfCharCode add dup CIDCount ge{pop 0}if/cid exch def{GlyphDirectory cid 2 copy known{get}{pop pop nullstring} ifelse dup length FDBytes sub 0 gt{dup FDBytes 0 ne{0 FDBytes ct_cvnsi}{pop 0} ifelse/fdIndex exch def dup length FDBytes sub FDBytes exch getinterval /charstring exch def exit}{pop cid 0 eq{/charstring nullstring def exit}if/cid 0 def}ifelse}loop}def/ct_SetCacheDevice{0 0 moveto dup stringwidth 3 -1 roll true charpath pathbbox 0 -1000 7 index 2 div 880 setcachedevice2 0 0 moveto} def/ct_CloneSetCacheProc{1 eq{stringwidth pop -2 div -880 0 -1000 setcharwidth moveto}{usewidths?{currentfont/Widths get cid 2 copy known{get exch pop aload pop}{pop pop stringwidth}ifelse}{stringwidth}ifelse setcharwidth 0 0 moveto} ifelse}def/ct_Type3ShowCharString{ct_FDDict fdIndex 2 copy known{get}{ currentglobal 3 1 roll 1 index gcheck setglobal ct_Type1FontTemplate dup maxlength dict copy begin FDArray fdIndex get dup/FontMatrix 2 copy known{get} {pop pop ct_defaultFontMtx}ifelse/FontMatrix exch dup length array copy def /Private get/Private exch def/Widths rootfont/Widths get def/CharStrings 1 dict dup/.notdef<d841272cf18f54fc13>dup length string copy put def currentdict end/ct_Type1Font exch definefont dup 5 1 roll put setglobal}ifelse dup /CharStrings get 1 index/Encoding get ct_dfCharCode get charstring put rootfont/WMode 2 copy known{get}{pop pop 0}ifelse exch 1000 scalefont setfont ct_str1 0 ct_dfCharCode put ct_str1 exch ct_dfSetCacheProc ct_SyntheticBold{ currentpoint ct_str1 show newpath moveto ct_str1 true charpath ct_StrokeWidth setlinewidth stroke}{ct_str1 show}ifelse}def/ct_Type4ShowCharString{ct_dfDict ct_dfCharCode charstring FDArray fdIndex get dup/FontMatrix get dup ct_defaultFontMtx ct_matrixeq not{ct_1000Mtx matrix concatmatrix concat}{pop} ifelse/Private get Adobe_CoolType_Utility/ct_Level2? get not{ct_dfDict/Private 3 -1 roll{put}1183615869 internaldict/superexec get exec}if 1183615869 internaldict Adobe_CoolType_Utility/ct_Level2? get{1 index}{3 index/Private get mark 6 1 roll}ifelse dup/RunInt known{/RunInt get}{pop/CCRun}ifelse get exec Adobe_CoolType_Utility/ct_Level2? get not{cleartomark}if}bind def /ct_BuildCharIncremental{{Adobe_CoolType_Utility/ct_MakeOCF get begin ct_BuildCharSetUp ct_ShowCharString}stopped{stop}if end end end end}bind def /BaseFontNameStr(BF00)def/ct_Type1FontTemplate 14 dict begin/FontType 1 def /FontMatrix[.001 0 0 .001 0 0]def/FontBBox[-250 -250 1250 1250]def/Encoding ct_cHexEncoding def/PaintType 0 def currentdict end def/BaseFontTemplate 11 dict begin/FontMatrix[.001 0 0 .001 0 0]def/FontBBox[-250 -250 1250 1250]def /Encoding ct_cHexEncoding def/BuildChar/ct_BuildCharIncremental load def ct_Clone?{/FontType 3 def/ct_ShowCharString/ct_Type3ShowCharString load def /ct_dfSetCacheProc/ct_CloneSetCacheProc load def/ct_SyntheticBold false def /ct_StrokeWidth 1 def}{/FontType 4 def/Private 1 dict dup/lenIV 4 put def /CharStrings 1 dict dup/.notdef<d841272cf18f54fc13>put def/PaintType 0 def /ct_ShowCharString/ct_Type4ShowCharString load def}ifelse/ct_str1 1 string def currentdict end def/BaseFontDictSize BaseFontTemplate length 5 add def /ct_matrixeq{true 0 1 5{dup 4 index exch get exch 3 index exch get eq and dup not{exit}if}for exch pop exch pop}bind def/ct_makeocf{15 dict begin exch/WMode exch def exch/FontName exch def/FontType 0 def/FMapType 2 def/FontMatrix matrix def/bfCount 1 index/CIDCount get 256 idiv 1 add dup 256 gt{pop 256}if def/Encoding 256 array 0 1 bfCount 1 sub{2 copy dup put pop}for bfCount 1 255{ 2 copy bfCount put pop}for def/FDepVector bfCount dup 256 lt{1 add}if array def BaseFontTemplate BaseFontDictSize dict copy begin/CIDFont exch def CIDFont /FontBBox known{CIDFont/FontBBox get/FontBBox exch def}if CIDFont/CDevProc known{CIDFont/CDevProc get/CDevProc exch def}if currentdict end BaseFontNameStr 3(0)putinterval 0 1 bfCount dup 256 eq{1 sub}if{FDepVector exch 2 index BaseFontDictSize dict copy begin dup/CIDFirstByte exch 256 mul def FontType 3 eq{/ct_FDDict 2 dict def}if currentdict end 1 index 16 BaseFontNameStr 2 2 getinterval cvrs pop BaseFontNameStr exch definefont put} for ct_Clone?{/Widths 1 index/CIDFont get/GlyphDirectory get length dict def} if FontName currentdict end definefont ct_Clone?{gsave dup 1000 scalefont setfont ct_BuildCharDict begin/usewidths? false def currentfont/Widths get begin exch/CIDFont get/GlyphDirectory get{pop dup charcode exch 1 index 0 2 index 256 idiv put 1 index exch 1 exch 256 mod put stringwidth 2 array astore def}forall end/usewidths? true def end grestore}{exch pop}ifelse}bind def /ct_ComposeFont{ct_UseNativeCapability?{2 index/CMap ct_resourcestatus{pop pop exch pop}{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CMapName 3 index def/CMapVersion 1 def/CMapType 1 def exch/WMode exch def/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering CMapName ct_mkocfStr100 cvs (Adobe-)search{pop pop(-)search{dup length string copy exch pop exch pop}{pop (Identity)}ifelse}{pop(Identity)}ifelse def/Supplement 0 def end def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end} ifelse composefont}{3 2 roll pop 0 get/CIDFont findresource ct_makeocf}ifelse} bind def/ct_MakeIdentity{ct_UseNativeCapability?{1 index/CMap ct_resourcestatus{pop pop}{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CMapName 2 index def/CMapVersion 1 def/CMapType 1 def/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering CMapName ct_mkocfStr100 cvs (Adobe-)search{pop pop(-)search{dup length string copy exch pop exch pop}{pop (Identity)}ifelse}{pop(Identity)}ifelse def/Supplement 0 def end def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end} ifelse composefont}{exch pop 0 get/CIDFont findresource ct_makeocf}ifelse}bind def currentdict readonly pop end end %%EndResource Adobe_CoolType_Core begin /$Oblique SetSubstituteStrategy end %%BeginResource: procset Adobe_AGM_Image 1.0 0 %%Version: 1.0 0 %%Copyright: Copyright (C) 2000-2000 Adobe Systems, Inc. All Rights Reserved. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Image 65 dict dup begin put /Adobe_AGM_Image_Id /Adobe_AGM_Image_1.0_0 def /nd{ null def }bind def /AGMIMG_&image nd /AGMIMG_&colorimage nd %%don't initialize AGMIMG_&customcolorimage, it wrecks havoc in a nested environment %%AGMIMG_ccimage_exists not {/AGMIMG_&customcolorimage nd} if /AGMIMG_&imagemask nd /AGMIMG_mbuf () def /AGMIMG_ybuf () def /AGMIMG_kbuf () def /AGMIMG_c 0 def /AGMIMG_m 0 def /AGMIMG_y 0 def /AGMIMG_k 0 def /AGMIMG_tmp nd /AGMIMG_imagestring0 nd /AGMIMG_imagestring1 nd /AGMIMG_imagestring2 nd /AGMIMG_imagestring3 nd /AGMIMG_imagestring4 nd /AGMIMG_imagestring5 nd /AGMIMG_cnt nd /AGMIMG_fsave nd /AGMIMG_colorAry nd /AGMIMG_override nd /AGMIMG_name nd /invert_image_samples nd /knockout_image_samples nd /img nd /sepimg nd /idximg nd /doc_setup { Adobe_AGM_Core begin Adobe_AGM_Image begin /AGMIMG_&image systemdict/image get def /AGMIMG_&imagemask systemdict/imagemask get def /colorimage where{ pop /AGMIMG_&colorimage /colorimage ldf }if end end }def /page_setup { Adobe_AGM_Image begin /AGMIMG_ccimage_exists {/customcolorimage where { pop /Adobe_AGM_OnHost_Seps where { pop false }{ /Adobe_AGM_InRip_Seps where { pop false }{ true and{ }bdf level2{ /invert_image_samples { Adobe_AGM_Image/AGMIMG_tmp Decode length ddf /Decode [ Decode 1 get Decode 0 get] def }def /knockout_image_samples { Operator/imagemask ne{ /Decode [1 1] def }if }def } }{ /invert_image_samples { {1 exch sub} currenttransfer addprocs settransfer }def /knockout_image_samples { { pop 1 } currenttransfer addprocs settransfer }def }ifelse /img /imageormask ldf /sepimg /sep_imageormask ldf /idximg /indexed_imageormask ldf currentdict{ dup xcheck 1 index type dup /arraytype eq exch /packedarraytype eq or }if def }forall bind }ifelse }ifelse }{ false }ifelse }def /page_trailer { end }def /doc_trailer { }def /imageormask_sys { begin save mark level2{ currentdict Operator /imagemask eq{ AGMIMG_&imagemask }{ AGMIMG_&image }ifelse }{ Width Height Operator /imagemask eq{ Decode 0 get 1 eq Decode 1 get 0 eq and ImageMatrix /DataSource load AGMIMG_&imagemask }{ BitsPerComponent ImageMatrix /DataSource load AGMIMG_&image }ifelse }ifelse cleartomark restore end }def /overprint_plate { currentoverprint{ 0 get dup /DeviceGray eq{ pop AGMCORE_black_plate not }{ /DeviceCMYK eq{ AGMCORE_is_cmyk_sep not }if }ifelse }{ false }ifelse }def /imageormask { begin SkipImageProc not{ save mark level2 AGMCORE_host_sep not and{ currentdict Operator /imagemask eq{ imagemask }{ AGMCORE_in_rip_sep currentoverprint and currentcolorspace 0 get /DeviceGray eq and{ [/Separation /Black /DeviceGray {}] setcolorspace /Decode [ Decode 1 get Decode 0 get ] def }if image }ifelse }{ Width Height Operator /imagemask eq{ Decode 0 get 1 eq Decode 1 get 0 eq and ImageMatrix /DataSource load AGMCORE_host_sep{ currentgray 1 ne{ currentdict imageormask_sys }{ currentoverprint not{ 1 AGMCORE_&setgray knockout_image_samples currentdict imageormask_sys }{ }{ }{ currentdict ignoreimagedata }ifelse }ifelse imagemask }ifelse BitsPerComponent ImageMatrix MultipleDataSources{ 0 1 NComponents 1 sub{ DataSource exch get }for }{ /DataSource load }ifelse Operator /colorimage eq{ AGMCORE_host_sep{ MultipleDataSources level2 or NComponents MultipleDataSources{ 4 {pop} repeat /DataSource [ DataSource 0 get /exec DataSource 1 get /exec DataSource 2 get /exec DataSource 3 get /exec /AGMCORE_get_ink_data }{ filter_cmyk 0 () /SubFileDecode filter def ] cvx def /DataSource /DataSource load } }ifelse ] def /Decode [ Decode 0 get Decode 1 get /MultipleDataSources false def /NComponents 1 def /Operator /image def AGMCORE_is_cmyk_sep{ currentoverprint InksUsed currentdict }{ invert_image_samples 1 AGMCORE_&setgray currentdict 4 eq and{ cvx cvx cvx cvx cvx current_ink not and{ consumeimagedata imageormask_sys }{ ignoreimagedata }{ }ifelse currentdict }ifelse MultipleDataSources NComponents A AGMIMG_&colorimage }{ }{ }ifelse true NComponents colorimage }ifelse Operator /image eq{ AGMCORE_host_sep{ /DoImage true def HostSepColorImage{ invert_image_samples }{ AGMCORE_black_plate not{ /DoImage false def currentdict }if }ifelse 1 AGMCORE_&setgray DoImage {currentdict imageormask_sys} }{ }{ image }ifelse Operator/knockout eq{ pop pop pop pop pop currentoverprint InksUsed }{ overprint_plate not{ }if }ifelse }if }ifelse }ifelse }ifelse }ifelse cleartomark restore end }if }def /sep_imageormask { /sep_colorspace_dict AGMCORE_gget begin /MappedCSA CSA map_csa def begin SkipImageProc not{ s save mark AGMCORE_avoid_L2_sep_space{ /Decode [ Decode 0 get 255 mul Decode 1 get 255 mul ] def }if AGMIMG_ccimage_exists } currentcolorspace knockout_unitsq ignoreimagedata if current_ink not and{ MappedCSA 0 get /DeviceCMYK eq and currentdict/Components known and Name () ne and Name (All) ne and Operator /image eq and AGMCORE_producing_seps not and level2 not and { Width Height BitsPerComponent ImageMatrix [ /DataSource load /exec cvx { 0 1 2 index length 1 sub{ 1 index exch 2 copy get 255 xor put }for } /exec cvx ] cvx bind MappedCSA 0 get /DeviceCMYK eq{ Components aload pop }{ 0 0 0 Components aload pop 1 exch sub }ifelse Name findcmykcustomcolor customcolorimage }{ AGMCORE_producing_seps not{ level2{ AGMCORE_avoid_L2_sep_space not currentcolorspace 0 get /Separation ne and{ [/Separation Name MappedCSA sep_proc_name exch 0 get exch load ] setcolorspace_opt /sep_tint AGMCORE_gget setcolor }if currentdict imageormask }{ currentdict Operator /imagemask eq{ imageormask }{ sep_imageormask_lev1 }ifelse }ifelse }{ AGMCORE_host_sep{ Operator/knockout eq{ currentoverprint InksUsed current_ink not and{ }{ currentdict/ImageMatrix get concat knockout_unitsq }ifelse }{ currentgray 1 ne{ AGMCORE_is_cmyk_sep Name (All) ne and{ level2{ [ /Separation Name [/DeviceGray] { sep_colorspace_proc AGMCORE_get_ink_data AGMCORE_&setcolor }{ 1 exch sub } bind ] AGMCORE_&setcolorspace /sep_tint AGMCORE_gget currentdict imageormask_sys }{ currentdict Operator /imagemask eq{ imageormask_sys }{ sep_image_lev1_sep }ifelse }ifelse }{ Operator/imagemask ne{ invert_image_samples }if currentdict imageormask_sys }ifelse currentdict consumeimagedata currentoverprint not Name (All) eq or{ gsave knockout_unitsq grestore }if }ifelse }ifelse currentcolorspace 0 get /Separation ne{ [/Separation Name MappedCSA sep_proc_name exch 0 get exch load ] setcolorspace_opt /sep_tint AGMCORE_gget setcolor }if currentoverprint MappedCSA 0 get /DeviceCMYK eq and Name inRip_spot_has_ink not and Name (All) ne and { imageormask_l2_overprint }{ currentdict imageormask }ifelse }ifelse }ifelse }ifelse cleartomark restore }if end end }def /imageormask_l2_overprint { currentdict currentcmykcolor add add add 0 eq{ currentdict consumeimagedata }{ }{ l level3{ currentcmykcolor /AGMIMG_k xdf /AGMIMG_y xdf /AGMIMG_m xdf /AGMIMG_c xdf Operator/imagemask eq{ [/DeviceN [ AGMIMG_c 0 ne {/Cyan} if AGMIMG_m 0 ne {/Magenta} if AGMIMG_y 0 ne {/Yellow} if AGMIMG_k 0 ne {/Black} if ] /DeviceCMYK {}] setcolorspace AGMIMG_c AGMIMG_m AGMIMG_y AGMIMG_k s setcolor } }{ 0 0 0 0 ne ne ne ne {AGMIMG_c} {AGMIMG_m} {AGMIMG_y} {AGMIMG_k} if if if if mul Decode 1 get 255 mul ] def /Decode [ Decode 0 get 255 [ [/Indexed [ /DeviceN [ AGMIMG_c AGMIMG_m AGMIMG_y AGMIMG_k ] /DeviceCMYK { AGMIMG_k AGMIMG_y AGMIMG_m A AGMIMG_c ] 255 { } 0 0 0 0 0 0 0 0 ne ne ne ne eq eq eq eq {/Cyan} if {/Magenta} if {/Yellow} if {/Black} if {0} if {0 exch} if {0 3 1 roll} if {0 4 1 roll} if 2 255 div mark exch dup d dup dup AGMIMG_k 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 1 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_y 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 2 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_m 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 3 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_c 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec pop pop pop s counttomark 1 roll }{ pop }ifelse counttomark 1 add -1 roll pop } ] setcolorspace }ifelse } imageormask_sys }{ write_image_file{ currentcmykcolor 0 ne{ [/Separation /Black /DeviceGray {}] setcolorspace gsave /Black [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 1 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Yellow /DeviceGray {}] setcolorspace gsave /Yellow [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 2 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Magenta /DeviceGray {}] setcolorspace gsave /Magenta [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 3 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Cyan /DeviceGray {}] setcolorspace gsave /Cyan [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore } if close_image_file }{ imageormask }ifelse }ifelse }ifelse } def /indexed_imageormask { begin s save mark currentdict AGMCORE_host_sep{ Operator/knockout eq{ /indexed_colorspace_dict AGMCORE_gget /CSA get map_csa overprint_plate not{ knockout_unitsq }if }{ AGMCORE_is_cmyk_sep{ Operator /imagemask eq{ imageormask_sys }{ level2{ indexed_image_lev2_sep }{ indexed_image_lev1_sep }ifelse }ifelse }{ currentoverprint not{ knockout_image_samples imageormask_sys }{ currentdict consumeimagedata }ifelse }ifelse }ifelse }{ level2{ imageormask }{ Operator /imagemask eq{ imageormask }{ indexed_imageormask_lev1 }ifelse }ifelse }ifelse end cleartomark restore }def /indexed_image_lev2_sep { /indexed_colorspace_dict AGMCORE_gget begin b begin currentcolorspace dup 1 /DeviceGray put dup 3 [ currentcolorspace 3 get { exch 4 mul 4 getinterval {} forall AGMCORE_get_ink_data 255 div 1 exch sub } /exec cvx ] cvx put s setcolorspace currentdict Operator /imagemask eq{ AGMIMG_&imagemask }{ AGMIMG_&image } }ifelse end end }def /OPIimage { dup type /dicttype ne{ 10 dict begin /DataSource xdf /ImageMatrix xdf /BitsPerComponent xdf /Height xdf /Width xdf /ImageType 1 def /Decode [0 1 def] currentdict end }if dup begin /NComponents 1 cdndf /MultipleDataSources false cdndf /SkipImageProc {false} cdndf /HostSepColorImage false cdndf /Decode [ 0 currentcolorspace 0 get /Indexed eq{ 2 BitsPerComponent exp 1 sub }{ 1 }ifelse ] cdndf /Operator /image cdndf end /sep_colorspace_dict AGMCORE_gget null eq{ imageormask }{ gsave dup begin invert_image_samples end sep_imageormask grestore }ifelse }def /spot_alias { /mapto_sep_imageormask { dup type /dicttype ne{ 12 dict begin /ImageType 1 def /DataSource xdf /ImageMatrix xdf /BitsPerComponent xdf /Height xdf /Width xdf /MultipleDataSources false def }{ begin }ifelse /Decode [/customcolor_tint AGMCORE_gget 0] def /Operator /image def /HostSepColorImage false def /InksUsed [] def /SkipImageProc {false} def currentdict end sep_imageormask }bdf /customcolorimage { Adobe_AGM_Image/AGMIMG_colorAry xddf /customcolor_tint AGMCORE_gget bdict /Name AGMIMG_colorAry 4 get /CSA [ /DeviceCMYK ] /TintMethod /Subtractive /TintProc null /MappedCSA null /NComponents 4 /Components [ AGMIMG_colorAry aload pop pop ] edict setsepcolorspace mapto_sep_imageormask }ndf Adobe_AGM_Image/AGMIMG_&customcolorimage /customcolorimage load put /customcolorimage { Adobe_AGM_Image/AGMIMG_override false put dup 4 get map_alias{ /customcolor_tint AGMCORE_gget exch setsepcolorspace pop mapto_sep_imageormask }{ AGMIMG_&customcolorimage } }ifelse }bdf }def level2 not{ /colorbuf { 0 1 2 index length 1 sub{ dup 2 index exch get 255 exch sub 2 index 3 1 roll put }for }def /tint_image_to_color { begin Width Height BitsPerComponent ImageMatrix /DataSource load end Adobe_AGM_Image begin /AGMIMG_mbuf 0 string def /AGMIMG_ybuf 0 string def /AGMIMG_kbuf 0 string def { colorbuf dup length AGMIMG_mbuf length ne { dup length dup dup /AGMIMG_mbuf exch string def /AGMIMG_ybuf exch string def /AGMIMG_kbuf exch string def } if dup AGMIMG_mbuf copy AGMIMG_ybuf copy AGMIMG_kbuf copy pop } addprocs { {AGMIMG_mbuf}{AGMIMG_ybuf}{AGMIMG_kbuf} true 4 colorimage end } def /sep_imageormask_lev1 { begin MappedCSA 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or h has_color not and{ { 255 mul round cvi GrayLookup exch get } currenttransfer addprocs settransfer currentdict imageormask /sep_colorspace_dict AGMCORE_gget/Components known{ MappedCSA 0 get /DeviceCMYK eq{ Components aload pop }{ 0 0 0 Components aload pop 1 exch sub } }ifelse Adobe_AGM_Image/AGMIMG_k Adobe_AGM_Image/AGMIMG_y Adobe_AGM_Image/AGMIMG_m Adobe_AGM_Image/AGMIMG_c xddf xddf xddf xddf }{ AGMIMG_y 0.0 eq AGMIMG_m 0.0 eq and AGMIMG_c 0.0 eq and{ addprocs settransfer } }{ currentcolortransfer {AGMIMG_k mul 1 exch sub} exch addprocs 4 1 roll roll roll roll {AGMIMG_y mul 1 exch sub} exch addprocs 4 1 {AGMIMG_m mul 1 exch sub} exch addprocs 4 1 {AGMIMG_c mul 1 exch sub} exch addprocs 4 1 setcolortransfer currentdict tint_image_to_color }ifelse } }{ MappedCSA 0 get /DeviceGray eq { {255 mul round cvi ColorLookup exch get 0 currenttransfer addprocs settransfer currentdict imageormask }{ MappedCSA 0 get /DeviceCMYK eq { currentcolortransfer {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll setcolortransfer currentdict tint_image_to_color }{ currentcolortransfer {pop 1} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll setcolortransfer currentdict tint_image_to_color }ifelse }ifelse }ifelse }ifelse end }def /sep_image_lev1_sep { begin A get} {AGMIMG_k mul 1 exch sub} currenttransfer currentdict imageormask get 3 get 2 get 1 get 0 get 2 get 1 get 0 /sep_colorspace_dict AGMCORE_gget/Components known{ C Components aload pop Adobe_AGM_Image/AGMIMG_k Adobe_AGM_Image/AGMIMG_y Adobe_AGM_Image/AGMIMG_m A Adobe_AGM_Image/AGMIMG_c {AGMIMG_c {AGMIMG_m {AGMIMG_y {AGMIMG_k }{ {255 {255 {255 {255 }ifelse } mul mul mul mul mul mul mul mul round round round round 1 1 1 1 exch exch exch exch cvi cvi cvi cvi sub} sub} sub} sub} exch exch exch exch get get get get 0 1 2 3 get get get get 1 1 1 1 exch exch exch exch sub} sub} sub} sub} xddf xddf xddf xddf ColorLookup ColorLookup ColorLookup ColorLookup A AGMCORE_get_ink_data currenttransfer addprocs settransfer c currentdict imageormask_sys end }def /indexed_imageormask_lev1 { /indexed_colorspace_dict AGMCORE_gget begin begin currentdict MappedCSA 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or has_color not and{ h {HiVal mul round cvi GrayLookup exch get HiVal div} currenttransfer addprocs settransfer imageormask } }{ MappedCSA 0 get /DeviceGray eq { {HiVal mul round cvi Lookup exch get HiVal div} addprocs settransfer imageormask }{ MappedCSA 0 get /DeviceCMYK eq { currentcolortransfer {4 mul HiVal mul round cvi 3 add Lookup exch exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi 2 add Lookup exch exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi 1 add Lookup exch exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi Lookup exch exch sub} exch addprocs 4 1 roll setcolortransfer tint_image_to_color }{ currentcolortransfer {pop 1} exch addprocs 4 1 roll {3 mul HiVal mul round cvi 2 add Lookup exch currenttransfer get HiVal div 1 get HiVal div 1 get HiVal div 1 get HiVal div 1 get HiVal div} exch addprocs 4 1 roll {3 mul HiVal mul round cvi get HiVal div} exch addprocs 4 1 roll {3 mul HiVal mul round cvi HiVal div} exch addprocs 4 1 roll setcolortransfer tint_image_to_color }ifelse }ifelse }ifelse end end }def /indexed_image_lev1_sep { /indexed_colorspace_dict AGMCORE_gget begin begin {4 mul HiVal mul round cvi Lookup exch sub} {4 mul HiVal mul round cvi 1 add Lookup exch sub} {4 mul HiVal mul round cvi 2 add Lookup exch sub} {4 mul HiVal mul round cvi 3 add Lookup exch s sub} 1 add Lookup exch Lookup exch get get HiVal div 1 exch get HiVal div 1 exch get HiVal div 1 exch get HiVal div 1 exch A AGMCORE_get_ink_data currenttransfer addprocs settransfer c currentdict imageormask_sys end end }if end systemdict /setpacking known { setpacking } if %%EndResource %ADOBeginClientInjection: DocumentProlog End "AI10" %ADOEndClientInjection: DocumentProlog End "AI10" currentdict Adobe_AGM_Utils eq {end} if %%EndProlog %%BeginSetup %ADOBeginClientInjection: DocumentSetup Start "AI10" %ADOEndClientInjection: DocumentSetup Start "AI10" Adobe_AGM_Utils begin 2 2010 true Adobe_AGM_Core/doc_setup get exec Adobe_CoolType_Core/doc_setup get exec Adobe_AGM_Image/doc_setup get exec %ADOBeginClientInjection: DocumentSetup End "AI10" %ADOEndClientInjection: DocumentSetup End "AI10" currentdict Adobe_AGM_Utils eq {end} if %%EndSetup %%Page: Untitled-1 1 %%EndPageComments %%BeginPageSetup %ADOBeginClientInjection: PageSetup Start "AI10" %ADOEndClientInjection: PageSetup Start "AI10" Adobe_AGM_Utils begin }def Adobe_AGM_Core/page_setup get exec Adobe_CoolType_Core/page_setup get exec Adobe_AGM_Image/page_setup get exec %ADOBeginClientInjection: PageSetup End "AI10" %ADOEndClientInjection: PageSetup End "AI10" %%EndPageSetup Adobe_AGM_Core/AGMCORE_save save ddf 1 -1 scale 0 -318.237 translate [1 0 0 1 0 0 ] concat mark /0 [/DeviceGray] add_csa /CSA /0 /1 [/DeviceCMYK] add_csa /CSA /1 /2 [/DeviceRGB] add_csa /CSA /2 cleartomark 800 path_rez % page clip gsave newpath gsave % PSGState 0 0 mo 0 318.237 li 523.475 318.237 li 523.475 0 li clp [1 0 0 1 0 0 ] concat %ADOBeginClientInjection: BeginPageContent "AI10" %ADOEndClientInjection: BeginPageContent "AI10" gsave % PSGState 0 0 mo 523 0 li 523 318 li 0 318 li 0 0 li clp 69.4707 .375488 mo 57.8599 .375488 48.4419 8.2251 48.4419 17.9067 cv 48.4419 27.5889 57.8599 35.4307 69.4707 35.4307 cv 81.0894 35.4307 90.5 27.5889 90.5 17.9067 cv 90.5 8.2251 81.0894 .375488 69.4707 .375488 cv false sop 0 0 0 0 cmyk ef .751123 lw 1 lc 1 lj 10 ml [] 0 dsh true sadj 69.4707 .375488 mo 57.8599 .375488 48.4419 8.2251 48.4419 17.9067 cv 48.4419 27.5889 57.8599 35.4307 69.4707 35.4307 cv 81.0894 35.4307 90.5 27.5889 90.5 17.9067 cv 90.5 8.2251 81.0894 .375488 69.4707 .375488 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk %ADOBeginSubsetFont: ArialMT Initial 11 dict begin /FontName /ArialMT def /FontMatrix [1 1000 div 0 0 1 1000 div 0 0 ] def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for /PaintType 0 def /FontType 1 def /FontBBox { 0 0 0 0 } def /FontInfo 1 dict dup begin /OrigFontType /TrueType def end readonly def currentdict e end systemdict begin dup /Private 7 dict dup begin /BlueValues [-15 0 600 650] def /MinFeature {16 16} def /password 5839 def /ND {def} def /NP {put} def /RD {string currentfile exch readhexstring pop} def 2 index /CharStrings 1320 dict dup begin /.notdef <10bf317005b6d50bd3b903bc9f60e6e804630266f839393d56ae50a85fbe ffec110deebde9f8a007323688ac> ND /A <10bf3170789bec1ccf5fb017e1dd1362ac54cb2fa3a278c1c5e8b8e0184d 7cbeaa35d4ddaa02f35f83f589e53f609414a1e8dd86a2916a5d28875546 282a3c313b2605b04804> ND end end put put dup /FontName get exch definefont pop end /ArialMT findfont /Encoding get dup 65 /A put pop %ADOEndSubsetFont /ArialMT*1 [ 65{/.notdef}repeat /A 190{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 63.5225 24.7124 mov (A) sh 21.4043 132.573 mo 9.79346 132.573 .375488 140.423 .375488 150.104 cv .375488 159.787 9.79346 167.628 21.4043 167.628 cv 33.0229 167.628 42.4336 159.787 42.4336 150.104 cv 42.4336 140.423 33.0229 132.573 21.4043 132.573 cv 0 0 0 0 cmyk ef 21.4043 132.573 mo 9.79346 132.573 .375488 140.423 .375488 150.104 cv def .375488 159.787 9.79346 167.628 21.4043 167.628 cv 33.0229 167.628 42.4336 159.787 42.4336 150.104 cv 42.4336 140.423 33.0229 132.573 21.4043 132.573 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /B <10bf317026ba62063ac1fc9b1b7e78ffd02405a6073c267edcf7d4772d8b d58886357b255f6a34ffdb28ea7dd3bcde9e8d86152df16bbf95464b3da5 81a80241ab3a15cb834fac879964bca12ae45a2346542b45e7f82e769dc6 0e9db083a82e08534c9f6f82aa9d811f6505bf0b1bb832cbb587ac8320f0 ae1ae42aea897a566c4e8001af359257dc731487787c0d93ef9b2f1ed840 41901425e5e82bd0ae3793e0dd4c50ff12905ccd193e1ae08c7b651a3ee6 9ac2a8d60e0001b1e2cb724d65cbbbc80d6c9cf4edb8b286a76ac8c6d7e6 c234df3f063f1d91> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 66 /B put pop %ADOEndSubsetFont /ArialMT*1 [ 65{/.notdef}repeat /A /B 189{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 15.4561 156.91 mov (B) sh 129.554 60.4653 mo 117.943 60.4653 108.525 68.3149 108.525 77.9966 cv 108.525 87.6787 117.943 95.5205 129.554 95.5205 cv 141.173 95.5205 150.583 87.6787 150.583 77.9966 cv 150.583 68.3149 141.173 60.4653 129.554 60.4653 cv 0 0 0 0 cmyk ef 129.554 60.4653 mo 117.943 60.4653 108.525 68.3149 108.525 77.9966 cv 108.525 87.6787 117.943 95.5205 129.554 95.5205 cv 141.173 95.5205 150.583 87.6787 150.583 77.9966 cv 150.583 68.3149 141.173 60.4653 129.554 60.4653 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /C <10bf31704fab892742fc2c6be78329c0825c84c392f40122153ca9a91165 96e2ea405597ca7f292098a14c92b8766b957d29536d6a74922bce6efa67 d7fa67d47a8ae997e897ea42f1e923c09a3ad5b1aa2186622859ef03a213 f7c26727c45c24d289e1bf8fa6a719352242839e565e8af9cb5c48758232 20530e01b09cb28b590a86024fb341940ed5d19a7e036981d38ceef64334 a577636f4f149330a371e1> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 67 /C put pop %ADOEndSubsetFont /ArialMT*1 [ 65{/.notdef}repeat /A /B /C 188{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 123.125 84.8022 mov (C) sh 93.5044 132.573 mo 81.8931 132.573 72.4751 140.423 72.4751 150.104 cv 72.4751 159.787 81.8931 167.628 93.5044 167.628 cv 105.123 167.628 114.533 159.787 114.533 150.104 cv 114.533 140.423 105.123 132.573 93.5044 132.573 cv 0 0 0 0 cmyk ef 93.5044 132.573 mo 81.8931 132.573 72.4751 140.423 72.4751 150.104 cv 72.4751 159.787 81.8931 167.628 93.5044 167.628 cv 105.123 167.628 114.533 159.787 114.533 150.104 cv 114.533 140.423 105.123 132.573 93.5044 132.573 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /D <10bf31702a859cc72343fc5a00cbe95321e18bb8a769a7bb762c302002c9 2b982836fa4260fe2a0c8ce27d8958937313533c8e6b2532aa8f3c2ccda0 580c74d4a11a4bc549192867065c4c563d8e65b752154cdb3b974ad93d22 39c345160f109954785d974e06de814d5117d5cceba690e455cf1260fe1e 56dd78848498e3603eee9eb4dfbe5866301d46b163af11b944ec34affd> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 68 /D put pop %ADOEndSubsetFont /ArialMT*1 [ 65{/.notdef}repeat /A /B /C /D 187{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 87.0752 156.91 mov (D) sh 93.5044 210.69 mo 81.8931 210.69 72.4751 218.547 72.4751 228.221 cv 72.4751 237.911 81.8931 245.752 93.5044 245.752 cv 105.13 245.752 114.533 237.911 114.533 228.221 cv 114.533 218.547 105.13 210.69 93.5044 210.69 cv 0 0 0 0 cmyk ef 93.5044 210.69 mo 81.8931 210.69 72.4751 218.547 72.4751 228.221 cv 72.4751 237.911 81.8931 245.752 93.5044 245.752 cv 105.13 245.752 114.533 237.911 114.533 228.221 cv 114.533 218.547 105.13 210.69 93.5044 210.69 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /E <10bf317028198094ce8cd275e305c79a7a258ddd928bd9dc896c51a549b4 869242612fc9caa06c2483d03d9996ef> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 69 /E put pop %ADOEndSubsetFont /ArialMT*1 [ 65{/.notdef}repeat /A /B /C /D /E 186{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 87.5562 235.027 mov (E) sh 129.554 282.798 mo 117.943 282.798 108.525 290.655 108.525 300.33 cv 108.525 310.019 117.943 317.861 129.554 317.861 cv 141.18 317.861 150.583 310.019 150.583 300.33 cv 150.583 290.655 141.18 282.798 129.554 282.798 cv 0 0 0 0 cmyk ef 129.554 282.798 mo 117.943 282.798 108.525 290.655 108.525 300.33 cv 108.525 310.019 117.943 317.861 129.554 317.861 cv 141.18 317.861 150.583 310.019 150.583 300.33 cv 150.583 290.655 141.18 282.798 129.554 282.798 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /F <10bf31702f7c4b31b7f92f61f70a9032d1addef58c81f5b8fed9651d8c00 81acb06eda84b504e7> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 70 /F put pop %ADOEndSubsetFont /ArialMT*1 [ 65{/.notdef}repeat /A /B /C /D /E /F 185{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 124.086 307.134 mov (F) sh 54.9385 30.4131 mo 23.312 127.932 li 23.2446 128.127 23.0342 128.232 22.8389 128.172 cv 22.6362 128.104 22.5308 127.894 22.5986 127.699 cv 54.2246 30.1802 li 54.2852 29.9849 54.4951 29.8799 54.6978 29.9399 cv 54.8931 30.0073 54.9985 30.2178 54.9385 30.4131 cv cp 26.1211 127.789 mo 21.4043 132.573 li 20.4058 125.934 li 26.1211 127.789 li 0 0 0 1 cmyk f .12018 lw 0 lc 2 lj 54.9385 30.4131 mo 23.312 127.932 li 23.2446 128.127 23.0342 128.232 22.8389 128.172 cv 22.6362 128.104 22.5308 127.894 22.5986 127.699 cv 54.2246 30.1802 li 54.2852 29.9849 54.4951 29.8799 54.6978 29.9399 cv 54.8931 30.0073 54.9985 30.2178 54.9385 30.4131 cv cp 26.1211 127.789 mo 21.4043 132.573 li 20.4058 125.934 li 26.1211 127.789 li cp 0 0 0 1 cmyk s 84.6567 30.0527 mo 111.687 61.5547 li 111.822 61.7124 111.799 61.9526 111.649 62.0879 cv 111.492 62.2231 111.251 62.2007 111.116 62.043 cv 84.0859 30.541 li 83.9512 30.3833 83.9658 30.1504 84.1235 30.0151 cv 84.2813 29.8799 84.522 29.895 84.6567 30.0527 cv cp 113.031 59.0835 mo 114.661 65.603 li 108.472 62.9971 li 113.031 59.0835 li 0 0 0 1 cmyk f 84.6567 30.0527 mo 111.687 61.5547 li 111.822 61.7124 111.799 61.9526 111.649 62.0879 cv 111.492 62.2231 111.251 62.2007 111.116 62.043 cv 84.0859 30.541 li 83.9512 30.3833 83.9658 30.1504 84.1235 30.0151 cv 84.2813 29.8799 84.522 29.895 84.6567 30.0527 cv cp 113.031 59.0835 mo 114.661 65.603 li 108.472 62.9971 li 113.031 59.0835 li cp 0 0 0 1 cmyk s 114.999 90.5557 mo 96.0879 128.27 li 95.9976 128.457 95.7725 128.532 95.5845 128.435 cv 95.397 128.345 95.3218 128.119 95.4194 127.932 cv 114.323 90.2178 li 114.42 90.0371 114.646 89.9624 114.833 90.0522 cv 115.014 90.1426 115.089 90.3755 114.999 90.5557 cv cp 98.8892 128.555 mo 93.5044 132.573 li 93.519 125.858 li 98.8892 128.555 li 0 0 0 1 cmyk f 114.999 90.5557 mo 96.0879 128.27 li 95.9976 128.457 95.7725 128.532 95.5845 128.435 cv 95.397 128.345 95.3218 128.119 95.4194 127.932 cv 114.323 90.2178 li 114.42 90.0371 114.646 89.9624 114.833 90.0522 cv 115.014 90.1426 115.089 90.3755 114.999 90.5557 cv cp 98.8892 128.555 mo 93.5044 132.573 li 93.519 125.858 li 98.8892 128.555 li cp 0 0 0 1 cmyk s 36.6055 162.273 mo 75.7944 211.667 li 75.9297 211.832 75.8999 212.073 75.7344 212.208 cv 75.5693 212.328 75.3442 212.297 75.209 212.147 cv 36.0195 162.739 li 35.8843 162.574 35.9146 162.333 36.0796 162.212 cv 36.23 162.078 36.4702 162.108 36.6055 162.273 cv cp 77.2368 209.249 mo 78.6187 215.828 li 72.5352 212.989 li 77.2368 209.249 li 0 0 0 1 cmyk f 36.6055 162.273 mo 75.7944 211.667 li 75.9297 211.832 75.8999 212.073 75.7344 212.208 cv 75.5693 212.328 75.3442 212.297 75.209 212.147 cv 36.0195 162.739 li 35.8843 162.574 35.9146 162.333 36.0796 162.212 cv 36.23 162.078 36.4702 162.108 36.6055 162.273 cv cp 77.2368 209.249 mo 78.6187 215.828 li 72.5352 212.989 li 77.2368 209.249 li cp 0 0 0 1 cmyk s 93.8799 167.636 mo 93.8799 205.688 li 93.8799 205.898 93.7144 206.063 93.5044 206.063 cv 93.3091 206.063 93.1284 205.898 93.1284 205.688 cv 93.1284 167.636 li 93.1284 167.425 93.3091 167.26 93.5044 167.26 cv 93.7144 167.26 93.8799 167.425 93.8799 167.636 cv cp 96.5083 204.681 mo 93.5044 210.69 li 90.5 204.681 li 96.5083 204.681 li 0 0 0 1 cmyk f 93.8799 167.636 mo 93.8799 205.688 li 93.8799 205.898 93.7144 206.063 93.5044 206.063 cv 93.3091 206.063 93.1284 205.898 93.1284 205.688 cv 93.1284 167.636 li 93.1284 167.425 93.3091 167.26 93.5044 167.26 cv 93.7144 167.26 93.8799 167.425 93.8799 167.636 cv cp 96.5083 204.681 mo 93.5044 210.69 li 90.5 204.681 li 96.5083 204.681 li cp 0 0 0 1 cmyk s 93.8496 245.587 mo 112.761 283.293 li 112.851 283.474 112.776 283.7 112.596 283.804 cv 112.4 283.895 112.175 283.82 112.085 283.625 cv 93.1738 245.917 li 93.0835 245.738 93.1587 245.512 93.3389 245.407 cv 93.5342 245.317 93.7598 245.392 93.8496 245.587 cv cp 114.653 281.221 mo 114.668 287.936 li 109.291 283.91 li 114.653 281.221 li 0 0 0 1 cmyk f 93.8496 245.587 mo 112.761 283.293 li 112.851 283.474 112.776 283.7 112.596 283.804 cv 112.4 283.895 112.175 283.82 112.085 283.625 cv 93.1738 245.917 li 93.0835 245.738 93.1587 245.512 93.3389 245.407 cv 93.5342 245.317 93.7598 245.392 93.8496 245.587 cv cp 114.653 281.221 mo 114.668 287.936 li 109.291 283.91 li 114.653 281.221 li cp 0 0 0 1 cmyk s 129.93 95.5278 mo 129.93 277.795 li 129.93 278.006 129.764 278.171 129.554 278.171 cv 129.359 278.171 129.179 278.006 129.179 277.795 cv 129.179 95.5278 li 129.179 95.3179 129.359 95.1523 129.554 95.1523 cv 129.764 95.1523 129.93 95.3179 129.93 95.5278 cv cp 132.558 276.79 mo 129.554 282.798 li 126.55 276.79 li 132.558 276.79 li 0 0 0 1 cmyk f 129.93 95.5278 mo 129.93 277.795 li 129.93 278.006 129.764 278.171 129.554 278.171 cv 129.359 278.171 129.179 278.006 129.179 277.795 cv 129.179 95.5278 li 129.179 95.3179 129.359 95.1523 129.554 95.1523 cv 129.764 95.1523 129.93 95.3179 129.93 95.5278 cv cp 132.558 276.79 mo 129.554 282.798 li 126.55 276.79 li 132.558 276.79 li cp 0 0 0 1 cmyk s 255.729 .375488 mo 244.118 .375488 234.699 8.23242 234.699 17.9067 cv 234.699 27.5962 244.118 35.438 255.729 35.438 cv 267.354 35.438 276.758 27.5962 276.758 17.9067 cv 276.758 8.23242 267.354 .375488 255.729 .375488 cv 0 0 0 0 cmyk ef .751123 lw 1 lc 1 lj 255.729 .375488 mo 244.118 .375488 234.699 8.23242 234.699 17.9067 cv 234.699 27.5962 244.118 35.438 255.729 35.438 cv 267.354 35.438 276.758 27.5962 276.758 17.9067 cv 276.758 8.23242 267.354 .375488 255.729 .375488 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 249.78 24.7124 mov (A) sh 207.662 132.573 mo 196.051 132.573 186.633 140.43 186.633 150.104 cv 186.633 159.793 196.051 167.636 207.662 167.636 cv 219.288 167.636 228.691 159.793 228.691 150.104 cv 228.691 140.43 219.288 132.573 207.662 132.573 cv 0 0 0 0 cmyk ef 207.662 132.573 mo 196.051 132.573 186.633 140.43 186.633 150.104 cv 186.633 159.793 196.051 167.636 207.662 167.636 cv 219.288 167.636 228.691 159.793 228.691 150.104 cv 228.691 140.43 219.288 132.573 207.662 132.573 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 201.714 156.91 mov (B) sh 315.812 60.4653 mo 304.2 60.4653 294.782 68.3223 294.782 77.9966 cv 294.782 87.686 304.2 95.5278 315.812 95.5278 cv 327.438 95.5278 336.841 87.686 336.841 77.9966 cv 336.841 68.3223 327.438 60.4653 315.812 60.4653 cv 0 0 0 0 cmyk ef 315.812 60.4653 mo 304.2 60.4653 294.782 68.3223 294.782 77.9966 cv 294.782 87.686 304.2 95.5278 315.812 95.5278 cv 327.438 95.5278 336.841 87.686 336.841 77.9966 cv 336.841 68.3223 327.438 60.4653 315.812 60.4653 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 309.383 84.8022 mov (C) sh 279.762 132.573 mo 268.15 132.573 258.733 140.43 258.733 150.104 cv 258.733 159.793 268.15 167.636 279.762 167.636 cv 291.388 167.636 300.791 159.793 300.791 150.104 cv 300.791 140.43 291.388 132.573 279.762 132.573 cv 0 0 0 0 cmyk ef 279.762 132.573 mo 268.15 132.573 258.733 140.43 258.733 150.104 cv 258.733 159.793 268.15 167.636 279.762 167.636 cv 291.388 167.636 300.791 159.793 300.791 150.104 cv 300.791 140.43 291.388 132.573 279.762 132.573 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 273.333 156.91 mov (D) sh 279.762 210.69 mo 268.15 210.69 258.733 218.547 258.733 228.221 cv 258.733 237.911 268.15 245.752 279.762 245.752 cv 291.388 245.752 300.791 237.911 300.791 228.221 cv 300.791 218.547 291.388 210.69 279.762 210.69 cv 0 0 0 0 cmyk ef 279.762 210.69 mo 268.15 210.69 258.733 218.547 258.733 228.221 cv 258.733 237.911 268.15 245.752 279.762 245.752 cv 291.388 245.752 300.791 237.911 300.791 228.221 cv 300.791 218.547 291.388 210.69 279.762 210.69 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 273.813 235.027 mov (E) sh 315.812 282.798 mo 304.2 282.798 294.782 290.655 294.782 300.33 cv 294.782 310.019 304.2 317.861 315.812 317.861 cv 327.438 317.861 336.841 310.019 336.841 300.33 cv 336.841 290.655 327.438 282.798 315.812 282.798 cv 0 0 0 0 cmyk ef 315.812 282.798 mo 304.2 282.798 294.782 290.655 294.782 300.33 cv 294.782 310.019 304.2 317.861 315.812 317.861 cv 327.438 317.861 336.841 310.019 336.841 300.33 cv 336.841 290.655 327.438 282.798 315.812 282.798 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 310.344 307.134 mov (F) sh 240.843 30.3003 mo 207.662 132.573 li 0 0 0 1 cmyk s 270.629 30.3003 mo 300.926 65.603 li 0 0 0 1 cmyk s 300.926 90.3901 mo 279.762 132.573 li 0 0 0 1 cmyk s 222.563 162.499 mo 264.876 215.828 li 0 0 0 1 cmyk s 279.762 167.636 mo 279.762 210.69 li 0 0 0 1 cmyk s 279.762 245.752 mo 300.926 287.936 li 0 0 0 1 cmyk s 315.812 95.5278 mo 315.812 282.798 li 0 0 0 1 cmyk s 258.733 150.48 mo 256.479 150.48 li 256.284 150.48 256.104 150.315 256.104 150.104 cv 256.104 149.895 256.284 149.729 256.479 149.729 cv 258.733 149.729 li 258.943 149.729 259.108 149.895 259.108 150.104 cv 259.108 150.315 258.943 150.48 258.733 150.48 cv cp 253.476 150.48 mo 251.222 150.48 li 251.027 150.48 250.847 150.315 250.847 150.104 cv 250.847 149.895 251.027 149.729 251.222 149.729 cv 253.476 149.729 li 253.686 149.729 253.851 149.895 253.851 150.104 cv 253.851 150.315 253.686 150.48 253.476 150.48 cv cp 248.218 150.48 mo 245.965 150.48 li 245.77 150.48 245.589 150.315 245.589 150.104 cv 245.589 149.895 245.77 149.729 245.965 149.729 cv 248.218 149.729 li 248.429 149.729 248.594 149.895 248.594 150.104 cv 248.594 150.315 248.429 150.48 248.218 150.48 cv cp 242.961 150.48 mo 240.708 150.48 li 240.513 150.48 240.332 150.315 240.332 150.104 cv 240.332 149.895 240.513 149.729 240.708 149.729 cv 242.961 149.729 li 243.171 149.729 243.336 149.895 243.336 150.104 cv 243.336 150.315 243.171 150.48 242.961 150.48 cv cp 237.704 150.48 mo 235.451 150.48 li 235.255 150.48 235.075 150.315 235.075 150.104 cv 235.075 149.895 235.255 149.729 235.451 149.729 cv 237.704 149.729 li 237.914 149.729 238.079 149.895 238.079 150.104 cv 238.079 150.315 237.914 150.48 237.704 150.48 cv cp 232.446 150.48 mo 230.193 150.48 li 229.998 150.48 229.818 150.315 229.818 150.104 cv 229.818 149.895 229.998 149.729 230.193 149.729 cv 232.446 149.729 li 232.657 149.729 232.822 149.895 232.822 150.104 cv 232.822 150.315 232.657 150.48 232.446 150.48 cv 0 0 0 1 cmyk f .12018 lw 0 lc 2 lj 258.733 150.48 mo 256.479 150.48 li 256.284 150.48 256.104 150.315 256.104 150.104 cv 256.104 149.895 256.284 149.729 256.479 149.729 cv 258.733 149.729 li 258.943 149.729 259.108 149.895 259.108 150.104 cv 259.108 150.315 258.943 150.48 258.733 150.48 cv cp 253.476 150.48 mo 251.222 150.48 li 251.027 150.48 250.847 150.315 250.847 150.104 cv 250.847 149.895 251.027 149.729 251.222 149.729 cv 253.476 149.729 li 253.686 149.729 253.851 149.895 253.851 150.104 cv 253.851 150.315 253.686 150.48 253.476 150.48 cv cp 248.218 150.48 mo 245.965 150.48 li 245.77 150.48 245.589 150.315 245.589 150.104 cv 245.589 149.895 245.77 149.729 245.965 149.729 cv 248.218 149.729 li 248.429 149.729 248.594 149.895 248.594 150.104 cv 248.594 150.315 248.429 150.48 248.218 150.48 cv cp 242.961 150.48 mo 240.708 150.48 li 240.513 150.48 240.332 150.315 240.332 150.104 cv 240.332 149.895 240.513 149.729 240.708 149.729 cv 242.961 149.729 li 243.171 149.729 243.336 149.895 243.336 150.104 cv 243.336 150.315 243.171 150.48 242.961 150.48 cv cp 237.704 150.48 mo 235.451 150.48 li 235.255 150.48 235.075 150.315 235.075 150.104 cv 235.075 149.895 235.255 149.729 235.451 149.729 cv 237.704 149.729 li 237.914 149.729 238.079 149.895 238.079 150.104 cv 238.079 150.315 237.914 150.48 237.704 150.48 cv cp 232.446 150.48 mo 230.193 150.48 li 229.998 150.48 229.818 150.315 229.818 150.104 cv 229.818 149.895 229.998 149.729 230.193 149.729 cv 232.446 149.729 li 232.657 149.729 232.822 149.895 232.822 150.104 cv 232.822 150.315 232.657 150.48 232.446 150.48 cv cp 0 0 0 1 cmyk s 316.188 95.5879 mo 315.797 97.8115 li 315.767 98.0068 315.571 98.1567 315.361 98.1118 cv 315.166 98.082 315.016 97.8867 315.061 97.6763 cv 315.451 95.4526 li 315.481 95.2578 315.677 95.1226 315.887 95.1523 cv 316.082 95.1978 316.217 95.3926 316.188 95.5879 cv cp 315.271 100.771 mo 314.881 102.994 li 314.851 103.189 314.655 103.325 314.46 103.294 cv 314.25 103.25 314.114 103.069 314.145 102.859 cv 314.535 100.636 li 314.58 100.44 314.775 100.29 314.971 100.335 cv 315.181 100.365 315.316 100.561 315.271 100.771 cv cp 314.37 105.954 mo 313.979 108.162 li 313.934 108.372 313.754 108.507 313.544 108.478 cv 313.333 108.432 313.198 108.237 313.243 108.042 cv 313.634 105.818 li 313.664 105.608 313.859 105.473 314.069 105.518 cv 314.265 105.548 314.399 105.743 314.37 105.954 cv cp 313.453 111.122 mo 313.063 113.345 li 313.033 113.555 312.838 113.69 312.627 113.645 cv 312.432 113.615 312.297 113.42 312.327 113.209 cv 312.718 111.001 li 312.747 110.791 312.942 110.656 313.153 110.686 cv 313.363 110.731 313.498 110.926 313.453 111.122 cv cp 312.552 116.304 mo 312.162 118.527 li 312.116 118.723 311.921 118.858 311.726 118.828 cv 311.516 118.798 311.381 118.603 311.41 118.392 cv 311.801 116.169 li 311.846 115.974 312.041 115.838 312.236 115.869 cv 312.447 115.898 312.582 116.094 312.552 116.304 cv cp 311.636 121.487 mo 311.245 123.695 li 311.215 123.905 311.021 124.041 310.81 124.011 cv 310.6 123.965 310.464 123.77 310.51 123.575 cv 310.899 121.352 li 310.93 121.141 311.125 121.006 311.336 121.051 cv 311.531 121.081 311.666 121.276 311.636 121.487 cv cp 310.72 126.655 mo 310.329 128.878 li 310.299 129.088 310.104 129.223 309.894 129.178 cv 309.698 129.148 309.563 128.953 309.593 128.743 cv 309.983 126.534 li 310.028 126.324 310.209 126.189 310.419 126.219 cv 310.63 126.264 310.765 126.459 310.72 126.655 cv cp 309.818 131.837 mo 309.428 134.061 li 309.383 134.256 309.188 134.406 308.992 134.361 cv 308.782 134.331 308.646 134.136 308.691 133.925 cv 309.067 131.702 li 309.112 131.507 309.308 131.372 309.503 131.402 cv 309.713 131.447 309.849 131.627 309.818 131.837 cv cp 308.902 137.02 mo 308.512 139.243 li 308.481 139.438 308.286 139.574 308.076 139.544 cv 307.881 139.499 307.745 139.303 307.775 139.108 cv 308.166 136.885 li 308.196 136.689 308.392 136.54 308.602 136.584 cv 308.797 136.614 308.947 136.81 308.902 137.02 cv cp 308.001 142.203 mo 307.61 144.411 li 307.565 144.622 307.37 144.757 307.175 144.727 cv 306.965 144.682 306.829 144.486 306.859 144.291 cv 307.25 142.068 li 307.295 141.857 307.49 141.722 307.686 141.767 cv 307.896 141.797 308.031 141.993 308.001 142.203 cv cp 307.085 147.371 mo 306.694 149.594 li 306.664 149.804 306.469 149.939 306.259 149.895 cv 306.048 149.864 305.913 149.669 305.958 149.458 cv 306.349 147.25 li 306.379 147.04 306.574 146.905 306.784 146.935 cv 306.979 146.98 307.114 147.175 307.085 147.371 cv cp 306.168 152.553 mo 305.777 154.777 li 305.748 154.972 305.553 155.107 305.342 155.077 cv 305.146 155.047 305.012 154.852 305.042 154.642 cv 305.433 152.418 li 305.462 152.223 305.657 152.087 305.868 152.118 cv 306.078 152.147 306.214 152.343 306.168 152.553 cv cp 305.268 157.736 mo 304.877 159.944 li 304.831 160.155 304.637 160.29 304.441 160.26 cv 304.23 160.215 304.096 160.02 304.126 159.825 cv 304.516 157.601 li 304.562 157.391 304.757 157.255 304.951 157.3 cv 305.162 157.331 305.297 157.526 305.268 157.736 cv cp 304.351 162.904 mo 303.96 165.127 li 303.931 165.337 303.735 165.472 303.524 165.427 cv 303.314 165.398 303.18 165.203 303.225 164.992 cv 303.615 162.784 li 303.645 162.574 303.84 162.438 304.051 162.468 cv 304.246 162.513 304.381 162.708 304.351 162.904 cv cp 303.435 168.086 mo 303.044 170.31 li 303.014 170.505 302.818 170.64 302.608 170.61 cv 302.413 170.581 302.278 170.385 302.308 170.174 cv 302.698 167.952 li 302.743 167.756 302.938 167.621 303.134 167.651 cv 303.345 167.696 303.479 167.876 303.435 168.086 cv cp 302.533 173.269 mo 302.143 175.493 li 302.098 175.688 301.902 175.823 301.707 175.793 cv 301.497 175.748 301.361 175.552 301.406 175.357 cv 301.797 173.134 li 301.827 172.939 302.022 172.789 302.218 172.833 cv 302.428 172.864 302.563 173.059 302.533 173.269 cv cp 301.617 178.437 mo 301.227 180.661 li 301.196 180.871 301.001 181.006 300.791 180.976 cv 300.596 180.931 300.461 180.736 300.49 180.541 cv 300.881 178.317 li 300.911 178.107 301.106 177.971 301.316 178.016 cv 301.512 178.046 301.662 178.242 301.617 178.437 cv cp 300.716 183.62 mo 300.325 185.843 li 300.28 186.053 300.085 186.189 299.89 186.143 cv 299.68 186.114 299.544 185.918 299.574 185.708 cv 299.965 183.5 li 300.01 183.29 300.205 183.154 300.4 183.184 cv 300.61 183.229 300.746 183.424 300.716 183.62 cv cp 299.8 188.802 mo 299.409 191.026 li 299.379 191.221 299.184 191.356 298.974 191.327 cv 298.763 191.296 298.628 191.101 298.673 190.891 cv 299.063 188.667 li 299.094 188.472 299.289 188.336 299.499 188.367 cv 299.694 188.397 299.829 188.592 299.8 188.802 cv cp 298.883 193.985 mo 298.493 196.194 li 298.463 196.404 298.268 196.54 298.057 196.509 cv 297.862 196.464 297.727 196.269 297.757 196.074 cv 298.147 193.85 li 298.178 193.64 298.373 193.504 298.583 193.549 cv 298.793 193.58 298.929 193.775 298.883 193.985 cv cp 297.982 199.153 mo 297.592 201.376 li 297.547 201.586 297.352 201.722 297.156 201.676 cv 296.945 201.647 296.811 201.452 296.841 201.241 cv 297.23 199.033 li 297.276 198.823 297.472 198.687 297.667 198.717 cv 297.877 198.762 298.012 198.958 297.982 199.153 cv cp 297.065 204.335 mo 296.675 206.559 li 296.646 206.754 296.45 206.889 296.239 206.86 cv 296.044 206.83 295.895 206.634 295.939 206.424 cv 296.33 204.201 li 296.359 204.005 296.555 203.87 296.766 203.9 cv 296.961 203.93 297.096 204.125 297.065 204.335 cv cp 296.149 209.518 mo 295.759 211.727 li 295.729 211.937 295.533 212.073 295.338 212.042 cv 295.128 211.998 294.993 211.802 295.022 211.607 cv 295.413 209.383 li 295.459 209.173 295.653 209.038 295.849 209.083 cv 296.06 209.113 296.194 209.308 296.149 209.518 cv cp 295.248 214.686 mo 295.038 215.888 li 294.993 216.098 294.798 216.234 294.603 216.204 cv 294.392 216.159 294.257 215.963 294.302 215.768 cv 294.512 214.566 li 294.542 214.356 294.737 214.22 294.948 214.265 cv 295.144 214.295 295.278 214.491 295.248 214.686 cv 0 0 0 1 cmyk f 316.188 95.5879 mo 315.797 97.8115 li 315.767 98.0068 315.571 98.1567 315.361 98.1118 cv 315.166 98.082 315.016 97.8867 315.061 97.6763 cv 315.451 95.4526 li 315.481 95.2578 315.677 95.1226 315.887 95.1523 cv 316.082 95.1978 316.217 95.3926 316.188 95.5879 cv cp 315.271 100.771 mo 314.881 102.994 li 314.851 103.189 314.655 103.325 314.46 103.294 cv 314.25 103.25 314.114 103.069 314.145 102.859 cv 314.535 100.636 li 314.58 100.44 314.775 100.29 314.971 100.335 cv 315.181 100.365 315.316 100.561 315.271 100.771 cv cp 314.37 105.954 mo 313.979 108.162 li 313.934 108.372 313.754 108.507 313.544 108.478 cv 313.333 108.432 313.198 108.237 313.243 108.042 cv 313.634 105.818 li 313.664 105.608 313.859 105.473 314.069 105.518 cv 314.265 105.548 314.399 105.743 314.37 105.954 cv cp 313.453 111.122 mo 313.063 113.345 li 313.033 113.555 312.838 113.69 312.627 113.645 cv 312.432 113.615 312.297 113.42 312.327 113.209 cv 312.718 111.001 li 312.747 110.791 312.942 110.656 313.153 110.686 cv 313.363 110.731 313.498 110.926 313.453 111.122 cv cp 312.552 116.304 mo 312.162 118.527 li 312.116 118.723 311.921 118.858 311.726 118.828 cv 311.516 118.798 311.381 118.603 311.41 118.392 cv 311.801 116.169 li 311.846 115.974 312.041 115.838 312.236 115.869 cv 312.447 115.898 312.582 116.094 312.552 116.304 cv cp 311.636 121.487 mo 311.245 123.695 li 311.215 123.905 311.021 124.041 310.81 124.011 cv 310.6 123.965 310.464 123.77 310.51 123.575 cv 310.899 121.352 li 310.93 121.141 311.125 121.006 311.336 121.051 cv 311.531 121.081 311.666 121.276 311.636 121.487 cv cp 310.72 126.655 mo 310.329 128.878 li 310.299 129.088 310.104 129.223 309.894 129.178 cv 309.698 129.148 309.563 128.953 309.593 128.743 cv 309.983 126.534 li 310.028 126.324 310.209 126.189 310.419 126.219 cv 310.63 126.264 310.765 126.459 310.72 126.655 cv cp 309.818 131.837 mo 309.428 134.061 li 309.383 134.256 309.188 134.406 308.992 134.361 cv 308.782 134.331 308.646 134.136 308.691 133.925 cv 309.067 131.702 li 309.112 131.507 309.308 131.372 309.503 131.402 cv 309.713 131.447 309.849 131.627 309.818 131.837 cv cp 308.902 137.02 mo 308.512 139.243 li 308.481 139.438 308.286 139.574 308.076 139.544 cv 307.881 139.499 307.745 139.303 307.775 139.108 cv 308.166 136.885 li 308.196 136.689 308.392 136.54 308.602 136.584 cv 308.797 136.614 308.947 136.81 308.902 137.02 cv cp 308.001 142.203 mo 307.61 144.411 li 307.565 144.622 307.37 144.757 307.175 144.727 cv 306.965 144.682 306.829 144.486 306.859 144.291 cv 307.25 142.068 li 307.295 141.857 307.49 141.722 307.686 141.767 cv 307.896 141.797 308.031 141.993 308.001 142.203 cv cp 307.085 147.371 mo 306.694 149.594 li 306.664 149.804 306.469 149.939 306.259 149.895 cv 306.048 149.864 305.913 149.669 305.958 149.458 cv 306.349 147.25 li 306.379 147.04 306.574 146.905 306.784 146.935 cv 306.979 146.98 307.114 147.175 307.085 147.371 cv cp 306.168 152.553 mo 305.777 154.777 li 305.748 154.972 305.553 155.107 305.342 155.077 cv 305.146 155.047 305.012 154.852 305.042 154.642 cv 305.433 152.418 li 305.462 152.223 305.657 152.087 305.868 152.118 cv 306.078 152.147 306.214 152.343 306.168 152.553 cv cp 305.268 157.736 mo 304.877 159.944 li 304.831 160.155 304.637 160.29 304.441 160.26 cv 304.23 160.215 304.096 160.02 304.126 159.825 cv 304.516 157.601 li 304.562 157.391 304.757 157.255 304.951 157.3 cv 305.162 157.331 305.297 157.526 305.268 157.736 cv cp 304.351 162.904 mo 303.96 165.127 li 303.931 165.337 303.735 165.472 303.524 165.427 cv 303.314 165.398 303.18 165.203 303.225 164.992 cv 303.615 162.784 li 303.645 162.574 303.84 162.438 304.051 162.468 cv 304.246 162.513 304.381 162.708 304.351 162.904 cv cp 303.435 168.086 mo 303.044 170.31 li 303.014 170.505 302.818 170.64 302.608 170.61 cv 302.413 170.581 302.278 170.385 302.308 170.174 cv 302.698 167.952 li 302.743 167.756 302.938 167.621 303.134 167.651 cv 303.345 167.696 303.479 167.876 303.435 168.086 cv cp 302.533 173.269 mo 302.143 175.493 li 302.098 175.688 301.902 175.823 301.707 175.793 cv 301.497 175.748 301.361 175.552 301.406 175.357 cv 301.797 173.134 li 301.827 172.939 302.022 172.789 302.218 172.833 cv 302.428 172.864 302.563 173.059 302.533 173.269 cv cp 301.617 178.437 mo 301.227 180.661 li 301.196 180.871 301.001 181.006 300.791 180.976 cv 300.596 180.931 300.461 180.736 300.49 180.541 cv 300.881 178.317 li 300.911 178.107 301.106 177.971 301.316 178.016 cv 301.512 178.046 301.662 178.242 301.617 178.437 cv cp 300.716 183.62 mo 300.325 185.843 li 300.28 186.053 300.085 186.189 299.89 186.143 cv 299.68 186.114 299.544 185.918 299.574 185.708 cv 299.965 183.5 li 300.01 183.29 300.205 183.154 300.4 183.184 cv 300.61 183.229 300.746 183.424 300.716 183.62 cv cp 299.8 188.802 mo 299.409 191.026 li 299.379 191.221 299.184 191.356 298.974 191.327 cv 298.763 191.296 298.628 191.101 298.673 190.891 cv 299.063 188.667 li 299.094 188.472 299.289 188.336 299.499 188.367 cv 299.694 188.397 299.829 188.592 299.8 188.802 cv cp 298.883 193.985 mo 298.493 196.194 li 298.463 196.404 298.268 196.54 298.057 196.509 cv 297.862 196.464 297.727 196.269 297.757 196.074 cv 298.147 193.85 li 298.178 193.64 298.373 193.504 298.583 193.549 cv 298.793 193.58 298.929 193.775 298.883 193.985 cv cp 297.982 199.153 mo 297.592 201.376 li 297.547 201.586 297.352 201.722 297.156 201.676 cv 296.945 201.647 296.811 201.452 296.841 201.241 cv 297.23 199.033 li 297.276 198.823 297.472 198.687 297.667 198.717 cv 297.877 198.762 298.012 198.958 297.982 199.153 cv cp 297.065 204.335 mo 296.675 206.559 li 296.646 206.754 296.45 206.889 296.239 206.86 cv 296.044 206.83 295.895 206.634 295.939 206.424 cv 296.33 204.201 li 296.359 204.005 296.555 203.87 296.766 203.9 cv 296.961 203.93 297.096 204.125 297.065 204.335 cv cp 296.149 209.518 mo 295.759 211.727 li 295.729 211.937 295.533 212.073 295.338 212.042 cv 295.128 211.998 294.993 211.802 295.022 211.607 cv 295.413 209.383 li 295.459 209.173 295.653 209.038 295.849 209.083 cv 296.06 209.113 296.194 209.308 296.149 209.518 cv cp 295.248 214.686 mo 295.038 215.888 li 294.993 216.098 294.798 216.234 294.603 216.204 cv 294.392 216.159 294.257 215.963 294.302 215.768 cv 294.512 214.566 li 294.542 214.356 294.737 214.22 294.948 214.265 cv 295.144 214.295 295.278 214.491 295.248 214.686 cv cp 0 0 0 1 cmyk s 441.986 .375488 mo 430.391 .375488 420.957 8.24756 420.957 17.9219 cv 420.957 27.5962 430.391 35.438 441.986 35.438 cv 453.612 35.438 463.016 27.5962 463.016 17.9219 cv 463.016 8.24756 453.612 .375488 441.986 .375488 cv 0 0 0 0 cmyk ef .751123 lw 1 lc 1 lj 441.986 .375488 mo 430.391 .375488 420.957 8.24756 420.957 17.9219 cv 420.957 27.5962 430.391 35.438 441.986 35.438 cv 453.612 35.438 463.016 27.5962 463.016 17.9219 cv 463.016 8.24756 453.612 .375488 441.986 .375488 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 436.038 24.7124 mov (A) sh 393.92 132.573 mo 382.309 132.573 372.891 140.43 372.891 150.104 cv 372.891 159.793 382.309 167.636 393.92 167.636 cv 405.546 167.636 414.949 159.793 414.949 150.104 cv 414.949 140.43 405.546 132.573 393.92 132.573 cv 0 0 0 0 cmyk ef 393.92 132.573 mo 382.309 132.573 372.891 140.43 372.891 150.104 cv 372.891 159.793 382.309 167.636 393.92 167.636 cv 405.546 167.636 414.949 159.793 414.949 150.104 cv 414.949 140.43 405.546 132.573 393.92 132.573 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 387.972 156.91 mov (B) sh 502.069 60.4653 mo 490.474 60.4653 481.04 68.3374 481.04 78.0117 cv 481.04 87.686 490.474 95.5278 502.069 95.5278 cv 513.695 95.5278 523.099 87.686 523.099 78.0117 cv 523.099 68.3374 513.695 60.4653 502.069 60.4653 cv 0 0 0 0 cmyk ef 502.069 60.4653 mo 490.474 60.4653 481.04 68.3374 481.04 78.0117 cv 481.04 87.686 490.474 95.5278 502.069 95.5278 cv 513.695 95.5278 523.099 87.686 523.099 78.0117 cv 523.099 68.3374 513.695 60.4653 502.069 60.4653 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 495.641 84.8022 mov (C) sh 466.02 132.573 mo 454.424 132.573 444.99 140.445 444.99 150.12 cv 444.99 159.793 454.424 167.636 466.02 167.636 cv 477.646 167.636 487.049 159.793 487.049 150.12 cv 487.049 140.445 477.646 132.573 466.02 132.573 cv 0 0 0 0 cmyk ef 466.02 132.573 mo 454.424 132.573 444.99 140.445 444.99 150.12 cv 444.99 159.793 454.424 167.636 466.02 167.636 cv 477.646 167.636 487.049 159.793 487.049 150.12 cv 487.049 140.445 477.646 132.573 466.02 132.573 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 459.591 156.91 mov (D) sh 466.02 210.69 mo 454.424 210.69 444.99 218.562 444.99 228.237 cv 444.99 237.911 454.424 245.752 466.02 245.752 cv 477.646 245.752 487.049 237.911 487.049 228.237 cv 487.049 218.562 477.646 210.69 466.02 210.69 cv 0 0 0 0 cmyk ef 466.02 210.69 mo 454.424 210.69 444.99 218.562 444.99 228.237 cv 444.99 237.911 454.424 245.752 466.02 245.752 cv 477.646 245.752 487.049 237.911 487.049 228.237 cv 487.049 218.562 477.646 210.69 466.02 210.69 cv 0 0 0 1 cmyk s 0 0 0 1 cmyk /ArialMT*1 findfont [18.0246 0 0 -18.027 0 0 ]mfnt sfnt 460.071 235.027 mov (E) sh 427.101 30.3003 mo 393.92 132.573 li 0 0 0 1 cmyk s 456.887 30.3003 mo 487.199 65.603 li 0 0 0 1 cmyk s 487.199 90.3901 mo 466.02 132.573 li 0 0 0 1 cmyk s 408.82 162.499 mo 451.134 215.828 li 0 0 0 1 cmyk s 466.02 167.636 mo 466.02 210.69 li 0 0 0 1 cmyk s 444.99 150.104 mo 414.949 150.104 li 0 0 0 1 cmyk s 502.069 95.5278 mo 480.92 215.828 li 0 0 0 1 cmyk s grestore % PSGState %ADOBeginClientInjection: EndPageContent "AI10" u userdict /annotatepage 2 copy known {get exec}{pop pop} ifelse %ADOEndClientInjection: EndPageContent "AI10" % page clip grestore grestore % PSGState Adobe_AGM_Core/AGMCORE_save get restore %%PageTrailer %ADOBeginClientInjection: PageTrailer Start "AI10" %ADOEndClientInjection: PageTrailer Start "AI10" Adobe_AGM_Image/page_trailer get exec Adobe_CoolType_Core/page_trailer get exec Adobe_AGM_Core/page_trailer get exec currentdict Adobe_AGM_Utils eq {end} if %ADOBeginClientInjection: PageTrailer End "AI10" %ADOEndClientInjection: PageTrailer End "AI10" %%Trailer %ADOBeginClientInjection: DocumentTrailer Start "AI10" %ADOEndClientInjection: DocumentTrailer Start "AI10" Adobe_AGM_Image/doc_trailer get exec Adobe_CoolType_Core/doc_trailer get exec Adobe_AGM_Core/doc_trailer get exec %ADOBeginClientInjection: DocumentTrailer End "AI10" %ADOEndClientInjection: DocumentTrailer End "AI10" %%EOF % %AI9_PrintingDataEnd userdict /AI9_read_buffer 256 string put userdict begin /ai9_skip_data { mark { currentfile AI9_read_buffer { readline } stopped { } { not { exit } if (%AI9_PrivateDataEnd) eq { exit } if } ifelse } loop cleartomark } def end userdict /ai9_skip_data get exec %AI9_PrivateDataBegin %!PS-Adobe-3.0 EPSF-3.0 %%Creator: Adobe Illustrator(R) 10.0 %%AI8_CreatorVersion: 10.0 %%For: (David Larkin) (UCI) %%Title: (Network_Figure.eps) %%CreationDate: 3/26/2003 4:32 PM %AI9_DataStream %Gb"-6CMtK?FWgPV2UMJt^)2rNGM!f%86s+u<KX]?] (LS1np7LD(i[&H1V=p$D)PVhXPs2.cT<<m7C&gOQ7S.Y_e,HsN/Ta"33S/9 %]>*+VI!k\^o%gdeRt(=g-H;#UH'@g/8L_?#nTTKWOdVlpb6K);S4[8n0AJu5jNaU`WCXcG`nhCGi.c1Ruc/;n*YXQHh6CZ_h\38 %e]mK:T5AaQkAU@HIt+tRG6dX)mH+/o0>?efq<c5sn#n>shC_uJJ"FA8>[C\UDJlZ(ml'uP+COu %*qHoRkMKVDCdW[[r9*P*>^_!H %nS<CC`S7"l_tP8:S+7;Bq!H&V*D?s75pP:eid^o*5AC2Aoon;5k2P.=%sPMGGF(8WrqB3np %IR:TDRB$pZMGXoZ-_("MWZ]?@6hn %n`l,>ZtZZ#cb#feY`&O.o;hTkq*9/cblIe5s*VrKWr_kh_Vp!Hg%$fogMaqUnoK9YlVi1ck6?4a_usFo\\ Tj=JCdS1OGLn00<X2> %S_m]a(PEs(UeM[>rbd4$;]lT.Erl;6j1$O<ajaGQifBEBJ,7j\f6^!GQTm\SKYH3q]AHro+/! +eIT&]hi88pp]"%^p]1ZZ?L5gTH %05fWQ>UbVL5?s`m8\:tLDe\b'q<bX-GJMrl=!&%M5MO[R^\d-5ldt=W?ebuYi'Vtdro2b#2ucRhr? <MrW=F59.;@gs_/F?62P)A\ %L.r*th6^,I!UnX3$^0T&^ja&0^&7Tph9Q@*bYd?"?_>*J\Ga[kS%G;@! H::EU$rHQ[D=M(pjCO,o"Xe5e,TC?nnhn$i]!-PdHjYD %p]%2lb9R+"GBXklFOoQS0>IC/rUmeo9>IY#'em"o3.N#?_7S1f]6! 1"]=@[WMgsLJ^:tnl)W2tGr1,YC*_6.Ah^^Mdr&4cV2?`q9 %"TF^#YIEVPc#Ug"3FfCcZ!#A-K6B;9fOc,.bm6OUq`&&kEPuJa(]MEdq`Qjln+#!-*l$CsZD6Xh]<7fe*Vnm2E2]O-6=uSR7G3A %jDXQhrB;@gn/lJ$o>9D;%-OInjmR.dp`%uGV!p=f?.$JIj1Ok? I_n\8DsW@D`EhN"n2JT4s$/9`$_PR$jUklVS/VCH2MVCOPY*cW %`\c_=;2)d\<h;HMJ;;IGj6+nLPuQIjJ$9g9&V":l9Lta8Ij]oe5Hl$N; (9bgiL=hIp_uHV"ITei[gX<Dp`#^]*:Ys$PM(YPb9Of8 %.PK0,Q'7GS4@I1P2IkesDKtk;!?+'2NM"FC/ (qFhra6\8T^jL+ODa6Lo@Grlr/Jsgf5Zh0(VUc:@iLp\goanbP/QSEB/$564"Jc. %hpLAMAXFoG8<gQAI3'KjStF6JUVSHhFFH?"Co5PAm^WH!Spt;?/?$eG9RB5? GB'8tB&tB<Hk5#8dbEhVOk&NC3F-3hE?a5q\4J!] %;-S%rW.AGVFOKOc,s#9OZ9F[<k$+AqkQh,&<U&SbHiC&Db<I`PkOpS/_! NR*W;Xn(V=<[A0E9PET51j4=8CNeq5a3Bs6Oq,\c']9 %E;SlKKA+*<F*>QqgV<YBfT56AU`o_LqXS:t`;eg:IGDkb3$$9SLMbjJrXJn! q>r6DLSB8+S6MPq;mmt8_iPH=c-kQI:@T\1(I,Ct %l*_Tuo]b-Ur_W2/c(f@oV;'@7ddOZT:-sG7*B*olP'hJCDmr#VFnuP1SO(! *r9R'8:7bML2tD12S9Q8@d0:q);tEAIFLp!AP:rg? %/I<9B6.+*k'lgqR<,^Vor1BQu38M_UlNCLk_q7-d3ot^tUYE%$-B0[3IDWRY9?B[_B)MqU=&+&1! 6.=`/:EcA$Z&/:%YhIi6A37m %dB/VK9oq=me.F1pZeXu>gpXWF>^m^K=Kr<0Em(pYX$PkX^mtmUcl6/$Y/iEng4^2TTOdG$@*4N+=`6? 4.^P5`-r76\\D<_K5\QC@ %(2%k:aW7*-d^LE(/>(.nrR[nG>+&u,klGEP*b(X,-,MP8U>&\rm'bIO9gIBU&@rP-St]mD":\*! kn`5EVfXABH2D?D1+ncN0[WJ' %NeqYO62>t+rGYKbS<6dIj<,Yqc`hD_N9%c0L0&0.O(3%U2+,KX1ipi;EEDl+q %L.R&P6NX\oI]C/2CKEqKF\5rk>()Bel+R<*f1C %C9qP!l;F*Hj#ZHl(t>/=bCn/`14`@2<\2!`bVkd7(A)^p>"L"mRUGE__3@sscM.6&*N+@KWi? 33':oD'87Wn9oN%i`-$%\3LdWJ1 %<=_sYSsAr$E/)P2bKo7M><#TY@!AP%]MLQ0'.11FZM! 4Yh$N@[J3.6JV^,L8;PfE9hL4'f8dDm_g(0'E`40t>bChVPJ$jmLNeH16 %ha<bYT_978_b;uW\ZSM@IGa]sV]k2*GC!1ljau=FpUHa"TX!fZ-`g*>gh/k<%Zt %p#Le$uWbmH,>U>r>QHa4k9__p+SL<,\fp"[m %1?[nh%(1^>eAF40&Xp58Ihap>I1Jl:8G6cb1)]:@0.+f1TSu@Na\0g[skeqqFjr$cDJMb."cY8A/c)0VKH..RC=IF*a$B;3h+L %QAo^G46UnEm9A.Mr>NFaVHpQ_K)\`c*TdfMoiAc,o[eqn_Bor!h/3lcm6@(WZ'YTBB6+jsim:f)2<u'? IM?>Ab3HfMpZ@!"@_2Pp %gX)ol6dk!AJYQYre'm]M6YitkO[Et!0p-1Y%?I7PA58+BOf?:@#k0T%4>N%J+m&Cq.&sf9EY@*'aa<H$ $>uohbNOpAZaaasHCYp! %MRKc%ZAGnb$/1eUVAB'q.8rg&0fBnKFck9T_t:Lq3"F)C4SZ7N=L>? o:A_gNI3=SOr<ZdS9<S[ka,SdZh]S073HL[i:Z!XVeOT$b %4a">O>)2aP@"WCT[@-cVF_rnGkpjUiT6[$"53Z9+XuF>^:XV"leCc^rBtlqs(S!K;8D:&;F5+]L53OE>Ed0:UFh_<+"@),EB-S$ %8Y7po4(FL!iTb6@gNJbjE\bKA;\N5gE@nn6RA$r3>oRLU.P7UHpg-[l_Cg? jf@DD)Fo*UP2n`_WmO)bTNO;CJ@BuWmE).i?2&-j1 %Vk(b#L-&.9&aT"hdD/d#R?-3N3[Kt!<IOTWALTD0Btl].m?DKPRrm5^8gf<GsdmgQqO<#;'Pgc*Ck0;/`=Tm2rPKl$K9J9OXW!5 %%d&-adq+Dn_p[6N;BH&5i_S4U,nMi=6*!""U!B?Q`,J0ZRGRYeSucf&!,!@[J0s(&\F) $k7oO'A[$0Yml=>`6bd#JNf8"HSUuK-r %WfDekf]2<b?N#i6=7l;u[W<70Xq^`OC=`2kOd[N:1n&-/=XQO8?=d`CTj;? E6qm3l\1:g^p5CjdM:6A^Ije9D=FQEfh!B303lC/7 %?%98iMG2niNlLf;F$<<r'61.VAf=M[eMk#r&Y5DO[+GuLHH4IC75;2>9a7SVU,n\U)YZ'.j!Y7QcI@! lo68>RfS6$4dd/*Z5:[5' %QDt[ms,3bnR>NXZ&$7=m3dnf7MTA?[0O5rm<<p!VAts$+iDX?X/pK"B %V+O$H@7KTBmlAIMaM>j6O95F[GsW$*8TJ$'dmF]DH^?8 %fC2$Le"mct>:;gb>Z7]O_^t.q+?q`^Sc!\En(qM_?2iX:>[sH1k1)KVrp/=.X.+%hg\34qsDAYa7h6t`.A!(\U8aDqsq^qO12UF %antZgJ%0n#mH3j1j2L/uKmnLHig!KoCq`"2j2Er9n*W+&DXKF_DZ+&C9ilf8b5QEqoChb"h<++FpRA@k-% (Q/IsHKkZ*@Wm?@4!e %0>E!dYmDH/([$"OQiFMirFS%*/8Zh@EmfI4hd,j@LGpoJN>m93TViS7rZ[$0n) (ji]mP;74Z(N'G=)nqI$'r^DWmENj6YTk)m")6 %plm`#\$tPXe't=N-Deu%DdJt7At\PRrC<IPIr)j0\_Xp5GqV<cD-gLR^:Unefj*@'^D5]"k10.L+ (rAJRo_kA3HY#co'5WA]CT5p %s8TKTHh6pL=$OI2qFDo&2n*.&*Q]DLDa/%jrp@sSRo`sFI<g$ZoC_j% (CYh&4n^e.oAa__p>90(@g6f\2g!AhGnW,U)kucF+5m\t %c.0eFDstEpr8aK!g3nYOn3b."-",T1c2$,'HKV&XrJ-="qbbh7$@d-grd1BYUg^K?_(D#BmOiDWG^^t!R?>kI/i1-#4^ink1bg+ %f&%S,d:XHh*O>)`iX,Mr+8rCY&EcGCHmT-KS+ASr?+dlGj5lbgc$r!:Ig9d5(qTarj]fO>Ir$aP\ [_KTZ$?+`#m9Kh^\G9r2_SP9 %a6)^2GJYYK.<YZt7>C%G^&"YU,q(g-_11o+rq-10aT;;MUV)=GWo&'i2h7>V%f0ff$,2YEg8jUc'ncd#(QJ1kath.G,=$2+)e<" %5$[S%r9-$F=9KZXL9aD(Dh<2&4H,a@L.tES!tu*jDmCm_O@EoH2kbt#)BsVF!>G`.O*$ $Q.G[`@p)emiD_A5r(:3c,fnU8ep2RkS %`!HB]@KG<Cn\Jp1)aA.:E%o^78mrB'JsQb\hPAP;C4V6&NH6q5%.eKO5e_,@)<kMs! e43AX^i9S*s:==4O#P@$Id;iS@Am%DIS=q %_X-bBBG$$28atXDa?n+h<9Ynu:old:jQ,3ckpuZF9?+!0o!t"&-:\tDMD0.Re9#hs8*I%o9lZ3@%7$\Jls=$"$@7sKs+*H67Y8S %k,,Y4"mb*6d+Ealie0)6T+PatK8:T<'!a\U_oJ,Pi?\QJdR^]3*lKKq(h8.(e%^Ie! WN;b_'ZG(=0PT@_G^H76l9(Fk5i+<E,h,S %#(CYBphqM1_ggS5\FInG2ML8265XEGdF"R3$&/A;*cMkP_*IeRM%>]%K#8bK^VIbo=N"8f2R&"`! (),7IS5Yhn5"i2L(54>i&Xu4 %'(Z-Gi^0:J*O$g7fa6=e/nGM6+#Y@&!r?Qd6,!BlTYTPX@0*DtV[Iu[[<[1P#_fep-'-hg8Vl;=cnQ^ca: [>D;^K4b#_52Bc[&tg %2\=u^:GA7M-4PAG\0*C.)Ism[>]BZC-;+:R650? TZZHL6#6c[lWpm'HA]l<?!\=DDHJjMDkq5pO)>Gcdi(SAr(aK!;Lk>0UT-t(%Yu\t?a:t=*kd6!eP>Q(G4?UJcOX!FG1.YstJ<p@W%ql94]9-8C!.j5="9[Ta`X64LIh=:(&[<imh2iQ(Z]H&4So7ZMPQ7X+@+OX %kSnaZ#s6QS3CK!]Igmgf)^!3,T'ZmV[R9TcRUK<K.h?K!p:qUN>o,bEI/t61! 4'=HV2)^AIjSh6:T3n"HnpcuoMu/6V9VOq1M[4` %O9ZZBoqF3! &Q]GI.,=@TnJi;\8ihim7ZKg//Z>JOgT]0q5Rq`8\C[OP;,N46%]lH>8jOddd*,A_3)kMa$O8cWTT[@E,m"V$$nH/ %f'$IQ@f/%!SJa7l7,C4`*><X!LtaZj*;tj8Y;#c<_D>).5W&p#QB<24gdllj6D:]R$BiB4.<`$7GYs@Fdl+]L;DAVA^)/#"Di[* %:1/c0ne.EW.hX(Z_EnGSA,urPB:L9rN@)r/+Q3B7"h6"o"F9DH=%%gZ%;7tm;/h%s6WGH";#; $8Yt*6`DBPH;i:@QRK-S&4'32`1 %9eYTC/UT5'UcI&bH:qLqIqZ=i?QitBf[0YTb$5j,J').S.&--*Ti(4W@Uk7dr<]7F$aYf']&l3YpWaarIn %a"=*=J61-?g_pSX$) %G(80sO!!Tir%YHXahYX2-N/A7L^?TH^_1qf?^r_>[6U3j;mPT6BRSAn@=q;9*oQVHB.CIl! j0eme"#:t\q$779jV`^P6SG][ %:%b@`_i*`E-:^Z`K=+Td>23.:e6$XIH5js^Wfjc&eI=CdS!"8CBS8LUG13spVKu0qRqNlF;-7Kr^Sr? uTdef.6rb&%&J`$+q#^Ns %O-Y/.n8flGJDN-R`[/"W6O=HRJF=fTn9`MPj/[\.G]S*!!PZ=[fSoXV\$tOM"J7CWh%sFjJ %0arc.*9-'gpl-c*3,,X3:5Z/jI/4 %hO]5omDZ4*"5gk>F*[ZFj7P?4(]X3orPe0[G;gU.SA0FJlF1]WDf=LGqA*=MlMKl+S %Db:3WkqF\8ML8J+WL&jgX.'fd!JqIc.ED %rWpl_=+H2"&)Y(3\>FcD^e;Fe"^^KKMsKuh5<rj'Ae4!mD_>A0]t(bdq! d5Tc';B1lg<fQ/^,&Zl48D$oUOql%aVf`*^8Xd?f0`< %iSr\FkI5+-e5tB'(&GAekO%#B0!6kb!E!6epTL`;^:eo8IeE-kmaZO=^]3`]h5ac6UBENiI<Bu;#)@? EELup_>/QmQ5J4T)e'3Z/ %J@*LhgK/UVh-O@=Vt2hhmk.pPItXXQ]HZ!4N35uqD_Bmu:,n$#DVhc_?pN?,+5VCXU(Pq5? iKB3o38^0s8;<_l5P2,!'fD1nS1^5 %JC,WkijPWEQLVSpfl(j3YI8)Ip+h;&B6=$O1V+Gk2r3k6G2LWVe^+%'5O[>(gtJ:SIJ<#noK_X&=+ %ohpkE-u2uJQRoIIQBqW$,^ %jnl+I?iB9-(%T<3F@*b&Rt'&Gr&_OVJ+8k4IWoi@gi@C]%359<eV@5hr8;XecZsa/3C! Aq3]SR0S6rpTUZf5GgFp)2MfpmuF^b#M %EiViNFkJq;db7q+3o9B/Dn,V&Np3FQiC99gI;^e=G_lDi`^dc9,<tGQA3:t$T'uL@4$ps] $@_g1b;7Ql.K,=2^ARKjqVl.W?NMJF %O\Jhe5MLR^@7H/Irr/2"/-O'6ftRB6? `JQ1<VY\Ca,;T"TL4(5W:R4NBtjidhiZFd&p,1>(V=m>PQ-)ieA/<P:M<,UJ(snImk4&] %2ST:^q:/8J^/tQf? G,)udYiVTo#9R,326KCm]\j5LO(A(Hq9$;#R>iuLZ.T=G'8%T[QiN;D9p5.H</>^=ZVIRiQRq)Zf1OqH? OU\ %\j,#ADGS= %qXVU>3R+Jd1nKG#J*O6BC4EZVh=(*MrH:Enlb;`W54.Aom/>f.LYZB_[QE=4GIu[S2t#t6m.)dri\'TqcL $@Q0=HZ' %g%KO"hsRr-mC9:QZH_.2NSC]1>IPWm_g")2Nr*fTDT?au@i<,>*TIu+n@6K3*pQlkXo#]1gH&@P@kAE2^` %!e^4Q;h%csd^Q@7GO %D&GtuV1=P2@KHA4\2*,450KjLT6GRM8+=(s)!hQfRfEg:\;=VP*7@tN:&D:j>;5ee.Oh7u`d %PGaar])LhH67mc,p;_/ukgPNJ5V %\:)ap(Pcr8BAk]6__,cC(b3NV64O>"<\VYuXAo2Wchsd"qjlX@d8s\&"pYJd7.3;6j6kjNgo9&? S_L^fN2csA0_hFr3"KmfN,\i< %%R?+a2ZV81R.cUH(tnt\&%!;:+/%$Dn%RNGZIsD>N",,^BOW6C'NOCd$B\XBOXclG$eYCh5RV5#_=c$&]W\b]E\n,]I\Q+rR.r( %+<AkTLe#r>ne(gk!$jk-h'eBk&ZF7tLdC)eJfmXH-qG+!bSH`R+qG:l8]4"`1*N?Q<'VuY(D7JL."D71#[Y)E"sQ<OtT\r+k#L8 %:P8jK&i#fE85LQ\&f&NGKWS5KP_m%D?m[T@)9@ceq*8[?2Nf!cN[.,h,MA4K9R7sJOrkPA=TFl*&W$O, +t-AeR0nk/$OKHZ/lR<E %OT@+4Kk;em;o+lZNX1]%c;]#qL*Sh]RYoHkLo+Y2$PJ;Z$5-41(T+/k9a,8];L?A %.\rtA8"b_R_b[(gcn.)E5)D<eqmg/*e'sN> %NVK\_o:KH;JYJT>B<r!B"\%!Lqo,t4?/+$i:+th9cE8q7o'AuT.o%b]&QS/ho! <*dFoEPs3DmbG^Ci`pnr(\6(JG!Yj=),93g8l/ %Y!$&P]!c^?,/M?=Km4*< %f$SeMJ8bPUJ*a9cN1T',\R.5C]:ZJCQtmB"o87"%hESKarf0NNYF4J;cJTAp&iDe8hA+99.e:<9<QDi %81teu^6;rg@@[Fd2sXON>c#%HTh-k?EcB]^*mmCHA0s<GiWEJ!A2(:1KLQWD9l)eol(l=_RSRN\! D^(=7[22KZs:4DfOT!`fp0,V %BMPTAY>BOj>H;;J,$gil(9^lRC:/3<\=f'XfYoNGl[49gdP\.NH&W_p^m65IulmW;b,hPA.ms8,R!]5J[cdDKp)Xrl.3fo+SukO %&(WG5#mVF^J3+C#5QRGoED%bm"o7D! HN5+.JE&oMQf(.5YWi1(n>BVP\BVD"*p@dU4+On_5g9:N9eacmeD:8gpV6lDHRp7^^`rli %-G]flnCQ=W<Q#F-.1t-M;Rf+>4qXt[_D>X@E=Z"kME%=B;@@2oZpYTD?fu[Rc,"AX9rPa%YG %g\`$5U>kt]a*-u,]'Oc<4*K@VB' %k(jI_N0H>jNfutYCn,BcS;$_S9brgcZCXl4:m>p!#MY-#/Nsqg%V1-a! Ji34ac/1sg1k:Em)XWCJOFhplj(a<_1`!2a5Y@+X:/Vn %ZjP2A6n8l"#*OC1,)t/!=I$6-+S4T3nY$PUY^s1u=VK %)Zq\q;79^MW((0[_g9F7K_R\Yf&Z2U;Gu+2u38V"/$*T3TWS#u<*XR`u %Bu!P!lkRClehD8:\8m8!5Zl0^+3)Td0EYDhN-N>G-N!u[,N3%6o;B-GRWYDd(RhJO'^'`aR8o)<,ce_) ['jdB:/OIk,bpBq1BQ9, %TF4jg,H0rL-pgn8BB9-:Zia>78.n1(#"ttJ7C=GbC'QZJ.G.f/?r@[E&! Mm$q@",Wg:h(Gm=t3]`i&U'@_9[g?s<&iYo9mbo+]A2 %Ni*^Pr"=1N\33Y7JDta0fdU5hXA1K2_e1-^^#=$iboW3M4AN.@p)4TFd&G$Tl:]Nj*R==jD? [#bR9t#N.P0qgBKBmWc)iqT@FK"$ %!Lc_BY$?$pEkAP8<@;r+oVbr6HHe$Hd@p/IM'bp"Y5Cu\mD\o^pF0[%T)+YqRk1VsUg!%;<jKcrlJ>XTpjN%,g6hDjrKZo1uKN@ %o6h\"_]]O-/&n[fYf@sOYo`W6H`GAY"^sU>kF%BcCmk1@Eb$Gro!!R+l=V;VO1\t7DeW1)j! l$Oa`>s&[.m6)e'PA?DNP]p[;`L, %i[o[tp>[Ue69_?f>r_DlYo!-%P8lLo/.0:7(rsKg5!S6P>/*'A__E$gb%r@Z_m,UZ:/]XK %8g5;1dT>f+;n2kM:6X0Gg2YpCcH1I %E>sqnE9q2,=Ot1)9S6CBc9.6OLM.BQ]F]uHYTL0?`, %9)5VWGH>;`RVOTgd$9VXPqpl39136In6#)V<Sg(;5aFQ+[>M-%3nW'`Ea %YXNUip;#&\NB[F3:`Wo/.)[sBUToWgE5QA:[hd`g(3e5pgWo`&=U=kF"46+3:.! =")t<r5A/9drgkZK,M+g:`T,[;Th/b^D,-dKb %CDhVaeGso#>8NX,k=SE;Y'OVY?EW/NELQQ69c(/#/-ikSQH"7KAj)%3MeBCkpHQKlO5.Y^eFT]_\*]a0b5d#o>`\bYkq#5(!k1K %6cA\DN#ioR/2Y4u20GHRgm7hr=>2V&'J.rW:+DP=_&(e."2IMUC.t*'jAY=]\u^4cJe:<L:/]0+Sgg)fCK[VkN=q.IN)&/<6'KO %,KsTt+CV^jrSaV/,:pfciKXuoe<0mA_a5DZkPGQKeFXF',JQ7RI/!<YT.iL(Iq"g8TAP! IS6iBq6/=^j:9R`tYT,hm:9R`t=9S<m %3PAamOob4.3PF:>AE2ZjF*bMc$*6*B.64#E!nd%Eg=K?_&&+j[F`mS60'Mg3H^j\QCq9>Z$ [R2pSrWG&:IG&1CRNCS?C9C;B6A6S %pKZI"Y+8nGj)0&-n$u3^\`=!A>lG_'?RlVm3R3#'6?F`E^ZPqo0/?h,a1-GlH`hbg! j)VhQ6TJEk8O6@ikph9=$8HF"`!@cnZ'W! %X0AQ"EUg'L7]SfQ5;HR<QtR5Sm9r_<Cui;o*4ptp'ugO&lRB(7! DI55bAMjl2o.7S8.rBW4"(==ia#@8QA@bedP/%\jVEkYc&]IX %V*(>U*W9- *n=OL\q5blcWOD7oWqTkAomBGMJ*+0&n\4,F;&Am"WV>2WSA>@l51&:f0Bob@d*#C3GhVI:]LRk>d6dN %f3_jF9&Itb %^=I\8QS1PCqc`U)?G?1Smq^2BHMQQA]WX3MlfF&Nn\3S%YEpn+a86dp'ik4C=i@jNL7=Mo08hg!b %PS@B4V\<<Z,"HT:&-<>@fHp %*4*h;W)X&Qf+GX]@B7VRY/b)jqs.[Kk$_KZ+a^AMVF$>Z1"NaGloc60Q0dU9rpo#ak%\LL&oW4AdlG %#r,ha2s1l%JY_e6dm%XNe %k0)qT=J+SuY?prAQM:4?7ka)r? LRmBIm,_2csLSRq,iaYfJQG;X;-,3hR+D5HeOkCNu)5OU.F#`S@]m$J?!QQ<?tgd0sJEa-k`\k %(bBo-'F@iF%.(/FMM/#^7O;nI&d_WD%.(/FMM,ab*2Q/8i%C7NpiB2J..d_D=t-]ZG+#4cB'HgPgMn! B/3.iin,NN(;u<`cD'hCT %,Gk8EDP)W\@?O.o?B^uKCF24'M,DnNdPLE\#&+\t4l+_KHf@'/GR9kn`(pqe? SgpQO(*Y.n=YAIP=\:=[/.]\fpB0,mr<F6k-lGi %ICQf)>hL*M]9G0c2K6@tI:E)8'=B$o[c=5Y.lV'?)h#t#>2=1n@_B[$)>]5M#O=6:WS?$^NS %=u@o1m&;sbsEWUAY:[G4L,p/?O%199e&<nX7U4^-\%-_>Cg5&tMC<E1.5]#SL7b<:6(.ef":_W*94&\X9%]@)*DoQ^;gr'N+#E=H6'pdH? _ZL/:-?U$6/qe0d-;feD" %B!pH126PT"lU<)>Y=3HQ%kA"R>h:>OEGiT!>.L8u`46%!UgX2.9:T4*Jh3QBuj.@$*r"I8K&TW:<]5%NW0d+F=1+p9<'AcUr)ZG %gEh2]d&2U>\N]=%=7`roB5cBsY,u"$btNX?g<71<Kh43X`RA4]n$Xu3h9aYgC-%0QHtM-&G`.dbkT6t1?) (ZT/laT"8MtYCe>Fd' %<Rjg[CK9(s\)n0h[&p0\cW73t`ALdnT_#V8Bmso#Y&SI3ks]7H<**,']Q0j6CFuKu(7&<cQ`>'4eEu nOW\5G](>!_r9lG708 %`8B$-PM0/+D$OR<mpFQbN3YNjC)>PeF/j#HgIG0MBkekepRL]<() $#;a]AAof0,T\1tdA-\l.iVWH6(S&gp])\eDd7MgdS=O$;B^ %52DEoAEVil^Ya.2h`\UL3hA4#Pb_4;ZYju<n4MHcX42%,K.QT>qg&24p[`c),TbJ.,:b&Mo;eIn#)/\Ck7_?2?JN/D*Mk?L:.g\ %B`uGn(lq0p-DI>@6JI7A1/,00[`tI\>="Hi"6DtRhZeD\D-pOc!L8YE])Atir+TA"WO? iXos8`Z)lMFS&)@H1l%W!emRbHNXDIVV %QbeLq[nVp/ZH[Hra]#W"4$'74hmV;u/K9&__GsQfN3]o2+k:U[1l0l46$&PHkk($_@oaE3<:]i.@@iYh*[m/PYSNbNsZ+`;^ohc %EC\W\[:;<:A*CNchM1p+IBg7#:QXJFgK2/h`'Dc>hRu"c^3I9c<^7Kn>/6`QYFj"AT?FFiHMl!_cmL)o5N!KV;C_Im-K,Loj=`> %-i<`3rN(JT4jNfO51e[VfAAgEh`o`M5GD?\ak*:Pb:<GQZ9:Cp`qfom'F<`? &cQh`ra/.:r6tE8(KrTooK>ASiVs?$iW#"fc3LLB %p\<sJ54nWLAH73_4oSTsbJj:1cT<\LG?D6<@@QpuC\`72KjN(e/=q&fIM3"^OP66g5d28r4M>KGr>UA)eSd"IsBg2o=T5.H0`]G %esZQ.XYUZ3HfY0oC"q[;BY&?tm\H8Z4hdJAGH*cC:X-96J,,']o@etZ>H<P[..lEK6p.XncYLSmg@;Y_G! (OrSjPE^+e.YVc#^tg %3Fq_$ZM@9*ffYTP4R.5F=nj]Y%%b2R^X*%7kE:P^P(i(^KtktUs"'JVF4p;/g%TR@pN, $^F4p:4_q7a")#p[VrHd/ko6/FBm@;MW %3U-B6:%DF*j\pL';=s)DG0]&l46Q/LInu5YJ'+41+/<<(8#`Tb&Lp&;Y!V6VC*NS %;1tP]3r8SM_pD..3gLmoG:Q]7MgJ2M>#1A( %F"bbRGkkh.@]VX/`tG8?RpjJ2$'N':_ZWHE_o^e3EgOR<q<ZTa\kDao>5#95m@ %PcgX1&U]0^_\mK,4tUWs)Ik3a_T[2rp^:TmJ+ %?H5rBlV@JsWLoa!eP>+=B5od=Dg]nkU%-! QcfpZX7jj=Na`0QjSQ<17#6>EL1hXDiqi'S"6s8.389:gNV_h^ogsYtO3+a5oR@(k3 %N8aF`jf1<Lj#godY8bFk^-s&]fc.rsVX^o`O3T^c>5t#GKMMm1@]@FI3! iX7`1a3&qthTK>DTB\kp:,2A@#+hZ%Q)?kH],9kfTTm %d,Xc^d-:(o^=,+@_2Oq>idpBRg\\X;/r_WG2N9cBNGCA>n1@IIB."H1GosYQg6I"(]c+j.c"7q(6F`5c#4:LaOG!Qgc3ueQC=R= %J`=X_*RF'CoD8Bt5!Q6scg12oqY[uis+RT$'RkVR@:0)b^khu;`8;a"ER!`t\?0YK8-PaiM<jqLB[uU4W3NE:'*Kf[H0U@Is)/H %A+9<AA(C8`NRrZsGl9"Kp[MAar*[Zn/;6D>Ies&0@=J4I6RP,`@,$2a^>HYMW;(b&ZA%s\C?=6?[XHNJ! DDV;MgK92LJEM/.7CWY %dm)U$RQ_<aU<b<;?`&a4X$3TVI@2\l>O[cOmgl7Qd>0n)*jiBpD`7$"r7Pn)j\Xo5H#&! %BsYZlG<#/m*fRbie]+`6YHX1kn8'U3 %BX[_h()QLYZdKfm2GS#"e@8*GWGtnt.H7@]k! t\h;//omCW_,)CH34L2,mifdkAH2Cu&+BPukfhENolSLEIkjPH,A3R6\jDT4#?] %L:*MB@83p=BTD)jA=eo[Q&hr;VLY,Yf[l/Ul<pV'jsjeF.@=9=Q#LP0bTdgS$J.)rSh]tu\c3;0lQ#F"lG ,T/;9*lH.!;-YT(P6p %A&]:ucd:6qYB<>-73g=u@:^&%'k()Sf6XoPU1H3Ee.]NC5nugn;aaVSh9-7'kljgDW\<) [CCVjp)AT81b4<\BIdJ:a^h6c#UmI]Y %o62GDF`/]6mDF>"lg[+fD4g@tN;$tt5ND]4`VUo7L35*8J+.*j'/2BmOdi+?3! >JNHtW"c=mL.ANP2$^qql6qJF?7]oHc)i/bjdP %/D:%R0tee@521&rf,_=4*OfEbV\?Q7eLe4.YPh=$ZfOZ,0!6I+qXDS=Lh>$k^=6IcUouI"AL(7m&R>&S;7TpAjT,VaZOc;miWtG %rT+E5h/=LDP5TV_/k7ZN\)Pm*jLpTE[`L.D521jD6=="KSh^)#d:\F;/R`b,W*qflrP(llXF;b))k280Y; mPSho'kZDf(Le7R!C< %3fNed8D<9K(T"XQ-H/P'";@G`_qF#@YWqIagS`]96>m"@G? ==4mTfj#pOQVhT=T6#U(d:h.fRqn2[6MThc9TRHWNIo+4sTkWG-93 %1M1V@PGLr1@6.*!jt!.rhJ.*/Z$gP@cXl!u<r!QIZXEPPO8"n-EW+BG\ZTh]I/2d< %,P14eNB2LL#YFN:@fRVJ=MAT>$d1ECRWKe %lZR<MMf.>>P=%g:kMAqBoWTDl4ZnR]6$i@DN^B0VC,A)FBR8=XjN%PIB5u33S2m;^?g:jTP3:QQ90mdNpc$%T_aOBW]?6J-CGuQ %=O/bNT-.4B/'4(D.X'@-f5G-kb`cWiGOCSRb@NAgns2mVo2A/)*U6\jXRrp! H[RQZ'U7hLC1[PoNM7gl5Wc+O['RD@\sTBXb-dLM %[uS#e-1BY/ke#7]Gs/g2PbfYfJa3^+q1\D_9!ARIGp0j>&,aRrIY%H`o!UX&h<l_AHV-;'WU-, (nk&f:b84'gf;eLII9rtrCKp,4 %lE4.@Bk<iO;5`gG]&gSA+Wi-`NXA&:RSN+cpc+h;kcO@"ac[8)5dli8H[L6/OMTq)iuYmqIu[tm]d#/jM@:f,&KcVF/QA2s"sbj %9HP69r/N$0V!A\*lKBa=jXmYjTAZA$is?oCRatb[+BBKe/mM"T)qC.GjDbjN#tdX)g*fgKfjb0(XJ*hY[YXIE@7\'B5s!-c"%t] %_+d^@)jo3jqo%UlT.b,c0((W1hd><AgjR$\Vq*-nbR]5ke>"&XZYMM3[X(6#qY.M0f$7H$4.BZ! NW\ppJ$#@CY^U%L]]Z@&Daf=p %f@lW.X/1RL"[0#R+<J9]m0'pp5EkM6cb4\Tl!R;+>1h;rmI_/VrfFJ"T)Q+$k8lk"a+ %bDnsO0nS`uk`\g<c!n1)s4P:AXUisRo%bt<GKGgaD8H*qbgN4eFS0i3&S? #Ri0WH:<l+le<WVbY'm+E'>t3J<.75^rHYI.&jGVtT2(n&Q$sOtVjPGU8E`OB7Hk3F:&Wg'2A# %Y`1'>2-KXIVHF2DP2_LGr3MZ(Ul1BfYh[a!7!3Ye-/'ZUU0MHbGe;J2QQoP? D.*Ed^3h(*GA>ad/fV[9ru&GLG*g.;TZ9C(L&O]. %.o*6$]DVSY*o5gZ3F$a<\C %_$Q7lUl^Sgg4qZj<1]:d4#4kKDV0BePuHEnXVn^pY9@2JS2"7Q/kh4qLYpRU:5_bVUN'MWn:lUO,* %ma$#6h-\du*pn:EP;AeWI.$Op4dqpr2B#b3KkrNK`lJWWq[4u/[("E1644/Q/$u36=+QYNk: +bEiZ(B2)^n736LtkZS^;Gc>$dq7 %-)N\Z/gCDn]['/3k*4>i)%"S[]R4-jM*<T?1)"LlT&q@V4#,Rh76(_!;G]''1DQF\i+rS[/ (unc5iF#EWg_^Nh8HfN'5lQA#V39] %=1<nJ[RSpi7`tL6>Js:Ye7@U#[u-.X]I^@"$o8s7eV8^`*0]FmA9bABA`rn`[Zd7[:1R.GOe$;>j3;[AP)*3q*G/,=fs$:#,F*d %Wfc?8e!+8'[,V?Xh20`hm@=7+G6^f8_.2X.g)3hM3B_;/S\G-33)=K#CptTPokO)OqVpc9qXJm%SI! siJE?U`ATm1SQ0+EM.daDn %]DUZ/Mp&Cfd,Wj2;qla^\X#Gqo2fcmIeLn1;iQW<h]B%Fq %GNnTIE+s>\MF@Y,=Yr,N`BlP<2q^TLrsoMZb#Z"5q@ac6Nai&HMM( %S*(k>/+;0?(GGef<kk2Mo^'V2nE?(tkrjCXP,[%j;7#r,12=hCXcJ\"9q])G]VE%aZK<Sr8]FnRX! P22WHDh-g'12Z"\i4C@2$3W %@k.lA]d?[h17J"c\$8SuFG2P)? VGWK9XhPQgS/u^Ak>&>I'M;_7sQK&n:2SWo6MJhpfo:9I5^f*eAY<gJ>r3u#K]20nq"2P5=Ap" %0DQ_Hk/"NF/P82<>AO"9@UuH'QT-.iJ1++]ZGas"2bR`9@0a$E4C:?.[)C?)98h48^t'F$QFL+ +l`\\&s#fC^jGp39rZ;*XAE88r %!8sJE;QN'QeEBPlZ+RQ6S-V^,=e;ED]9_31=I!3@Ii.6pbp3T'CC)>'A'u^WSYT*2-H? crfqm$551imK`>S9T<7j,<G3ifY::uX9 %J+pFY/]ca.&NRD-P-45er5@[as8;<Umc(uuG$!jFrda7halhi-_<5jT:FI#!2K!YerUc! O>L2%fG#(7d^A?s9]3jH%^:V")p[&c( %oISjKoCBjRhpZe#^\d^"h;-';45g,*s7pndZ2"j9q1-]HJ)#8ZJk<^TQ!ZMjO"YLC:.G(5ht+AX#Q4Q#! VB0W\G=,+p]#Tm]VTfO %nf.M@F`hOCWRKJodCSd1;No_]Hg0QPlLm02hXL"K4IUJQ1n&n<rHV;hk"j>T%b`R!Ps.\4QtkI\IhLcqD? reHdpI$l"8J6Qa,ns0 %'X^/?L7`L?DHtu\/L>1VoG=pa7hLFNe@XE7WSn(&F2J]?UsAilgQ33r(80Mm/T&;Q7lTA6q+krs^\"\ [H9,I1eHR"Jl$s]ZgV#WJ %Ru#o8-Y"<a&(<6l#&1Tr7hLFE3cnkL*TEG*_d+5!.?3T#alGP%$k&lQ?*hr*8#<NJe`bn86_? gZ\mOo@A"4%@nHOD@9&$Ree;HWY %c$IQl+S;!5H8<qe(+'lm60MTkJC?53p>G)NFNfaCg:]Ot2FtMs`iP-p@63b8$gN,l%C(4\CMgt,oUoVKl %IVUTum3oG-).bWU?.6 %AuZ)Na!&s0EJQf<+S8=qC9=DODB(tbQ/"96)td[e3bD;4;jpB[5sNg9(+'lm60MTkJC?53%cQQfFNdIl] $]#6Jb3\i`ii<X:cf/T %ad>8o;*aSbA$f\EmcBifWNZfSK"A\9ma&(T5(7Qqr[jBGG+Zi(-is=:Y,hQLlRI'sc$quCZp%B;p8? rcSGp@*kHADd.[fkQGK8B` %=??Jt:S+`YoRQ7!?`j4nR;F)(]VHdu`ouWN1J\B9s5Wnm %e(IufQrk0dVI&SV$90aBMWAeGL(>X9YKJ=og_2[ND=NS7lhK>o7f1! %(f-$AOc:_0O14j2[CW$'1@AtY9R$RuX@E`89IE$K5(o,'Jur;a.486JMp3pa\ +o=GaY3c`ntN(uGX=3AY(o(<"S9nfg'n;inHqVa %Y!,F+8;iQ)A;FVAYo4>/GZ"_VZue!)R,7`s(@%bJ%oHFh),ea!QpF4+SpgfF! Ae$nV6G1WLDXDA"al9Ja,5Z<Go[^;^n8QT+CI"g %i"dCJ+E&t+12K'mi*'r]QLHoE)XT?Ma.='(!d5cH:\dFDCO=DQ"8EGYT7-."Bg<OP&7[IjrB-L:! G2,cah*eSnoKjX"Y,h3P6ud5 %noI;LKde`bZjsa<jl`3Y$n+g0o19d/>'uq2SH59i?.R5lJc="gBpm\n9BCa=S^a1O9%ek4GF_O>(#al<+-uj8nX9+rTKV!RR65& %aQOZ07aD<)NYLm=(OqMZM'*<TW=G%dfKEsM^fn]j%6hGYa*rCC1W=q8RCMg5U.Z1KfRg#QbO$+<R^nrP6G%l&!1+F,f0mI.$1F# %O`eI9+.&UH(,@$&))WmgC?GG8c`76`IZ=`=1?QR=M,5$c,U]=`#?! 3=pYr)9dj;6hq)U,m:R$b=72lMt<E[C5eLbJ<p.0%;da-9& %H8jh,UssO<To;6GrLEINFtdgbJ-toc[Y%/KPDV+RrsYG#BBi1u"MI!DSC<"(hY\Tl[8t,V! l5Rk&Z:G)\<*#K_&d]N4NDsS4KmZ[ %7UO=9@ji_=RRU@d!0[d+W<>7,B>=6.8'kGJ4=MuEL(U#nLo]D11[nmND59EN$$ $2X:*)4lY.aGQ#qVSt2]9u5":mWtb"Blqn[SWE %jCHmi=?%0kh'eO5Mi<*!c! jkn'[,N2`dbXHGObX$S*R9*@Vd.50HVh7PCl@Pd&"O`FT>hNlK",.RZVKoID9C44_.<&GM<#'39l]? %^@$RC? j=nG1BgNkIn,,RjY9=XkNLm7'\)XedE)u:3P[jm\M+M]#H0maliSZ0f0W_=V1<tr7&(#6MKD7[mFj! _4.P(7MU@.;AKJ0J %^K*k_eb8_)o^^8_jitF/g[@'c6hm\c@! d6I/q<cCX.R/=g\a#.qu>@IjL5q,s*/ttSH/0=p?/=qW9I+Rqu4=%N'H.2qX*,+jh#Gt %2kQ]!SbG):hgKeLp!j5+8AE&LN-jY"-3YE.'04&sNh5,%KV(6*`\B>YrIi`;BXSgK=TSa4Jim! k7:HBs)&.k!b>E?Rm1cE<:+6`? %(7d/(r6[a!!oYee!\10!%$-PQd'Bp8b__H2+<Y33n5!AK! EmDZ=Th]?,C2i.Fpb#4S=AAo+qU$oVpG;\'`^)#S=^+<!dhpf'_VS> %!7rMl"[HK0[Pn'X!\f,r?\\W/!okL`1<,hL(P<#GaTMWRoI$N`eu)atGY%r*3*L-g4oJrH$Ti:S2CVhk"kp@@/@oZHSG9s!Zm7% %]2"SR__@gOr![f->_,%B"F"7=ATf>'9*K'sPM9S2)8T5eF[(<Jh]/s=[&"/8?787(Y<ZLV>1KhX'.XS1ieu7k7n[H939TLT`V4: %S0iH4Mr;6GC&[J60t'k3I1J@XGRo1,0<#<[!]uar9p(2s"Z/q!)ToMYUnIjtbPlBuGsepB$^IGj*T:jER+:cS?R&O;4!5?`WoDg %D3L7mS1q\6:7NC_q)j$#h\bMYeoLG$b4uC70XMuF=l5(Y#>U:6e7hPZ@\:mXP1tif7l?!4:]Kb=r? #q9B0]31a,,W`3kT'7G-s%4 %.W8&TLd=7>WBfikEdPVUQ.]frrp(,G+)L(L:_8VQM4'E5TFtm.9U %u8g@US`">&E@S<<jV2%F>8kYGC]/]rVK>pb/r^^5Kp\=o5l %NUBJD.WE8_HM^)Ck"l!r'a9T/9LM0t'+S(pp7e5MSOl0P:)Mc"d#5d=iI;<2nG#!4s7lBWgT5A55kE`<Tq[M)aLa)*-dnek<6P8 %J@gn##5YTpIeTa=*EMN&N8]5%`HZ:<ci#5?jK*[#b-Hc^]p:k@cR\qb\!1qA;H! u>5RuMopqUa]H`9\2c[&6s[J@p?2uiG557Q#T %\9N?,J)6d3]/Y;Lq==*6Z+U@]J5-5Yiiqu6GYE"#N"@8Wpe?V7psAo>e*@Jj4e(9W4`(8LHXEuKB,&hS %iLneH:S=5d[_\l;G&&> %A,!p\Om74LV$4)6]*="(6j<O5,S<LO)@2<d+0\@9F9:8[L(1Ol+J'B-N! uc;@,5l1o^tlAPj2;R=La=q2#jGGSJ1I;cK^455,j", %GgR?4?,ZnMZ#kbn!T?&s270stX_([&gc_NoEAI6BUZ8:@=<adi&%1^:j!3J,_Eup=g]QXL=GG0l=UPD>Z? %fE50!_013&o:;)7.P %kNKE>MR^&hf,d]/k)okEM[7TF-qH:P)3>o7N],]'5T5^c=,HW.VtGsDQHrXp[l#c_l%H(J`"? gNr"&A:X@IkN&o`l8lhdW2I(BMd %`V'FjO&GZfO_DD9-@/d)Yl\,CV]PQVb=2^[m<)3o<<di4.q_"?B@J2<,!?T2&]M! Z>=dF@nieX(qs3]hc`]"ZdV<3?o=gb-.k/Ma %dJOM)m\@L@`7f#,;<->F7=JDO7j[^k33r#n/0.7'r2<+SXH^1???+`+YI_/DMDVE% +=.k="h/sg&E")T@#oC>hfMZY]9VAAcS&c# %r/^sR7/^POVj0ICdIr".OY@A4s(p3[3:RKskRZ.AhM6tg[+rhh5@i54jmRB%+$Y-cIJr5n(Ot/[WoJ[MH`]]q!2;do^]uAQW(Ju %EuOZ'(Sq1]n<hZ<gm<rjrM#O0dBaBFq!0rqiEB1u/mYQ/g>24(iimlcU\T)i=25!;lE_M*R@k;T7^! OF13h-T'8_W\(*euK!<14T %#N7%;? q&RA`nYD,TBpaU2fClds5rJ3*#h\UFaSd*6&u9mi(ma3FZR_H_]12ECE0YjaAYY=O$A9jijO*A.g&_$ome! 9Og,V:J-29R %Y8n%.+%Ut-Z4WmkI"/uR]O57Q=-nG:(:@4;jZ!N.#++F[_[rW!l3A7od2k(<=`";u`@*kX10f$ $>ub8LP5oZC1,5f`C-D'2!GBc3 %%A?>I0Z5/#Wf89sbL*^-VFZ2WWkoU1bbhmP)cZtU,;H%3kVc&uX<VX? osr/b]naGlXTtpLil5J"dPqIb4_,AGAo.hNVk7H2('UFb %d-)a+Y5kiM:/4;H7MsT5-3K8ok;!m"JRKc7Rojcg]QC;?nB&e<:85oeEYsSW#]'0f(-#\ +@0rS8`@$5u6#Wq-XP:GFSjF4fL_]sD %B@=ntTKPu@s5Z#[-U%s<Hg8#ULKm5O%!?MER[R7S7]"f.8WjN7.Nj%Sm# %en&3pEqU=`.F#;sWEW5;T(@Y"g.05,#"HBSd$^2ZlL %.N'jM*c8i9gSg94]Dtk^_M\FfRV`0p9TdlB(m6ID0FIHX(lhf1(^PW6cuK? >D\]r]:;EVE)B+M\d"@4SUac?p$Q80Jd<@jF]H=O9 %Y-ZP,L*iB"q+osH,`a]Y(gKui6!:1?BIbnTI]KnKTst<!p@@:U!^,IWg'AM9CP>8g%%i\<7MCI&? jU<MX:fT]'tOAaWof>:A"LZP %M<^0'N)]l[I=s>S.+3DY0q?A*6SUd-*%bP)d:K&&6(r<l'3^s]P7tKimmSJn\40^BG]X? (61@j)J4Z&R+L"dPXjTMMFoWLuG_'Lq %A&VVfldg"*#4U+u_ufG($[#<4c/KJBl-\-C&&pK`ed)E<MZ?3EZ)rc.DI0,prYA`9ID1n(d)YL$_E;284>)gbe]^gJdem+9EC)[ %N0teWlQ@)nN?bJ8HrB[TMdT24ejCI@0R4RiPt"TuUPp_S&-_l> %78JT<f9G\k_e)aYr9VP[:OqHiXCOiFtJ1$:kEfKUM/u@Cedc! %\;f.m/CR7:RY>jF'M'1&jA@.s(\oZDXp;;^PKN! #NH'#<<k@D.piRS4fdi[_=e`]b'q5bbi/"DpS(YNCF4?8dZ#rn"b^&^#ZVGoY %^rO5*<!!Pe;PVdJPG_Ho3UeX-@5INAZH&/""@'e;/ec*-;'R9i)3_=1^pLHkh.,/8O<--DZ.BI0mc %pr#6TBPItMo,#S;2HYe3tC %>7]Bt!]T(kd1dt/lVQ5Jb(4c)nmG+p*cO+QFZ#n\8m>F`i+]/Y!KK-]B%3NZ=hk#pJ.[22F07! j$`FA(*,E0u7W.Hm)tTG1(CR^3 %/D<,S-:=Xp9!(fqFK49;^;sun`SS_%?F-XO4?c.pJ<!8[<Q'hBmA!j+0o:bh(W'F8AE]KPc'&Nsa$ $TjLc>,ARYtd;aspgNXf:fX %;fdlr1@>I)*,Z-*Q1:Kl0TUh`q#I"6L0u;W_,)Xf)fu?\C$V<DJhuhf/MX97q/ZSeYoluWc;n,ZfaRKr,D7rg0VVmct3R,:9O_* %/)1nGo&j@=?Ie1P0QF)S\s'h:qS9##;Ph5A<Ssb4Xpm! L",W0`&08G.oI8eciZ(kih=A`W,=bHfOCCi1X"Dks(p<pUhFXWpfJLpc %U=E*[-c;q9+W/,fdA^W@;E"^lIU-Y:R\9@G/2AoL:Jr?PYp@g]B!bAk;&Yo[<%@J\!jShWT7sOklI,lo*!+N35ZYf.ZNIB&4`(l %pDFnkb1J-K6$fMhIi2<]!Z[`a2UN4,!LIV%:EjF0H&BWBTc-knW$?9>/PFk3*GU_O&Y:? 5*F,nHF6rhn+AP(;>#ahu@P\$Y2#sYZ %g:@a8Jr"t06JT"/l>fK9/*0?*h2pj5CHW*gM2[95L-)<'"jA`_$65k'jAAKj"2jZ5@9jqE2Jt %skX8ho;nnoV("P`'f(6\kFiHSR %.TKKcNEPs,F%cGbZs+S'+u[RFO=fPKU'fO..WX>V;X5Ko+g4"_4c&MkUED'@@YUB&k%Ja=J5c"i;lE6a+<Q?<3g:9?qa!`KqZD[ %7T_e]\M/Zib!M[TYQMda!$5)l7E7j7.tfZiZJt?Z3]2OledD78b,</@WW9*Q0JO@W*u$fETI[WuVfD$7>V'c"?0d5Rf)r#%*B'4 %p<_2W4L1,0P0K%S?dsCpj!/foW)dJIfs2'IoajAZ"#A$4!HEn$R*m>4g"^p_#&+tj? (RT#J;o1_CBjt3dQu4V<-cJEU]o'XM^0_j %"ias8(#aVk2)ne">R.\+b?+o"r)[tJXFlsoXsYu.J.7-/Tlo)+&2#ol2KB5&0p;UnW!ed7=b24SF`+S% (;O^KJVD$^`B*L#A4@b4 %lkl+BMY%aCXYEqp<]!K5Gi`/VqlVA<>]:NnPU %K=(QN04coDoRV8mBqa)Q,TYLT7EjAr@gd<nA!.0=asb2bk4VV6&F)!l4QFqO[U %G5K6S4W_praVd'Q\>>"U^_pm+G&S4<`MUUZARBTU*F#H$5;0.#b"0Z;nQ/8/t&;t&m;N&^^Tij7s&fTpI_HjXm\8`$?B)c2*2S7 %5ZT.#p%$0M1b:YF*tOO,6_J*Pgk-<$;<^<i(9C9q-n.1!KW82bC0O8UP_#4'g1q4fYEHi!!2HfS/@.Q)_SD=lKFKVB`o<u0+/ND %MBTd:0t(>N.[X4'Xl9XJWdHVgSN:l$^,WR"?X-X,')g/TOc_eLE!2aDU:Tu1>M7N^BPVg3Wea/F25Jjl? O9mIQ3)@6Zlgp)rn7XL %S@m7.F&]6#]QaWGdeQG<',q/[HF9lML#PqSbh+J6/^hX6HiZ&B]KXX(ADL#$n0=m<VF='j>cYmY/K. +eibS.=N5E:5%?E(;H"rWa %@qYIt-c@5MK1/'NLXR*=Z"),_ims'%>\NhnQ=Hf4kVO8!Gtm>-ER5gKV73sC;! SMe`8'c^q^7t+SK*4dhD3%J9&QgPUOBMV9gsP) %jZRc[6D5$6[^QT*+981M>qF`JYR\;\7YJ&4J1PJjMu*LiS9.=n=f`5m%Fs1L_6k?4W8;aZ1(7h82*,aF'4O0odX*Lkoad4*K`F` %`<p!S/Q!hn4!'?UOULH5p %VWHejKNe>7%6c:iPPemD5b@Vj8a</6+PTKn#m'O>uW8#Z3qp/UU[=Sd1pF6AjUd0kgct8?`hZ]&%'s %<%udp>.QZ$#rF<\ZT#nu=*++F;Tt:(<_GYZ#MG%<$MbNRRpi5Q7_K]q#dfWYCl[dA3jA=RZR:1]e^mHQ5?/?Z&6EA(-ej[Y2btH %5u_%T?7W\Al,Jdl)dAWDH,VQYKKgm./fe#:NMUL"3TI)oW`$l790)9nb#fn'RIftL9VY(Q#! BhZKf)Mf>XJ.2'4PGW%1coXZa>TX %lGnI:-Yh_H*^W\p*&8Ia,9E&FnaE9bJPK1kB;)lGf3&foDoaf$JXM_$.j_PB/VPmL7@L+S5\gg8]gb^F! KbkRnI$nT0KSM:,GJ%7 %U`YK:&*Gi?D_@dI:qk`RXh`2&MZ:(6n %k19VIm)Ta"fqifoMg_TE\**n$Rq:NhJnmHHo8#\@PBZ`^MF(`6kk&Mgkk_me:$hS&))\ %$W8p)'KA,S;XD;IE*@.UEG9q\qIl_CM"Ml_a_J'tBNr,].7]5%i?Ho(]9JIX1VM$ %is;^fB&L`\N`I>d;Y7?-Zp)$g;7[SW9\.FH %j,0RbQUo]'PH"Xm3f7g_kGKBu32s:+]ShR(@o-X7Yre88k1i%Y[K3I3CnLo8!CdEYR(LNbcEVKA1phL# %tb((]+,/hiFPT!NiS/) %pK]O/`>\kd)Qh#Zja7'b.'IW@Ypn@6p,2uSRYb9Hl_/E_'=JHAn,n9F$T<aEb<U9&D=#(? hO^KpFVoAX@^R$kpH\W/L!d$TP^:n; %[T&Pj%hd<Ml?jh\`O`FX8DpA@-$P)/k;Dgn,WZ4W)Qd,9fgu/r(0_TESpDD/F; %:ZTLR>V*Z2R#_/\^Q[EJXQOU$!JaX%.#N%:sJ %3tBho\)NsW`'g7W""\J?&V1j%Lo^la#P#sP3(:SZgM/kOj\^<-UX] [M/k0M,<en`=m?)ZSXG/IkVX$=\20^'#T))XTUP0%/i1t2C %CjZ[3N*4?D,$/?CUk",5^M(3n<qr?PP>PDMbeZKJAD%1*I\Tn2\#;I*WC0^MJ5pmt] [\Z]>ULC[2'(J>NA)9TjXs`Z$/dF>/?J+Z %g?Pd;R#UhdA2!\TcA7[O*Pb:u33/q.!>s&B`YTr0!D*0!.k\Y(H#jUMlD>=.m4,W4C@fP1_SclkeLqeCP?D,H$q4'_23II?W/N; %ooX-@KRmkd)NVb8Xpqa!oc#4@N.X&,P^jdkWi!JL3qPOD$EBj5R<YhN:=.S4RjVPJihV:4^u:dg/N[SN0BV$>2dWHB]+q7gm5]@ %'qW<!%!>QE_/35FpuHM5OA$6[Ou1@P7(!SrC-c!$O&FRFq$:40Ji,)oVe$65V^>W;A;/"BhXlgr`2Nu! #11hbqpE!Y<eZl0BrY$R %EO?YiX*2u?AK*r%N)"DS)+\P8BLu(Ok\)J2U75m<FFfB*D!!GAa]G_AjE)l=iDM%tZ! OhIO3gq6C;Oj8'*=(n<RiS,&Y<de_+?_m %\AL"FJ[OhV\Ti;4<XAJ4<E.gR.@,Qu,`h:Y<=:-E%fd]G-Au$e@Lp_A*d(&X>j]RA!3U$N0:EbFHb1oV3^$m4>R3PCfWC(WjRTf %D\eCEk<WtT8Qu6A4b^\fXN[3:"4q,D,RoLD<cgr;)M,#Da]i2c^pA`6'#b<a#HdE1[LiO_SSli@l<m5Z)O XJIJ3Yb?Ct/(a!\'mF %/a? q2N#!"!.26LOVC&]b#UJkl>7OpDfl@uUH_8i^ZEX05cH[T[;Uo;.8dCK9OnaAN)QQOo&D3NM/D*\`naU^Hr si-_>tt<+nHFRV %@bP<O6]E=pc[_OlXU`l][``1qOg.)nH$#tS9*D;6hX<(t*^_5grH[7&KcN\<KG=V%X`2j@Y';)C*'@O6,uf=-^s(d*VcF0[+F<< %:>$._Vd);ZSpN/<T*r06V2pp_(\Pc:<rIY($C/VQ*-8Mi!!C:.9SmOYKZ7D2M %i'BT]6^B72=5@NPO[3:tSHfn7F7^^f2Q)#Tm%e %8a)pqO^2S!^`;=b3Rs&:-=E6G0VV!:%h)Dr9k"CVK0s&ZV,(\X:O(5t'0%lVe[;\4Ef %,!\8lV\V\U8q.k(7ibGif6$W+1\\0iR> %NrWG75[rO[OC4IXY[^0,MOiNr,8LUnV,Z3L.=Dtkoo.FO`'H//1q"Ha$CSd6#h-X0=b$ZX<=Sbu9TC]:k)5,!Ru?B1H'I1ig_\* %[&`o#)JU>;D9>U">IFu@F-B^KH4,O%;'%;>l;(99UTI0)%A:CsYAMOl%;V^i/-@(e6Su)IY7;HE?YU+ (/Q]L%XN2u=X^E`Ol2:.k %kCZI,JM$iY(WaP7P)IA<`'Jas$lp6@eub5M@L00Jf;Yfm,G'4`n2.M.5g`=X;Fn! t&G$/d+ik48Br7,=WZ]IB]QDL/'hP^XGb$9T %hng2F'W0Pp<u_:"Aos9WBI`\_Y+;,XDI"*dALmU"T4?oH?)q:>D+B0lFJm`,dO/1TFe)dL,N"4*i4@pFXuas?0YI*AYWB3b:u-P %//N'q>/?Y%!O1kEUA6mM#t/1Em^IU!5^'@H9k-Y.)lt#ZN.X!is0Paq]+!g\N@ %`lo^o@1>^fpQeDQfR<qi?WF]9]T3A#KK6g`== %ZcB%2^>efJ23')m;)Q't3%D2Ze@\h$'6%.N?Ea+o`1`+SEPY7^F=JRC=tJm<eH#f^J:r! 3m2t,JW(no,0c&S/20M>DDqsqZ]k`<< %ff@7KK<G`#)mmc/b;'(64B!b/1rci]V]L/!V'LU3CEE:^Q`V6`:hb-X<=!-dJGAgM1LjX? +i2\2.YFn*\7O14$ft'99#iV3Pom:( %;Do%AEqmNJX\FYpCF'hcR]ReE'+R?DnR8"u_PLdS/s3IeH_ %KDZpfEELZ#(aNk'63JZsg-]I'aEW(Fk;@e*C\J(5q23g-5&<l)`P %f\N&sM+IC`@D5j^33`4D4MP*ZEL=s?8/P+b(i%K8?)<a2PHO4fLSUUSdTbQD>UIf %hUX&4/HD`]D^(fLK>;4`7o3W.?39(S9hQoY %W=cI._i2/,XKq^NSlc:+K#-Ts&i2"!X)r4ub5`*p,qm&C/pc85;.J@+&uC\Wg+FRT1"qg:7qiu?U4:V>,TbkUdYbAf_p=1@=cLH %9+ffpCFY:\8I2M%ll]c]_-DXE8.;$a(IheXN1gU^&^*]UZ:S0BAbHKVQK)^h7? V2H:5W,H+YgGI#'I0#7)Lrn%2MD):4`%t+gF-7 %UB@`+eMN4'i;ch/0)MUZeEpuWNK/%`.8NZI-29g1Cs*Q_Qso"Hj),h(!8jt;BJ;#X>In0/)O8K+Z! fA.R&Ykp#g@oQ&k7b\l6>^1 %.<Ccc8?"SV*^I<em;Zr;ah`Vb<WXtKG"AhmF'q!Yh$rMOLYd[6b[7$!TJ:+o*<7/e`OK@ENg!!Hp'@dF? d*f+4^/+8;W4d[?E*6X %9#>75;tj;7$#?22CMLXfN%i1f59EmB#]R/7&0r*O4g\rTgtU_4(nBkEcV(,'p7+.Rhci?.E. +#,mlQ$IHhJD2l_8s*Lj9iKP"<_M %8e6.dRlZ1b9IF5R[8c4IJD-0pInL:^L0c^jbF>13R#L+ccj%gYTK4YM`5YAY(6mL;Ve$=QG=&+33)SU8VF,AdA9)+#St+jFWCHi %YnK`]XH(#(nXW,NS5%:i*:[OeqdQ6C4P)]"7"`C]5+.$7c.g7ILhId0Po(^t>8^8;?CFo9paJui^er; +]@=I5]gulEZ3Nkf8K2M& %'e:Wg(DsU/V#+uU[^.Q2NXjuh/UB))@M%1ZO.;'?i[,t2^M'! t&>n/18LPM'O4TAHjDS0+J4<i1,tLe7(J2:hY<]3<CWG6R3H[9d %Cf#H6HIdDDWZf)kTe&nK,Krdu&f+f=SfcI;<6*U#)26UH.Ba7%(#od%mQ.9NY? 9OeX?,12,j]ES.6EKe@lneL[Vm<Kg"@@6QpRM@ %(''WY#$fR*LWFZ((.k3&k]P+t<_FJ#0JF4$<qI!*+9g`\gEn0%bCc80gC[dRKqKXKGu(?n+ $,g1Ps_Ysg+d/*@0X`MH[]5jSN8>g %NIAs?Z^TL:c@L21.8Zk](:o%nS8B30B,]-<Bd^Tjj5,aeg@h/l?6k+A1Pn@>bViYG%WMPRD/2cj!B? %LpJGFp!0"@gCrf10-t/MS %6a1GIO:#ELV)7B?a"QQ:9t]rgE&I^6<c=M7T9HWZ;`9Jc'c4FCYam2G<jk#hAe8XSmf;SZ3C5_Z;GDRWPrGHJRD[i%8'&<h= %IE %1$(ahL.)6S%_<)r<VUWG'ua8hFU,\t; $p#PiJT5+BQRmFQ5XN_8L*)*[;#$5ebPkpB03L9M>2hRTUSe,Cs'QY>%Y.P-'R,>AFp2, %<FaRIJHsB3<X@FLIV@beX&mV=mCm7(eqhhKM&TGcCDp]p^Gsh<dq^hJ?*PVO]QaW?*iggSMJ+j? [2)]L31@He)+^d*H#8"(d6aBJ %4@5X$Y+@p1YD>BJRbF;7+1%Q@&Tf+4V)QY67RFPF'@;p>[&Me@cq%6r)JB?'%T=G;.#*$0ICc.+XZdM9[MHfid$fLE<^!0_IJgQ %;@a$V8$tE4O@(T3.j6M;>e!T?hf9fk`O9SWN2)YKgQ?[?<BK:_.<%dbsH#ip'r3MNM5M5,s4INc5jKY<u-6c*P*t)C#"RRd9@]e %g'bc\,Gtn6/0'Y)q? D(>JiIlIaoSiOX(6);F@n>3LZVM^f,lZt(17P3UhZ>OB\9&*F(*OrEK=h0l)@$Q^d['fR4-G6$FcQ>H4i,g %F[lW3d:$j10M?LFP_Cc"FNFmV,\aQ3i/]RgfbiJ.P%oCEgZY*BH^6OpPK_YpZ,uhl.4Dhg$_IA#jS@Acq3sEI8:fNbf8SH:0q-%cio>AZ,q^_bB_jgX;kQXCjPFlIDn;u4f=$]D5Ws."jVkljRLjMQ)<]0]tjFHePW.1/^-5`9XRlNY4V>8j= %OFBgNhM(d-1)q2?-l %;m>Mo_R2E`l7$9%lu6'g)q-,DK__XjXW9`_n<,Wt890X(a;*;0PjNZ#eD52&NV'mo@Bd94.#(d*<iHGg+Y 16re^08grKpehD</Sc %G\Xd[2T`uu+q3o[,YBL5B3%(f9#II0'jp-3Cm?u/p0-F\La<fcK_8p-;YOP_4L4lZV;DBf&Tfq\oi216So_nJR1H\[A39A[\sp` %Sb81dbFsq>e\SYR#7F!)1$nBX^T<\>JIh6:TOu[u9:,8Zn>nbhWFNj_VqV\O3StO %/MNYuD#bS(W(Ao;Idi$+)EP7#J;dNO(YQtJ %>qh_&*U*i2D*.$U\7uO_2UX3ML<''hBe'Gc+A=^@OgpQ=dL;qEa>adW]TV].kCnTAo3``)Q_T>beeNs#<o8h$70V7\tGRB`,kDp %;T-G,"82O9YAUNYY5:2A74SsY[M;J2:Ls<6jTI*W-;%Cd>(o?-e_'\jee:0hG+<dO7:lg? Eb\>q\'nHRSps%2C=QBb&)+P&SaEPK %IRjJ*<#XRF6)OeL,2bFa!YS%FB@Y^NZLD*S$ZS7'<oEr5Ni_=_B(R?!m%dfW)d#2\6tqn?d11E:'RS9"Y:mZbD$S0mR^;$fis;_ %e6QDee;+6NTP%OQ]HL1:h!6H1[t%^FkRkXB<*9<$k,-;6mHmF`Km4grL\,ZO%QMU+ [rddfZjeX_6r8p:d$06.\k<:em/SYo,dHKL %`ML/X,j2=Dfinju%mrt#<iL]Y^g`#Y<LF%a36Y=$^?`QEWi6Vl_t/WDgr@Eb$.-PcTiKn,M, %ZAlXlGfGo+b:ok>JU0S4CCH/2u, %2d"0CSlXrQR499I-"9ckM:H(:b$`b<_<55'9G)0aWt9*pGC5^YXQ<^WJ4Ccn;=]m&pjpE=@5X0m? e9,A`):B*<eo/39C#7eVT;\? %AU%h(TW*ta(Q3'_B;[hZW%.PL[?gl-e5PidT!]9^qN.p<*m,aRbLEF! 9A>^\=_KO5XKaC]#kV^jN)m)JNHs2O\j;X48Ym*-En[Ti %m]"T8#M[k%GZt?HY<(DDQ?:#,!=,Ml&%hE=9A5Ka-8(M#'A[b=%??>Nna*/>;(%L! dZVn4;af&"3GBp_4uW^THMU:aj,Iefnc-[! %^X>D0N?In#,G'GIe-tL2FGSRIrfO8f[Npbe`',o,n7$RJA..o10%$hY<rd\KZb".Wb_Yb^etj[a:X!c %2.YW!RW>ZC*XNk;MD1lK %&J*obcuH?8?YDG</mOIt`a?E@eF#S\,Z+t4D8e>d9cMTGA2</'r %VsR<0e/:4IX5I]ms#UB5O['>GAhq"G)(kX70M,%o8>0=sMIt %Cj=`plm58MN"ksCZmm@PE^hkdFh"28k3HDfoL;$J!.j"Lg_7"&".Q(4Nn-M+f\KF$E4^JO2AeTEd4FZKZZ_VQ`8TZ&!KO.`C>hc %X7Y'pe_4^=go]<$7In$'/u`?I]fjln/=qt>X[7H$pBLFAJr7Q>r[9(NQka)>02X]>9l)`\^WH3Y03=U0pq0H8lK;i*l3&,E:b!t %Q<:bUP?[eF1@06^Ke:FJ@!]1jZ@HS)p%YMik[0;88Nm(1]c?^IOM?-6Y>dQ0pNHC"V8p8_.F);-`36RSJ) (`>T'J%7noUW+aP:_t %"%?!_**+l68kV_"/Xb:<HEAi'iZZ^MQ>il.^=3bPDFLbfnh<%Y[Q)"SnI%tILbkO=A@g>>Rc8Gm %9Y/`U!b?4j>&2O;Ug$m %)i](F/ceYk)C($dBXKFMOA(%4<GU#0:&EC38AT;U!opSCUO$TWZMd41l7$Hhq^<I]\_8!^G79=o@A=GCj=9'/Tc;YOk2!P/7\u3 %:RR_3lGH292b]1#a"Jja+_Ua]Cfu^$9K(Q<YX[i9-K6:bLTem`/2gOKO<tFh!"j_]YOoTjD_::G6%-"UgJFZ&&TBBC_/!Vp:S(! %6BSeH\0cAYQQ2jjBJ/J-@A;6@dAT$3c2TE+jpfH`nlrsIUZ(O0OkV4AKFo!#fHuOh*AH\#h8ZC1nN? tP]mpt1Go".,if+0.F^1[_ %DN*^cH^N*o=@o,Aj01'r2U,coH=?HW]_EaD\JuW/Dr.St-/\C8+q4U7ei7+CK'2H(:!fhl^n]6'QnoM? j(Q%Z?p0L0\,%kTYYJY& %@@d"[_B%2HL!dFQ]Tuu#a^t[I.?sWbg,k5h3=!goFN@$C[L"90j(6*-E8P?a#S`7iH=E3$k9NN@YTnFhQ'*RI*4H!/9HFH^YQ\G %:S;M/L/&]2\_)#ln";qFCF#QmDo(dY@'K'J`9L//MW(8BR`fb51P*5:Yu9Ac[`0NTkure$cpi#Zi/jljfp ja!ZH[e<2`?=BBl4=\ %dt-Bk=_3RY#[IfBBgT'S50%2N<A7KCGTlKJ/^VkKb%%L-G`6cHq0YmZ<Y9TklRV %!:i_9**V6J6O`c)YVOZ4[]^_rkR#oqp=lBb6 %Qa4.H;K>I*<b62T:tMLh<W3fG@]i$;-_]^H89%ZNSteHMEauNofP!TE#of<7OIV,ECA<_MD)]FR&t$Q9'3B.E6]M1A$dGUYrAN+ %B`QcJd?g;1`ZS!41hG,JE^B>p!60ud=f1qoc8e;#eXSuf/[hYu+/MJ]Ro]? &D7IW`p*`*#k$`'hTZ3%pV]F%\6sU^\GiRo*8)<qZ %c]'L$+q0Gq7njM:N9lnBZLDWhkG"'KibfnHabi]r*Vr]<*@ed! 8&cHn95`8867&)#`$u;Vmn@S$IG+\Tm8Sd7p0haill6F&V$.0H %? S^9MH+IT<.2@Fd/Y1NO)D(,qcW[gmkW*XP4Kg2j,PkqNpT/,/KgqP1[n":bH`Zbb&XHX4cS[mm`SiP)YEEK ``W^K4)LPOdY%lKe %'msO8lo;AIm=^me\38U$C=.r1VsYr'P\%3BEAFHKB2TYj;KbQ"Qs%9U4122eG).CLO4(\o1Dj&Akl7U]B]G/Ao4<3'@hW@\)9U< %i5//2fXh?X<>'J.*%.5"Ha+'W/6j2(4:?H_]#*Ym-ec6Afh;XQ&@e+*ZW(^1<8adf>ZIj5-+qaP %0rpBZH>e[phl?g=4qj.MoRNc %8t,u)=30,J40'i[D(Sjm23'`'78jnsoVjV$.V3S,]-j\`".4m9B\ %PY;_j9AoP"iLUonsJ(fb]YGIJ])LnG.lJ4Bu7"ub2A/9Zf2 %f!b3Oe`=+Yjq?F<5,.S<@8R@ghmCAHNn-uA:XI?#=B\mM7FjDO4-&>o0WT\iit-i3ZUT? VUP:39,:INI+Cjl^p,YTiX_;fm#[\5C %rmb4N\>ZNM$YMoa+%DZl.(a'P?"cb6fjBdD/hB&;pX]b%33=i'0$RY\h!rFpeF.N^?bXSK'duurF+[IG. $GuFD]4V+1Im!i__^>g %J2PTY.M&S)4GrdX0s6k[NX7!6T'&560KA'o;<jWFk"4W8=:3?;1]p28[X=TE(nLNk,:,)87lj`dM$Jcl34<!]mHGP^O%HE1\jO4 %pU5(7JWIeLk9<5O^Xe4GSknBk:XU&d1T31^L"G(+YS^stN&i;"fo.,TV'p5a,]rGbYG@mi(5QkNB2q[.CU @+'\#Lbk.Wpbbfud_8 %U!\3e-gG>Q-$>>6FE80dXeMDi(n6>ZZ)\Mb"%? 8dC(60C:`bc7FEorA$[5Z4h5Wis>0U4#.NU[jPW[Ts#@V;i]]19j<j3-(a63ES %hDIR,WqYeRp+3g:SRjY[VIs3$J7]%<N7M]QoU>0;U;CgY>?cuFatflFE79.eb!LlN\2J0? @BlaV[WGT>KH,u3Z+38^_dY=nBW8,T %B(1bsE'$P;A(Oq*/<4JV9Tj(pL:)](Znhg%Ec\hG[1lrFGV*tm\\62W%'7)h5Nn$Ed>eF3rDEE8S2bL7s\527/+XPZ6?)m'KFQ* %?!H+30(`n%l($W)BqGPM(2;*LZPD7:Tu%_a<p7-QJ0e]IBt:XQl"YP;=>"bKDnD=m?-VY/RDVbJ1d"=bKSs<`j+S"<=W6r`>-*M %B#_=U8nH6>bh.p.l7h0/9#tO)O0Y3@FFo6KacF1/Wt&F]S?i$$_T-@E&aO^KR^RnfGumNmOecmdij;0? RDX8]%2Sj>GnV3p.K*S@ %)'@,nG@,)t52#7UbfX2BY]gN)CK*lK;HlZ*Cf-^?XC"fZ5E<'aXj)?HWjsBMF;`YG-/(NsjhO8B!p %9Nlshjs5^=sSiN.]f%+*aU %@LJ0sY"1(cm$QX6;ijM7l'ga?e^7$D^7sgQp0-S>25X`EO/')b&q-D[#cj8J?M?JPg2E(J? VsD:n\iI_32Z?iHkPbP11\n!?Rm>B %/i<"]$;U@J2RChrbSps;ALr,+l+t!#H>A\29$n>iDFfkk?=3?p";$Jd<@<^1C! RH,67f(%DHVi2=nS5hpEe#8Ecmf^&K_L6_qYmO %B?_;^-f$<SIYS?^W+_/`=3HcVqd6IP_2)r=o[8jeCc$H%eeF1GEp<YMR-%^:? s]YXQ)Dh6H<*[gmO8g<F5nb)Xq(3Ye<Ur]%pALU %U@l[(Pq&W*nZf*W$X?1_gu;i7IZf@afY!1J3Q9GOplsLXV.+hAHL'*#'!fK=3b`9C-97p[)r8:S4,? q\hWeBg*GL3peO3qGA2Mr%h%_1MUKB$PdYCQ`WAMnp+'Mo*1aCe"NL+p<"YR_bVJLN]Q-!L,1*7/Q'i^a&ccC:eK"dVn]O7cZo/_? OEOgu$2$,@C3Npr"PVfM. %I'"0>*@W7<003;f:KslVRZb1]T3A;&>*`_O83C><<BaRKW&=;Gk2iV7\!4jP;7*fNib1>$e+AR[TMt[69AWB<OlJe&4a+LWodI7 %;6,k"</fB2DCM+aP"q><eWk6)c!=PH^NoWc[ERl,C74T33]==D&7,^d@gD;bQ4n2BI,3\k$LD[0oU9A! W_qF\q6@*Kda9u3Lp&3# %\qQSK!K,DO@[O.S*G'6O_^G2YC(d.h"7,^FS8B:LZ83U`H^d?ZHMdrLos1>*^ZYP.[+MfuVT8d*h7=TnA\ $V(N^jK^[?nJT*^bRM %7H'\C@JI^;m;sYj-jBN`TkR);K25tf'PgWl)!mJ%3Cp<2#:u! de>u0LSi`L-"=H8lWDf4,7K<t/g('$'fX#luN_'rA+d/iGopDME %G(V;rjHjmA;]QO+rB<l"@98b#\$ +>^Q4<@d[jU@NUOM7j)L,JlKh(W'7<;M$&a`;`<+2,nOBAs;jCi042+gOM'g)2$rG*,4$`T+P %Zm<bU[r\q6A*H_MdB=Hc&,s`=`-,D3q+U_A?6Y.>Gq9[ij)ut'W_%Yj %rUSNXKiq/\'<tOis*lIVjF+F,TE,NVF667$BYBAAfrH' %FH%5s>CBPijL!ETK)(^'m&5S+QZBZ3ULuEl>U&PV4);qeL>`lU>%>>o\*he6SmgKcGY+cTK! %i/fW<]p1WSSaMS#=pF\,]!R8j8L %U1T?]VIc_Ul0AfUZIHfrRXfL+)=sZ:Ba91ERt4Jc",*m&aP#^GA;A#F>`Uq%Z; $O_LZE/8Gu]E:"F#i8[)Tg7G%9N'):t%^k88)g %cm5JY_ua`K\^*oW1`S.PG?)Krl<pg\@#"O0g@5N@<[kU<O^k_HS=Xus#ZO!`WK(`Kcr%@*#: +l'K6,B0nm;Gf"j6XV"SCN$=`P9; %(=okQY4.)i4qRmtKCIN,"QCkIUcaOIq/2(H8_$ZCmu%B3L2H$t*G]lj=A8QTNO]T=e! Nc/>F!-\f^?/")<+>[=0T>0O0s6QS+Jaf %k,;NmGZ)5bXqTBna/Z."OtRjK!0*.%k]O#i.Aq1%1S[>1N.2$r8puU4Ja'4%#!:)>S&; %@Do,MVBIsF:q&H\On=#Ms8]msD*l5N, %mf#CE[?-"+,EqPU<1?*lF_LA\XN[iJ>?_oJ2,RV=G^iN6Gd/ICOcMT1$@@3A'>@.5? QY;I4[0Yb7#t:UR1HD:m/6pOJ<<d*"o(RM %Te@k^)Rn`]0Pp#dg&j/.6Ta#8kDRXB_Lk>_WGp"#?>N;YRc%SYL?4s"pJc%TRJ?Uah@)V! %r=USG(*4G^#@%)/?Y1nDNbYSZ^t4, %OJVc'pIF=gd).qd(Qao1l+&h*h+M>6\Obd.g=lc'1dF0YFHch>fju[Z-n,5'':\iR^V6o,B>KC)3B-?V %MP[+!k9^Kp;]m^.Rdjr %H*q.oQX'8g?"H0fg=]VHlcaa8o8e^LRQSilI$B;/@NVY? 8Z`>"eIraBR6dq9kBDo/3CGpX,"]e]>ChZ3j[D3(m0br8_+>EI80e?( %eTbjnV<.'^>:f=)f*fT\hdpIu&%:Wi>gcXiS=EUu6sZ%q=.`GaF>8FYM(RH.aoNi_$ $&'B+cApT2VKn[>r&_u\1]$\!`*m5dGEa4 %2,<!>gf6\ea`_U=gDgkY.Q'`M$>u2@&FqB(<CWQK?u%=o[MlWC'$0_bZrb+1MqHEL9Sj%aLadIG? KHqWhDr"E(:/gq'#:Jq.:-BO %JDrP-AT"bL#Tb4l&W9MI_8$Ljm<s`Qf(-A`fJr,PK47G^EL:fNr %2hGSlIQl55\)H+.SqngR(Z-,^P2]Pp6t)eYYKrS(d:!Jq3aO %E\O[0W=,'r`itC2"(PC,+>9k;Z)GgM"-i?2k*e-#1F'ec(B";Cf,D`2L@HDrHD#n\o*%Cl,tfMiAk1[44,R&jD:=,<Pem_;NOV] %Q&2^Rp^>52aPfZEf[2I,*^h$$*KXBUT&,II>3E=? _s8gK+s+.YeZuuSFSK6I7%<>TW_'[k1"QjClOU=n@"Gs@MPudiY,r@Qb3>9; %>?,r=p#E&->ueKE*PJ2ZB?&#UX4Q#(Lnq*XeZ/8DMCR`25%u<L+iR<a/Le?T#tq]=G$6HC-CW,cI! sO0Ag4>0'9D9(6J><GYDlU" %H?NR=YN_%A8nLd</TmCk)/&MSEjuhG25rg? +]d.8Rc7K#;F_-]419<9ns#l_G8sdc.K7,bSpU`WEqYeUbYmuYTpV[nYc4Ti3H@"! %HRHa.aEl?_lF,T1qN_.%L3N\Ma>GOeU3#f]V-+$*^">qj`q'I\IAK)0TGVMg5EC/i%? 7bAEnQj71HX@^lejp'd %JbON/Sr6".;/)Hk>>#JZ;i**F3$k/!F%]-/o#0f]Nm2kj5PH:AR?:`G?*: %bO2a>RC2uq_S)'B^*\L(\qP4kOEb]>%IuBT9_"qhE %"b8mC4Hu#FZ?H;!HsgATp2]+IkjaH7`-I3q=7h$n<;X$ %En$1.'s^4heX$/6g>Q'(B]#,RlmcFI::&SWMd,n=C-C].4"BPu1!Za& %`+cBT2-qV='Y"^b_EF9+Y&[a8EF-4%XOW1Z#^;o;\!Y6!kM+=/%6m@ %\W6Da$8'>5A=b*"NQfSanS3f(4WD)'\R*U%Y9[_X6uGTO %olTXH2nU9=@!D$iopi>-;l^>JG1'hS\5o)J\T4dS1!9`7YC\j"a4CZ*PMK4^?W.62b %"GrXKqOS3EVW8Km50tP%I"rQ0!$t?!U`g %-WNGSO#b;Po!qe@F0,IrA;>DQPrKWTDXS.$ZdF\2:?.2Hd:,o"Z4(P@RI)>Vd:0q68U<_*"Nmrp/ (kND]MfRJ'<uY[TtKb,QW'8q %X8/e9JO9U7AnBINS`P$T3`ZLV#VoKJRcu/;U;B:%7l*HmAb()#FXjt!4+>:i/j-L"MG8A1'V9k! n#jUYNP#kUiMlXc4>$&OeG-q` %"T6D1g./;<&i\uP(_K^'\TVmnn1I=^>RSh+.o(l.U]-GTY?2m^n*\B(d_n>h:qSUOt>3nErtepoYc8j\6Jd"=nYBI*1i9%):1nc %Xt5/Y0*MX2"8M=j.q5X%g:M*,;W`T:`WO<MkW671,;US)HO];O>C:EgJWW.S.L8_+,Pl=IY@4QL-_-dR %U*EiO$k";?N"@U"-Rnn %.%YZdnLm3Kf&,;1rGWK976^rNf#B'p\nAeB@844!*'B<>\@uM/3M[`l8WJIHPXO-B5d.I+c4_QJN?!0Kj_uBmB)\`=7.2jHaYjC %#GBo=?G%lc(N8YgQfIj'*f7qTo6Sb-U#_2MZ&V<q5OQO>*PY_K"++puN4HX-5,S$mL`_]Te(se,RnZs24J %$J`Rl_C_*a#8q>I-c %RF5$l#s][^B%b?ODWg1e^NVnW:M96AI_S(jp\PbQG`Nd=j=&&5V4Xr-K>U+7An)X7*5YYF %ksdM!]lQV427o-7]Yn--!*.AXg,4a %8GbcpW2klAqfI<"qtmmC[m;5-s6tqB;nFV+&qo+"3jMiTLZ7jrghIEqR;:5J.<+K6A;sokUA"[OKhiAi/)KM$M%*-/HHjudTq)8 %i&ZE3[U4POh#!-K)1`iA1I-L9YdWDcql?+CI>eH"4T+-t`89&VCO8..Z*sDuqfKu!2ra/@Ck$H\&Fju:oeOk+BTS6G`m:B'g/B$ %L)MbU'Bssl>o`M3VcUoDPj1JpWJpq/YW=$uNlLRe7nbOcccoX/mZHDhr;DOuqe_ESQkq;*E7I>@r=Y0eCt&fqncioh:'UBiI8EC %D^Y&?_gK6!l$3)`,)m$TR,dMFq?;^*\"t."6@LK5q&\BYAHlD>"`M0M:W1pna,%i#r*I!E-u! 9NT[I3#Nq:ii+rbKQ6f<603$44O %mJM>p:\c6uTiV%?#+`%ajTOb:#=Der0q7Ms%T#U'/;(kbn;BI@]#.cUOKU/[5/$2k,Jo9NbpheKK+0AdT! =1+Rbqs@%WNUJ^u-eg %);s6m9k8LXN#DB`c&+gsWmb<K/m\%+EAjXQ^$Zk$/'Y_E4*Ntt5c9V`Qjt1%5aH"d_D$8qqldZ-pQbXb %c(1aM*3Mn$kC$UM8A.@ %Mt4^Xr+)c*g8_ilpgu(teD==-rPj`\+MZd\bM5:p*]Sc\8M %>7"3I5sp4YMEOr@.jGK;VE'm1GBR,ACR3J*P'fY2G/$1u:W:q1(B %!hj[B(fUEh_McuJ7L$1Cj%.F79As-GP28HGh[SF8\E5aP4uQXqlWuH%'XB%\+cM9k>P*7"(#"*un! AiS$PZ4kP.8mL-VTSe2P<.s %*9,4aosc#cXROsAp:(jP0[VLH6X-\Vm!<[h>kj:]pcI3"m88O@OAYLSCn(P6/Nf6<E:QqaW'EL&@G52#? +e?cYDLW7SZ\T0nA_\g %:qd7UDp]Z'kbGfh,b4=d*&?Domu[ZV%MsZH*#T`/9(lZLDa@C_n-hR]];uDYqKCBJPVB1j0?+S+[#]1in?%\]-ERa%U6R?:6ko( %D1iIL4$<)QhH.C_`?uE5I/BQ1/CpohTM-H'Fe^`6)0V\mf8i]1:CCC+T.2ZJiBP %=YH6V$\o#pVIQhV_)"`4E*r5`D,JOjl2p(bA %"$[+98*Tk9%Y)(eO+Q@WUc]`m-WLP_9i]Xa)_(?WLu8A:IbLH'Oe7.PaJ$Zphc2LMDd>cfUd6q %I6krhSReN;`=4Mdgd:L;g5)QV %2n1>Qkj8g3!>tgqPqA$SIJ)JUV$ajqHQ2F[3JN;/_bB)J(U? Br+2#kIN(A33`YA'9Bf7"iTSqdSo<2N#=Z>gEcOW+H^#i*Tq)#QV %bBS'3IrNBAbj6-`h<?XIO3/SFKjMqCYNEIn/\2qj1N6S":[+]pB[JVl! &Rt:gg#U"K)^#e)'4+G08FBX;40lcMKA0rRN_+=&]Vrc %HgcB3'THRRVNn1qkj<fG^[PPq1pP2O3L8dQk@d0BF55U<+8kZn8XI^/I$Z718>cm&aH+Y53":'iqqhu7%jiWnK_"MiofY''Lg78 %Jb^Crl#BK@&&@d6\Xfdgg7,_^\TAX*O&GI=@fGIM!L303$/i?!5^r, $:]g_9m4(SUW>jun8DfoDU(tP":;2oEJ*7=A]_)4_9J*n2 %'^OpHV3.OIitOMmSo8E?^uV_ClG"*YXgeAo*W*lR]Nr;"&,tC?_>d8Mn*]!V4:f'r*<R/7*c,@V? b/J(:plG9pQ&_ebS4cO<PNi! %><f^p@ZW!$es_8_D?)`F6'b?,86:<RplEi-f<K!5R%NL/hO(I^05Fj]7:t*u,M#K6%=eKkc/ (.-.uEFX48)j[k0)hJq7L4>Y@Hlg %)dKP+AK<s%.RkPOb[i#0LJp>0WNQ2("uODaS+AQ<SW:W0o'cR@GA!_$dG5D'T.P,qm%EC[riN=Rmbd? F>p0/jmuH-SWMegI^hmp; %?TeSce78c(,[*5tA9Aif%T\CX,08N*pm:FC44V\VSN*G@U-FKGT@G.kK!jDM49p! 0#NCR5b8+ru#HlU7Ap3j.B!#GqK$9EJJ84tl %b(NQ%DVE#Idc,`>@! IA7<["PR>^J;r5Q@F1SoX"HC]g':)7d'JHii>OHf>LE(%dY5n+]FM)s`(JV=7gG&]a6-bEnGT0AnoDmuRkF %&fa.MY=E_&!^n<@i`3mj)kaop.&;Bj82`_*/E/Y"\_nOFY6i&7,j %sYcg,s*Zq8j1`ttkeX"F'tZinj3ohRLf7%+XF+UHAZ:*!fa %">)S&,bE!ec)-\<@(J89?oRK`"F*HogRrq2#3GFKe/b9H%X#;4je*Xsk)U1fGDNTU[X-&uo"Jb0ce0! i1Xu^pAi8T_bjB(+%FL7Z %M*8:[=MhU+dF)P#\qZtAh`27,3P:K$9C"'icRBhk)1;jt7;b[9+n>nXI8]`dYd-/^ %'`pcs/dmhI&<4,9tK; %'&!?Ki6'q2'P7/!);HUed?/9W3*mRjc2ar>1D'ii\]cP=JlbsupfAM)4ug,85\@A3';Y;lMNAWR9@mOZ'4;>g;p4#>3\CgnJ[mL %:8H?%kJ2=6nUT2MfiJCpk6gmjq$=da^2sQRbO7jV>1_i!M-gY3WC[,GH(cDBO&1H<RMorQ %P\kjqK2<:XQUT>BPg+;s))\bB?gA% %^7eWKakrWe/uu*;ABF=()&=h"ZgP:KRG/_-"06tJ0Gs@'r`OuoH0.Yb"0c"U38';'8u\RGo,ji<i5B_dI^c*%5Glo=8s6nH*nTG %dZQG^>:[)FL>2u4-2]dQ,U6)XYuA/P=QJl! CeoW82$L@=ndQ:*\A(Mr)#t8qDK'Lha68.>D&n7h."=l*,'eNIS404,e=_:+MQ1&q %/\W6q7X%.JEi9+A1V,J29lG<f97aFjT!? o<Bq,Tmn)&<acaSS@X:nIB4?;TF"nF8'JZ\qP^t[0O0<+UhqnM&a+'sqUId,:\6WE\k %elIOa17p5EoZ/"cc#MoB,+?i);9HGj;]LD*V[tKXig%GI%HphImmKraD0QQTkq(N:(i3M-7g=:U0W't6m1ho4o=%N/6Ci%$^*#c %a9)X';^+R]"*)1W=@`h/'[N=a*`g3JB;'7`nM),.UnC)"t8"/Afsbr+#D9:9^Lb9Xa[6*qX[D\0TEj_c;A/9@*EmKe0tc[2%`!D %*^rP>'pq)$'!>OL^q;+d'.RN1IH\mQL!ZYGF([hD#;@!lk@S**<9;P@e&_%q3MECaF)m$P"eNW %2KBtg?"hlcGcc%q\jp8!XGi\5 %'>q0!'^Kf_e+nC-2<&E7MHCRVQrrLhSB^t+4Zm[1m! TtQlPLUM#ueimf7+7[VIji/Ciuk@*"[$dGDkDW0@c&2k=n:8LZRST>[]d0 %V@qW3bql&W20Z8^*,^CJB! >d84rnbH`9*0GcH#4pKQ6"KY77Xt.&T^l=a0XDL'XWOg92g"WgOnh[C15Rq`4$(i"5U`)42g8M9Rp? %7iheWP4bt@rr_,mc($JXo(5%Yc4)\`8aIU8;dd]0)Mc`Gp6&p)dc$h\J[!)^]d+N<4Ol^jTfS#D:T=<k4H Kh[rZ5l-&tqQ19"W70 %JMhh.kn4I65-<5U!2npo'0@9fQh?_sAfFq-N<O6]F].l? IWKkp$<<mCVbZ&8fB<nrmY&L.K+Htf]&`$/=[#CjVgaY%Mf)dUJ+f;J %)Uln@Dl.!enLXn)#)r=AMpGs;C0*9SJqI_0r,(TU>IO@"FdpnXF8Z^FNkX?9Dr[I4F%JUR@! bOP.Ue1K=aUUNAcK2<l2fJYJb<sc %[ZTST'aHk\a/D7IYMl8hP)hi=VSlh+.>p@hcf*&c0.a3s/X!NbI?GsfQ? bjr+ec73SD2P[kOWT#n)Wfn4V/^Ep\gM?8,C2<Il5GW %NV6G+rmb]^QT-,erSRYRJ,8tjrTE'YIWn!B:7;,u-cB^Fi,q#go@1n?,tmZK3T$ChR6o;rCS.3S>bd6E#IgPrAotN/T)&Ve!<;j %f(hY)RgEb.L?_MpdZi'.CNSk`DVq%tCD:QpiEr:%mA(noa@ZN/>7VID_[?%NL-];pDqf'7!@?*K]u? U&LZ^Fu\Y?f,*tU((Es7;R %&Nc`;2Qq"(JtA:i/obAs6)@s.^p=pF\n(H?:-HJX/gcS!@/qKN@.lXdg4l-9dC`Hf8+) (A]S]IbBYs2UOu+Y4%\kBEC,@tA2;-2< %2kGS4r?%UHTVXsRfZ,ndV4FE!D=j8,S(IHm9fNTQQr>B;6];r2DEYI]NQb1E-*! @F:B>StdBMd2[i.po,G#gcCU6M!0HQ4&^ufk# %4S15bAkkDu]@5nV@I1`f^PC2EkTIb"1OQW]]&8Zp*IM"DN=_(5r6t#PT%!7=B66EE+6Bs: (<3=FhLG[t\PjNm\gF(Oht6#FjL=?t %ccn5L#a4*Y1R`TeSS2.77Qcare:\@.ZoYbD,;-djqO13tA>p1.H1le`-#t3p_L,`b/-^h2hT5<X; [*P\Vu@sa!]FM>\Sf?-g'S_u %9(:cZ*I%!WoUPTfpEm@$K#??"_j:f!e.:$e:LB&ri*PSNON`44T-?=+Ut/EWbnkOGjBc;(V])h! P=MK+aa^?KVj[#&Bnoud"1@15 %-hOD/bLtp+=`WOo/8SnU^MgbGb-%^%Ed)[I`ES(GMgc!`NmT/YcB"[%)f`Y\_h!s5m)1-XbK-`B*) (%bepnNMld2<XB1jY\q"rR@ %PA;=KOB5M29K+S0:<^TDC=UR][it@hm3IisI'7M6X$k,"qfEr]TDH9K\_?S,LD^\D-X6t,;-'O[r`&+2JWO)W2nBmR5S"%Hs'q$ %8-f/Yp$:2Ql.e`T8CBDb!R9:=Q"N9.'3"\&F_0N_@Rm3>d7f<ES0+Y&^U3=F1"PUSF2S,2Rgt@2^=W[8^iO(CK[3AejU!TQceMd %4](N0]?%u/HD'1XeA.hZ8Xf)%$Y_f3^JON7kCal<a,%'Ca5"Ndg4DQ*p:Lht=kStMNG'UT:-7!@SQPe! s1IZH[+tE5>C>50PC`'< %Z.6_WdG^*4d7"?o=RBsd^mE:),-C?oKK8Ea<efJUbi=99m8l740#0t8ojanQVN@eK&92090"D*ClN? W"4#`q<7<V<Pj5Zpu3'%;c %W4C_X6l:RIGBJ<q9m/gQO/sd4FEEH000M60)"dP(_O=EMZ_0C#J&am$5R.I@S>6lGB"7EJWI@=_"iJLTWM N<_>]5Lr-&YYP-bCnb %Le"_FF<q]dqG%tm/e0cnnHGo:<sE-'Hp^$ei5C"^Ba[$$6R,PpH$G6gf*jRPRW&$a#C_Ibm>j7%[b@@IN5NY"2_p3/LS]KPM9$) %DjIW6>7t[gou@m^`%p4@9TgM\37)ZGUdE46lk(#PkXhDS:_96PWRH`X'tQEUXD=E^(@Mq1U/)pk %8ck4S`7=Zk.buR%h<OtcAQJT %&WuQ^%b`]Di3"m/4*U?7E=FD)WBfi-g.^"NS&uF]gt#1,SFfa12h#! 0j]UardJhUOa)m=9>ioKg8/i]s7W.j)3'rP`E"WBY^]2m$ %!U=@M!MjGA8orEA%SS4s/:Sn9]W4f70G+Q*Y&l/8rc$Mg]KOf/(`o(^m%':W(Q</TRs2i3X'YlPNl9+E(\ AIB0M.HJ'YI37-d@lF %mY!O(UNEI\eIo7*ZYT3iNZg]?LkQG],d!N(m2s=J\^;\lJc,qJlcNjn)k0;F3QkL58\H,hk>uM:_:^9"**\qoNB9,;lEC%nB`*@ %838R'3Ch!.,M%%J"5BCM"+P=M*<+Au[aR.o_%BH%o#rUhQ39XOEXnL?S,D^K>;"WEi,;k4lN#6G<$3\0A-qq*F+OujTRuuU*3!" %/Y8h_LiuaSh`3>[U@q9[g.dt0OXelSkFip$i&:U!?]IOSM;qVrC&,#,.(jCAa.A$a4t]nXEHhHG]<J`K`);KN=!EB#lhohlR3hL %)$b=cg'=NJIctnJKDRSY0(-can\`*;?<n'3;2SIi%>`e+JH*NDkO2#AJVu9aGLT<424^'Y*7To+@,c2ZlM %hePI3E8@_2X]XH(Si %&ph.p1AkYn2j0'!f3eDmUdL#:d8;]m937'[-TeRI=(L:i@<T0\>$n(dTmOE,U]X? cjgG\nBqU0gho4O`a[4UXaW?3>fTRORW9jIO %n:l1t6&NX'g);f$/UbNm]@>1bP?",VkU.d.d&:@uMmVP=?g^Dk%E(<A);Waebe[l$-:SF48+ldc,? h$!]O?^C:K*F(e5P$?:+NRA %S[`>8%o4_/;s4JN'/n9s^&qi6)YT0"EA*%mG511EoVWV<oZG? >>5.'0Y1U>E#lX=R4*mcTT'AMj_aAE]\F1#e3ri!+/t#+0FY;il %]*p@ndcoZ+[\o3:SH?E>>&TWOdDbF2me2[#3ie(669[-_U;Y,=Fa,>%B.+onk7ch5-6jR %io7VUX0G/a(F$[ID\\qm)M/Wt<@JNm %7E@/YNC6F)oO3H6C39::c=K@#-IIMR"LAi[polV$pr\p8ZE("`7H\0?_MTQr\^0.Sq%+N<EhNs:@us! uS-;B*s/+2FIbKTnnj,oW %8PBhiKT;=:m$q>/ciD8.15L=c@/;]0!kFO,86Pl0O($ %'bUsU]n;b3n$i$E\'j&Q6Li"_CXMVF[8ge^$VraLAS33)`FR/5Omn80! %g(=6i'rjakl(BA/ZubCI.34THe8&t9e!.m<@LnhThnMr)oP1Q]kf&U`&L2fkblu$pqAYkFQ_L7,FS9TYUd 9G!46Rn<g5oT]!RW5' %RMBR"9hcu@2>qu@(3BG%dYMY?VW1QkZ_f*tfOdcp7X=!^4;D-kcq-`aHf_aB:H'ak?1"$91]Xo! 2e,Rsebo:VNnNZ>;GJe2"+bpg %4Ib*e%<i;qdmfs>cr@Ks3@>;\H^TKO&o`$j)G]"34f)A5>\)E4lAZ>4:Q4O$9*:Qfb1.qs\eq-c,"LtX;? l_E8Kt.D"U8G,'Wb5N %3a[QYf29_I.7bWl\;rUP[pO)K;2c+i0PH)iQ`H12fitUOo5R$.<.:5I7P/s3('S)hSaTc %>hk3g/n/Ng7U5T9AZp1L,N9jI$ilpA %QVJA>U\k?#h$gp8Pb+Q^f!6W1^81ON\Q4h%g@STt-0bDp&9/>V*Xtk%pF7UN[o&=EV=hOdNVk64\MQ,Z9R9)E$BKICqgI=1_s^b %X\fe'bS_1X)cm5c0_/d.@fX4\GeU)j/rTC\HsQZY04]>TT"VG5c[h*l3g'c;3,qq>kV7^5<#t22&%4EM`tEfF,"!%!aTlPriSMO %DS_Z=GglPp`Z@$LIOhc5gU'nVnHRtkpm99CL`^DSpEZe+MIGmijBclHSA)9M15N#6a*sY@3r5_?V+3;: ((;Qbc]$u+?dr>b9s/!D %i]=XrWmOaih.l!Dd<L1^J4iJn>$2c]e;_9M_]R6X\S=TMXUhBCr`7q>E%t>hKFFI! Q5)2sP6WfEUNc<ld8#@icp*gX!g;/,j_?*Q %&Nrp,f4&>3'XKLIeed3jE7r2$r(,@A9Pj<1]8H6d_SEK"ICe*qpQaV-\3)'Tn! 8SpEr5Q_0pSn4+&Yk7R"QGQf+Jj'/!/EYUfa@[ %dkZQ^o8h>/-r#)hXAu]8Pf&-Pdj&Z>^E1ij28DM#.8l%o5,@[>\!u?_`*&t?D.S^$ [Ese+Emq8>1qu!"_j+Ga"4?3gLt%UV'>$s6 %<:JrKWCPfD*caoL<VJ.M$(Qo*#h_o_K.,U9AkAgodfY*s\X3XHoO00l1;o"`g! 4i<;<SN7XCE,/nNrta5[Nn:;omZD,K$5_73Aug %hj-,*E+8C:7PY.7Ir>eR8X;)?7=0'BV;ZlmBbf#a-i5ZMjO%=!n:tWABc2/6>0eD$7,l0fo0POdl^! _P.>N;_Z^qU#l$LseklX</ %?@!WS&,/HH>p]+U\lWM6n;Y2/HCW,HXXPL %"I,_(;NkA&Y@U>S:lB5g)`p99CSs4Yb2kPU`djSk&?]aq/F0a?0+E5KL=\W0I9$aj %n5_>e>h;&umV-Es;i&OA`?=,rbsOg9*/`@!Nek1Y_ej3I"JdW'8>8tH%l!(<ZQ+#c[I>K7*'? W1GM0:'\U>aaOG&7Eq?fWn*7Xf* %3gFVVd,IlET4pMmZ6n00Prh_geVu(:CGB@8J&MW'bnM;C3.Fo3YZ8Ikf*d"^IC[,o]W3"bla2"S8u.hj+uS^1mALa=tXjUC>:dV %S1%u`TgSg-f"<IWOo2T7k9jU`nCWZYdADH4!$bQ7R4:Ykf[3q,Y? `LsRBC^k4Oq.N=B,s4@p=W/9`fH;1%A3e(at`h7Z5F3;]9L* %SR2fKpHLtQTQR*#O)V$oe[A8!I7h\WXeD@J'W\\`: [WTqnE&Sg_g\cLN>u+E*h#>48)5E^V*"f>S5BPJ$^jr*bAL:Lj@CKYjk(e7 %O53tBaTG&Nn-aL+N^hm<+58d$/b2BDS;-4;GspIkEH'^X7d>;5]id,>%;`JC=:arX4\ (.C#VO9*Dr,rsGuI&5(_Hr<?EM*O'X?'4 %YTK_alU$@?2a:/pZkU1j=h_`3M-o-a=.[+b@?=35*Th_K5WKPB`'(hnY9X`Z\+`/A.FVORr&T^i8(7$ %DF?m`\m_]*-rf(.[/1oU %P+I^$`6=&@g:<F%i(R<uIfY"8khLK)_UB45p>kiK_K%l`SfE0Pk'6N8Z]? n,51PucifWk2=o*Ni:3eEE,;;H20Fk5<:#;JH,(>-P %&k=49BRL8nMa_5/Nt-;2DTR`t6XYF.`Agq)HGkP'UV@2TWG0HZmW;WGG,G6-UTcIA@ %:)/'N+*]PS0,nePod?2r0dlej5$V\T=4f %Lq: (djkofg(;_MJfM+ZJjj`/NTgV8sY#/E&CQC`I@c&"m7c)6Q;@E#1,ub2j"7`5"nW)T)gE(SjdHN@hJ1C_)aC0gh3tleIX*DB %QOuuf1-<2F)fEpNWO-nIK[Ys6e$:;$HNlteIHmckA^GN0b7l\*"R4Qu+ +.psI#=$.Lab$e&Jf!/Sh"89Pb>]S700&DoH^,RQ165H %+PlAf](5E)I<dNaM/nS-8+G7;LCT`ib@LN1NiZA#N2I?NSNGU-&@X%YkTSa,;hDc*BCtbj %_mKR.l'!"9*6r%CWmcmTM+f[@N@Xj %OY.5)MqpBj)t`.*8#7[U;qSUSDsPmrThf5Ff.R"eVQF;NKV29"_a)-&9JU-a!GBE]\J(e:8aOPp %Q"0#HHhNJ:Pf/+&9sI-qm_.U %]gks_Wh$1$jV\n03u,%*?glmm"18t%SuB-6CWmT0Gqlq[P?\W3mUH#;a;/ (6FSD,pT0s]hr&4EGNZ"q["&2!H&MmO$a%f9Y9aVCr %FY_YhmT`23Y.5gT'oQpGLTUaZ\@VN$jQ! XTK3Rea$Lr.*B"oWjKicMQG8*HM,Q9:kg\9TPU`,#^6m*#Jk.QO<jh\3<:*).(85KC6 %9$IV;V8(n3f))QGltW*>22_ZeS\Sfr#I!I_>g8lR4/mF]=Y$\52(Hi&XWDnS?\aK7,I0M=*Mg`6o>VKcY=l8pm?-+XS+BC@boRE %%UU,?GJAHA15T:`@.BK%3Q1K(`2gNGof+sBJ %=Cbh5'o`?"Q`R,<P+m_o1h]7,JN9'(?.aM"fFA&`2cn&Vnq"OfDo:ZR6?FMPE/Y %3q[OdaQ;b`DY,l^<CC %dP6pJJ5l'@g+X+J,PBSeR@aHXL:<>nM6[%3)m2O9uM_D\m:lJ^3*sD5".@L8nr3<EmfC$oeYodq]nM^&r %hZE&+qTE@=WY&sCiuPK(=X/5`!6Gsuk[IZ[*2ZV1qP1ot#@fLIg5%:aJZC\! NZHh@7rlPar0:l:E.#')>eUb^mb/_h#)t!(8PU\l %VZF*?dfmBN#*ROpiN"-;e9F@qKZ;?K$",oj1p=nLH$K!j%)?\jb?hQ3=! GP:WBDAm.dgMdN6MQ1EH(]`/8BrfGXl"CgI?[d(cmOk %fIDX8-1(sg$*&TL;AAl%8^?tq@_t^0j%)284tKuNaE-koq!BJ8ljp. (6SA0#g\<IL#@mu]_ajc)^BG:nmprSeIMeMHZ:md<ZcVkD %dj*OUBr1hcbUj>VW:DN039"G9<^XSL&>c#+ZH%n(ePPB0k-\GOL<e5X<]c27fa[I? oo"9_(Wi)u.Bpn;b7(-9A)>iS2]#Y8Vd;G` %P2s!!2j66uF%*;7VjoB7knPhHho>KKU=jsu'.!t*QH[pA^o6pFQUe5Y6p\2XfnlksJNO8XgNI7(1`-/XM7DsY+Wi>@?82i=u`"` %6)@C&.di?de!_V+aNNe,=IL`ZLGoX%8%[9n$%uU6kU3\O8/\lp8Gpo)d_ljFGAiTK893b>e.P9*IZsVW1\u9FYg;omS>tq<ZqZf %UMIJ7mkuB7*Sf95NrhFQi@npM%5.OFc`c1"ek)C'>[l^Jg!a4<rK,6+%%>QXj3O,[$Y&@`,?! Z;0#tln8V/jN%,0bP9@0a\"drc' %EaqEGea^p)*Q`V\_,EHRg=^*19K/q'%YuWM9AE$@&*Ba>eqU\8O%Yb''g@))?KAdOPdR1S_sItj2=:\nab7WeN,k,hLlt2$rtfi %a!Np9fPY&rC,bP@(A(@9NV'_5VC@X._U*F$R1[Jt?!Zh#k8"PD6TC:*? (SJ3>-;*tYNoXuS(OS<YHm/GQ0=T3>Do7_(_G+G.F$(7 %f!@K,kbZ<\#?VWOpV23],D!:F<r?WW(h,3>$/)\LqGjGg"$O] $0eGGq>4FNe[+W;`h^Z>0VTV\K42i*Q(sU6!N-8`HB*"Z<jC/#n %;]D.BJP"tK+&`ZiI0C5)hrSP-,O^TP,KiNqKH<?'3m=C7O=! kgUX8R]^@_0Y1HSD*jL6_2_fFBRGg)Njh<?O:OOb5n2!)iPZ0%_2 %:'Z%&8?)/3QO$`scFV.63R;L1Tm';(7]\'\1^AI,oiNg$F %fd$Ogj48`14caFI_L]ob]tDhVDO]&6kr>,GO,"aEfT>[V'AEa;aON %-AeL@A'%T:h!\mHXAsMoQei9QFS,(L1D:2)gC\f]ba(Qr9T^o;ic*5:1,2tHj]*%5)XaQc0@? X9(/3Eqn6-Ec)5"h(HaZ-9E--K% %'"]OqgRaHC@5`B4("ZTc-2BupJo&[c.rT?EiSssN#$l"bc(TT@('-6VGG3^H]#%%ho1S7#d9@&N/iS? #35+\@35RGW1l+H*];9te %$> %efO8We2rQ$2:'1HAnNbr/>0uD;@=`$!//)6h6cYJ7#Q.b+9i4'UM$H6/Y=eU`/@K9^2Ffd$s9L.dX$r_1l ><#^YR!laCdl#s, %(,PH]./<*&RUER0^:IFsXt(Ig2Srj83f#Nhn<N1d`76e\-95/0-*IXhOAF,6*P+St;nJFNJr`'t %,u<Y<6JD&_g\D;%b.Y;%1uUS %K?RUShDp,Y(*O9"f_OuPe:?&`_p^<d95H#Kcmf\'>NLo:k$u9.os:cjl`;_h.LII,=*90Lkp3S<%5D<f'$\2'G>#[>"';ZA%uT> %bMRZp%f@rYkk@6qDN5YP-^=rL7^NNLR!tbYDdBT%I`q'2+MY7pr+`d\9l#eD+D)2%hAjJk)He@+/M]W=! +m\\I3Haaf0-bgF&PI3 %r\sQlfW]Z*-,VIr2+)sbZ=Yt$<B,fi[]D? t$hPig_"Jh9#W2Q&*\P0ep>Eo@8QcNk,un">';ikFJF#koOd9FDk$K%#8$-q7G1[C$ %\neSSlAi.M7Bsm]LmiJXF+<HFS1bk+_cselO]gR$-(^iM^O;fP<TXi9J'M;#5G]=pL)QU/KajT\b4N? Xj>+&A7OjC@D"eLb,#\ot %MbNht6cM,<;dmNVP<! =5EPkg[$XfBN9KHuLc^j<LQ:UtaL9I^>C),EuHt\Oc\`Z#/.G,X"dV'8kTT)D"<HTj7"/+Ug%jfPoHi%ut %d:j.OLONo3=^]57;*_R[&WXDb^)cb<D_(Tl#CH@*s6\tL`=deQ[H6QL'O;d,l+Km-5CELE#L+0/8?P^s"% $Cbjl*Dgd#i,7j:+%) %l@,G)<FP8.bD0VSTT"A,&*Xa-[+AZ7>'BGUN..d>bcl>HJs1O,pskq\;E(>)e%;WO/Z\L?H2&a65nuF_G %DCS5=K4M>5)k+O<lod %c7A9unG=nJ%VHOP(%4N^;fb^6-r_cSBU,44<F<(=#>\5).5'jbfWiL^NRT:)A[c %H\kJ$],LsK/S/8I9%i$CnaQ1*cIpF2oVm$Lj %<iA?s(:@F*7E&_oH6s1r,Z'GB=f!S`RF]<Q^SO?KkQB3bAY1j'lOBo.Ma]_H6.*sS! lUls,@qYPV@i=@&NYRP84f!i2N8,(#("Yt %Xsb1%_%Yjm"5Qs_BP*34jK@>SMd^E7eP*hRQl$qn-/UYIQK?D^,\22LB9AYt:M?'%? =mR\UjjAp@3F0rWl!_5)B&d*S/9-*DfBU^ %U1C)dpc\,!r40p+;uHUno;+Z9=?CW7.2m]MVJ6aCb[==*+d-/"0S$?;EZT/=6rB_^7d_EiP6BZ4A! 632)<r+(*DOL0nOkG@@8bJp %+%_0m(:f795LR@^=/G%eZ\KG=WR)GE;l9uLgWm+E0ks<k=5lWf3tR+ [e5>grU_XZ\8'ib>05C"`Z_@`mGDhW.jXSBq+$iPh783$& %"rK(K9'9tjOP;[JnH9E:1Q*^p@gZ4A531kCZs83a*R_ITYcmF`oNWLu(bH %@gkap5<73X/K;m4A.UN@8<Sl=3cXZ_^c+GpF&k`\f %@9.Y\q5bTC<T:nokouZZ9Fid3L,DuVLiaTl(STrUaY8NP0nj\N+=+,mA5`#'oXF9Vre=>a:9YMZ[47Mrd8 uR95aadrh[5lgVmGM0 %Z-=@Jh``ml&Fo(A()o+`:71ckl4SMq6CZFoUWm$RprEK<1E0TES]6e,)kgG)ul5'[.iJSg)N\Xo3'a`b[M9Y7I`LrHQd5J+63" %HVOFjEma[[;u_8;onBii$kOaO3meSH9`8OK=Dc7d[o(nR3&0X;EjFC$J7_9': %r>,><MZ+eeW]]lr/-.AG.8NXt)H2T()s?QkQZo %,ttU8AQ<FI&AG6n-J$.b.?Z/)CM6&D;(h%]? PZSNo5+;oVO73B[T3VEas([bpP]"M2NE50*@dtS<1qm9oC+:_UK_MdDp_cGX,OIj %:ZG^2TY".91%)bkbn"L\i8j:.nU$7+n#Y4RRQou5fJcd.C+2<4BDLZ\n%EK_1^jbM`'? 2E$1ieir\.smoFdMK5#2#B<?uiEBZ=CE %RYX!;AsQEVj/.um_U'B\9?PDr*J,+t;NE:rn$CfE2QBh(h5>3P[.4>F&+dd2=$0PIKc22dU,&a0jitc;tbp^\+C$(Lu*[7V-?nG %UYf_RFkPfSra\+e$cSm@-<2]&PRM<MRJ6ofcX$N4</aG)8<-;0ob'X]RokRo3Zi3V7mQaG].9FK9i'BGlRb`q"PY+**:;E'RL'6 %-u:-rY3C\gPQ@B=TF\JE8WGS<oXFAN-C0b3p"C.UWpXP(LKdC,6Jo3`jeFAEh\a`\9A>MjS.juHu*A:<^*rEhq$Nr0#j1.WgZR, %13Ul:WSp\\=5P1i9BiUGJX0D8W@B2A:\e^<1=XP!NV:GPWBYn2q9-G%iNY+j,YPm+/c!<:,%8s%BD7-;j\ 01+eX,'o8]^%G/0m$t %f)EDQa)Z&QESkBt[5V'Gn4VFY4GZtR"p"t! =:u8`)_3\f0tE[HBSRu_f4/>kSQ<VWqTl:>F7M5EbO"#a^t@6*0P1POc%!%F3#@N' %:<s+(mnJ9<k-Y9V54HOo? @usZL+U'/,H5]+PE0.FH]#D^GJ1t4R*592Gm_@Z>jBKA9)K(?]SqF(XI<ie/jJh`NddZATup(?'2ce5 %:]M2&n;!bcp7O0A1=-/uVtI<9aHrD2?F!uAdnu'24#j1%k3k,$g:DlpI["ilZakF+,=7Jrh`? =Ya<dp7,jIiX=Ng`;[W,8]lDO!u %Ulk&f^-NXZg>L! mCc3J3rqkJ'Y8u@*0OZHLXXZ5im5ScQ4g_0@Ed*[tEYO5[/iKI='cWR$&^T1jc_V]#^.oj6QDA(8d[9#V=[ ,XC %NaK@#i:Ec&eJnI0R-tt(?#nlL9AfI7s8V7HrRKPmqurP/s3&b1?^ophj@U=C9m!r'Uscn>nC %:7J[A;@fF7atr^<D%a%k>Qp-SWT %kE5sYBZ9QjYr]T;L[<Rpg;sRsNk0Fb1LeZ5#GQEf'7]5t#]K5/n]HkVIi3F@.^Q&Bofoa^gB0p$`D,jQ@2p^h1(/8$K"Pdl(D0K %?4OYY3B)d3%Z/iiQc5.*Mg']BlaKeXRl78k>]^!Bq$[BCIqM? Ss+,YA3;pKAO*gZ7fl&uoIm2AV.DEOfO)1pb)b2!C\cd5<FM9ql %ra+Wo/YUdP]smeuHP(`1?QA"eqXHmEj3k/l%g;f6K0&Wb9Hf#F)#gXg+#`:r(I.<^j7.@V8FK4s? e_PMM6AiB#%O]dl_:6$q4qd! %? ES[=]<ClhL)HP(D`gLB0ABPbSsZLknXIJT[hT.]ILNT0"*D3bMp`f))7DPai:l2JCJHnZD"%67oS:\=h"FN VjRGJu*k`M^\J9Oa %bPRcAeoE.$i>A(qW8:J:UK93*I>la*7@@g$:'Ba=(_,QmkAp*X(/)R8\QdM:8_\L_Qdq;p6i<tpl>ub<l>=-A>;nO,aqf%1SD/? %oJJL1LR&kfYB!nYoDV'5*cQYa8_?+R4#YCim*fZr4M$T/rd2,YnLmCjV`JT@(ZdVgj[tC:Ks2K;8[pa/Kjc!_j/*@HN#H.?l^($ %AKfa2a2da9EZB[.%K?h')?AIXo7@4bIa-C=f/8X,LO]q;f8gI.1!W'*1<>@Q$p<m!#,nNpJShte)fG1b? W^P"QcJ=Ka??->a+K>a %_MIs"b1ecL^lq:NIHE@Q8qt,DVLrc06Lu'L&[)]?m9-A]qp-39IIX:\ol-Vn&5q)^n*MtZ/]90n[(_! (9PSKUY#lBaL2>OXV3*De %70u?,lZGpopA*rH4<L/mPP/A_FPe2n,a?!0M7pW9JG[Ju0','](Ugc_g[^%8lqN6YBjX)rNd(: [lna,5\)M,J*jul1#?shn %L'h":VniO\/5uLQq+&[cb-(L5TpD-+hWTtlj*HI].=sIX<)n# %D.:T4=0g;V9&Oj=gPin=FR$=WfnRD^KH=`S>NXLbP6p/f3*^d6 %V)oT'3?1gtlE%guJ_976><dtLraF/sf5I/N%3%1j3&]1<.$sQ#`g4te+*i*Dp=% $oldWE*rsZlF)`AWt8;P*9k*g]unDgkif<pb' %5TA;s(GWEtmCHZ>X\sr1>H(,XfQ]<,'R&1l[t6+@S:0+C:YYQP[u[HF`j5o@qSp;.CL2`9#s[oV@T*eG;H Ceb[t<?$d6Y9\Man.W %):="V?5QGs&+Su8h94Qn`Il[D_e/WSEXmB]B?R;:DKEPZco)$pg\J5FT? bO,H$VSt2_I=ne2P\PPfb]=0fAkq7D.OBNdKg)@1$!t %XOA5)h-LLhr_1n%g(.4_eEZ[`-D.u(S(;ZHQG\ej<_m1@QmEfdI[l8cC4d.!q2jlS'-M1PdiJIn*W^S %eQ\oq?C(7N1`gTB\!(da %n_:<o4CFdVj5\O84QNu"HdJd2/.D %B41cTCjjOu3JXJD]"(IE<\\cea+)BQ7VL;G(dn(29NicrflI#UDXs*<1K$"`'XYLpNr3?;8 %isaG*`nSOi;k&R#3\3&C>/*cTano_7mFq!G2)m.f\@)4u'Kr"skG.ipNo*k%gH&i>*glN>^.1X7%Rk`bP<PI=u:1kP9GBY3jOB7 %pDLV2_9$]`kMK&BP&k8u5mX*trRU?.G[7,$nXTFPE;d4k3Sj"o,o6/7J`98KYHtX.<(#uG<UjLq+&Bl9q0 >#;(TmPB`,PJ-g%!"h %:FmOsm!-qtYrQ)1F)_]NpY%JjWi.*GPPLkV5H`iEl?1`T>^kIkVnIH2kH.u6l*TNB6));n@po.)j3_b>[UT3Gagp4/?cbnH?IR! %YTe7[:IXHk9&_:c7I5Ie`o.(95;^6!bN/0j! 2ism17Nuc6B>'ZCY,uhjVhq^jGU$<@Mt@g@8W/WHZ1lsGeo]g6t\m:VEOlsXSlRn %ccc-koLD).EqG@i0ssqTKa!iQ>:`rmL=m9P3HQ<42]pKe:I"@7Y#jM1+aD.rAQ[? 8gf;EbRZ@:#KuLap7!?2]YUD:Dg:Skm&MN9I %AO2U-PJS?j;b8=@,q1nF'^3eEQ"LpR[sa474mr.5CttHLR=09;h\^N<Wp`U\.Ja.=*]\OVIk:P3-G.X81$ (A+*NGp[5'of)TMI?j %d4-o`LCP%*83jR;]\)"q8$ciMF@U?r>C^$VZkPj]T1[aNNI4m0(pTq,@'! Z.kTf999rodelaF>iIlIaqBBJH/]d_M+Ac3>AJHnup %\hWnOHng:sK---W2.MVmGsO&oP$JA_X\R)74@I>YdDiFMG^<ipq0RsSDuO6![0Je"Jk4fb*ec)O* %KENA4uV6T_^#FHLr[m2L(u, %-X!758i`>gaj2o,jr/X?<i&:Xe.Eq"-\Gd%*0,pR3=*pc&'a_9H9t&)YJOO5@\'gXEnFBLCHKOV@KM.F(YG0hGO'iWll"(q0.2Q %5oeX\8R;mOdZJL1oJ,/_ee#2M>I/Gf[CNFhru<qTIQM\\[;F%`(>+ApD'bF5g):0AP_PO8To!$? 4#"4+Tlk:PDF@8CqKN2cO3>GO %H9?gu.eWZ_Ir6Uhq!ioVcYS?\]gScbeiF]4rn.bTK5+Pg^=B"I<AJI?/NmAujj[dq+f^EkN_/s2HcP`DH)lK#$ll;r,:E_>E'CG %-%(#k=rh7+rf\*,YV+6liQ%e*=@9f*q;k(1Sr1S[F$FDDUV<l!V\o'AMaspui,J9e55R6NO8_&5F8LD-U! C+7*K'cm;NJH:*LP)` %(7*nJ[`Cp#[HLuhpi/ZmG4&e&[mH(IBsi0C4HF+=30.+'M]DJ$H7q@&',.Ck6JFRkdgGghX8<=(5WO$BYS6"U.2L"a?MKpo/4(t %N!ImiA(lp_FXc_m][-DV;$4)CZl.Yh'Y+QapC>#To^)!n!"7Ggk7n:'$V@US>]icj)9F*r]&<G,sAI3O]`dYqR-X!gU'+fK.PlW %M7g_q"'5MD"(CIiF*-+@QJJt6pKo%AJTtedf'[c2Bn/AcmKi#m<bFfNqm%r2)hJ'+O9rYT<+pce?aJCOnp>t4%?'iTk2WW91Nsc %(fI=$S+s*an?Cs!8)qUP:Ybi_jqiL&<U)[7Ju8g\@!$1^b,M-jOmi8&q27_/2*T\FeqbW? `5LU+6HnH2bdK$9V\744m!3VU3AEda %k_6'0_dBR7>feq5e6F77J\I5amYeB"hk%NIgK$N+q1nS3FHetZ\Mkkmh:-YWr6uu6GkcjEDd2fZ`b%k? 625`'`.572P2;'HA4#g* %,$jr,(q<>2C$pOBZa;H/lUkG-[)7;LCX4r]*G&#fQhTi';5uFQH07]EXCWDX3;33"Lb9g6%^Dd^U\9Np>YN'k4+*f*QL+8pceYK %qNZiD5'#`e$P<[-UKtPt*Jj37R`TB*p.? Q6<jB[_^9$&>*[/'e^1Zc&i3_M#'Qeabr"+pcS<.@H8$Zob\R9jaX1RhK=DK1.k72(] %!.W_+7c/VXNG`%Vh)e-)0\ZGGA#eRqfVfQKnkD^7_7X^S[q>>Q&g!(Wj7.FoQg`,t.K2L"lA;L42? <ROFr.E;FD$RcT4]h6:!&5k %s,l67c6bG9*@=;GCHV#Ahr(eQ<Y^.S&eE_C=9bpo8Qdb2koXl$g&fX;FLeqo.V^.8(8D`pAlo4EbpEc#IKFurWQ5`\ZARsi:4HB %*NZ/+\/"0')LmYD`/f,FIH#0d! &OLmdXa:R75S2iXr7aOhA/)Wp4M=R*[n2_LZMpg[r^pbSEmQ9N*igaEBbLgmV/0"^:^e`@ABKD %hg5F7dBh]qIm3gNnGe\tg[NnA_)i]Dk`!72d_^..7D<$QkrWUFKB]`aa2oeJ[kAQ<W6=q_1=6U]JJQHeS54;](#k?_W*iCJ,TLF %idV6#o]u)9=kt0&:qb$)=cg)X^Zp2U`OX,?RALkqn0QR1GNd331c&Yl8l>MKgq\Pje4Gd2[rbBFLdW4E2L+^qU1U8=giqn:[EMb %LekYV[)7qpiJhPYG?=U"J`08gl!Q?hMIsa"H?@HhiB<1?gfh>j_k. +>:R\GqTjVY,IC@",QV>SN2bn1\W7@3G+J$SI.mus!%;47O %i=S;!gmt?[I,=G7oC:cb]lEGU?[h$CE-=s4lg+2r#2R8n=r/!M+c*]XVmdb]3@e0MaK[sti! =b0:T='W8N2KELBBGDZS[U.H0HT^ %6LD*a,"^$P.IGjuLWR$hDqbrta1ZlQohS*=_g/g8]GldtWr7o-gSK5Zi"N/0g[ZZbdMPR=K%8aR\&JVI? e[H%(-aEl&)gYP\>3;+ %N*KUK]&57F3cc.0]<HOi$eLHJ'P7(UPb#`j$0pR>.h=dJpEkn3T!hC?2F'>TKa4='(,! +C3$am=*Tke+Ak"ke%?3Ul!"#;b.Wpen %1+Ca,^eR\'Ct%hXo&8Lj*:g]XrJ`>dS\;B!RG"3U`ZUFXY+4KOrbA:1%!:!_^G?DB."hPW&Sh(9cR? nLKY+QZp#3H^n-$@0Lhr4e %M=DtlPW*,\i^JARBpoce9Y<j81L^M7rXH%YCMVj:.e^"^]TATf/]h(.8Y,n"nT[/h:P\B&JDOSrD[R"Em/ pE2q=fa!"0*_=.'@,J %aY&4$8p(:[G'EU!*^p>nX*'[`\dXGH]I08pf3=fXcT62U]-SAN1S(\#? 6UQu@Gj=7A5RFqK=0W(gYbRcYh*[L*[T.F6he=O\:`Y7 %p6XP4E&KnMUAL(b37Qj;pf$5YIQVZ=':Xa`>8t?jrL>d(gZIc%kb3]-C"QERgO<f9/":_JOQ!=]? 9^na$pfARoAcE)mbYiVD[U!I %l*Z-/(IND_U#Wk4<eura'^#&N_d+Ie6u3XS54K&bW+^ulN`E1*S<6GS0B"D)X;N(fF].bsYkYNPP;We\EVhYTD0jZFfifP5?@&2 %&2;NX^!i_Xo]@d#Cihp!04bSt._:oJ2B+Y.5HFjppA2&Ah6HK3@hb,(U5MP"cG/; [,I8K$jj'3"0_'_IY<9F4h08j(+r!Hp!HeWR %VYd9=;8AoG@e1E\XRSUnkYu[npK0l&=&'?Ah_n7`E?\>>iC+YZ@1*bK7a0h%\? l':oZ+Xjg;M#@IlnaDcI!T[*^&^H#)5Y(d%riQ %>bda.Ss"1qda&ZK6"[HP:Pd+)(.u[_Lsannd>75PLSH)JennE&NHl>JHC44Jen,5/UHj\bbWpT %,e)q\TVFOpAF\_?$h##KjN#Mm %f_,hGjMPt`3-[A/5Bt[rN"(i?[DFeIgN=7Pg`%`nEO[fG&"d=?rPhC47ocQoL'THm'L]S^=2j$ud4^?1;AV0-]k?Er?t4l=c2s% %Lj7>-VEJbaLSO?`C`X,>NG2aDGPH%R58D&FoBM13pDs$lO7kE<,R]Y]Jf'5CZ[<>-e,%o!Y(`_Z+]3X2bckNX0+UkkHg4u%;QeM %W[@p'7g=MH:LCr#mi`n%!nQ6n\3uWFrRT$4U@VD(kG&r#YO17)1!":K12a1DP$VeMntSoc/J`Kh0bUZ<gEHH\GgYb6;H;Hf],PN %3jrsqn87tc,Kt1<eIt_CnfM.Tj'Yd<_r\?m$2grc?<Ws.Qm"I[Ng1\b*f2G"8WG3#JKZtC5R)V3gmrpqm0d,WUOq2<[^1MK3L=s %#!Phs;cIqUeTMTnJ:_;s"4?X4RS$P/E<%%TbD1.]4+e=kq/ (OE7=S^b,MPEP\EeecY]oFG8doQga'dRgG<@cr-+m2A,*7p6F'+f= %@j$qkb9!G>?ZGjL00\dWD2\G;TDn$RrhmNR^]! htrp$ojVai3VJ>.8Li8Le(2uRslhcgT)XWUm>RtqK@&.05"Z'r%d;4Cr<Y#>nZ %#=+Yc[/Bc?4/Cp(;(o;C)-lBP\pMrM_X:[%dI>asdbtq;-sb[E[DbF_R1\N#'0\DM<uBL,RocDijo>n! kJpP?`5ZIW@9FX)"<\E/ %">fj$]eAR*7X`6b?8sJtk(P%dmI6Tec>U7aO-ALO%jst/<)*@7VS4KjcQKbKQR1,M`WAA's8GfDFZEO, [7?9/HQ)d$(8#5e?elA7 %5-jO3^X#"3\7s:dqfi_p=VbZ85ebn1!fol(_,2dJn$TW87OBOjnL2.Y %.O@sDa\/VeRUqs#qD+,I5spCmoCFGfX0pn3<Bsnl-fo] %+E;"Vo9XJp"&s5XiS#;SOC? o=ER>XbPYBHS#k3Z]:FGJ9=R,9$UE@[sr#Sr1C"\P0HK=39ej&TOj,Q;Tq]h.C\bX2?(R`6g,K&`g %;,]A^XQG\mIm@-SW0Ap7.J:=p"7dMR?6`[6=@rNlrtdD#7Yi!gEWZUoN9OL\-C-8S%/? B9P1EA5g;7j.oU-$dFp]]e*:[#b?"pRG %/JrNnmWiNEhUiC[.h:)+3e.//AY&k\m=+C!pA_FbgT?aqJ,e!t:cl.W^U=PelXl1oj4rDbP=L)I\ieKZDg+HYN(#)?cPI=[k33E %l^RkAeBT&J,$BICgK5@@(RsipJ0I"djmhfj6[Un=@+oH!lO8;6@"iKsTdr9PK$NRf\iaWCM1`=%893N_+ [Wt#Cel6seb+\gA[!C: %RUdB@$al3_r]M`'#A7G[5ee8Zi2P.!-O+*gG#P_-k]sd*fW<3_S6iXOde]g9A? 1;%<\*]cKapUBhb^LNCD@:f,CZ.MTaq4WjCl8Q %CmYG1.%6et;jd\(["cHCfe.fl8l4d6?2oCf!/nu=Dd!q#c"-.g,;:5lMgH%! Ib([AieW0X,1'@7)AoRN_2h+[5/sJ1-MHu:`YQ:C %e!NthcfJJjhpJtNJSmQPcsaS8.U_A>_ge1b*s%1CeiPYfHQ=`"PVsNB? i`"=g6JFUj_8W$59I9>7^tIQ"$Snb$+ZYI:)1#oROhVX %kFqUVZP.Z7c8]a[f_a;`X6k*9Y"dc! [lN6BZdD[n7eEf/A2dBi#=g2uOo2;iO<;&G?)PCn^a)6l7H/h"Y2TKT@oGOu+%1oS[[8-g %R+QCJ&%7ii)SnP&gKa),?8IH#hY*8P(X,src5p^bg]KPs)OEN34#jWDZj2+ %kRM6oC4NRAaCAG&H6O]=l<l4na_Vu&fl2-h^"S;9 %H@Ug/l`ro00gHE5Os,d7145FJA>u=H$Kflp]@/AF$+p$G+3>C6k3Ls, (82:**'+3qm?,]SAaR'q$X:J0)7#?Jb?aa7[tG&'_'`Hs %lH=jn%4AMon*t?0Xa:+hRB7p2dE7P10X8n(]"kY927"h2fE(L.FQ:ScKFj_u7UcKjIr^BFj5\N9r4&X`X&!WGHGH4%j(gt7"^jB %7s,(ZoPbi3R.X)S/JAZGH=e8Ch)OXj#6>BINY@2Np8RT+Gf>Vm&[M9e.p0:jbEX!@p[!^NL/]p^$Gb[*W/ SV5@40)nn.C[5["[ja %&6kE0:E%jeUm:CM/]-p2@dKjNIqO7a^.%4-cEmY$cf<cE\Rd@!ioIXP1%=.*!9OB5J.kHFm'YmUX*pB'6Au`6b%b3d-N,!M`YNN %Fah/N3?"#fLF`uM?f&HL^]`9MPA.V'UXU=`>bJ/QD1&11s1ta#"6!t[%;Zs<pTkBs*)TDUT+q&o[6?@!aP:5-Q]Z%mqatN/nQeL %&TIt2>J$Q)$Ym"\cPUPS@k(VE!tfj)V;r.Yas0p7Kc=A%1:;HP,GB7#@gn9]Op2N\TbbaE@eE]OfSs$s %Qt@6ii$+4UZ%,2j5rc6 %!M*L9CuMV`0ipfrK#J6$GYJ[@4[gR'8f*R5E&Ii4@btRmKHhU+P35:3OT%d9?'Zsj<W]81L9rhRSO)%_ %:#A(7LF)=%S`CZi5JJt %Ok=t8qJDQCa@.q[0*:IJ.U.?aRc)&LWspEP#9hMb%`m4k0*'3Ke/SZAMiEH_!@Cq%W9uj66QX3=*$e(_! #a!oMaL'I*d$:q3[KoK %(Ai%^Qe9\lKG<kkcY,A.WUj]9.%c#b;S2tnQpsVQ)/HoL_FUIV87_&CYM9o*+OA=9odNpl9c(DDfYgL@#+]VXQl">4Ieo-hd>n/ %m)Q+jR*[%8pLA-54j?^.;Dp9a'2/gq<2ofJMPco2O$uU91-uo;Od`[n%fEj`0l9HMc4jVKIebL5Q/WPo5FZ`5Q(33rqM8`rNC_N %TDmS0rq=*uf&D2W=2+j:j0Wju^]*<?<s5pe?p$_n9^]!]_^]45hs6DoI[biqJ,<UBl2QM<"2!m&?'@+h'FJMp]=>O3 %!RTqL6C*k*'se-q&)oB_^s(s7R,@>6SkSqM,R_gplj@kFeFCGK>+fM&+u7Dg! UDA=&/V8W.m"-,5%TIaT2tFtAJEo<^H3EX>Jg6= %dA_R<n#I):[S[>uc"%2a>XCPH'O)@\J0G`LkUB4`ipRBU0^Wh`%tF-"cOH;2]`H]F(ndo?5;C[X@n.F>&k8Y;-f(R]UNimF@-<S %PFI_dHQg&[1^*)\:d$G6C;-?e+!m%0Si#MT9dW-NL.RVU-db8^@1il%*Bn/2TNA>TpGq: [inHs#pe,M6+6Z>8l0Ok9DtOs!dT\Lm %]3rT/#E5//S;rcX+liYeKSLk4?Qp,^9j.]3DJr6_4+*I=&kolf(+*m@5pOZ@5T>oG+BG'K@!Yn@Ws/ %#K5cc0L$<m2LVN\$=ZMAg %*,<XtY5B0ULP6RJ[SK-[pZLA %o_(+CVi&;i4,jlT(r4bR.msu@]K>B$C=+W+3jR4FInAg3E4_I:2pBLc_V(BHj]b)!)N&j-?lFku %3tpfVLUMDq).<+$\/HJ&d4g:A%&30OBh2SL@#QADU2aiH_c1\rU>jY5T;96#B]A7o>bcF\CSn*bFA.L2mnpe"^339T5MQ[F3)LQ %E=SMO_3:SPW6^Z`SmZVLJ7jJmig+mfG<G**?/N"DAV<4B@h$N2p8RNnQ;o*N83Sc&Xe:/RU5GRJuQr#[@!<([. $g-\P!<oEIJDE %>SAdgG<8okZ86qM=d5(2SUNb<#G1bWSk8=PN@r.A;d[V],bU9r0WElW_8U%?dsf(2",H,6)d?CZ>E46n3S<tL7$FjQ2K8u.f373 %;`2:3"@^?Tor$emK`9EjeC%,dlcdJA:-[d'Zpps!T<@mHjb_]5qmfic%ACVn@*8k4Tg$mQb_(@hTa&FAr02JlYSTN1E-]#ciC2; %9-@;keTPEL[h;Q%mG.WW'!_L/)X^GHaW7Lt0F'E:;2RCIDR)9R1+]>Of7nBid#W-OqJF1W"C40)eWH_Zo8^q!Ia4e8rjM:aLY[e %SkhE!DB&,4hWiVn\#2<Na %trOMcNG_k)DsQF*&>J"P+UUdj=Xk,qXQ0m9PRaoL\VH"k6BCDQnRaJSF(mcgi_:[jet9g"R`u1Ii\` %l)]@XQ4bP.fRAL"*J):SodVAU_!WH? _JJGCAeEjk*GZ)46W'A<PC7RfPhZ$8SZofXSNKZJ/lSh6h<Mnt5qTqg4:pXm$!YT)=i03r %%1R7PUnVV,;][at#oKE.=b';LPNZ"&,Z7LI9&=O+*! CPB,4@,hN7r$s$]m5seLB"oM`^W<3SMul1q9dqLU:M['Tdr?#>YX36`4Q\ %+bfU\7]_B`IAorZ:<9HpP(=f)=k(=]f@BQ<$b<foo$Hi;5Y51`B%HmAWn\96GA,.bO&MMn'R? P(fhS.q(='q&!=mT]`0oXIHm#/K %GeAt-:,NR?E8XW%K>[>S^QYf)Vo+OfB5eQq`68I3&n*t"NY %6:PJ5i2Bt)c_ck;"m"+;6>2+ri.<n@kBj]-(\+u\X4H+A.8C&H<\ %r(CQ45+?`:j,6bTnFNG[NenF+'u)k;jYV&7q>dfpD5rHH"`%bTVTFqS0FfbHN#+lhl1`G4\P**)OoX6j.Q"kF)Yq#F.U%cetn2J %>0-^DLJKr4Km+<<O<L<e2#W? Tli6DcaQbp'rBCKP<p_WS+G0h$G7_2=CU'AH>CWLT^=IGN=#_u503_QTr'SXt+K1F5S:?EVN'l%H %jqYgH8I?R]X9@u5&27QG8qF@#73.u%%,/e@E3al;`u090<;s2%j::II>3tnL1b01-fnLYfM %T(Dlaa:1(dFG%NBr,^bXR;=-[U1$ %I0q^>Y1sFn&C#?+*4p;rDLXM@L?im5<7";'E$-#0CF*YW]-s:@^AR+eNa20R$jh7Q;fQUREMFU^A1baj:_*oE<9,Mq/9;s\#MY1 %!Lq$!8,sCZR>U+Qa&X,"0Cp;]fo#@6qnV`c=g^@".B#DXs0B6FNNUQH-ZK^f/70("AoY11G$G! p#btI]&@m6,G3EGq,i.W+QG[(b %"hU(^<m3lj<j<Q+(YuuPW/lpd4rZ9^=j6tV;f:mT\GAYdQL %Y*Za,4H7]H3R<mSG&#GO\Ph,C+H]>Q$h.)0n8,ucnLFm3tY\;<Yf %=?u3M0c//31XOpMdsJ.,ftF[D'#au#e@e"@5_&Qn:\%tW/nj)j*b2FOqEFE#4s! &LntqFe3]+uu&8Vu7D$oPmg/&#n9!V$$8t6B4 %mlEV85^"V_6rCTG.)pqcpU)AfSX7WC>Aj$MQ`V2@:CIS;&()&KPH>bs&<R^$ +D.NS)tGWk5QDbX^*n_O9@^bW3'8t:BN>pc+#E`g %2RVHu]_YRB>A+!U+<+lo=u6Rnl;Uu4DsRW<H1'rS? bM4&*(DVm^1)WTpd6XuPJ(l`7o39<q\3@s5jGr<;2<i\.nh_7/RH09d0+oJ %\D):[gmWnQ(4ofOHlr!5J71AlP9hBHoLNS'7mATaCJ3H!e\=(M1MRJI@`ojT=flG5Prh10\UegNlsQkGtZh,/b6LDc.U[m4Q];] %n6[R4:C<i\HF+&Qon3=0YLn"T27CS/nlPe<q/$esLW%PZBId9[A+Eb4Ps'/.[@.Wbr1d(OZ/-! d@O9"ISTW+to@/SI-1??0D+\-3 %`ugdOZ@`b%J]3$=RMqd7lM.X'!C&oE@gdJ,GBY(SBB&;Y#>u+[&A94P5-TJK]a6ikq>;nderr?P!Zb! g]UE.\Jldka6DtWh92BVe %#1>/SY1$jp[IimlMW?sP03+/4DP^L8B3jl7b;bEk7p&j-V'^5@8=?BA([_"'5>n.'H>dp! ELuNj'm61oH`($QDi>([)gBNoAb89$ %lSsieVJ>t['a?<(]4PH`jnOLr?*k5u**dg<Na2nC<Q58(GH%Z5YE[=hR,Sg%8(R#8'j5CJq6+'(c_](=KB %,2\N#SBb[@K5NCN(* %h#!5fc`s5o8jGm#,AVKLR(G_4a&*,^faAa1Wp)M<3nX>s_uPN+XQ)\aCFPE9]*IYq:2gb8lthF)? uN&U<Le?d$[9`RX3$52bQ:o& %>C!6NWo\'m*0=5lU3@##6+?]% %Yo*7E9=6Z4bWKC7C,@&5eeHiNnr_47YGRN&3j;JB$iF0_;'Ec3+rA\9THl#X*4tKMU&J#%\m*+ %MO;3M+_8-VS9o7Y)i>ImE%]b?_Z9S#fmDT0jpVhtPCYf=l*1\oRIC'H2oLMG#=nMm<j=qdkqm[/) [=@b*kUNF3DO*DQFTj6=7K+A %&QOJ-EC3D="*XM? P]<])4]@X^+6h"lglj_2^[k'hK-)=b)^L5]n(A+pk('pIh4@3F`&AU4\aI4Fq``)NRMLgBRUAH*:A^iuFhp JW %9Ci#qOLVrYOhj(kIVG655>+m":Ks[a@Fq#Imb6cR@I'2:HAKOdV]Tl6?-'9QRcc)7h:ka0Q\2P>)&XYtX_ L^I!j@7Nfg^iP9451Y %U.#8+>;I8R6c"cT]#iKt`,QMFni(#fbq_2mgQKFAPcfZ$gA(Q2p?'<Q8.M[j4X@*W(YZsOfZtTI+hr.-1U#tJNiF^@MQe-]n)R+ %eEYG(e4/q5l[S8iCjX=lSusYbD6lf,[A`6kZ'^j=cc2T`&aO3/J7R2O,L)ZQ4LCrr`:)nu#CL=$kBP#E)Ba/]9Jk'`*.6o/;&#) %co&&mgoY:Do*\iSLRL]n4u?ETUESnrbe)&+j@cZg(.7%m,%$lr[.)_U1=\k+]! TI[CuZ_YAH^O6Jt@gj8UB@^i0j,4F2k42@W>LX %WB4H*TmDnG;f2Z`"RR$=n*?]o0SM':K+&^ePB%ppiI.8MWrb#"g4!B'i<ibN4l:F`*P;`Y:T\nV %b:^&Y<*[f%+d"qQbeEb^lJB' %Lm_EWg6Tkl6F-bd6(o'3J1gBdUW<fj\1J9*@MX0J^(.gOD?I&.DPHV8pkue.JZ#Sc,E?o&rlLkH=@#7]^.dJS`Vj<^+F#fY+V=u %OFNmGl[>^-gmdZ90ff?ZA!&^L\ePL1YY2cXG-2LFS2)<r1rAX]3Q0#$,n%FnLUR8c-I/9fbMT3EDs!_? iDF#)Uf9]gp1GEO-9)sj %>Of9+V]F_C8G(KX&u#a$O>,(4r>bej.TK[]fA4uk#UgP!@)#,d.]7:K2AYY4&Cm!.fd'n8mk? c3$&@6"00Tlb1Ma]]^oB.2k>Ft: %c'O^G4!8kP1HbTUL:9@",.qqQP!TtE`S^FL+`ACGNFA\&#?[>aW=C-'^FTYe1uuOa41>7,KOX#.9Y/N_,Y]KY"K8s+W.e!1L15. %cnis@,LlV]^Z4omUTjqbjlHj"MuH2$SpsBIpl:KM=1sG48(#-q$jF<9L+q05^I7g\(jT)? XLNg-'1h(RFP'ebV+dJKNPc??4;#)8 %!VD*naN'tN9/%7#GP7e1]%SI6(u`o3%)&B9e&U`[4P0hl?G`Q4a6]FK.CAmImM^f*(t\ %WFOgM_@d5lS>s#^8dG!5h,63M(EuMIn %3XPq32cV3_KK1(&$!aWUUaC#=bndq"bL?Q:6fg*-"u_9T_;L]GBIc$9s! =Ph>R`usA]M>:];;Ho[IaWS.)lO?jm\LEGK?8JhD/3R %iVFC;mrTR+X0DJlQ2P6Q23Hn63W(5W4-hqt(cBf[G"dGlI$$R(NQ)6hB7q`SM!0D`aO!%S`1]f\4VHD=[! fX.j]0Lja+O'gEJN&p %)jOW;:d&OiZ,[,CY1q)o"G\++n9g:I_T`E<f[COa:NuP28r.adM.pJ?e?;kZ(Z! @4Kks7q/ds_,m_<1mh1g]:<3d'9(R:I.\qq.Q %97KW\6ekFF,+2lg"4VSmQ&pGf8,k?"Kg3(;e%kZR;aC^!A&FA]IFHE#Wd"-q3H"fh\>-[[U %d9aQ[E@Y.<`d6%+qOY:m-#9NY._e %%Q.n-:kqN*]:b4pf?!LlBkX0kdeu5?'.DTNDq",iE]=IUc:of$2FARpWCOE(Cm4S(alC2"QFOcIM0A,2? +*#g9Lb'#NAp8(\W50H %1m)W5@"bL=gqhSSe`72gE8?<3I78E3_e_Sn=Z97&]H:;\6!? r6<Zd>_'VI4<'*BY)P':>\GJi0H)9kKih^H(ef#]d-6FP2M7q3dL %]AXm=\ft"NMKj9BGIaq#,4gcaqWXT4_]*duDM@l6WKJ'(E.f-b,_bOd+ (kb",fu.Fl;8@fggaSY+NUqGW$NUFn$='FHd82'0$SPk %&,i#Gg%CElbj(Eo)"Hf,2DI0krPF1h]N3!9VE@=D'C+1kB?.e:U/3*/ $f:]J2,'1,6$h0.1Q^oC)q3[A,:6YJAs+E,@1Ono[?CDK %c'4+\F$e';RPP-.0)ndg2jb936Hh(O]O21! W_csC`<_@)eeeFEjLf9?'/tNl9d2s\`mC8$b>'JhBD`a_@]0oKDmq5O?Ss._;Fp*f %F:)&b$a/ZNCad/J:*FULG[Kpeqb'n<;X2p+&n,a5]<&[B&ftEM]q"B_QiSuESGiEu? iSOSliLun2*_ui:63Xu;]WbdDmEg^+h\]\ %[AJIu"BPm`AZ&>l"-DQ=W/m[$.m6dr'JLl"[Nd8(++h$XYb_T70VDB^et57/S$$D2WRaCZ:j11Uo? m+]*]U?^>,^f3O!*1bbt'^b %R]m$1dYjE$_R-9pm\Y@Fn:$%]?6$."#"X"C+80;g[0nq(EV'Y;O@ %:tr(3M:Dc0NOi7\NFIWOWB(JflN<sW5abo@Ed3^Fu@iBPh- %B#=77Eu:@Oh"'Yg]KIu$RN<D3aa,`e$r'"d'ee?",*D]^e8un^IdK!#!s_9+3t["k$]UMEI] (k6Wl9"Z]43feM\-f2F!<]WRpMd` %eu+KZX^HeRU@U8pmMBdZB$iuD<L7R0l(1"NH$? bnHATk6*<WVoZUGD7(JTl^bn&+ncW.LoEk(P:*E;0Ag6)Q;_2Tm:E=o\S27m]' %h3st>c>h$fd2BSBa&Oeqe[IsoBOMQ^P`7;p=-aT:!E,<PKoK:6`uKM:Q/-X:$'F&N_+5@BraM!@<cJe(9p2N'tRDmY.\N;"7,]c %3\+sP/^R(N9I*9B21b596!m;[!:?_YI:!Rtoc.U_PSOpB\-SQiLoC1n^,27nfq6!lAB3lNa3%20Cpb^ls\q96t)ATZ7hme8@$.n %P:4DPK;TBD*>M3*MZR@\K,Ih#rh0Yiq45QK2dK^>SpH(cLW*-`9,h1=r@"HWT?;tnChMQhW^ld;8^E+9./ X2#43u`G!_\"alK=@Q %LfOU$V!-m)eh.6SCj6CATWq:O.qur.m)1H/? 2_opOeC*HYKlaa/3D(a,]]SV[4j;p8oO$,]i/WZW#.*T#jOH^W4^AIr7L6Oo<PfE %$2o"d]oh^E0\)Lp%SMA:Vo1E*NY"r*9Pjtlc$h0p]g)d&nqe*$E!0ilEq5:5],5^mAp=28n<Q2,t.XG8k3=-?"f=6<Uai" %Eg;/5Y;CD7$0c=deImokSV$k"#Rfr2'`himB)\^=$pd5l-eAa@:1?6#iLLqsK*a8&n1+ [nq$W=G"DGN1(2"."IuQRf_g=O+D+1l_ %T7`RQE5^48f05(KBuC:p0J6l998P"LTJ6["-LZt0%n)d2(>pHYcLP4R'S]uNYTKbiTa).'*C3)g"2"[EntL`/'`2G0O"i6fWO_$ %<9_6P?D>+:.Cf\#a+FnG3?k&MkKaecb1`iE(U8Ws=pIZ%`,=)6gda$n+AKTbFY? 4^l32IRk&=m(MIL:TZCN=&BVI`j]I]U+l^bqI %"W@pLL.]d`(2#!HPOp:1X6qNYG$P8k'laW/0IJcar,@_:%umeL[W6?mGo<<],S+BGEJ06uKUu<H2H% +G'6[(f1<!/(LR'_3Xp*so %@_,:'5.2sE+!4)_=VT*te`A[^B*Ko9jdKZN4)5aC7)gG2uT89c:CXn8\;\MdEBh(_R=TXF#0$_k&&G=,b8X1'9R/fS'L63-om!J %`m/I6,0f*'!mh9%-N=lq9DL>[Rp^b5@fklbMrJc.g'3k/!XJ'S`KU^qPo9]c40B9,Q4W*X+@iaVGIU %3_;oKGVEHe@5_QZm%C+7l %&7MXb5h*1'b6u/Y?-jI`#4Y5hF:&?C<Zj/FEk9&+Bjr<]&,,@'2cjdGT>l9(H$+"+f&F2iAQ&9]PJF87Lka2,[\$-h#P028sDP? %GM_$\6Oi.amW4fiORIsn.GhkdXb*H#<QWnqDM@Mi1U]fg_G_K!58@9.'MkS_NQ>GG!3Z8=Quf(:<D+! 5hV9$)FR\^Q/.NP_%1mfe %a):&#Wr:F*=O5:MBh'QTbZfD'Np1E_`;6`]gU`b5qasA6H*OmDP0[flW#T,j&**-CiNs<'nEdQ]<ku3s>] [,s.R1Cej!K,LJOT;X %"0`MO3[5AiOrfE=9:QgFH#)7chhX2]O"`RmCan,>_d%;+(Xlc8GRI;(VMm?u0^NDAFf! 6rReA!.CBDrFDlA)'pC1q%XT(7[aq8Od %a2H3=dDDPh[>O?a*&U(m9O+jid^SEQ1)T'XUN:_sLQ?Krb0FWZ'T&$o<4`$5LY,Z %0.qFFScgDT/ZKNK3s<q5!4Ecc-0\b_4<%-5 %?8)nKJ@IDODgC+`B;J];GRa&?Qf^/O3;GJ[&F*bYI;pj+kJYW6n9$)RYJB %@a[P(tK6^Y776cA98jWUme"Pf3o5Wcf)NM<3-2amO %W+*TmYhuX%DsYAr$%_-+ch%KC"jZ?XNZB^_mRl.Mf17qlT\A):TR]s*Beu)JQ`<P)m)u]J! f5WVT6h5YgIL+P_qe7;K"dJdfr;t> %3Eg!0SR=-@1j`^;0p:[,8_HkG>+'M-J*q+fiNk,f=O(Sc!t7W5pc(2+PkfNhaD&T,Z]9>S<6r"N %gO<a;!')kB2(t@(Y9Dc/+MXp %Pm!5>[ATZO>B2PJ/?<%T?L]%ho8A3Hc#`boGBXgPa^_lFGk&6\i)24V9Xc->d\a]Y7E#60? *HYUJ,hqRdaQ6K%iC?JMT)bRmI.;\ %`p(HZFC?FTO_:Ao'<ol?05!7'f79n@S7jbseYNOoo6!A$6c=a\<)@^ %g[R;qeVlesNhXWU<PdgjR_N(6RrEPZR?;PLdcHug3_WSG %`,rq3V_O\L@@T5JFH1"-Hd56Z,?S,2))RV=:_-n"ZM^77<C(Jt]Plh@'Ld6KChMLZ)UiT8h(GiC1/DU6i-Dl#gSpUTZTi8;WI5; %e\MoQ9\N<#OHqUiQfi*_V+]((LMC0Cmel/m7MZ7m,;%crd1hDDB.`6g\_Fdg=(K/n? 4B;^KnZ77l7N9+ho0gkk>&<'_jcYT6j9<` %oeDgrBr9'j!;e"t+Mm1[_@B$S']qX('M8/g>!4eX9fJP]AG$!taAYqYHZj9_d$C\ (2[7HGAnLIZgSe/3agmY8Om"iaU\h.%6>b(4 %`,-Kb9!'>*2GPRY\+d1rY?e5Bc7e?;Z3#3S*g_mDkC0t>3aUXSpelcAAF<E4&>K[*WWIPhGurKDRh! o2\EZ]_Gan2hj7)uS4E\m1 %JIR1/=B)raXauPSBWhuf1?T).Mh=i'RZS=^LJi_s+KT_U0%'tO[@/>MlP2f&f\Ycaon&^<<59]%? u3f$`=F$_*/\uJQRm_]i8m._ %b"7`\'M5Um\G[i_[sqiQH8<hb:WjeW$MmuLe>C!@+28d%(/PXmTl%%mj#sd25b$L#\A/:kXm5/>VMB0GSQ!hUMke5Vg"b!8<5T< %`teG9+Zb@"6(0c(mTZuP/0#B,jK-3EH,tbL#4!9HH%)98ha/WK66`8)N\n&KBI0/fTNL1<XA[<"$t>T? XI!0H8#S.jY\4#klHORV %1$W$B_T3Re#C@/Z`341&,>okK:t!?Vb0OKZU5bG%&)sKWrKRUp]4?,=eR>IRPjHQ5K=\'ZHs/]aL]f@Rg?KC/tE@A4JG&K5]IW' %:T!U?'GFINPF&A>C["ZA5Rr:m-.<+k4@52b,(3__@O2U1_'%iAc.5aq`Odo1fRbBSIr:/U"4:,*C? kHJPWu!-0]CQ:iR';.I^"82 %<Q %i]#.)lLK;hepSV#j]XW$`*0>CIPf,^=:nnimF5moXr]/pEU4aF#m[%lARZq)GXKZlVX4Ck\:4mn<#BiBii jq(nV5bi2'k\/\d %*iYqk]XOVIW/XGL9%I=Dkt0kEqMcmt>e?3;M!3)9^Up]/\ipmB0/n$'b-)q9qUc*";okaF7(5-:iFkmObMXokWIO,SY$sD9dp+c %n1ko-Is!88JUrHAJkr$()dtt>1I>EG(&W>]g\:A8a&l!Th)H-B+&T,,:UPGZ=r7@NS%u_BB&]?BT\+ (mUVOP=!e)l0"Q,/ZC1%uN %pu.YSA_uSIo%(]c7VC$=pZJI<X31#hCUp5laR(]?'K2ETah@&C? _9gedKhF"Q=2hma=DW`O[`>p'rW+gNs#:,SDb6PY):9MA%!b> %5mDYFaQ,XWqa+#n!1TdCF8.Y6r$G<*j:F1Y,8eM]s#G9U<)][G>S1`POTt)rs*B[bg]Z,=B0q. +gJo2a_:oY\\JjRP$B%^eNKcO5 %Mf`)I2(Or/)I,]6hf%Q=`I\2?.7._ZpJ7d'nie.5PCAG8DFkUN$]XO;cHFI"G"!FoCrk#/V? U4kKjD$Tnk9M"!]lAYf#YP2;!QW# %%u%R!A<qCChM*;[r"G3?1>*1_%oAND.t;PuPWfL0,(&G#'P,f;4,;`jP,;4a:<e^]q)5FI((a$3('po9R! FW%Am&o21gJY:-O)!1 %HkBXeOW^&9f,WHd&I:GK2;P,e4`:NEr4?T>K\jR^4AVRFN.q)Um(GP:n=Te.Zk1]Kq2uMH5L*'9_:Y2[07XrN0Z*P)F6NERRR=c %D.O-K-6UpB<0+*#.9rZ`Mo*a"ER(2N1TH)kYk%.LP+#;4TWJOF9L7@&MH45@<SoPgD.R^AhBUG_`^[JJCK8t]JB8iLlrf@c0j$p %==fLj0P;BCW[^\:WU<FcR2M14>0I+n\eIZ8N%^M#^*@>7;j&?tElZ\W?Xo9EM('$1fQbO4uAN>pHFWS$iV-D7tO^_QW]=gZg9cu %YXcehib9u_qWfi)XCO!5ZK"M+6ht%))uF?6Mo?0m^GbT2K*/uo7c@O2Se8X92b_n\XK] +no143Kl^ChfPe5>cTr`?jUobIV'#b:r %b)%?KZHAFQYVXi!F&eW4=(L$f&I]q1cXH#_RbQ\UL'-L0<`V6OUbf49(i'Z/9i\rm@YlMI^C.,XOjDVFY39;%dP'd?]IaNQ];F8 %4V%fe<B,7cNU7CO6/G>>m_c^(10fHc_W/#aocmtuCunLYd8E'*KU:@.j4Hr!BrAG7Z$) %i]pr(cWq<RgLFV*9J,b3-^l-P(8n"E) %G/U@W>El;IcP_!8Qm+u2q%XF3o2V[1M:q_0'2P;A_qCu\>PrI3Nu$c(=tc$Wem %BDV^]d9Ar&>)bR=?/cT)o5@srhDk'QhWZD7rU %I>#X'IN[&\ea@E`Mn?'ETbCXpY=&)7l0mNLI8QA2/a,..+7eK#H;Sj(hu_;lAN/,+0C;s"`mMZ)R? T0`/YF-!TV=%3=s5W$<L=tf %p/Z-_0eV8rnua`\=%7OtQ-C]fJ[MZ.$(<`9)3Zkh%n/(*ON83n&X`9*-(olhD%R9JA3Wt9X.Il6W$m/=F\ XN2c>*Y-O+(9Gn;,a5 %Fb<4@CBVfkFgag&"?>ER*G\1\I;[\7a)\]5YBd(50sg7$2lt'QS^HZ\FVj^ARn*qgd++-"S/9=UIkcNmultXMmm.)ac4q+%8a(Y %O^3ST.kY`e156HP+]`LM1p\ %/7G0mmBeWVchAI&O61rbK[etjSHei,;>\)0VjZt5'\qqad@B+M3g3%*Ykc?=^:*Eei:?M.8*G0fR %Z9_!/%T/NECLjS@3s83!j<C=ur=Yi56Y4E*kj&hOVG%S8ikqGk`9&9C1MbJd,.i"`@P*hGWa.Q<gGI<\Eo2i7["![afV77CaGc= %mHp4jG*8_%N%K#4I^R@\H)sM7$DbhWn^Af4\g)N>9'(r[h1"UJPD^Jr\t2s0Q*R3! QU>\tH@6Nl0"BTB;tf`\6&0#;-ae.p<HsBT %lqGhi+;e<^b+Z6=P[S(LjG<>s.\2`l.sosGB`GF9#gXK-/s=t,*#[@(VLtTY(nmpuQ$c7!`P'<S, [S.aHq3fcP-ROR;TI@0IdBDL %UWX*9^\[JA'LXX_c9c]S7>UfSpRcq:fiZVtlG`t? aBrV`;^X3B,cS.k\q8q[h+ONhkk]TB!\7u4?.7(gR4@/#T5._Z!;Sa<3+Joa %Y0-N?JI7.Vg*mC`lm\aoB3*c3SV-_eHMJp(EUN6+GG:g:dI\/2Bm2bTS,icIrRJf8hTs:4-;Nt7_rD;6`VBHY\.F!?iDrW"SC7e %6_T-*`5Gi&-jXgGrl`;@k31*ae>f;! gqcsOF*R"P<p,UaIXTDO'_.O&l^0h9+nD`1#mY/6pFHiIoToF#hCD41\*%9$4nIWO\m'8U %@=uJR>Pf3m(l);IW@uLul?G*tjIEsr"7XijY,DpU>`d?17=;<Jp9j.gHP&khpTEI*'$Vg.Oj0bZ[G! L4;g;=&5kXr0C.:k=h![ku %'5"L1:V9$PO`Gn=jk+tc0@Bh#&lZii>2o&ha\U/pJi-Sk:\LGA4@\,-jkV7-+NnLY*:g4IO.j]5X% (/KK,JTkfTJ^7WQ[3[VAPU. %\Lq^\&9L;M^PTCLBMAbk5TVrY[:RiE`hh7$&\b!I;*QnhIaM]`\Fnn$VG^0!$-/ANrq\J(?jKV: [RKTO0lc1_+CCTs%>Sh,SnWH5 %iu7`ek2gphq:An94R[SbMrq7:'jE"im^MDgSbAQ)oE#iq/+U$\57DJn+.._N2=<YPc1,7\%X! IUOj?'5J_.J@n^7?_ok_,+B^F_k %N6F$ge[Or>q[qU);(VCg'>DLq7J1It4,Kph(TRc)6aI@#+c<?)b7p3*HOP)d\G^eKX@EF>g@QB49#! ls[i3(%&:;`iO%K8rLZGE! %&^3bN7s/(m/J*68ZQQd$rqk<88`!aQIBje<dE4J>CiX&$HeDuIjeVUo(<mu,em/FNpoul8B(qcX:-f:W %F+6[etO(?P=&,IQ"6kD %"U]$Eaf)S6!Y<#P[@)UgpbkW8L,/DkmdG6Lj*@34O3P3V/Hi/5E,^giC6_ctcE](%[9!5!X4^3#? M0./<)hu`]V>hLi\lRJVr`ht %f-3ir6Y6'QbnS=#Vdo56/<j'grs*tbCQ5(h3GkCBgPn)X%N-e`48b9<YYUi5d %]c,<_;CiW]tZ'YVj\K$Hs_C=N;ncH_dH*XaQ)F %*tYL<.eC+80n@Q1r%>BF1Q<)Xq`]X*^iF %0\2,bVgal=B[tORk'hs5h'u."K^$_us_b3:)Ebe'.KK\g#U)Z/74)]M8*C&Do+k^KF %'93u0a)ZK0779>&e9Gd%Yp+fC`J(5njt\.8".0nGKp`O:K[/0E;=;o`'uBV@>BCWeT`aMT:cpcmj^ %<R2Rf&rM0<(dC):=>L2(UO %2V=o;W2W.%/j2;iTpgnl.JSc$Ee"lI+r[:@Da,YlMIN5,NNmj3:? B.l.;FW;<&^P2,)An*Tk3$7X,ObL_V5U@<9iQcS!Rpn4;)s@ %/63;g%ME2mkH\'*VI5$I.c!UTSZoDNGfiK$(SS1,3nVch_b!!8>kKsBp,5SqC.'_DilC/H`="7P#YdX,0K?N@;Y'MNqG;*(i2(@ %ad!ZBq\lMEH/9rNY:]\gUMRb[0!\"KgC5N`k(=rOOC&>Mgh6,am1`LarPPVNj<2,\R*HkYP#8(PL!)hJ^,4qX0[@\J)3Z'hgE9) %qNjQmom[QaQ\2[`;At'A%FEK7+nHsg?-p>nl,,PL\q+o?jobE?$6Zu&5eIN6cFO`OZ=i8T"^IRP(C2W7K=GRDTkMid>kr?::,*k %_s4>opCWOj3G,8B^R_au*<FQu"s@rMLih4>gl^hW:RZ]JMNXaO>I`H3m;aAtIK&s %13cEDX&hR7k`3Od\lUcq;sugek=L9[kfU,/ %4i92WHoW[)nYVs41mD,3n'Q'S*WGeF(]=%A+n[B(e->EV))!O3*c/A>'l`\ADrHtj.=%*d-a(? P;cECC'AG*3c4AX\lR!tTR=2uT %K$;4ch2qb)XSdKl(nGJ+l?lp(/8^$jQM@^B!d3KZ[-H]($)9srB[U@3n$6FkK0FKa6IYpn=<-. $`#l2GdngV'O5Fp`O02p)a0H9d %c=R_MLZ*Bs2M--G1LaZ^E/0? jLH'dD*'/6^#G[dGe*6"TGTfuK30@Ue)iBNf<es.X0=6@)2FeF1,8/iFO9.9t_V-4AGr(WlYbG&2 %p@J'/fR)*0\;he2oXc@?+7R5]RYV3Yp1<kfJk#A0L0hafbk8o6)[ZiR-&f(tJtNnZqH(4.STDB!IAIsagT)&Q)q,eQ'IW"HNj\o %m%\[t2L1[`7W+(<,T'^fLVRA:Sr>-<!?k9oROh+i4EefIeo7[)Ph`,LJ>O<j8#:cq@F*ahd3,2? G\Q#kM.ZsT*fl=L&-A:oh&puD %SKMNZEbQsGGWOK]TmJOHKH>j&B.sl199#VQ2me74Z&'DuUCe/JgtB8X#S9d>M*hgi:j^)_HQ1`C<=PnUBS facKVg#c3XmF!',^UW %'+F[=[44V;(]k/fC,AhY=4"sfh%*`#D/[FSZN2l_;s$0==i66)#`:gEt"@B)D+ePKGpdiAcSF'o/C'Q(iO0*$DohT+d%1q==m;6 %$k5t13t\P>C0@$?.UBnF((9*Zf;'"(imQE10!lBTYLm?HE<uhr=6n'5/C`Q8P=A/=?k'RRB*TSU!6$ $"0gX!rQ[of0m#l4e2CPb: %=WnoP6&X0:(tO>!RZZi=lHotebm[[R3?o)&)fR'7J+=! K9f;^13:8nf4\_]HYmu,piXumsfnQOV2=TkWYbUnO!SC%^RK3Qu!3@W8 %IL\+mZL<dWON[F7'$V!+9;RjbKq.<m1e6A)&K %J4DZp5gNqC*lkkh)eJ=4C_:Y>FFJI[9Q&QlRWD#`"X1a(G&$@q+=eS:MrRX=(& %GWT.W@*I14AAFR`Vlo/2"u;MgT9)?Nmiu]$i1gH?YKV;X`PpklVqr0IBS");kd<$?IahdciaNiH%8ct1EM %7W^"Fg0S\Ll_/X5@4 %CtJ.0o@C/,q?-`e`".Id6kG"g'k=k'BHbKeqmg@_d\jh>#kqRO@DaqJp:^W%3uA-@C9sKs@D\5Gj? @Fq?;4n/`+%?I_26SX!E^b\ %Y7id!!,slAO[Z6m3juPqQNr&n:DJE<+\@-MQ=ka9(3t'*0HZ+L]i-e'bMsq*! 5UOTM77U'Ktq#5(l0ri7PpXL3tgg&B>tY_CB8cu %-P#Ha<@Ol-7N:A#9U"h,J@GWg+_>)f8<I;"Oe-[il0r\XMcobd8eA^.<FLL,<J%su_3eQ1QOXI$#fhN %cSj+Ts&Jd]@dU)T1*'k; %52:!X^>\2Bq90L:\,<U=ch/p)n^!N]UX[iH1s`lJWXf*6)Y*1B'nTo(`,3/drN^P? YgDJomtqQAh^Ee",NTgT(G8NG7AL4JT`p$+ %4enWYe?Bn)kBD=u`0<Trp^p9O*iX9E#bbc@5^t7Y><sGWfr.rB! ISegbq(S8>H^B:l=(I7.P"t'^^/dqfp]^3j[+6:T;Idu!X\=U %#@$Q0j_"f`n9t@2&bGNZdMqB&/#hQCKHP:i@Tb-+4#oGds7p'F2aCd3-&1iW5WHn]IH^lV`KV896oD6&? <MC!%*o&/PB<K9#-7\p %V!I.1p.5=mo^%__Q?"SHPcYt7oM"2gab$JR&HZa8D[.10R.4(Gaoi_K%$n(kJ? u*>Hgb)HGuN/5@Yu.Cpc(1Sl#ap$(_R/#7_:o? %AFmVOd(a9$Heotq;p<oX7>b?rPpoMZ;@"+[Z38*foDHW`F0$Y;Ae="+>_I-)YUa6'"WIuK6"*bK:"YfkoS'*C4;^E3,Ib@>u!Z> %+kn:W+qCAFGe&KU+!a6ujDg%.!\Z!`X*M.,@o;o3bB^P4AY)%`U1iGeC!jX.,/5M6Vu0>, %F>AgJ7d5F&3BX#UPu<LTA'=W\QNZe %<0.J^8f/(_/RYO440`-QW(%fK;FQG1#Rcsbe=lVDB^gh#J\,WX@;OL.,@UaA-?E]2SG%VNn91@$@! aU#UhN)l7Qc=nH3B/e,:\tq %GBa0Zfh;[lRO\Xo&DYf1`rpK]Cp"Ti:TCIJ&ljbt\(%su!Pu6NPks$1rqp/)]frYBaM4E;aFS>)O(g>;>/f[4*nZAl009LD_5M[ %'n\>;lKuO&MJG)@p&O4:7"9uo)9:n=JmBo>Z]<;**(EQ@JCRW?Zkue`FHA+G-JH[mDZhBmEBt_ %0lA22G@eR`7fXO*ph_Qi14(`R %Ple;u6pD>:hU2^*J_A`U@a&G5=5$&rDN/5<-&;i#dt]o95c`MAik.QZAH)Ye@,@$dPSOCKjun-+k$C %e^Ak>=q3gcc8oPK]%Gg[! %7=%F]pi+)Zai&2IVk'pcFYO`3PrrNgd>]Z$=6t0PCuaBW_+l!DoPD_G4hlP3;ANP^VU0q-aG.KbYZ257$\ fIA?J])Bn&$o-eLjj= %/=4">Gf7`L3&lZ8K;eu$N\'2hl8gLr,q+nD-5P\j+;V],hd^EfA6$&SGfLiW<;;/=r5(^%$"g! ho)iR"fh'C@+4%_W2r+K<5R95= %idJuEC-^J=G#WQU=>>=RJ6"Q"aGGrnJYgBNe%7_rIEQAm4] [:P.c$L(F6=@c[LD'&kgdF0+ZjcUgH,,V2Cur!,WsG:gJ]-FRqCM9 %.PXeh4aL82hB>#GC=9>.Cf<E>=+YOf^3:"G7j*+1q^,*ML? bP+H7#<d>*s/TZ*HN24b6RtrSVOjXX>LsNhU"sHLOBL9[8>dQbmV` %"C_RV"(i!D,<4AV;JAf7.mQ!VK%3O#L7r;]KBC"9?s9\4JMRIN,9.BB$"sV_KhFH,OM^1#+K"Pq"B_`8W! hr=J_3kZ@,Z526p<lO %BOrIOM<YLO8KPX$6,<]J*a&ZdA_M5_>q?)'"u*n=+2sOMQ,dM*)280$#`IcpV_6MW![Jb&nqn*D]1TY=`P$]O^$m1&FJ::RDZ$5 %'o$u\WsTQ=JiT$kFL^r77AH`RM"/hG#o5`Jq)r1!/qSADmV>A)ZR? JsV'+dYONA;Y<ld$H7Lm,)Y+@>8Wc)%LJo3,K#p"q-1i#K( %VNTL2BhT_4`K/tPKLq5l^dJsk6cp7&+SdHI!>_P!\;N[t=?W^G*U+'^:Q,p8KZ"Yum:-W! 8PEU\W&"IRRQca">%te!]4"J>6d+L8 %Pa`Z1W:fLJbue1.%21E]6XAZfB*PbbA[(]8MLfrCk^Q7Y;na!m&D1+jE(X_3@!g]m!@^? mVFB>OeJk1=4D?OsM%OTcY[K#-hLL>U %U]I%U]HC5oJ7YKF:$=c3&Q[R`"uH<'"+ge3E&ok:1_AD1#Z"b`0c3TY-e? KhLEhPZk2FYm`erF@,Qf`*rj`H&pkjal5Q&ng/5n&N %rc&K4&2M=o%\[fG`.0\g$RD2`1kNn5V,h0EBt_b9J^[LaiTj:q9*g/`L/=J7(p'M<5q"3;)Q`Cp!] (p*"R&QgmY.7cF."/7@+P+F %Ac+j%aY7:_:o=h@5QK;3$j3Y`X_'>J6Ua$K5mIT6<;6\6SpfiN."hC9!%%7W%?B5*DmImF]B%u&S?R?G! n9Ch]Ni,77%.rTJA"95 %Q-up*>^<?_"$h\:`Fq0_0EAr)l,!K0E5`gM3i'@hh9aC3U)jRb4".(@;,,muE"s,.f+(G*9cl-H"l^mGS! <C`qJrjK8`W$&ME*1l %e;f&)Si7M#l9#)L0JQ&"'Q,a\b;'c:M/KG_VCY%B46M3KJD? esmQ6E7Z7%A'IQ5VCa2T=jg,7ktYUj5:QpgaqAk2^+aZs0_80/mL %'iLA3\+i<5-"_'.L\<9;;*"iT82IIg*! A^V2DMXg"mCRgGjDS)ZLA\5LiBdX'Sq(C1:Ul">WJ*.Q7LUs8==QME:-1aaq7C6,S6=e %Wf#.hQOJgTjd<3L`tBaN;dr2^3YA8&aQ:;#'#h:FiV"O+(\TuQhZliS`EB2;*PuhDcJ^W]"ffC; $nHD5F8<Oo,^jY_$N_OB+V6Fa %$!:FFAl-RS7N6D,g8P&[)7;c-'m?n$iO^o.!1om[#CbFXIX2]B40VG071mW:M1Ad\r(%! +=E,h*+5j,S9)o?2oBT>M(eH&14#q%6 %1^H_K9Ss,?.f'3HR(,,S/6HLu@(t$4Ahao'K+]3*RhDZe1l[4E%)K9[T%H)t!JtMA#!(>e"FN?,>Yl, +Q=^<dLQ@(4UCj<Lb@%?g %87A>)*sO0+I6>H:WhcaiE08)W9_F1joj`U_O)20:H"IETWNtGl]0M%(dSL/(5j.5h\kLY6J_87%8]3+5'$ $#@;k,icRjk1]%ck^i %WSW8.8:c\$fLBX[]sd3u[2H&4Jf//5Z:KW=>S"uuRmUVr\e[g#1CPXM2HjZIW()k3b# %a]W%Mq@rggM\u"?BR8UZ"&P9D*f;O$WFms3$*-.B3[$ %jbT51)*^CVZaO[7f_Sk_I6"5c*DN+s:74)Tg`]RcjKV$B*Q6O;F.'OE& %_FU=Bou.Qrkp&>$BOdtPd9m:Vebb3*O]?+c?ic5ecNG;Hba`2gHMOgB;\Gb4Ok"q44ejfS^qGic>:S(L:&^`4IQeh_Q65"KNJ4Z %j63CqL`0$%hf-j$k!Z.>38T*&kR=e^TN7Bd9kHtBAX/4/U'Z9X7"CC:,Ghi*4p/X?El&nCO.f)ZHq %i.j*I6>_Y!@ba-E3Q)9Z[N %S\FV<Tm.9HYNJ\GJY+O1;;1WdB%[COC%`OD:fugiK3NOYOb&#da#W1B^uM"iK"8-tGRC>>^,+Z? dK_R5h2j`9'0a_1NGuc!esTad %doo4A/l1=^p5$/.T$Y<PRLH?EC0Og,i)^1Y0nP8p7H:s2`slr,^]1Xql433oPh1"? kF#6*El*gJV&)Tf[H#5!d<Y!;;<WY'5*rT% %]L1qLALCX? o`hqV$nVJi(f=2"=L<UCa\=]<C8C=WL<PsfDdr(7S"E^:@gZYL64o;1(W`0X$q@oG,)Qhm9]lBhTM.AB %LuF+&-qp` %A"'/*iLAE5s4]SuB_8`j$oN-JR_^`9qUon\D/bp+h;.MW;B-tMlhR[G[E\q6]+i%32&2Tr? dli_rGLHV]3N7f%r`6O`_CK*i(Pu%Y07Y@^oXneT#c;Cbm=?<+E"W<GK@SpDXnS9DYJL:>FG^-cMVL:C%e*H!QFEd]4`&>GZ=05\HWp"Dl3=21mQZftXb'WZ.03]e+&" %.#,#n#[#aFCq-F`+Cm8Lordq\Rap*ATL#oP04<+--#8SfV! gU"p9h]@482/+J:coDY]`@8DApkpbSjShC(T&+Ht#SZ=(^Th_qg,7 %5k`!PFcR(T]q9"KfoPhP7PXP)/9usp?EGe89bAo5"eN0.C:cmN5(a1#'HKT<ZI]u[AnZDq7D0.j[`W1d(5L\MIkEgLb3VYp27gK %X%d=@BS&2SWJeEm?s'n+B@(7R#Z"DVJL^:4A#`>,8QNeg[fUu-822]+f!_FUNHBcT(3QoU$:Oc<;]*W%8/ A3>,rK8,L5IaJ1!ii7 %'?4Om%9gKcUPp#8;*Dpu%;Tqnq`\](Y!U@aZPO]Vj#Yp@Ja)ZPZS)n[1UIqg6Y %G!/Q`M0qm4Pbhk=:a`"aHha_QH;kNPPD#2BE' %S;\4YkW9DIdu3&pJI`GE0n/0%la&?C-g:%>o]_%g(m_;KC09nj=.S\@[VEr-WthOa^bn@bb<r7C8AQPY& %i_05dlPeq\W""7_B16 %4`%E\KZ,O?GE4g4l3*Z]A0%,pF@qKJQUbN;DF]! #=qC[TKpQPqWJ982F<nr'$ViQFf+cO.EaX)qJ>S"605G$g,&oBHg=^Ae8QU7H %A9N7VN)Lu9c1:*9R$cf?/@tQ5<A]"SE`gPak'&!$*]6-ue`[:H0]e=Aa])I!Z9=*Zi0C^6-iR<-en! X53&TEJ:eI1u!tCX(?IrMQ %"0tpb?sdPKI."c,Q(/<*&Cq>hVCDf9#]T9po;V=;E\R`caHNRDa@S1CAI;*$I1BP<]M1+,kG`f,^XtV2EV11d"U1$?I']"L<jb6 %qU#)(/t-Q6AShj*2J3'h)! 2pqE&UEC.C3.IY@J/VNb;nGGX_7f$.#&b)40CX/S=4q1d<U<>RK$GR0[fm)>9tIEp4ARms3k'3>dHE %%kI*p`j!N5OGP--.>Ka>#+`P.5E!W/&na7.L;_7ef=(^pnK:]-\3c/o(\+7FIFI\6Vl<$KO3``jQolC0(/ pl'aeQTTKD3&EQA1mc %=."O'X:6SMbSg^4B<eiB?_EqSYjcoDs,:4m_mb/9Q?QAe_L`0"%ZKRSi47/%0>Z=X,H(9Pb<55i! J*SOncVKHO;V/^3YgrCnEDdu %ljTE(IZp(</RYa?3-u=YiTOt3!,#kUc_ajR1Wt!SguR,MOJ %@"gelD@RDO^QG;8Pm\L#B`a[sEtZ"C4B$Gnb8?=bHLI-=!^)j&:J %1<IP(pDp[k!@?)."lfE_"^J>37nV.sS#WPTrF:^k8R.@GJCq"+J\FM]'NaTa"KbNLE!QnB@tVdL6? u0[*cYIk%aoOIQCb/H`on`8 %1Jg7R39#i#N]P<NJd(f!g&P.,d==!T(;aSoo526Eo(.)70l92"C>q*qkjnepQ_: $Pd]ds+fRS^J<C6)N=PU7I#jcS_=,m0\=;4>) %+1%N$ZP6i%V4&'74)smG[/09D$Od>B1FQ8*lt6GQ/1CWR787"Q&do4L4)>9%F%Kg/L0XNg!@^ea>C13:]3HR3"pC18Md,[b1,C. %J=%@/(^OFW35]L)!krkW$rh*bYQ9CR4J>?7CNr(trl=lbm@V]hq-D]e<UBRXWn=jIXA>Z>MkMtpIiTXC#;nl5F[5_aDK<7Rl\_N %Gb=,1;b?=620<SUh"_2E-sd:o!:M2CV2d$-5;Z$VSP#F\ %<d'XO]K>n&WUGKBSNJ#k@RIk]n8LJ_&,M@LIA@63'%8B;\>Id&X]S. %?uT3fIDZiW`2'+*7`d+HI/Vg*Xn8?@*VQq;%IU3HB?jC]*ai!&;C=J77g)C+MhjQ`_Y#>g"9^hQncIn'"O:=PW>TI8h>n*^.9Ip %)g)In*UF_6NbWZTgF_Yo!(DihiR7!/8g@R)+!kdfU"2djN"#0=oLaX3.CsQa!>!Z!hum_)g?B7D:Bfr+bI'JF=P?Y8XlhMc-$,) %AN.%>/`1$I;VZ_6$DheCGhtG3@2io'#:oP53q,Fpk:3%-YkHh@&Bp].q)##jO5V3XDB2c2Lh6p;G8S=B5\ _S]"Mm8.R?p\FQ8&Lh %1e"WMCf#6S^3c8l9f8U$`<P'7;#`]F3plbq6%tZZ<'V1=#.h`9LSu*p! X#jS`-/fI\J]/X(F+oZ4n\;s10E8B('Fek"_\Ji"dl*( %(">UW=kX@,UE(b;VbLsf$%R\+=Vg]4jU%*?#I[0t(4/kH1hQ1<6F&u]p+FhP*:uhJ.FRUW"te? T#>,1nO')%Vnib<M\)=$)087m( %<pqm\H*IF'U8d^<3,bW2HX]p%K7h9M)Lbj`$Uc+Y)?<eW)!G4dY!h! g#N1"6gl`=7B56KS6'tqG037%\6AY@7@QNb%MKKtS>D>qt %;#];u6J=)dK"rPC3cioOTU,bFBkQ"V):&T[_/i7?$afZc1`!s1POO$9m0Q$q7bmH<L@? I*$&Pd=)4r$B7\2SI#:tC6<[mdd6lZ6S %<pVQ"(*fRZ'!uLcOo?p<A1SP^8]3D%fl5D`F.^9',D:6X2Y2r]b7)=DG_@j?ZjS+<f/8)? Sp:btGfPGl<he)WD?J>]J#Z&)KFZ%& %fFZ=;>Dojib*`+J]:j6jDqng'T$`U1Q5I^3(#5LW8BT@5'mji_$j"f)G_R\@E)Doib[ZljbKsXai7\C#Re 5!VALuE/fn>!+oCt]\ %24\r0Ka(Ol\M\<! @+sD]R!:437RisS/Rf.;MiC#)]Z#U<dO7"M^ME/6Y6H5>\d2NC@Db'^_[JuFl=(DFJlS? AlcK3hbI/'\)KR$k %AQu;_:GD.(69oESD^"3paN1:h`GD2>5!53WR>(!M.iUCr:WYq[! pO*NiO:k#Mc&H0lJPq.7[jmhb*H;kB?!:%;3$6L-Yr5)nUc2V %CWK,ags_)rS0H:@\>q`./]lpEEYtI#=&h$-6)TiOq@QXD=.1pH@4A2,#8RkE'R %OQS=t=ZDrYW4Kr,=3WJ5+aRsS?.KZXGG^s0lJ %h'h^r@F<8@F&do`)!cjnC^G]sId.#Sb6ju<9A3G+^1s5Oiu9Ct`U9H@.e.2bSP`l6aB;,$d)q#VGd"XeOTb#KnM2.5-!k61!p4& %F$W'u0CoU"/.'tVn?eb0"ISmY]<](GM!58ZJ*3j4'46eo%4QQ/mGF'X+XcQ>B0d:K=dLU@+;! pY/3\7\BWFdoR=S3\Iu;Gp+E\S9 %&\?<(_E]j"OW`";^6PY3+Ma_aG+)Zjn>P!9N_9i&5ntYuF*D%s8UP$i4R!7cU`q4Re[fXplen25jhna#Z&#9B?7&DS)C0tc;52p %I1H1Ns! <<&i$'7)p\TWB?))4uoF$HA_8>baQA5&+Ml&'e34"VQ$e'"P6h<PJAebtN8>Jk>KEkN:=Q)W;ai15Kqn6kc ]5c7XXC/qd %2f<Fn('MAUNQqN>n(VA$_7E%178+8Q%iE0gEY2*9eR4W`f'nD/CcJe]a1J! u2\XJqb5PTL01g1/nSY+DQoPrHcn.5`&Dnu^Fu15% %R7C`PFujhK+E<5W=]9CHL-qo@OVh15]j&<N3=Z1d'9d#6gmSQ.PUtL<"e%^7)PVEAN-8mPN?"? uJ5T.<bWrQYmQ[6DAT-R9cO,!< %U-<DI`*cuA!=B&HOu46r%;EUEAQTL7H*4].-;<k1gI;L3-.(8?YpqY2'HMbp$7S49@`5&lKLRADV7R7^@BsVEKJU=jqF,RgN'ls %7c3-lA/8(t/;\/ql!%&4s7_Da\8_Sr?&0E+.GpFp$WGYK=AS'3dT$#D>=`g^jT$YQ@L!Z`U>H0? H_M25/jX[aLI]Z%<*oo"DI)a2 %h6FfTW?d+Jc_;!eBY[0)#? T"f68PS8#Hb#*1M[O*]3PD^1a08))E`AtO"k4MqL7h:a;)Q:MiVgk6^B@^:]Q\s;'gVlJR2n@.!-g' %[Ad=E^;Yds9'k[kq#p,ZWc`RV`A9fkWX"Y!d!a*XSZS##'N.ngUEJ`@I7'Ofbt3\:GkALA0'#_1T %-,s,25,h'FrGIRn6_1"^!1= %gQ+D5P<r8BT!M$PAs,^7-<$)KIO/N=MTX3'/a1,>Xfg'o+?8W&.((+IKf_/5"&o?!/DY\(.pL&i1s! fpbC0r4&4i_g*(6!1To/6T %pFUo<[Bcd/']QgQ=-CeMYcP!9nRDgVb"5[-D]A&fZ(,8Af.&o8M*M2f9FPDpWiZI,7MARJC)R,@`G-/$!h %#Z?)jq""m+F2S.&WG %N"!uiYg#nL49-_i&E)Bn)+%o[A&LE/YsAngVRWP7JVZVVQ]=uA\bpn:G4V6Y^;"Zm)n33m#8! QepiG^B88SPcK4+lDA$ca*&eTpQ %jJc5j=_k!9O[*;"fiPk_L?l5[d!;0);5%KgQs1tKnkt\i4S<YP?/gT"K2kX<BK,*3R)CdkOo$YOTdH.Ou(D"Mf99H/(_F#e/5G& %WqEf^%?a/kjSK''ME8bk1>"t&U0"+lR!3<tJ',]o3Z:q^(U(nWK(^Q=M[VJjr_!HB,>sO-%;IGKX:Q!R[\ CDRgT%\^2H3,%E0Eku %2r/paHZ9Rb5c(pk]f1s1).)/6E;U!b%e..SG-^Nc75!cBWo8o:j.UeLA[<ep+r3mi4$d2G;&b0f9K? p#Za$KB7C6CQ[D=hi@6ujB %L1+a";h4H"fe2.BMLShemCE$LJr^a4GIbJZ_`a+2F=hM]Z_PGkF+ll5=V*rloq($/K7EnPNDK8YkZ00r.gbShQhmh@UFLlO1q+^ %KqUOGj*)=sXr1Ho]#CaT^jQ:NA)8"<BlV&2">oNTCui#WG.%S0-bte"OH*cXIu(^/U@Nm79+o=nX]_BJ6^43<7J+3kq)!AIA='+ %mYGl27,83.$^NbDFqdA<MOCffG*[+$7YWhNXJJhM0Z*;tP."BSp1?s'&eTrBbIL:hpHRs"i+o,>! $X*mL")_[<iXdsM)N1qBl1R` %=LUnbA6VU0$06#UE$A/Q&qq>+Dlk3-@*)a$Va3%>%;8bZo\tqN.SCDKJuRoqJL@@9K3PM+Ld6f$! LG=i)X5I3?cN9G$KqIB!l#ii %qMU9P1c[#fbr`]U,_*\iBY+L@oSiBRm=a_=a\'tP3+RdTdX^W&1mILp3JTfV+O'0mAkOfi.:S>a:lRQ3p7:AI8BfIKP7<9qFP.? %P>WVt)pjS4)Jp)NVMK.m!r7E2)-"CLGhS6Ol);QN]ElR@R=JB^'*LMiRM1e=_m! 7"YeulsE/gkATWrg;7E]92n\h\J2Zet9I1"1O %!Uh*YX=b:F1"pA]g/rT4cqE4-_R0q)U).V/dZ#CL)B=D^&lCqLIX#C*d"3mB;3O<Re-*@A`pi %YCQp,dHA"7$0s+u8q1oE`l8"`- %T]2m>?LBHQE08t)Zs)sjlO4E,'^:=<c[!(8["K_gT? l1@hLJejTrMX+70HPhCn$-:44(f6hJhV0i)jI-:*pcDU:t#/r!"m17)j:K %8lB7F91!1B8;n2pR>GaM6,(K07]2O]3SBe@D!a%2<.r>KNMT7PW_?qKn[8r6G9j)pDLpJd@O[K6>6A/ (6ckIH.jGQ0RY1IqAA`US %0XH;i9c+`JTu"RdRI_:!;GrScrL+qTOaXf;K;,Ue?S9>^Lus<YB2a&*`$md^eP"!YgDc8naq:`b,M`;'&? $LW5UlEr(Z9s,q@A+O %Zi?q!^tWTP#.?q;8asAb.(t-81;cR-! 5b;DB*l/1dlkoO]sH^XJX@^BHcfGdg#D;5VMJh+!)g0nW:DWR0W77D#j`1u9%74,F]*4T %K*#,p'PeHsJ#i+Jb5+>l<ko@+\g>G%IKm[$9+osq[SR@.P+=! UQ,F/FkQt;GQ^'I5]>XkGYD=#,hMi200UY6Z<"dE`>>]4TUBZc4 %$U<i-!t[:7;+1ORF(qU[*KeVZ6JK?s^%o]^O/oWnn#-nH"1CEtI+P#?M`64hn&_EXi'@E$)CL4F! 60"Ba(Y5m23&#tMpgjlG^c?b %3/7`aE$usg%,B_%R*=&NQr)>Gqk'NG$5gboSd]ToBTV4/%kdL'q'_:/Y1/9c'g1Rc2JrlL6Y+.:i<!aZ:En+!GW40@guu?XOb$V %ojgXW&Mm7VAg;0D6<VLHW7e3oLP.//J_`.cr!:\ [>F#4$'3FbG@UgYb4D'9eUDtK5'b)k6`!)YRkFg3Ym$qs48$T],bU4Zp6jW\] %M.*?j2BZsPTaus-M$YJmT[,;u*&;:6(#:WWef]\C1t_ %He0^n`jti>H`cVl_L9Z"0/OV+YkDTh@+H-'@a"dLHr?a3X<!j$gi]Dl) %4)-@l=G?o"47@Ls98'&qd@aN`@E=LgU^tkB^cas\6\Ka+euAQq!Nuh::CVWf=gVT=YL:$U(>L$Y1:Nj_@Z#:'-!*.Tg'r.>VdX%;fi*qNDf`&7NU9LnEh!Fh&QCPO#Qf'T76c0CQ?\YY@$/#^3P2"lMIoS(J!)dcS&m %9>]0tNe"<;k1X2d7dE(gMH/7a%7(b:ic]B3 %g4L_q##>=/p64O_j!Cru]c^da!so)/g=8f;(aPktg`7)*0dJ@eN>kg:%E-D7d@oM<704N.:r? S6#`"os\__ZS*==\@\N&pul;9#S %Ohc7$<[;i7q*\[N?NqoqLgPA"a*^1'#0M@%WO=Z?aad))+!tNZ-q-CoTYmZJP5DAM$%/VqIE3? ZFMAu(#:gS=kgUXh^g]Z%c&o48 %W@nuL#K`.!_l2^$TnJ7pMAtOseXiWh7CH/>&?e;Hk<23V^q5?^S07H[S4gX]aiN$s7mHatAJD6^Z1Cs*? B(4[ruiJ_TUuX_J<:NZ %i#rtFJ9EPie+r`W4,NiC^abs8LXAV2cV]3@oH$BVf<?',&@!%e[*2>mn.SZ9.KdXN^Vp0JQ?0TG8KB@/! CNa"lN5Z,C[nGN$<FR%rUJXcTkh^s>^,S1m,*=7T,N=ASfeN?\dVi515^b=9&o]GaME<;3Q'@Y[PF(A="p3;nMU[n:cdHU+7'L(1cDA=0!r_XK7CW-\`&V %a"j5j,H9Z_?6I&0psS2d_&g2'Nh)9BMAo/%Ok=D>S0`lQRYZNF+nf)u34L-Dd,;jY?nd3>Z32qZ6K? 1HC'?Fia\aJ,WFQkhWmo*& %E^Fs!J>fq30[TJ',Wt9! M>XV,Cj7#EqFY_6Duq3uTib9Eh44odfZ=E&*gtHM>q*$XOBL([T.<MehGQq#*h^?N#.@02W2?mIP15p# %+Hi=UaO;9sa/Um%E"k(o&/Q$'#$tsYgLb:Hj;oI'Kequ2b=aQk!Ql*&DDHdh1j#c%G_PX+(8cN!*CI %d]o_GiT_L'op'/-dHD3MO %["bWZOF1l=AI5tGK"*'mUtq;5O@/Jh-*U/pL2j/BXlL$QjoBWA\tq>7Z$f\MXKbUJT?K=B>T0"l33oUg? <bkC_3s=P*5H)2HDA<` %<CeBdL^IZpmGXkLL+#8d7s[fLiYkXrWf5Ut!Jl8DMNgVQ92t9;%![@-*)CEYHE(*p]\0(+?d?!K<FO_o@U"M6AH<(Z_7'(,ejdr %:t_[\43I[E5lBYTS*+>4Q'R45XD++Q4MP9u6[]^9==Wuop+M/rN';JE27=mT<jk*A` %A":gaJkYM1g/.=3LHLE@uF=F5f;MO](.%CsjMt_D`dtY#'IU[?j[UM"^Dk+C#'%&B'<Fd/m!#A0lispnG4GMW)T(K:uUr7Go_K.O;? P7H@'q1E>[iJ5gkA(2$-V0_#3c<-\*2 %,kF<,F`SpUk9o193^7jri?coT/=YAP--?Remn$hs1$PC&(/#NPb6K"9\J[Hea>=C/`i..U%c#ZRfdLBc`? [I=5aP]a2#F("-;dAJ %>-'j=JJIc=%m(E,`5!ZYJ9OCWUkqi,Z>DHce_R8DV1V4>/tqg2mg)U@\5=sV5q*7+m+S>=/^BP+#LJZ+dOm0[JCmIo;6>_.lX12 %LgeYh+V5fZX1$D(**oQ*g1L&#@G"G4PCB"2=88'5W>jg$9cDor52LO-E2#R%i=[Oa6d`[B964/HYCc;U2YL=&NL\mhe+)%Z/+(A %E_Ii\[b4%J3aFR!VD5So0Mu&FIlJm<nX";N@9.&U?u1oW'h0":%hag:os5c[PH4kPHk: (<3FKlo.`5`PTltZ1P^E\]>o_c_b([ek %DM>Dc)D?+DoL-u-fa*oU1CPk,mhangf=BZi@\Tt;PpZqHU2mbc;M6"]Uf5@7[q#jOT0_W\-uT]MK@5)0W-Yc51)++,R;:<Pnc"Q %BpZSn*+H2bAH\9'm)[0j37tD,b0q!Xlj-\Rb'5]p]d![t(;,8-GT(9R.=[7T5t=M0q-+i,C<F1h#cm9%uUTB3OV)M)k]qa"PtWL %51%nkL&aE^_4!LB8+!^H-h'5^KF-0BM9iFr] [q,cfNhVdJ'Wd6Z)im8_[bTi&T1:KcNJZmFr=eC'E09>CG'tTlCZ>Rl+Wst4h(k, %H\CR5&.G-jk(+=7ZH=SP/O@:8G707pXC4<3jpu<3d\[JdpgbquL6!Hk`Ght_j\5m\! sMD]^PuZ;q$h;2k1SnMBa++QK)k+,^'\@j %F,**oSV\7a:rFok%5.67gG8dS<Wo"'NnNuUF:2p&ecAHbNMKTbr)K6fe*,[2i*#DUj/h75*57K, +dtJe#<L,>*%($fl.8"E=DFJ8 %mqKLan[nM0J9iZ@bDj(:JPS03:C'J`%7&KA(76i;,a`&\Ei7R3iY]2@c7lbHH'hW`ZSck"Y[F#FgtDf?k? XIoqI"@QV4t-S5#&$i %h)p((!)?SHiPS^m[)8d<)Q"@'#!sK!g#+!qpc,AWB5?`#@DP"l\?uJ]Q5Ceq^7MN&^%? _aS[Jd]KXM,1VsRnjV=!759&!94p7WMe %_jh`,>sO/UX6m7YY%HEQ?T`daIg=g-*?8o.DR\4OZ[T,933NVNVifGX92br1hg/S!s-VP/Cg2ZXqB(Z3A %ak%Ft3OKB)?mm`Z"lk %U*n13;goJRKI9>gO;$_%&2?b?0FFolEfX/HJ-q!?Vu_PX4e'a'%6i'YKD)`,`Ki@s)k>p](mB7cHX`Rq(1f6YS&1j%IiG'%2ue< %rCKTA<!c^_!'ZKb`!J[?IZA(#Rk0dQ_]hLj2Kr;VN1m%O,-OF63J,]o,"GOYK? $.Xe2>2*',RWT*s"*9*;sa.`?*u49.Dd)F&(L] %%S_&JVZ6niAKt8sNp7.Z@gB(bSisP&AHKRllc;7"'u)bl+]4@OZ6-u^GQr,cTkh_]WGDPE %JE7XMGU,\0Q9+JncQ3b*WcRa5eKU` %r>$l8"\o0D#U$UdKKU/LF$(h#o*X+WJoJiIKQrJkg!`kF4j-J5"oqiOAFj-U$ %:4j'd"`E"8m2"bj]I0QI:S^G[L4,_Nu^l/U4GH %MF\PeN7D;hXRCo]#="&Es2S'u(p:Z.,m_R@%cDaIK&daiE8NXU! K]Q+'\F$RjeWr\j3uFa2S]mcZH*,th;sD?TcW,o@bQeS`7_#k %*$*'?b]*lTLS-jJPZMnA&.kVd&El*a*'QcY6%EmV(eem99"$AkL`2s8"3'1dau\F %X4mba1p6Hs7Ugq@$JMt$pd_VIJN4S<0n,51 %@)Ye2FeL=;^!)`Sq']FEP1p*<)!M;M`XGc;MU)jt^`H@d]3r]N]J#4hTY^-@Jble'f<@#J0[IJ1(u\=cA7X6VEeDb;$M),+\(A9 %V$,R5a7Rc>Xhs#"[\YVs@m0=)<H^"T$4^$kC<POlKb1HKdB_U_8uQi<U0Ace2eb!+#<)J'T&-! Z[gmsh*pjFI6<1,FdX`>XiBTAo %,0ei4`$'pA/?QjH:L[H7;'T<h[]'sa5%5q8,+`ST!2G0C?c"q8;^kfW=:*VN(uDc&VP'8D\Vki5&/0Y7=! U6T/d*a;1-$N&kXW2) %aXZc>lp6I'6:D-br.-6E=C?D&+omuD:(a=g;2TLWp2d+'IPD9,)Id*g\@T1qhW04Us7iFLq2_Xfrr1*aA\ 8H4\f/YO_Aa9<7W,<: %SN>tg`3f%YpWTU&$-7c%?Q;OH1NB@/hF!-<Jk<0WJMH:)T08CjZgPqf85Cm[I$fhdUVN? @jN2A&Vji@;E"m,81)f[;0RF->nIR^: %#%Z%CMGAj63O0Wr<[tA,%sl(!4Q"VXTVa7D,NDER4md3cW7"olJQI^fXU9$3]IL[PQaEJMFAJeB>Ynoq0hdcB`Xb#k^3QRjQM=! %=%]F=J7m_:joPORYU[:IkAlc>/S30NK^6VT/s1:IJF+? rEN:njaPb!?,h0#oaHjic^$u/_Pa`,EB3dO:p#93:c&(f;#Ljr&+d47f %R2!9h:>%YPc\1K4E]coFPa<":!aRbu`I(! _LrUpU7T$l)1;N^@aAaYufH[lN,h1nNQegR]Ln[U>pkGF_&Z^:u)SAC>oIuY2eUT5N %T%"X'?QH\_.&+^Y_@G?/oT[6.ZVE/?``%HB'T!1Y5g0r]ll\a,!)GOqGn%:*Ih4g!Nh2Xs->-T,FXr\7! usGgQat6Ugd]u-7TSFn %ed*OVJbL_V8^odhN24V5.p(F++=;6X/_5_6^a\IH5`cMq8>G69<^,tJ36rNfAh!`kY&7% %#7<m+g*_c;,#XQ\"!K"R[?KQRiLRnX %'0$?/=</;Mi%I-W! kI6pLbsoF*opT[nn`Tt^IN]S"3*+Rp.Wd9s$"oK&iXg,.Kiah+;B(I$*(DW[8<#u+@Z&kpo&S4mLM]VJO<a n %0$"NeK#9jb=!0u=WW6KW+i$rB+-f9+@n*5`+M*GnU7<!V!sO? 6.c@sjW`>]e'Mne]Q*YHm`_d<_26j9>6sfYF^`^d@&aAEO+K][G %'.=p?)BaDkLp"UB(do5$I(uh=DC3pbYo8!YDGi$c+>@FfYU6dDd:o3*<P,G6l4>2Z$; ['l^r0H42+uoZ6*VrSXq<3_R!7a!b;nbm %PcFgA)`9Q$(stT&&=pPeL(kg6a+9#=lK$/t<g\fbpqhc-JPJn%G(?VK.kUV=27t4#7B56JU+=7gifm+AfO5Jn%87uj%-TZ.+sb` %s*tbn`l5&CpoP@S.<B5*9Rta<)/YDS]Tans3):.S]Wmi,FnQf[kCZkan3F$`+Y3:YRS)t@5,D8c\W9h7Ec@)j""acf8V#YUF9AD %rNGd[8U1H#+/A#"Mb9mR5*lV7!0Rco"osO<J4DJtU-BlVo.;5.onK:) [u_^shmW_K(>f<3c^AFMCo<u&&;!HHUr^-J>WU.95]NN< %*gN[\1d#Jf=!DWBNLEA4Fm2M)2T'P..-iS:aJ7VMQq+2r0gL![-36,p!eTU/T(S.Rf&2?,+:qSom?g\ $_&YWt8tE4F=R7>1NK=BL %Wg:YW"!qmF<L&.::kL>+%*4ROJgO8d*[XVp5iPpNd_T`ZWgXM.1%1LoiE5MI1h.^Q,#lKHi!ajUI %YSN+1Id+I`SeG,%rp"oDO6D %6ZAdj7-ds`P#p#*onkc>W)rWL'X_lP^^Q/8/faiIj&7'CRdtJMjGR+\ %d#7]fgQKf&1O,:Ag*@p=W=@YGRdjH+R)dUO;-8>,b>5V %8UP5((Ou6Xb\rJtH\*&oN/&4".`E7-7JEQZaspt^S#YS(]G_clKfF)"9gPR!h&-RDE"FE'?]ecqL?lbtM? c^UNlN&q=Q.(>G"gMT %UDsZ`_._8<S/7La@Ot;uYI"E(E<ODe[,-K2/hmq=F3\G2"K;RQ.BWgqWFdN63*[B.o32d]5XsY;'de\AX/ h?D0Lu8lJ0_IH0j#.n %J02(f8CRcAe?JoVQiWm_WM3JB<Jop/0BW4QY:,1!;ieNkj':hX %J(jl1op"&(s(lr9QcbIA#ZIeNHKQ$60rc(lP-<Y$=/?V.V^oa %Od65lp_k:]7nL[4!n=^Nl&FSQ\k&5Fr_V]c@.Kgm2dDJQon/d;cf@It61Mgm=Vr#8a+0U"cE#&/g6mi&(4RNS-rD/-:=i@O$m2$ %l`HQQA0iJ@P!]<m<(JkA;'t85iP>$&V\,aL,KN*brOSt\'*bNbH %Vg+PN86JL0nI/S4)Q`AXh.h(2Np2S_Q_knd^i5TUmL_]Jq+2 %3[:$7ag^1g09hI/JXW.Xb:H\jq7Q1U5";RsX!\eD=tH@V? Ku75&^#Gg:*:Ot(_#e20#@k$cTo2W'1jMUq_.4uR,UN9jHVS<:ZWMO %oL2Cf#0A()A^;Q"5kF?n1Yqm74>.VuL(rrNVIET9AA$AUb.^e0XSkb3m1N!;58mc!BZ0$S %FlRKKUC^f7VZXg06`_.PU$9\`ma$D %n8rVI9i[;oF-"tFNVO;Rl?bimb!K*3Xos$?ZfE9ER11?39$m[=Q7sum%\A387$&_EhO`7Gke)Y>6>E.#]Z %aM/;nrF("oe20KBmU %HJ:J;^MkW"?\WG56)ppedH2j_$s*Z+h>7NP)(YEQg?lr^WdflA[j4Q7k/8B=8B(@4*Y=/!/at"\3u/q9!::T'aDd0Q':qM>IFSh %(X@!*P/ROlAi*C=NRN$CH3blH6=(5$D&CE,epJ^no%F!-,\IIY@>kqB+)*-jc_1Lk^fX30^t?h86gA! XSD@kAOhCRC2Pk)dO,LTR %\[)?_C"+n.8`sbakLXm+KTqB%[gXQJEahSo7<^`kO6$5r'TW?ab*3K\+Fjuc! &0LL:N$O"c7Kt$9cD9iiH:PW%M3c6'oO'X@*7T: %Q*+$(C/e(t2PQ7_#K_!MHXRR?<#+@+og#)beWg1>:<0.F`^?!+ +)lo1X<Knj_*"OO`9&)5^fcr>(Z"unAl8+T<dN(Nmd3N)9&Gd" %IXIO9R3R,bW-Pe:]?5itJN6)/XD@KtO\HC?=md2_;'L]G]7l.C"R*E0=DPmC3=Q9k$! _j35q>)ZY)Pdcj"rO`XS+[k<pGa@l^&"3 %)t?DO*bGO2:d#0o_/J=F%=ri9A'Gb/?<nsj!BlK00iD^*lB;C1is_/e5ndW4X]!8\IZ-#US7i-Flr)k8_G*LW5,hGH#k99W$9E3 %KaR6I4U%E12T\5/%naK4O't`1D[akANqFKu+-N+j=#O8(i*-P?LZACWO+1fFHT;$9meg1"tj_d>5sCIHmi$ZZ?2sWLluL6C28C/ %(fX6G:sPdkPd)J9%(u=2nq760.7agV8N$^&`Q_!)-S1+R2DE</! eo'(O3(A=k#sAfVe.0V#XNSkQWnee.I\QMb`;&R,K%a//d(N+ %6#2UTog#pPc'^Id)DN)[Z*.f58BiYE+j!B8ZRoQZ?(0"59\Q3O<FV\\E&fL34PCI&Ob6e'#&s\sc %>&LHMD^8QA5IT&lkL]=;iDu %Hq'AFP7oXo:6? #_:GQX5rSjlJ7ZYQ0$;&5Ca#^BOEB+SHXJ(3doSR&8%HHX#DZERF\XMXR61#NlT?"aLU7NN0W0A8R)"r/*. MBYX %9AR#dDk7J4GkR(CR7?K]"Ds;^^n[%?=]/X(:LV`AjXM?;/']6Hj9l0&Ws:[RS_jma/8Va6i/;;-iUn? d/7Chu:d7'6DqfgMTnj:` %f;@VpHYN!V>\^MS'KGpB"),Pu7lg)Ql@T^!FSVeUG9s[cshkmMY>B((28tni`\'0<un4[TiP(q",DJqa_@T(3CnVsD"F0XiERg( %D;ja%#.UKJs*=g&r*[WbL?ChL/6WpER[`7>,,X(fa"G\qs;jIqPfgAFP,JU5<6OVh")s9F12kBEcHHJ#js&o\^9!4RqcN'Yo"!^ %906D!'],asPW_#3pY"HFNj>SoM5/P,4[PfDSf*l[q)<gOe,9&dD39I_QeRhmVVC82r3B$? dipH')=akh[B[_E\!;a_=#j%&Ca82d %'FKt6\45*/E%*LGa`ggUB46C:n>]Q,]V\\kOsGAHa0gQpIF-Ri"E[)jB1j-,`,>cWc-? `d[F8j07I3@_SretX^V_dH_^s$Cdon,M %l3P^rY"2",Z*04=GiiY.5PXTs.G5C/fX3,'G"2KI2l>Y3H5+WsWcqd1+><3[;gLB6kpG0r=[?"%X\A0[&g Wj44:59"#g;'jN)204 %1sV/Z-!^kYCQZP\-9,a'P2Lq4MJJ?]'56T,[#l65XPf^D,Okd[iDApn*5i2s$OfA"6JL"= %t52&lNflqT`bY`+YINC>lUdf/hrTE %8P=T8G32^mC8aG/V54'CP*)35$i"P0BCZ3r*R2q;MOe_YNTtIV+sG61.GtA9g.4O0!2N;;!M0Xfb %)l`RC>rGbMZJV`!HL]cV$hA %>UT'0/raUr-g:@s<k7HYH5i%#k"bf^fp? M(XeNSS<89cgTV(:/9ep&6dqRr\9$9O0'd4]OFD=JNnuRsha^?uOD(gN$_MW;G*i63e %L6RLe\QFAVEnWmW+RlV+c5$n,J!bs0O9;gEj=aU92E?VPhi,V>\2%RVmY8(O'&T@%*QLgJ %O2u:S^gc4_oK9&$%L0>R@5@H0fU0a %C=F(P`K5[^D8W0>e.1$j'%J%SI,lbgHH9kh64WUIO`bthm[TAUcP),=Gfp&aKM`T`*QS/6]s8QBZJ&'gls,M)F`F0I?Bup`2+CB %P+B`_M\47`_,Y@^<;#9M`#&\2Gp[oh,^2o4Y[Ii7N0I-EI1;.%2GQ$U;khO9.$BN0"qur)/? jXBKi;NcQuNfGG:IofLJ'.Zm'Qtm %(\X:Tmi@:5B'lZ>,e\W]XV_R@:DA>j7sYNNf/CIRBqE,m:4pPAf7oHV*68I] $M\/efMNUqbu4SHE<[j9$12p<g%_do<+&]qF75dN %'qZY6.*gPFNQN,J(Rlt@fLf\J/S]/\Zq<4(<`fn59i\apAdNRZ:t(GN3%,Sr+&KKaOJ[DgVIP3Sg&o0E;? Kq>f*Pu(V\Eqb<i<H[ %ouJ.?'_1X=(V`T?T/Mq9[(k*3;cU,i1DcUNmiI?Ck9peT\Yf,:=b%3L=,YMZg:KC[0? 3n.m]k22:u6cFV_AT^-QkcVdXL`jS'5sJ %3OtJqP#OS6(af:>9)9n,&EC^k@C8sM!-!uIjnXX(%"'LFpF;#! J>S1F9+O=d,etra:o@p]J:,OUTmr_T'J\NtF'Y;26;UOeVje2= %ZeFI]30faIG*8Oi[Nt?mA0jRgpJ8T;;! qN-)irM94OoY@s#WP5\`1X6(^AecChMn+eN9Vk6LiXP]8@>hd`*1EdtE+B.j0'!lSJ\9 %PIhM6K]_b584fRPL;?G#@Lp7F`G$)D"FW_SW.;n*PWJQ<P+k%/! 5#rlSfi#g9CP.Y^3m[r7:dE6AR:W$nEUGMWE_COb*#oFCNUPo %F\Bhn=9;d_Jh(2\.]M4q0?W7+Qsct:ggjcj86<r!3=.)+7WHlQE[$AA%jsOd17gZR/<5?ra:58F? 7e>&YQgC>oGs0IqN-S&l')NR %PsQ2CXl\]XnDk3p#*VVkAI3Vs+0`,(#AW3<:Oq4t.WL9<M?D(^_+2I,5=Ki(Tq`pqHshB<lBb.? M*r\f=[aj_g,p[\[n-j4Kd*C` %X?$VFglq<uGi,CXDkSol>r&V=Yn&W4BIopkoJV4,X"$7G=;n[f/J80YX! t1OC;;VW[1A[gfiX52rOMtU>j9^_/7Q:W@]N_;dk-)% %*8XtlJMe#f&C#N#f,$3O4.QI:"FfSDZ8Sn!`_/hY)iBclKeq]cP_=E?F-eO"G@knb\:lRR %Q$cc7@/DiQ=$dD-#b2r.!81:RfR#W %*!M8^B23(Q#^dU"P`i\@RXD*]/"p$Fi(cLkX_M@6!o\Qeo'5/?qXjAeJSt]-fu(6)p]2W50,k;1Z! ds?".]hkjlf'n4t:[^!Ua/D %2fMi1<$hDD+&T^k_#Gk(#i;L2i_*;hVL2+h<SY*;c%@t!\nqTnecZSXV35S_^iF::cKCg@BkLIi/Q3'>lteI@gTa*;l].!o"CA2 %l3q@'Hs/YFm)CD@C+3Y673XJQeP&4l?T;fWK\9%[!Z,A$HosPD,559S4p0/+Y"I64m<I6M,\t.E$;9F %L234Sn,*&6rVhLJCk\"o %<dE[YhJ8Oe?^)kK3;muYUNNbp_;6Od>Nt_1`.oU4a#:fX`jY;O$/EmJ5Xec! %g70JC\aI)O[1VR_Sf96Jm.!"n65]G=/nYC32-O7 %\m5sVs&Y*n>kRM4_4dEU*=9F0Mb)2h.9+34f$5)]q,QhWREDgceOE%^k*D'["]2,%g*I:C=6ZL,[m[j)? kZ.Iq&@>2JFc?CG"bPf %r7S/3J"E.MiV8EI#A2N)AuK%C+S<!3"&]qVb=DN`%)Q\N,IDX;=n&@oJq?f]Reis5R(? ^#_2GkcUQCF4UnW(a6uZ(HOTq:udPM1' %]?G0bPY=<jJ<M[slC!Z?Ll8'`/X[6P)*D8_/CF7OPTZ1e>-Cen;t9o/a;0)TR49T65Im/L*C\_O2:4e/ [V9,q]o@Qk6`MojZ)Cn/ %<]#DLMGF=H,Y9nAN&#T36L;aWBr\jUqBR-)Nfm\Y%XWej2ma2o#P<i-B!?+h+GpBN8698cFOPIRXc\m!O\ o3>oTCP9\>]ksF.S?a %<<sDXA9;q? btlt\FF*&cE/A$Oo5T=9l7lh[>K:DUmGP\kd*AprqsX9&EPtr,JM'Rh)/RKfos.*n3]m`IW[U:6;fL997C= ch3n%^+ %&-JgMUg;B&O'Z[<@Y,aRgrcYh*[W"uBg[NHf2Peg846OTd\RpXV6E;Jfg9Fb?pQ5<AHfM@\:-? [4&R4LPb'R96<)SugrgUe#!;W[ %FTb2gZKq"]/:MuI+@_c3i<i#"p.gBU-j?AmP"#Ro?qqh[kujJS<TsgJ? &,UAUKe[^*73p"kl_l^$LZNaNA"YRJl'T_?]U4Pa;&/^ %G/G!#pnZ=h\E%H=9gIbDLc=M;H"9TFHEAtM]b.qi)GHm8JuJDf;W5DR'SU4%G!a98lD#I=XUGV6&g';iK: (`=AQ'mo@"_T8OXkgn %;naWK]$is33O2sjCbqmd1%H2-Y*-hieT`?bn^2fX8uFX`2P-mLd? P'M::1%0QMDn.e>S8Z9MN1'jf=])*MP8l^C'(YBn"QWPg5s, %GSYNO%&e9kA/'buR`a.mi@=Oi@ZtBD=&JEeIoISeW)UA/O'UX:P/hE[5G@,MR%_l'WXk1i-L! T8L4Q]YA1gC"-k:En:ZMq@K&..: %q?BM3]@Z;<mla7b5kVqYph_"C2)%l$B<=Dk@=edGcl9ULBmV"gnE?c[5;l>iR.l;c5K!*4W:cpm&!` %Z/_KGbR+?4A_rMhqc&B73 %<@(`nNd!^$YWDPpqbjHP%"\iYPM"8VLC\=gYj'9W@%XhD7ncT\Z@S:+p'aZ]qM1T),G0o:[B".`9@cLBW/ PK`@14G:GTRUgABe2f %/#EoOhu*<Dk-&uq2trXth]3dp*#7&pDa+!QT3pU8=[R]7omcr;=-m! *W_\*<#Q6Hsi;_aXIsUhOgZKCBk>,G-GR2:gq>0BRrT,d3 % +6^HVMnf(kIlt>h9n.)lL&:YSpJOQO&"hb8Sc,klo#9KnhgPCulJgt(iZ3IIZTdCHqoc&'G8HKYn:t_@_IT &kc't'ol2<t2kt?/G %?0X,FOj2_D\$,6R?K&]n2gsD"6['?M?=2OW[&#Ws7[?3pcF7Gi0#"p/pqO! Op4%@,<tIa1VHqGI5Mt8@lg)<Uhk0iQ5BpRKDGAk( %f0/$?X8C*;oC)^.H*tPeDJm5/d;.IjAGuPSRg7:6ro2r0pA3n<X3:AtZb4JN#7ot_gXgZ4(]Sr.p@A+(o/ 3)ajirtJ/oS1(NqK\> %>k<=f[kBE&cL,TmI'0rNi,>of^?gWYb@BaY#Ia[02;r$IU]:-QgVV:[/c9_drfT[mb=sX>oVa&cStIo`T;=$5:e(^D)\ce"UBGS %i)W&Aj#<T;^&7lr)nVsV_87"L.&niuH#n92YQ/\? mJgF]hg]YCqW<&Bou6=,HhNqFDR,B0=Q:L;]QeGgfg1o#eQ'-rG@sWj^&%?f %jf="h[ru>#<P3'r\m/@d[LTn(6'j[sEX,n<TZ\?t\`l$'VYqKV\[a?%.RE'ebIo"/gqTJpIeE! sm,j5,fC*GX^T(gs=(+h1Z:V4P %;3Ca!qjFNXOaD6Nr6(!?0=dP+qkWXR=8pc3_^N]G]iQ73Ni85XGt;mE*mMQ38VHm<cr2L5:lc9lE38,+T4KR=SuIV*e&RV/cY\/ %`VJi#Zb'imU:#FI2@oIfD_H%sTC!iXreC@5@?NflP.*/]U5;AhFiSK5]@`e.rU\uR\@!? s5CY7`_oME_^1o4b0<_jE>LbP)lMd-N %LE/6Rb^5DsDm+'Irq32X[i8e+,=)rdZ.Rjt],,,C(LNf,mBFW2`MuX6^=X5dM?!;@bM/MERpGA4X4l? <q:dfPH@,8KrbRo1Y&Sr> %okuGSHm%j;'f*XeK<=V %\ll/Sk2Z*lI$bo3]lJAca9Sk#n,I]W\b/sKmhikJq:a;b^tIQ*rV+n[pZnQ`#r@rbm"]FYR_auoVObMK %(OOd]Jus/+G/GC!q^#pmH5CpQpqEqI&+1$jj.@sl^3`olj/,Vi^VA[pniDd'Q]H+gI39oC7]Bk+o@UsIG+ [l5%Gku.OX?,FGHYfr %O,m`Wle9DnUR5)jS#8\0I<"f;`RWStT09sfBpErmmr=T<T5O+ (IXc]eqqZo&l8O*bm`qD2^4&$sbatmcqcQt5e9g([qq%SP'<Bj%2N,N!>5\!8X0ZrZRC6o#40[@;*R5-WFb??8? t1]tA*]ki-\P^,BcdTB[Go)L'_D/DJjia`$;\1sX3rZ0\k[FY(9?01VPK7n_H`/R %'dNRu,;/^6-2uL[QH^lK]C;nE?'-KgX`Xr/HckV\eY`&,e\A+l^5j_Ds/fYT<>"/a,g.ho? bO*5428;>\@MXgfuk,F5T^`QhWE!g %'t`<K4D/5,A5d$a/f/q9kHRTXroNeLZ^[GBX041Z0$\[gnNUC0Ng? `<n*fGKh;@,@[(k_f(Jj9j@K*;O_cIc6s)q2`.AUDMl)]kk %d!<9IL$/;,]6MY$SQ4(g;r5f"=Tk=*T39]62Ea+2OG?8SF! UcK>5ZcCrj\g7bN@ZM^\n@J0d\D1]=GT2DSBH[DgcVNFgZiVl/L]p %X"kpIZKDIqj8P!1IjeS#iHc<TakgXA=A\\HmIg>kRS,0&n)OE@rNa/QHKTX"r\.RP1iD? r^PuCoo`g8^8WW%a\pZR-p!]tbRu=UQ %7Jc_S0:9TOq<R@uDt'?Y#-jXtEOTrPMetV,IX-G=j27@t]0L/ [WqN9)h]PbPTAAlGR<8,Nfe9D;:qH5nQG/'-4qA$3X4ducq-c;L %f<Q<t9?r!<k-M(clRA:KW]%.So6ICBAZLuP%V<gIQq3J5<>!dqmeaRRo %6KtZDL>9,#LP*8<fBFOXDib<B10mblSsu>ukO"4iF)%0DF`CMt5g\lr?%MT+['fZ7GLe=Hms!`uu5[@uWo[Q+D$m7JW$S;-(]rT($p+b-_'\ $dG\0ZHlVeH\b,dm2=\34CMM0p]R1m.T=/^ %Gf$I=Eq%KcfD\TUm`Fg-?,Z\T,'a,`@V*jCO8(!O=KH! s+X=`gi5mUNlg(Rdp;gi(X4kJOMu21M*QFe_T@aAJps&'jmF<#RMZuCf %.HS<)e1Z4GlapZcY>s8pSm8tu4__"eTp3gu'ni+5q"L,2QZ#nn]SF)"CZ9,D9r)deCBqTI2LK@A`^EXCZ9-1HL_PnD76L']A'G7 %\W<,[r>VEk+KZZog-Jn(E4$48X0%8$hg_g&SqNHC<?/fSi_82e%cGsN5N>UjZRQq8Y0e/k;jomXRmF5$:jR^2>TS\?JSmlhek$Q %ZD+X+43$%/,Q!lb7lIgU2b37bT=$nmIt#uJib2&u*("J6:u7,Os)2*RZc:^*]@<%MlREeD[";2Z?: %5_2=9R':hi'R4;=$+(KQb2 %Z_5h7FC&:Dh1)s;\%B:uIduFgk&Oa&Y@7A?9<dl_L@J,!^AN.cIE\<]\8,Y[H#cg(W\h(1-A@uH?GF.$ [@O;1-OaC*2"lT%0KG91 %]\YPk>o[7+q#oEWbeWCYd7DB.q,U;V=J&8J[JgT4`Q*S,pPUE*NW(BHO;Pg]=Y`UrqbW'>mtUtO5(hcq.g0DDG<3Doe, sBm7OI& %%sGi3[KY3_1^b2P]@b$=GCEhEE0#5h&,F]OI%OJ/%r9K1h9CrSf? 9d>Y5W`ip<,D\6LMmY'=VD:gDrLGCCYD"=7oH#97Pl/*;mPV %s0$6N8,k5?4*Z:Hq.t2<J+38_1d9ea';9V;FpFZ.2OhP!kPK%4k2>hopj@Q9<V#)>?.Dsc52UnrI! PPI`TpSAc_122gX&5>46U7_ %SR4"PY&8acm(9lfMjr&H'u'IE4b/mVh1#(XjmCU;rF^<jcTf %T41j0\#(;OI[O]'$a6-:tHVOClLXpW^rHciE%U.UQCHH3H^Yp%n %?>KH/ZCUI/rNfep4T:'je&>>ac;*A@>*[3R=SIErrU]UVoe*(-bGo`]bC5i.IO4Z7FW02up% %:A0<JqI:Jf;;\=8K3q<PX/9lg#T %Vm\snWWkXmq*J=6oUk!s+A74! iarsahgD2B41&#TCpNR+Y'/5&kA'XXFuS<o>72Q\^UuOE]"m.<Aot6p/VIuF&<Y4n%7k.n3nTB$ %2PYoLk[63X4kP]'2PXW+1C'Dsqe@q@6"@TS_\Q:JY9%LeCY@+Op9dEFf.0o"<gHUnc2RB:<[7J_R>p8Irp Am8:$13LDR?Rk/XF.g %K=`)B<lK0HbF`_B/WE:qDdLolSnp^h5Z5g-aq$]X%far=QQM)ZXG[an\>IBCH,8%mrEml'[m %Op*@"[]YObS$@_/C9M/eS-19i<1 %js,dXXQpiI=(GcGH[&5HM%AZe>iS2WLNd`<p\ZHNj%>%)_rJ7AL3BN2[#R9h.PSQrd%_,K! n/V@Z4F)6d^H3d)IMU"qU0JHX/ePX %JQ,u;PT*`2;R887oi@^QgZ7V&MYB:h:]E($?G*jOFmRCD'aer=`rV^smc+'(r<Z8oDHG]_WtrS$0tm`@@PWKeiiqY:i:^a?F0&%\so#W@@k]sIAQDClM:,IB?tLG3`Q(Vc1K;6L:/!IZW=eid*R#9Bh^ZMBP=FkZ@dn?gfR_.4s$\sX_SFP %IKg^*Ak-ULA#-em:#.* %Cub!9K[C7qqdJp+[S?\4gr*!TcZ_r]$t`KYiDn2_oDQW\H+T\P^TQD6ZKKtf.m(bNHoM? m`qs2bq"sBhDdQjWgh\P^EMuV(iRB3# %].uP,T"V`1lL*[3^2DH*mC?P5Q(Ae9\(;-\=.ZKCd?iEHhoYia%f9@.M1&Lr6HS&WNl[od]^3R6d_^sSGQ,>l.t"]2A]*aW%&6> %7fK''5Cf4>GA$+5B30Ss]j+XeAtScKbpqoBo#X)P[! o_=V/2VMI2>In[A),dnajHM]Y=A<],X''&C8"ldO=.mkF6d?IsHPCrSK93 %G1b?imFO=D9m`A2rt._]F^6N+FhF7Gqub&C?.heci7*P)`bnCgJg@^'Wpe8._S&N=e=rq:s+9/0U+bl@IL!Dgcr00($Q&eMV551 %2/Qr4K!tJ?-1+\9[<tZ"p.$R,Y)PL_UstH+9&5'_s*d];GZ<&5]!h,'O;G7+NBArVAS&K!>0'@'`kU2L$#&Q*ONA<5b!,8Hp8^` %5.@P6li!f(X4l,jSNEck#BfI-c5kEFK0$JR"mDW)D,f\! Aaqs_F74lFpRtSs=DpObLKomK#@=gHX__HCDcKhI<N=fIXMjr@lshOr %YlbZLI1r0RL(,+P(qqBj0tt61]mZ"+IRC9GCT. +LqD5j(2gfapg&0.qZ9u+P(I29UIe$j\]fJ7TiNja1h7c!5^V'U.?WUj)k$>[n %/c%_kS*Qi^O%o]-_0! <WSUI^Xgp^kTYHT_#l0>G$A+E(&Un3Ok\=rD1@qYW.'"]tbgVlSV>OpI&8HTnfY:Fg._\7N>e^h$1H,s"I %Xps]gDs?V\Qe/Eb1"Z;&=b:eL%q"+EA`08aXK]J+'9n1cmUi6*nG;Rlg%iV=k@Zki%BI'ee! 2S&"GHd'gDbO0*bHs=g=g$+Rr?eo %LUO4R9boqMeJ1_3a)=k"qSn!\IV! (4k3IM4C$obS,^L$bp*e4gM*_^#gd.D+8>Ne]2FZJ+FoMQ/KB*mKmH9hF2]'(36E=QNbN3Zs %i;4tf/Q[E5MEX]Ir_!"Fa2?jH_:Pa?bM*/,J!cba6O`+@<p4>Qc;PRr)Qe3Z@KL1dQhTBE?`^? Qd<7b2&)4r3L(&_mm0)"PfY]UE %F/?`%XEUq)D2HbX4U8`1%hIRlFm["n]T;(k+-OOR\9=;?n2@G<T0;UZ>h:#<pGT2?I=L&,\?7tWk&! 6Q)LUhV]_9^l`tHAgIkkf( %0]$B1_*\O$GC6o]DVq[%j6ED9qZhsp<V$+CPpQ97X3@`i_0MtP[,%BpFaNk\ZSq6fFMG5io'87%ir*? GlXY9:i8O^mQLX5L;'2iJ %iOG6q=PT%ts).[s6IrMRg"BT9M%?`0a+ko^X]8``)?b5^On&EWT=#<d'CO1R<c*!4G)LMl0laiUh;XPSB;0H!?P6OiWF0=Y#:"$ %_S(_7JQr0KQ.7^>MW\s7]^-2<pONY"CV<&]iX2a/;;[9kD:d<&p5&i.50jMnFsQ$Ro_7lWsY5$]tQN,gPRZT:=ccKZZ"IgZ>VXm %iA1FK2Zo%$>*T\GZLkW'FWdu>57lN5M!QB/RA3c!l,dK0`IZ7a7qVJ.AnD:5FD'S(+&.dklLJgm>8h %uO4*[*eoQ*\WKAiED4>it %C>gYK^(.$$6]C6#=OB1um9\fb+2cOrKKm5_=qaeWIlSU'QlUQ>G$Vdr*n:F.D4>ct+/HELNBFHVd`Qb)Zp %%\lh:&JGB[]cH>3sb %OSEai$.A9,s._I/r7fJ;D2*_J#bZ,8I!bJ:[PoajEm4#+0#"s1)?8i_hu3AIb_(E@oe4qShHj&q_o: $\cYgJoQVW'CN]r6uqo;L) %r9j5*oNu\3(BDj4It0aU[+@NkJUdRsg7SAB_1"EP7t3SrhuC_:4`A+2a59)Vh/P'TS2_V-;2Nhnf] (?,28SlUWZL)pT"&8-&Il1g %=9+X#PC,c+3jGqN)OZ1K8*;]r4:+2ARb>5FKB%e_R:*;\HLqT)9d_Pm*,A>j1)\@ktK'm[Afm?!,UQ6[J6M[9NuGBJ\P7>HG(s3 %[r!2j^K09Rh@e1'O4.^./0pUkD9#e+FG_lMg'/3QT%',Y$r6UDA-8=%mNb;(&K"<,1Pp=A?0!jgJ!)TsauP(Eg&Sa(+3t'i_sDr %YU'o93hsI!-e6m8n-5a)!72lCS]'l+>+^4RTPO>\);If'_%AeoG(-eLk7%o]- OnUgJ]<@8^_"pJ6dF3a4IjpDCPX>bcsV',C/'X* %)^CA"%5mOVBnkFB/`@Ug!DMM^fsb6(Qm"DIg3iPM1q&s%3sG[DSEEMBk"h/BJBHZAj#(S@60/HLs4hR(fQ+1g;G&KWL^7F9K:QL %>$*O/0]<b)?Y]IY]%BcR%G[nnnlTh#,M\Z0:eIP")Fgm=:8gB(64G$_O"r[V)-lg2e8-.rY> %F3m@r:&$I9WJ?Cus"550:74cs7/ %R3N&[%J_%tAMoI916IqeEAd=<WbGG$Bk#OLM)PKdJ3b)iD0-2n`FPFg\$*j]%4-Q(#&d!ECuWdk=Qm2? R#35(pDul!*=">%StPJ1 %01u,EZ^qE2h%TqQ7Q<p1WMGk6RP6;/R*:2F;$!ogVr7l2i?\:E]P5C,g9lD"M)d;n@DCXI[ds-QL? d:fJRnG+I\N,r]Z7TeM$!fA %o9P=CZHot"7is? $WMLNj[YBRcJ3IUK\S^CmgMC[Lcp_])l@A^;HS2lI0EZme:&tDlF<bIgaIDBe#RC_+#.Mqh0Y(Tu.6476jG nVd %JM%"fb66'D6)[(]n0]Ajjp&i8aqWcK#f>ckd7,B:p(K-7p(-%?772E8L`3O*)U97do+ +Q1oQ2\SRN41jS"/Su=T]:D"/^6Ej@KY4 %&u'/=DMefnoMFVg/Xa!h7KM(B*Pr^^1>ZYi%m2NUk%! d`Zbpj<gPXn2N>['hdi@lT113=#<L@qr_FiPpf32ls/u?LVgZ;E1#n?_R %#S8sgIh2T$"*5jh>[te(Gs89P%r`3O/S8p<28BfL'C]bq%#l.:9FjJM[D!hj!&JL\F@<4?"Jf,o;[W(<_! d's2dY;W$BBh,3EK\E %TdXe/4dEgVSTjW[2lr_rdD3gBi,%,i!s*sie#X"*0d7(7Dmm:?4-/N: [E/iob\Lh)PV[`:i8g"K:k.k)aNR/VbKPfk0oYU`'pu)] %QPL[<cACf4gK&?k,JtBc+^j?*["a<eL(<3/_%];R=.`"hrXX %Ja]3WJ9B-')HIsjTW6f(0.$S/Qj_(A$R)fda(3s,;?_aiVD]sWM %<r&;)nc=eg]VR<D?eC*sb3NS_M2Xf?Z[AkfEsH*u3^Id[QrTM[8PKs/Q(OCPl.Kj=-<h1")S&;[;HO. [cN4,&0;b&T&#-l01(h&6 %S!]?"CudIE^9FO+n.mO0k[!2A-&*gMN;EFq5L2TgqKj:I*7I? O^RF71()`m0<A)K5gXh_G)Ne6*Lc1f^o_nJ!"M2W=_AOf$IA(MI %d8HOp0E^'"Em&DA54STS%\GknO,4Y',d:MtNbhU5$$qQt!`Y?(XZd_DA<(i\Qse3+?6i7_/o3EJ-+Q>JL\ #).YO*Mgd?n`5_br';!6MmA&?8&JY0/skcC2*B<N$Ga)B-FkI'gJ3WNqD84//gPDM[E^/G0H9f")nJ[L! 8\lN(D`JZ0Y>J/XSl#)O@AGhGG5K*WUd)0 %?'5AI.,FNT`de5L+nEUS[e*K(&`4,KTGV$=GT98<Q))"2(i('qc0H5=)/Kb6 /"P`PMhX.4Q?"=rOCo %oS>@;%<P#g#RIiD&CL\-f(TT7kc$7#>PPaD8lc^Y,neamL5"jQ3[kUESdP@S9o,TjgSQd1^sSn8(t0mD,13goa2=Dm]T+oFBJSX %Y)#aQ^GS-uL_kNCi?:/q%APYM9&SXllF0iW"^@5*RCLral4)bb\LQp!m@?.[Gq8fO3)Th?A!tfT\ $YYJbVOckf1oBq+lF(XF>Zoe %Y@D!=9WlMIR6;#B+@T"2\+VsqXOkUs@W[:FH4'\1l+_D54*laAMGVlZ)k]XStr84+tY3I+\1%O)agec6,TLS1Mn)(3Y6b/'[fOu %&XE4dl7nQ-<"k^dF!@V^4#I\=p//r](RhiN&@@G6Yo?_,'<Vq542V*AR(r[`&"hb8:X(u9s5qejG%GL%> %:gr(LMQ=IfB3?Dn#I( %ZL@PFJG&%D?-,K+<$^(oiW`6f:_TRZUbDtl`aLUUDj=C.O&&AK3,M/6@0/LgPt]ag_e)1+LXL:;aNuo:.T4E6R=l@PO[iU3MWHA %3,WIF/)O(kd8Or<L@js.!h#p#nT*B.=`(shhLpN:OPFC<OEX.!3VlKJC+HXX-MeoLJ+X*m[`RQOM/7! Kkd;O1A?3]lE[531Sf)po %6"bC2'MM#%^3p1ZWnJkZCiF/Plb;c[fplc2G&'2B9beCcS,jZuA7e)X`>u(==4=n#D+7`m9'okThgb<.0Q,3e*m*J+u1!uF'-sD %Nf=mspNVFqmAj8`"@aS=HaNng@m_sYK2&HtK6TeiIt:>*,.o'H0hdrceBoO,cUS[tm0oaAN+G6#VFU`qbf p@07$E@f?bgN_<jgAq %a"q2;_7`RE=Ym5E0gOj4><7_$r<1bt#E#POOZt,b$fEN9ol,B8Kl`hd<\Xe84:cfM=n^FQJfR^H(2oHom5+]FoC]ZG_0"8jg^b: %08+"Dk%R\K-9FZ`7L_kb-CWW@a=)-g1"2GD[ZJ^/k#+:pL2%1qckssk',Xs;8i>0dA@1;RO^:6! 8=C0X9]d-D(aD($]U`&E<Ko.N %E%mQ>m1Q\i-K5hB4keoMa5uu21U@c2`7tJ6AX=)^R?]\3!>kU)T@BW3s5iGdrsR',hO((amlD(+JkMnO'c+OnEXo`::IcCAL3nm %Z8%E%7;$K>Sluet$>r:L; %BsJ)VhK_F2OnHR&_Mh/N&*(O;O@mUXc[>a7qQD4eq6T,1QqARs#GQWh"S[FJp\?O:Xg;R;MtgV1l>X %(-"R7C@BET(aO]Ubc2XGWaNI^C'H]Q(,9lTDg>_8+&OTC(OZkdE`7fdPOlqEphL9HbYXc++?&p %H@HO:Q&i2q#q"s`gGL;Ko+9Cq %2Cu:d^[92>bSkApgU+m!U8BUFd8W#eN.a[:dW*cUC'Q^CN[8;qqt*]3&TR<)6$$*l6;6SgBuf5- (\2(NLK/c&_-$,6fXXg3gJPtq %^_7]O<23V]"bLQm]%6q"r.DD%`-f$qfH@-%OjR.Dm\Im6R#tLZZ=T\4bIdg<%W`a6Z`\i;+JbeY+*4DV&\ C./&U9Yp]p?91_-Y#+ %(>;7\(12>@)DW\U$$HMl!T/pa:qN5kQSC5;jEq*-k9D=A@;J"TDtt$%aLr> %<].dr\g`"Y"Le#):\o@WNr[_;B]L5WfE?t0Gn7F( %.<';o"2*p,#JQHYP<"LmgW9<3hccqQP6PIs.1d@T^c'JT*KW<Cp@Hs#bKR^[%u&l`AYt+7<qLWEZOL;NLA!O!-nlCOUN&LggjSb %Suddt2$d#U:?rq?p5KNf0!T@j:[WFY%/;UV[9#e7!&jt%:0o=l[6boMVH"SY! *&+E*;WKe_$udQ3'L"t!,2a#5mO0E@59A.3`ASu %,m[=e`9SEKNuOC!(K`Y(]_5q>Kf.8o=F>kX"(OX"^)"6'Kl,/q1'A^?0;qmB/1"\>X.j(Rd*:@6A5? 0pF>-feEM'e4^>W;P"<])%-8:>0J6!Y@B=@O7$U?p.Qm\U?)J-T6K;Wh\2l)CK(M'65n,+o4:k!20m4*$*Oplu3?g6a?KEo=Tc'J4-R\ N$F;=H>.,2VP84*YPV %-HfN"9nj>J2a1ng4gCIa12MOS*EdOg'9"ml]N+>UK97T;ndTqS_.? m9*eCZ;b,&`<(\i0U*B8`9PFr['<sLq4hCCsr>96?K0mYQ` %*+U!qfi+%aZ-Tj#j2=1<%UFU$#\dtf)fmXKDFMYJmC$Q)! em6dnc34h`uL"Ud]a/hBt&A3"a_HH>Le\b2KLI>7=c6c-]8-;bZ$R3 %XjtVn#NIbrj+2`>lbnPMgu&AfI"aL[EokuZ3)mNUa_:IqWgI,#B>hG+'4Z<'>*hgeVcZd..Mjk*3Ad)0u^/\_hhU@d<0A:2/C2l %W#=9MU[_;"!,a0qKQ>cX6XokuIII:Hama"+#YjPqHD3g;7<"3=(&$V5c'7OO?4S#9>ZZ_kY`+4/Y*,g=^ %G7DG]nm]-CBPMBQpo+ %$p8`h5P?cY%Sk^pYOqZqaE&HXRuC.i.!"6r;IWD>\a9uM4M`jZi_G$#p>^(QiIU^9Y^Vi(sT$(2une2@DJ.q7+tM3ndi`c3cp=u %iI=#R?\4Cc:PPS)L+]T%ej1V*009SApFLb?S1L(K,!eo-s/UNGQ8T0#%J7c^IGuohd_V;%p\"8n0/ (&L]"!%bf<bACs7dm=^o.4; %Fj/_hZEB2`r7SE9j8O-)p&/dC\9N"?G;1Bn4N6QI]'5W?6krh%5muoLibpM1M7"A.PnZ,sTt0HU4OM]5! @[_2IoHd(i<9p5EEC9# %*@U7#3VqVYEr:k0K>"lGH>0Yp"mWY@ZH(qAf)*BYI(]9.5CZ`^r:u9JMnAcc2dZ!51'WlkL?gH!! lQFG(OU\F+,E^_?0oU<lc3>s %a'S#N?KcN<B0P1L0"5UQ3QY+?(i2e`b%-b=>B16&m;NVT/RRCi,CD+BU3HSRSU3AiC*5c)^\6%;a^D? bB'[?Fec@0l:s1H.CD!JO %c3hU&.9o,>+L$<f.8<;*:%]Bj#U''VFT*u3?H8sO02Pn*3MTL`%T,33L9coS1T6d#N7:2&&2;8Y? jGU$7>(NB%gEDaFVr$LV]C;n %#.;-#*#sK(U2FYq-5`<73*?66'R@(:5-XLTcaV]E+O<@/h? 8*8UGPK4%oHU*i(UkV_*Jg8/D.B7Tb[i0'[Fn<]AQ.dO!-i(\W6o1 %1ni2h-67WB!_"-IgK$\d'$Z0;!_+G!9bnkUNkFR&,Q"'e)4(U? m$U[^f^$"XlYa7(5r#IRF9V_h,^SHSIfLqc;c?%<h, %PK8(+#GWLj:gf\d3rih$h.oAsLsaBcoH;V7Qb"pZF:ATD.)Z:MKDX5SBpX'P,^O$EK#;!U! f,<0%0['Hj,i5m.i7/mhA8R'Qq]?> %5'sZ51TUfrH.5-%-p!J']$5?>!@FH%OZiqPcVftb+sQMjK+n'5_4eV>3n5YmqS55M#otMb]E^T4"^40qa"WAOF_)-lPUZN"<7OT %CFZ8JTc\u1CC"f-4q']9KP<u7PJQ0@V@]sqCPU"=(ki$G&06VHPrSjoZ@?/1!]pU+[H$2ZY@62&d3jS5;N_";dk^&ON!7D+NWPg %"p`[;7<q/F@uX*n7&CYm(D*6Kd!.<Wk[<m`ee5i1g&WU;? lUX9*LLr+3c+r=C+=,,"pHIhBu/if^9qD',p!2Gn-VmPfU65>@ZH^L %!!?c8BCI8:S!`7[#mpQ+?uP %\_ZDP"."_kgOf4tCI5#unX&ojWg&WU;:aCo]4uX0dNMe@jn^<6J:"GuQN^R.A34NmDR!+;k7\XZk %SKcH_=(b&tihL1j41HiFVdQa#E[YI&;7'kZ!m_In-Eb%i0b$B;Td? &GA8h_LCn=AUJ[,EM6/a[o'Ln]1Y[Ua!eMSaO;+M'9#OBZi %=VjU?"9L?V#[@Y`.ds+r^=\H2JV/e[n.u1^! `^`b(s#Ro0Z@AI/>kiiSu^Rb`W=""f2*fK6\6.n>j"eJ1VmP5Hs_FFFYV)EpH8u7 %/eK5I>J.n9=>`SiLD+'KKZP6[!]OXAk9\Z[7bT%Vmqg5NO>`a3od,jiQe[F]MCThGmuoeL>WW6_#aHp/YE8Aro4n2fPu]T*XDGA %%FZs"+?6`:p6H-UF%9\D(N0;k,d6BM92VIkVA'T/"5(ZY/V, $JndI3KOm&g7NeJUOi2;c^(b\-/8776]"#XJR1-sQTUa4%E("ceD %\CPY=hpjFH&d=4Y>KuLPBp/3qR=bbp$,-Fqbk2qaJPe^>&WHB0>6G2M5dWTV2[b_u? dN)LVh;gK'LS6_3rit$W_5,b@X0td8nS=/ %TPnCHJc\"@EP:Dj^9_8%"Vq5n.F$b30&LaZL);5R+k?[J!f%K+.'H0Rj*MFL$CU>jpjd/tJ;Q\c<)! QaKP@/WQ9O[9j>El6aRG&f %I"F_S(=7['QfAtuW&URVO+[>\L2!!!&0qH=In(W6FH/a_Os=<u4A=@J\.c1d/1FT-1F+>N[%+^! +@[J9BR)?E'sa>W'+Q_qpn/9u %N#%d*aBL6;6I9\.-&c24=N=\kHU8h/G;N")gqM]anH='`:f%Bo? [V`$#bKX(YTn"K(0%AFIE]"teQr@'ee=]#O433F_%:dmiOCZ1 %!9>H)1sU%o7OAo,AQh>k-tF=J2(29U8.-IDlct5f(J%s32/LO=JZe.G6J(jE,7tQ %@(MrG;.&>0$dSi4i41dH<hCh:5_+g0/7BI7 %@)tMhekTlF5Zr\J:uIE87/fZH(?<t+G?EIi^lH6uVIPAjpK<hb&/8_<1C4PSF[ol94<]+3L6rm2@c! Z>:qS-K<C2Rr)h@B=RQLQb %K>tFc=H#63dn(9DT3"11JKS>7_&Z8VanAl--1Z$ZG1>JCa2,YgqlKDV$g'dIf`PNljU9:t<;GT0f(XIp#? td1)K$*?AduX=-nlRP %YS8925fR)EgCdl"%#/^a7mVoYg('?)W#RGZe?>lG$WurHa2o56W$nGFO+W3>Vt![2n/t8DIV'?8oFaG6`! o?j?])u"5Y6\tT`?^3 %!,F'IkiQ#%X;"a>0Ld5(eq>dr$5$l\rYjqc5ZrW[O9/5=OW.p:Dd2<S2dLt93sJ=de%rqNqm9! AS8Sgf><"[)\%"FGn4,K!O.Ydu %SAHB.i#ER23;;PbSX]ZT$'e>l8)g7Zs*Xgfmuk1B5Q1NUmC*m%n>.A"ld`c.i22#%j0*<[! 6NJ<[-,ElIu4Qp'`XB3["2UCRErW] %rt9]$f7%TqrQ!;MK&-42jt$GWL7\^[*+$i*?d4'-X5]aifWuIn\Sia<X:RZp? BES?;3BH37n3`:Q\HV3%R\HSF^gGo(ec%ePo0s3 %\N!jNRm$jSLhJ!+8Q$kN;5P`WS5FUQ6l@A/J'hr(9Z9u6g&q(7]! oV8gCgemM#k.8"Fe^fdn2KO/CCtu+:0'R*QOhUQI:c_mHm74 %"A4j='Ga<>Y#[<B2^%Zc2s(r.R8$8W]-k8-B+6AHd8qh'jX!S2N!<&CCXh\s4^BU'7C"Eu#.M? bKaRNM$uAmY#\SaF>Qi*0Xe[&* %0`9]FN6[#! (S4LRKIlRP0b)qV"QUIeOAcR0TFN2FUnU23l7q8!/os@:eH,bi686>e[jTll26ptp(ol&sgK1S=ra4S\b<W )d(>?7# %ps`,tXtCDmUK+W'B3LBR)p/!Y/f^n?:oi_j2I$D`C-YHCFXXasXd(.N%R>bZ-;N6E^j%)E3r9r5cp)&mG/ Ej8%7NOplNi_VD?b2h %Y,A%@'_Js&75/cs=U9]a3:-hS1OBlq^":2D8WP!\^3,U>Ds?e5P-BXb`8iJfUP=0s(aF2=]c1tjjI$]iqs&VRp,X$NBN%%Cac0d %GlY0rB\1g+P]u5Z#/iXG@ZFnK<HK%`,[UfY7LDbB&jV`qN"D?nk\AKb67XUrW8kVad-mbJ<j2n7gYsQ3= %WKQD?AdY2oe1,OE#-A %NG.N39]:l=G!_X+O1b6kKV]BQP\s?X74?_`,W+o,BG(@fFuR!D.ALI+aJON[%PTbdY$Y293//U!3`V)p:E %8F_4?r+0%)I%1]e5H %TFilYd0c%Ikii)I%hrp`RkTPE%%-9M"O$?.Q(K]E);2_+AACthVUIVU/Z#$O>/3OgM!E! 5I9$sIA.NOU(Sr?gVn\jq"&H.ObK3&/ %4W0\<qj=SK(R^V&<CDA;)mM*WQWROlmQj;S:s5r/4!@7O&oKHMk$&_IB*SdJCaDr<(]qQ;3#-at? <'HTBZQWCWLAqU?SI?2kA*"Y %!Pc`F&EiGCCfsZ!PN54dn=VS]i.AM>RC7r?I]]<^ebYGD!gmtr3JC5R$56Z]*.XqJ! M.bWYh'e71@9Gmb0[%o>qtE#<mEQo&;G-U %XG*o9<9O=W.TMab/.0LkDc7Uu^t;TI]i;%@0[YdJL@:KQnI0r69#@5I/,*6h^!dsMb$0CC(F+^3LoQI.? TNQ+fq,3DfLt?Ghp=u< %F(hbB.j-DTcpNeiE(-0nMk; $ImHR*DC<1C"W6qUXfL./m7(]TnMB8I6Zu;@G*Z1Bm<j,D3>:rQQ7I1r2mV5Rq^g8"4k9>O7k9E"H %:^!l&aLgj!@*TEA-Y=NX=51"A2M#$b!eo.l!8Sdi=,hk!ToKu %jq20eJ]Pbfij$7V;ttlgitCNp@r.XK`Q25&.;HcG;BlZBYo7U/ %E`<Cm@]p@GE/GYI3:f3^^qrr?=CoB*YW>uM6OslE!3G"=f*AYC,UKl9$@'I!:e?YQDBO1a<5=ip4!Pst;! 2#h#a8&S&!&nL`>]S! %,^<:`+^[50*c4;Ss7mA306pPL&99ZdS.FOI9P:M=.AmcRr_6u*/YC+b&VFZs6L$AeVJ:)r+CN3,! j@WoNf$k\)![Cas6RF)YAMC$ %,k`j@s5C['TE[BXqYl#;fLM^Almp/=L):e_5u<nbN@\CV+H\J2^\?$tLoB%jh! Sm^Bu(<I5\`'$T=*:R<@]Ra+sRk9Z2KcdI)%2n %8Z[MKALmt9G-OU5)&"I&NRB`A5','tOI\P4?uXngE'1h7(mf9_3cO*6X6"R&`? dXMr3K[e4p6MBAK1MW#EQ8Z=R<gs`)J%7"H2o* %R;eI^Gj26<!.8";r?_k)f1tpZqS.&TP8:BnO@#HSL9S`na*:, (k\'BfjM\'4_HU]4(`bL^3r@nI4u's]rJE9h9=f^2mka],%0es' %br>An=Ui"TRQGrmN?(DF7cttq3h%'V8n&%2.d.0db/6#e'\7$9=SNXbW4"%fc6e[lK%k:! Fe[Y8f#f#Z9-/p5n^d?CEG`p[mBQt; %U3FeR/%i,;^cSMq\TnL_8J#%e\l,]OgDM)&#;BK5*ZS&&<nKu! jkQsEPFbEDg&]9fS_7.CA,&;.lS>rIis0R]I%Z0(]aB1^!Ck#] %7\+[J8N)SE`!FB$72CSG@V#AHi7rUm#.VN3]2m0!#UHVF=Z;&R29u.="f6H25icBqEEpV_8s*a3jis9)`q8^bD$/R7bU/ZkE,*K %\'*0!d(7,=gD]\^cS<rg?!n:+JF+nfdMGi4`Q/M/(Wj(TG@\T1P<&%/1?]'`lrpn?A! jts5(<O"Y8Ig*gKB=iS82tO,*La)p-uZh %2YrDs6//#c-_'UE@>l'<?_X@AH/rsgJa3FfRWkm63&2ok5WP0? 7suX*Wa2O2D3r<uc"S;3ZVEX8<cSb,`[Ut><rB1!fm^=3'%*+& %WEfcFWmNQti[Wppn*KV+SH(f+)k8.kaQOO-;A8\N4tF=n+noFYG"[c[3\Yb`]SGbNsRc5'nAK6U.cNnc:Hrb?q#u3ie=aNm/c[[ %\^88qh>js@+7TFCiPODMer8s0=#hS(p#RI\,KOMmp/9tM"uZc\11B3d/7_`Z_A]#KfsCW@PsEpUrKcPL;> XNVCLSINE-(M7`rfmY %.*!k7ap5V31!/hD.Dq)4Hr!r=OrAe*+$O>j_7EapX-Jo^odF-$a<bPcPKbS!=CWK7.X`@cBI9u7e! @JDE6b7,ZW8[Dau^(9q1qu% %`p$tH^E@4W?]hb6:*eWHnZ6=sN5,2? Q4=XaNLRkI(o"Gu4ceng_'$&FRr,2.#I9V3XQ2Ks#p<#-)=[LB_77$sD,@*L6BjkSpLXHe %j5/F<onK1!HPWpei`Enir6<!(>7K>[)p;p*nW/g`Be6C_rN"Yl`O-@-]X"LJHtGR %qO.STTFS6L$kbMZD+QPg*l>H<q??IoSL@8' %GX!t[[?/i">/\*UMR^+?jAf$Fs"M?],l]JB>&Q#"T5l4=KIrl2mCUTq[]_O]<[K.:C*Q</*Pb5j"@E'XkN(A#_m/CTogUWg]V5Z %I+>k5Y?Sf*GqNEjMj'e0Z$=pN<fC? V0C+1JjEPhGlStO*Un<A10HqiUmDpB(#h>]`5UhGAdZ-,N,4Fi5n,d<eO5%3i<';6(UjeRW %ktNW:kEK#"_\%kL7=4:hQ!"c@'m"kYC"GUVA-_+gYuVLP>ti\<\0^"bW(d0Zb`*>PQJ!JnW&NmkZ`PS, +8O2RlPk(31T!e3$37qG %Ff:l>G[]FQ_RM66AFh5V+'QU11Ncep4\,fFH=a.@2t_.C&/\:1MFq"%?FJ'qj40WsK"VAG"XKMD+1p0%W) (3'ZF6l6R+cr,2Q@a: %g""UtYgH2D"q9W4#,e\+i,NTj@^_01Z*]83Cg5Y%7O/br_kNdhB:N7,UR3:W1O@#a"X5-kVU)Y_BEPjUf^nlLeI)Wkpe6f65&S> %Tu5kHf'I6h%cssr,OW!9p/C+\>VZ>!5A*i=01_r^\R-&DQOlRFmTG5Bp4EFV+H8MBin/r$Stph)1aPra4&oV!+gMaIedQ'LXE/9 %&Tm]bah?R);kAh#;l?*T&=tRsm3<[V/Y>PX7]*J57U! PQ@ENd6`L)nLkH8J/KQ5VZ3mXJYclIAL)DnuPL5B*=rJ&a"$*l]/Gk6<j %6@rBP0:g.<<>lSkEC)P'X%StZn<no1*mtY)RluBlfOOr@8HQ)bj*/`PGeC@cJ)VY3:1? 0_@<',8$@951_j`l?pkUi39IMRZ.?r(2 %UL8.iBS(1+3ZpLt9hmL$Pg+Sik18B13"`$uc->dtIJ#tkk;S5c4c<JG`du%Y5.O6^lnSL? H89nXF8Ma:iiF,Ye(+n/Hn=V"Hgu3M %fQL:j<jo8)AA\p2Y:G8Xq0V%$4mard:>2dJou0`\%?)Zrm+jj-\HdKk?a%<I*[-6+/6&1U&MB=JcK3c@BHA*EeL#Zghdg$<n<cO %W?N/4(j=>e].HHf>S@*M8b^:5o45L0C5j*S-==kGA%*_8rTgcNYS\umaD0MJ.p %i<.uJJZCaO0@@t@AaPgL=nCmf\-".(`un-5$m %p3I0EcrYO\`9O3Uk*N,la/S#i=d@(72S'n42-FiK! qUGpp<UuNe9eQZHSImAX4o$1T0mO]FRTB)>7$RB5<"+lSm5J1ng55V8_:Qu %OO,c6NKRB%/I]sJ+r(,&gp[]5R@Y[Q0MrCBgC81/B=h(0`?A0,@$ %7:Y0VA6$6(:MB'dFVYcB0:VSnioJDT0h+<MB,`G4tTH)X+_ %a@^ol>feJg-[&IIj*0%0Z$\f83b!U\\T9/8Y>^rM?CK!,S7*[`bbBH.-Fo'dg@tOpXYa! X=B0DT.A1N,Qt!MLgtp#hcJL!G\oL?m %13RLQDo(Cb\17[XS=3V/m+GT3312`pee[Me*ki:Z8_l<7>06pZ? H\=.Uq$ffb=2&LBi;@3AG&3)"]In\It4-Jb%g-=%Gd5mEbA7l %>:C(%3Dh$AdPj^jfXPT\PhGO/Eo]!)>Fq%sh]'C?AZp\ +B1J]6pQ,f&9NE5oRM53)9]mQpgmBU9K[IhWiuDj&;iXhEgNPG]oH4]d %]@2nT`,L.3E)#AOKTPR@_J)Yg@18+^=EH8Z^C3ah'Xa@#&/M_1=@p+*H0a/kQ"/r%O/<T %]jSp(@2lU1Ap6u+4E`4H.q[cbXHSBu %j-Ilb@HPn0YT'5#k(b,4[$$6J %:-'LIkBq\)ThS;.Bo((11#d#=J5mM5VqD`_[$f,cJd;3VTLsR3l^\oaERu%1oI4QBMMf2?H.6k %l'<KQQk_LX.%F*$NZJFUe*%eu'WM\r0*&WST_"W<XC70)H]6qlF_$PWnAi*I:0[cecK8=M1hK^^2h#cTSCV3[K7:hYR^t][2$+s %@.M%4^m4(J>?q8u!_,Nc][uXbe.-!1Q))R!AsV#e?kG&<0FM'hBTb+eEM<EA9#=I?I%6! q_7">eNsQF3<M'_(j>U[HWJR"[/$(Y: %Z_$ADj#-@@T$2i'=j>ciaJpp)Z])qc3a$bTfb$gPmH=h\`,RU;fD,_,.VJ<U/*uPA46^m8*R\'qMC% %FDWR<Jfg/P$AtXBT]O6B" %[3rYC!'RT&m;<HXlk\Gc9Q_1X<$8P!ekp6g?X^?7SjKZ,UqX*kOWn,s!VYL! (j#I/DI>pDlW8%2]r8'%HO4M?6[O75ps2R^7?$Tf %De^:u7*E.KDUp?4@B:N[Qlh/`hf\@[>EpB_e-2KTiEX4hAXO>l[`7N*\?W>V2L;Lg-P3%P!XOX$"0',S\ +0`"[@>5>F9>CAnCOa, %0gXfmc:V9=NtEP>F-cBQ%W_\q&bJKh"r\FgX--:k;5VTH]_MAY6J04a)tXom'XKo1l^@iAoQKN %9F+3DlVFV#2&qd]Otr_FV)!-S %U2UUtmY/!ED%OsOCs6*<nIlu<Rb2]OYJLHt.3kJf#+U\k=4$=qRc[.\-qZOoB#nRBTYa0('-GMf7,X0o%B)Ff$B:YBO3]!oV<8_ %N&mrimVu`k-/q1CoG(V>,,T<"`m[LGKiHN`?&N_?`0hOglI#C.f8kHBN=Q"7de)-S.EMU/CI,]=_0Cl.#m^iJ++a-AFEg-oShFk %c/.IpTURcJl@QnaQ/b2.-$-35:6c(i2<[o1&8h"[);I(1X25KN.r/l]D$EfpA,FDM$:WH=^DNG! ZUQ:m,uu*XaIm2a9*?`VLD7\U %K@j&n`,hlA&C$ZAGD</T.W,@lr]Y#Z$roJq6YLfB9Sb$QpF0Vh,5&E4? d<Hr[SgSV]S2(ADBMfTb7HUfaToAGMhXNGEUu#rK`;>X %)QcV")D7'%pu*[SlbghC`g.p+EA?IA\WB+R7b%CHKa;*i=8'CG+?oDN`qadkd"9LA`J724VXb? RAWN4T\lA=LrU<d[YfMO?5H@=f %%Kt+;(.CU,g?X$MQG9F+-$q+u;t5nk%-?J01gUk9dLJ],Z?I6dU&\7*IDS)eo3B58lP7YcWf=;1MAkOOR9gu2aBq@#QCBqLEmi< %HntA;B"CS8R=WLQ-gRI+lO*CU4<pEjX_9@EdrM3A;*d:ASjq? &/o7n3/kQ9d<"/t1M$q3_1kI\5^GsaU.j8Duhs^n)3$Q?oj3l:3 %^9199YHr(aTh_cB'6(pJBLW[f,'>@V],:;aqiQMUCe*rnh\T3%5%N6og1*1qK0'@Y?K!#A;U/]p'PGl! _g#FpD!DKZG&'WeCa%-+ %Jispcs(tRV;."GtI[KL"n,&uS^1.<2ci7*GR3WPrC`)1U1gUC`a!57<=9!KY)_F`_Yd$0p,\]6^dm6=868d-IQ$Z(@7-2h]OS'N %XBMN.=a5K;11AQJ@n=L\Jp5#KWYOQCSF_IXTTu/XO8Xlu6IRB9=_St_B:i:b1V6!:e]so*fl7=d01QQJ4h :Q]rgj?n(70h_'IQuu %pg^q79+>AORO5IEW`,-Z%Wi:ZAs64VbIH2\?";`pJ&g9#AT4m]d6_dn+2n%i%A.raJ45gEZFTZo"r6"(P2;o9&KT(iRGMYj[_OZ %c*f#`?-fVDc%W0Lh23YDb'tYo2ID7aY$GI0njG$7G/2F_fIue:Cda^WoHmaL9ni[>Q(<K(j2_! $E<2n6<b4VjbhZ'H=$reJN]lER %HetY.A4[4FqG:bh[Lo23@oFWr!oS=ldqBgsMJ_+U6[9Z/aTb%=P'Dn>5$Y]VGc,dW2\0pn8JH_6F? $B4[0Q!e/jH=^3:M`WI]P-= %,*678q! H*PV`N"P_O>\oLm(`r8"g/rLW3#+&m\_rCY#L8b./"2_CIrmMl&tR69@&(ZQgAD>RN`A(01i<NEfL5%L_)V .LSF2U(\mf %FgAE?bFkU-`KY%bE:VBjEniscbu]7h_Grn(_"^[f\6^Ns^.o<F! i$:EdKZgrN"<`_cP1<Z8;8pQ1p*DfC4#+u#k)VAkUEmok4i=t %piVa;;Q>0eM<6#<KQ/e1p`O=f"Gm=JN,^TtajY1,A/^*CkUS<j() +QNUg=Q2[@lK/dL)'e/]p.)\IeEnc@[gj]V7.2,,u2GjeaO\ %ZSiLnS5]_.J(po]B1!u6-F!s@B+Q]bpr)1(5jhjKJX/bHV@^2mV&FaloU3023JA?I6Y? t+*+Y>.1Etl$dDYn"$c(Cl1QK$8E)PmV %=g*DLAd=:YD\Iomr:Rlr2fn'2AZH%CG>L(7/U\`9J53=]s,uq6mL:TlMP$R'Gp)BcjU5@d>,grh@fV+ab*uBZj'QL#]49Pqo'L^ %\rn'H&@T""@7X>P`HL.dBsP4Zl.:*ui1!7[,iX!WN&0EK0@!&3GCejs"lEr:@cibEpG:=-VDo>ln8j@>b+ +c(LN%!egi*NY4lKBj %HhmpBm=m^FDmBh!cPb_KKUj`X$o=@"#3'?5>&]@3W$Bj\rj#NC\5\]OF72khB_E,7EZ*m=$7jSK;agHYQ,3\PaTVgTInqDg@ib7 %cRN3Caq!:'klU0tp)25G/IHN1XH$l&7](UB2b)/ld&oPh)Q4t? (fs"W_3.X\g>NoQ>g)ql+3]'4/p8GN<L^_fP87;sq\BC";aN!N %aDEWuhU"R&N%<Us\q5k<7;c+^9URBZ#W,KeHae.1?DSi0!\<8SNj=Tq,>JC=APm<Ra&D,S\Trk:GSqK;%(r]=NJJ\\3fH4ZtiuE %ip[qZ<M&`0A6/XkL[uHgE9CmHEjuF:#8ZKU1)UF(g=gE6R@SH"4'[Q)6a`)NZ/eVU+]3enOai:]M$mjNS6 rL9+Yt\ZL%^qB`Uug+ %-bl6WW3B?L_b<d3:RVq%)E9;>f[O&[g6F8lPZ0O=5eor)H>O^Oe/!"6@3licd5\KI.HYbS9S[1GLX>_aP/ @=.D`X>4qSQP5b>87N %+;4V-EVj8K[:eVUK6itZ[AeKP#aCD;S31UG2?d.6HRA=(<N:9L8sUSCNV#^,%DH<4R? VKg;g@+!,0.#P3TipLB]U4CL]P_C!rXGM %/O5$W&@NGGQ)d_"$eVV)JZ$tRZ!eBkorP)=mAI0H6RQ(QV_o6FmretIRN;Kk"X9lK\9^H\0)m+#EdY=+>ejk/6p`ec#eLL,ca+c %+M+V*!K^7'2"V@o6$ou_ZjJc"XshbYeFRKhmUD9KjFSQo*bR21pVD`R5jf>$J'NZJS(,UJ#OX;! GI7I8Q2"4.O8>:,R1q<]6ZLl` %ChF5NC1ca%>=^h30+/>s&&.B<G_;m)4eF_p1==L,W3"2>DhpO5#%!m5kRpCKdZde>Mf!e;B*'jI>pl? JNdd];433>n%T;O"o!!)r %rV<PZSdW&[1&.Ptc\>d^4%cTBRF'h:p;e-4FFam7K@(21j>%Eu<h]Q<QjFNIB.FH9)Z? `XqR4@_n,a_g)_:DCo8!fOK$^)A7Zlh@ %rPCsd6!dq@"Q3`Qi>MM!@JT1l5;?&5:X?BPM)"O#q_SaGQEdS7YaDDoCMf] %XN1_]2.'Y_SqIaq=Mc7=]@A;kV=KEIZI[Th#V\$P %P'O]@id@D5?thcl3jMZM)KRmA]Y^\M&HZ9JJr)af>?A=5'3U%R[-GIK9bn0Ob13@=*S]ep-OrX96Bb7(r;^&-/V;4#df9`fH#WA %T`/DUdl:Er<!'K(8neE@0]G#%$k_gA#-E)YVBjA5q3ATf%Op<d3bJcR;&k5K#Kg2O]:X)OTaUNQse>2E[kYNqb0P5T)O+Z-@J64 %QL&ufl3\Ko^\62dpWFmu"/GDJ\#NIV"0Z^;JKp'B\cSd0L5nRs<Uu<3f^6dsjSdn&7'M94U$BU.AM^^rr3 R2k%^o`[q!lk]F)\qs %60?&.NWEE>94\'+g@hHY424ASB.'QY>Z[Q2XoR3);sNG-go!o#TNa[lh8(UuP-u(=S51e? PZ]@>o(4g]RdH*ibJhh0fG8]3%Au'6 %i!9(NMsVf6.\TkEpcaK`9]FaniZ)ZI(BeU(b/i0-G!NtTW<4KF0aMSO7$PA*H4b[) [&I<Kqf[[<Sa@6[E(GH278ihHAnS&,!3fY2 %YD/1TLoP:8Y>?>nONtYad.-N`P/9.*K#6c:3L#9<n<Q3t6_is-7RlS#2j? d+N9LQ9X7<i##dYFA.\EUEk@<faH48E7$dd3.6p^Td %6@ %],be;IUgN#+kc6s6aWD^.C(G,Y7FYG0QTFW>M6Rbl@SIaP]CPgF>JmCmWWAPO0+>)r]rqc8j^]"F]*1C8* +4H57Z.KF*h=,u` %fU""^6t=O`CaT/l+q2*:[B=g$+2iunkp=KEJou?tq\#a^#d`l]LNhWaVA6k+5WED6(Z_Z[YE9s5Gsr! #.WJs=map3(d8r.L@1&D> %-[WB%#]XF9]/d`N&F=rJ_6Jm9/n+7j^4*;`lZeU[>ZgVbr9pDK@W1sX`.+GI@ur61(r7D"! 7__CV<H1/jRO._Tf&T(V[K/tCu./( %/`YRedq*khMd3Q2ij@:Ln5hD(NP25q?nFc'-B4**YCQ"OikbT-LE%UGK, (7]oco'%^G@&*mg>>eIa,)W*XJ?_E.6!^>fIdI8H5]7 %9eE'[#PaKc(%cd'al[2jhXqAo(sl`sig,XlHPqX41?q_fDO>/c:51hkAs38LphFc! VUIUKe;cC=GXPl2REZ;Q\$H:k\>pVQ=65"n %'[e7.-0JDAn@a8N3uim+Hu9pgn3c6TTAq2TV7X-:?D4^6^T/JD]IeJO)kS]=f54DD?!tZ>? O@qe#KI9Cn_fZCJ0K%hVa&TRE"o'8 %C(HsPjtMZhcdn%m,hK]`1eV\Sc=#&3gn9glZs.4:0tQfi&?^\hJd694,i1^;a= %sI1gfJ(^Oh;)K]i7)J*][]IUE.V*IhPJ[SdSr %%u?0.X+u^5U((-u2Og-$ff2Hq&VD\tZF\LQ(QYG\g8oe>=HXn8?>1Bm=WPHX?JH'TDTJM4)D*7B<&X*+sC%BP?\a\2!?8X,Gl;\ %XM,0H,RRYOIGDm`+Nh'b3KXCEG8A&sXDVACj20sh:pq1X-W`_WA[Kh9;i0*te#=+F7j?liE> %SP.'pe]#Yn/U`lk@a@=IHMcm,hE %M3Z/e0:\>8B.hQO(f3OD@]:"3Q34]82P1hCqV00EUc[N=(9L5aKDg7/,: [LTDDKUF,dpFXAeHmG)E3ejTFPEql85AY]-5a\%V[lA %!u9@KFmpE26c6@i0&"9f9nI?he_2Q?FL!ME7)sPUk2+BH7+p%%bf"a^MR[e4?l<XS! g3K)5=b7r.V2#cN1`[tm&:e-J\S6US+HQ2 %k`8m>$DXH+#aole>/TK-0]?n&$>QW7FRiEb!Nm!q0-#^TeC<51iTs.HMPG+ %`(u<uI$a"0P+r5.Cchj)nJF"cj]Q!2So.rS4Waem %<576,n-<@B_g_!H;snr=5%epZ%%WmtL",=GTnb5dj98@m[qb)pf2(<*Be2Tf5Rc"s2V! &BO#c0PSqjMh)XrHVh5c\FE:GdYd=AHP %@E]4TSEK.Oo-nk-b&<i^``K]]dp2#E8h,.T>!NPeiL%p]P$0InZ? k\\6aon$cHXR&]7YUh`WD(-]NMoe[9eH=*&VP&Ro!7prF"]O %%`kYtOF:GF)bo2'TXEa+)LV>c#3'g;OQLiW9=9clPauf_'#?]5qf(o+'QQ5bOD %q'[';SiS=/`S\2W`*mj+V5&;E6\@D,2:=d<?Q %(VR;;W+6'[<uAd:AnB'T8i`K6L_@G9f8&O'Ci6p!o<*.=]0G#![Z[! ZEdl\m2cWSWF[8OK3aJ)Kd=i/pSRFplEchB+SLd[<3;i5e %dt)e56-^/dk)M4B.P2sG=ReZX@'L`RtY>cBkNFc_B6T8VU7CGT"q2NB+_#lnIJ$>MV2JOQ0p)mI_d'F_^;V8d6eZ+[/lP4j!8[+ %&CQpdrQ4&A5C@r)>#F&_Vo5!Ui]n;&Qo-=iED-sS#Ia;k7ZG[&%f*mO5V$nh. +ggElB.URp81GLn[Dh/@Gp5:,=!&1.F$&a9h$9; %W]GZ:=[Y'4,Ir80DA6C`g#TY2<+Gg<$53:+3/q.-?n@c5Q*c"VJ.RY_2dJ2e#O?Y1dJP1BE?-Cr*udgUV3CK=Aa^U!.uK:m@#K; %eCD#Xp/`($Z<Q:!&VRqHEJZm3b?]XD*re/P4uqe&>N1DE`B4h0Mu0i:s1l9n+c^7Fl!OV<>7N_d- 2Y8>G1'gLC"L.A=bA5T9\OY1 %$VN(UAJ*ZhbKX`s'&qr0ac)=i'll<C7)O2gYp2rZ'J*.1@'[Wg<j9_KQoO1THF/ +gCIp],"0kTj,urV^W5dqA\lW3h&1.3m+pMO8 %!nZ(->roXmdioRXi@k#/bh5udVMWWQ^s$oH/$CL77ljUE7>\qH-TRkKRlOg#H@:-o_V0Y:c2l'C*8W$ +`MDh0njfa5`!kM:&3]9Y %VC92$?,51IO?_3Z<dDn7*>OY*M'(;gesYBQfQ(8+2\)loRfT`=F,$Wa>*iO5RIe;=-!%^l? e@2uMQ#HD[T:WRL\_G/ngc5m$:hd] %)`DjoLI+Sa8(`XongTc+D^0FnpR'p['9reb %bp.R#e;RUD9#[.<07Gg]>ufYB/D9Qrq/)Pif0$f0fMe^GYr:pf\,3=!^ZRR1fmV* %2UVbd`,Dn[i^ON\!&e:/#b+W;'i&nmfgWd1`+4\Jar98qXEoE'03j&PA[ZY;HZ$! uA/<UW>5dK<hhL249dQ((3?K_@i4DgsBYdeu %g@Bn#OE08'-)lH;`Do!f8k7VPCFAQeP1'-E)q1D_mtoA];V:%CH?9Q],DH3*T? `P)_.m,Hs(]6JNXpFYESBu'oU51,+q+Nlbu$gF %fK'qlq$asO/n,Nb"tiS08_8ji&tb;f;b$2qCG=!! %>YcSX.0ete*sjbOXo(C69fs\Eh$'DB7<ufbfJr]Ml\\`Rd8M?_-hj.La9h^ %kaDu3T[T@V"^U_2<l'f>UkPFO($Xf+2s6LJFb2+%!o8aL!GFhT*.F;!`BFmjH+s49SU!'/4? >U[/;<>pfg2-9`Vk%^4aWVC$fU#8 %MSdFbY:p:+mmQG?2EuTuU/KA6<O4r,siE@^AZi0X,QXA7:uM/b-,hCLXXK54HB3Ygc,_o^u.&6(0S/B<heKpLSqq9/DQA?eqQ6A %^`_,TC8e2Xl*qpJe^sp?kA]Ik9k;.'8jK;V/X1T.4,j\rD3_c<=/lph/_AkXI"=7ZTjKnd6%mfX6OD@7J"(la1;(m>$63\SW/a8 %f<Xr4HpLHqM?Eik+5EU'VA<d0s3EW<S'fRcmtF+[2k_KJWap*Dc2?*<<hJ!W#1>+9j]Bn-R?U]HJN^<WAPh$88>FV1#]JfQ-b'/ %BLHNIYeH#>-kjp>V\DU`m"Q[MMY%<H1n*RUgRR6MjuC[<nK`4j,4Mu1qFRVTfG^bYBChEfLa("'<Md$@P:mi;2m<N@d%[E/;`'% %Yp5hM7qjhI%KNbQ1m<eaL+1f?(G?T%,a)B0@ZZUe_2Yi^;a9dZJ? @(rE6BjQ+d<(i$L],C5Jetf]q[*N.Vd-s+]pI.:(*1"&P(c8 %DuuNH2k8Mi2gFO5/-Y^-Yr&n:2S(i/O18%1`m"3Ip7rn@Re&pN+(f$c>dPG/2C&,Y %N3\>X3"e0nKa&FVK\!C.&@=NLP0[>6RK<> %^UP3U'9af=#7*lj*gi3^=.R^4hC&dM\IRq"R6Sl3<uMLs6.aoK+u`kQ18`:K+0OQ9:QSX-agb7&<>o1o! GIeO`YTFT=V#AV-0C,/ %Z/JHtfEPoLQ6Z3/AdCj3*.U<uLSB<R+>NCFj66l:TW!"/=MKYTYi(^N$?$FZ1Pft&6+WpAMZH)Lps+VgMu&?8R6lOS@tBQoXZ9n %Ys#^^HHJZ@D3G%NNIf\9+C61Nr3l*\hLs3ma*RpBXgfd`2OLP+ApXTiMc["QkCDsR><97/$up)eA25L`"\ =@Sp!;)g#Eqelp(Iin %'lIKC)klbW0mH!e=&Ts7GOnF(&e1'p"r %G)Uu8A+^HEMZDu^QsH0)l60_#j@ZbZQ3@*IcP<U@EY:>.0O:A_LpWiMD;=s.2/$6cG@ %,QY4)0u8D_&VC:Z6D'!XV.fG5(Gaa*K`l#%E=qr36W90L9(>aWd,`u&HV!=lNJlR? 8N>lKZZ*+\_TWB"KX>(7(&*UeW@D8Wost1D %KnY/6_3Tc(#G!l)8'r)=!-52,6!,;)o1bbob/K$,@"qQsWCEN6A^W[`H*I%.9FP[PDUJ3;5cO! <J4@Wg]G_/j`3od1q!t8q51'E) %oIUF>IsC7'ciJR/Ka3Rc:@hrGkL8'a"X6c)DG89eTdXG0-16iC>OHX\2gL^;-ED\$ (MLiR3S>Rf(siM]3*mW,liI97A@hlYS<(Uf %.T+qX'tf1pacgNua#Q?<!`TcO<65U&CFf,o"JqNO"2%MZF.'qM&VX] %N\d*Z875s'jjK"(f<P\o);Gs8];"J:i8e0'Il"B\ELOS3 %'=ls7e"<s#o1Yr'hBlWJ]MXNC7$$(aNEnd`\o>Gc_FI=qT3bX]/A7>6lb!FcF5m0HK%4Kl)h&Tk7k/g? hRu$e=KhISPpgRU:h"H( %r<Ds0gKbM5@7=f(dM/q=C3D'Cg&YjMgr3mKh:o'=,EMB+]QAGJRI3Q!^-48H1bD$#Y7'AmFBBC*DNaN? Okmb:8Ks-CVhs,,Pq7]k %V5Xf%U)/<*r0%c&j?`N?kU6NnYQQJJ(7+)c(kE\cHR= %O(^.0H&kru(>*$u*eqq,MB]ctdTGI8u\Rnn3/JNa^C(S:__)ufM*SPF9 %!sb1*dq5/chJF\0OmDLe1n,@;X&KT:V$JVQ,Ki2TH;&t@!'as.\sBDu$DaV5JJI.F!g!KF+K(+7(? 4R0WAal0;4`#n%,Q^Dajee[ %jVG#`g^mm^Ir,45WC8)DKjU)&<m/<A'l@NoHdRdU56l)6Yc-Oj;sg]e\U=Np8n93N\q!? 6jFT1#b_qWW`uhS-Gs?k=\r>N`-cgfh %]N(E,>EbB#G.JdtRI7d5o;3.43"OApqU%p=4HCt6;Hpb3ZGm5d3%HWPK-VlXoHJu"Ls^,B3:L'[6)G$SN^Sj!a`m#:d>W9Vm%!%"['c8T__FH/a8oqRGh<j/F90T^^+mnSNJ$$OQ$jqSZZ`90@M`YFp'uEfZq?)l'-@TL0X3L46=u2-Q>[! @b.dBH+2]PI207W2iHsq %o65-_[^Zgop96#ghY5Vhd)CDhrYu%a;qoYV7jcqM;n1nMXsW?];:a^i<Zed'_d? gOg/^JRJ7G#JItWqd^NC5DQ3r9qOqc^S4+S4$ %^s]2H<VdG<_&3`iP<A/3rAg#.!0cS=\Vl(O)W@,$s7W-P\2_sh,a@$e;`=.XR2,*9E_7_^/PU)nhC`Abo! +nJ\:Z>,TE#bG_3,VS %6PR)c+KBt9dHROS[TFh3N2?_uk>VTiGf//q#E-bb.V508RH?'A1Y]kLOeS?`7M:?LuaRn(&3ONUW:g5p"?TcT8bAr"3qVs9=eZ+ %G-6(iE[=*^ILcaHe]0;`k>sph_9'q,,t(%o5"1IF\iMkCJql!MKuK?<H7G$S[R\ [6l=1e7a#OqabXBPHj"SN5Q3i\LcAt[i\ZTgf %^N@XKf<GY<h9M(3b_gr3.SE&n`n%:!S%rKS5Ob5@SnekPgUVolE<O/Zs/[`S(#H_0j?0]Q-,b_d9o]: $^P]9ZRVs7gdX<2o0>ZrD %bLjG0)U%LlA$uM?-VHNkRj[Ye=bN)%-q;G4K^lj`]b(%_.q"I! 6\6tBDTM1.'2h=tR_XIpH&3/#P:NL:#="^Ra;/uE\VALY+[9]) %]^^5a<7ihg4*B+0][s?!EZ)>gNV^XW#BdB?&E@:-%(7S.$! 5Kb>/#u]cngk.\5ajq[g20H.pMib*M.EkGERgn/_Ujl.c51RquHtO %n[Aj\D\ZHK=fW6AX9$a+LHSB?EsisjU8&Jn^*-;uLTqN8H)]fJXdRBOiZ0`4-*=7e?Gt^/YH-dl %>4`GN>;U`0P:%(0,auu6nXC> %0#0VbH'R[M>Ff/:.o-VO!oA9C#rmmE#1hpGNRh#LnK#tVePJ;)WVoRo1AMDTG!cFL1NNE.>qO86AfO-4g8nO2N#UJF(V,IH<U/4 %dJ]0,8Q->LjO<'#'[452C@)@f=5ZcK%C@<[.VH>98n#Cq %@U(PoFr`tc$AE7R[BXd+8)TP4kWM7&GW"4)k,&e:6Ai6+C[;H81`nZ %pYh'cZm[tg&H]r;M/I9)1s?=dP7Rf>[s?J/fShgc^[2E^5gS$#r*hgp+BMa;W,J=$jfk"[<"? &RqC*K39[OLZHn3I/IXu==!@HuH %+M%k^Nn)%Pac1.(%4Nc?)Q`&-U`F0cd#JX=?>'MfnN5BR(V&1u<F0?2^s;6;M=U+ELoKr'o;b572`^! _d4*qC6AERX\P/X6ja^7D %e>'?ZSLmtSDdP.eR)%1B^9)$0B0\C]d(lH[4Cu:H6ls%Y,!(L-\!.&(Su2h>#\Zi:EGAV)T:)jc9Ob:GDMh.Vs1e[apd<@XE+q* %NK`'3+OPm'eP#&JYW8M,*;3*^j'(`DN>ZP7dK^PASG'ci7\2<UAsU4eQ$huB@\VT %M/uZ8=8^;nYCP&s;oO:)W6t]D)_Dg5j?GiK %J*s! a@s2;EagNcBUr2[+NJokrLb-;U0?"7Z3q\>+#jcNBm"&G98LO6WpG"J1bJ:oU`.JN`'>'b5:6[IBO#:fk^u Bl/!Q_FO9mIK% %TO]1D]iC].H2$Mh]'PM<%Zg_ %4HdbsW.SQ1kTR9(4Cl^]j8g6):TO`1h^bB(i2E&DJmsMZTW4W$NVY'ebS#<P_Bsf2 %TkN<+>+O:P=h %!)0q^>t#ec\b&S@Z"WCU;:"tI]3E/t+OnQMVZ*7_A$'M"RcNL\u8Zc6k67K=C:op@DQC*E.5\%bd^WcCMT >2&$? %&i]LI:M?F6P"*j%a0^P?3<TDVCHug<mP+JNKuIM6_!Gcmh.`Tb?]G]nBH6l`K\\b0`S[Qq^.! Tt*+C26"pP.eWNt[2U):ge;2]aW %1'sE7`jfM*)`YXUp(2pZBbY9@JJ`^]5\"nE`mOReNeo.sdM!o\8KC8_kne:)i?U11!K_,7;4orF_S! t_\VfFJXZkehC;B:!/Q]EX %CXO-/j<o\4Q"Y4V43A[^o`)6E:0`o*TNFRoZ2W]Soc?472eKj+>ffDdE=d! r_<Kbm_2EC)A/Q&j1A\We)GkZ"0%$ZE#5@!(Y\HEB %#efcNfssGeb:AF:6N+-f#47CDaOb+.2nu8B1M/f`$&OG\oLL'g<qdDcu_B5oh&c2OO+3R9Nk+@U8@:UmVHh*+#"IF'EqCF!NauV %[$<U#:2qX0!U9`J7kl[2`B&PJ3=!_.DN&b-SH7?hIce"k;n?r!4I"NhVP^U=NF?r3Xq_uJ>E`Lh`WO&e2\ @q=']&J[VMA(fljG,W %$+W]j@5I:FLT5SJkYBM+7B'OK=jgj$4&(:Bi$*a&EYohRWZ[]f[gXj/J6*o:2>+]ae,;2WujUFH3spXpk(.V#8/'q[;,toE$&+$ %-cDMes,`Jir5iJ^_n.@+A5BN90E4<QTY&_afDN./R3P;)j11R"OFRk-id]%&!T[krJ7T? aqGME[5LYY5lk3MPUPbR.`Em<B3<H9g %"[/ekqbTdoi<o]'X!e:\!#!D#\IjVRl-*s^P%c`dChqRf:<H%J! m65`n^>EfUT>a^?)MP_fnp'W_WG4$nj-@S$m[f-fZ9OnpW8@< %\Jn2smS8A4XrO36NUD'=S! ^UHQ*B)XXuQKUp.=(,I7uhOX):7G[tu!'hjdMAj'E3)=A5&Ba1rWCNXElSB9_bJD0>OJKq#9G/[p6R %+\r(,Y'SL!3J0n8Y7Y5#OXC^N3X*k8f:;F*+:`?SPU<))?rT(A;qr3+Qr$76(K^go.SgUTB0$X1#Tk#! ZY,E(b1dT(Bb%YDE6[G: %b]RKr`=g(;;I3>>4Ih0*h\:GsMecg;FNCD60#C.RAp_1t\I*=\,A7Nrb@<A?[!6J)o7Vt3f=SA(@8Tda! q"3#(2nHHX`1$!*6XT0 %%'_#WFNY7-,.?'i1YWR?7gAlo@*MX(2cQ=>#s\l1cLSWi/g=I!>, +Qn`IKAW,ghKrDnY1MEgApISW>_(33[NP<E%>1e6OHU!ZlSj %$;NS,X_Cq&k-C1lIaO^8q@8LPJ,dR?M"tH</g^g5s3F?\rtN4Tg_C<.Do?oYPnuFN\uLNk<<"3MUTi8O]DO2jc]_:b*.U#6k]%a %/.jm3"4-*"d7+TW&6,R`9-!=H6/IV>Y8;+q'+*k.C^hS+Yo_s^f=OStl\``W60FVJM4OXg(+,p[8oP! P\9Oqt2+H8:bgFDV"]u=2 %7u'9-Ve2%g@q3LINKkiN!jRYNF>u'2VN5Lu_u_U,knWf=*OUE.pu70P*C'6S2I! *q`I6<bZ#&G1eg283eOE9<_I5R#PG<PJ"YcGn %iUZ?^*K6NNk+!uYl0L8iA]^dCMmHoo]lK-Zkf!:-,:^nt-Kio8+jXt*6/*V=(7td:G'lig@)I4:>? =)@@p__9iQ^s16b?bOL9THM %=B@3>#Y_!5p(Y,N4_O-nJ>C0q56YMTLt/9\hCbT-.5C2!Y@e&0bS,.*$SP^3$YZU[(KEdQs$1Q]#K,dT, +tEhK*<EW*5P?H0Ym3W %pm1cD]Zs`QU+:O=pol.k-)j$flL,AKf7Ang^=Uc=aGI_CLE:UU0,D'u`_:50Vi4i><C#*L*hb+MH6=K?)d MP-KeSNi2/m&*VT@3p %).-/#R<X--a?*g3!)Z5Gd9m7s')R<1>=WG;h/rufkQ6LroGeWg:IgUhX9Y9mrZ#>]/0UIQ1f! jUE-,ug3#]A#7/P'"Bcbh0-WgMm %MD#0ZH9?(AFi;>M'f\V)FCp8%U&7nU#M=n>_U)5K:Xm%s9cplDr*#hNY+7p6NHWDGl,G'k7O)Lqt^:mg4*R"6<_qTno14D8k/_j %mkR?hSToYRk_">lTg'hG? 0]/L_gq9&05Uu*aWj\==&lfErHLfd>;MVk^u"n:TJY]r[7hg1Z=f9<iX2"N1+X`6_e,r%G\hXl!Ypfk %N=%>K<);1;.g<H:\IV8dL9l;[rLAT8]0!%`"?.7O,]O,-n1SdpGrW! AE[eoY>T@@06RuH[EeP=F*9*JaX>>KFSp"OmK,nOPYqVZ? %-;tX^p^uU]=<3\:Ene>/9!WPfPN\ble2d0fG0j^Hc-jR'RLI[sIH,2`!J9nY7)+am;X$NL1u<ARbQgIb %KQ:)'`DTo+Bi316;WgX %_t>F5F?1/X9KU/(E#`#Rf[s)@<bTrn.T1Wec/J.Rs%`t[MF>"P3WQ3#f(UJVHp_eIlTD#"D@+B!cAX;N/? *Ik/)lk+f$h>t1Y__; %dUfK*U,AL_G9a"lj6Vu'0Qikfo4]X+Yp0n;R<ACHZaYWo%VeN6[`U$nFbmsKk[(K!=26Jt1L$ ($^sgN*\cD?*Fq`(oiSs#(`5j-B %D/sb_/;pQTHWaXWM3C,onbj_NfbqTP(\B3r9'u$<Qq$FmLY6fi,ZkZklDOsIG)ioo&1Y@'mQSK2U#G9aN#Hg%<aWc?4aY9^skWf %"imW'6n$!@;W)(tSAossU67Ja;;jlKlBd%dfh]Kc&mKk+^]cb.OT6\F`L$Wn40&I?@a[NhSFOnh+o,? $_<g+_eS2EW*/68hDn^J%kqk69d)Sdos"1_%dr9?i^p]\3Gr5`C6Zm(Hed#lmSM^r+pld(9M-cTU,+P4>&B)]2.fL'QKsU@? Q1Agec9p%EY+Xe7+j#2nRREeN %4`,+';'<?oaP@+/31Q+.E:gZH&nR#hgj[p?@'!'FKSB!8?1$qb'cID(9\C$'H?2>Q@$l;Z"IpBiMr&_)9& %:Se/8?DH`0`O7iORA %d=:]t9:$)dE-Bp4E:D)*O1>OsNB4XfStp*RW(Hmf96ZmOp->Pn<[D&m %mL167JG&c#79P.`I_JFK1Ffh^f2%09MjY9ZhS7l#;Y'1 %94^LA-5X,Z'+d]p"B%-pOo$Xl#[Xnj`4VY^!IVGAm)f?#1STaJG0Zn%%>1dP_-+6dF$2b:%3aDDg*! dn$!'abs4`[L=\#!]kPIqa %PCrES>;\2EFK=Jj)Tk*Ii_hq.V7[heaC.alcQQ*!b+n8@[ghSkKpMpii-ls;%H/MT_6T$ecIoB''ba)\m1-^h3X/=CBK!_B;cK( %n=j.[\":ruIWSXF'0hQ9Zh&uK?jQUkBUg!B5p> %0\G2\l<O@KE2LW:oqfW#b03\\TQ7lSA"NcfUW3iCOktZ/Bl;[Sd,:bZ);)<48 %RILD+p,:ji2!2)=eiM<Ea$g&RqWYtWR@i]*^qW(5<)[&/G]5.IM %3\`"&fl_=bM";o`Z,/RlM&;fc9S3Y]1dLQg6>1Z',VF'$[99 %<\E;i5(ah,Atsa8=G@Wb+lCX+kjF9QO>m,s(;2fdGT7WYG4Dp.&JP0XEsIBNk!'Xq6_?,Ep->U! o*D@X&WO7VLr:!*_<aDoe2]$$ %)Fb.P(7Q7C="pH)+hsD?,r?O!,E`,bgO[IF"K7CaW&K+NHrQam8'u*q16>?WY)R!X.;P0;.r:_bk;_3(FgYXVh5g+lWl7A1r,&n %qPhl*->LDi4CYP'L3="+%,R'B`*L:=%N&OAh*VSsO]F=V!$D>`7&PDg7I/4A3`EoUpi'7/GH]33gp]LN! &6E#;2S+"Rs@XPaAsJJ %N;NK89%q0R66hs?gl)<JHkJndq\&:m;]l&j5Rid0+=EOL%=t`"B?r1;K65G2@Jnt&C#SCq>6q&3sX3&MJ-=945gSlKI62oO,\7g %\AUo6p1=*'<le):poTVgehMQ4FWL=s$CKZ=B6JU#lX>LPc3+;uX9N=+LZ5PD_cGqX0n9;^;,=c/8NAN*. (F[^,U;\rn@i?onEH!+ %b`!&TidL-*f!-u;*ogk@ZpFJC:`O_E8ViG4JK+OJ6;Lu'W?Q>$*([kYNTZ1? Ko>&&7fX`@T5:9LcC"(p,@$3#6Mo]n5.J\HO-qu? %**S$p.e]pn#:<0g-';t($#)l-Rt3ZRe;'bc<C_mWkoTMR=@_;^m1.4B:'G=CeYX#:8NCd#)<:7Q*#'S2Q\ G[mad-cN?55.p!a>5i %@>shu?F=/)AK'u6` %M$EASS)5+`oIVR$^'([,*k$nXF))@pZ<_Or;n1ei(3VNf\@Ee&:3&TD1UO`RAsh`]0%O<`\$gOG! C#$'P$Y %X;Kl;2R(h1+!RRgD;/+9/3L\.f@aEc<,K;b'74n+bPJR!2MLsMV\C=$9<F26L:`/V:a?sqEN? =6Hq[7u"^X].q;&GT&U4%[NV::A %49/4sI&c\*L=tX%^eH[_SCD-S_4-'Cl^M='4$%qSGCFi^"0VGmbIu<12`rRH"i.#(>'ai2*umBl8B=! b7,c=7C1KNhNRGN7P@!Ym %\ogorcZctm$GIR%!ZNhBZKAMJBC@;d<:W&7%=\iVC&l@dfeGC(QL)8NVCPc% []*r4P&o\g(=&hp2Eo;4<TV7IN/;[!\tJ+c-+QWb %_,FqqN+'?%>BS0?'nm.5i:F$_RWp5KXVrW!RM>['Qh&]XgN-Fr6a7NSKF.%^fU? LD).Co,UQs"Hj#;5,KD-2nf;=Ti'0[CZZeX`a %P]2EZ1a/&paW6gVXqO@=eC0n3]sJ<*p]N^hi4h@P`]i^+5o4-U^nf^R#rG5ddZRoc?FcT %U0.n+N1ogHGD\KPc:KmE-GHd2,XdtS %8P@ej;Y!(S%0XN;gstMu7F(%lop0c2B*HDh\&1V'+!RSrA1%fgl2>iNq+!`d>ULi$(IhOI:YXJA1LRa9S %GINl*%X2h+8-B6\tWH %>-R7sN^]:/-oe>ol^W(2>Q]/p?Bf`@UYfVb]J5Z7\t`YV*c)HMQ_D>R&'U-NGW^W&"C6?J*E! aJ<MqhDQ)NA\$WH.9bUO=tYdlIo %*^)E\f+ihmo+*d/(na8eH83;ioP#+Wn!W=GQ],;cX"?%QpBMU+&8t\CSduW'\bo>PM>SNQ/0^3>lI8! 8,VO&&"JhAeT#*R6iL/0R %k^N7m^?Y(pLa[-H!ETSTf4Pl8fZbh]I9fRO,0;$9'M?]:rP\_BOR>tO0nqLSG#3%ri?K#VW.TBfg,! mm4RgQ:75<?=q^H00hS-Os %IOu<)2MXN9AX#&=dT#%LZO5TT^qBZ/':>Ej.'U9#=C&u6rpiR/1YWs:I"d5J$KU_pnrV0e'J'mYCHAWs8)Q[J+K_]hmq_3DuS]; %IneBfrkg\0pualL5Q@_]^VBYa5PgT$rTJGiqKK]\s7Ou^!Q"$<s75r's7aG)h`eCXJ+_e#pcm5_? TrAgn,C?+h*4:NU2jHu(]NHk %O3QYY6?`8D3?)9Z'5W<bbe1/>ke--t0;>e0G$n*na+'mJ"9pD^"Z`H>j>>jq]G;SYZk4jfZ_.@9hAXg9, ($WJLraT\AJ2>Z$$'Ji %rA_Bm<T0>+QLfso8p4Q&UD:2+=4V8fQoZ3snPLU'`=@giKSP_]0)CQIJe? N.<"oD\c.i_Q?.\2::abe@6"\[L3hYUV>:fJM*llf$ %(.jQTlf'a/iB39]I1$M.r^MqYM>E5Tn!p%aHU3F+,<KqN!+Z9ga`"`7]"h";! l5YgeDSV7`*M6'9FU7jl*=u_rm.o`rA73l\nBBg %'kh.&@AWdIZd/Gq`66."@!o.PmFT>Y)tjN6'M@-g$;`ibVp'^Os%#4:CfUQ_ZJ/9Q6MrF&Km\59% $uT'jAgnm[bjclq%t<8.T@b> %dcK]a^!aZ=hAXMaQBrc!No\![C0TIoMEqsTrF=Xp*VtT88,;P/lu*q?KTT*#fNV+;nII$O %jE2%0mr'J<*57G%DKbU/5TG3ZoO"F %7G*e7f]RHCSn,BJSs"f0/<8C/Yr;G42uDOn_T[+f1+X.i,&eD%HYb#D`$fVo! aVc6P)q[9WHrA<3A8>h>m$"JLXfNQPe^P2`gGP& %M5Q3I%=q$8(Nho"#NDb`pXg['k<#j+ULM`q3j-!/&d`8BPT@UFR(]? +mF7@U)^uT2nJ90#H,ckX^:bma/*gmok>TTQ,VFI^Ak(5t %hka/1X!1-Src]iudM^H0Fr+)F2\L^K38-1)WVS@d2<Q4T4/1\7M$*Ub.S_j)^Ub<,! @n(&EpJsZ@)CtOkJYR2,Z5^e7sho?#iclN %(#(d`R69"&>?aJ%@IIIj4Za`5>_sf"N8#<;T_?I<$? #)baUHE9,DQrF1Y81;2OLlu1H#qn*=[c3#g[P=ia8&V_o?N<%W&T&8]E/5 %dQ%D0rQ=9O,KV=5+E)FP:d\?T7X*ili=&8+kMqi(YQf$4rCB#^:H#IX,c2Ne=a)0W3ofaOo=ctVC#O:hT"6@0t>orWHsd_Z6Xm7 %RcmWG^u$Yh>&aQZXI4ujQ@btIiR3lMCa8!I@QeUf(>^MW[+VVo]?.a"+qO,%X%A_g3N %21qR/Z_(MqR[qB>K'Tqq1FKod-@=s+SW %_sd,k_6i6b2L\ksS<Mn4^c"?O#2,ce!+Vin_9r.$48;#%+We'D4$g*4<l_!!&/PBfnWcfl&n? Zr`^cJ;3*DPQZD>4XJe:UP^,Vre %V86?">-ui%*YBXd^?D>TLMUbVI;UkIa%!]7_[*7]@k;/[2=]aOCs5TeHr\>\E_$EhFE0&Ktirr[8g_eXW98[`M?AK12#.2/8gN\ %6"8(X,MML/#7N;o-f:6F6J-%7+Oinn-]Lm1nOa#ihmkHjplT`A_TdNdL_8#Q7!I&uqQ5P"gJY7nHGuI!g\ 7E&AY-5_nB&2ZLAe2r %UE=>n:d'gHCE4L*@@rj.UB?*eKc9]sSp]]2O1C"/<@bd>Cfe*TA,**2l)/"f%"j1L)4b;[(r? #]GN7MChdJqA"@(Z0a><tK@34+8 %XBiYLMcVfnP*^R_(0hmT,O<E75O3M%ECr=7VLCuJ< %CGcr;tRLdohKr8<N_$/U<@5*&ruMeR`XRjIH=B`?)(I\[)ib8NB".8Af&; %c$rh3nCRu)[[A^hHQ;r*C#5VlY`itE78]! C>+;^+i"4'e,L08.H]PB<-]ucZ[6LP*Oh]nXK[Fp$<1C=D`ZL11T-%dM?H+]]qi(uZ %nF7K<ME0GN`[BSb/)lIh_!IRaG"LG>S\Vd,/#FVAE$+r#N_%91JMT@j_#+'s'u;5B4i/o524Eo#WMs;@ %<\_%3p%DueL4p=;0cl) %C[7o%gAK0l0pbPk/o%V&LCC\VZLb(AVsl^JGj6MGNN]E9pVbU%aPBA?UX8Ho>$4D!Z-/ %Ra^Pg]L2ifIi"2$eLIYCSBr0Ip70V#Z %!,R`R!#aKWou-3u2#/\Or&?)%+j$'LG5>8lobX1]-2V=ZE&E*?4`DXSdg>R9(.#q5aBGCY:YOsnF"Qm@X!OO'1`Q//kVX<;8L'l %[YWN\hBZC<\H%+65+]L*L0\jt%6.QJVM!k0JC$@)otGI#qqm9cB4X`d8-UK)<CuVc>oZFY! $G`VFFI(V#SOb(mG3KV4FkZqQDgk) %A1?Qim@'sQ8:08ih&CsohMM@J^9k^n%F#B/PC9T4^qor0+_+>2[VF..9b:iEMDcNXg %eS$Kgu6Lfh]H&)k1Y'g4@p4`IUheg)"Lo %S1W;`4<0#th#J<p2\F0l^aqfcMP@Rt`O2AQfhW*t$;T! gZkh[J[503V:Ea=#Y(.Ct7)KC6kk[>R9mi`WE7eP?pM2U"OI]p"*-kVE %oR0U@P@F03.BLjR02$<\png]ObNLHUcf5Gm$N3Xu.M#>D6jq8F=UA)cb %OB#CIOHae3G1d4TjS:A)VAj>3BDO$M10j1(M":&35HR %cH)82d?(hEU#=Zu2-P4HT!p[)5-hss*l'*7^/;l6NWGK509q@.UN6? HD[l`qLS+M:QbW@nDgq]7^YD&'r5%:ip0W=Bc-O_6T'PJ5 %_b^;jrVo+FZ1c9':b6c4c=\1IiOHQXbXi:sEH=$ZX(cU=W80%q %SN5J-)N5e<Nm[j[]lQHaqh&=$HT,b1!'F\jS#'0e/1+uKE)$q %8b<A9KCmab>ZcJR6lE6c-g!>unMa,1q"(]hhU^m<5Pt,WJ+<?(?[hd*J,[D?s7)Rcs7ShUdgn)9PBqU? I<^$*J6%=pgSI8lpMuUk %"Sa@G&'n^#polu+W0LlILTga:7t8r=fsUXc@1=73Gh#&"G#uYiKZ"8eXiAC.Z,Gmh2u_Xn&_45h?)u8DAH DN%^KuWb1YX[6PE,M9 %di\S.?[qMtIVbAhH3$n#Z2j$&[(X6Rg3<'/IqSenT7-/9s1XQ[ci3'r?i92mIdu0Brl>&ZrqsZ0? @Vg<rrIK+5Q5$)q<-)oms%(3 %hed^Ul-E/Ckl#u0bhD(Rc2ZnWjP/Oj0>)dAHr7Z=Xa]F6^?@&\pelP1p&!`QqScP4s"fH*kH$tc;N.3+3XSMnL%qR6<t7PJLIiN %.2c0+7UM-i6YdL.s!Z)N:>_t!4S(Y0'g9F.I#W,+A8`]=-GIA! XW2r]K>_5js$hj(6:`SAm`e>q]Z&uuLpP3b&:FB8s19o1b3/DI %cGT:0GefaZCfRZ24ap"C>5cKY(;%%FqJbmaXcY3DHDCQ'! K2qRRi?)Hj=t,IpOBf\EsgX]H\=b;NA``fLOS^Dht)3X,C\+Cb_gZD %J%38^n,@'d#JlE"RH??)c0h?an:%FTdEMctW7>*e1&?&:^0HiFm3M><,dt/fhL(QeJK!knMfb! I.<^TkXLpf+-3q.-r#`)',6a;2 %_n?4[KeDkW2Lr5nl0Q#npc %\mh5Uf5EF/s3%GjM2$h,lc"-"emP@=Vs*+C/`_#q,uT[OP5KLPX.qZZ5`l^2c.GJ2UTH@?>None+E %ei]*UP`2#JgBoklSBI+0ja59\PC>nS//P-K\e/A5hCZY>n:oW$-e7"G&! m2<mdMOW7X00;m.7@8r`SD/:s4%=B/8;=Oapm6rh)9h %QdQ<Npc*V91>(dMN.(`8UKGXUML/o"`5S7p+82gDJ)>/Rm_-_ic<eQki<m?'/)92E>:U! T5I7MP=`CFfA"q4p\Z)h>Sr)P;`SodU %R@6pB&AF'#1E\_R/3M;B=<hgkNs&fQaSJ**ic,0QWQN0DenCh%[IMq*I7?QX]O;%OCp?X! ^4KTldXAf9L49kD\25B-piY[:I9DK( %bl*e)7/SJki?DR#*^+<j>bSfm2q/?u>mR_hd0;ZZdU,$gcE/V#Xi9&0c7PJFH'm/N!K(.?p?G) %abo1mWmhqE+B6L=GGR]kgjei: %BA:%0q!\'rAo*:qL!+_6"#1Vlhu-ff*:a]Ent3nJ.$#U5s5ZrGg1Igkng! jN5F6e]]RA^&^[RS<EBp5+^n&''qh)WSlgOS=4(E0F %h]+kss8V0?I_Q9jlppsIKM;Bk^\I2os(ih&^]!P<roopHi5t%+-[<)7_5u="5Q %_B#,a;pj"DN)I6Y$*[oB@/_IJWskk2HV^\uRK %rsM$ij$3J)hu<TCIeEI(Dr,C3YKoAHj+R@`#\`S(61T#FYs5uX%lG\>c+ (#f1'uLUZdm7oM.u5Ocg$s*'A1X>'iV$&hL,:@3MoGe %8OZrm&*#0GO9H5_>p,nUIp^e]^S31,-G<%)Y1l#"o*`hicS)uGrb5BHpfUnoXRrdVTtL>MRo#;H+tdS? 0YP-pH5POgrUj<!df>U! %c&.02jkF_"ELK!q0a2Ohq:f<lQBBK#p5a.#b.5N;ro^nRmCoW24njH/G^eiKm8%Ng`R!h<B:[qngj2T4NADF4co4l(pQ9>1I&0a %W`X7MUo;&dd]KKT7R?lC$ToHrK(M4scM;i"cUME/ja>mJd;M`tb8^?!\+V0%kj.Qg=6N%X\(31Eme'5ir/ kUjl>m-2cLjnM(\77B %lhf)$6p0J>pj+MDr0,gGJM.%j%2>PMG)51;L4cT,DUZI(N>7jalb48B+;G5%$Brqjr3@^1\sNBKr:n7L,AbuQd(mWI(D&beC;La %J6@\6roA-WCN7Xd]j&S0pC"OAn8W^(o_@T65@+L4U2;/a0EbmVH8E#$4'DiM %ATG<6>gG8Dh/FT\X"AX05OY_-W>6I:!Eq5PtL]K %<fGK8BX^V+'h&o!'(U+:6(/sGjg=_pD3f:[IaVgk`\AYjJUqMUU$9sbL<Y;8m/k+3s*N.6XTN#UG! CaI>.E!N>QuHl"3Nhr-nj=p %V*"(f/m!q`]'C:+OR8TWF/C2m:\h+!NNdaOf2)5;`dWBF`AB %5ChJ/)YhXPM]9Yaf3M2Yooj:ZJ#+Lea]`a9%:K)\gSNKX0e,T2Z %O,_"<HfSi"hG=5!Lh\@sT/+[Z_gme9-2=TOH"(188ujT;&MHteU#:^2LOb>@8%Vlka6\^;/-X-c4rc>\#/ C%Hr$2f:;LSPK7HuI` %/QgW>p^6gW[.sKg-kNP-`1/"CW]mc=oZ1*NqfF&`mLj*Uro%b1V3[`k=N4.<\7+ [hrid"47XB)\f#iY.hCm-Tp\4A9Eou7Brf>pS %arfO':O`65=JMGI615@os3,t&ZD/'=0Sg/T.bQbc,G-[4Go9PBFM./WL'g1l]CD'S? [t>Up^qIK3C;'4BFX/2Fi-@e0H)^q-E(:t %rKZMdDhbWoKY5hr&hpgZcLGFeZC9]]NGG&P%83L$5BgceZU2)3dA3Ta(>UN-l!4+&jMfBaN&n+k_i+E0i_.sU$+CoVf-\6pg10$ %e&<]dKtlm4]74lRJLPq+C@5CZ1SRY7Ao4G=PI9RDiBn8UTfiq2gghTmBZ%[+266u1bI&oc^Ag,Lb$=J%F %.ZRgWa,$iC(195Of@2 %`eWq-*gegC7\7B_7AT^5:[8L<b;Su4=rMhrLVu3I/_f(1,ZS!;Ghs#^d`fro9mho2L&jbEHiEdu;GdC=)RVZI*_^/h`<mqocJI( %o#EtU8GgFl?Vdh5#N(_djCa+f+4oGh@>-C=K;a9Ks)1g)dtJC?L'Hic`Ppc'9]N %W9k0Rbrq+3gC=guURZ4H#:*=D`r)eBa_5"!P %H2!g2<`qiNGo:D]^g<L\rrs+"32V5\Z\\sHe1O,t11%^@! Bb^Wg_efbZ(PX$lPN*4:b3mT\>#$;#M+tAq6eF@m*tKrb'.d"5;nMJ %O+7/8a&f8<_TL2);,JV)<L%JcIX\IEb865=++-V-b7XEb&#^S!4FPuCoRi4%D`a>8n? MV&LXH\tP(*1WoPMXr%mGr$n58hq&#(.p %%/lY96L2p:=#^@FJ!Tau<;frS1[:IQWB16CHDCXB*U9#`Y]em?LF8L5C>TklF1O6B:3@8VUSC! =+t=$hl]&5pAu%,;;q:+>@#D;D %/.UD,i8!rF]<`1Si`6MFdnWcjH?k4sA;haLdum8S`MDY#%D=8Iok/K6G$212cL#"D(r! T,1P$D7/h&1\FbMW`!0Dp)oo6sgJhuFi %7SJ@!(i<>qC(BQjftOIsk+'8Ll$Jf7GW%=4=/,t[?.05":U"Zp!1D:EJL32u8PHhU;K:5W?@MW4&MF7C^P^FCZoG[bNgRu@=Y\@ %GBVhZ>b!L:B9(j2]Wj*M1N641=@)Jm:Y2/(q7*.!>MH6,4ukG@TdpcAmiR"<c[EVU\^_]c<qBq5fM:LWt&i\_5__nQVdB)841iO %Po7^&m`I8)dnYK$H^-5KKLULU32bh*AoR;*! ^/2%j@VH<"fA>U#+k`aFhG(EMeU6]Nq]"Dfh':P$F_3)*+X^nq_"^.i[7EtAgm5= %lf]:`c6Rmamn[9'l=OI(Fs"("h7KcfFSR&b#0`/pQOeD4KkQ<ENlG0Kj@Hfqbs,XlGX[s$=hBU%LOD(, +a5;0g&u"=;IsY\>pY<F %XE2SAY]4&iX,sO.NR@*26#20)oUn:(JNsLUliAM>pZ]4Vf2T3QorZ#CXJ@5P6/Qu=! Z<`Xl*&(i@`o4ZNZ6%/Ua)O.(>-4,?JLj% %`:6a*O#$:GETMb+Hr+fD2"L^cs1;$5K"&6LBnorL^MWO-/HuQgFFf`Vlb^Y%7n5#t(gZ;+;ZUG^_)b %51uX*CA_S0r(&URtE_2QE %-dD-&Hkb!Nq:*F4jM[3hOE_4p4s*jh.t#!CIM10?m,<'^+s6ObA%SppL:Bt*J?$GI*N>h#/% +aWoA22244g;m?SF=jN\;4m4UXf; %&.i/1>uDA"m\l8e]-VGIP/+ot2CH<g.#$'I/%?!]`19oQXsd5\kXf>c&d'uINQS^l.YZrjOS<)B1nbU] (`d/gA%CmH,VD"P(4'hS %'Hd0Bmp4+V7m5XirF6_.:$u\P2g,@]Xic`d>6G.q)h&0QZSf/QU_VfepLeIA19E+]21b:BMbp%D[^-i`@/dU'q@_=iIJ'L*0)D# %::P;4@PQZj@fVEnTG_lcO+#Tpd-'Fl'0mGZ12Z%WgaXnGBW)SImXi,@!EnMHmUF_U#D#>] %DJMdoMX[cEt[@HTU$@FIhuUTB\J:L %r$?gQ1?0(?KC%"BGRpNTB!B&[31Y`jX4=QTX`@q;(Y>'J["nSm$(liVB8O(:)3d;NR88F-NYQVJR/.,Er! 2C1@VSu4hsa&$-k+cj %S2Mi6Ui%s>:c><a$(?:+!cl#8Q_]N'TQ%i1)T_V\ %gr:*^n81m,?,Rcg`qRteXh+W_8N;B)J8(GCR&9Xp$K-tc`FJ(AkqcR:63%k %#W`m%9UB/3UjT%8,fl#h\orFaXP7,@5jD'"DA#u,M=+Z+nICFFGbTd+12V_\O,[B-am,]^&$j0bUjup7nXQ]6S8/B,gA3BbNX!/ %!?^PF2&s\2"&T;Ykh^ZOj,&@6H<GW+l2'Lt87>ut9q008V)?'R@I"G"f7S5%=r;*26sG? XTk.SqV5qH_q2e#H*@%1NjF,g15ltbl %]ZAcP-:fe[D"/hJ5@$\[-;0V69BJC?<hn%RHeN/o#NT$2"<]V!eCdO*#1L1ZP,Sft\fHYlCf2]B#SV %HRq0HLFR!@AJFLi?>ARj^ %&"rmO/B!KlUY0!akG44n_N];jP#a>q-.b16mm(S5_g=ISf8X/h%:9gOZ#XA:NL1k6cKSiFl0V7a_9Z! SRo!^<DcllCMS-Bcdg64p %AJ8=259%/-g6%g!5(5ffVo)*T4(TBZ^9RrM4`4eA3;UZobdp&,]XiGM`e;dIo/Q %C5)&FN]N3n*=G=s9fUkp!=cfu?F/CqaAjb@e %M^4l]#L>*i8U]]UUFWU;>>LS%8I_IQN?d^eo;YrkK\+aDVD2?_*[jK_"&0sFe6#L42MDB:."LGma2tP%;b %-nfsEA7ru?2#`X00A %%N>%B?GYr#@4/+OaVWm0ckUip;WNP3UUDbto9=M@2`-*q0n-U&)P? 8c7N/Xd[blJ]jIesaM4E'<F7Q0rq=pX%L^0j4gq3\F"rskJ %.>144Jf+VC-g:tO%GS:P,0&[bS;o"k9;FC^gun3SgU\UVYD976]*JEPT$e`NPMJLS8^H;]i[MuRq? pl/>>eCl1:@?rC"GMX%h)f5*VPf/U6e9u.gN5fjXGH)q7`:*#hAKoZXq`_4c,K<a"oC?1`fbs^rU18MWO,FHgd<(n@PJOjm*-r,omVkWpX!(iN %r<QJ_OtR19-u7H$$HJEoR(,'n[#(j&BCh-25m8i5Qtt]3M`Pr@je#7:LjZ.J//&DOEj@? OEKp[hK8a!'h((hNIL)!>fr*2%8>%pj %Fls/`P8P;bO)$">#L9W,e>f*/Zpk=$$d %TriRhNh=*dqnZp1]D&`CMG_c\k7kR,HeAi6`Q.*u]Z8\EL#4:4##;20>S&[pF)<Df<1 %n\RE^1/cMJBU[h'Q/d]jGTpp64X-#6H_Q6_\&?LQ4;$fBbUuHun1@i11, [rI2^R'GQ7@_I<*(c<YonkCjY]4'4WX9(_+ikVXSbmI %nVjofP*X'T7<"k3gWmY7(dW=B,\\C%^eT/6ClkT7:DORF@WU*,OsOC#ibm)Lmm=_"\^di@e)hq! GZ06oi226/iqZJ37/] %Xf?k;K!uq&P9WCV@!N=9r12cW%[N/4jm8R!N+60]Kqg6<3fcOY<M@h<8!qW=#4dDLT_d[^nT%$=9RJhg62b96hD<J#e#]\`JH_D %="GS`Os_0-5C&s:B?="U_;iM0J(+^(fA5TZ,aP?]UF/SlK,MR"fdAECR2)s6gq:.F %\,d'P[U^aY[`TQHb-F$]"ucI=+jH8*cXLt %66d(u/&m@hB1cW<I#CeD27GS7^() $qdiI7cMe;VJ4,dY@oZGC2f35rtGj2/W2R(f0;Ke.6qV.L3C4;.qc:)KMdFN@F=3Td9\lGK%X4=oFNK,]n$C<!e"lcg95J?eBnj_#%\#<tBq;h*8WKMM%9>fG? &[IEcYEM:FDB3Qs$dM(6_Pml<DDjkh0C2nP`>fAQe7ZioCm=nl %,6U#.(i]b)of=gcadZjTasOYAG=A1l.L>MG7d:rQ2jbru5N'Bi;:HTF8;gj6Q& %ffl[3G0@b:,q2+Iu(neD:"KiE+R3<$)h%(IM' %_<%j34q25?3iG"?46`9BlI,Cg5ShOq#!)V1gi+,e8X7qd1L[X]? (Qk.8/q4P,f"V=,kj;EI5:bH7QqlG*_2G>ek4q_$V/.L2G%6o %7)\FN>gb7ErK#K_!(&YrM=T%+pp$'_A\.]NY)m6pc6[d'!okEAkJTdF,)tUU,6p4FR,KmqdA!4mT1uJ[Yf>M0Ii*-](/6&e5>8U %fZ.Kg7o6Rf?4UCB-['d%G&?Fn%l@^@;G`QDp!nf0qddZ+B2Sl_hOgGR$*U1CG`lFk %fJ7A2pjLaI-.7Q1qplPJW%k>7mXiTdL&QV %C.SmiW='B9-e_/'pBVj>L9WX&>G#3EnO;Dq7d0&"hJ@J40$-j"T?8/T6plOF0_PN&B_K@(b7$o/r&<Gh*p$HF$-C5^?.$$\(dS' %:2[TekLsm!Zu]XU! C^#[4NRH/,ZVKY4,u6l]c\lp6.5$uR748:-]SRE>Kd*<mEWSZ]:JB6cLXGIa,Vc[`j9aHlLu#_7iK6n\I[2 6 %L'_NF].eYg3uXGPgB?$GS:Nc'(Iskf=CcZ:aVgR1B_*FLgsKWXYhVY?V1e])rI'k(C) [7EB>2h)Ie_k+LBnVNG=RoMH[6MZNA\3j %IlZVNFtac0Tnuf_KdTA4ZX6LsL_[SPN1DPLncXJE2P[KC=1p#8mbCpeFbPep9oR(uUQ/*7'p45kZoJ4#0S @h[rb.FeQ!bhd94E[^ %Ep;"`_:Lbd3cK:@d6ASZ#&Q[CV^p)aBK1b6DWbYC:64!['tTqs'>,2NN\,*H%-ARjj,[_`QU\oQZR4R<0abqGa%N*Ot1i@]nS%6 %?HeY7)ZgOA6GN+B`u!"i792;b7Y#RU,%rm&,;\.m%[LQLc-/nWm(n<^! E`*=7A/Qrf9'sYT>tuIWqQd+2ZpPA&$Ae^Aa*57k^0Ua %p(DFue#cY;#A3-WiU";s#6B[Q`X33+Bm#?Va!;S-K98$^&Y0($I*Vdd^Hu!=Zbs\ba0NP/mk@r.]VR? 6JFgW'U#-rp#YClKD_!)e %,oML.9W-+dplq>)rN?io^h; $3'a=BJ]ga6.GNVOf1,%4Z1mhWI9@0[h'@E,dU>^so=SSW$YPmc-)Y\oX`-"9Y5N&8qH#1$)m+GLb %Fb'maMZ$^*\fR%<;f*2%YSi"4JBisu5QX5e%N8+[95c@4Q#d+0RiE,bY(3dL/L;R@;,=]qfpafkJ4i,n0Xrp&M5ljmV@P%g&u+R %rdDmr?Z\n53?m\7H)RbTC58%;+7bh[">ub?FFb<O<Gm#2#96S`! Bd>X,G3+<4TLcq_F7nratacJINGVBJ(I:`_2i<M;mS/ReB,*^ %a<TJ6ne5*_3kk><njGWk7E-MGQ(;]26q4!$6"]Ac-TRpRXD[2<X7;!7^,jg#2gNM?)R,EqR! i"7S]fRn\qVt45`5$'VIRWKYhJ-C %9tnt+gjm`0LY"PmW[Um\lte1>-*,:bT$r,R_k$ou2.=ZdH00Dp5o3W:NekU/B %r*L3t3&XfR]U1n6DV$"@^gmpGV#c-^'dOAZ?2* %OiREm\;ocr-!]cT]4GYnk7iW$n2V`g[EWBP"C*+(+C<^B5ae@!*g+`Ih7=^Fo.mXqYd:aS(TnDc'ar4WuB8W-\^Ci,<'XMTRt0\ %-nM(l'\R9D2!-ql5I^@J$?AOcl)O3@cgN!F;6d&"8f3?(3#=! 7UNqukis[59A>41%M/)WC1UHJ`qpipJ)hk,q#KJ3B!m)V0'IshS %2]!u(PcYT-ggN^p_+RE7Uk=_aoYN*J2&g`U/uJbt78M[S!"1Ha.h'(`L(nL7nUq=C-bNPMONLj;Rp? 2ndKXP91gP,;6fLTO2U0,%l5Y\/j&M*a$:p<ZUDl#hjbZUn/pMRjcQhfES_mO.^bB#NJos-+OFtj\K;2-_TBUBk#`]F"gs86'0(97\3#iT.#q1NRelnOf'`6X %,S\L-:J<1[6(7[BJGQIurj%K\$PpZLg+%0>o4AqXX7J0nq\K4"C%4%*]##dI\gYi^=F&]Sjs:? U#H,7RGgO`Q'FkV3WSr'C1;8?i %6(Z/o(F/oeh6)L(.j>^B(;"`aG`muAcDjR-G#1%6?7"'eWCUH-`(\,?!GYDFAVW5"9LD_'n3r2F? B#U(aj<SV#?O:bg4(jq9taW9 %&MT(`^;QEONdffE^fuM$LZZIl7j;^Nm*&r[6r<l'T6>T/,/>-9@>&1dh@fJR.#se@j-Nh9G6$GpgqIN1e5RLG(Wb\1XY5rFeGX[ %OlrTZ-O61EP<*L:b]BnD=>Gm3"t'#Z\+LHM9:jL:&O=b5MgU"qX#D+o8[rem-EuTK!F*#c;H;RCR-)%M\? 2PI9]`(=imBa\F[It2 %Dg]au7fb13po#QUX3i"Tf\>$!=]a^G3'+F]P*./Z_QB78pqIJ`Dg7J(a2[J:eEb9=YpqV"0:*k>nr!"3@IP]N?4DifM()0Q3S(u %3(Zb&=n9&5j:kkV<_H-^<%VD&A<5$?HsE)A]fV3:d\@RE!N=![3K:2K6">X?K5956/! L0LV"sj)4GMgSM"@u%Y[X2A?Sb<8^["bp %h@W;s1Q1[Z\ID,&K-E+!8Q'):Fm@Wsf-".d%boJJR%ji#h<WIf>Y1B*$\h#RVhl0RCn4E/K9^? L,4@#'(LcsA.\_4`e]\r#E6a$6 %[5I=:WYtP;Oo+kD8OAN3I2&;h4AjP@o"37+oBO^HOIM0WZ($!U9!W`;cStr"KuBKMi[eheb#iM[G? Aq$F`$nsq4P%/]'3Te"A,)7 %9LJJ3QBf^>\+-#S5FbpncVKe)49X:<Bu? q:^mU_1UfU(l:^53lrk,8*h1]1<)p=M7;>+eG/r`$H6IpN-\,W0YOTQLVn(_aUXGqSn %bf0XMkT1176i7)`dh?-Yp,.k]\-@=)R;`IkV:T`?;&Gp,$o<<3D3JVQC1>9qQ, [+tBoNDdJ23n"`sVY[7+/]h[NYZ*qc2u8S/`sL %?ELNY9Q$fJ5,bAYI@n8Dl.3:k3i__N5Ue&eg#Xte@9`'35U))1Z^Bjj3E0`Sk!Mr1,4H*OWgkS^s1H[SKTCX&Dfa=(m^r<\AW*! %V')tRH5MhKVB0<cSIk/OnGWH!j[ecrjIH]=nh386I)LB<8&eW1! CYpN5=[YH\ipBlo+'K$5p^+d.>)`13sDY>>[>tgfq#>\QWR]J %$Pb\4+TM2WhSstter[]C\3h*95u43=(cUcm)C$O#nj+CM[k@#>bfX1Tf2"r;D-:@u %Ht"+pncaW5m5aDbeci(pnb#aS^q#h-FiSf %nONL1\'Lr)Z^_7rs/@W"J?#,QGg(:P,QmRh8#L;oJR1*A;I[+>@GZ#o8UWFKcEn3_A3-$! nK'/CdBcn7N[Q#=hEPf,1:c&`G*Ild %^HKm/R4\C``tBHNJfIWANE4&0A!8\F)Z)Eo<Z<MNS(+S5X!lZs]QN50_A\rg^;c-J?mYnVA6*6Y\%)sB0g4d)R_gt?pe5#I"4-X %i(2IHS!p";$)d8;6F\N5"-]`2??(F=@YEK+2u(Ju-WMgIVA3b\%XghTL@<fZW``:aB[K0<2q^]5%tm9`,7)_EUhC"'m0b$1pai5 %m7-QRa<*PX?_hiS[pVq9<T&qj!O3.%S==YnGt%=IFa,ak*JH^EEOno)I/&or? XYc0E^qIX*P^5K<>ZhR*.7E-PKDNJ>%OP!EKtdC %Np(Y\SGg3'Sg*_q45^OCj>^5^)?-QnBkaD08.oKc4c>iOf)-)A5H;%G? _bDY,b.&F1t::SrhT#\0eR9PNsSH8ZciS^8N3Ml"\KH# %F?]6TN$@"3Joq776,655%VIYn)*rt9qJP*I(7cPqS_A^/ajd*0kplCSJdLRS546kc7:G38B+&TF7CHgnLX6#d5c8TP]FKd &Uf!8 %g1*u7\u9Z%40sK;2f&S+;jJUY*=h\jMCWIK2L!!9``.XP2Xg$%(s`:Yp%E! Oiu1L3.PDX@cql6m1Y$W#92<Sk&a.%l8Lp4<M(jaM %.umhG$"BMN;<P09KfiXkSi&=`+:;o\-OW,kccCpu6GT!`UCgsL$ek+/N//o<!gj"$e4.! =;/)RA[@,*e__^*SF[RJJGR'=2\Hj$1 %i!ta]Y[c(_:K@^j;;.Ln!KppY8@sm<_M;tD5c*%r(4mccW$Zm.jf8LiL:kp:$)f&5PcE0gG3&N? 4Gr7n^?!Cr;Q$JRdD!e<^dY4p %<(2^I!n_dU4HiU$`K#?M*6lg1h09G@f7m8MrK=;pF2$LgAN"="1B[GKeo&AD:! 1hC[BA_l"d[d,kdm3MZEg,BWBO`#WQ4_9=$PB' %RPQRXP2&n]#pYI3-O.YJ-(at+[21fYWTgf#iOfdN.\`a^FuSGDbQ>3ZSN8q;\"r6Lc]k@^@Nnr(WG$^q]m-&]P1g/_L15pKh=A# %=seWRQp"(Nd^sMd`@lZ;!YY:XK24%_%! RpuF=IWK:e$L3jcMmNPSk!"ZHBf*#^9WPOr>U'^^*>dCaBEQ#Lqn3%J+l:H.BUG(NH%o %N+7I;_VYm7&g*p1E2TS7%sPrWSF6)H %Xdii',r9fDmdd=#aA(O>SS#qJfA`"YORfW0fnarb4@W(Y_'E,J0MX#)_[InP%4ir:P<W< %X([9"S)ij:5k_b9$?4_7&L3eDHJ:dD^h[,Aj]a*mpEh>N<1k#^'MsVrOoA$Kph:"f8.IV]k;X`On9W\.@P6!C/q+/g<^*,.i37h %=(m1li#K/.CRKUZV)5<40'sQC1A`2<$nKM,j4B#D0$I_:)\Zk":03J;/OI*IN?5d:_Et3Z! Aj;_G&Ki_IHuTbqkD8c"JXA5W/mRM %TB.NDoc-&9.[C9Y+3=V1:V'q+J_CXp^;`?gh]ZZY,[M.? H+u"u?/N2Xj,"s2ni='\mfBd8ZCL=e]Q3_6p4^X!)ThaU&EA`M!JW=Q %U+P("3nlK9cu#0ke&F#UemVfPK2^8N+#++MS/I?Adjm,6.7T_'J-'C0P%:)>*@L) $3&ak/DG]or4\T6_M[bEVAm`h/!)r<1Lra;/ %.Kn5OeeL6rR.m"1Z?nj2f-Q%20jd6t?OB"5eP`A-QYVgCcbtiC;6(+W?^;o'6Irtd\jQt'd=09[2M% %nq/.l$a+p^o,$'E\C\\<r %r/bp)VUaH@@DZ$_rr.)\mikD6\>)U)SXg<Ja]:t70"NJ82BT?K$Kr%f'9g4_>O-74_X*IkEJC! nkcrr_Km^<!Xh^Ca]C%1#-L>hN %K4XLl26Q:X=WJ?5\-4",XLDP9aY2;S4_@(C8f0&N./C[o3<bUBh?pIJ9g@:%J,iL]E*ZCm4(*kF<1W</6/ eS/.Jc0G]^TLs!15ml %%qAUXhj6NcmAaA\ZL2<-dfrsU$[3^ub<*0W=0r$ +jFd9Id.EYTaoR$3Ur8ZdbCI/afQ=>V_f`Qs8ZY1t$TPoSX*i]?k^'PmD_lbH %F#MbI"OIAD5$oT,AMj$;.XdVRGm(K'8u^2jMZZase]sMdi,BCC<0aGbeC3UsI/:a?hFp.8&.p0qI:5M=PmQB5[J'2XhEnsB8$^s %B3]R1o^GN&kSOhY463Q\0ar,+:cJ_RoV/2Z"RW(g7aqc[4*_s/Kn;oD[aWqL!DsmV6Lq&tN$Va7BjO?? 4:%hi)Xp!$3-,c5.JO)& %e?.h`JkXKR:bI.I?,#%ECK1R1@no-'T2`NE!,HYO+#qQ_SjjC*GhK1MX`[nl=<sWg3A2k&,#K6;eONOF*UT\/'Lan,_;VL)p]L/ %S#^O;13PeB6]Vb0PkMUi%K*;`K6iFJF_&cS4\sH0%tm<_QUYkfIc/5? rd@COH7iL&RIa"(]aEh+;2,sD+EkW`LN-Z!qc`_WQP\C2 %E!8.P[1@uZZU[#^.,[Kg<)cO=<aI2RrP! [9oeXjc3O)]IJ9V1Hl=E&]SZNl+@5lK+8K5">E$M9ji0+BTog#=`,Rt-M6+D&g$1D?? %"c;T7_<Z*9rnTQtE"795ZGsm?e-cU;Y)Ieb[mCZS3V+'I*]PSo+YsAPPlZrc&c:93'g"nHiU0]R?(j4<*H21Y6.h0&W9%qcA_-E %*g.%B"ehooc"^%1S0j)NpK.-:"818Mm@2MQl@RC.hIp`*&j7G?_@,/dqqUgT24YL$fhI9!22U]>P2c=d81BQfcmAtg;pX9^1aL" %^7]mU"&(:BY`M<(5`ij=l2>r#I\"pg7PDLr?da1p:g2Hk%'/6Rd]YBR(oQ()pFU@^T<0?[_j6JqF^0%f7Dt/*]/_m8Rp]?S0sh@ %R,FP:Jjb\W.h6@`7i`kj)Sgh9iFfl\UY_f[Qp*^Q3<[f"e!#`)Dmq5<.L#84VJr$CE&n+pN[UR!DTB,? pI+)(3Fr!;WuOVDm'4O@ %q5)qXB*lD-\"daF;P&\X_gUiJ@#W:+ (&4%XL$uHm##r7%dsrn&i/t>BX.fXs`NC(;LYhVG6ud5#Km&64(*Iq'Vu`,-Z+;Ea80--^ %$P:q\E&h`fB2e+AI;tI+>pIJ!XNR$7T&H<_DriupjWk`>;=[d*o/o#fS11CpH>JElH:9mm:m#\L*/GHn! Wb=:hr"0dicB=p[OXsm %k&8>WjrM!.gcOFTZhA].bR]Qg6d9SRLtTXi\<<EC/+Lc'?>T![#E^mb5l&XHSD$;YaJ1b&":DG=Wn+[hS! $j^F)kR1=-]1-f3tb* %K:P%ML/j*R<Z,8&*pY*I'1IldU"D-(_#"?hUU-X@W4^/Ek5poc2Pese?i_;%6*Z0@R? Il[28P:tb)t4*FdP9qbEta;$s89E8Cg_E %Gf5LWp8/A4LhR^tVCM`qac*3+Y`,70FMCCTjc$Z$N(YXGXIuX#FH/"hr3fH.ObFXO7i./'oc([:HHDM %X,mCSlT5u<BDWbpU(BQS %#=p8ig&8_g$IAE16p:X4n-=as`01'1l%FOBiImj%-km2t'Fu8br8j"=A5GlA,Wn<D? [qS2r6(`/LEAVDn,Bf:2(V7G\D3TpdXP;4 %l.,eis83I84oM;/oA:X>T"aihJrf%IrnI&]plGB!H#rZLro5MWr>1OAqrpoDY41gcps#%aq! 0::^gqlW9,us1C!4[D50Y1J"<^$Q %aX[^+g><Y?>W7fjq6V_o<1%.pR([T,9f<7jc.M6REu3(q*>RZqY9)s9,d5%;m0i,%bd:A3E"#PH"L]^. [:Xf]q=3m1,Z)`"mV66, %8]7T5K-m(//`++u]Vf2h&:ZICHbYHqo`gf5n&*h=IpL.^]*Jq:VZf)2o#1U0C6U&><KWn:/V,'HiHe:9[_fh&gM(XGl(c<&&aj] %lE?X7[l,C9o+[B#046#n(nEidl"HegckoPsZ8sqUBWko74^kOLHlp;mo1;)eEd2l5UGP"7n'4H'oA(mDf/ d-'pkT@-pKco/p"SA* %#ktNOnZ-S7ro0EnO+2OK$J-!7F6ND1HHS';L`o+!C4D%UMk.gtJ@,I`S"[SOlQtOPgZD^M %HIE,0d#P5:LeGM+![B=ZOp9kmm$/" %LooW!.XSidehHq8DL:N$>mKoU071;:hm"!GLHk[Z?iTi;:[GoGq"1'%s5c2Sqt2U,r/2RI+ $T_eQf#H&hgB+1@t_a7nKOuGF!r-% %+[b"jCJU@S`4re\R>OFfXb=67FYnB)NIRPmkMuR5XH+u^Zs5LqZG*Slir7Su73? ucGolKd)Z'$&^UD4uc0(.j2]iJPb@fQ[TBlB8 %Q?U)VVu!6^DW\F/oOV6RZgcUImG0SP<pmaZhQi,"cQ.L!o[0@n:>+>;rqsss^?YTb^Fi[HHole(q8/,? fuDp@T)[SCBte:Y>hM;k %[t&&o]p9Nt(rgV>?M*T!mC34,lK8\eON'!7r3ffX(cR<\b*F,nCN9",U]:4\I00#DhO')+ $Hn3;>:eBUIJ_E3D9<lIld<\ICahjc %2UZhnHH[/[+4fK'<H$X)hiqX-! EFP'qY4EDF+G2^^tT7@rRDLORB:ucp:@63gUN3R5l&i`b87<b^3g#O2s[$.-fZmos#]81,rk#g %#*(:6JupPlF%-rd5Cl:/Tm:qPq6T`tmh>)9nJTD1o6[s&XnAl>lHeVm\ %QtnZKo(3`(Y2&aW*Te/B*M,\E6C48>&Uhme>C=Z91R+ %UdPM'+TS6-8M&F]irWo!+)jG8;'5UQS>o]:d"tDuP-%5b>@Ydt7!:+/2+^MO-WU!6a %YVSq4.Amnr\;nWo@QZ]q0SCHZ(jSd<Ld] %P9A9=m'G$lCHpD(l`%jB3B]?V^h?_gp0oo?rq*jNc#AV*fG^l"bCP>NRp$&[k`PV18umf+MLjPtM? pg.`#:@+IZX2<D3oHFVE6H? %j*<YdSMAsdL4'6q3!r.@6][6`U=PJP%MN_41t>$F:>[WADsi.h4^@lN57de/ %K5Y@rR[u*cCc[18H:3cJH;(hl361^GcZ)(5X6Mm %#B//''<(gR)]oNIlqgqt%-3ng>Lkd4!L-kXa1sr*^"WqM[Dm*(A. (f8SMF5d[&,k(5a7(`"u!)p:BtD\dMNh"LU6S85hI,,!g@+%!SR_Q9^GpmUE2Oscq.B*8S=AV#F(U7'^($0cX>T'H*/ma_=hrcU,\*XJ.,O_&q<G^nEq)uU)#KiF"gY3`? e6pOt$Ld;C\g?:PGSc %Tl]qe*9%MLkqs3Idu6kNjOJ"\5WQ2NY:OXj\^rm8;2<-qbiiN%(4(Kr]\$u?\0BW+`8HlU#`SgcKa]Cq8RD#E8DJ7r#hZ+[rX#5 %!n9QdL4L4p\dp5$%TkrE5HpY(me]i74,EC&<Q-/Y>&? OTC87nJgc27aT5-;1)phJ`hl[41Z=;\nXZGD&dETLH8%.GE^b$RDT^$_L %%]R!3I)Zl!/",Dp7ZEDWa[ed?)Jd.Dl[g%&0J,;okpgNe0i7MX]X3G\E'@_9WSf! B:PS3S$Ieb*P,<\2T7.jb":e0O>*mCt\?pR4 %!Z-[NQ"%Wr-:/7ud;/lkPuJ;D;b=D%e3h>12GP50J_b?_:^>3THr0OUE6J\u[5"SG20@Fe")X[OUk:TtV6<->gFDIOi4"aJW)sl %:sMqma@m1OjI))Md#qD<l_"E&QSNFeG8,5im!o0Q]q+Tmi_$^S=TYEkk+(CV\qbRhWplt"fXS1Seo! &#PP:WleEP-bBt5iIC:QM1 %.^2]EguPjVVo@bV$PD;n2'.t>Q!7'7O*Ui>GiIp*\b":X3e/TUQP]=7]jc@8*a/Grl0;H6PT(UaTq>u6MP9'#`:1]!@=W["4\Ad %.9o\lCT6YL#g+,G3bXt=&nk('ijY2AJZoPIYQZd/Xkb;[@^`JECf4lC_3ic!"b).kiZgG^)Di+015.R? WJItb6P&=*.#)eap7Ejs %?)!-2"U5=omAiL,$5:R<4oiNcM5]+dA4:o>S,i@g;-0V[rXblq_-i3"J=ba7\;(:?J0k9)!1aUUKG@n.m40.<@&m.Y]u"!@kn=/ %FcHl5U+$FKkX^kZ02l;?K&mUI_(^h! h[bsG&W[TpnGMUn3,f$2RN9W@8R0`/go/"u^p89=SSOao'Zq70]9Fjp%oH65G'(ZK+?kie %%[P&aZnQ""2@e`9"5X#?#`+AV3$a6\MOo[S9`=:=N$cLRaD)ni4@)CD]>d! qr=+)2Ge>tL]FPRgV*.5Hc8IL;JpA[s*kWZIG3,*# %A,+Kl97]hOBu!$PL!?'A"e(^&o$Vg"h?'H,N8_t60#E"._PLp8rh7:aki&m%&2OKgSZ]f"<7JDad#hP %C<#Lg"Lo.KQ'6=>5m($& %Zf=tcq`P)/pEBHBH7;h(Y5=Zagp?#^$mf1\'N>*#MEhGtMiqJq;rT@TJOulT_C5K)YCfV$"/_o+MUASBC'U&)NL\7e6$;kr25/R %$UEaCl[\9,i2Ab+hfte>8u(K.0W/U"-DOM!0m&#@Mb`i-'Q2Df*69cPp0Hk'(c/_)p;^Gb*!c:-XP-% %KZQj]W-jK!gE+))0uR(' %QKlQ:,qp)B_&JTRHodJD:?cBFaUBABU'"aPoPb%hJirod+ +Sn^#r-"gOeS'#5-)K*F&_KEV]qB/8$KO1'nli.?^D8D2<J53]:n3K %n!;,WOF2]rkn#g"X_l*f(Bbo7k0Dl%3AY=Ro41%6<NbAE92mZoS`#?_946IWY2fl#-G/ ('g(>L<ToN9lbc3a,,4D*`(j_J3b*BMF %q"d+C':>q\)U]BC3]Pr^UuH:teE&@!Za.q3np9(NXAE? j*X:lGUKd)XLU2<+K4R(jpo`[H$f(t@FVo4[F^&t$)TpYp-Sola'9^bK %o4ZacB\&Z]!ARMb>H*Xhasqd,YoY<XRHpLJUP%V'gsAYDQT4i/GY5@59$>bqF/2BlI1K(o2C6D?M9rU9? 9(&)l.N&F:=nk=kXatW %8[[TM-.'CG>1\DP]<lD+A1uM9_mr=l1'QQtX?(G(6<RP&!H/>dX>cYF8iI>h"@gE;a:l[;8lVs %>rXd[dd,N5>91:!hTEh/`b^!B %DS!A?gYQ2t%)P1N(d/=2MC)Fe)=P`9ka,/,s/Ga(Y-bR0%,Ko^.T>ZU?D)76JVA+fPAT@2d:T))kOH^mnA:i<M!u5,[9OXI"]U& %kpc>k+!%N/p#'F@cBBp!/l!qX5n;l]jBgZ0Ik\7@*PgJN$I[%1#W8J#OPa.(D%sO[1h^Z-XJ\J\?'c! Ihj5DV6.(Q>X]MOZ/BJ"* %htcYoC#;gDe@Jm)5PD=b=4<SljZe%UM0%jG[X32/]6aG(esY4AXmJ,3ccMNq1UkUV":F42MXQnRo(_V`T_2^&"FsR#,..fS1.CF %h:!49bWK'Z6;ojj1&.M^%fT$Nn?e3;+JGK7kQ?We%MZM+qLs$l;+%9N<+)BkdBN&-\+ +S]02U]e\\2joYrA0,-a)%,Bmsg_nb.!k %pE8j`Y48dIn)GW5=NgF8EH_5!p\JlQqJl9*rOL,+*%,,d`V7pP`#;(u_'84m'eUXR@(KmR2@"Ic]CIg %`;FA(J-I&um7?Iu-?,de %P3RbG@04q9@#Qb6`h4lH>IF1Y!IG59E5T-Wg5g$3#-/_/`FOVFb(d&"4l)Wm/B8/l)pKo[.CZ,t9J! 81PrqAXR$:WP+dh4b1k:Ls %BWjZ0$*@2A'W;@GY"$eWU[!s,9P_*XE.gR`Dtn(,#'\7i9/n7"u;dW3HA65Moi$? I&NnA)ers$E38K*!0i.KMT %BW^#'1pK?a6%J5LAuPE>CQ.OU<MaZD*H6[!#O`4Ah0).iUr+2>./WE4ENVIlK(s.k %dORD+e`/XV56/,UJo@F%1>GF3+TVD"iH+] %b=$[\\WE)E%0HVhiR4C3h\q-MfZ6tQ:)e#&5Qc5O[Q_<3/WsL82H.spQ,"iL-Q?nE\dIdEKVV6^iUT;3H7r.oRIh^D-unC_81@7 %2=UtHR\CR(C`!FS<Lo@gV/ $L2PZVG.n$W=YE9Q6iiRVibf`DcJkQ]3=]_m1R2V+IN5Ao&B).490)RTjKX!-"fVk![4QYf":8#/"% %PTB7n&)qI?(FpE_O@BtD0Hg`P(L,pO=`dOYFkZpe3:u]pE9jqOg*.R"8bOtbXr"B@8As7&;&j[?;a+a=,?1XVbnJUH#gae/s0@G %#6YO4:'1rc7E^ZMTMVfuZF4C? ohQD1:b@QbC]UXm(f`tlYJ#+p&IL\6iS1s27^bjA3Q_Ma#7PQXFHfED'Oo1?5qg$18jG9o8JGEf %4Adhs*ep\7[A5^bdt1T%:N5@S%GVL+i2WaJ*@^8Xj'ms,A%-?&@#mVZn'GqG2laO_AqMgbna:*.jMoN6mi]*1b+[<UX^=@_-*K< %Kb^C],e!eOgX']Y2`TEH*HdhUc(j$4&0THI;)YgZ@n:bTN>m)r!Co++G_^8([N! pE*Th$*@^$)df@/#KehZ5.TsWiPn,auOa@R7X %I<0Fu"rt.-go@SjJNFJR7bsqml8OcC&0R%hG&BXp(fRNG0^c@ONc8\$%cPuU2mc"7XH):akB-q)BF'X% +#p]Pi:sm7@qu;:9>/+] %O0:E:gsPn#5CTtXI'"L*$<Z[;? OK'WU`nuTqS:M#,@ebe@(dU5kXJ*b7MuY@r_UAT2eYb^6kXK:V@;=APg9p8ZM,>X!!6"3"$J!M %4XUG-.T%7B<c'UDeIYM_X:&LU!m4MYZ$)S%*K>o0GR+o_g#\`S3Lq&'3D3lcRkNS! _"FH_h$rH2^f>=&mgjK7OjbnLB[4^'<bbA> %lIlOm>JgW+K_mZlYnWUl$B>Z$@p#P/>]>dr#BKej3%'C\UJ[*[G! b>UUe3M3l>gMDV,Url@Le9NS.dn('5F1R*''8b>b3t=5@b!< %e<]17lcK$'RdDVFn7'Bs([X2%\YQ<Ln1$^YhZEJe(72k;Dg%ih[:e$OC!! C`9FFU\o7JCX/X.dYS/f/'YF7g/GODi$;l&-ic\jJ< %jN(Jjp!sB6,]L1i.?Fla?0OW@UC\kWq7(.e;S,4(G$%G77%q9DUetB:*/CXr-PP+n7;% %i:]@(FQF+njdLjop@J+jiSO3^hF!@h[ %-,iEsPNbtZME(93:Y%"7ShGeMTt;N6=@C5$%8SVR+j!o-9'SgX.*P0(Wl=$Zl3P:7ZR"lDAoIeVIr!0Z_\ GA^1Q%+KABF7,mS^?F %Z9%j?`@jcI&QD`$'=d*!'i:BWmuA61M]g<mN"L\.`f/#ueE[L#DJ(Hk-j'M5[E(4aE"`iPPl,1Zc&QBTk/.gXJp/>hFH6&pF./B %gom!6""`#cZHA%. $W&6C'F.`oL\A)E>'4e+6qOh0bV$S*4tE\NQu-,jGpgQ^5ZW_T+XmChp.pq3+joI5JTHrh/4Dk7JZb@C(@f1 %!ZGO)W4me$,$upn36,UP,)-U7FPmcq^g=6S'PWshiuA-2W^OZ3o#*$e7Z-Cj_7FpA/_),! 77HVVk`K3Op:T1;$WbkEp12iJdWBLY %-<b_%Ue3g]iV\@m=1=aAX.DpMT9C9^=Z+%:c7,,7NtuGZ'@iIs?:?g<3bjg"XPG(X'tej_`pbj1;R9o0m$IA"@F?)SEH6"MSp!Y %T^[P$N9B84nPk_W\2N5M#LY-0StD?%YhU/5bokOBL+J3L/ZB[gg'q. [K253/mcXe>gbVN311I:m/X_KH3o-bA:/72-#aK73=:\<M %:uO]:R"MpKU,9<COW$5`;GLZ2`&>UF$lUK"MeA.;0BS9U-]/-[=@H:Ne$M:aU(:Gg,tYWON8Vo3:r)B%Mq %T.'V:o:],F4K1^Aje %?"8KPXQ<Ls`=rp>>=mj-)3$bT@-SUGK2f!dTqQ6/fnF-I_? hkM.@)c(Tl7fpS>s(W'KJ;b'(mUeC'RWF'%mJ(#`LKlXtU9\!sA)8 %E8hI'fM9F#?o!@6$"=eRctGg!L1>Oa99q9201h-TVa)etgjjpWQiehPUs-"#MVkZ+Ms+; [c4]t62\G7I5q]m9)@F'+Uh(KcR+^Qq %P>Vnl'TXLP6W='Kr@[BbS:0iT!q6b(;s_%7)+G0,G-I7c8cYZ?_N;>WC4TSsojfW %L^_'l(0ojnCi'Fpakba''b$LUo=-4\Ot(f1 %;F!f`7+;4?QRM+E!?R2)GWAJE\dm2O%_(7ljQ(HjjYBha;`A2%Gee)KM4!57jVn>(0#b0SMYEj %6$^,>S<MSb,n2!4m$?k=l%_Q= %CGW#?](GlmD!#sdcDmk!5J&`up=l9tE7AqIUu'K3l7h&`MGDf4.BSoQLh/EUXnpB._eQ(H@b[O7.hcDW"Q%L67Hk\71^pV$pB7f %'efha6%fB,(^>)';Vu4=Oat! Gq;fQ2Fr$F``>&7%>iF/*e^Q&_*_AGO/)`d6eu3pL$Z&32+UiHXpD;I3JB<Q4@h.M@:?0KJVianp %DR#XTQ?]k5PqFI@BhKo<i5hpXhibiV(b]!YgaLdG(#BKMiY9l,CLc]*6<\Z$^t9jLM9tlO*@QYYkVR %,/2>AES@'mQHe<[e)I!r2 %+>T4#WW*3k"TU<Q/l]B7S<@A`adRi>iD()_O>RDgOHWQlRk.6a:6*<q"1&2u3h;d3M[! 1RK,hr8K6ps^)MrB$6]H\OhN=c7+fbAu %,qKJWYiSI)j!/CLgY4Cs\5'6;-9J=2M7)Lq\AL7JqB3V0Qpl1[P8#94VOF91A"#6Z?"MGb'2YJOtM$e#Y(u&NTWXX'S6Ee<X"nb %880Mg#"^<'2"VWp-_GZ]9j.W63@BuF+@UqGjoK*#6K?(#bU&j,/9CX*->gunX8[<f\DnT %Wc#XBbu/Ep/R!6mOkNZZ:b=4=5ErN7 %2E*_>J@be&iNYSp@e[rjgEFnJ?@b$ %`]P5o0We_Wk<3F'j)>"&ki_"gTIQWUQdBQ.9.TDo[=CgRN6#G^k`)B!<KY#g>*k=]Hu:>d %:m\HFgDY8\9.d#hJIH&i=?c]Q^VP)j@LU/\J^c@m9b>9;AHJb=Rk4YH;^Eq*$Do_bN"/ %Y$FqAL@6SrUjkuGI''Ur_\e9`.,R*Go %V7=V2mj2cg:*"8@Lj47a"37o#]O%$]plIC=`bL)Z3\?f"jC&mLi4-MsW3(lsUL"ZpLIW+Wi&P+CoiS3d+VAs-6C:UC3Xji89Jjr %8^EQM%$F*pWD?E>iO*3l>XnmVE,4rlSiPGK]HZK>cg$,*nPQu\0@##`Dej4$? dNRo8mo)O'.eOil_ZYAruOX[Z[MpRqe[aK]j?YP %Xobgq^90oMa9sqNX?6nV'IMAdgp><oU#=MNjB6AqR'4J]4B$9+"Cf4T2;&IB,QQ7%@G?? cGMJhqFH;\":a$=;/lbd#.kuhC95P/8 %<ffI^kaXiH$m]I`;YL[(_@'Fg:+LlhL%JS$2,HUMF*9k@/Xnh8;6jgX8odcR[Y[-P\U7IN<: (Y/.guqjPnC6H"1BG2XS=Yrq1&HS %]&UWg1NMhM.]k7[Td8>:pCOk2H\l"C'&Y#HfYFB6"A\'):N]^\iEF@WmP)sH_P5QWF/nPLAAVF`h@l*k$m _uG5&aA%\j!I(#@-LQ %56/c?>tTKW`17Pn];NbkcP\/VWP,fCXt@k(0ro&I$rY+mKU.9OABpbo7HL5!TOg!0BIa*9L6<;8E0D<opo2(*T[PE;J$Yd=(;Ch %S.(_T%HERH?`Pr7j*\c$#n\SP#eAHM/q7e78a:8``r.+C3c?qa'QsY9eWb2#89'>TZ<9X<`!_P3]kBG? Y'^l'<3`I3#gWgj>87TF %3aj<oWUkddRNS]G.k"[6'L'#ak;)A+.=nOBU<73s_bnOX4cglu15VM)"h\,OW^!?E\>s#Zk< %6XeKN:3^kB$lBdmb9X[4K_"qFnt %]W6Db#9`_U%F$PU$k%+YIum:m'&$E<Sr-Z-.R^? p$l\7@AM);lOAHaq<1pXPga&6AfTC7I\Ng>1#q.>E[T3u=%Mp4qOGUGgba,>l %aen3U?$Ws!]#YZREaEOR7J^'QF1bu(6tE=+[(8q-.MhiU1SiMJkp.#qn)FhqIB1RXq? haWbN`Ic)7V2+BFd1aH='tf2N^c6XGEYS %(#,sl,nIFl<uD9W\YL."R7sm<Qhp,rLj_lT.T-S;b_$M`1J? aCfO_o#*I+e>,UpU7E<uo]B<:#&nX^7VgB(&';4Q`gZ0K(/R@,ia %;pi")U*1@[rQ$4nLTobtH^Nh=i/f382Wq0aTST5MIDVY@jTZJ1KZ(V/!;>06b']o;Vt-'&>M8'bg&e4eiac4_uiAj%Ki%QHoW%V %'t4pW>7KV1R;29)ju\b@=GIa"+\;DH2G\p#O6"(CC0\[!.? _;pF8?]f@\fe/gNkP<C2n(&$WbFj"3$.fk(Qr+iM>ZCA>9s<A(D81 %To47&[@<udngqTYODV[mE6:b4<ibQiNCc_F>._k<`2<i61/`-\X<qV=j5@GM<\mS(YrNVuLLsU#'F$]A_& D\hGCLH<d.4q<m01dB %OJ-'M"9W\k3n0>%lsnQlZq[K36)]j5H_AMnCpgIU!3uE7edOANW+(rG8qS%/ (eD@*L&GX9L&jOo;F5A[U`O\cF*%PfAVOAf_jN>8 %)u+-u8@%e,*>=lnYD?sik5%6^o*::G%[*:r$8.0UW&Y/"/Ab'^RoYWhlkVs#B8_q3.! MF8lnO/0ij5@>O$Ou0"1`be``Z%:3iGh= %eC>B;)\RQ/?073Z]ihu533O#I<\(^;K&gk5(ePLH>q=D4f'[?R+P-l!*ZF7?I$&r:i5LIicj1U9M;cip5[.1Y;fQ!0paFrE=T/^ %R*"<gg**RD1IE0(d=<]rT`(g6L0;P\2G#ES@,;L<PulpFEo$eo,-+k4;L98GO@4d*Sk[W8*6(PYPN! kreX\6A^%kKX;$HF@T,+gP %gd?cCaf'r:9Gkj:44&3UV+[%8Wi^(? bbOcq"$B37$ndRk4#YY@1far`"0bEtCh+SAE]<3.%Seipm,M>+f=XDMB%32a81.m!N_2bj %bR&)0)c9c&L&$Y5j'Y_H+*Ap@/0r.eB1_f[BEY3C5'XZ.@jGjY1@(o_3/5,PM?u!CGV94".#Ps`Q&*9e! 3tCMZF>ESULS*t\Y.)) %AP%_$U67PMA"&N6&WYD88LbVD)$!e(]g2!O\h8OM';qXZl6cf1(pk:Z)iR9f=HCB] %B<fKV1$j`.Wr.>+EM(KYZ9)cAn2<)Bf.HO %#TFhNOi[AMa.i?*[<j<ifjdZWOVFdrKpD^0GP2Ac8ci,JF:!Wi,Sn%$=d(Q? DYh)D8#&,3M>^)s6)k8>Z9FYj@f/W+:B@FD!Bm[a %5j5OU,2@7^B<5`55i`SpUh:]8&3"A*C(Gr^:nX=,4pYWe,? qc3F#SX2aJNt3d_\tnopLeDM6D:DJtE1EM+lUs"=tcL6NX&2'Q^f% %La*n`78k]M):=9N(G0ae<RI*@`?2B\`JUQ3<ICQ?PS5%\X*)^N,;4;rOE'W\79L_kK(H6>0h`PjHHo\0L&8mDfc1Rd=5Q#Y@[H0 %\0iEh4.RZ)Z8Uu+.@AO,P:2B8X_IBh#mn#O&;.gR[n%%&ee@qL5mBSpB_7Gs=qZ2tP1s! P*fLf(%n7<.8ST_H[9bQ@ObYrA8V,'M %=rqoGJ9Vakc3N]X&-mUqp'PM?=B1MA-4D_m75@Y[paE(N./c=HK*E\9Y7$YUJLP_urhXJYZIAlm$RTJ$ +^[qT1:(It-nGn>.[JC9 %(f$kOGp5P3V!O[?d-@:&]<Rl9#e/BbM"iM.6\$_C`M-jQ@#g[Ds.>Q>jK@o6k*K`S4jXM]#&<!C? 4)skFda+l,\rrC7U4^^gb8hW %=b3$1R?8/;$8t#i*!S808d;F6#WWU;E3<=u^m1-)\hM5C9%\-RLqS<lPd%.67-rj"o10Q %<*c/Z_+C*GNWg5\`-e>(`CK[Hf[VRW %l\"QHE0Ri58tbRL2!/anM\f? U+>Ck=iAET9TL1f//hn=]`#OTqQ@)e1PQ&@+jqI5*dX#B(QGjOfc&FW$.7f+&HjEkp4GCOi4Ybjq %c853=+<ROoQ.IHs0P0pLi?GkC5a#4u0s$TRcK`1FE)IXK='SeH=rnMoed@run, [^V#7I,\"mG_N^*n^uE<q7p=S.ml6Nc-la^[$3 %ciBth5^cR96*B.ep2Sa>uZc/G"9>`RHihtD,9bR8m?:/1<;GR?/6`g#2%W^NUNO^R"NX]ZISf&4V+@6%YUe/VM<V;1eSF6?trtO %=h'^1MD_GtjrV^#9/TBoUj#kI=^K8*eVi %p3:P/sJ5T5_oHT+`RU')95WH$J0(L`Qjd8V4k>ZR(>"L+'Ws]%\T2ie1o;nq4m%ZY( %%h5N<=rgY(rO._K]sIlB!r3Va>^68^P@I+a"ZBM=n?aN1M%IffN,kVbC!O#HW"<=4Zk[9J-iHf'R^>L? K2BFQ:\e6PGnG9,&lYO= %_#l&UUoKP%4\@!t+=B3L@--I0Ocs;g%\@DGo'%`"<&-;Gf!WqAVNT"4C'TkVPe,5A-.-G[C=ElX?u*l@J/ Bo^J!!?0Xu6o((@[=K %-Qo.V+Erf7j\9h-6SITCe\SX(NU_bK3H5aZ<(\5Np,5a40LT#D+XI.$]dsRI%RF %JiL6N/4K2[[jFjt`NI&s`W4,@(o/W!oINr#o %RR8&E.k0-.<X7W[5-,KcAZXNX(,JoV=kV2Z<;?V6k;lL[l-W87_BS`G25oeX!o^S$,e!l0qeI9FWe]; %C1EEeS2%$G/`J9/leCa%n`7khhsiN?RcL:%G4k3=43u<S#ItN09%eK_fI:XX\*ERH*%G! kdkl[l(ij4326]f<H2rAoO]m]MSJDk&B)RUOjUFU?1@N/1bm+_I %`PO=qD@C[^&tdS8n%lf,=J;&6TI %M6Rpp9:$68*I=V'/G9YMFaJ.8;,r=8&*kfs]YDJVfG;'JR=;j9NM(c7_Xm?\08Xe_\C-1\do %C(dLF$U?NYTR\cld%_a=;-$TN!g&Ys+OM$-3)pA_'].P0O4*^;=qS8QVkLFe9^mYYk8ST&T!5J? hpL#moRD6DLat9O6R3jGgWCCD %!B!A4&TD;f,O$l?fOD:Q7GADWJt^^TGgD-d7\P#R!8e">M%e&@CF'!neMgq[_& %WM3[;_X87tu(=c7F_,9MYsUL)jo7?6(%KO&T+ %F^^.91%<-mbK5r9$]`'gj?[cK'o!o6LBXm#kYY3n0QQ$.JOBVBP$o$$%bZ;$M^ffOOd1q$? *KGNFYn8Xnq=tnnq`eU^]QX8TXu]$ %4^r*P"^/%qfr7GDqX@7'<T\Co))&Y(WYW,KL_3Gl`sP+D`1^WOF1'tSPSnBj&ufBoMqtQrYts:,gat5STq::!M\.1<oH;M5Rc`5 %[S;#i6]'a&NcL8HI)>eMA;2_r!K1[H4c3Xu;Y$"=jM?tO`N,+#"+HAk>@%b(=o:MBW5T %2K:0XEXsAAX$s7#Um7>MYb65IfMg*2U %mZ&mQ*F#a0^0#T,U$fE7h6@-pj,.ou(Zp`2b2"p@DC!4>T=nnb1$N^*XH9`fRB0?T8\PjV>h"? bp0\Ge1Qo/uV'*"d5]`,W5YOap %Md-B^mDRd/7lK+3S8Faa>hD@b3$TuC!nkA,E_qj+VbPV[8H9eoqq,FNf`Lp?,$EOM[g[VF,.X7A!>e7:B. (oT_$c+liLm%_<?l0M %!ujnhW3/-!'BhjC4C=38`=8p;nEg,SDG=Y;"/i]4Jk[DH/A%SlWF=(l8`0Y6AFXWtlB7eH! d2Vb3_#6O($n::b>"N0JFTR9GF2pZ %Z7pC?Q&NOiXH><ug71_-(n/?hVA`&P,%fTCcfdh0;1mH,ibYZHno>DjZB,rMKc1p[OgK %5CZn"d4V`<o'9lG(!VJut'Zh8j>*ORP %=7or9kl@g%hQ_Td[PaKo\iBc7PtmJ%Z5l>r$c8-"mZ44ocFp^i@L(/t'dYGM"ML!'OOQ&0TdrEaEs6Fq91LNBS&MsAn43LT"(n' %Op6utb\&d;PHG85N$<VLDg5QSOf0`lbd%TobeT=j_%5JRZuRnkENg'<"nTl+2ZT"!0LD>>dT'Kc<\ [Fqj=r>]?=Gn9SZ%k%qOnp? %+8C.,m_E37OG$XIVHI$Y'h&/&%$qdc@)WWeP<rmkJ5KZ#2G@WJ2iW=ga!Xbp[sD)J6S+8b#%l5<=Y? 3Jfpd#(:#o\h(Kc;ZW]RN& %WcZAS3&VereeiapXp.[S`ZpWS2r8[;B-[O) [6eThXE#)CF417#XO0]Z&>D4NJB`aPHb_bnRqa[W#.pBqq3oBuSdb88=<[q_J732c %i9[@;N;4#Es! f*7'+V#O^lqk&;)pdlD21Vn><B*[O<e`b*>7RO"qLIOLM6.OB:0#tTZ&ML;<S642\`NnJM^3WhCiM*j*@)HQ+F? %3Cr6IKFNc*-+_#sn?FAkf];*[`SQZX3[;"QU<a+i_)GT?hVB(5E'poiZ.+[8"hO6jb`! _,b(iO<K&T_eCe,Dma[mO"O>*H^a@V\< %ctoK1BKR"D5^23#.8CJC('t#BR*>KJk>i(qOCL!7-Sa"9ET=jS-,TaY"cE)2J\,&s_17\O? Qj.t1o^[5],)\)UnMJP#a0u1C+IGP %+4\44_ka_;+"@O@)m\8#0r:LcJA.NZ(F'Ks;Gp(GFo)4,\7[fC/T#-s""FXH&iXGb!eLSa6_#J6-H@taKoi7WD]=O;N\rRpCN$= %Ppd'A2!\0b^L#n[Muk7tUE^;P%>jaWRE@Au-Rp^Z^-GpB%o/YQ0P:RZ%5*<.5eM3f[3<!.Jk!n3!?E1<# %6ufX^Sa7"57GLp4T\t %g-[!h(N:6Ecrc7:o&I@f])Y7fm&gT6NZ<)m#94pL@5pj%W[K.Aq-$/<0! 2e9dd.)),tC.X_:'+hc)V2p"t2^`gmsVm*uI%!9+9)" %!\lCqRYJ!4M?;]$:bACb;l3)23X<@99ThRKrmpAo64/LlC$ULa[!#VHP)71NDAfV1O=<)o) +s9=fgDN(KNd10=J4NX0MsJus&DJP %^5n$V<Rm'\]$PJ>Rg*@hjpfH=;i'&4*mgSdfFb#[!hTfi/BZSZEE! W?/4W@W_:Iqj&oIi,5BYS^eh]*KL:/8p]#\"l_=@r?%8lcU %7eC&u8Ec4P3F#RlL0C+?)CA'P#\25&(bP8?@.[LL*Xqotk8"IXN_\g4cgLJ)*") %SN,Hhm6V((L+n]/2/iLY.<4u7674*0l5ssH& %+mEg:0!L[H>bp-i+F]S"5[u+!#'FS$9G4m3@V1?=[kKA7N-?QsrfT#6MA",IgKlP?,9c!>Yde*uGt(gn? 4c7W3)J/m(g@L`3!Ega %d[1F!]-bH5Q9L*hjmHRo/3>LU==p&5a>qWMXMs'D;?03alSI9>n(\a:WYGUE8/Ven/kQAm9gM5R3C/! W2h!_h1S;LNc;>;BFUJM2 %'Q&f*19JeJCIN"k#<'T\7FkNN9rJU4QD*(t9mpPO4e>(#b0I$7[*>Wm0@4`Qb9.'X2p+*7#WXYiPI390rW %_(eQ?tcHSb/V.#OuQ %9>+rM!#?<)4gX?uAPA)IadoG#BVUe5Qk+npRX$#miN$hdZ0hd0cYA$1o;3c9FZ^,""7#EG:BaBMRQ/LdXrB%pb'B7q-mk2P0qpg %,j=JZh'pnXrBEp&Mb,&7P9C^B4]E;TF&P`WO'JL#oq7-`&2C=^a9gsM.T/0pi4qFF2tg1ee.H#38P=qt;$DP-IlcUra*`tJo4F! %%S3HsLhKb5!9&KmI:`-F7%hJjM/s[;K*7Wc=0"VUFP!UBE'NLmnQ,4)Jjn,Z`@-^d`F-M44N5_36Y! q&Nc<c$)q;CZ.;1Y<2Oc"_ %#V&qj\2="g!\;+Qn:n_U_F+kY\%VjQ%/HcQ&g?ch/mT!S1QD%LStlmU\4p#l5Md1_WsODt,+!r# %<j`47i@G?k6sgS4>"oKK(-(p %R-7'r9tQ`hoG..gEsN6;I*h?tPD#3tTl:hj*]8opL;[3uFn\1F30&?m5rF%S-j+&4G(Q]= %ZVRT(5rlLk+&<*iuZUNAi]&TM[?h] %R4IXqT@hBqpf!%9ZmX-ZQK"?qOc6'@3L^S!W54@V9AF;'V6j_T3GK^eo%c%e_SGHIS@! 8NX'*$!\=0Ljp`MCTgG(MXNfTm%Vi73? %>r</;-j+e*(@DBSKC+J;Wl3AdYQ>S7]2>*V`4M)X<c6E'X\DS0]I;4H2CWWgUkTgLoc-JU! ^*F+/@`O<'e!f.*bDgA>Z4=a;<>^> %GU,X&(qm7\XLoN'$"X_.7\q]VJIMa\N0C(l#`Ecb1!dmL'[+g)2e/eFHDKJ(L=sX'5nRN7)DZO$A/]u%! fPS4?Q[pjYLsH5)4`i+ %6?e)l#T#7j(_fn@XCBP+P$jMc!L=noC"hlh23'8u0hWJf6mE-JbFDZfBA;62aRtHhacrNuB! *a8\L0W^(aO$-DP?!-1)J9IYI#iG %U*CZLJ[`iUL4)6VfrH#p<\S""n15=c@kBe38\+X*0s6@X8EY4)@'Y*2Q`uj/! (]S4dL&rhfK>P">fQr'2e!C3rKbKc1H89"ee(Hu %dR#sh=pH[dT8g?C_]k+D6=1\40T":rOmWfS\.FmfGt#4H\P87tXnf/Qgk6/a@+,bW`$!Ym\:D]kjnXLY %&]<*,kqem5D'^>%9BtR %WkKjnKp?W.pKWAWh;Rd3e6AX'Bg(@%X;^J?2$4r;gh;Z\Ee(ME$S_\XVDmX)"gq@oDq(:odDM,Q2q@+! StD23N\t$[.[*e'@8E/3 %U#G'-"5YPqZ]La_]SsO]f91L+NfH?En^/J[H(u]^8Y]Cp.O1rQRBtgsdQ"4I;:nfEY8B<^nFk? 4Zc&Z(gg+bW!Y=l+X-1pW_u:s^ %jg;+]O,RjuX,D)JV,2j&YVH9?`8$ktJk58W2mcec-)'"+j9@<#61,5GnJn6`1l+9D6m)0F\oY<iL31LDM*ik:IqZk#c6,elh-$C %hiS:l@9Lhb9#aS?f^>#2@S)+YEM0pY,NqmeKf-,1"Z^;`%O$j!KE8-"O7b`bBrtF_&CW? PE=9A/6"VVg=<tC*3j6qq#m0#m>W?CI %Zt'dPB4(Oeh6mpZ3Uf[1nK^s;?kVb'Lro8s/L=*_`8`&.HIG8F? tp;ef2_H[l&AW>63>'>87cNu)<ahS7Nlm8;I1!D>.U;n8a@Q2 %P#eCK(Xnjj@<P?*1knbI\j>t"^qq@<,c3OiAI<*Dg4^ekW';W=)d<4q%X-tSW<D9E1(]b86C1! RBr2;D<=Hf<oPfJ'1-C4)f(7O[ %eI7s>,c-cRT%#3G@RA$#0Gr,RS6-r@]fdY'7I!>X=OF5,#.3SC+W9hp$7;6P78C$R9>"$!Md,p9Aa/ZL4\ khO>PC'fpbBEUM;H;B %2&5V_H^aLkFUUK5L>T;'.Dq5*@k'=MAIh_%;f::'PaT^sH^@XjA,)@qluME`V(= %N\mHn=O5X)2nDj;.nq_5?UQh(mEVrBGILL-m %L>TQql!<m+^ %4*[igm0=U,>bb;DVn`#I)psAdUWGAhYi(7N4F]KC/ddg`2(gIqD:N'F`0+4PqRd[H`,tE,J(]hO@Zr$m=; hP9uGG %&7*"8E]L1:0/to)Hjq(M9u.&GC\f'EFp^X/@;1pHhNhGP*ROo\g"e6KtuE<aJ$A9Q6u6q>u_m)Zo$/gNhI([i<2npQ074@"/SfB %61@/MO`rgD)_C0:`@;rBXdM>Kk`3Rh<I#lJ/0ZR1R>g3G#"`5Af,I9$KZS14qh:D_N^#qBP7MK/40Qp:72 uj=fURdA"!"-Z7uo". %UgVI@$0aR1e8cMLP8JOm<^SM#Qqr:h6aTr<U]D[s7B=PV_6ugY&h;_B9K`'".;)'[lD7Fp2$Q]XP(O&Gt&FEZqCZ%<X(bA[:7<% %D@PfN&iI?K=,2=]6*ZW`ZXlE--![;th.j3^D%X@b"iHM%[OUUa(E.iN@M2k1N(KDuKRj?5`]:V$@(c]? _'$I*!u4-d9mI7$B3GS0 %6,J_>K'@Kc-?C.f9e_pIJ1Ll2Q[i^<X+^ohKs^udB`J1S5TZSQ8f6! NjXW]0Yad'FamDOKLBaBZNnDTpd.Hjb9*&I2;55=><[D4A %a.gqO&)gRe,j!m5C.P*t-mt5`IH(mMq^2X4JeLUO@35#IE(%*7*oQopZ<`J8\n?j_N5KFP(B7+M?,?7! U<3Kf8te6g_5of(hBPt\ %-4I%)]a(Lh#m2_!68qoCN8(1iO&Gcd/t`i00'Q\^0c3Y'"rHQU?$V(G>rI4L2]el$0=[*Dslmr62DAjA&3ES5pPn?3u\Zub8h3# %:nB#4=M[Y(,e4\#_T,\p(??t! ^;C:^h]NLV(L\al;LgHt>_\A^7]:B#)Q:/rDa"Ji9P3>r/_:R^b#"1pi(eDqFu5hKE3CC@(%^ok %7OG2o)Hs-h('3/9*5I`h.dEu=H+!E_:uW[5;,Sc,<)fKTKoe8!VGia8,]FkR9M=e9J88T`$PR<HK)#.<lkXUbFXGh9.t9QM?\?N %Q5.e9`\t#%Vi=>jCB1P70k..)rBO#C_S:LD,NdB]^<,O(i[GcJfV@LC`9J:q\ZT_i3PbK[76N]9? Nasu[Hp:*H7GRXc6?$u2)Tu0 %;(SfCjg5+lie_`:e=3,4,cpckJjUmh6W-&CQo01%0<3O)W,Ur+g*T@imDp%%XK9C.fYN:O; +4S>ME*\Sk:\2!Nhi)kV+cT@Chh7Z %&3e%c=JAb!.BMp47#[tKbYXU08Fh?m9aGD@P1?i$:1kY[s+U7B?C_eKL?kA,H0.7.,2A"PQj$M+uO_E(o1ado+^=AZu[+ukembb %20&5XZrh[bI"Lr4L\].PTL)242U/,%8io+(J? Fho(nacOB#BTFZ`rYI@gs@=AS"mVa\*Vm&'[qdM$,M2KN)BaOpDNBT>>\3ER(or %E,.9oMR97KPuZ$][%;.'lPu]q)b2Onaf8ajq-Qs<_#b_c7@?'KMA22[hj>pKB`QB! 8]G9gj\EiQ>ighJWJIAXo91'DW6;(]k%krh %\n!6VO$pEg6P1<[rmJb[Ttm%sYXA,R%@R_X1_8>3)>USh;W8aJ7i(6!_I1a-m(!?p"&$F#f7&cs<J> %n:h)OBG(g+e)37$>;",W* %&D5cYH_Bt`j@p;e*DR?K4sd?c/`T?AUm9p\/73/5c^4koE$MgXHn;jm6rs@d1Io]G$,r6gU6['; (q\E#"ZWReP)]^C!(qW`[AH<A %A5Q#VD1%8T@\+"tQLb4-Y`Ou<mPKJq0r9?c]MXd2E-,S*d<Q;<BK3[b#R&Er11t58kuNLTE!dM:F*o1m? Hder87<(l)-?msqpS[[ %@5sb_3,M:reJ\riIC@.+=?RdjQ6S>*Er?4X\GF)[@T*hY(Y(cIpDQ, +WbDudqiWZaVQL8^FWBnJ#5"kjim;HtaU&:&#.KsrcqeY9 %@,FS2-r9B/>`s/0A+!UdrQBsE*?4Y]cf3E+b'?0iYVIAJZSn;(O`[bI_"_"3? UMt`$j'`HpMt:T"CQH=U(r;`*JPub#Y;@foO>*c %%BBknp^`X<rsRFkZh;l7e$\Sb'<A1?SXm_^r*33SZgi[2!51#je8ZHcSet?AdQJ*o%9e1U_.+ (&2`5fGX9lu,&BR9EA!%jD&)VrK %\6tG([]Kq=a@JB[^X^.'0BuWt,h&RE<HU.XMTgbtoj]u]0"=K.R)8XfiaF7&CXC1b].P"=g:)AFj)oMeqO W=nYpZqF-J(e&"Ze57 %pq`KNKb7[@H>S*(1&a8;OUKX/h:ZsW,G==KiKGW1r=Vm_V<Pp0l6e5Zl=I_JRQA@<pMBsSC.A6J'+e^>32 (Jns*u$U,_#F.l0e1R %PN'8;n`UA,4ShuHs7sjK5POKi4J):'hD`@FI_tob\D@`U*u3CSNUs:3H`qC;)rEaSo/==,p? +`XpKmj3R;eF`2\W@`o4GiSIbr*= %cMegH>e='IHF)RX]C<L<35:IArK$-4`qO=Tmlt(Gp<T;&l^\sS]tj;AEP@dLh?qR&)V:bBI$DA %/GL9/Cj-6L>Nt0sa7hRR]\PR) %Xu1?lrne(Xme?*1M<jQGq(If]f=f23a5_#amju1s''J#+lWYCeUZYKfAs&oo/Lt9"c),ek>pef'Kcm&F1^&Ym93`g)X#lRo4Gl4 %:?$Z!J)3l/hG0U0p<T33cXf?8%?:tLT0p&7jIIYn]^q9'[!qe@mlQs/anNL? iL;e)q]@qIrAT5tqUlCmqiR?knBMPnr]g@"s5h#n %n,BXHSpL-*H@G'@^[bTYrAXcQ?iSCNo%b*Hps+M3Ie\>`q8'iBJ,[^q1&FjJ,Z)<b'S$SpAO0(r&=Z5hu2BgrU%Arj3RYY_+5QF %D8kI`s4b:M'Fo8%s6*hf?[qs&+(f>SAmbE6s8%6CDu]/82#F8-hn? >oci3_N\":8.>l<)IrOlS5_B8eZ49#26R,^eqkJ$ilQi=f_ %%^gK:pZ^T4d46;af4!AsoU\j+rQi7XM4;kMgV2tu?hooCs31B?hS\u,i3Ijn(I %j(J,#iNs8;cakNC^nNWTJg#PSIQnJbham^)ES %m&/jXF20Kq2#kC!s5ad+qsA=PTAT\9=7!O0B`$XnrU%B!(]X.MhRm^]R6USrc+j%Os5B<9],; (h^[pXf_+.7Mkn!gXV2tQP9ucnJ %]0H)/(Vb(c9Af^)(OknP&#S#)mlpE]J,HG+\F@IUrQ/,Y138Mhqlqf(j3R_o[3n3;>CZYF? iAYJ*c=46]g)G_;d]ODO2&7!%mP=8 %Q2fi.J)M[!#5l.&4l^,JcoXJa_DcrA].]_(hkU5>kJ.%\?RJ1eN'-_%akuP+5OuNE? iRHN^@^'77ils5Vn`1359U)XlW`9Gp:%g. %qu>'?IRcQnXq+n:_%0m5IH$C#e:uShotBfjgM_T)&&/(aJ,8?CH00O9FPT.V`a?CKjSLIgTm-FOn;Mbpr! V,c[smAPr5#cO.q'KF %kK.N>jN"pQ++D7WIZ?qkDuZR3o&^b&r&[,gj%8XJ0(Cn"lMDA]5efPUO:^`? pZC(WBC.LE5O:G6X6Y+^ou=2LGCDk#3g"pjTD[8] %(Oj!^pu1ssp3T#1?^r\$-5XhY&$Y)L\F"LSs3`S!oYP/<oImoM8)HN1Of.+3aW"%Sr6N %AV]XWBqpp4'q9eYZjqgg!qr+/`$m.\/ %rjkFAq_$h(n9YcHDnZ1m2u`%`IeDtB+$]9,iq9)8IdR=0#Lan>ptU(BoT]s %lXrD/mDo7uJ+H1FrXXMP@GJTS?Q:&/nX\B&>lh_9 %P99h]G!,:+'CC"8HN1M88*[Pq[>3U!q<Z+dkD!>o*E>nlYQ+?HMXsOHK+QI5Q&@JPBG\Dr91oifS;XU40"mb07NLGILk"tcMJh6 %*dd.@J+e"g2@mR_BAW1"_t4A'qX;;tIK-nZo[(L:]^,No?i&S#J)c4nnT*uNJm7HZ^\>lL+8N^! ht>IeHLD)&o&M=Yr:)_[]_$`0 %`kVBeJ,27m(Ol$%^\!XaI-rM'r:&%Hn`@fW+7RYPS,^D+oTOe&`qi?3I/UZAqXYeVrIn2InUe@:? i9abrlP38=$Q]`O8f&Ihu3E% %1EYDED:HJa="^Shn\+C>kP)ajQ-Xm<@+!okGLeKsimXOum&,?p_]O-l9gfJaeU-X8&DlkRKka#khsAYjN4;XYCM,rM+:qJ'RP^= %M"lfkI:<`cbV)dF"o)^R*<K8d#a<k8:c+*h0ZZLn^c!J1KrV.<J2%a]?^DUPb` %9qN;6\EOCq/d2/ppj\qJ"#!@:D_"k@]Er8K,l %Jan='#)JfAKGGhgi\8GEjg$`n8Dq3kOsQqX<Mmh+:(#XhGY? dV)Gsa3))mM=QY=lY#NX3H*2p[EMXs+88Z>X(.$UV/]YH@sLb\;N %G%59X/eW[Y&<V!8Yfl;7\fl,UQ_C6iLH&q8^dM %a'F`1dl]c33O+EC.TU;mR]YI7"Gtjei$]ClTP#=j)D0uS))>Q$Vm^:&rA&&R_ %ghd;_ETl@aMfhC;eKChE-)u!IO@4o]JZK>o@A,:!ggVUk5I7m^3<bO)PLZdp)d@ZY=! g"jSn544F_*0Wb@n@M<A_p<:cq20DFhiF %1bj)k>j%kQTOiVLU<`XQ6Rfg`YS!iGn?T0P:R5ieHE_3ISpVF>6sC:;o,R^) [j>"gjc(^cPS^gkr0&@D:8ntVle@VL36h^CH66dX %Sp^>hPj)dpl:.%1?JMRQjB.ld\iB,$Q,9*4fs"AHqA<G&(?=pDmE(];gM/&,KoJ`8? FFt_NR(ZqFmARfS(!AMQ,sT(Cuf0TIE7FU %rp84uq<bT7h6kLCVbd$f?2]s#O+d,50NTbr;'aumrOi110`SbFAHPXpNE]8St0aoYKaL'cY[$WD*N3MLD+u[G.PE%G&;SPj8.IZ %2ncT+[Jos>:N#Mo/cZ%s5G77NPD]/bHm-<6:TmQ<-O7>8:$_H$[a2WJ?147\? cueqo"rX5GHnTQ^'Ob.^ClOa/kn"%:3WbCKWV1+ %BmZ]iEcX9%2k+,Zel\AHQsNpbf#;lRGIlV<UV7LIIqin3\iG%^2Hu&h[! I&sFiY2=VD_YN4[,RRp2BrSjsuXR2\:F7YL)W-l>(b4 %L:"&:la]_^,M'7c5MKFK><fXB=f0emHZa+MPI=9U?'u_cK'2[G]#? 1k#C#m`l2(%QYOCA'f4o/JEHQVDI2td5H%*?<2SHaeWtW'i %D>1WSI3.X[\`>8`kFUPl^/!9e-;RB\Y1LpJEHccqQ.aF>Ir>,*>U/NL)7?s)? f.C@e9,m)DU5I]GBVP<WNSebrEm&oh:S_J5;l[' %j/%cII(7s_K5,E)_,8^!.JVFg*g[P*g@6:4[dI*cE]V%4_2u&;niO>u9&8K,'Nsr?0FMjG/'$q_`^3! 9aS#V%?HV3i_85.rqH-46 %o\e+")G]DdcJr80(efOSD/Xh;]P(!\!13(C;r<sA?3MMPVsR*)"3MnK0=d)Ur]mO=4g9)tnYeW5HVMPD %#tMkH$mIGFL3ujK)_9$ %JJfM:p#nGug&iQ*l"l6pW;-)<a,-mOl'mL_@0/k]M96.e-"i1'[Z`2]h%:QLhc>',#OU:9sDnNAN:0Us"cZp$_q0f&_i&,"!EFn %kI)ViF1=5HXeW;i1@.p_02pKM?N=Adar7esMRWI:g.*-uZ)E1>,HLjo`=_WIDt&fL%*H'Uq'POVpZl--6^7@nC9VrD%rUEE8n^' %8Z6,Wo]Ju!^WE$5qP`;+"mtaEkF3kjT<BJ87e.bQIh/qbDt2RVK'$uI1(`? cl$94IhsOdU9\':;cE_u@>CRiDh`j;eJ*=hfh(D97 %O%$YY:grU-*Y[.8!fYVrlK5^0&;[acfTa!D(D;Pe&[D&t@m]no_5*D;mKGNGMuUsSFPSum1=! f["j>Z6.JFMAEF[Ek?u]h>"JU=[ %3$/N(pt"0F(\$jGK'HI8$\&tLH`$>+_:!1:nK)l3fKksPI,B]%]Q?q_m/;"? YYpP,O:E1<]eD(p38sCQ8F34.VLbaHj6a]% %\7i*#GdjQJh-^bbOE/YQo6GG/p9U6FKnXk-:,b)]/:_B2'4pt\)2hBpn6l(2MH3A'^4M)41aV7oGr4I[rUsPH<*hfMn?0rcZW&G %qY4\][pIh-ha#Y:b+8h-FDlA9mE/*\>eL^"Ob&8[nL%@]f3Y"^o>f1_.e`,7FgsngN226:bm?6Nn7REEgr+BJ$%Qb<aRl`CPV`> %R;"f@]6EOIf5L4PYCE^mhqGat>M\#I;Pt>&63g2:aatQ)d&GYOp"'rRf^.naj(.;:/5NDW6_UpSZ.NgEpE6XZ_q-#D*E1*$Go"k %62W&OYHL';I_*5)FHflPi)mn8*niTu+ii,mVtI8YiWkNrQJfTsE;7WQF5,LFjs-XUD.mZ; [u9s#>DHtZ:u.;.@^1[X'R!b(@C"0r %D-kn"gYHe$7j-H$TD!8%MVC/Yopr"p3a:DB>j*>SZ$7[f=l5]C5.S(DsuLOAsj_>A@Vrgnu`t=7m1)&>],>gRHlO3C=9.!odaga %c.tsMO+GHr@le3MQO^E4ThJ]>'<#hA)-E1%B<FOeB?o;8KDT%#P2$+"d)j8mdjnY+;:1_jLo7h>/(:mFFd %og!8/W/]:9f4nG&if %h=X,d^aa_;Qqcm+Y&A0,mBI8ae_0XK67c>Q0<];#))o+=^:-g2N"O^l1QXu)F:fL9NMBa7(Y0ZgHNIm,moc8lg33rk%oBWO[c+d %qbq43Qc%7n7MuZ:.53:/4"bs6*HDCGla'N)F(os\4q\q*SR_coF#V:Jp8G[P[ofUS(n;Vj5(/A\f/il,"^U)Q?<UbIE*2I>OfN) %eCNdKp!p1(bEIj"l`]).8'Yt_Y7cV;mcr>nfe1j*>NB_Y_u7.#W/&:][aRu3p! k'lq*?,BlY@H#n\KcC^fNF<Dqp[l&sQ1ors8q& %_98/3XWC11c,^"!+IEF;j.X[Ee=K@q&?P)eT? m86_P\D7O"n94Cu(A3\,4$8P8eFGV,4mYVuN7EB"@7dC#*942??S`]LLTd_3(LC %ZgbZ?8%o_krqYm/c/%X0`q8!92Yb>K05UZ*jj9L\,ekolV<?I=euN? SeE\ni,t03n_Z'uUWc_)'8q9NFGObaDdsKs*]5u]@[?o#[ %_n[R.YgPVCcp?"]P`CE[A/6Z1]t"s(S`CK':(cHiM5Wu%('e`T3,kR_&Q_6BIJ2>15P)<?n?t/m=%UldRl&+Y1h_I\*n>*b2(bN %GC%HQ[tTAp+:Pd=mF?2`EW&gKV]/ie=4aA%B(r^1k5f,fHTSiTX5N8is7#m>FB[Kb[^nQ#$>oihX:6oAoflC2:KQM-\o*I*7;a` %g3$M79:QCJ_1?J-o]BT0nmZ%\=o6ohCid.m4'e35JUJ#9`GIrt=9,C3`Ur`Hf)"7k9V6!rF`_! &eW]'2oBLsPdU$27?FtT1rUn:] %e(=$+@=->0>?ofueh#QoZq,?u^j^UJ_h2Y_RnW/=\FeKkqT@g5(>J1?7W&$2l0ZQE<N!"0bc-N? 3o+&S5)-.UcMbI%W/T\>Hb0Lo %ktQ;e-6F9b5`C<45R"Nn)R/Glb;mJ2jICEs5WHPi528**ik'0k>;:$2?kj$)ME,nkOhmNrsp5>>$J1#e`9%[G.-fg6[D\@R,4^H %p#)5"L#MLLE.:2*^<fg=G+N"jmXTB4XAmX)dM^U@PY^6/O<*E3PA<6=eu,_#YLr:5:Hj! u.i2qZ+.J3q\J^)CmmFf=%]>[b8!H-m %$8ZqRoS'cPn,AllPldOhO?(U\oFs)LY$1;m5uThW<N#J<&np.94l7PoAaAW! >uEbr/c=`pd8mtuRCkJfLlqgE+%gY=M`WmT)?TD7 %`XgtIQ8VW=hbV)=`$h56T$8UI^$KWfhIN3$pJ:PH_W*fiI2t"EF]R7tL3Sf(Ta/;($CP]kTO$-sEm %=PN`s$XHJl(mrN_`\=r+R[ %#HRf0g"BqASM)KOGh51=cASlQ_V4F7h=mI/e15JMFT=%e?@e$5"7Xhc/;3U2T=? Yi;1Erg#0uVZT=hgc@<!lHEk8^^\M>LEf(ZUS %o&Zpq(W33)&QXOcj_J'WT"sk5=/NUYMk\[Jr61VBs2;m_cTIEOPI6H %f`0&(et3J$r0a`nJ)tHAjOMS+.":UNl4eajr""5kBRsIF %6T6dE-[4`*aq(.iZ9m6SCuYOfUf^N8@aOjS"I9<[7\h>'IigESfXR)^.uM@LYO&NSuO"5NLeaRf)ge<ik@Y2g";m(@iCo0W<7WY %m0]<b7c7(eeui<9*HuO4[bb3^d&q@#0PQ=qgaOXZ"0ZB*_BQhLj5uE'N]X*FRZb^$XDDWDXLccg>5q:rq^=!e9(?`PBYWt@<[:F %4M1/:k:bO,0?K3U=(e.Oq>BXnnFJd[GK].*`n@I5CU5%d;^:qSg?/45[8#HXo\KAs.pEt0O? *dCmW<[HnrpCq<>aFmqM\=8o!=Tn %YZm[$=&bf`Y#b@TN*0c\g%j=pl>.LRI!0CEF1/a%k7? eHq;jbWc`XG&'C1@Kckh`o>+XX+Hj/nfB@aPh98(L[H`O@"^M8]*f*Sqa %Yk3&$^sD@KN%n$^HMM<Nal.tp8+$F/c4"q%\-N_`I:IMIqg<YcI!GO937@Wlp0-(USdnrjG/]N*O+Pjrp.6j^2nr2DtdW,o,Z]P %omUP@84pDEhW>ktfcB/bA03>L[JS\44QOc16gfoIq5o!%goE7e] (g2n)AsIG(Y>g<D0g&=9GKbeiq1t(j5C243p;lT?7U9:o30a) %`00VeDX;bZr^6kCFssIu\McNA._3$ajlHNpcM$qohDQ<;Y\)qmd9#A"AgZ(*M)qmlAH0lLg-d`\%a(%n0e %Djh)mX\SNABH<nFfN %poj+%YMM@a)i_hmgLK_G'gCGXhgMIg"Y[#qgfSKmi*mo(6RAL4C*MS-3FC+Zh%=+`6iX.1.pWAXS#>71? R>Pp&L)&:?`"@L5Gu5; %Tg%A5pEcKJ9/'-pm(dT'^unch,<PRPlYBmcC1(:hQ0S&3*jo=rp`Q&iP9g_Q5"sA#(.8R5BQ\Ibs/QZ2kRZXQdW44!*-jnn6^Tj %"o[Th<ns8bilMKaXe6Ip!F/A<7^i*+Jo6"b/4,,slOSDVS2>?AT7d-5oX?%/=/""hlRd'sEqU/lN8.$oR! IJ_Behhp.p+<:KUjq. %,Q(Tt`6=u(/Y2,;D!#T'a1YVm! RuJ)lO6AJLXlqhjL,g"lmM_8U*qKo)NNT0)C1B<L_W=hVQTUWTNCG[7aiPlI'-ebYK^TQ7[*0T %B3AF@P&jRhk3#nej"0oQD&;A>)Zuh08Va03a2L'-QiKRs9$!ki\nZ$!pXr?<Njaa2(_^!*,L,L@C!7F? &QkMIdWM4BaLG9Im1Wj] %gRdA-*Nda";/)0:BQ\Ks8W,9/Q5qm3_DOsO1qu"S? O+lXgOD>hMi[al>^ST$])FE3bJBt@UN3HWl*`\h_H^U878?J#Z%,V73l/7( %]6F4N*A;i=_t*0FN>o`9&*QKOF`0U0R`dDIS%Pcgp)-l&EU5#Xoh@MA/lfFiC.V,PmVUPPr(Xe+BFfN^H? OJ.dV-8\_:`pOEiBCh %4,:tBYl$rVo).h.duCacL[:qH`g;aPQa:UjYCCk:o@c6[Og!S#lq$9r_2`2%?)Y'E+aY*?J6a-Lo>IRjFE %4Q'2DL03Eh!,F&`Pb %M-hXmdk%&W9D:XD-os()X*%l8ReXffp?!#o]oNh"go!q!02cn$+Wod %;3$H$fo62[Mj9O.TncVD*P2(r62XXB7lZAhN/@cGD/\h. %9Kk>i?+j!eKW>BjK4Xsm<+$F_JQL:=>oq0LnHV<[sf3DH+)#Tl)//5;sKC]dO1rZl'H_79[;1N6bR1Vf^.5`[aq=:iV>I&Xfl'7 %GF$>aX/hnQ'&9m.4_&raL$\"ipW;g)]c5:6?JRZi<SG#J_/$iH``:Bh'7-KAc`Ol15eJ/p]Z]-`OdJW##^"F5,5Le&+bp[K`rjk %iNYH$2m?imkPCm)_L$1kfd0(9VGQG`tmPlpcC`kX7]SnY?]l#]8;K&<D4)"WPb#tG:a>XIm&4q@+AqNd&/d/SZQhdQo2B?^gchf %l1U*(&I5e]g<N0_8I*YX+/Z*MYI?T8n5oF8H[ieY`^fK]>H<)iZd%;RVn:CbJ,+'b^`=5? mB5j_Gi@=sT*6lSr9`"KItaA9SrR16 %=Pp23:;_QHSVVL\P:nS-nERBP@GIT]#,6U]qt^bIr:gqjI4n*#A%"HFO5],/@;d$A=1JIt`>Mbmmh8C_ %n,hD4[._+<DL#PAUCj7 %Xl`],f<h,9<ERo.ANL/[qrk=OI;EO'\ffW]pL(.b0Xa![iO)$\Hg8M<4"md<=_;I0j864O;0VbB> %B&)V?\2km+"I`Z`_ZGqg4PL %HZ]`VBVjS^g8K+lC\b;-SXU8[Eb25XJ\>FTedlBG&m=*qI:[T`&-LaiQ\G<ZO>;VR^G_*mDVY9hl0oCV,K %gWfBt4Lh-")hI;?)c %*7;a-^$XA')%bTlj2&uKrqakoFZuo1'/U<XIC0erhhQL6HrqPn%*f=Vjf#o)HrR:H*7W5&(7ee=6Vt5csG1'Y(bh?kCB_)NR-@l %;AWoY0?8:M7AVREnFG.J'h6NoY3nK_]nY.pRgi@lkkEUE(WUNF1%39DhC?28p9LgT2iLLAJtNgQO %dkISgflfp?q%El1UCalIPg_ %p;B_7<Q;Xb;fF_Q4Da'$D*F^&0(7]KFZA0`Bog/+)dco^g5G@\(*,4sQgYmB3X`! lf.X:4R:n(pP:ruc&[]3%qWaWZNP0IVDig0e %728(gkOs(;m-RP#9QtYmgM:06QBM\4oW)d]ff4<Bg"F[DS%Z,33b1kJaCJ\2N9n]H[? ^PB9\7m>k$]4XSQB>Ab,]DRYB4u>-_?_g %Z+%?AkUDdV;)2<2\[i9.f?Hp]D/=IneJ\-L:G,GpVjj_[#Wd9EMmFPpcG$l:aJM%44]rWL>jKr5[2X8V6&QH](W:,!oE:/)r%]i %g%MJQak!N!m2M_`PW(q<DP!a!E4C=6YEF)'ouXbtX0ZppguH(\dbOIHGV4,D#! 1YsC*0(LD;kQ(G1LhLXnRMZ3ZjtS:$bHURETjK %aR[/JO`T"'BA:\)7kA[Wl)APWMGT634a.d&3m\cPrg_a(@sN89YPA#O:I8YCD#JBkrGa %LbI)VDoN4KQAMDCn!WRH([1eVhSUaH, %`:brfW11C_=`Sqr@Ds!(-8C5iQXZD"5fA^fM:oiP/:PR8.[J%M"_ufj? 3T]3LG2jonYj=[Y[X>JPLb^F/'^J,,Q4&r^_b#0Q#'aX %b/Y5%nnm\a+l2l2OHItO"RF%Ce^pBV1%-N&.t&u3+gXG0\uqY?f<>L?4r<P+05XSA4PHH&'j3o2okS8\3*aS,qOF_l.$H.?94-s %)m;R$M&`Y/'D:4<>N:F`STses]!U(dld&n+<-d+q'`! 6V.tYPn03uP'G:M#*2fnpE*1N;/L<s3eKabiVcO5*,6fY(OroEqA2m-NC %]=bKIYt=iiB=I0BL[REXpXf8a3W/P=r9s5)*_df]j>)7hbmS[S^2Sg];DC1)!H@PK!=iIelnO\sT9QTe>/ NP$[-:ioa%n<n8(b"2 %@[?ljCXi(+3^V4Mk0e$Q7!`Zil)PQ&;dZ\dkgBk3DjR&JKFk%&S%S6Ed=.t+RaR(q6jh4*ornKJZHR\aYm7W/#MA7W)N"up'kDE %;kJ#d"m/IVoF?!EE]626"U3fA:[.?@V.!IDTX(E2lMk]p^@`\#r_j.;I&%_#G^`U^hP(Mh=lsp? 1+ROHHc)3HZFAd.2s.(q7pLgm %W(7Gu;RI"^%Pd"3R+t<6,&[S;kj-&^pJf4J`Ok1laH0G#W3h+c8qD+,sfXbm4+Do"B,g\rLuR8`EZ2s129kLMDoP=\l)*!70P/M %g6Eks0ZKloNX(hC$QLE$.le%-]s<fL0"8DgcQ75&qT?D)?q4i3eEokicWbtOf%jG_gid1[FF.&>]! Jdph>I,greReP%Qd)1260YQ %A]<)?-'6Lj'rZp[<t4tZ0ckb:5,`!q=K()Z$tUj-5#IrbeV3:@?R`8&B`/>fY`ZAOH)CAl5odsjV2T'&Ji %0;)5tDW7X7V@-kMet %kdskV!SW`(q@>&PnWKIXon="7qD*K'LpXZ_>s33a+C6P3:m'\e(?nc,b4[??Fa(AN5?"41. [TECEYWU5U^C)Xg+bg5+flsPCu]/9 %[2H:?NOpTlq,oFkg"'cPW*370l+a/^781<kj;5g\lYQSe,L[jkY8bEEH793=8i/! Sl9]pqi._$NH],.9NY;:Pj(*2q75?.s\(HR! %9hNCNp]);:;TP(^W>DokWg#>bKLHj8U]L`Kd0tP5$3F["-4#\?ma2C5Z-"s!QEM7;! aMfCC[=(n^cP3fQJb:WOR$9>[fE7d9S)Y6 %1_$7m!a($n6@hco",9d9KF/"1"9KE$,@GJ0EoC6:*\A*\34S6@f?RkbUZ(f;4fEi.nqk34q=HN!*: $=CA+>-SA;V+d@=5U00d,]r %?H!D(q=?F1est7'Z)roqCZTBLd\@n(VaF"$LeN*@gKL6i^i$Y&EaUdEfLFpFasaSd6$&3WKN.r$W';Seoa(L7">9+P6sSV' ]4PT %*pQg7S`YTmeU,#!,V$%$"/<DcFTN*U+%Mb81E[ru6rZpAA._nA5)dc'5jFB)mY=WBPDc5=>t,n]? _,`Yr]FR.lUV9/5?1bD1QXZL %YPCj/f9=(;:k?T;$r=,'\&WP&ELD>b*\-t1bt3FJMhW!l?-E!Q!!h.N! 44c95u^DBeIof"RKCEsJKXWW6)R9X>$DU?9:]LA(n=o& %Z\hJ/ZY^d>[ksdf"K:8d?70,lGSYi:kHbdFAK!fPQl3qHk6)omN66J43q1X%ai'l/*-_H,?.]31<gODSDe$2"K<dM@pHG]bG=?E %"pX8k2G1-a#`1SAqIip8X[`Pp+WLoN`>hg;,ErW%ScAlg3WW0$*eF!["V%)TP<C(bSlu.<!QChF"fgWL9? jP'`F=@ClQ\;CW?14. %#q.QoPu?]]HERJ,-lL/geY_hJQ7/L;c7&G^mbK4*@:cb>Ec:H>u^pY3!'4Q1/u8(kQt\jOGf;`Am66t'7J]_$Ue*&65Z."=0[U) %ebDrY=)kT7S?E$okA<?jlU6(^N'QIAX^%J0iK/leYE-.`I6X-GR,Om[KHa>h^eg*]kcIOd!XHeM%? TKQ"OtcO?G9pj._TK-*Asnl %AWSFRSiR.+&76-ETXI#hF;D%Cg4+hO\kL,Q08)"tLhts@8$5"7BsG7.5eKPPMXu@;>tA\:5?,umr[(7%X5tWc%Xi,"0?`GO,(kl %kqjA\6E\NJKFn`@#!VkB:`BD]-9)hHgA7uCWOe`)6@:r>&<_J$US;'&l3@;YLNV].\IA+:"r<41"!Un8g/ u(A!o6L4oAEe+5cQ9$ %$r[Z]!#AKD0na(1"/uMaD=,5!/OS(IAIZL*<>^an63t7DSTk8hA_YfFW#UpM#_GpKKWU2KSPf':gATN2_koCa.,Su)7fh>WB5EQ %4=*@f]nGYs>K=8$!NV:f(NGn,*gl4b7PQ[ZPS$f)WM(+Z)6ujfRVZKkX=bZ+6f1lK_(Xf+ $rl$5kCDF*mZRPM''c$*X@P\aUOh'X %Rd&J4X"cJ4Q][)9AZ5L+$6Bpngp9R#2jUNWjglb2C4s#`i;Dn%0a+t';Xk2k7)B`h@*@JlS=8Ooobt52h7E4$X&Na*]ci)A84B6 %7>8<,>?>4919cu8MZTk2H<V9,:lg7[XId?RS(P;eORA#9.#>:6"Sp"k*r-`K^liF2)Ws^Ul6hE[Jq9#guW!Vo,.\b:+b]q&0:7P %`PBVHlK&D<d]!+#4eu!h.M-`Z^a6?<j]qZ$T#! DurN$mJAp=jkgN=g(d2*OrLe1YWq1UOEH(dF+A6N*6Yg>P;i4Ee9o;N)[<DX_S %H;IL\Y-X(3?`teA(pp3ngd=-/9*9cg-:SdIYUeZSm>E! SWD[r*FA)q@2a\4]>?;0r^SjCd9Y43`(WL^l'D4X;e,2Q*&bHL9na<\G %b_,% %LG1b=J1Y<]GVRF3\fi<NU1H\M8@NLPW7tO&dM"m\f,k^"rjLb)d[J^U<s5M/od#XH#8O1^8QQAqKb5ASR6 I!+>$.TYOqZmG %]aKj8$Z#CubWJKTJMk<%25NT"UIt]HD+8jbo1f*gBB3e!f4IX)m7AK"#8O1^Big2h_?b(.OZll8>.-ufbuTN(8g8BDrab"Ud/Kh %C.i9&cK*E(@[Uq9M=m`oYqtr!")?)68[Y]8dXP,FMO8R`a=iMBeli!)7]&V?+ $md_m^+S4E0K=&h1$l:XhiW4+^Q$%AF+FULUXNp %#](EeKajORfRGpa6uAu4d&L/-C1A,C`MO+rA3#fVfETdXK%;DP168fN[G(ip\ZtK(S80Wf;NG_! l`+e<`5@RG9,?9FO`>A]H:-_L %OU,@2[YBF?p#>CU"0N<a^bS_/gr4?2$:<+oC'85P70ag4^cE?U<@f]_reh'H%s\>]'9HJ? g:P(VUt58<GE?.6;'9B'Fi>SoVoCh; %6B0/9>feM)A2g6Q.rhD=O@O-g3/#_.#9Y`9hf'H! oUa_<EFbiIE:fnY$KXae$0;.h2hUGRc(o@IqX5O9N=O%^G$XWok,C(r7Sc$G %;)W!GEb6WZ+jNpp/9Yq'*E/"[f;$ao %H.NO@<MP<d(@U]Z?:s\ZM>4S62B6kosOZ2qYiQI_kI5gY$G*kS9\#VUX>4+*[N94nQ(?b %0mGL5a]<u<a8S.8@UeQ!Y_OXL4ci.aG=A:q^SmC_EDt"k0JJGl"Tc<h^AADgYipUrD!Qqu1J`pS,^R %Q'p$%r)r8:Cg&!M[L9`#; %Jb5?;5ju:=8IoP3TFONQl? _H`GMd18lS**RF">A1TmmkpV)J'YlQD1'*K\CoFiAHlVo:b:*SlIDrg)`Ukl=8N3O1qiGJ==_&qc$( %h)\*%>6e]MF^<DQ]+6CIHH_Uk'o:]Ph5^X)A[Lke8Ah/(19t1e4J6t'bbNSL>"T4bJgd<`dl*bn7i=931/bH=UP74`=e6I<2B\] %d->=B&446"Kc#nMd'9C.O9dH>+>=oLG)Sr#JP839&`*U\p'r7BMA5h0qVce, $X)s1@4[oLXX<jY&/MtoZ9(J_;GI;R3CCa-"Mej3 %e,WnGKP\W! bYp.DrYLEr\r8sH5X;jo7(KVi_2q>gJ]WEl.tXr1RcaZO)3[EirA3AFrIE9/Q4@8_,HSa#6:.D^@&u]i!"M <qK]N@K %1oLHYb<[?u%Fk38SJ-mU4[+DLd?&PUIahbD<JE>bcj5>/Gr0@? p(4Zc&/,<5$r*huh>i"j0ZbA253P2"1g-W.]JosBh+Xg-?PNg% %\S]\i#F);Tf1`J$^sH!f?k-Eb.Nf.B3rm'J2\nZYkfJoS?5NZ1"Ui$LMOHNSb7&?i^f`0!P% $mO/4JIf&NCrP/@"4N!](fk!<hsS %)Lt5;(+Q!FX,);"0Yht)3E0e1>6Pck`X(K&0d*Ji(?rUk)ZuL?R?X:ch9s;2RLODZ_&"%! q^(b`K4>P(Cfd:OO[^E+*+-Od"p"#] %!F1B[;A.:k7*Yp2004R0i#r+!4+>T8MQ)[;?7c!uqLATa.F9mr&.H\]bgBO? [u.Er.,aRsJ.,j&Gg2%]l7ui;C!Y`Hj&'#(K+0[# %@p8A[@j'7&?A8YD2!_iq_o>!ReM@['A#L@:4O8j)fR/r`/P[g0W.@`G#bF`jWUo*\K"%[YHI:\S#/Gaf %=VN##(R?+_g)@rn*#[i %'p3`-H9s1lc3Y9M>m.qGRBuuM,`ld"jp'QV+9b;8!<^uWAb&`@),fcNq'IYc\4%a]uRM<(WSe<>6;Q4!..la8@JjWS1k:hoS?2M %$A?@T!$"+7l=2*s)Ls)cVaJ-?GfL@k_3Y/'0MfK8?`^.aFd32)Q[;deSeY`! QHq4Y@KCFhR<]GGd1`/S,JH^"1%eUi@t5/ZQkM?u %-0s?[(EWVjY0o@MjAcrSi;d41"i!#$1>/\S#sP;1#"Yf2A?.Y!\Gf!c8gjDbj";N07\$ [_pJ6R+J1#\G8QGi5nU,o:*ZS_k/Gu*_ %(m5]ON=l9KJh.=-W?hdpD_ThDDA8<0J.80b5Zljd"^a^]1k:8CBEi8aLi[Fu^^h/e"GJjpS$_supM=Qda>NV`^$C>aB.HZQOUJH %Td;(\DS8Xd^g\-f1@J287gK(8`rnZmAh")&@fdgJVQ)m:Bu,]Ck8C-5=;^[Kn2M%rBnZsRApG! @FN"[,S99Eof\<Q(4N]q)"7,%f %+dG\hRLt;uLDAf;#c\R$,JR@U`QH'^70=UY$\[I47PH/l?.L\1[N;H/eKNkt %R(4#'ME"6F@fZ95\Ikg0LDJCS.U@5Klnm2+9bXH %%f3><6,lAl,69(Jp4rW1E\L#SK>mdPaEo3!=nM1VKS>%7[32]8"B;?#C?< %Tl^V.q$QZMSg.,6a')=@S+NXVV%4Te,p>Fdb:CDVi %"CnGlnfS;UHo<d%;--6iLqj?1D!U3.+p]&/5_pp0&7okP/30m7UtEK8>.LaOG'sKJ%JP>=Wp[u&&7? Xri1gQMQK:6-@5,b/;86fM %6FO1l!O8S.\0(prM%bCH%Q#[=SN&.(J3oE/?f_V\D;?BZpr+tLM.XjY0,S(3L5At,5<.Ph#R+42nusYoeU %K-W;s2W'a[n>K-=4> %O_o<o_%2/?K\Wa8HkH-AjSK\]7YG;>?UR2Jl"4l><RcDY6c.9'!an1>/YZ+]UOj'L<lR]Rc/(_+,54PN. (krB7?Y(g82HB?DbLRg %E=?Bp<A"JH"]K%hZahkY=bh<-WBtsieQ-Tg"%_Gh2NVYF<R)'[6&d<Y9FCE$A2X]J:2ke.X? `g_a@Q[\"#*2t5\:.LPTlh7/B-fb %0B]t_/8PfLC`r6Q$@9KW1DgE`P8B/!"9Ho(Hcq.pTl@=>hBLU%aaUNd$$gLn,cZE:C&u/S<&(<[ReYJ84j+#D3ZT-Dubi5[gd"; %W/rJo#DAabh4oqSShf;eX0023U4[.`R2d2IZ %'g^^f<d5o<N3Y7o9dJ[jD@n/d(VO\3QfpY.t3qS7Ut<+qIq;GX)N_qITNMeH^U9 %'nDKaq*f'D:$@r[r8JQlF>IlXJ.MJ6#;6:T"Il4p[U^1ZB4+-r%(HkS)`<Fm!'j6Z! *hcRAdFRi8iG]5#QgS."1bH7"A]GZKRk6p %PTVUl^Sn)2Jcrp,-[',M2?[@?E+f?,*:gm<)]b`iPVK[+HRS %Wcp>,pahXq'IGR&Sp+\:hE+:"(XtlXULh+k-"L`*qErk]o51ar; %fsD=Opo$IDEFoGdc2`Ca(AJnS,J[O_m_Gq*QjcguS*.S<MZE7$HEO/TQM45*"2sK+7)=FLU<Jr@JC&! 62B9cnB/h31%5&B`4X;f` %!sV8-11gN>:5K-Pn;Cd!PAO^_+a<u2L6-3dW<=_qJ9[7$1CYfZ(u-82Y!R*%#MF9>06d)tL_, [&=6Vk\"^"P7C^/$.khTcSVhof7 %!J9'fha<e4D2`GV1D1:1'`d5B&!.s=9+j]o!Mfj?%H.CpAhPoY(siRs+FtL/ca4/$Uu;!e5UK^K3`5K80jS-'s.Up)Z^K7Cj;g% %1\hAGp';4?ciBb4NLK_LZk8-&!'9#tHPYAgb\uHc!>(J?r.&3YlJ@-`*[$2X(up-DDZD %X<$Boqf)bn'OMc$8]Kl6Q$<)_M#i7(N %Mh5s/EeWpI=gpp.IW5d,W^T*Y+><eu9h[DHWZn&jl*VC="$X*mN#>EH5a)Kc]$l1@)AG %7iL=5/"iIQj*V7nj<D1t-78a8O,61V$ %j9IaKR1E-3S'j=u#Iq5EO;Un1A/nj>#"r#DS/:rC!*I\S;s,$O2FA<?SorthDA1:iQkK>R(s#Ya&`>B9b,J'+OmKJlXbZMWTXIl %'#G;P,,">T^fd!dS!-.M;]+LGHgXmA5\1E*6_J,_b/pT_84I,#R4[@k6!kOL"!nF%>ULZb=V! f\`.Yp/'njR65ue+aJ7Ak"/S*uH %('72`b1ltO! N<Im#_$\#A>7U_RRjGde37a]EYta-)TX&l8%le#8GYR6#Ds9Aef<dL;^'%T4@+MapgqNA'j6ZQP6t0OL#0_ R![/s[ %J?go7A.QLiTLK+7L;H'PIaZ%%PUs/6HG(iED(<>Q<<[$N0Z4[A!A7F2R05d6P(A1:eIV? 6.Ii@X8AQs>JP7slp4#sDA1!e@Q%HKl %'TukJf47ZX4Fie"`E]t*KR*V/I)/Zq!5t0L]$?Ol'5]1o%53n_,L+lA">BA$'huM"gAr=W&Z0)) +=9MhYokFGo"$63W<;iB70B@. %I6)S+JV55+*7$\0*Y6s.>4@G[+O^e,p(2NTi\o$/"sN0gEf!IO4$a]No8pRsS6&?M&]uE06`].9/E1K+,2'ZGgGA;f86iLd%PZ9 %l`WVfHi;kW_dkR!QnkJpALmg)]q>DA+]lTTS>A6]nKB/[VfRX#!?aF!_A"6RiDtL[EIei%iY]aI!t? EGODp(pcq"8o/TFS=_#&`d %0o5fgX[[srNoU<Kb@Q^HACr1Xj#IkpWIY)%H6M(!E*sdk70qOf?Gm@! _I4]7%&6+70g*hgU,g/@2838qW").k*Z5?Q4YZ.DciI-T %OtH?e]OIHFr72-C2"P,AKo7;U-*e0r$m?cJ_]g9OWZssg0ftAgBF27b")GqE>S\kOMJcBP10! O`NN)MW_(,(d)@$&JEIf0BQHVJs %ki#2Db``#t;Q4(7<$D0$ai,=h<Oe?NQ83<!GZ>U"k8HN$%1@1aFPuo5^r+-=J]BgEd)Rnq+d1<<! is7G0eJVDd"<b$+Q,4l.G6uh %8cVcT8qN<"K3]m(Q!rr]L^b+sd?/kCW'S#`25$Zi4XoObj#aQEie'dqGpgQ2! T('(mWPBBRZTj\gUl6np)Pfa/VtRJ8Zha3\%P*( %1k#L*:O2>"*=2=r^!hB0NE41B&5;>&YbgYX+QLCk!`[+6X+pPh(luC#+&k!I/6#uE*D/VA3RS</ (Y[6J#c?hOeqP-!![Cmq*%0#6 %eQ%7[m?85Z%4GXTXXeB^eIQg(9G+(IS%D.O?Or@DBL`Eo^Sa=c96sL[kJqf-2>SFnBRY4r@S',gKfj.MO$&?N"1XF8hNq^lQ44l %3'#]J[`$re@(YuX? %Hio938^roo&bL;=CQ5$.*:G=:`Agkt3,t(E60^e#jD\`A&E^NBX:O>$.`]UM'Pq,A)uTj43A@KeG<h$*]O %>Z<tTcle?sUdd-_;+I`=M#q?tliNR.$tqGf!U6UM\h>t7+P++:j;5j]lO3AO,L`rP3e2"`*KTeQbiAn_ %"W4:I7VSVi.>qnd9,u0 %m+VSI$$_LSWa4M)R(%KH$7F+5Z0/BJbU1Y7fSrI;3Mn0oLE$2T+oO=9iWS`! @]0QjpjM_]<T0K"`51e=5a*Itm%/8iY %l*]3@mHN=c'N_fQ1OU!QqJL3<:3U>0l6E6AZEq0N4e(eChg,_Sn<1M)o&N`q4al>;ru[t+-R&~> % %AI9_PrivateDataEnd %%EndDocument @endspecial 2435 x Ft(Figure)562 b(1:)879 b(Example)564 b(of)f(Appro)-31 b(ximate)564 b(Decomp)31 b(osition.)400 15763 y Fs(L)-57 b(eft:)1084 b Ft(Input)632 b(net)-31 b(w)g(ork.)1283 b Fs(Midd)57 b(le:)1082 b Ft(Moralized)633 b(net)-31 b(w)g(ork)400 17092 y(graph.)493 b Fs(R)-28 b(ight:)557 b Ft(After)370 b(eliminating)i Fr(F)154 b Ft(.)p 3527 18679 19746 45 v 3505 19786 45 1107 v 4191 19454 a Fi(P)142 b Fh(\()p Fi(A)p Fh(\))285 b(:)p 9355 19786 V 2922 w Fi(P)142 b Fh(\()p Fi(B)50 b Fg(j)p Fi(A)p Fh(\))284 b(:)p 16314 19786 V 2922 w Fi(P)142 b Fh(\()p Fi(C)71 b Fg(j)p Fi(A)p Fh(\))284 b(:)p 23251 19786 V 3527 19831 19746 45 v 3505 21065 45 1235 v 4191 20733 a Fi(P)142 b Fh(\()p 5385 19919 768 45 v Fi(A)p Fh(\))285 b(=)g Fi(:)p Fh(6)p 9355 21065 45 1235 v 1329 w Fi(P)142 b Fh(\()p 11236 19919 825 45 v Fi(B)49 b Fg(j)p 12344 19919 768 45 v Fi(A)p Fh(\))285 b(=)g Fi(:)p Fh(3)p 16314 21065 45 1235 v 1329 w Fi(P)142 b Fh(\()p 18195 19919 802 45 v Fi(C)71 b Fg(j)p 19281 19919 768 45 v Fi(A)p Fh(\))284 b(=)h Fi(:)p Fh(4)p 23251 21065 45 1235 v 3505 22299 V 4191 21967 a Fi(P)142 b Fh(\()p Fi(A)p Fh(\))285 b(=)g Fi(:)p Fh(4)p 9355 22299 V 1329 w Fi(P)142 b Fh(\()p Fi(B)50 b Fg(j)p 12345 21154 768 45 v Fi(A)o Fh(\))285 b(=)g Fi(:)p Fh(7)p 16314 22299 45 1235 v 1329 w Fi(P)142 b Fh(\()p Fi(C)71 b Fg(j)p 19281 21154 768 45 v Fi(A)p Fh(\))284 b(=)h Fi(:)p Fh(6)p 23251 22299 45 1235 v 3505 23533 V 9355 23533 V 10042 23201 a Fi(P)142 b Fh(\()p 11236 22388 825 45 v Fi(B)49 b Fg(j)p Fi(A)p Fh(\))285 b(=)g Fi(:)p Fh(5)p 16314 23533 45 1235 v 1329 w Fi(P)142 b Fh(\()p 18195 22388 802 45 v Fi(C)71 b Fg(j)p Fi(A)p Fh(\))284 b(=)h Fi(:)p Fh(8)p 23251 23533 45 1235 v 3505 24640 45 1107 v 9355 24640 V 10042 24308 a Fi(P)142 b Fh(\()p Fi(B)50 b Fg(j)p Fi(A)p Fh(\))284 b(=)h Fi(:)p Fh(5)p 16314 24640 V 1329 w Fi(P)142 b Fh(\()p Fi(C)71 b Fg(j)p Fi(A)p Fh(\))284 b(=)h Fi(:)p Fh(2)p 23251 24640 V 3527 24685 19746 45 v 400 25080 26198 45 v 378 26187 45 1107 v 1064 25855 a Fi(\025)p Fh(\()p Fi(B)50 b(;)171 b(C)71 b Fh(\))285 b(:)p 7855 26187 V 8076 26187 V 3654 w Fi(\025)9359 25966 y Ff(1)9821 25855 y Fh(\()p Fi(B)50 b Fh(\))p Fi(;)171 b(\025)12494 25966 y Ff(2)12955 25855 y Fh(\()p Fi(C)71 b Fh(\))285 b(:)p 15764 26187 V 15986 26187 V 1550 w Fi(\025)17269 25966 y Ff(1)17731 25855 y Fh(\()p Fi(B)50 b Fh(\))227 b Fg(\001)h Fi(\025)20688 25966 y Ff(2)21149 25855 y Fh(\()p Fi(C)71 b Fh(\))285 b(:)p 26575 26187 V 400 26231 26198 45 v 378 27465 45 1235 v 1064 27133 a Fi(\025)p Fh(\()p 2059 26319 825 45 v Fi(B)50 b(;)p 3339 26319 802 45 v 171 w(C)71 b Fh(\))285 b(=)f Fi(:)p Fh(23)p 7855 27465 45 1235 v 8076 27465 V 1550 w Fi(\025)9359 27244 y Ff(1)9821 27133 y Fh(\()p 10219 26319 825 45 v Fi(B)50 b Fh(\))284 b(=)h(1)p 15764 27465 45 1235 v 15986 27465 V 3353 w Fi(\025)17269 27244 y Ff(1)17731 27133 y Fh(\()p 18129 26319 825 45 v Fi(B)49 b Fh(\))228 b Fg(\001)g Fi(\025)20688 27244 y Ff(2)21149 27133 y Fh(\()p 21547 26319 802 45 v Fi(C)71 b Fh(\))285 b(=)g Fi(:)p Fh(23)p 26575 27465 45 1235 v 378 28699 V 1064 28367 a Fi(\025)p Fh(\()p 2059 27554 825 45 v Fi(B)50 b(;)171 b(C)71 b Fh(\))285 b(=)f Fi(:)p Fh(15)p 7855 28699 45 1235 v 8076 28699 V 1550 w Fi(\025)9359 28478 y Ff(1)9821 28367 y Fh(\()p Fi(B)50 b Fh(\))284 b(=)h(1)p Fi(:)p Fh(41)p 15764 28699 V 15986 28699 V 2045 w Fi(\025)17269 28478 y Ff(1)17731 28367 y Fh(\()p 18129 27554 825 45 v Fi(B)49 b Fh(\))228 b Fg(\001)g Fi(\025)20688 28478 y Ff(2)21149 28367 y Fh(\()p Fi(C)71 b Fh(\))285 b(=)g Fi(:)p Fh(207)p 26575 28699 45 1235 v 8098 28744 7910 45 v 378 29934 45 1235 v 1064 29602 a Fi(\025)p Fh(\()p Fi(B)50 b(;)p 3339 28788 802 45 v 171 w(C)71 b Fh(\))285 b(=)f Fi(:)p Fh(33)p 7855 29934 45 1235 v 8076 29934 V 1550 w Fi(\025)9359 29713 y Ff(2)9821 29602 y Fh(\()p 10219 28788 802 45 v Fi(C)71 b Fh(\))285 b(=)f Fi(:)p Fh(232)p 15764 29934 45 1235 v 15986 29934 V 2068 w Fi(\025)17269 29713 y Ff(1)17731 29602 y Fh(\()p Fi(B)50 b Fh(\))227 b Fg(\001)h Fi(\025)20688 29713 y Ff(2)21149 29602 y Fh(\()p 21547 28788 802 45 v Fi(C)71 b Fh(\))285 b(=)g Fi(:)p Fh(33)p 26575 29934 45 1235 v 378 31041 45 1107 v 1064 30709 a Fi(\025)p Fh(\()p Fi(B)50 b(;)171 b(C)71 b Fh(\))285 b(=)f Fi(:)p Fh(29)p 7855 31041 V 8076 31041 V 1550 w Fi(\025)9359 30820 y Ff(2)9821 30709 y Fh(\()p Fi(C)71 b Fh(\))285 b(=)f Fi(:)p Fh(207)p 15764 31041 V 15986 31041 V 2068 w Fi(\025)17269 30820 y Ff(1)17731 30709 y Fh(\()p Fi(B)50 b Fh(\))227 b Fg(\001)h Fi(\025)20688 30820 y Ff(2)21149 30709 y Fh(\()p Fi(C)71 b Fh(\))285 b(=)g Fi(:)p Fh(29)p 26575 31041 V 400 31085 26198 45 v 534 33686 a Ft(Figure)369 b(2:)493 b(Appro)-31 b(ximating)373 b Fr(\025)p Ft(\()p Fr(B)56 b(;)184 b(C)79 b Ft(\))370 b(with)g Fr(\025)20340 33852 y Fp(1)20837 33686 y Ft(\()p Fr(B)56 b Ft(\))246 b Fq(\001)g Fr(\025)24038 33852 y Fp(2)24535 33686 y Ft(\()p Fr(C)79 b Ft(\))400 36398 y(The)464 b Fs(width)548 b Ft(of)465 b(a)f(graph)g(is)g(a)g(measure)g(of)h(its)f(densit)-31 b(y)-92 b(.)778 b(It)400 37727 y(is)546 b(determined)g(b)-31 b(y)546 b(rep)31 b(eatedly)546 b(deleting)h(the)f(no)31 b(de)546 b(with)400 39055 y(the)f(minim)-31 b(um)546 b(n)-31 b(um)g(b)31 b(er)544 b(of)h(neigh)-31 b(b)31 b(ors)545 b(\(without)i(adding)400 40383 y(new)446 b(edges\))h(un)-31 b(til)448 b(the)e(graph)h(is)f(empt)-31 b(y)-92 b(.)725 b(The)446 b(maxim)-31 b(um)400 41712 y(n)g(um)g(b)31 b(er)298 b(of)g(neigh)-31 b(b)31 b(ors)298 b(a)g(no)31 b(de)298 b(had)g(when)g(it)g(w)-31 b(as)298 b(deleted)h(is)400 43040 y(the)352 b(width.)488 b(If)352 b(the)g(width)h(is)f(b)31 b(ounded)352 b(b)-31 b(y)352 b Fr(i)p Ft(,)k(then)c(v)-61 b(ariable)400 44368 y(elimination)266 b(can)d(\014nish)f(the)g(problem) i(without)g(in)-31 b(tro)31 b(ducing)400 45697 y(a)318 b(new)g(function)g(on)g(more)g(than)g Fr(i)g Ft(v)-61 b(ariables,)329 b Fs(if)553 b Ft(it)318 b(do)31 b(es)317 b(not)400 47025 y(add)369 b(an)-31 b(y)370 b(new)g(edges.)400 49018 y(Appro)-31 b(ximate)371 b(decomp)31 b(osition)371 b(w)-31 b(orks)368 b(lik)-31 b(e)370 b(v)-61 b(ariable)369 b(elimi-)400 50346 y(nation,)347 b(except)338 b(that)i(after)f (eliminating)j(a)c(v)-61 b(ariable,)346 b(it)339 b(will)400 51674 y(delete)410 b(newly)g(added)f(edges)g(as)g(necessary)f(to)i (ensure)e(that)400 53003 y(the)387 b(width)g(of)g(the)g(graph)g (remains)g(b)31 b(ounded)386 b(b)-31 b(y)387 b Fr(i)p Ft(.)545 b(W)-92 b(e)386 b(do)400 54331 y(not)475 b(allo)-31 b(w)477 b(the)d(algorithm)k(to)d(eliminate)i(a)d(v)-61 b(ariable)476 b(with)400 55659 y(more)421 b(than)h Fr(i)f Ft(neigh)-31 b(b)31 b(ors.)647 b(Ho)-31 b(w)g(ev)g(er)423 b(if)e(the)g(width)h(limit)h(is)400 56988 y(main)-31 b(tained,)448 b(it)430 b(will)h(alw)-31 b(a)g(ys)431 b(b)31 b(e)429 b(able)h(to)f(\014nish)h(the)f(prob-)400 58316 y(lem,)445 b(in)429 b(the)g(w)-31 b(orst)429 b(case)g(b)-31 b(y)428 b(immediately)k(deleting)f(ev)-31 b(ery)400 59644 y(new)369 b(edge.)400 61637 y(As)297 b(an)h(example,)313 b(supp)31 b(ose)297 b(appro)-31 b(ximate)300 b(decomp)31 b(osition)300 b(is)400 62965 y(run)443 b(on)h(the)f(problem)h(in)g (\014gure)f(1)h(to)g(compute)h(an)f(upp)31 b(er)400 64294 y(b)g(ound)284 b(on)h(the)f(probabilit)-31 b(y)287 b(of)e(the)g(query) -92 b(,)301 b(with)286 b(an)e Fr(i)h Ft(b)31 b(ound)400 65622 y(of)519 b(2.)939 b(This)519 b(means)f(that)i(w)-31 b(e)518 b(do)h(not)f(w)-31 b(an)g(t)520 b(to)f(record)f(a)400 66950 y(function)451 b(with)h(arit)-31 b(y)451 b(higher)f(than)h(2.)735 b(Starting)451 b(with)h(the)400 68279 y(moral)494 b(graph)f(in)g(the)g (middle,)525 b(whic)-31 b(h)494 b(has)e(a)h(width)h(of)f(2,)400 69607 y(v)-61 b(ariable)277 b Fr(F)428 b Ft(is)276 b(eliminated)i (\014rst.)461 b(This)276 b(can)f(b)31 b(e)275 b(done)h(exactly)400 70935 y(since)405 b(it)i(only)f(has)f(2)h(neigh)-31 b(b)31 b(ors.)602 b(The)406 b(result)f(is)h(sho)-31 b(wn)406 b(on)400 72264 y(the)c(righ)-31 b(t)403 b(hand)f(side)f(of)i(the)f (\014gure.)590 b(It)401 b(still)i(has)f(width)h(2.)400 73592 y(The)369 b(next)h(v)-61 b(ariable)370 b(to)g(b)31 b(e)369 b(eliminated)j(is)d Fr(A)p Ft(.)p 28400 44 27095 45 v 28400 25431 45 25388 v 29118 1068 a Fe(The)393 b(Main)g(AD)g (Algorithm)29118 2575 y(Input:)1046 b Fd(Functions)523 b Fi(F)142 b Fd(,)524 b(query)f(variable)g Fi(X)49123 2686 y Fc(q)49581 2575 y Fd(,)29118 3682 y(operators)g Fg(\012)g Fd(and)h Fg(\014)p Fd(,)f(complexity)g(bound)h Fi(i)p Fd(.)29118 4789 y Fe(Output:)1047 b Fd(Bound)523 b(on)g(the)g(value)g(of)g(the)g(query.)29118 6696 y(Let)g Fi(G)284 b Fh(=)h(\()p Fi(V)57 b(;)171 b(E)57 b Fh(\))524 b Fd(be)f Fi(F)142 b Fd('s)523 b(graph.)1046 b(While)523 b Fg(j)p Fi(V)228 b Fg(j)285 b Fi(>)g Fh(1)p Fd(:)29732 8689 y(1.)554 b(Choose)523 b Fi(X)35839 8800 y Fc(j)37337 8689 y Fg(2)1065 b Fi(V)57 b(;)171 b(X)41040 8800 y Fc(j)42538 8689 y Fg(6)p Fh(=)1065 b Fi(X)45245 8800 y Fc(q)46226 8689 y Fd(with)523 b(the)g(smallest)31332 9796 y(number)g(of)g(pairs)g (of)g(unconnected)h(neighbors.)29732 11788 y(2.)554 b(Let)523 b Fi(F)34078 11899 y Fc(j)35361 11788 y Fh(=)850 b Fg(f)p Fi(f)958 b Fg(2)849 b Fi(F)142 b Fg(j)p Fi(f)632 b Fd(mentions)523 b Fi(X)48268 11899 y Fc(j)48701 11788 y Fg(g)p Fd(.)1046 b(Set)523 b Fi(\025)850 b Fh(=)31332 12895 y Fg(\012)32128 13006 y Fc(X)32793 13146 y Fn(j)33490 12895 y Fg(\014)34286 13050 y Fb(f)p Fc(f)76 b Fb(2)p Fc(F)36253 13190 y Fn(j)36667 13050 y Fb(g)37374 12895 y Fi(f)108 b Fd(,)524 b Fi(F)426 b Fh(=)285 b Fi(\025)228 b Fg([)f Fh(\()p Fi(F)370 b Fg(\000)228 b Fi(F)46022 13006 y Fc(j)46455 12895 y Fh(\))p Fd(.)29732 14888 y(3.)554 b(Connect)523 b(all)g Fi(X)38454 14999 y Fc(j)38887 14888 y Fd('s)h(neighbors)f(in)g Fi(G)p Fd(,)g(delete)g Fi(X)53611 14999 y Fc(j)54044 14888 y Fd(.)31332 15995 y(If)g(width)p Fh(\()p Fi(G)p Fh(\))284 b Fi(>)h(i)p Fd(,)31423 17766 y(\(a\))554 b(Delete)523 b(new)g(edges)g(until)g(width)p Fh(\()p Fi(G)p Fh(\))285 b Fg(\024)g Fi(i)p Fd(.)31423 19094 y(\(b\))554 b(Let)523 b Fg(f)p Fi(C)36881 19205 y Ff(1)37342 19094 y Fi(;)171 b(:::;)h(C)39836 19205 y Fc(m)40618 19094 y Fg(g)523 b Fd(be)g(the)g(maximal)g(cliques)33546 20201 y(among)g Fi(X)37530 20312 y Fc(j)37963 20201 y Fd('s)g(neighbors.)31423 21529 y(\(c\))554 b(Let)523 b Fi(\025)36235 21640 y Fc(i)37109 21529 y Fd(have)g(scope)h Fi(C)43594 21640 y Fc(i)43945 21529 y Fd(,)f(and)g(use)g(approximate)33546 22636 y(decomposition)g (to)g(bound)g Fi(\025)h Fd(by)f Fg(\014)49061 22747 y Fc(i)49412 22636 y Fi(\025)50009 22747 y Fc(i)50361 22636 y Fd(.)31423 23965 y(\(d\))554 b(Set)523 b Fi(F)426 b Fh(=)285 b Fg(f)p Fi(\025)38908 24076 y Fc(i)39259 23965 y Fg(g)228 b([)f Fh(\()p Fi(F)370 b Fg(\000)228 b Fi(\025)p Fh(\))p Fd(.)p 55450 25431 V 28400 25475 27095 45 v 32910 27535 a Ft(Figure)369 b(3:)493 b(The)370 b(Main)f(AD)g(Algorithm)28400 30185 y(In)687 b(the)g(top)h(of)g(\014gure)f(2)h(w)-31 b(e)688 b(sho)-31 b(w)687 b(the)h(CPTs)g Fr(P)154 b Ft(\()p Fr(A)p Ft(\),)28400 31514 y Fr(P)g Ft(\()p Fr(B)56 b Fq(j)p Fr(A)p Ft(\),)429 b(and)418 b Fr(P)154 b Ft(\()p Fr(C)79 b Fq(j)p Fr(A)p Ft(\))418 b(whic)-31 b(h)418 b(men)-31 b(tion)419 b Fr(A)p Ft(.)635 b(On)417 b(the)g(b)31 b(ot-)28400 32842 y(tom)554 b(left)h(of)e(\014gure)g(2)h(is)f(the)h (new)f(function)i Fr(\025)p Ft(\()p Fr(B)56 b(;)184 b(C)79 b Ft(\))615 b(=)28400 33340 y Fm(P)29568 34502 y Fo(A)30474 34170 y Fr(P)154 b Ft(\()p Fr(A)p Ft(\))p Fr(P)g Ft(\()p Fr(B)56 b Fq(j)p Fr(A)p Ft(\))p Fr(P)154 b Ft(\()p Fr(C)79 b Fq(j)p Fr(A)p Ft(\))346 b(whic)-31 b(h)346 b(results)d(from)i (eliminat-)28400 35499 y(ing)308 b Fr(A)p Ft(.)471 b(This)308 b(new)e(function)j(adds)d(an)h(edge)g(b)31 b(et)-31 b(w)g(een)308 b Fr(B)362 b Ft(and)28400 36827 y Fr(C)79 b Ft(.)575 b(The)396 b(remaining)j(graph)d(is)h(then)g(a)f(clique)i(on)e(four)h(v) -31 b(er-)28400 38155 y(tices,)467 b(with)449 b(a)e(width)h(of)g(3.)726 b(This)448 b(w)-31 b(ould)448 b(exceed)f Fr(i)h Ft(and)f(is)28400 39484 y(therefore)340 b(not)g(acceptable.)484 b(So)340 b(after)g(computing)h Fr(\025)p Ft(\()p Fr(B)56 b(;)184 b(C)79 b Ft(\),)28400 40812 y(w)-31 b(e)370 b(replace)g(it)g(with)g (the)g(pro)31 b(duct)369 b(of)h(t)-31 b(w)g(o)371 b(unary)f(functions) 28400 42140 y Fr(\025)29046 42306 y Fp(1)29542 42140 y Ft(\()p Fr(B)56 b Ft(\))286 b(and)f Fr(\025)34298 42306 y Fp(2)34794 42140 y Ft(\()p Fr(C)79 b Ft(\))287 b(whic)-31 b(h)286 b(is)f(an)h(upp)31 b(er)284 b(b)31 b(ound.)465 b(In)285 b(the)g(b)31 b(ot-)28400 43469 y(tom)428 b(middle)h(of)e(the)h (\014gure)f(w)-31 b(e)427 b(sho)-31 b(w)428 b(example)h(v)-61 b(alues)427 b(for)28400 44797 y Fr(\025)29046 44963 y Fp(1)29542 44797 y Ft(\()p Fr(B)56 b Ft(\))481 b(and)g Fr(\025)34689 44963 y Fp(2)35185 44797 y Ft(\()p Fr(C)79 b Ft(\),)510 b(and)481 b(at)h(the)f(b)31 b(ottom)482 b(righ)-31 b(t)482 b(w)-31 b(e)481 b(sho)-31 b(w)28400 46125 y(the)467 b(upp)31 b(er)467 b(b)31 b(ound)467 b(that)h(they)g (represen)-31 b(t.)785 b(The)468 b(b)31 b(ound)467 b(is)28400 47454 y(not)h(tigh)-31 b(t)469 b(only)f(in)g(the)f(case)g(where)g Fr(B)522 b Ft(is)467 b(false)h(and)g Fr(C)546 b Ft(is)28400 48782 y(true.)858 b(This)491 b(substitution)i(is)e(equiv)-61 b(alen)-31 b(t)493 b(to)f(deleting)h(the)28400 50110 y(edge)531 b(b)31 b(et)-31 b(w)g(een)532 b Fr(B)586 b Ft(and)531 b Fr(C)79 b Ft(.)979 b(After)531 b(that,)573 b(v)-61 b(ariable)532 b(elimi-)28400 51439 y(nation)477 b(can)e(pro)31 b(cess)474 b(the)h(rest)g(of)h(the)f(problem)h(normally) 28400 52767 y(without)371 b(violating)i(the)c Fr(i)h Ft(b)31 b(ound.)28400 54760 y(In)620 b(general,)685 b(appro)-31 b(ximate)624 b(decomp)31 b(osition)623 b(computes)f(a)28400 56088 y(b)31 b(ound)255 b(on)g(the)g(v)-61 b(alue)256 b(of)f(a)g(query)g(v)-61 b(ariable,)279 b(giv)-31 b(en)256 b Fq(\012)p Ft(,)279 b Fq(\014)p Ft(,)f(and)28400 57416 y(the)415 b(complexit)-31 b(y)417 b(b)31 b(ound)415 b Fr(i)p Ft(.)629 b(Assuming)415 b(that)h(the)f(width)g(of)28400 58745 y(the)341 b(b)31 b(elief)342 b(net)-31 b(w)g(ork's)342 b(moral)h(graph)e(is)g(initially)j(no)d(greater)28400 60073 y(than)k Fr(i)p Ft(,)350 b(it)c(eliminates)h(v)-61 b(ariables)345 b(lik)-31 b(e)346 b(v)-61 b(ariable)345 b(elimination)28400 61401 y(so)491 b(long)i(as)f(the)f(new)h(edges)f (do)h(not)g(cause)g(the)g(width)g(of)28400 62730 y(the)439 b(graph)g(to)g(exceed)g Fr(i)p Ft(.)701 b(If)438 b(this)h(do)31 b(es)438 b(happ)31 b(en,)457 b(then)439 b(the)28400 64058 y(new)354 b(edge)h(with)g(the)f(maxim)-31 b(um)357 b(sum)d(of)g(endp)31 b(oin)-31 b(t)355 b(degrees)28400 65387 y(is)408 b(deleted)g(un)-31 b(til)410 b(the)e(limit)i(is)e(met.)609 b(If)408 b Fr(C)46533 65553 y Fp(1)47030 65387 y Fr(;)184 b(:::;)g(C)49724 65553 y Fo(m)50976 65387 y Ft(are)408 b(the)28400 66715 y(maximal)365 b(cliques)d(of)g(the)g(subgraph)g(induced)g(b)-31 b(y)362 b(the)g(elim-)28400 68043 y(inated)483 b(v)-61 b(ariable's)483 b(neigh)-31 b(b)31 b(ors,)510 b(w)-31 b(e)482 b(w)-31 b(an)g(t)484 b(to)e(appro)-31 b(ximate)28400 69372 y(the)416 b(exact)h(elimination)i(function)e Fr(\025)f Ft(with)h Fq(\014)48021 69538 y Fo(i)48389 69372 y Fr(\025)49035 69538 y Fo(i)49403 69372 y Ft(,)428 b(where)416 b Fr(\025)54032 69538 y Fo(i)28400 70700 y Ft(has)397 b(scop)31 b(e)396 b Fr(C)34209 70866 y Fo(i)34578 70700 y Ft(.)1149 b(T)-92 b(o)397 b(do)g(this,)405 b(a)397 b(linear)g(program)h(is)e(set)h(up) 28400 72028 y(and)451 b(solv)-31 b(ed.)736 b(The)451 b(details)h(of)e(this)h(step)f(are)g(giv)-31 b(en)452 b(in)f(the)28400 73357 y(next)385 b(subsection.)539 b(This)384 b(de\014nes)g(v)-61 b(alues)385 b(for)f(the)h(b)31 b(ounding)p eop end %%Page: 4 4 TeXDict begin 4 3 bop 400 1107 a Ft(functions)301 b Fq(f)p Fr(\025)6302 1273 y Fo(i)6671 1107 y Fq(g)p Ft(,)315 b(whic)-31 b(h)301 b(then)f(replace)g Fr(\025)p Ft(,)314 b(allo)-31 b(wing)304 b(v)-61 b(ariable)400 2435 y(elimination)392 b(to)c(con)-31 b(tin)g(ue.)1100 b(The)388 b(\014nal)h(result)f(is)g(an) g(upp)31 b(er)400 3764 y(or)346 b(lo)-31 b(w)g(er)348 b(b)31 b(ound)346 b(on)h(the)f(original)j(query)-92 b(.)484 b(If)346 b(a)h(b)31 b(ound)346 b(from)400 5092 y(the)439 b(other)f(direction)i(is)e(desired,)456 b(the)438 b(algorithm)j(m)-31 b(ust)439 b(b)31 b(e)400 6420 y(run)530 b(again)j(from)f(the)f(b)31 b(eginning.)979 b(Pseudo)31 b(co)g(de)531 b(for)g(this)400 7749 y(main)370 b(algorithm)i(is)d(giv)-31 b(en)371 b(in)e(\014gure)g (3.)400 10561 y Fv(3.2)1274 b(THE)424 b(APPR)-35 b(O)g(XIMA)-106 b(TE)3300 11889 y(DECOMPOSITION)426 b(STEP)400 14263 y Ft(In)621 b(this)g(subsection)h(w)-31 b(e)621 b(describ)31 b(e)621 b(the)g(linear)h(program-)400 15591 y(ming)467 b(step)f(whic)-31 b(h)467 b(is)f(used)f(to)i(compute)g(v)-61 b(alues)466 b(for)g(a)g(set)400 16919 y(of)535 b(functions)h Fq(f)p Fr(\025)7963 17085 y Fp(1)8460 16919 y Fr(;)184 b(\025)9597 17085 y Fp(2)10094 16919 y Fr(;)g(:::;)g(\025)12643 17085 y Fo(m)13487 16919 y Fq(g)535 b Ft(suc)-31 b(h)535 b(that)h(their)f(pro)31 b(duct)400 18248 y Fr(\025)1046 17846 y Fl(0)1664 18248 y Ft(=)2832 17418 y Fm(Q)3878 18580 y Fo(i)4431 18248 y Fr(\025)5077 18414 y Fo(i)5771 18248 y Ft(is)326 b(a)g(go)31 b(o)g(d)327 b(b)31 b(ound)326 b(on)g Fr(\025)p Ft(.)478 b(W)-92 b(e)325 b(will)j(assume)e(that)400 19576 y Fr(L)427 b Ft(is)h(the)f(scop)31 b(e)427 b(of)h Fr(\025)f Ft(and)g Fr(\025)13011 19174 y Fl(0)13321 19576 y Ft(.)667 b(The)428 b(tec)-31 b(hnique)428 b(needed)f(to)400 20904 y(appro)-31 b(ximate)282 b Fr(\025)c Ft(with)i(a)f(sum)g(of)g (functions)h(is)f(m)-31 b(uc)g(h)279 b(simpler)400 22233 y(and)369 b(is)h(outlined)g(brie\015y)g(at)g(the)f(end.)400 24902 y Fv(3.2.1)1274 b(What)424 b(is)g(a)g(Go)35 b(o)g(d)427 b(Bound?)400 27133 y Ft(W)-92 b(e)895 b(will)i(use)e(the)h(notation)j Fr(E)16094 27299 y Fo(F)16830 27133 y Ft(\()p Fr(H)90 b Ft(\()p Fr(F)154 b Ft(\)\))897 b(to)f(denote)400 27631 y Fm(P)1568 28793 y Fo(f)2327 28461 y Fr(P)154 b Ft(\()p Fr(F)564 b Ft(=)410 b Fr(f)119 b Ft(\))p Fr(H)90 b Ft(\()p Fr(f)119 b Ft(\),)448 b(that)432 b(is,)447 b(the)431 b(exp)31 b(ected)431 b(v)-61 b(alue)432 b(of)f Fr(H)400 29789 y Ft(as)369 b(a)h(function)g(of)g(the)f(random)h(v)-61 b(ariable)370 b Fr(F)154 b Ft(.)400 32223 y Fv(De\014nition)426 b(1)553 b Fs(L)-57 b(et)483 b Fr(\025)e Fs(b)-57 b(e)482 b(a)f(function)i(with)e(sc)-57 b(op)g(e)482 b Fr(L)p Fs(,)503 b(and)400 33552 y(let)404 b Fr(F)154 b Ft(\()p Fr(x)3893 33718 y Fo(L)4556 33552 y Ft(\))405 b Fs(b)-57 b(e)405 b(a)f(c)-57 b(ol)57 b(le)-57 b(ction)406 b(of)f(r)-57 b(andom)404 b(variables,)j(one)e(for)400 34880 y(e)-57 b(ach)355 b(assignment)f Fr(x)9181 35046 y Fo(L)10198 34880 y Fs(to)f Fr(L)p Fs(.)496 b(L)-57 b(et)355 b Fr(\025)15588 34478 y Fl(0)16252 34880 y Fs(b)-57 b(e)355 b(a)f(b)-57 b(ound)355 b(on)f Fr(\025)p Fs(,)363 b(also)400 36208 y(with)498 b(sc)-57 b(op)g(e)498 b Fr(L)p Fs(,)524 b(and)498 b(supp)-57 b(ose)498 b Fq(\012)492 b(2)g(f)p Ft(+)p Fr(;)184 b Ft(max)s Fq(g)p Fs(.)816 b(Then)498 b(we)400 37537 y(de\014ne)450 b(the)532 b Ft(cost)450 b Fs(of)f Fr(\025)10015 37135 y Fl(0)10774 37537 y Fs(to)g(b)-57 b(e)450 b Fr(C)79 b Ft(\()p Fr(\025)15514 37135 y Fl(0)15825 37537 y Ft(\))404 b(=)g Fr(E)18741 37703 y Fo(F)19477 37537 y Ft(\()p Fq(j)285 b(\012)21360 37703 y Fo(x)21862 37814 y Fn(L)22786 37537 y Fr(F)154 b Ft(\()p Fr(x)24715 37703 y Fo(L)25378 37537 y Ft(\))285 b Fq(\001)400 38865 y Fr(\025)1046 38463 y Fl(0)1356 38865 y Ft(\()p Fr(x)2419 39031 y Fo(L)3082 38865 y Ft(\))247 b Fq(\000)f(\012)5727 39031 y Fo(x)6229 39142 y Fn(L)6868 38865 y Fr(F)154 b Ft(\()p Fr(x)8797 39031 y Fo(L)9459 38865 y Ft(\))247 b Fq(\001)f Fr(\025)p Ft(\()p Fr(x)12398 39031 y Fo(L)13061 38865 y Ft(\))p Fq(j)p Ft(\))p Fs(.)400 41299 y Ft(The)401 b(cost)h(of)f Fr(\025)6959 40897 y Fl(0)7671 41299 y Ft(is)g(a)g(measure)g(of)h(the)f (error)f(in)i(the)f(b)31 b(ound)400 42627 y(on)540 b(the)g(\014nal)g (query)g(that)h(results)e(from)h(substituting)i Fr(\025)26090 42226 y Fl(0)400 43956 y Ft(for)327 b Fr(\025)p Ft(,)336 b(assuming)328 b(that)h(all)f(previous)f(and)h(subsequen)-31 b(t)327 b(com-)400 45284 y(putation)633 b(is)e(exact.)1278 b(In)630 b(the)h(case)g(of)g(b)31 b(elief)631 b(inference,)400 46612 y(for)585 b(example,)642 b(if)586 b Fr(\025)9101 46211 y Fl(0)9996 46612 y Ft(is)f(an)h(upp)31 b(er)584 b(b)31 b(ound)586 b(on)f(the)h(func-)400 47941 y(tion)368 b Fr(\025)e Ft(that)h(results)f(from)h(eliminating)k Fr(X)18908 48107 y Fo(k)19452 47941 y Ft(,)d(the)e(query)g(er-)400 49269 y(ror)k(is)3306 48439 y Fm(P)4474 49601 y Fl(f)p Fo(X)5654 49712 y Fk(1)6086 49601 y Fo(;:::;X)8127 49718 y Fn(k)9 b Fj(\000)p Fk(1)9587 49601 y Fl(g)10280 48439 y Fm(Q)11325 49601 y Fo(i)11878 49269 y Fr(f)12420 49435 y Fo(i)12789 49269 y Fr(\025)13435 48867 y Fl(0)13992 49269 y Fq(\000)15100 48439 y Fm(P)16269 49601 y Fl(f)p Fo(X)17449 49712 y Fk(1)17880 49601 y Fo(;:::;X)19921 49718 y Fn(k)g Fj(\000)p Fk(1)21381 49601 y Fl(g)22074 48439 y Fm(Q)23120 49601 y Fo(i)23673 49269 y Fr(f)24215 49435 y Fo(i)24583 49269 y Fr(\025)310 b Ft(=)400 49924 y Fm(P)1568 51086 y Fo(x)2070 51197 y Fn(L)2895 50754 y Fr(F)154 b Ft(\()p Fr(x)4824 50920 y Fo(L)5486 50754 y Ft(\))p Fr(\025)6562 50352 y Fl(0)6873 50754 y Ft(\()p Fr(x)7936 50920 y Fo(L)8598 50754 y Ft(\))119 b Fq(\000)10127 49924 y Fm(P)11297 51086 y Fo(x)11799 51197 y Fn(L)12623 50754 y Fr(F)154 b Ft(\()p Fr(x)14552 50920 y Fo(L)15214 50754 y Ft(\))p Fr(\025)p Ft(\()p Fr(x)17353 50920 y Fo(L)18016 50754 y Ft(\),)319 b(where)306 b Fr(F)154 b Ft(\()p Fr(x)24139 50920 y Fo(L)24801 50754 y Ft(\))308 b(=)400 51252 y Fm(P)1568 52414 y Fl(f)p Fo(X)2748 52525 y Fk(1)3180 52414 y Fo(;:::;X)5221 52531 y Fn(k)9 b Fj(\000)p Fk(1)6681 52414 y Fl(g\000)p Fo(L)8673 51252 y Fm(Q)9719 52414 y Fo(i)10272 52082 y Fr(f)10814 52248 y Fo(i)11644 52082 y Ft(is)462 b(the)g(set)g(of)g(random)h(v)-61 b(ariables)400 53411 y(summarizing)598 b(our)f(uncertain)-31 b(t)g(y)598 b(ab)31 b(out)598 b(the)f(rest)f(of)h(the)400 54739 y(problem.)400 56731 y(In)459 b(general)h(the)g(random)h(v)-61 b(ariables)460 b Fr(F)154 b Ft(\()p Fr(x)18540 56897 y Fo(L)19202 56731 y Ft(\))460 b(can)g(encapsu-)400 58060 y(late)503 b(an)-31 b(y)502 b(kno)-31 b(wledge)504 b(w)-31 b(e)502 b(ma)-31 b(y)503 b(ha)-31 b(v)g(e)503 b(ab)31 b(out)502 b(the)g(remain-)400 59388 y(der)486 b(of)g(the)h(problem.)844 b(W)-92 b(e)486 b(will)i(mak)-31 b(e)487 b(the)f(most)h(conser-)400 60716 y(v)-61 b(ativ)-31 b(e)419 b(assumption,)431 b(that)418 b(nothing)h(at)f(all)g(ab)31 b(out)418 b(the)f(rest)400 62045 y(of)409 b(the)g(problem)h(is)e(kno)-31 b(wn.)613 b(The)409 b(random)g(v)-61 b(ariables)410 b(then)400 63373 y(are)488 b(tak)-31 b(en)489 b(to)g(b)31 b(e)487 b(indep)31 b(enden)-31 b(t,)519 b(iden)-31 b(tically)491 b(distributed,)400 64702 y(and)403 b(uniform.)594 b(The)403 b(cost)g(of)g(the)g(b)31 b(ound)402 b Fr(\025)19221 64300 y Fl(0)19934 64702 y Ft(then)h(dep)31 b(ends)400 66030 y(only)473 b(on)g Fr(\025)p Ft(.)802 b(Theorem)473 b(1)g(states)g(that) h(the)e(cost)h(of)g Fr(\025)24292 65628 y Fl(0)25075 66030 y Ft(for)400 67358 y(b)31 b(elief)440 b(inference)g(\()p Fq(\012)425 b Ft(=)11141 66528 y Fm(P)12309 67358 y Ft(\))440 b(under)f(these)g(assumptions)i(is)400 68687 y Fr(k)1196 67856 y Fm(P)2364 69019 y Fo(x)2866 69130 y Fn(L)3690 68687 y Fq(j)p Fr(\025)4643 68285 y Fl(0)5201 68687 y Fq(\000)248 b Fr(\025)p Fq(j)p Ft(,)372 b(and)g(theorem)g(2)f(states)h (that)h(the)e(cost)h(for)400 70015 y(MPE)442 b(\()p Fq(\012)428 b Ft(=)g(max)q(\))442 b(is)f(no)h(greater)f(than)i(2)p Fr(k)19932 69185 y Fm(P)21100 70347 y Fo(x)21602 70458 y Fn(L)22426 70015 y Fq(j)p Fr(\025)23379 69613 y Fl(0)23984 70015 y Fq(\000)294 b Fr(\025)p Fq(j)p Ft(,)400 71343 y(where)380 b Fr(k)361 b Ft(=)325 b Fr(E)6552 71509 y Fo(F)7288 71343 y Ft(\()p Fr(F)154 b Ft(\()p Fr(x)9647 71509 y Fo(L)10310 71343 y Ft(\)\).)526 b(In)380 b(the)g(subsequen)-31 b(t)380 b(sections)g(w)-31 b(e)400 72672 y(will)535 b(assume)d(that)i (the)f(b)31 b(est)533 b(b)31 b(ound)532 b(for)h(b)31 b(oth)533 b(problems)400 74000 y(minimizes)371 b(the)e(sum)g(of)h (absolute)h(errors)c(\()p Fr(L)19789 74166 y Fp(1)20656 74000 y Ft(distance\).)28400 1107 y Fv(Theorem)426 b(1)554 b Fs(L)-57 b(et)617 b Fr(\025)f Fs(b)-57 b(e)618 b(a)e(function)i(on)f Fr(L)p Fs(,)673 b(and)616 b(let)h Fr(\025)54090 705 y Fl(0)28400 2435 y Fs(b)-57 b(ound)484 b(it.)772 b(L)-57 b(et)484 b Fr(F)154 b Ft(\()p Fr(x)37429 2601 y Fo(L)38092 2435 y Ft(\))484 b Fs(b)-57 b(e)484 b(a)f(c)-57 b(ol)57 b(le)-57 b(ction)485 b(of)e(i.)773 b(i.)f(d.)g(uni-)28400 3764 y(form)508 b(r)-57 b(andom)507 b(variables,)535 b(and)507 b(supp)-57 b(ose)507 b Fq(\012)i Ft(=)49560 2933 y Fm(P)50728 3764 y Fs(.)844 b(Then)28400 5092 y(the)481 b(c)-57 b(ost)481 b Fr(C)79 b Ft(\()p Fr(\025)34590 4690 y Fl(0)34901 5092 y Ft(\))463 b(=)f Fr(k)37912 4262 y Fm(P)39081 5424 y Fo(x)39583 5535 y Fn(L)40407 5092 y Fq(j)p Fr(\025)41360 4690 y Fl(0)41670 5092 y Ft(\()p Fr(x)42733 5258 y Fo(L)43396 5092 y Ft(\))309 b Fq(\000)e Fr(\025)p Ft(\()p Fr(x)47012 5258 y Fo(L)47675 5092 y Ft(\))p Fq(j)p Fs(,)504 b(wher)-57 b(e)481 b Fr(k)497 b Ft(=)28400 6420 y Fr(E)29217 6586 y Fo(F)29953 6420 y Ft(\()p Fr(F)154 b Ft(\()p Fr(x)32312 6586 y Fo(L)32975 6420 y Ft(\)\))p Fs(.)28400 9022 y Fv(Pro)35 b(of:)1040 b Ft(Assume)642 b Fr(\025)37905 8620 y Fl(0)38857 9022 y Ft(is)g(an)h(upp)31 b(er)641 b(b)31 b(ound.)1312 b(When)642 b(it)28400 10350 y(is)561 b(a)f(lo)-31 b(w)g(er)562 b(b)31 b(ound)561 b(the)g(pro)31 b(of)561 b(in)f(analogous.)1070 b(Let)560 b Fr(\017)627 b Ft(=)28400 11678 y Fr(\025)29046 11277 y Fl(0)29626 11678 y Fq(\000)270 b Fr(\025)p Ft(.)600 b(The)405 b(cost)h(is)f Fr(E)38905 11844 y Fo(F)39641 11678 y Ft(\()40071 10848 y Fm(P)41240 12011 y Fo(x)41742 12122 y Fn(L)42566 11678 y Fr(F)154 b Ft(\()p Fr(x)44495 11844 y Fo(L)45157 11678 y Ft(\))p Fq(\001)406 b Ft(\()p Fr(\025)p Ft(\()p Fr(x)48439 11844 y Fo(L)49102 11678 y Ft(\))271 b(+)e Fr(\017)p Ft(\()p Fr(x)52445 11844 y Fo(L)53109 11678 y Ft(\)\)\))28400 13007 y Fq(\000)p Fr(E)30078 13173 y Fo(F)30814 13007 y Ft(\()31244 12177 y Fm(P)32413 13339 y Fo(x)32915 13450 y Fn(L)33739 13007 y Fr(F)154 b Ft(\()p Fr(x)35668 13173 y Fo(L)36330 13007 y Ft(\))p Fq(\001)833 b Fr(\025)p Ft(\()p Fr(x)39609 13173 y Fo(L)40271 13007 y Ft(\)\).)1881 b(The)832 b(\014rst)f(exp)31 b(ectation)28400 14335 y Fr(E)29217 14501 y Fo(F)29953 14335 y Ft(\()30383 13505 y Fm(P)31552 14667 y Fo(x)32054 14778 y Fn(L)32878 14335 y Fr(F)154 b Ft(\()p Fr(x)34807 14501 y Fo(L)35469 14335 y Ft(\))488 b Fq(\001)p Ft(\()p Fr(\025)p Ft(\()p Fr(x)38833 14501 y Fo(L)39496 14335 y Ft(\))f(+)p Fr(\017)p Ft(\()p Fr(x)42786 14501 y Fo(L)43450 14335 y Ft(\)\)\))h(=)504 b Fr(E)47410 14501 y Fo(F)48146 14335 y Ft(\()48576 13505 y Fm(P)49745 14667 y Fo(x)50247 14778 y Fn(L)51071 14335 y Fr(F)154 b Ft(\()p Fr(x)53000 14501 y Fo(L)53662 14335 y Ft(\))p Fq(\001)28400 15663 y Fr(\025)p Ft(\()p Fr(x)30109 15829 y Fo(L)30772 15663 y Ft(\))295 b(+)32542 14833 y Fm(P)33711 15996 y Fo(x)34213 16107 y Fn(L)35037 15663 y Fr(F)154 b Ft(\()p Fr(x)36966 15829 y Fo(L)37629 15663 y Ft(\))99 b Fq(\001)g Fr(\017)p Ft(\()p Fr(x)40076 15829 y Fo(L)40740 15663 y Ft(\)\))296 b(=)308 b Fr(E)43882 15829 y Fo(F)44618 15663 y Ft(\()45048 14833 y Fm(P)46217 15996 y Fo(x)46719 16107 y Fn(L)47543 15663 y Fr(F)154 b Ft(\()p Fr(x)49472 15829 y Fo(L)50134 15663 y Ft(\))p Fq(\001)297 b Fr(\025)p Ft(\()p Fr(x)52877 15829 y Fo(L)53539 15663 y Ft(\)\))28400 16992 y(+)29445 16162 y Fm(P)30614 17324 y Fo(x)31116 17435 y Fn(L)31940 16992 y Fr(E)64 b Ft(\()p Fr(F)154 b Ft(\()p Fr(x)35180 17158 y Fo(L)35843 16992 y Ft(\)\))p Fq(\001)273 b Fr(\017)p Ft(\()p Fr(x)38795 17158 y Fo(L)39458 16992 y Ft(\).)460 b(Therefore)272 b(the)g(cost)g(reduces)e(to)28400 17490 y Fm(P)29568 18652 y Fo(x)30070 18763 y Fn(L)30895 18320 y Fr(E)31712 18486 y Fo(F)32448 18320 y Ft(\()p Fr(F)154 b Ft(\()p Fr(x)34807 18486 y Fo(L)35469 18320 y Ft(\)\))p Fq(\001)371 b Fr(\017)p Ft(\()p Fr(x)38519 18486 y Fo(L)39182 18320 y Ft(\),)f(as)f(desired.)492 b Fa(2)28400 20922 y Fv(Lemma)424 b(1)554 b Fs(L)-57 b(et)490 b Fr(\025)g Fs(b)-57 b(e)490 b(a)g(function)h(on)f Fr(L)p Fs(,)514 b(and)490 b(let)f Fr(F)154 b Ft(\()p Fr(x)53307 21088 y Fo(L)53970 20922 y Ft(\))28400 22250 y Fs(b)-57 b(e)479 b(a)f(c)-57 b(ol)57 b(le)-57 b(ction)479 b(of)g(i.)757 b(i.)f(d.)g(uniform)480 b(r)-57 b(andom)478 b(variables)28400 23578 y(e)-57 b(ach)485 b(with)f Fr(N)605 b Fs(p)-57 b(ossible)485 b(values)f(and)g(maximum)h(value)g Fr(M)121 b Fs(.)28400 24907 y(Then)527 b(the)g(pr)-57 b(ob)g(ability)529 b(that)d Fr(x)41877 25073 y Fo(L)43066 24907 y Fs(maximizes)h Fr(F)154 b Ft(\()p Fr(x)50505 25073 y Fo(L)51168 24907 y Ft(\))p Fr(\025)p Ft(\()p Fr(x)53307 25073 y Fo(L)53970 24907 y Ft(\))28400 26412 y Fs(is)29892 25976 y Fp(1)p 29721 26157 785 45 v 29721 26794 a Fo(N)30823 25582 y Fm(P)31991 26799 y Fl(f)p Fo(f)87 b Fl(2)p Fs(dom)n Fp(\()p Fo(F)119 b Fp(\()p Fo(x)37470 26910 y Fn(L)38055 26799 y Fp(\)\))p Fl(g)39440 25582 y Fm(Q)40486 26744 y Fl(f)p Fo(y)41389 26855 y Fn(L)41972 26744 y Fl(6)p Fp(=)p Fo(x)43154 26855 y Fn(L)43738 26744 y Fl(g)44742 25875 y Fo(f)87 b(\025)p Fp(\()p Fo(x)46634 25986 y Fn(L)47218 25875 y Fp(\))p 44564 26157 3178 45 v 44564 26794 a Fo(M)c(\025)p Fp(\()p Fo(y)46811 26905 y Fn(L)47396 26794 y Fp(\))47875 26412 y Fs(.)28400 29146 y Fv(Pro)35 b(of:)1006 b Ft(The)626 b(probabilit)-31 b(y)629 b(that)e Fr(x)44588 29312 y Fo(L)45875 29146 y Ft(maximizes)h Fr(F)154 b(\025)625 b Ft(is)28400 29644 y Fm(P)29568 30861 y Fl(f)p Fo(f)87 b Fl(2)p Ft(dom)p Fp(\()p Fo(F)119 b Fp(\()p Fo(x)35102 30972 y Fn(L)35687 30861 y Fp(\)\))p Fl(g)37072 30474 y Fr(P)154 b Ft(\()p Fr(F)g Ft(\()p Fr(x)40296 30640 y Fo(L)40958 30474 y Ft(\))401 b(=)g Fr(f)119 b Ft(\))p Fq(\001)44874 29644 y Fm(Q)45920 30806 y Fl(f)p Fo(y)46823 30917 y Fn(L)47407 30806 y Fl(6)p Fp(=)p Fo(x)48589 30917 y Fn(L)49172 30806 y Fl(g)49866 30474 y Fr(P)154 b Ft(\()p Fr(F)g Ft(\()p Fr(y)53000 30640 y Fo(L)53662 30474 y Ft(\))p Fq(\001)28400 32101 y Fr(\025)p Ft(\()p Fr(y)30019 32267 y Fo(L)30682 32101 y Ft(\))1785 b Fq(\024)1255 b Fr(f)119 b Fq(\001)1256 b Fr(\025)p Ft(\()p Fr(x)38946 32267 y Fo(L)39609 32101 y Ft(\)\))1785 b(=)44371 31271 y Fm(P)45539 32488 y Fl(f)p Fo(f)87 b Fl(2)p Ft(dom)p Fp(\()p Fo(F)119 b Fp(\()p Fo(x)51073 32599 y Fn(L)51657 32488 y Fp(\)\))p Fl(g)53347 31665 y Fp(1)p 53175 31846 785 45 v 53175 32483 a Fo(N)54093 32101 y Fq(\001)28400 33081 y Fm(Q)29445 34243 y Fl(f)p Fo(y)30348 34354 y Fn(L)30932 34243 y Fl(6)p Fp(=)p Fo(x)32114 34354 y Fn(L)32698 34243 y Fl(g)33391 33911 y Fr(P)154 b Ft(\()p Fr(F)g Ft(\()p Fr(y)36525 34077 y Fo(L)37188 33911 y Ft(\))1189 b Fq(\024)40699 33374 y Fo(f)87 b(\025)p Fp(\()p Fo(x)42591 33485 y Fn(L)43174 33374 y Fp(\))p 40699 33656 2822 45 v 40985 34293 a Fo(\025)p Fp(\()p Fo(y)42305 34404 y Fn(L)42889 34293 y Fp(\))43653 33911 y Ft(\).)2080 b(No)-31 b(w,)1032 b(assuming)28400 35427 y Fr(F)154 b Ft(\()p Fr(y)30239 35593 y Fo(L)30901 35427 y Ft(\)'s)780 b Fr(N)900 b Ft(v)-61 b(alues)779 b(are)g(ev)-31 b(enly)780 b(spaced)f(on)h(the)f (line)28400 36756 y(b)31 b(et)-31 b(w)g(een)638 b(0)g(and)f Fr(M)121 b Ft(,)704 b(the)637 b(probabilit)-31 b(y)640 b(that)f(it)e(will)i(b)31 b(e)28400 38084 y(less)573 b(than)i(or)e(equal)i(to)g Fr(q)613 b Ft(is)574 b(appro)-31 b(ximately)577 b Fr(q)40 b(=)-61 b(M)121 b Ft(.)1106 b(So)28400 39412 y(the)653 b(expression)g(for)g(the)g(desired)f (probabilit)-31 b(y)656 b(b)31 b(ecomes)28400 40026 y Fm(P)29568 41244 y Fl(f)p Fo(f)87 b Fl(2)p Ft(dom)p Fp(\()p Fo(F)119 b Fp(\()p Fo(x)35102 41355 y Fn(L)35687 41244 y Fp(\)\))p Fl(g)37376 40420 y Fp(1)p 37205 40601 785 45 v 37205 41238 a Fo(N)38306 40026 y Fm(Q)39352 41188 y Fl(f)p Fo(y)40255 41299 y Fn(L)40838 41188 y Fl(6)p Fp(=)p Fo(x)42020 41299 y Fn(L)42604 41188 y Fl(g)43608 40319 y Fo(f)87 b(\025)p Fp(\()p Fo(x)45500 40430 y Fn(L)46084 40319 y Fp(\))p 43430 40602 3178 45 v 43430 41238 a Fo(M)c(\025)p Fp(\()p Fo(y)45677 41349 y Fn(L)46262 41238 y Fp(\))46741 40856 y Ft(,)369 b(as)g(required.)492 b Fa(2)28400 43653 y Fv(Theorem)426 b(2)554 b Fs(L)-57 b(et)402 b Fr(\025)f Fs(b)-57 b(e)402 b(a)g(function)h(on)e Fr(L)h Fs(and)g(let)f Fr(\025)51759 43252 y Fl(0)52471 43653 y Fs(b)-57 b(e)402 b(a)28400 44982 y(b)-57 b(ound)465 b(on)f(it.)715 b(L)-57 b(et)465 b Fr(F)154 b Ft(\()p Fr(x)38986 45148 y Fo(L)39648 44982 y Ft(\))465 b Fs(b)-57 b(e)465 b(a)f(set)g(of)g(i.)715 b(i.)g(d.)f(uniform)28400 46310 y(r)-57 b(andom)470 b(variables)f(with) h Fr(N)591 b Fs(values)469 b(and)h(maximum)g(value)28400 47638 y Fr(M)121 b Fs(,)551 b(and)519 b(supp)-57 b(ose)519 b Fq(\012)531 b Ft(=)g(max)q Fs(.)881 b(Then)520 b(the)f(c)-57 b(ost)519 b Fr(C)79 b Ft(\()p Fr(\025)52266 47237 y Fl(0)52577 47638 y Ft(\))532 b Fq(\024)28400 48967 y Ft(2)p Fr(k)29749 48136 y Fm(P)30918 49299 y Fo(x)31420 49410 y Fn(L)32244 48967 y Fq(j)p Fr(\025)33197 48565 y Fl(0)33507 48967 y Ft(\()p Fr(x)34570 49133 y Fo(L)35233 48967 y Ft(\))247 b Fq(\000)f Fr(\025)p Ft(\()p Fr(x)38726 49133 y Fo(L)39388 48967 y Ft(\))p Fq(j)p Fs(,)398 b(wher)-57 b(e)396 b Fr(k)342 b Ft(=)308 b Fr(E)46892 49133 y Fo(F)47628 48967 y Ft(\()p Fr(F)154 b Ft(\()p Fr(x)49987 49133 y Fo(L)50650 48967 y Ft(\)\))p Fs(.)28400 51568 y Fv(Pro)35 b(of:)578 b Ft(W)-92 b(e)410 b(assume)i(that)g Fr(\025)41324 51166 y Fl(0)42046 51568 y Ft(is)f(an)g(upp)31 b(er)411 b(b)31 b(ound)411 b(\(when)28400 52896 y(it)516 b(is)f(a)h(lo)-31 b(w)g(er)516 b(b)31 b(ound)516 b(the)f(pro)31 b(of)516 b(is)f(analogous\).)934 b(De\014ne)28400 54225 y Fr(\017)308 b Ft(=)f Fr(\025)30971 53823 y Fl(0)31316 54225 y Fq(\000)34 b Fr(\025)p Ft(.)456 b(Let)264 b Fr(Q)36373 54391 y Fo(L)37299 54225 y Ft(b)31 b(e)262 b(the)i(random)g(v)-61 b(ariable)264 b(ranging)g(o)-31 b(v)g(er)28400 55553 y(assignmen)g(ts)590 b(to)f Fr(L)f Ft(that)i(maximizes)g Fr(F)154 b Ft(\()p Fr(x)47823 55719 y Fo(L)48485 55553 y Ft(\))p Fr(\025)49561 55151 y Fl(0)49872 55553 y Ft(\()p Fr(x)50935 55719 y Fo(L)51598 55553 y Ft(\))589 b(and)28400 56881 y(lik)-31 b(ewise)391 b(let)f Fr(R)34945 57047 y Fo(L)35996 56881 y Ft(maximize)i Fr(F)154 b Ft(\()p Fr(x)42896 57047 y Fo(L)43558 56881 y Ft(\))p Fr(\025)p Ft(\()p Fr(x)45697 57047 y Fo(L)46360 56881 y Ft(\).)553 b(Then)390 b(the)f(cost)28400 58210 y Fr(C)79 b Ft(\()p Fr(\025)30346 57808 y Fl(0)30657 58210 y Ft(\))785 b(=)f Fr(E)34334 58376 y Fo(F)35070 58210 y Ft(\(max)37561 58376 y Fo(x)38063 58487 y Fn(L)38887 58210 y Fr(F)154 b Ft(\()p Fr(x)40816 58376 y Fo(L)41478 58210 y Ft(\))p Fq(\001)656 b Fr(\025)43517 57808 y Fl(0)43828 58210 y Ft(\()p Fr(x)44891 58376 y Fo(L)45553 58210 y Ft(\))g Fq(\000)184 b Ft(max)49745 58376 y Fo(x)50247 58487 y Fn(L)51071 58210 y Fr(F)154 b Ft(\()p Fr(x)53000 58376 y Fo(L)53662 58210 y Ft(\))p Fq(\001)28400 59538 y Fr(\025)p Ft(\()p Fr(x)30109 59704 y Fo(L)30772 59538 y Ft(\)\))1491 b(=)1079 b Fr(E)35880 59738 y Fl(f)p Fo(F)24 b(;Q)37879 59849 y Fn(L)38464 59738 y Fo(;R)39394 59849 y Fn(L)39978 59738 y Fl(g)40486 59538 y Ft(\()p Fr(F)154 b Ft(\()p Fr(Q)43087 59704 y Fo(L)43751 59538 y Ft(\))p Fq(\001)1080 b Fr(\025)46214 59136 y Fl(0)46524 59538 y Ft(\()p Fr(Q)47829 59704 y Fo(L)48492 59538 y Ft(\))g Fq(\000)p Fr(F)154 b Ft(\()p Fr(R)53000 59704 y Fo(L)53662 59538 y Ft(\))p Fq(\001)28400 60867 y Fr(\025)p Ft(\()p Fr(R)30317 61033 y Fo(L)30979 60867 y Ft(\)\))759 b(=)639 b Fr(E)34915 61033 y Fo(F)35651 60867 y Ft(\()36081 60036 y Fm(P)37250 61199 y Fo(x)37752 61310 y Fn(L)38576 60867 y Fr(P)154 b Ft(\()p Fr(Q)40746 61033 y Fo(L)42167 60867 y Ft(=)758 b Fr(x)44419 61033 y Fo(L)45081 60867 y Ft(\))p Fq(\001)640 b Fr(F)154 b Ft(\()p Fr(x)48387 61033 y Fo(L)49049 60867 y Ft(\))p Fq(\001)640 b Fr(\025)51072 60465 y Fl(0)51383 60867 y Ft(\()p Fr(x)52446 61033 y Fo(L)53109 60867 y Ft(\))p Fq(\000)28400 61365 y Fm(P)29568 62527 y Fo(x)30070 62638 y Fn(L)30895 62195 y Fr(P)154 b Ft(\()p Fr(R)33031 62361 y Fo(L)34115 62195 y Ft(=)423 b Fr(x)36032 62361 y Fo(L)36694 62195 y Ft(\))p Fq(\001)440 b Fr(F)154 b Ft(\()p Fr(x)39800 62361 y Fo(L)40462 62195 y Ft(\))p Fq(\001)439 b Fr(\025)p Ft(\()p Fr(x)43347 62361 y Fo(L)44010 62195 y Ft(\)\))423 b(=)439 b Fr(E)47410 62361 y Fo(F)48146 62195 y Ft(\()48576 61365 y Fm(P)49745 62527 y Fo(x)50247 62638 y Fn(L)51071 62195 y Fr(F)154 b Ft(\()p Fr(x)53000 62361 y Fo(L)53662 62195 y Ft(\))p Fq(\001)28400 63523 y Ft(\()p Fr(P)g Ft(\()p Fr(Q)31000 63689 y Fo(L)32413 63523 y Ft(=)750 b Fr(x)34657 63689 y Fo(L)35319 63523 y Ft(\))p Fq(\001)636 b Fr(\025)37338 63122 y Fl(0)37648 63523 y Ft(\()p Fr(x)38711 63689 y Fo(L)39374 63523 y Ft(\))p Fq(\000)f Fr(P)154 b Ft(\()p Fr(R)43436 63689 y Fo(L)44848 63523 y Ft(=)749 b Fr(x)47091 63689 y Fo(L)47754 63523 y Ft(\))p Fq(\001)635 b Fr(\025)p Ft(\()p Fr(x)50835 63689 y Fo(L)51498 63523 y Ft(\)\)\))751 b(=)28400 64852 y Fr(E)29217 65018 y Fo(F)29953 64852 y Ft(\()30383 64021 y Fm(P)31552 65184 y Fo(x)32054 65295 y Fn(L)32878 64852 y Fr(F)154 b Ft(\()p Fr(x)34807 65018 y Fo(L)35469 64852 y Ft(\))p Fq(\001)712 b Ft(\(\()p Fr(P)154 b Ft(\()p Fr(Q)39948 65018 y Fo(L)41488 64852 y Ft(=)877 b Fr(x)43859 65018 y Fo(L)44522 64852 y Ft(\))p Fq(\000)711 b Fr(P)154 b Ft(\()p Fr(R)48660 65018 y Fo(L)50198 64852 y Ft(=)877 b Fr(x)52569 65018 y Fo(L)53232 64852 y Ft(\)\))p Fq(\001)28400 66180 y Fr(\025)p Ft(\()p Fr(x)30109 66346 y Fo(L)30772 66180 y Ft(\)+)369 b Fr(P)154 b Ft(\()p Fr(Q)34602 66346 y Fo(L)35572 66180 y Ft(=)308 b Fr(x)37374 66346 y Fo(L)38036 66180 y Ft(\))p Fq(\001)370 b Fr(\017)p Ft(\()p Fr(x)40655 66346 y Fo(L)41318 66180 y Ft(\)\)\).)28400 68172 y(No)-31 b(w,)1180 b(let)1018 b Fr(r)31 b Ft(\()p Fr(x)35878 68338 y Fo(L)36541 68172 y Ft(\))1387 b(=)f Fr(\025)41251 67771 y Fl(0)41562 68172 y Ft(\()p Fr(x)42625 68338 y Fo(L)43287 68172 y Ft(\))p Fr(=\025)p Ft(\()p Fr(x)45979 68338 y Fo(L)46643 68172 y Ft(\))1017 b(b)31 b(e)1016 b(the)h(rel-)28400 69501 y(ativ)-31 b(e)1190 b(error)d(in)i(the)g(b)31 b(ound.)2950 b(By)1188 b(lemma)i(1,)28400 70945 y Fr(P)154 b Ft(\()p Fr(R)30536 71111 y Fo(L)31540 70945 y Ft(=)341 b Fr(x)33375 71111 y Fo(L)34037 70945 y Ft(\))h(=)36364 70509 y Fp(1)p 36192 70690 785 45 v 36192 71327 a Fo(N)37294 70115 y Fm(P)38462 71332 y Fl(f)p Fo(f)87 b Fl(2)p Ft(dom)p Fp(\()p Fo(F)119 b Fp(\()p Fo(x)43996 71443 y Fn(L)44580 71332 y Fp(\)\))p Fl(g)45966 70115 y Fm(Q)47011 71277 y Fl(f)p Fo(y)47914 71388 y Fn(L)48498 71277 y Fl(6)p Fp(=)p Fo(x)49680 71388 y Fn(L)50264 71277 y Fl(g)51268 70408 y Fo(f)87 b(\025)p Fp(\()p Fo(x)53160 70519 y Fn(L)53743 70408 y Fp(\))p 51090 70690 3178 45 v 51090 71327 a Fo(M)c(\025)p Fp(\()p Fo(y)53337 71438 y Fn(L)53921 71327 y Fp(\))28400 72467 y Ft(and)2430 b(also)h Fr(P)154 b Ft(\()p Fr(Q)39064 72633 y Fo(L)43468 72467 y Ft(=)3742 b Fr(x)48704 72633 y Fo(L)49367 72467 y Ft(\))g(=)28704 73536 y Fp(1)p 28533 73717 785 45 v 28533 74354 a Fo(N)29634 73142 y Fm(P)30803 74360 y Fl(f)p Fo(f)87 b Fl(2)p Ft(dom)o Fp(\()p Fo(F)119 b Fp(\()p Fo(x)36336 74471 y Fn(L)36921 74360 y Fp(\)\))p Fl(g)38306 73142 y Fm(Q)39352 74304 y Fl(f)p Fo(y)40255 74415 y Fn(L)40838 74304 y Fl(6)p Fp(=)p Fo(x)42020 74415 y Fn(L)42604 74304 y Fl(g)43582 73435 y Fo(f)87 b(\025)p Fp(\()p Fo(x)45474 73546 y Fn(L)46057 73435 y Fp(\))p Fo(r)24 b Fp(\()p Fo(x)47686 73546 y Fn(L)48270 73435 y Fp(\))p 43430 73718 5338 45 v 43430 74354 a Fo(M)83 b(\025)p Fp(\()p Fo(y)45677 74465 y Fn(L)46262 74354 y Fp(\))p Fo(r)24 b Fp(\()p Fo(y)47838 74465 y Fn(L)48422 74354 y Fp(\))49813 73972 y Fq(\024)732 b Fr(r)31 b Ft(\()p Fr(x)52999 74138 y Fo(L)53662 73972 y Ft(\))p Fq(\001)p eop end %%Page: 5 5 TeXDict begin 5 4 bop 704 682 a Fp(1)p 533 863 785 45 v 533 1500 a Fo(N)1634 288 y Fm(P)2803 1505 y Fl(f)p Fo(f)87 b Fl(2)p Ft(dom)o Fp(\()p Fo(F)119 b Fp(\()p Fo(x)8336 1616 y Fn(L)8921 1505 y Fp(\)\))p Fl(g)10306 288 y Fm(Q)11352 1450 y Fl(f)p Fo(y)12255 1561 y Fn(L)12838 1450 y Fl(6)p Fp(=)p Fo(x)14020 1561 y Fn(L)14604 1450 y Fl(g)15608 581 y Fo(f)87 b(\025)p Fp(\()p Fo(x)17500 692 y Fn(L)18084 581 y Fp(\))p 15430 863 3178 45 v 15430 1500 a Fo(M)c(\025)p Fp(\()p Fo(y)17677 1611 y Fn(L)18262 1500 y Fp(\))18741 1118 y Ft(,)1616 b(where)1367 b(the)400 2640 y(inequalit)-31 b(y)551 b(follo)-31 b(ws)549 b(b)-31 b(y)548 b(lo)-31 b(w)g(er)549 b(b)31 b(ounding)549 b Fr(r)31 b Ft(\()p Fr(y)20885 2806 y Fo(L)21548 2640 y Ft(\))548 b(with)g(its)400 3968 y(minim)-31 b(um)491 b(v)-61 b(alue)489 b(1.)851 b(But)489 b(then)f Fr(P)154 b Ft(\()p Fr(Q)17288 4134 y Fo(L)18457 3968 y Ft(=)507 b Fr(x)20458 4134 y Fo(L)21120 3968 y Ft(\))g Fq(\024)488 b Fr(r)31 b Ft(\()p Fr(x)24999 4134 y Fo(L)25662 3968 y Ft(\))p Fq(\001)400 5297 y Fr(P)154 b Ft(\()p Fr(R)2536 5463 y Fo(L)3714 5297 y Ft(=)515 b Fr(x)5723 5463 y Fo(L)6386 5297 y Ft(\),)526 b(and)494 b Fr(E)10743 5463 y Fo(F)11479 5297 y Ft(\()11909 4467 y Fm(P)13078 5629 y Fo(x)13580 5740 y Fn(L)14404 5297 y Fr(F)154 b Ft(\()p Fr(x)16333 5463 y Fo(L)16995 5297 y Ft(\))p Fq(\001)495 b Ft(\(\()p Fr(P)154 b Ft(\()p Fr(Q)21257 5463 y Fo(L)22437 5297 y Ft(=)515 b Fr(x)24446 5463 y Fo(L)25109 5297 y Ft(\))p Fq(\000)400 6625 y Fr(P)154 b Ft(\()p Fr(R)2536 6791 y Fo(L)4023 6625 y Ft(=)824 b Fr(x)6341 6791 y Fo(L)7003 6625 y Ft(\)\))p Fq(\001)681 b Fr(\025)p Ft(\()p Fr(x)10560 6791 y Fo(L)11222 6625 y Ft(\)+)f Fr(P)154 b Ft(\()p Fr(Q)15363 6791 y Fo(L)16850 6625 y Ft(=)825 b Fr(x)19169 6791 y Fo(L)19831 6625 y Ft(\))p Fq(\001)680 b Fr(\017)p Ft(\()p Fr(x)22760 6791 y Fo(L)23423 6625 y Ft(\)\)\))826 b Fq(\024)400 7954 y Fr(E)1217 8120 y Fo(F)1953 7954 y Ft(\()2383 7123 y Fm(P)3552 8286 y Fo(x)4054 8397 y Fn(L)4878 7954 y Fr(F)154 b Ft(\()p Fr(x)6807 8120 y Fo(L)7469 7954 y Ft(\))p Fq(\001)491 b Ft(\()p Fr(P)154 b Ft(\()p Fr(R)11263 8120 y Fo(L)12434 7954 y Ft(=)508 b Fr(x)14436 8120 y Fo(L)15098 7954 y Ft(\))p Fq(\001)491 b Ft(\()p Fr(r)31 b Ft(\()p Fr(x)18349 8120 y Fo(L)19012 7954 y Ft(\))327 b Fq(\000)f Ft(1\))p Fq(\001)491 b Fr(\025)p Ft(\()p Fr(x)24446 8120 y Fo(L)25109 7954 y Ft(\)+)400 9282 y Fr(P)154 b Ft(\()p Fr(Q)2570 9448 y Fo(L)3558 9282 y Ft(=)324 b Fr(x)5376 9448 y Fo(L)6039 9282 y Ft(\))p Fq(\001)380 b Fr(\017)p Ft(\()p Fr(x)8668 9448 y Fo(L)9331 9282 y Ft(\)\)\).)526 b(Since)379 b Fr(\025r)356 b Ft(=)380 b Fr(\025)p Ft(+)f Fr(\017)p Ft(,)k Fr(\017)325 b Ft(=)379 b Fr(\025)p Ft(\()p Fr(r)285 b Fq(\000)253 b Ft(1\),)400 10610 y(and)999 b(the)g(upp)31 b(er)997 b(b)31 b(ound)999 b(b)31 b(ecomes)999 b Fr(E)19410 10776 y Fo(F)20146 10610 y Ft(\()20576 9780 y Fm(P)21745 10942 y Fo(x)22247 11053 y Fn(L)23071 10610 y Fr(F)154 b Ft(\()p Fr(x)25000 10776 y Fo(L)25662 10610 y Ft(\))p Fq(\001)400 11939 y Ft(\()p Fr(P)g Ft(\()p Fr(R)2966 12105 y Fo(L)4482 11939 y Ft(=)853 b Fr(x)6829 12105 y Fo(L)7492 11939 y Ft(\))p Fq(\001)697 b Fr(\017)p Ft(\()p Fr(x)10438 12105 y Fo(L)11101 11939 y Ft(\)+)g Fr(P)154 b Ft(\()p Fr(Q)15259 12105 y Fo(L)16775 11939 y Ft(=)853 b Fr(x)19122 12105 y Fo(L)19785 11939 y Ft(\))p Fq(\001)697 b Fr(\017)p Ft(\()p Fr(x)22731 12105 y Fo(L)23394 11939 y Ft(\)\)\))855 b Fq(\024)400 13267 y Fr(E)1217 13433 y Fo(F)1953 13267 y Ft(\()2383 12437 y Fm(P)3552 13599 y Fo(x)4054 13710 y Fn(L)4878 13267 y Fr(F)154 b Ft(\()p Fr(x)6807 13433 y Fo(L)7469 13267 y Ft(\))p Fq(\001)821 b Ft(2)p Fq(\001)f Fr(\017)p Ft(\()p Fr(x)12219 13433 y Fo(L)12882 13267 y Ft(\)\))1059 b(=)16482 12437 y Fm(P)17650 13599 y Fo(x)18152 13710 y Fn(L)18976 13267 y Ft(2)p Fq(\001)821 b Fr(E)21474 13433 y Fo(F)22210 13267 y Ft(\()p Fr(F)154 b Ft(\()p Fr(x)24569 13433 y Fo(L)25232 13267 y Ft(\)\))p Fq(\001)400 14595 y Fr(\017)p Ft(\()p Fr(x)1912 14761 y Fo(L)2575 14595 y Ft(\),)370 b(as)f(desired.)492 b Fa(2)400 17780 y Fv(3.2.2)1274 b(Calculating)424 b(a)g(Go)35 b(o)g(d)426 b(Bound)400 20202 y Ft(Assume)444 b(that)i(w)-31 b(e)446 b(are)e(giv)-31 b(en)446 b(a)f(function)h Fr(\025)e Ft(de\014ned)h(on)g Fr(L)400 21530 y Ft(and)387 b(a)h(set)f(of)h(subsets)e Fr(L)11138 21696 y Fp(1)11635 21530 y Fr(;)184 b(:::;)g(L)14291 21696 y Fo(m)15523 21530 y Ft(suc)-31 b(h)387 b(that)h Fq([)21192 21128 y Fo(m)21192 21818 y(i)p Fp(=1)22681 21530 y Fr(L)23434 21696 y Fo(i)24141 21530 y Ft(=)337 b Fr(L)p Ft(.)400 22858 y(W)-92 b(e)281 b(m)-31 b(ust)283 b(compute)g(functions)f Fr(\025)14607 23024 y Fp(1)15104 22858 y Fr(;)184 b(:::;)g(\025)17653 23024 y Fo(m)18778 22858 y Ft(suc)-31 b(h)282 b(that)h Fr(\025)24145 23024 y Fo(i)24795 22858 y Ft(has)400 24187 y(scop)31 b(e)410 b Fr(L)4183 24353 y Fo(i)4963 24187 y Ft(and)7157 23357 y Fm(Q)8202 24519 y Fo(i)8755 24187 y Fr(\025)9401 24353 y Fo(i)10180 24187 y Ft(is)h(a)g(b)31 b(ound)410 b(on)h Fr(\025)f Ft(whic)-31 b(h)412 b(minimizes)400 25515 y(the)377 b(sum)f(of)h(the)g(absolute)g(errors.)513 b(Without)378 b(losing)g(gener-)400 26844 y(alit)-31 b(y)322 b(w)-31 b(e)321 b(will)h(assume)e(for)g(the)h(momen)-31 b(t)322 b(that)f(it)g(is)f(to)h(b)31 b(e)320 b(an)400 28172 y(upp)31 b(er)368 b(b)31 b(ound.)400 30164 y(A)446 b(straigh)-31 b(tforw)g(ard)449 b(w)-31 b(a)g(y)447 b(to)g(do)f(this)g(is)g(to)h(set) f(up)f(a)i(non-)400 31493 y(linear)250 b(program.)454 b(W)-92 b(e)249 b(in)-31 b(tro)31 b(duce)250 b(a)f(v)-61 b(ariable)251 b Fr(\025)20256 31659 y Fo(i)20624 31493 y Ft(\()p Fr(x)21687 31659 y Fo(L)22294 31770 y Fn(i)22701 31493 y Ft(\))e(for)h(ev-)400 32821 y(ery)284 b(assignmen)-31 b(t)286 b Fr(x)8443 32987 y Fo(L)9050 33098 y Fn(i)9740 32821 y Ft(to)g Fr(L)11762 32987 y Fo(i)12130 32821 y Ft(,)302 b(and)285 b(also)g(a)g(non-negativ)-31 b(e)287 b(v)-61 b(ari-)400 34149 y(able)327 b Fr(\017)p Ft(\()p Fr(x)4206 34315 y Fo(L)4869 34149 y Ft(\))g(for)g(ev)-31 b(ery)327 b Fr(x)10793 34315 y Fo(L)11455 34149 y Ft(.)956 b(No)-31 b(w,)337 b(for)327 b(ev)-31 b(ery)326 b Fr(x)20679 34315 y Fo(L)21342 34149 y Ft(,)335 b(w)-31 b(e)327 b(de\014ne)400 35478 y(a)349 b(non-linear)h(constrain)-31 b(t)11697 34648 y Fm(Q)12743 34921 y Fo(m)12743 35810 y(i)p Fp(=1)14417 35478 y Fr(\025)15063 35644 y Fo(i)15431 35478 y Ft(\()p Fr(x)16494 35644 y Fo(L)17101 35755 y Fn(i)17507 35478 y Ft(\))206 b Fq(\000)f Fr(\017)p Ft(\()p Fr(x)20721 35644 y Fo(L)21384 35478 y Ft(\))308 b(=)g Fr(\025)p Ft(\()p Fr(x)25000 35644 y Fo(L)25662 35478 y Ft(\),)400 36806 y(where)445 b Fr(x)4310 36972 y Fo(L)4917 37083 y Fn(i)5768 36806 y Ft(is)g(consisten)-31 b(t)447 b(with)f Fr(x)15411 36972 y Fo(L)16519 36806 y Ft(for)f(all)i Fr(i)p Ft(.)721 b(Sub)61 b(ject)446 b(to)400 38134 y(these)f(constrain) -31 b(ts,)465 b(w)-31 b(e)446 b(w)-31 b(an)g(t)446 b(to)g(minimize)h (the)e(ob)61 b(jectiv)-31 b(e)400 39463 y(function)4801 38633 y Fm(P)5969 39795 y Fo(x)6471 39906 y Fn(L)7295 39463 y Fr(\017)p Ft(\()p Fr(x)8807 39629 y Fo(L)9470 39463 y Ft(\),)452 b(whic)-31 b(h)435 b(corresp)31 b(onds)433 b(to)i(the)f Fr(L)24174 39629 y Fp(1)25105 39463 y Ft(er-)400 40791 y(ror.)588 b(The)401 b(v)-61 b(alues)401 b(that)h(the)g(optim)-31 b(um)403 b(solution)g(assigns)e(to)400 42120 y Fr(\025)1046 42286 y Fo(i)1414 42120 y Ft(\()p Fr(x)2477 42286 y Fo(L)3084 42397 y Fn(i)3491 42120 y Ft(\))369 b(will)i(then)f(b)31 b(e)368 b(our)h(desired)g(result.)400 44112 y(The)331 b(problem)g(with)h(this)e(approac)-31 b(h)332 b(of)f(course)f(is)g (that)i(non-)400 45440 y(linear)445 b(programs)g(are)f(in)h(general)g (v)-31 b(ery)444 b(di\016cult)i(to)f(solv)-31 b(e.)400 46769 y(Instead,)546 b(w)-31 b(e)510 b(will)i(relax)e(the)g(constrain) -31 b(ts)512 b(un)-31 b(til)511 b(they)f(b)31 b(e-)400 48097 y(come)623 b(linear,)686 b(and)623 b(then)f(use)f(the)h(solution) i(of)f(the)f(lin-)400 49425 y(ear)646 b(program)g(as)g(an)g(appro)-31 b(ximation)649 b(of)d(the)g(optim)-31 b(um)400 50754 y(solution.)1320 b(First,)713 b(w)-31 b(e)644 b(in)-31 b(tro)31 b(duce)645 b(new)g(v)-61 b(ariables)645 b Fr(r)31 b Ft(\()p Fr(x)25307 50920 y Fo(L)25970 50754 y Ft(\))400 52082 y(represen)-31 b(ting)586 b(the)g Fs(r)-57 b(elative)669 b Ft(error.)1141 b(W)-92 b(e)584 b(will)k(not)e(repre-)400 53411 y(sen)-31 b(t)633 b(the)f(absolute)i(error)d(directly)-92 b(,)700 b(so)632 b(the)h(constrain)-31 b(ts)400 54739 y(de\014ned)512 b(ab)31 b(o)-31 b(v)g(e)513 b(cannot)h(b)31 b(e)511 b(used.)921 b(Instead)513 b(a)f(constrain)-31 b(t)400 56067 y(\()830 55237 y Fm(Q)1876 55511 y Fo(m)1876 56399 y(i)p Fp(=1)3550 56067 y Fr(\025)4196 56233 y Fo(i)4564 56067 y Ft(\()p Fr(x)5627 56233 y Fo(L)6234 56344 y Fn(i)6641 56067 y Ft(\)\))p Fr(=\025)p Ft(\()p Fr(x)9763 56233 y Fo(L)10426 56067 y Ft(\))446 b(=)e Fr(r)31 b Ft(\()p Fr(x)14200 56233 y Fo(L)14863 56067 y Ft(\))452 b(is)f(generated)h(for) g(ev)-31 b(ery)400 57396 y Fr(x)1033 57562 y Fo(L)1695 57396 y Ft(.)477 b(Since)323 b(w)-31 b(e)323 b(w)-31 b(an)g(t)325 b(an)e(upp)31 b(er)322 b(b)31 b(ound,)332 b Fr(r)354 b Ft(m)-31 b(ust)323 b(b)31 b(e)322 b(at)i(least)400 58724 y(1.)729 b(After)448 b(taking)i(the)e(logarithm)i(of)e(b)31 b(oth)449 b(sides,)467 b(this)448 b(b)31 b(e-)400 60052 y(comes)3576 59222 y Fm(P)4744 59496 y Fo(m)4744 60384 y(i)p Fp(=1)6418 60052 y Ft(log)17 b(\()p Fr(\025)8924 60218 y Fo(i)9293 60052 y Ft(\()p Fr(x)10356 60218 y Fo(L)10963 60329 y Fn(i)11369 60052 y Ft(\)\))66 b Fq(\000)g Ft(log)18 b(\()p Fr(\025)p Ft(\()p Fr(x)16792 60218 y Fo(L)17455 60052 y Ft(\)\))309 b(=)e(log)202 b Fr(r)31 b Ft(\()p Fr(x)23000 60218 y Fo(L)23663 60052 y Ft(\).)463 b(W)-92 b(e)400 61381 y(can)355 b(in)-31 b(tro)31 b(duce)356 b(new)g(v)-61 b(ariables)356 b(log)201 b Fr(\025)16423 61547 y Fo(i)16791 61381 y Ft(\()p Fr(x)17854 61547 y Fo(L)18461 61658 y Fn(i)18868 61381 y Ft(\))355 b(and)h(log)201 b Fr(r)31 b Ft(\()p Fr(x)24999 61547 y Fo(L)25662 61381 y Ft(\),)400 62709 y(and)459 b(the)g(constrain)-31 b(ts)461 b(are)d(no)-31 b(w)460 b(linear)g(in)f(these)g(v)-61 b(ariables)400 64037 y(\(log)202 b Fr(\025)p Ft(\()p Fr(x)4154 64203 y Fo(L)4816 64037 y Ft(\))506 b(of)f(course)f(is)h(a)g (constan)-31 b(t\).)902 b(The)506 b(constrain)-31 b(ts)400 65366 y Fr(r)339 b Fq(\025)307 b Ft(1)370 b(b)31 b(ecome)369 b(log)202 b Fr(r)338 b Fq(\025)308 b Ft(0.)400 67358 y(No)-31 b(w,)293 b(for)271 b(upp)31 b(er)270 b(b)31 b(ounds,)291 b Fr(r)31 b Ft(\()p Fr(x)13491 67524 y Fo(L)14154 67358 y Ft(\))p Fr(\025)p Ft(\()p Fr(x)16293 67524 y Fo(L)16956 67358 y Ft(\))308 b(=)g Fr(\025)p Ft(\()p Fr(x)20572 67524 y Fo(L)21234 67358 y Ft(\))50 b(+)g Fr(\017)p Ft(\()p Fr(x)24137 67524 y Fo(L)24801 67358 y Ft(\))308 b(=)400 67856 y Fm(Q)1445 69019 y Fo(i)1999 68687 y Fr(\025)2645 68853 y Fo(i)3013 68687 y Ft(\()p Fr(x)4076 68853 y Fo(L)4683 68964 y Fn(i)5089 68687 y Ft(\),)538 b(so)503 b Fr(\017)p Ft(\()p Fr(x)9369 68853 y Fo(L)10032 68687 y Ft(\))532 b(=)f Fr(\025)p Ft(\()p Fr(x)14095 68853 y Fo(L)14757 68687 y Ft(\)\()p Fr(r)31 b Ft(\()p Fr(x)17210 68853 y Fo(L)17874 68687 y Ft(\))336 b Fq(\000)g Ft(1\).)896 b(W)-92 b(e)502 b(w)-31 b(an)g(t)400 70015 y(to)560 b(minimize)6868 69185 y Fm(P)8037 70347 y Fo(x)8539 70458 y Fn(L)9363 70015 y Fr(\017)p Ft(\()p Fr(x)10875 70181 y Fo(L)11538 70015 y Ft(\),)607 b(but)559 b(unfortunately)j(the)d(only)400 71343 y(relev)-61 b(an)-31 b(t)480 b(v)-61 b(ariables)480 b(that)g(ha)-31 b(v)g(e)481 b(meaning)g(under)d(the)i(con-)400 72672 y(strain)-31 b(ts)487 b(are)f Fr(l)6794 72838 y Fo(r)7284 72672 y Ft(\()p Fr(x)8347 72838 y Fo(L)9010 72672 y Ft(\))503 b(=)f(log)201 b Fr(r)31 b Ft(\()p Fr(x)14513 72838 y Fo(L)15176 72672 y Ft(\).)844 b(The)486 b(ob)61 b(jectiv)-31 b(e)489 b(func-)400 74000 y(tion)406 b(is)f(therefore)8545 73170 y Fm(P)9714 74332 y Fo(x)10216 74443 y Fn(L)11040 74000 y Fr(\025)p Ft(\()p Fr(x)12749 74166 y Fo(L)13411 74000 y Ft(\)\(exp)q(\()p Fr(l)16723 74166 y Fo(r)17214 74000 y Ft(\()p Fr(x)18277 74166 y Fo(L)18940 74000 y Ft(\)\))271 b Fq(\000)f Ft(1\).)601 b(This)405 b(is)p 28400 44 26627 45 v 28378 1151 45 1107 v 29064 819 a Fh(Minimize)p 55004 1151 V 28378 2385 45 1235 v 29064 2053 a Fi(:)p Fh(23)p Fi(l)30678 2164 y Fc(r)31140 2053 y Fh(\()p 31538 1240 825 45 v Fi(B)50 b(;)p 32818 1240 802 45 v 171 w(C)71 b Fh(\))227 b(+)h Fi(:)p Fh(15)p Fi(l)36883 2164 y Fc(r)37345 2053 y Fh(\()p 37743 1240 825 45 v Fi(B)50 b(;)171 b(C)71 b Fh(\))227 b(+)h Fi(:)p Fh(33)p Fi(l)43088 2164 y Fc(r)43550 2053 y Fh(\()p Fi(B)50 b(;)p 45228 1240 802 45 v 171 w(C)71 b Fh(\))227 b(+)h Fi(:)p Fh(29)p Fi(l)49293 2164 y Fc(r)49755 2053 y Fh(\()p Fi(B)50 b(;)171 b(C)71 b Fh(\))p 55004 2385 45 1235 v 28378 3492 45 1107 v 29064 3160 a(sub)57 b(ject)342 b(to:)p 55004 3492 V 28378 4727 45 1235 v 29064 4395 a(log)185 b Fi(\025)31154 4506 y Ff(1)31616 4395 y Fh(\()p 32014 3581 825 45 v Fi(B)50 b Fh(\))227 b(+)h(log)185 b Fi(\025)36578 4506 y Ff(2)37040 4395 y Fh(\()p 37438 3581 802 45 v Fi(C)71 b Fh(\))228 b Fg(\000)g Fi(l)40196 4506 y Fc(r)40657 4395 y Fh(\()p 41055 3581 825 45 v Fi(B)50 b(;)p 42335 3581 802 45 v 171 w(C)71 b Fh(\))284 b(=)h(log)185 b Fi(\025)p Fh(\()p 47388 3581 825 45 v Fi(B)50 b(;)p 48668 3581 802 45 v 171 w(C)71 b Fh(\))285 b(=)f Fg(\000)p Fh(0)p Fi(:)p Fh(635)p 55004 4727 45 1235 v 28378 5961 V 29064 5629 a(log)185 b Fi(\025)31154 5740 y Ff(1)31616 5629 y Fh(\()p 32014 4815 825 45 v Fi(B)50 b Fh(\))227 b(+)h(log)185 b Fi(\025)36578 5740 y Ff(2)37040 5629 y Fh(\()p Fi(C)71 b Fh(\))228 b Fg(\000)g Fi(l)40196 5740 y Fc(r)40657 5629 y Fh(\()p 41055 4815 V Fi(B)50 b(;)171 b(C)71 b Fh(\))284 b(=)h(log)185 b Fi(\025)p Fh(\()p 47388 4815 V Fi(B)50 b(;)171 b(C)71 b Fh(\))285 b(=)f Fg(\000)p Fh(0)p Fi(:)p Fh(83)p 55004 5961 45 1235 v 28378 7195 V 29064 6863 a(log)185 b Fi(\025)31154 6974 y Ff(1)31616 6863 y Fh(\()p Fi(B)50 b Fh(\))227 b(+)h(log)185 b Fi(\025)36578 6974 y Ff(2)37040 6863 y Fh(\()p 37438 6049 802 45 v Fi(C)71 b Fh(\))228 b Fg(\000)g Fi(l)40196 6974 y Fc(r)40657 6863 y Fh(\()p Fi(B)50 b(;)p 42335 6049 V 171 w(C)71 b Fh(\))284 b(=)h(log)185 b Fi(\025)p Fh(\()p Fi(B)50 b(;)p 48668 6049 V 171 w(C)71 b Fh(\))285 b(=)f Fg(\000)p Fh(0)p Fi(:)p Fh(484)p 55004 7195 45 1235 v 28378 8302 45 1107 v 29064 7970 a(log)185 b Fi(\025)31154 8081 y Ff(1)31616 7970 y Fh(\()p Fi(B)50 b Fh(\))227 b(+)h(log)185 b Fi(\025)36578 8081 y Ff(2)37040 7970 y Fh(\()p Fi(C)71 b Fh(\))228 b Fg(\000)g Fi(l)40196 8081 y Fc(r)40657 7970 y Fh(\()p Fi(B)50 b(;)171 b(C)71 b Fh(\))284 b(=)h(log)185 b Fi(\025)p Fh(\()p Fi(B)50 b(;)171 b(C)71 b Fh(\))285 b(=)f Fg(\000)p Fh(0)p Fi(:)p Fh(535)p 55004 8302 V 28378 9536 45 1235 v 29064 9204 a Fi(l)29370 9315 y Fc(r)29832 9204 y Fh(\()p 30230 8391 825 45 v Fi(B)49 b(;)p 31509 8391 802 45 v 171 w(C)71 b Fh(\))p Fi(;)171 b(l)33470 9315 y Fc(r)33932 9204 y Fh(\()p 34330 8391 825 45 v Fi(B)50 b(;)171 b(C)71 b Fh(\))p Fi(;)171 b(l)37571 9315 y Fc(r)38032 9204 y Fh(\()p Fi(B)50 b(;)p 39710 8391 802 45 v 171 w(C)71 b Fh(\))p Fi(;)171 b(l)41671 9315 y Fc(r)42133 9204 y Fh(\()p Fi(B)50 b(;)170 b(C)71 b Fh(\))285 b Fg(\025)f Fh(0)p 55004 9536 45 1235 v 28400 9581 26627 45 v 28400 11567 a Ft(Figure)j(4:)452 b(The)287 b(linear)h(program)g(computing)i(the)d(b)31 b(ounding)28400 12895 y(functions)370 b(in)g(\014gure)f(2)p 28400 14483 27095 45 v 28400 38639 45 24156 v 29118 15507 a Fe(Pro)33 b(cedure)393 b(Appro)-33 b(ximate)395 b(Decomp)33 b(osition)29118 17014 y(Input:)1046 b Fd(Function)523 b Fi(\025)h Fd(with)f(scope)g Fi(L)p Fd(,)g(subsets)29118 18121 y Fi(L)29815 18232 y Ff(1)30276 18121 y Fi(;)171 b(:::;)h(L)32736 18232 y Fc(m)34041 18121 y Fd(such)523 b(that)g Fg([)39954 18232 y Fc(i)40305 18121 y Fi(L)41002 18232 y Fc(i)41637 18121 y Fh(=)285 b Fi(L)p Fd(.)29118 19228 y Fe(Output:)1047 b Fd(Set)523 b(of)g(functions)g Fi(\025)43747 19339 y Ff(1)44209 19228 y Fi(;)171 b(:::;)h(\025)46569 19339 y Fc(m)47874 19228 y Fd(such)523 b(that)g Fi(\025)53701 19339 y Fc(i)29118 20335 y Fd(has)g(scope)g Fi(L)35045 20446 y Fc(i)35919 20335 y Fd(and)38011 19533 y Fm(Q)39057 20695 y Fc(i)39579 20335 y Fi(\025)40176 20446 y Fc(i)41050 20335 y Fd(is)g(an)h(upper)f(bound)g(on)g Fi(\025)29118 21442 y Fd(\(lower)g(bound)g(is)g(similar\).)29732 23545 y(1.)554 b(Begin)523 b(constructing)g(a)g(new)g(linear)h(program:)31423 25316 y(\(a\))554 b(Introduce)523 b(linear)g(program)g(variables)33546 26423 y Fh(log)185 b Fi(\025)35636 26534 y Fc(i)35987 26423 y Fh(\()p Fi(x)36965 26534 y Fc(L)37527 26674 y Fn(i)37934 26423 y Fh(\))523 b Fd(and)g Fi(l)41253 26534 y Fc(r)41715 26423 y Fh(\()p Fi(x)42693 26534 y Fc(L)43311 26423 y Fh(\))285 b Fg(\025)f Fh(0)p Fd(.)31423 27752 y(\(b\))554 b Fg(8)p Fi(\025)p Fh(\()p Fi(x)35690 27863 y Fc(L)36308 27752 y Fh(\))1752 b Fg(6)p Fh(=)h(0)p Fd(,)523 b(introduce)g(the)g(constraint)33546 28056 y Fm(P)34714 29218 y Fc(i)35236 28859 y Fh(log)185 b Fi(\025)37326 28970 y Fc(i)37678 28859 y Fh(\()p Fi(x)38656 28970 y Fc(L)39218 29110 y Fn(i)39624 28859 y Fh(\))524 b Fg(\000)171 b Fh(log)185 b Fi(\025)p Fh(\()p Fi(x)44581 28970 y Fc(L)45199 28859 y Fh(\))285 b(=)g Fi(l)47269 28970 y Fc(r)47730 28859 y Fh(\()p Fi(x)48708 28970 y Fc(L)49326 28859 y Fh(\))p Fd(.)31423 30298 y(\(c\))554 b Fg(8)p Fi(\025)p Fh(\()p Fi(x)35690 30409 y Fc(L)36308 30298 y Fh(\))1752 b(=)h(0)p Fd(,)523 b(introduce)g(the)g(constraint)33546 30602 y Fm(P)34714 31764 y Fc(i)35236 31405 y Fh(log)185 b Fi(\025)37326 31516 y Fc(i)37678 31405 y Fh(\()p Fi(x)38656 31516 y Fc(L)39218 31656 y Fn(i)39624 31405 y Fh(\))524 b Fg(\000)p Fi(Z)355 b Fg(\024)285 b Fi(l)43781 31516 y Fc(r)44242 31405 y Fh(\()p Fi(x)45220 31516 y Fc(L)45838 31405 y Fh(\))p Fd(.)31423 32733 y(\(d\))554 b(Let)523 b(the)g(objective)g(be)g(to)g(minimize)33546 33037 y Fm(P)34714 34200 y Fc(x)35178 34349 y Fn(L)35988 33840 y Fh(max\(10)39315 33417 y Fb(\000)p Ff(5)40416 33840 y Fi(;)171 b(\025)p Fh(\()p Fi(x)42446 33951 y Fc(L)43065 33840 y Fh(\))p Fi(=)44146 33037 y Fm(P)45314 34200 y Fc(x)45778 34349 y Fn(L)46588 33840 y Fi(\025)p Fh(\()p Fi(x)48163 33951 y Fc(L)48781 33840 y Fh(\)\))p Fi(l)49883 33951 y Fc(r)50345 33840 y Fh(\()p Fi(x)51323 33951 y Fc(L)51941 33840 y Fh(\))p Fd(.)29732 35954 y(2.)554 b(Solve)523 b(the)g(program)g(using)g(a)g(standard)h(LP)31332 37061 y(algorithm.)1046 b(Define)523 b Fg(f)p Fi(\025)42378 37172 y Fc(i)42730 37061 y Fg(g)g Fd(with)g(the)g(solution.)p 55450 38639 V 28400 38683 27095 45 v 28400 40742 a Ft(Figure)318 b(5:)467 b(The)318 b(Appro)-31 b(ximate)320 b(Decomp)31 b(osition)319 b(Pro)31 b(cedure)28400 43392 y(nonlinear)545 b(since)f(it)g(in)-31 b(v)g(olv)g(es)546 b(the)e(exp)31 b(onen)-31 b(tial)546 b(function.)28400 44721 y(Therefore)406 b(w)-31 b(e)407 b(will)g(appro)-31 b(ximate)409 b(exp\()p Fr(l)46136 44887 y Fo(r)46627 44721 y Ft(\))271 b Fq(\000)g Ft(1)406 b(as)g Fr(dl)51721 44887 y Fo(r)52482 44721 y Ft(+)270 b Fr(c)p Ft(,)28400 46049 y(for)403 b(appropriate)h(constan) -31 b(ts)404 b Fr(d)364 b Fq(\025)g Ft(0)403 b(and)g Fr(c)p Ft(.)594 b(The)403 b(ob)61 b(jectiv)-31 b(e)28400 47378 y(function)351 b(then)f(b)31 b(ecomes)39602 46547 y Fm(P)40770 47710 y Fo(x)41272 47821 y Fn(L)42096 47378 y Fr(\025)p Ft(\()p Fr(x)43805 47544 y Fo(L)44468 47378 y Ft(\)\()p Fr(dl)46234 47544 y Fo(r)46726 47378 y Ft(\()p Fr(x)47789 47544 y Fo(L)48451 47378 y Ft(\))208 b(+)f Fr(c)p Ft(\))308 b(=)f Fr(c)53021 46976 y Fl(0)53539 47378 y Ft(+)28400 48706 y Fr(d)29160 47876 y Fm(P)30329 49038 y Fo(x)30831 49149 y Fn(L)31655 48706 y Fr(\025)p Ft(\()p Fr(x)33364 48872 y Fo(L)34027 48706 y Ft(\))p Fr(l)34787 48872 y Fo(r)35278 48706 y Ft(\()p Fr(x)36341 48872 y Fo(L)37003 48706 y Ft(\))366 b(for)g(some)g(constan)-31 b(t)367 b Fr(c)47200 48304 y Fl(0)47511 48706 y Ft(.)491 b(The)366 b(solution)28400 50034 y(that)430 b(minimizes)h(this)e(also)h (minimizes)45819 49204 y Fm(P)46988 50366 y Fo(x)47490 50477 y Fn(L)48314 50034 y Fr(\025)p Ft(\()p Fr(x)50023 50200 y Fo(L)50685 50034 y Ft(\))p Fr(l)51445 50200 y Fo(r)51936 50034 y Ft(\()p Fr(x)52999 50200 y Fo(L)53662 50034 y Ft(\),)28400 51363 y(so)371 b(w)-31 b(e)372 b(will)h(use)e(the) h(latter)h(as)e(our)g(appro)-31 b(ximate)374 b(ob)61 b(jectiv)-31 b(e)28400 52691 y(function.)494 b(The)370 b(linear)g(program)g(is)f(then)g(complete.)28400 54683 y(If)855 b(w)-31 b(e)856 b(w)-31 b(an)g(t)857 b(a)f(lo)-31 b(w)g(er)856 b(b)31 b(ound)856 b(on)f Fr(\025)g Ft(instead,)979 b(then)28400 56012 y(the)559 b(constrain)-31 b(ts)560 b(are)f Fr(r)31 b Ft(\()p Fr(x)39959 56178 y Fo(L)40622 56012 y Ft(\))624 b(=)f Fr(\025)p Ft(\()p Fr(x)44869 56178 y Fo(L)45532 56012 y Ft(\))p Fr(=)p Ft(\()46945 55182 y Fm(Q)47992 56344 y Fo(i)48545 56012 y Fr(\025)49191 56178 y Fo(i)49559 56012 y Ft(\()p Fr(x)50622 56178 y Fo(L)51229 56289 y Fn(i)51635 56012 y Ft(\)\),)608 b(so)28400 56510 y Fm(P)29568 57672 y Fo(i)30122 57340 y Ft(log)201 b Fr(\025)32382 57506 y Fo(i)33214 57340 y Fq(\000)463 b Ft(log)202 b Fr(\025)851 b Ft(=)g Fq(\000)184 b Ft(log)202 b Fr(r)31 b Ft(.)1472 b(No)-31 b(w,)47568 56510 y Fm(Q)48613 57672 y Fo(i)49166 57340 y Fr(\025)49812 57506 y Fo(i)50181 57340 y Ft(\()p Fr(x)51244 57506 y Fo(L)51851 57617 y Fn(i)52257 57340 y Ft(\))852 b(=)28400 58669 y Fr(\025)p Ft(\()p Fr(x)30109 58835 y Fo(L)30772 58669 y Ft(\))p Fr(=r)31 b Ft(\()p Fr(x)33348 58835 y Fo(L)34011 58669 y Ft(\))417 b(=)f Fr(\025)p Ft(\()p Fr(x)37844 58835 y Fo(L)38507 58669 y Ft(\))290 b Fq(\000)f Fr(\017)p Ft(\()p Fr(x)41889 58835 y Fo(L)42552 58669 y Ft(\),)452 b(so)434 b Fr(\017)p Ft(\()p Fr(x)46677 58835 y Fo(L)47340 58669 y Ft(\))417 b(=)f Fr(\025)p Ft(\()p Fr(x)51173 58835 y Fo(L)51835 58669 y Ft(\)\(1)291 b Fq(\000)28400 59997 y Ft(1)p Fr(=r)31 b Ft(\()p Fr(x)31099 60163 y Fo(L)31763 59997 y Ft(\)\))406 b(=)g Fr(\025)p Ft(\()p Fr(x)36005 60163 y Fo(L)36667 59997 y Ft(\)\(1)287 b Fq(\000)e Ft(1)p Fr(=)184 b Ft(exp)r(\()p Fr(l)43256 60163 y Fo(r)43747 59997 y Ft(\()p Fr(x)44810 60163 y Fo(L)45472 59997 y Ft(\)\)\).)671 b(As)427 b(b)31 b(efore,)443 b(w)-31 b(e)28400 61325 y(appro)g(ximate)378 b(\(1)252 b Fq(\000)e Ft(1)p Fr(=)184 b Ft(exp)r(\()p Fr(l)40894 61491 y Fo(r)41385 61325 y Ft(\()p Fr(x)42448 61491 y Fo(L)43111 61325 y Ft(\)\)\))377 b(with)g Fr(dl)48212 61491 y Fo(r)48702 61325 y Ft(\()p Fr(x)49765 61491 y Fo(L)50428 61325 y Ft(\))251 b(+)f Fr(c)376 b Ft(for)28400 62654 y(appropriate)413 b(constan)-31 b(ts)413 b Fr(d)378 b Fq(\025)h Ft(0)412 b(and)g Fr(c)p Ft(,)422 b(and)412 b(the)g(ob)61 b(jectiv)-31 b(e)28400 63982 y(function)371 b(again)g(b)31 b(ecomes)40091 63152 y Fm(P)41259 64314 y Fo(x)41761 64425 y Fn(L)42585 63982 y Fr(\025)p Ft(\()p Fr(x)44294 64148 y Fo(L)44957 63982 y Ft(\))p Fr(l)45717 64148 y Fo(r)46208 63982 y Ft(\()p Fr(x)47271 64148 y Fo(L)47934 63982 y Ft(\).)28400 65974 y(As)258 b(an)g(example,)282 b(consider)258 b(\014gure)f(2)h(in)g(subsection)h(3.1.)457 b(The)28400 67303 y(linear)266 b(program)f(that)h(w)-31 b(as)266 b(used)e(to)i(compute)g(the)f(b)31 b(ounding)28400 68631 y(functions)370 b Fr(\025)33818 68797 y Fp(1)34684 68631 y Ft(and)f Fr(\025)37482 68797 y Fp(2)38347 68631 y Ft(is)g(giv)-31 b(en)371 b(in)e(\014gure)g(4.)28400 70624 y(There)262 b(is)h(one)g(issue)f(w)-31 b(e)263 b(ha)-31 b(v)g(e)264 b(not)g(addressed)d(so)i(far,)284 b(namely)28400 71952 y(ho)-31 b(w)249 b(to)g(deal)f(with)i(cases)d (when)h Fr(\025)p Ft(\()p Fr(x)43569 72118 y Fo(L)44232 71952 y Ft(\))g(is)g(0.)453 b(Then)248 b(log)201 b Fr(\025)p Ft(\()p Fr(x)53307 72118 y Fo(L)53970 71952 y Ft(\))28400 73280 y(is)395 b(negativ)-31 b(e)398 b(in\014nit)-31 b(y)-92 b(,)404 b(whic)-31 b(h)396 b(do)31 b(es)395 b(not)i(allo)-31 b(w)398 b(us)c(to)j(set)e(up)p eop end %%Page: 6 6 TeXDict begin 6 5 bop 400 14000 a @beginspecial 0 @llx 0 @lly 334 @urx 210 @ury 2376 @rwi 1260 @rhi @setspecial %%BeginDocument: CPCS2_Infer.eps %!PS-Adobe-3.1 EPSF-3.0 %%Title: CPCS2_Infer.eps %%Creator: Adobe Illustrator(R) X %%AI8_CreatorVersion: 10.0 %AI9_PrintingDataBegin %%For: David Larkin %%CreationDate: 3/25/2003 %%BoundingBox: 0 0 334 210 %%HiResBoundingBox: 0 0 333.2813 209.0445 %%CropBox: 0 0 333.2813 209.0445 %%LanguageLevel: 2 %%DocumentData: Clean7Bit %ADOBeginClientInjection: DocumentHeader "AI10" %ADOEndClientInjection: DocumentHeader "AI10" %%Pages: 1 %%DocumentNeededResources: %%DocumentSuppliedResources: procset Adobe_AGM_Image (1.0 0) %%+ procset Adobe_CoolType_Utility_MAKEOCF (1.13 0) %%+ procset Adobe_CoolType_Core (2.12 0) %%+ procset Adobe_AGM_Core (2.0 0) %%+ procset Adobe_AGM_Utils (1.0 0) %%DocumentFonts: %%DocumentNeededFonts: %%DocumentNeededFeatures: %%DocumentSuppliedFeatures: %%DocumentProcessColors: Cyan Magenta Yellow Black %%DocumentCustomColors: %%CMYKCustomColor: %%RGBCustomColor: %AI7_Thumbnail: 128 80 8 % %%BeginData: 8042 Hex Bytes %0000330000660000990000CC0033000033330033660033990033CC0033FF %0066000066330066660066990066CC0066FF009900009933009966009999 %0099CC0099FF00CC0000CC3300CC6600CC9900CCCC00CCFF00FF3300FF66 %00FF9900FFCC3300003300333300663300993300CC3300FF333300333333 %3333663333993333CC3333FF3366003366333366663366993366CC3366FF %3399003399333399663399993399CC3399FF33CC0033CC3333CC6633CC99 %33CCCC33CCFF33FF0033FF3333FF6633FF9933FFCC33FFFF660000660033 %6600666600996600CC6600FF6633006633336633666633996633CC6633FF %6666006666336666666666996666CC6666FF669900669933669966669999 %6699CC6699FF66CC0066CC3366CC6666CC9966CCCC66CCFF66FF0066FF33 %66FF6666FF9966FFCC66FFFF9900009900339900669900999900CC9900FF %9933009933339933669933999933CC9933FF996600996633996666996699 %9966CC9966FF9999009999339999669999999999CC9999FF99CC0099CC33 %99CC6699CC9999CCCC99CCFF99FF0099FF3399FF6699FF9999FFCC99FFFF %CC0000CC0033CC0066CC0099CC00CCCC00FFCC3300CC3333CC3366CC3399 %CC33CCCC33FFCC6600CC6633CC6666CC6699CC66CCCC66FFCC9900CC9933 %CC9966CC9999CC99CCCC99FFCCCC00CCCC33CCCC66CCCC99CCCCCCCCCCFF %CCFF00CCFF33CCFF66CCFF99CCFFCCCCFFFFFF0033FF0066FF0099FF00CC %FF3300FF3333FF3366FF3399FF33CCFF33FFFF6600FF6633FF6666FF6699 %FF66CCFF66FFFF9900FF9933FF9966FF9999FF99CCFF99FFFFCC00FFCC33 %FFCC66FFCC99FFCCCCFFCCFFFFFF33FFFF66FFFF99FFFFCC110000001100 %000011111111220000002200000022222222440000004400000044444444 %550000005500000055555555770000007700000077777777880000008800 %000088888888AA000000AA000000AAAAAAAABB000000BB000000BBBBBBBB %DD000000DD000000DDDDDDDDEE000000EE000000EEEEEEEE0000000000FF %00FF0000FFFFFF0000FF00FFFFFF00FFFFFF %524C45FD81FF7D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D7D52 %7D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D %7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D7D52 %7D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D7D527D7D %7D527D7D7D527D7D7D527D7DFFFF7DFD7CFF7DFFFF7DFD7CFF52FFFF7DFD %7CFF7DFFFF7DFD7CFF52FFFF7DFD16FF7DFF5252FFA8A8FFFFA8FD047DFF %FFFF52FF527DFFA8A8FFFFFF527D527DFFFF52FF527D52FFFF7DFFFFFF7D %A87D52FFFF7DFF7D5252FFFF7DFFFFFF52A8527DFD25FF7DFFFF7DFD15FF %7D52A8527DFF7D527D7DFF52FF527DFFFF5252A87D52FF527D7D7DFF7DFF %7D52FFFF52527D5252FF7D52A852FF52FF7DA852FF27FD0452FF527D7D7D %FF7DFF7D7D7DFD24FF52FFFF7DFD15FF527D7D5252FF527D7D7DFF7DFF7D %52FFFF7D7D7D277DFFFD047DFFFD047DFFFF7D527D5252FF7D7DA87DFF7D %A852A87DFF7D277D5252FF7D52A87DFF7DA87D7D7DFD24FF7DFFFF7DFD1B %FFA8A8FD06FF7DFD08FF7DA8FD06FF7DFD09FF7DFD06FF7DFD09FF7DFD06 %FF7DFD25FF7DFFFF7DFD7CFF7DFFFF7DFD7CFF52FFFF7DFD0AFFA852FFFF %7D7D7DFD6BFF7DFFFF7DFD0AFF52FF52FF527D52FFA85276A87DA87DA87D %A87DA87DA87DA87DA87DA87DA87DA87DA87DA87DA87DA87DA87D7D7DA87D %A87DA87DA87DA87DA87DA87DA87DA87DA87DA87DA87DA87DA87DA87DA87D %7CFD24FF52FFFF7DFD0AFF7D527DFF7D7D52FFFF7DFD21FFA8FD07FF582D %58FD0EFF7C2D7CFD06FF7DFD24FF7DFFFF7DFD13FF7DFD10FFA8FD10FFA8 %FD08FF7DFD07FFA8FD08FFA8FD07FF7DFD24FF52FFFF7DFD13FF7DFD21FF %A8FD08FFA8FD10FFA8FD07FF7DFD24FF7DFFFF7DFD13FF7DFD10FFA8FD10 %FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFD24FF7DFFFF7DFD13FF7DFD %21FFA8FD08FFA8FD10FF7DFD07FF7DFD24FF7DFFFF7DFD04FFA8527DFD0C %FF7DFD10FFA8FD10FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFD24FF52 %FFFF7DFD04FFA8272752FD0BFF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7D %FD24FF7DFFFF7DFD04FF272727FD0CFF7DFD07FF8358A7FD06FFA8FD07FF %7D7D7DFD06FFCFFD08FF7DFD07FFA8FD08FF7DFD07FF7DFD24FF52FFFF7D %FD04FF7D2752FFFFFFA852FF7D7D527DFFFF7DFD07FF5252527DA8A87DFF %7DA8A87DA8A87DFF7D522752A8A87DFF7DFF7D7DFF7D7DFF7DFF7D7DA87D %A8A87DFF7DA8A87DA8A8A8FF7D7DA8FD07FF7DFD24FF7DFFFF7DFD04FF52 %2752FFFFFF52FF527D525252FFA8527DFD06FFA852A8FD06FFA8FD10FFA8 %FD08FF7DFD07FFA8FD08FFA8FD07FF7DFD24FF52FFFF7DFD04FF7D2752FF %FF7D7D52A87D7D5252FFFF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7DFD24 %FF7DFFFF7DFD13FF7DFD10FFA8FD10FFA8FD08FF7DFD07FFA8FD08FFA8FD %07FF7DFD24FF7DFFFF7DFD04FF7D2752FD0CFF7DFD21FFA8FD08FFA8FD10 %FF7DFD07FF7DFD24FF7DFFFF7DFD04FF522727FD0CFF7DFD10FFA8FD10FF %A8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFD24FF52FFFF7DFD04FFA82752 %FD0CFF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7DFD24FF7DFFFF7DFD04FF %7D5227FD0CFF7DFD10FFA8FD10FFCFFD08FF7DFD07FFA8FD08FFA8FD07FF %7DFD24FF52FFFF7DFD04FF7D2752FD0CFF7DFD21FFA8FD08FFA8FD10FFA8 %FD07FF7DFFFFFFA8A87DA8A8A87DA8A8A87DA8A8A87DA8A8A87DA8A8A87D %A8A8A87DA8A8A87DA8A87DFFFF7DFD04FF522727FD0CFF7DFD10FFA8FD10 %FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFFFF7DFD20FFA852FFFF7DFD %04FFA82752FD04FF52FF7D7D527DFFFF7DFD21FFA8FD08FFA8FD10FFA8FD %07FF7DFFFFA8FD0CFF7D7DFD08FF7DFD08FF7DA87DFFFF7DFD04FFA82752 %FD04FF7DFF7D525252FFA8527DFD0FFFA8FD10FFA8FD08FF7DFD07FFA8FD %08FFA8FD07FF7DFFFF7DFD05FF587DFD05FF7DFD06522752FF52527D527D %5252277D52A87DFFFF7DFD04FFA8A8FFFFFF7DFF52FF7D7D5252FFFF7DFD %21FFA8FD08FFA8FD10FF7DFD07FF7DFFFFA8FD05FF7C7CFD05FF527D5252 %277D527D52FF527D527D527D5252FD047DFFFF7DFD04FF522752FD0CFF7D %FD10FFA8FD10FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFFFF7DFD0EFF %7DFF7DFD0FFFA852FFFF7DFD04FF2727FD0DFF7DFD21FFA8FD08FFA8FD10 %FFA8FD07FF7DFFFFA8FD20FFA87DFFFF7DFD04FF272752FD0CFF7DFD10FF %A8FD10FFCFFD08FF7DFD07FFA8FD08FFA8FD07FF7DFFFF7DFD20FFA852FF %FF7DFD13FF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7DFFFFA8FD0CFF527D %FFFFA8FD06FFA8FD08FFA87DFFFF7DFD04FF7D2752FD0CFF7DFD10FFA8FD %10FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFFFF7DFD05FF7DA8FD05FF %527D527D525252277D5227525227FD06FFA852FFFF7DFD04FFA8275252FD %0BFF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7DFFFFA8FD05FFA8A8FD05FF %527D7D5252FD057D5252527DFD06FFA87DFFFF7DFD04FF7DA8FD0DFF7DFD %10FFA8FD10FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFFFF7DFD20FFA8 %7DFFFF7DFD04FFA82752FFFFFFA852A8A87D527DFFFF7DFD21FFA8FD08FF %A8FD10FF7DFD07FF7DFFFFA8FD20FF7D7DFFFF7DFD04FF7DF827FD04FFA8 %7D7D525252FFA8527DFD0FFFA8FD10FFA8FD08FF7DFD07FFA8FD08FFA8FD %07FF7DFFFF7DFD20FFA852FFFF7DFD05FF277DFFFF7DA827A87D7D5252FF %FF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7DFFFFA8FD20FFA87DFFFF7DFD %04FF7D52F8FD0CFF7DFD10FFA8FD10FFCFFD08FF7DFD07FFA8FD08FFA8FD %07FF7DFFFF7DFD0CFF7DFD09FF7DFD08FF7DA852FFFF7DFD04FFA82752FD %0CFF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7DFFFFA8FD05FF2752FD05FF %7DFF5252527D275252FF527D527D527D5252527DA87DFFFF7DFD04FF5227 %27FD0CFF7DFD10FFA8FD10FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFF %FF7DFD0CFF527D52275252527D7DFFFD06527D277D52A852FFFF7DFD04FF %527D27FD0CFF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7DFFFFA8FD20FFA8 %7DFFFF7DFD04FF522752FD0CFF7DFD10FFA8FD10FFA8FD08FF7DFD07FFA8 %FD08FFA8FD07FF7DFFFF7DFD20FFA87DFFFF7DFD13FF7DFD21FFA8FD08FF %A8FD10FF7DFD07FF7DFFFFA8FD20FF7D7DFFFF7DFD0AFF7D527DA8525252 %FFFF7DFD10FFA8FD10FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFFFF7D %FD0CFF527DFD06FFA8FD0BFFA852FFFF7DFD04FF7D272727FFFFFFFD047D %277DFFFF52A8FD20FFA8FD08FFA8FD10FFA8FD07FF7DFFFFFD04A8FF52FF %A87DFFA8A8FF27FD047D5252A852FD0BFFA87DFFFF7DFD04FF7D525252FF %7D7D7D527D525252FFFF7DFD10FFA8FD10FFCFFD08FF7DFD07FFA8FD08FF %A8FD07FF7DFFFF7DFD0CFF527D7D5252527D7D52FD0BFFA852FFFF7DFD04 %FFA82752FD0CFF7DFD21FFA8FD08FFA8FD10FFA8FD07FF7DFFFFA8A8A87D %A8A8A87DA8A8A87DA8A8A87DA8A8A87DA8A8A87DA8A8A87DA8A8A87DA87D %7DFFFF7DFD04FFA82752FD0CFF7DFD10FFA8FD10FFA8FD08FF7DFD07FFA8 %FD08FFA8FD07FF7DFD24FF52FFFF7DFD06FF52FD0CFF7DFD21FFA8FD08FF %A8FD10FFA8FD07FF7DFD24FF7DFFFF7DFD04FF522727FD0CFF7DFD10FFA8 %FD10FFA8FD08FF7DFD07FFA8FD08FFA8FD07FF7DFD24FF7DFFFF7DFD13FF %7DFD21FFA8FD08FFA8FD0FFF7D277DFD06FF7DFD24FF7DFFFF7DFD13FF7D %FD10FFA8FD10FFA8FD08FF7DFD07FFA8FD10FF7DFD24FF52FFFF7DFD04FF %7D272727FD0BFF7DFD21FFA8FD08FFA8FD18FF7DFD24FF7DFFFF7DFD04FF %7D525252FFFFFF52FFA8525252FFFF7DFD10FFA8FD10FFCFFD08FF7DFD07 %FFA8FD10FF7DFD24FF52FFFF7DFD04FFA82752FFFFFFA852FF7D7D277DFF %FF7DFD21FFA8FD08FFA8FD18FF7DFD24FF7DFFFF7DFD04FF7D2752FFFF7D %7D527D7D525252FFA8527DFD0FFFA8FD10FFA8FD08FF7DFD07FFA8FD10FF %7DFD24FF52FFFF7DFD04FF52F852FD0CFF7DFD21FFA8FD08FFA8FD18FF7D %FD24FF7DFFFF7DFD04FF522727FD0CFF7DFD10FFA8FD10FFA8FD08FF7DFD %07FFA8FD10FF7DFD24FF7DFFFF7DFD13FF7DFD21FFA8FD08FFA8FD18FF7D %FD24FF7DFFFF7DFD13FF7DFD10FFA8FD10FFA8FD08FF7DFD07FFA8FD10FF %7DFD24FF52FFFF7DFD13FF7DFD21FFA8FD07FF7D277DFD17FF7DFD24FF7D %FFFF7DFD13FF7DFD10FFA8FD10FFCFFD10FFA8FD10FF7DFD24FF52FFFF7D %FD13FF7DFD21FFA8FD21FF7DFD24FF7DFFFF7DFD0BFF52A8A8525252FFFF %7DFD10FFA8FD10FFA8FD10FFA8FD10FF7DFD24FF52FFFF7DFD0AFF7D7DA8 %7D7D527DFFFF527DA1A8A7A8A1A8A7A8A1A8A7A8A1A8A7A8A1A8A7A8A1A8 %A7A8A1A8A7A8A1A8A7A87DA8A7A8A1A8A7A8A1A8A7A8A1A8A7A8A1A8A7A8 %A1A8A7A8A1A8A7A8A1A8A7A8A1A876FD24FF7DFFFF7DFD09FFFD057D5252 %52FD6BFF7DFFFF7DFD7CFF7DFFFF7DFD7CFF52FFFF7DFD7CFF7DFFFF7DFD %7CFF52FFFF52FD7D7DFD80FFFF %%EndData %%EndComments %%BeginDefaults %%ViewingOrientation: 1 0 0 1 %%EndDefaults %%BeginProlog %ADOBeginClientInjection: DocumentProlog Start "AI10" %ADOEndClientInjection: DocumentProlog Start "AI10" %%BeginResource: procset Adobe_AGM_Utils 1.0 0 %%Version: 1.0 0 %%Copyright: Copyright (C) 2000-2000 Adobe Systems, Inc. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Utils 60 dict dup begin put /bdf { bind def } bind def /nd{ null def }bdf /xdf { exch def }bdf /ldf { load def }bdf /ddf { put } }bdf /xddf { 3 -1 roll put } }bdf /xpt { exch put }bdf /ndf { exch dup where{ pop pop pop }{ xdf }ifelse All Rights Reserved. }def /cdndf { exch dup currentdict exch known{ pop pop }{ exch def }ifelse }def /bdict { mark }bdf /edict { counttomark 2 idiv dup dict begin {def} repeat pop currentdict end } }def /ps_level /languagelevel where{ pop systemdict /languagelevel get exec }{ 1 }ifelse def /level2 ps_level 2 ge def /level3 ps_level 3 ge def /ps_version {version cvr} stopped { -1 }if def /makereadonlyarray { /packedarray where{ pop packedarray }{ array astore readonly }ifelse }bdf /map_reserved_ink_name { dup type /stringtype eq{ dup /Red eq{ pop (_Red_) }{ dup /Green eq{ pop (_Green_) }{ dup /Blue eq{ pop (_Blue_) }{ dup /Cyan eq{ pop (_Cyan_) }{ dup /Magenta eq{ pop (_Magenta_) }{ dup /Yellow eq{ pop (_Yellow_) }{ dup /Black eq{ pop (_Black_) }{ dup () cvn eq{ }if }bdf /AGMUTIL_GSTATE 22 dict def /get_gstate { AGMUTIL_GSTATE begin /AGMUTIL_GSTATE_clr_spc currentcolorspace def /AGMUTIL_GSTATE_clr_indx 0 def /AGMUTIL_GSTATE_clr_comps 12 array def mark currentcolor counttomark {AGMUTIL_GSTATE_clr_comps AGMUTIL_GSTATE_clr_indx 3 -1 roll put /AGMUTIL_GSTATE_clr_indx AGMUTIL_GSTATE_clr_indx 1 add def} repeat pop /AGMUTIL_GSTATE_fnt rootfont def /AGMUTIL_GSTATE_lw currentlinewidth def /AGMUTIL_GSTATE_lc currentlinecap def /AGMUTIL_GSTATE_lj currentlinejoin def /AGMUTIL_GSTATE_ml currentmiterlimit def currentdash /AGMUTIL_GSTATE_do xdf /AGMUTIL_GSTATE_da xdf / /AGMUTIL_GSTATE_sa currentstrokeadjust def /AGMUTIL_GSTATE_clr_rnd currentcolorrendering def /AGMUTIL_GSTATE_op currentoverprint def /AGMUTIL_GSTATE_bg currentblackgeneration cvlit def /AGMUTIL_GSTATE_ucr currentundercolorremoval cvlit def currentcolortransfer cvlit /AGMUTIL_GSTATE_gy_xfer xdf cvlit /AGMUTIL_GSTATE_b_xfer xdf cvlit /AGMUTIL_GSTATE_g_xfer xdf cvlit /AGMUTIL_GSTATE_r_xfer xdf /AGMUTIL_GSTATE_ht currenthalftone def /AGMUTIL_GSTATE_flt currentflat def end }def /set_gstate { AGMUTIL_GSTATE begin AGMUTIL_GSTATE_clr_spc setcolorspace AGMUTIL_GSTATE_clr_indx {AGMUTIL_GSTATE_clr_comps AGMUTIL_GSTATE_clr_indx 1 sub get /AGMUTIL_GSTATE_clr_indx AGMUTIL_GSTATE_clr_indx 1 sub def} repeat setcolor AGMUTIL_GSTATE_fnt setfont AGMUTIL_GSTATE_lw setlinewidth AGMUTIL_GSTATE_lc setlinecap AGMUTIL_GSTATE_lj setlinejoin AGMUTIL_GSTATE_ml setmiterlimit AGMUTIL_GSTATE_da AGMUTIL_GSTATE_do setdash A AGMUTIL_GSTATE_sa setstrokeadjust AGMUTIL_GSTATE_clr_rnd setcolorrendering AGMUTIL_GSTATE_op setoverprint AGMUTIL_GSTATE_bg cvx setblackgeneration AGMUTIL_GSTATE_ucr cvx setundercolorremoval }if }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse pop (Process) AGMUTIL_GSTATE_r_xfer cvx AGMUTIL_GSTATE_g_xfer cvx AGMUTIL_GSTATE_b_xfer cvx A AGMUTIL_GSTATE_gy_xfer cvx setcolortransfer AGMUTIL_GSTATE_ht /HalftoneType get dup 9 eq exch 100 eq or { currenthalftone /HalftoneType get AGMUTIL_GSTATE_ht /HalftoneType get ne { mark AGMUTIL_GSTATE_ht {sethalftone} stopped cleartomark } if }{ AGMUTIL_GSTATE_ht sethalftone } ifelse AGMUTIL_GSTATE_flt setflat end }def /AGMUTIL_str256 256 string def /AGMUTIL_src256 256 string def /AGMUTIL_dst64 64 string def /AGMUTIL_srcLen nd /AGMUTIL_ndx nd /rdline { currentfile AGMUTIL_str256 readline pop } bdf /rdcmntline { currentfile AGMUTIL_str256 readline pop (%) anchorsearch {pop} if } bdf /filter_cmyk { dup type /filetype ne{ 0 () /SubFileDecode filter }if [ exch { AGMUTIL_src256 readstring pop dup length /AGMUTIL_srcLen exch def / /AGMUTIL_ndx 0 def AGMCORE_plate_ndx 4 AGMUTIL_srcLen 1 sub{ 1 index exch get AGMUTIL_dst64 AGMUTIL_ndx 3 -1 roll put /AGMUTIL_ndx AGMUTIL_ndx 1 add def }for pop AGMUTIL_dst64 0 AGMUTIL_ndx getinterval } bind /exec cvx ] cvx } bdf /AGMUTIL_imagefile nd /AGMUTIL_imbuf nd /read_image_file { AGMUTIL_imagefile 0 setfileposition dup /DataSource {AGMUTIL_imagefile AGMUTIL_imbuf readstring pop} put exch load exec }def /write_image_file { begin { (AGMUTIL_imagefile) (w+) file } stopped{ false }{ Adobe_AGM_Utils/AGMUTIL_imagefile xddf Adobe_AGM_Utils/AGMUTIL_imbuf Width BitsPerComponent mul 7 add 8 idiv string ddf 1 1 Height { pop DataSource dup type /filetype eq{ AGMUTIL_imbuf readstring pop }{ exec } ifelse AGMUTIL_imagefile exch writestring }for true }ifelse end }def /close_image_file { AGMUTIL_imagefile closefile (AGMUTIL_imagefile) deletefile }def /consumeimagedata { begin currentdict /MultipleDataSources known not {/MultipleDataSources false def} if MultipleDataSources { 1 dict begin /flushbuffer Width cvi string def 1 1 Height cvi { pop 0 1 DataSource length 1 sub { DataSource exch get dup type dup /filetype eq { exch flushbuffer readstring pop pop }if /arraytype eq { exec pop }if }for }for end } { /DataSource load type dup /filetype eq { 1 dict begin /flushbuffer Width Decode length 2 div mul cvi string def 1 1 Height { pop DataSource flushbuffer readstring pop pop} for end }if /arraytype eq { 1 1 Height { pop DataSource pop } for }if }ifelse end }bdf /addprocs { 2{/exec load}repeat 3 1 roll [ 5 1 roll ] bind cvx }def /modify_halftone_xfer { currenthalftone dup length dict copy begin currentdict 2 index known{ 1 index load dup length dict copy begin currentdict/TransferFunction known{ /TransferFunction load }{ currenttransfer }ifelse addprocs /TransferFunction xdf currentdict end def currentdict end sethalftone }{ currentdict/TransferFunction known{ /TransferFunction load }{ currenttransfer }ifelse addprocs /TransferFunction xdf c currentdict end sethalftone pop }ifelse }def /doc_setup{ Adobe_AGM_Utils begin }bdf /doc_trailer{ currentdict Adobe_AGM_Utils eq{ end }if }bdf systemdict /setpacking known { setpacking } if %%EndResource %%BeginResource: procset Adobe_AGM_Core 2.0 0 %%Version: 2.0 0 %%Copyright: Copyright (C) 1997-1999 Adobe Systems, Inc. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Core 205 dict dup begin put /nd{ null def }bind def /Adobe_AGM_Core_Id /Adobe_AGM_Core_2.0_0 def /AGMCORE_str256 256 string def /AGMCORE_src256 256 string def /AGMCORE_save nd /AGMCORE_graphicsave nd /AGMCORE_c 0 def /AGMCORE_m 0 def /AGMCORE_y 0 def /AGMCORE_k 0 def /AGMCORE_cmykbuf 4 array def /AGMCORE_screen [currentscreen] cvx def /AGMCORE_tmp 0 def /AGMCORE_&setgray nd /AGMCORE_&setcolor nd /AGMCORE_&setcolorspace nd /AGMCORE_&setcmykcolor nd /AGMCORE_cyan_plate nd /AGMCORE_magenta_plate nd /AGMCORE_yellow_plate nd /AGMCORE_black_plate nd /AGMCORE_plate_ndx nd /AGMCORE_get_ink_data nd /AGMCORE_is_cmyk_sep nd /AGMCORE_host_sep nd /AGMCORE_will_host_sep nd /AGMCORE_avoid_L2_sep_space nd /AGMCORE_distilling nd /AGMCORE_composite_job nd /AGMCORE_producing_seps nd /AGMCORE_ps_level -1 def /AGMCORE_ps_version -1 def /AGMCORE_environ_ok nd /AGMCORE_CSA_cache 0 dict def /AGMCORE_CSD_cache 0 dict def /AGMCORE_pattern_cache 0 dict def /AGMCORE_currentoverprint def false /AGMCORE_deltaX nd /AGMCORE_deltaY nd /AGMCORE_name nd /AGMCORE_sep_special nd /AGMCORE_err_strings 4 dict def /AGMCORE_cur_err nd /AGMCORE_ovp nd /AGMCORE_current_spot_alias false def /AGMCORE_inverting false def /AGMCORE_feature_dictCount nd /AGMCORE_feature_opCount nd All Rights Reserved. /AGMCORE_feature_ctm nd /AGMCORE_ConvertToProcess false def /AGMCORE_Default_CTM matrix def /knockout_unitsq nd /AGMCORE_CRD_cache where{ pop }{ /AGMCORE_CRD_cache 0 dict def }ifelse /AGMCORE_key_known { where{ /Adobe_AGM_Core_Id known }{ false }ifelse }ndf /flushinput { save /CompareBuffer 3 -1 roll def /readbuffer 256 string def mark { currentfile readbuffer {readline} stopped {cleartomark mark} { not {pop exit} if CompareBuffer eq {exit} if }ifelse }loop cleartomark restore }bdf /getspotfunction { AGMCORE_screen exch pop exch pop dup type /dicttype eq{ dup /HalftoneType get 1 eq{ /SpotFunction get }{ dup /HalftoneType get 2 eq{ /GraySpotFunction get }{ pop { abs exch abs 2 copy add 1 gt{ 1 sub dup mul exch 1 sub dup mul add 1 sub }{ dup mul exch dup mul add 1 exch sub }ifelse }bind }ifelse }ifelse }if } def /clp_npth { clip newpath } def /eoclp_npth { eoclip newpath } def /stkpath_clp_npth { strokepath clip newpath } def /stk_n_clp_npth { gsave stroke grestore clip newpath } def /npth_clp { newpath clip } def /graphic_setup { /AGMCORE_graphicsave save def concat 0 setgray 0 setlinecap 0 setlinejoin 1 setlinewidth [] 0 setdash 10 setmiterlimit newpath false setoverprint false setstrokeadjust Adobe_AGM_Core/spot_alias get exec /Adobe_AGM_Image where { pop Adobe_AGM_Image/spot_alias 2 copy known{ get exec }{ pop pop }ifelse } if 100 dict begin /showpage {} def mark } def /graphic_cleanup { cleartomark end AGMCORE_graphicsave restore } def /compose_error_msg { g grestoreall initgraphics / /Helvetica findfont 10 scalefont setfont /AGMCORE_deltaY 100 def / /AGMCORE_deltaX 310 def clippath pathbbox newpath pop pop 36 add exch 36 add exch moveto 0 AGMCORE_deltaY rlineto AGMCORE_deltaX 0 rlineto 0 AGMCORE_deltaY neg rlineto AGMCORE_deltaX neg 0 rlineto closepath 0 AGMCORE_&setgray gsave 1 AGMCORE_&setgray fill grestore 1 setlinewidth gsave stroke grestore c currentpoint AGMCORE_deltaY 15 sub add exch 8 add exch moveto /AGMCORE_deltaY 12 def /AGMCORE_tmp 0 def AGMCORE_err_strings exch get { dup 32 eq { pop AGMCORE_str256 0 AGMCORE_tmp getinterval stringwidth pop currentpoint pop add AGMCORE_deltaX 28 add gt { currentpoint AGMCORE_deltaY sub exch pop clippath pathbbox pop pop pop 44 add exch moveto } if A AGMCORE_str256 0 AGMCORE_tmp getinterval show ( ) show 0 1 AGMCORE_str256 length 1 sub { AGMCORE_str256 exch 0 put }for /AGMCORE_tmp 0 def } { AGMCORE_str256 exch AGMCORE_tmp exch put /AGMCORE_tmp AGMCORE_tmp 1 add def } ifelse } forall } bdf /doc_setup{ A Adobe_AGM_Core begin /AGMCORE_will_host_separate xdf /AGMCORE_ps_version xdf / /AGMCORE_ps_level xdf errordict /AGM_handleerror known not{ errordict /AGM_handleerror errordict /handleerror get put errordict /handleerror { Adobe_AGM_Core begin $error /newerror get AGMCORE_cur_err null ne and{ $error /newerror false put AGMCORE_cur_err compose_error_msg }if $error /newerror true put end errordict /AGM_handleerror get exec } bind put } }if /AGMCORE_environ_ok ps_level AGMCORE_ps_level ge ps_version AGMCORE_ps_version ge and AGMCORE_ps_level -1 eq or d def AGMCORE_environ_ok not { {/AGMCORE_cur_err /AGMCORE_bad_environ def} if /AGMCORE_&setgray systemdict/setgray get def level2{ /AGMCORE_&setcolor systemdict/setcolor get def /AGMCORE_&setcolorspace systemdict/setcolorspace get def }if /AGMCORE_distilling /product where{ pop systemdict/setdistillerparams known product (Adobe PostScript Parser) ne and }{ false }ifelse def /AGMCORE_in_rip_sep /AGMCORE_in_rip_sep where{ pop AGMCORE_in_rip_sep }{ AGMCORE_distilling { false }{ userdict/Adobe_AGM_OnHost_Seps known{ false }{ level2{ currentpagedevice/Separations 2 copy known{ get }{ pop pop false }ifelse }{ false }ifelse }ifelse }ifelse }ifelse def level2 not{ /xput{ dup load dup length exch maxlength eq{ dup dup load dup length dup 0 eq {pop 1} if 2 mul dict copy def }if load begin def end }def }{ /xput{ load 3 1 roll put }def }ifelse /AGMCORE_GSTATE AGMCORE_key_known not{ /AGMCORE_GSTATE 21 dict def /AGMCORE_gstack 32 array def /AGMCORE_gstackptr 0 def /AGMCORE_gstacksaveptr 0 def / /AGMCORE_gstackframekeys 8 def /AGMCORE_&gsave /gsave ldf /AGMCORE_&grestore /grestore ldf /AGMCORE_&grestoreall /grestoreall ldf /AGMCORE_&save /save ldf /AGMCORE_gdictcopy { begin { def } forall end }def /AGMCORE_gput { AGMCORE_gstack AGMCORE_gstackptr get 3 1 roll put }def /AGMCORE_gget { AGMCORE_gstack AGMCORE_gstackptr get exch get }def /gsave { AGMCORE_&gsave AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gstackptr 1 add dup 32 ge {limitcheck} if Adobe_AGM_Core exch /AGMCORE_gstackptr exch put AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gdictcopy }def /grestore { AGMCORE_&grestore AGMCORE_gstackptr 1 sub dup AGMCORE_gstacksaveptr lt {1 add} if Adobe_AGM_Core exch /AGMCORE_gstackptr exch put }def /grestoreall { AGMCORE_&grestoreall Adobe_AGM_Core /AGMCORE_gstackptr AGMCORE_gstacksaveptr put }def /save { AGMCORE_&save AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gstackptr 1 add dup 32 ge {limitcheck} if Adobe_AGM_Core begin /AGMCORE_gstackptr exch def /AGMCORE_gstacksaveptr AGMCORE_gstackptr def end AGMCORE_gstack AGMCORE_gstackptr get AGMCORE_gdictcopy }def 0 1 AGMCORE_gstack length 1 sub { AGMCORE_gstack exch AGMCORE_gstackframekeys dict put } for }if /currentcmykcolor [0 0 0 0] AGMCORE_gput /currentstrokeadjust false AGMCORE_gput /currentcolorspace [/DeviceGray] AGMCORE_gput /sep_tint 0 AGMCORE_gput /sep_colorspace_dict null AGMCORE_gput /indexed_colorspace_dict null AGMCORE_gput /currentcolor_intent () AGMCORE_gput /customcolor_tint 1 AGMCORE_gput end }def /page_setup { /setcmykcolor where{ pop Adobe_AGM_Core/AGMCORE_&setcmykcolor /setcmykcolor load put }if Adobe_AGM_Core begin /setcmykcolor { 4 copy AGMCORE_cmykbuf astore /currentcmykcolor exch AGMCORE_gput 1 sub 4 1 roll 3 { 3 index add neg dup 0 lt { pop 0 } if 3 1 roll } repeat setrgbcolor pop }ndf /currentcmykcolor { /currentcmykcolor AGMCORE_gget aload pop }ndf /setoverprint { pop }ndf /currentoverprint { false }ndf /AGMCORE_deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt def /AGMCORE_cyan_plate 1 0 0 0 test_cmyk_color_plate def /AGMCORE_magenta_plate 0 1 0 0 test_cmyk_color_plate def /AGMCORE_yellow_plate 0 0 1 0 test_cmyk_color_plate def /AGMCORE_black_plate 0 0 0 1 test_cmyk_color_plate def /AGMCORE_plate_ndx AGMCORE_cyan_plate{ 0 }{ AGMCORE_magenta_plate{ }{ 1 AGMCORE_yellow_plate{ 2 }{ AGMCORE_black_plate{ 3 }{ 4 }ifelse }ifelse }ifelse }ifelse def /AGMCORE_composite_job AGMCORE_cyan_plate AGMCORE_magenta_plate and AGMCORE_yellow_plate and AGMCORE_black_plate and def A / /AGMCORE_producing_seps AGMCORE_composite_job not AGMCORE_in_rip_sep or def / /AGMCORE_host_sep AGMCORE_producing_seps AGMCORE_in_rip_sep not and def /AGM_preserve_spots /AGM_preserve_spots where{ pop AGM_preserve_spots }{ AGMCORE_distilling AGMCORE_producing_seps or }ifelse def /AGM_is_distiller_preserving_spotimages { currentdistillerparams/PreserveOverprintSettings known { currentdistillerparams/PreserveOverprintSettings get { currentdistillerparams/ColorConversionStrategy known { currentdistillerparams/ColorConversionStrategy get }{ }{ }{ /LeaveColorUnchanged eq true }ifelse false }ifelse false }ifelse }def /convert_spot_to_process where {pop}{ /convert_spot_to_process { dup dup (None) eq exch (All) eq or { pop false }{ AGMCORE_host_sep { setcustomcolor gsave 1 0 0 0 setcmykcolor currentgray 1 exch sub 0 1 0 0 setcmykcolor currentgray 1 exch sub 0 0 1 0 setcmykcolor currentgray 1 exch sub 0 0 0 1 setcmykcolor currentgray 1 exch sub add add add 0 eq { pop false }{ false setoverprint 1 1 1 1 5 -1 roll findcmykcustomcolor 1 currentgray 0 eq }ifelse grestore }{ AGMCORE_distilling { pop AGM_is_distiller_preserving_spotimages not }{ Adobe_AGM_Core/AGMCORE_name xddf false currentpagedevice/OverrideSeparations known { currentpagedevice/OverrideSeparations get { /HqnSpots /ProcSet resourcestatus { pop pop pop true }if }if } }if { AGMCORE_name /HqnSpots /ProcSet findresource /TestSpot get exec not }{ gsave [/Separation AGMCORE_name /DeviceGray {}]setcolorspace false currentpagedevice/SeparationColorNames 2 copy known { get { AGMCORE_name eq or}forall not }{ pop pop pop true }ifelse grestore }ifelse }ifelse }ifelse }ifelse }def }ifelse /convert_to_process where {pop}{ /convert_to_process { }def } }ifelse AGMCORE_host_sep AGMCORE_will_host_separate not and { /AGMCORE_cur_err /AGMCORE_color_space_onhost_seps def AGMCORE_color_space_onhost_seps }if /AGMCORE_avoid_L2_sep_space version cvr 2012 lt level2 and AGMCORE_producing_seps not and def /AGMCORE_is_cmyk_sep AGMCORE_cyan_plate AGMCORE_magenta_plate or AGMCORE_yellow_plate or AGMCORE_black_plate or def /AGM_avoid_0_cmyk where{ pop AGM_avoid_0_cmyk }{ AGM_preserve_spots userdict/Adobe_AGM_OnHost_Seps known userdict/Adobe_AGM_InRip_Seps known or not and }ifelse { /setcmykcolor[ { 4 copy add add add 0 eq currentoverprint and{ pop 0.0005 }if }/exec cvx /AGMCORE_&setcmykcolor load dup type/operatortype ne{ /exec cvx }if ]cvx def }if AGMCORE_host_sep{ /AGMCORE_get_ink_data AGMCORE_cyan_plate{ {pop pop pop} }{ dup length 0 eq { pop false }{ AGMCORE_host_sep { true exch { convert_spot_to_process and } forall }{ false exch { convert_spot_to_process or } forall }ifelse }ifelse AGMCORE_magenta_plate{ {4 3 roll pop pop pop} }{ AGMCORE_yellow_plate{ {4 2 roll pop pop pop} }{ {4 1 roll pop pop pop} }ifelse }ifelse }ifelse def /clip AGMCORE_key_known not{ Adobe_AGM_Core/AGMCORE_&clip /clip load put /clip { current_spot_alias{ currentdict/InksUsed known{ [ InksUsed{ dup map_alias{ /Name get exch pop }if }forall ] /InksUsed xdf }if }if AGMCORE_&clip }def }if /eoclip AGMCORE_key_known not{ Adobe_AGM_Core/AGMCORE_&eoclip /eoclip load put /eoclip { current_spot_alias{ currentdict/InksUsed known{ [ InksUsed{ dup map_alias{ /Name get exch pop }if }forall ] /InksUsed xdf }if }if AGMCORE_&eoclip }def }if }if AGMCORE_in_rip_sep{ /setcustomcolor { exch aload pop dup 7 1 roll inRip_spot_has_ink not { 4 {4 index mul 4 1 roll} repeat /DeviceCMYK setcolorspace 6 -2 roll pop pop }{ /AGMCORE_c xdf Adobe_AGM_Core begin /AGMCORE_k xdf /AGMCORE_y xdf /AGMCORE_m xdf end [/Separation 4 -1 roll /DeviceCMYK {dup AGMCORE_c mul exch dup AGMCORE_m mul exch dup AGMCORE_y mul exch AGMCORE_k mul} ] setcolorspace }ifelse setcolor }ndf /setseparationgray { [/Separation (All) /DeviceGray {}] setcolorspace_opt 1 exch sub setcolor }ndf }{ /setseparationgray { AGMCORE_&setgray }ndf }ifelse /findcmykcustomcolor { 5 makereadonlyarray }ndf /setcustomcolor { exch aload pop pop 4 {4 index mul 4 1 roll} repeat setcmykcolor pop } }ndf /has_color /colorimage where{ AGMCORE_producing_seps{ pop true }{ systemdict eq }ifelse }{ false }ifelse d def /map_index { 1 index mul exch getinterval {255 div} forall } }def level2{ /mo /moveto ldf /li /lineto ldf /cv /curveto ldf /knockout_unitsq { 1 setgray 0 0 1 1 rectfill }def /level2ScreenFreq{ begin 60 HalftoneType 1 eq{ pop Frequency }if HalftoneType 2 eq{ pop GrayFrequency }if HalftoneType 5 eq{ pop Default level2ScreenFreq }if end }def /currentScreenFreq{ currenthalftone level2ScreenFreq }def l level2 /setcolorspace AGMCORE_key_known not and{ /AGMCORE_&&&setcolorspace /setcolorspace ldf /AGMCORE_ReplaceMappedColor { dup type dup /arraytype eq exch /packedarraytype eq or { dup 0 get dup /Separation eq { pop dup length array copy dup dup 1 get current_spot_alias { dup map_alias { begin /sep_colorspace_dict currentdict pop pop [ p pop AGMCORE_gput ] dup Name end /Separation Name CSA map_csa dup /MappedCSA xdf /sep_colorspace_proc load }{ }if }if map_reserved_ink_name 1 exch put /DeviceN eq { dup length array copy dup dup 1 get [ exch { current_spot_alias{ dup map_alias{ }if /Name get exch pop }if map_reserved_ink_name } forall ] 1 exch put }if }ifelse }if }def /setcolorspace { dup type dup /arraytype eq exch /packedarraytype eq or { dup 0 get /Indexed eq { AGMCORE_distilling { /PhotoshopDuotoneList where { pop false }{ true }ifelse }{ true }ifelse { aload pop 3 -1 roll AGMCORE_ReplaceMappedColor 3 1 roll 4 array astore }if }{ AGMCORE_ReplaceMappedColor }ifelse }if AGMCORE_&&&setcolorspace }def } }{ } }if /adj { }def /mo{ }def /li{ }def /cv{ currentstrokeadjust{ transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform }if adj moveto adj lineto 6 2 roll adj 6 2 roll adj 6 2 roll adj curveto }def /knockout_unitsq { 1 setgray 8 8 1 [8 0 0 8 0 0] {<ffffffffffffffff>} image }def /currentstrokeadjust{ /currentstrokeadjust AGMCORE_gget }def /setstrokeadjust{ /currentstrokeadjust exch AGMCORE_gput }def /currentScreenFreq{ currentscreen pop pop }def /setcolorspace { /currentcolorspace exch AGMCORE_gput } def /currentcolorspace { /currentcolorspace AGMCORE_gget } def /n_color_components { dup type /arraytype eq{ 0 get }if dup /DeviceGray eq{ pop 1 }{ /DeviceCMYK eq{ 4 }{ 3 }ifelse }ifelse } def /setcolor_devicecolor { dup type /arraytype eq{ 0 get }if dup /DeviceGray eq{ pop setgray }{ /DeviceCMYK eq{ setcmykcolor }{ setrgbcolor }ifelse }ifelse } }def /setcolor { /stringtype eq{ currentcolorspace 0 get dup /DeviceGray ne{ dup /DeviceCMYK ne{ dup /DeviceRGB ne{ dup /Separation eq{ pop currentcolorspace 3 get exec currentcolorspace 2 get }{ dup /Indexed eq{ pop currentcolorspace 3 get dup type currentcolorspace 1 get }{ 3 -1 roll map_index n_color_components }{ /AGMCORE_invalid_color_space def exec }ifelse currentcolorspace 1 get /AGMCORE_cur_err }if }if AGMCORE_invalid_color_space }ifelse }ifelse } def } }ifelse }if setcolor_devicecolor /sop /setoverprint ldf /lw /setlinewidth ldf /lc /setlinecap ldf /lj /setlinejoin ldf /ml /setmiterlimit ldf /dsh /setdash ldf /sadj /setstrokeadjust ldf /gry /setgray ldf /rgb /setrgbcolor ldf /cmyk /setcmykcolor ldf /sep /setsepcolor ldf /idx /setindexedcolor ldf /colr /setcolor ldf /csacrd /set_csa_crd ldf /sepcs /setsepcolorspace ldf /idxcs /setindexedcolorspace ldf /cp /closepath ldf /clp /clp_npth ldf /eclp /eoclp_npth ldf /spclp /stkpath_clp_npth ldf /f /fill ldf /ef /eofill ldf /s /stroke ldf /sclp /stk_n_clp_npth ldf /nclp /npth_clp ldf /gset /graphic_setup ldf / /gcln /graphic_cleanup ldf currentdict{ dup xcheck 1 index type dup /arraytype eq exch /packedarraytype eq or }if def }forall bind and { }def /page_trailer { end }def /doc_trailer{ }def systemdict /findcolorrendering known{ /findcolorrendering systemdict /findcolorrendering get def }if systemdict /setcolorrendering known{ /setcolorrendering systemdict /setcolorrendering get def }if /test_cmyk_color_plate { gsave setcmykcolor currentgray 1 ne grestore }def /inRip_spot_has_ink { dup Adobe_AGM_Core/AGMCORE_name xddf convert_spot_to_process not }def /current_ink { dup length 0 eq{ pop true }{ Adobe_AGM_Core/ink_result false put { dup /ProcessCyan eq{ AGMCORE_cyan_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessMagenta eq{ AGMCORE_magenta_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessYellow eq{ AGMCORE_yellow_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /ProcessBlack eq{ AGMCORE_black_plate ink_result or Adobe_AGM_Core/ink_result xddf }{ dup /sep_colorspace_dict AGMCORE_gget dup null eq{ Adobe_AGM_Core/ink_result xddf }{ pop false ink_result or /Name get eq{ 1 setsepcolor currentgray 1 ne ink_result }{ false ink_result or or Adobe_AGM_Core/ink_result xddf Adobe_AGM_Core/ink_result xddf }ifelse }ifelse }ifelse }ifelse }ifelse }ifelse pop } forall ink_result }ifelse }def /map255_to_range { 1 index sub 3 -1 roll 255 div mul add }def /set_csa_crd { /sep_colorspace_dict null AGMCORE_gput begin CSA map_csa setcolorspace_opt set_crd end } def /setsepcolor { /sep_colorspace_dict AGMCORE_gget begin dup /sep_tint exch AGMCORE_gput TintProc end } def /sep_colorspace_proc { Adobe_AGM_Core/AGMCORE_tmp xddf /sep_colorspace_dict AGMCORE_gget begin currentdict/Components known{ Components aload pop TintMethod/Lab eq{ 2 {AGMCORE_tmp mul NComponents 1 roll} repeat LMax sub AGMCORE_tmp mul LMax add NComponents 1 roll }{ TintMethod/Subtractive eq{ NComponents{ AGMCORE_tmp mul NComponents 1 roll }repeat }{ NComponents{ 1 sub AGMCORE_tmp mul 1 add } repeat }ifelse }ifelse }{ NComponents 1 roll } def /sep_colorspace_gray_proc { Adobe_AGM_Core/AGMCORE_tmp xddf /sep_colorspace_dict AGMCORE_gget begin GrayLookup AGMCORE_tmp GrayLookup length 1 sub mul round cvi get end } def /sep_proc_name { dup 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or level2 not and has_color not and{ pop [/DeviceGray] /sep_colorspace_gray_proc }{ /sep_colorspace_proc }ifelse } def /setsepcolorspace { current_spot_alias{ dup begin Name map_alias{ exch pop }if end }if dup /sep_colorspace_dict exch AGMCORE_gput begin /MappedCSA CSA map_csa def A Adobe_AGM_Core/AGMCORE_sep_special Name dup () eq exch (All) eq or ddf AGMCORE_avoid_L2_sep_space{ [/Indexed MappedCSA sep_proc_name 255 exch { 255 div } /exec cvx 3 -1 roll [ 4 1 roll load /exec cvx ] cvx ] setcolorspace_opt /TintProc { 255 mul round cvi setcolor }bdf }{ MappedCSA 0 get /DeviceCMYK eq currentdict/Components known and AGMCORE_sep_special not and{ /TintProc [ Components aload pop Name findcmykcustomcolor /exch cvx /setcustomcolor cvx ] cvx bdf }{ AGMCORE_host_sep Name (All) eq and{ ColorLookup AGMCORE_tmp ColorLookup length 1 sub mul round cvi get aload pop }ifelse end }{ /TintProc { 1 exch sub setseparationgray }bdf AGMCORE_in_rip_sep MappedCSA 0 get /DeviceCMYK eq and AGMCORE_host_sep or Name () eq and{ /TintProc [ MappedCSA sep_proc_name exch 0 get /DeviceCMYK }{ cvx /setcmykcolor cvx eq{ }{ cvx /setgray cvx }ifelse ] cvx bdf AGMCORE_producing_seps MappedCSA 0 get dup /DeviceCMYK eq exch /DeviceGray eq or and AGMCORE_sep_special not and{ /TintProc [ /dup cvx MappedCSA sep_proc_name cvx exch 0 get /DeviceGray eq{ 1 /exch cvx /sub cvx 0 0 0 4 -1 /roll cvx }if /Name cvx /findcmykcustomcolor cvx /exch c cvx AGMCORE_host_sep{ AGMCORE_is_cmyk_sep }{ Name inRip_spot_has_ink not }ifelse { /pop cvx 1 }if /setcustomcolor cvx ] cvx bdf }{ / /TintProc /setcolor ldf [/Separation Name MappedCSA sep_proc_name load ] setcolorspace_opt }ifelse }ifelse }ifelse }ifelse }ifelse set_crd setsepcolor end } def /setindexedcolorspace { dup /indexed_colorspace_dict exch AGMCORE_gput begin /MappedCSA CSA map_csa def AGMCORE_host_sep level2 not and{ 0 0 0 0 setcmykcolor }{ forall [/Indexed MappedCSA level2 not has_color not and{ dup 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or{ pop [/DeviceGray] }if HiVal GrayLookup }{ HiVal currentdict/RangeArray known{ { /indexed_colorspace_dict AGMCORE_gget begin Lookup exch dup HiVal gt{ pop HiVal }if NComponents mul NComponents getinterval {} NComponents 1 sub -1 0{ RangeArray exch 2 mul 2 getinterval aload pop map255_to_range }for end } bind NComponents 1 roll }{ Lookup }ifelse }ifelse ] setcolorspace_opt set_crd }ifelse end }def /setindexedcolor { AGMCORE_host_sep{ /indexed_colorspace_dict AGMCORE_gget/Lookup get 4 3 -1 roll map_index setcmykcolor }{ setcolor }ifelse } def /ignoreimagedata { currentoverprint not{ gsave dup begin 1 setgray 0 0 ImageMatrix itransform Width Height ImageMatrix idtransform rectfill end grestore }if consumeimagedata }def /add_csa { }def /map_csa { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_CSA_cache get exch get }if }def /add_csd { Adobe_AGM_Core begin /AGMCORE_CSD_cache xput end }def /get_csd { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_CSD_cache get exch get }if }def /get_csd_by_name { dup type dup /nametype eq exch /stringtype eq or{ Adobe_AGM_Core begin /AGMCORE_CSD_Name xdf AGMCORE_CSD_cache { dup /Name get AGMCORE_CSD_Name eq { exch pop exit }{ pop }ifelse pop }forall end }if }def /cachepattern_level2 { 4 dict begin /comparebuffer exch def /holdbuffer exch def /readbuffer 1024 string def /LZWFilter holdbuffer /LZWEncode filter def { currentfile readbuffer readline not {pop exit} if dup LZWFilter exch writestring LZWFilter (\n) writestring comparebuffer eq {exit} if }loop LZWFilter closefile end Adobe_AGM_Core begin /AGMCORE_CSA_cache xput end }def /cachepattern_level3 { 3 dict begin /comparebuffer exch def /readbuffer 1024 string def /DoEOL false def { DoEOL { (\n) /DoEOL false def } { currentfile readbuffer readline not {pop ()} { dup length 0 eq { pop(\n)} { dup comparebuffer eq {pop ()} {/DoEOL true def} ifelse } ifelse } ifelse } ifelse } /ReusableStreamDecode filter end }def /add_pattern { Adobe_AGM_Core begin /AGMCORE_pattern_cache xput end }def /get_pattern { dup type /nametype eq{ Adobe_AGM_Core/AGMCORE_pattern_cache get exch get }if }def /make_pattern { dup matrix currentmatrix matrix concatmatrix 0 0 3 2 roll itransform exch 3 index /XStep get 1 index exch 2 copy div cvi mul sub sub exch 3 index /YStep get 1 index exch 2 copy div cvi mul sub sub matrix translate exch matrix concatmatrix makepattern }def /set_pattern { dup /PatternType get 1 eq{ dup /PaintType get 1 eq{ false sop [/DeviceGray] setcolorspace 0 setgray }if }if setpattern }def /setcolorspace_opt { dup currentcolorspace eq{ pop }{ setcolorspace }ifelse }def /updatecolorrendering { currentcolorrendering/Intent known{ currentcolorrendering/Intent get }{ null } }ifelse Intent ne{ false Intent AGMCORE_CRD_cache { exch pop begin dup Intent eq{ currentdict setcolorrendering_opt end e exch pop true exch exit }if end } forall pop not{ systemdict /findcolorrendering known{ Intent findcolorrendering pop /ColorRendering findresource dup length dict copy setcolorrendering_opt }if }if }if } def /add_crd { AGMCORE_CRD_cache 3 1 roll put }def /set_crd { AGMCORE_host_sep not level2 and{ currentdict/CRD known{ AGMCORE_CRD_cache CRD get dup null ne{ setcolorrendering_opt }{ pop }ifelse }{ currentdict/Intent known{ updatecolorrendering }if }ifelse }if }def /setcolorrendering_opt { dup currentcolorrendering eq{ pop }{ begin /Intent Intent def currentdict end setcolorrendering }ifelse }def /cdndf { exch dup currentdict exch known{ pop pop }{ exch def }ifelse }def /cpaint_gcomp { convert_to_process Adobe_AGM_Core/AGMCORE_ConvertToProcess xddf Adobe_AGM_Core/AGMCORE_ConvertToProcess get not { (%end_cpaint_gcomp) flushinput }if }def /cpaint_gsep { Adobe_AGM_Core/AGMCORE_ConvertToProcess get { (%end_cpaint_gsep) flushinput }if }def /cpaint_gend { newpath }def /AGMCORE_ctm_stack bdict /push_ctm { stack length size le{ stack dup length 2 mul array dup /stack exch def copy pop }if stack size 3 -1 roll put /size size 1 add def } /pop_ctm { /size size 1 sub def size 0 lt{ /size 0 def }if stack size get } /stack 1 array /size 0 edict def /save_ctm { matrix currentmatrix AGMCORE_ctm_stack begin push_ctm end }def /restore_ctm { AGMCORE_ctm_stack begin pop_ctm end setmatrix }def /path_rez { dup 0 ne{ AGMCORE_deviceDPI exch div dup 1 lt{ pop 1 }if setflat }{ pop } }ifelse }def /rdcmntline { currentfile AGMCORE_str256 readline pop (%) anchorsearch {pop} if } def /set_spot_alias_ary { /AGMCORE_SpotAliasAry where{ pop pop }{ Adobe_AGM_Core/AGMCORE_SpotAliasAry xddf true set_spot_alias }ifelse }def /set_spot_alias { /AGMCORE_SpotAliasAry where{ /AGMCORE_current_spot_alias 3 -1 roll put }{ pop }ifelse }def /current_spot_alias { /AGMCORE_SpotAliasAry where{ /AGMCORE_current_spot_alias get }{ false }ifelse }def /map_alias { /AGMCORE_SpotAliasAry where{ begin /AGMCORE_name xdf f false AGMCORE_SpotAliasAry{ dup/Name get AGMCORE_name eq{ save exch /Adobe_AGM_Core currentdict def /CSD get get_csd exch restore exch pop true exit }{ pop }ifelse }forall end }{ pop false }ifelse }bdf /spot_alias { t true set_spot_alias /AGMCORE_&setcustomcolor AGMCORE_key_known not { Adobe_AGM_Core/AGMCORE_&setcustomcolor /setcustomcolor load put } if / /customcolor_tint 1 AGMCORE_gput Adobe_AGM_Core begin /setcustomcolor { d dup /customcolor_tint exch AGMCORE_gput current_spot_alias{ 1 index 4 get map_alias{ mark 3 1 roll setsepcolorspace counttomark 0 ne{ setsepcolor }if pop pop }{ AGMCORE_&setcustomcolor }ifelse }{ AGMCORE_&setcustomcolor }ifelse }def /begin_feature }bdf end { Adobe_AGM_Core/AGMCORE_feature_dictCount countdictstack put count Adobe_AGM_Core/AGMCORE_feature_opCount 3 -1 roll put {Adobe_AGM_Core/AGMCORE_feature_ctm matrix currentmatrix put}if }def /end_feature { 2 dict begin /spd /setpagedevice load def /setpagedevice { get_gstate spd set_gstate } def stopped{$error/newerror false put}if end count Adobe_AGM_Core/AGMCORE_feature_opCount get sub dup 0 gt{{pop}repeat} {pop}ifelse countdictstack Adobe_AGM_Core/AGMCORE_feature_dictCount get sub dup 0 gt{{end}repeat}{pop}ifelse {Adobe_AGM_Core/AGMCORE_feature_ctm get setmatrix}if }def /set_negative { Adobe_AGM_Core begin /AGMCORE_inverting exch def level2{ currentpagedevice/NegativePrint known{ currentpagedevice/NegativePrint get Adobe_AGM_Core/AGMCORE_inverting get ne{ true begin_feature true{ bdict /NegativePrint Adobe_AGM_Core/AGMCORE_inverting get edict setpagedevice }end_feature }if /AGMCORE_inverting false def }if }if AGMCORE_inverting{ [{1 exch sub}/exec load dup currenttransfer exch]cvx bind settransfer gsave newpath clippath 1 /setseparationgray where{pop setseparationgray}{setgray}ifelse fill grestore }if end }def /lw_save_restore_override { /md where { pop md begin /pmSVsetup{} def /endp{}def /pse{}def /psb{}def /orig_showpage where {pop} {/orig_showpage /showpage load def} ifelse /showpage {orig_showpage gR} def end }if }def /pscript_showpage_override { }def /driver_media_override { /md where { pop md /initializepage known { md /initializepage {} put } if md /rC known { md /rC {4{pop}repeat} put } if } }if Adobe_AGM_Core /AGMCORE_Default_CTM matrix currentmatrix put }def /driver_check_media_override { Adobe_AGM_Core /AGMCORE_Default_CTM get matrix currentmatrix ne { Adobe_AGM_Core /AGMCORE_Default_CTM get setmatrix }if }def AGMCORE_err_strings begin /AGMCORE_bad_environ (Environment not satisfactory for this job. Ensure that the PPD is correct or that the PostScript level requested is supported by this printer. ) def /AGMCORE_color_space_onhost_seps (This job contains colors that will not separate with on-host methods. ) def /AGMCORE_invalid_color_space (This job contains an invalid color space. ) def end end systemdict /setpacking known { setpacking } if %%EndResource %%BeginResource: procset Adobe_CoolType_Core 2.12 0 %%Copyright: Copyright 1997-2001 Adobe Systems Incorporated. All Rights Reserved. %%Version: 2.12 0 userdict/Adobe_CoolType_Core 60 dict dup begin put/Level2? systemdict /languagelevel known dup{pop systemdict/languagelevel get 2 ge}if def Level2? not{/currentglobal false def/setglobal/pop load def/gcheck{pop false}bind def /currentpacking false def/setpacking/pop load def/SharedFontDirectory 0 dict def}if currentpacking true setpacking/@_SaveStackLevels{Adobe_CoolType_Data begin @opStackCountByLevel @opStackLevel 2 copy known not{2 copy 3 dict dup /args 7 index 5 add array put put get}{get dup/args get dup length 3 index lt{ dup length 5 add array exch 1 index exch 0 exch putinterval 1 index exch/args exch put}{pop}ifelse}ifelse begin count 2 sub 1 index lt{pop count 1 sub}if dup/argCount exch def dup 0 gt{exch 1 index 2 add 1 roll args exch 0 exch getinterval astore pop}{pop}ifelse count 1 sub/restCount exch def end /NTPSOct95 where { begin showpage save /showpage /restore load def /restore {exch pop}def end }if /@opStackLevel @opStackLevel 1 add def countdictstack 1 sub @dictStackCountByLevel exch @dictStackLevel exch put/@dictStackLevel @dictStackLevel 1 add def end}bind def/@_RestoreStackLevels{ Adobe_CoolType_Data begin/@opStackLevel @opStackLevel 1 sub def @opStackCountByLevel @opStackLevel get begin count restCount sub dup 0 gt{{pop }repeat}{pop}ifelse args 0 argCount getinterval{}forall end/@dictStackLevel @dictStackLevel 1 sub def @dictStackCountByLevel @dictStackLevel get end countdictstack exch sub dup 0 gt{{end}repeat}{pop}ifelse}bind def /@_PopStackLevels{Adobe_CoolType_Data begin/@opStackLevel @opStackLevel 1 sub def/@dictStackLevel @dictStackLevel 1 sub def end}bind def/@Raise{exch cvx exch errordict exch get exec stop}bind def/@ReRaise{cvx $error/errorname get errordict exch get exec stop}bind def/@Stopped{0 @#Stopped}bind def/@#Stopped{ @_SaveStackLevels stopped{@_RestoreStackLevels true}{@_PopStackLevels false} ifelse}bind def/@Arg{Adobe_CoolType_Data begin @opStackCountByLevel @opStackLevel 1 sub get/args get exch get end}bind def/doc_setup{ Adobe_CoolType_Core begin/mov/moveto load def/nfnt/newencodedfont load def /mfnt/makefont load def/sfnt/setfont load def/ufnt/undefinefont load def/chp /charpath load def/awsh/awidthshow load def/wsh/widthshow load def/ash/ashow load def/sh/show load def end userdict/Adobe_CoolType_Data 6 dict dup begin /AddWidths? false def/CC 0 def/charcode 2 string def/@opStackCountByLevel 32 dict def/@opStackLevel 0 def/@dictStackCountByLevel 32 dict def /@dictStackLevel 0 def end put}bind def/doc_trailer{currentdict Adobe_CoolType_Core eq{end}if}bind def/page_setup{Adobe_CoolType_Core begin} bind def/page_trailer{end}bind def/unload{systemdict/languagelevel known{ systemdict/languagelevel get 2 ge{userdict/Adobe_CoolType_Core 2 copy known{ undef}{pop pop}ifelse}if}if}bind def/ndf{1 index where{pop pop pop}{dup xcheck {bind}if def}ifelse}def/findfont dup systemdict begin userdict begin /globaldict where{/globaldict get begin}if dup where pop exch get/globaldict where{pop end}if end end def/systemfindfont/findfont load def/undefinefont{pop }ndf/copyfont{currentglobal 3 1 roll 1 index gcheck setglobal dup null eq{0}{ dup length}ifelse 2 index length add 1 add dict begin exch{1 index/FID eq{pop pop}{def}ifelse}forall dup null eq{pop}{{def}forall}ifelse currentdict end exch setglobal}bind def/copyarray{currentglobal exch dup gcheck setglobal dup length array copy exch setglobal}bind def/newencodedfont{currentglobal{ SharedFontDirectory 3 index known{SharedFontDirectory 3 index get /FontReferenced known}{false}ifelse}{FontDirectory 3 index known{FontDirectory 3 index get/FontReferenced known}{SharedFontDirectory 3 index known{ SharedFontDirectory 3 index get/FontReferenced known}{false}ifelse}ifelse} ifelse dup{3 index findfont/FontReferenced get 2 index findfont ne{pop false} if}if{pop 1 index findfont/Encoding get exch 0 1 255{2 copy get 3 index 3 1 roll put}for pop pop pop}{findfont dup dup maxlength 2 add dict begin exch{1 index/FID ne{def}{pop pop}ifelse}forall/FontReferenced exch def/Encoding exch dup length array copy def/FontName 1 index dup type/stringtype eq{cvn}if def currentdict end definefont pop}ifelse}bind def/SetSubstituteStrategy{ $SubstituteFont begin dup type/dicttype ne{0 dict}if currentdict/$Strategies known{exch $Strategies exch 2 copy known{get 2 copy maxlength exch maxlength add dict begin{def}forall{def}forall currentdict dup/$Init known{dup/$Init get exec}if end/$Strategy exch def}{pop pop pop}ifelse}{pop pop}ifelse end}bind def/scff{$SubstituteFont begin dup type/stringtype eq{dup length exch}{null} ifelse/$sname exch def/$slen exch def end{findfont}@Stopped{dup length dup 21 add string dup 4 3 roll 0 exch 128 string cvs putinterval exch 1 index exch (_was-malformed-so-was)putinterval cvn{findfont}@Stopped{pop/Courier findfont} if}if $SubstituteFont begin/$sname null def/$slen 0 def end}bind def /isWidthsOnlyFont{dup/WidthsOnly known{pop pop true}{dup/FDepVector known{ /FDepVector get{isWidthsOnlyFont dup{exit}if}forall}{dup/FDArray known{ /FDArray get{isWidthsOnlyFont dup{exit}if}forall}{pop}ifelse}ifelse}ifelse} bind def/?set{$SubstituteFont begin/$substituteFound false def/$fontname 4 index def/$doSmartSub false def end 3 index findfont $SubstituteFont begin $substituteFound{false}{dup/FontName known{dup/FontName get $fontname eq 1 index/DistillerFauxFont known not and/currentdistillerparams where{pop false 2 index isWidthsOnlyFont not and}if}{false}ifelse}ifelse exch pop/$doSmartSub true def end{exch pop exch pop exch 2 dict dup/Found 3 index put exch findfont exch}{exch exec exch findfont 2 dict dup/Downloaded 6 5 roll put}ifelse dup /FontName 4 index put copyfont definefont pop}bind def/?str1 256 string def /?str2 256 string def/?add{1 index type/integertype eq{exch true 4 2}{false 3 1}ifelse roll 1 index findfont dup/Widths known{Adobe_CoolType_Data/AddWidths? true put gsave dup 1000 scalefont setfont}if/Downloaded known{exec exch{exch ?str2 cvs exch findfont/Downloaded get 1 dict begin/Downloaded 1 index def ?str1 cvs length ?str1 1 index 1 add 3 index putinterval exch length 1 add 1 index add ?str1 2 index(*)putinterval ?str1 0 2 index getinterval cvn findfont ?str1 3 index(+)putinterval 2 dict dup/FontName ?str1 0 6 index getinterval cvn put dup/Downloaded Downloaded put end copyfont dup/FontName get exch definefont pop pop pop}{pop}ifelse}{pop exch{findfont dup/Found get dup length exch ?str1 cvs pop ?str1 1 index(+)putinterval ?str1 1 index 1 add 4 index ?str2 cvs putinterval ?str1 exch 0 exch 5 4 roll ?str2 cvs length 1 add add getinterval cvn 1 dict exch 1 index exch/FontName exch put copyfont dup /FontName get exch definefont pop}{pop}ifelse}ifelse Adobe_CoolType_Data /AddWidths? get{grestore Adobe_CoolType_Data/AddWidths? false put}if}bind def /?sh{currentfont/Downloaded known{exch}if pop}bind def/?chp{currentfont /Downloaded known{pop}{false chp}ifelse}bind def/?mv{currentfont/Downloaded known{moveto pop pop}{pop pop moveto}ifelse}bind def setpacking userdict /$SubstituteFont 25 dict put 1 dict begin/SubstituteFont dup $error exch 2 copy known{get}{pop pop{pop/Courier}bind}ifelse def/currentdistillerparams where dup{pop pop currentdistillerparams/CannotEmbedFontPolicy 2 copy known{ get/Error eq}{pop pop false}ifelse}if not{countdictstack array dictstack 0 get begin userdict begin $SubstituteFont begin/$str 128 string def/$fontpat 128 string def/$slen 0 def/$sname null def/$match false def/$fontname null def /$substituteFound false def/$doSmartSub true def/$depth 0 def/$fontname null def/$italicangle 26.5 def/$dstack null def/$Strategies 10 dict dup begin /$Type3Underprint{currentglobal exch false setglobal 11 dict begin/UseFont exch $WMode 0 ne{dup length dict copy dup/WMode $WMode put/UseFont exch definefont}if def/FontName $fontname dup type/stringtype eq{cvn}if def /FontType 3 def/FontMatrix[.001 0 0 .001 0 0]def/Encoding 256 array dup 0 1 255{/.notdef put dup}for pop def/FontBBox[0 0 0 0]def/CCInfo 7 dict dup begin /cc null def/x 0 def/y 0 def end def/BuildChar{exch begin CCInfo begin 1 string dup 0 3 index put exch pop/cc exch def UseFont 1000 scalefont setfont cc stringwidth/y exch def/x exch def x y setcharwidth $SubstituteFont /$Strategy get/$Underprint get exec 0 0 moveto cc show x y moveto end end}bind def currentdict end exch setglobal}bind def/$GetaTint 2 dict dup begin /$BuildFont{dup/WMode known{dup/WMode get}{0}ifelse/$WMode exch def $fontname exch dup/FontName known{dup/FontName get dup type/stringtype eq{cvn}if}{ /unnamedfont}ifelse exch $deepcopyfont exch 1 index exch/FontBasedOn exch put dup/FontName $fontname dup type/stringtype eq{cvn}if put definefont}bind def /$Underprint{gsave x abs y abs gt{/y 1000 def}{/x -1000 def 500 120 translate} ifelse Level2?{[/Separation(All)/DeviceCMYK{0 0 0 1 pop}]setcolorspace}{0 setgray}ifelse 10 setlinewidth x .8 mul[7 3]{y mul 8 div 120 sub x 10 div exch moveto 0 y 4 div neg rlineto dup 0 rlineto 0 y 4 div rlineto closepath gsave Level2?{.2 setcolor}{.8 setgray}ifelse fill grestore stroke}forall pop grestore}bind def end def/$Oblique 1 dict dup begin/$BuildFont{currentglobal exch dup gcheck setglobal null copyfont begin/FontBasedOn currentdict/FontName known{FontName dup type/stringtype eq{cvn}if}{/unnamedfont}ifelse def/FontName $fontname dup type/stringtype eq{cvn}if def/currentdistillerparams where{pop}{ /FontInfo currentdict/FontInfo known{FontInfo null copyfont}{2 dict}ifelse dup begin/ItalicAngle $italicangle def/FontMatrix FontMatrix[1 0 ItalicAngle dup sin exch cos div 1 0 0]matrix concatmatrix readonly end 4 2 roll def def} ifelse FontName currentdict end definefont exch setglobal}bind def end def /$None 1 dict dup begin/$BuildFont{}bind def end def end def/$Oblique SetSubstituteStrategy/$findfontByEnum{dup type/stringtype eq{cvn}if dup /$fontname exch def $sname null eq{$str cvs dup length $slen sub $slen getinterval}{pop $sname}ifelse $fontpat dup 0(fonts/*)putinterval exch 7 exch putinterval/$match false def $SubstituteFont/$dstack countdictstack array dictstack put mark{$fontpat 0 $slen 7 add getinterval{/$match exch def exit} $str filenameforall}stopped{cleardictstack currentdict true $SubstituteFont /$dstack get{exch{1 index eq{pop false}{true}ifelse}{begin false}ifelse}forall pop}if cleartomark/$slen 0 def $match false ne{$match(fonts/)anchorsearch pop pop cvn}{/Courier}ifelse}bind def/$ROS 1 dict dup begin/Adobe 4 dict dup begin /Japan1[/Ryumin-Light/HeiseiMin-W3/GothicBBB-Medium/HeiseiKakuGo-W5 /HeiseiMaruGo-W4/Jun101-Light]def/Korea1[/HYSMyeongJo-Medium/HYGoThic-Medium] def/GB1[/STSong-Light/STHeiti-Regular]def/CNS1[/MKai-Medium/MHei-Medium]def end def end def/$cmapname null def/$deepcopyfont{dup/FontType get 0 eq{1 dict dup/FontName/copied put copyfont begin/FDepVector FDepVector copyarray 0 1 2 index length 1 sub{2 copy get $deepcopyfont dup/FontName/copied put/copied exch definefont 3 copy put pop pop}for def currentdict end}{$Strategies /$Type3Underprint get exec}ifelse}bind def/$buildfontname{length $str 1 index (-)putinterval 1 add $str 1 index $cmapname $fontpat cvs putinterval $cmapname length add $str exch 0 exch getinterval cvn}bind def/$findfontByROS{/$fontname exch def $ROS Registry 2 copy known{get Ordering 2 copy known{get}{pop pop[]} ifelse}{pop pop[]}ifelse false exch{dup/CIDFont resourcestatus{pop pop save 1 index/CIDFont findresource dup/WidthsOnly known{dup/WidthsOnly get}{false} ifelse exch pop exch restore{pop}{exch pop true exit}ifelse}{pop}ifelse}forall {$str cvs $buildfontname}{false(*){save exch dup/CIDFont findresource dup /WidthsOnly known{dup/WidthsOnly get not}{true}ifelse exch/CIDSystemInfo get dup/Registry get Registry eq exch/Ordering get Ordering eq and and{exch restore exch pop true exit}{pop restore}ifelse}$str/CIDFont resourceforall{ $buildfontname}{$fontname $findfontByEnum}ifelse}ifelse}bind def end end currentdict/$error known currentdict/languagelevel known and dup{pop $error /SubstituteFont known}if dup{$error}{Adobe_CoolType_Core}ifelse begin{ /SubstituteFont/CMap/Category resourcestatus{pop pop{$SubstituteFont begin /$substituteFound true def dup length $slen gt $sname null ne or $slen 0 gt and{$sname null eq{dup $str cvs dup length $slen sub $slen getinterval cvn}{ $sname}ifelse dup/CMap resourcestatus{pop pop dup/$cmapname exch def/CMap findresource/CIDSystemInfo get{def}forall $findfontByROS}{128 string cvs dup (-)search{3 1 roll search{3 1 roll pop{dup cvi}stopped{pop pop pop pop pop $findfontByEnum}{4 2 roll pop pop exch length exch 2 index length 2 index sub exch 1 sub -1 0{$str cvs dup length 4 index 0 4 index 4 3 roll add getinterval exch 1 index exch 3 index exch putinterval dup/CMap resourcestatus{pop pop 4 1 roll pop pop pop dup/$cmapname exch def/CMap findresource/CIDSystemInfo get{ def}forall $findfontByROS true exit}{pop}ifelse}for dup type/booleantype eq{ pop}{pop pop $findfontByEnum}ifelse}ifelse}{pop pop pop $findfontByEnum}ifelse }{pop pop $findfontByEnum}ifelse}ifelse}{//SubstituteFont exec}ifelse/$slen 0 def end}}{{$SubstituteFont begin/$substituteFound true def dup length $slen gt $sname null ne or $slen 0 gt and{$findfontByEnum}{//SubstituteFont exec}ifelse end}}ifelse bind readonly def Adobe_CoolType_Core/scfindfont/systemfindfont load put}{/scfindfont{$SubstituteFont begin dup systemfindfont dup/FontName known{dup/FontName get dup 3 index ne}{/noname true}ifelse dup{ /$origfontnamefound 2 index def/$origfontname 4 index def/$substituteFound true def}if exch pop{$slen 0 gt $sname null ne 3 index length $slen gt or and{ pop dup $findfontByEnum findfont dup maxlength 1 add dict begin{1 index/FID eq {pop pop}{def}ifelse}forall currentdict end definefont dup/FontName known{dup /FontName get}{null}ifelse $origfontnamefound ne{$origfontname $str cvs print ( substitution revised, using )print dup/FontName known{dup/FontName get}{ (unspecified font)}ifelse $str cvs print(. )print}if}{exch pop}ifelse}{exch pop}ifelse end}bind def}ifelse end end Adobe_CoolType_Core/findfont{$SubstituteFont begin $depth 0 eq{/$fontname 1 index dup type/stringtype ne{$str cvs}if def/$substituteFound false def}if /$depth $depth 1 add def end scfindfont $SubstituteFont begin/$depth $depth 1 sub def $substituteFound $depth 0 eq and $doSmartSub and{currentdict/$Strategy known{$Strategy/$BuildFont get exec}if}if end}bind put}if end end %%EndResource %%BeginResource: procset Adobe_CoolType_Utility_MAKEOCF 1.13 0 %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. %%Version: 1.13 0 systemdict/languagelevel known dup{currentglobal false setglobal}{false}ifelse exch userdict/Adobe_CoolType_Utility 2 copy known{2 copy get dup maxlength 25 add dict copy}{25 dict}ifelse put Adobe_CoolType_Utility begin/ct_Level2? exch def/ct_Clone? 1183615869 internaldict dup/CCRun known not exch/eCCRun known not ct_Level2? and or def/ct_UseNativeCapability? systemdict/composefont known def/ct_MakeOCF 35 dict def/ct_Vars 25 dict def/ct_GlyphDirProcs 6 dict def /ct_BuildCharDict 15 dict dup begin/charcode 2 string def/dst_string 1500 string def/nullstring()def/usewidths? true def end def ct_Level2?{setglobal}{ pop}ifelse ct_GlyphDirProcs begin/GetGlyphDirectory{systemdict/languagelevel known{pop/CIDFont findresource/GlyphDirectory get}{1 index/CIDFont findresource/GlyphDirectory get dup type/dicttype eq{dup dup maxlength exch length sub 2 index lt{dup length 2 index add dict copy 2 index/CIDFont findresource/GlyphDirectory 2 index put}if}if exch pop exch pop}ifelse +}def/+ {systemdict/languagelevel known{currentglobal false setglobal 3 dict begin/vm exch def}{1 dict begin}ifelse/$ exch def systemdict/languagelevel known{vm setglobal/gvm currentglobal def $ gcheck setglobal}if ?{$ begin}if}def/?{$ type/dicttype eq}def/|{userdict/Adobe_CoolType_Data known{Adobe_CoolType_Data /AddWidths? known{currentdict Adobe_CoolType_Data begin begin AddWidths?{ Adobe_CoolType_Data/CC 3 index put ?{def}{$ 3 1 roll put}ifelse CC charcode exch 1 index 0 2 index 256 idiv put 1 index exch 1 exch 256 mod put stringwidth 2 array astore currentfont/Widths get exch CC exch put}{?{def}{$ 3 1 roll put}ifelse}ifelse end end}{?{def}{$ 3 1 roll put}ifelse}ifelse}{?{def}{ $ 3 1 roll put}ifelse}ifelse}def/!{?{end}if systemdict/languagelevel known{gvm setglobal}if end}def/:{string currentfile exch readstring pop}executeonly def end ct_MakeOCF begin/ct_cHexEncoding[/c00/c01/c02/c03/c04/c05/c06/c07/c08/c09 /c0A/c0B/c0C/c0D/c0E/c0F/c10/c11/c12/c13/c14/c15/c16/c17/c18/c19/c1A/c1B/c1C /c1D/c1E/c1F/c20/c21/c22/c23/c24/c25/c26/c27/c28/c29/c2A/c2B/c2C/c2D/c2E/c2F /c30/c31/c32/c33/c34/c35/c36/c37/c38/c39/c3A/c3B/c3C/c3D/c3E/c3F/c40/c41/c42 /c43/c44/c45/c46/c47/c48/c49/c4A/c4B/c4C/c4D/c4E/c4F/c50/c51/c52/c53/c54/c55 /c56/c57/c58/c59/c5A/c5B/c5C/c5D/c5E/c5F/c60/c61/c62/c63/c64/c65/c66/c67/c68 /c69/c6A/c6B/c6C/c6D/c6E/c6F/c70/c71/c72/c73/c74/c75/c76/c77/c78/c79/c7A/c7B /c7C/c7D/c7E/c7F/c80/c81/c82/c83/c84/c85/c86/c87/c88/c89/c8A/c8B/c8C/c8D/c8E /c8F/c90/c91/c92/c93/c94/c95/c96/c97/c98/c99/c9A/c9B/c9C/c9D/c9E/c9F/cA0/cA1 /cA2/cA3/cA4/cA5/cA6/cA7/cA8/cA9/cAA/cAB/cAC/cAD/cAE/cAF/cB0/cB1/cB2/cB3/cB4 /cB5/cB6/cB7/cB8/cB9/cBA/cBB/cBC/cBD/cBE/cBF/cC0/cC1/cC2/cC3/cC4/cC5/cC6/cC7 /cC8/cC9/cCA/cCB/cCC/cCD/cCE/cCF/cD0/cD1/cD2/cD3/cD4/cD5/cD6/cD7/cD8/cD9/cDA /cDB/cDC/cDD/cDE/cDF/cE0/cE1/cE2/cE3/cE4/cE5/cE6/cE7/cE8/cE9/cEA/cEB/cEC/cED /cEE/cEF/cF0/cF1/cF2/cF3/cF4/cF5/cF6/cF7/cF8/cF9/cFA/cFB/cFC/cFD/cFE/cFF]def /ct_CID_STR_SIZE 8000 def/ct_mkocfStr100 100 string def/ct_defaultFontMtx[.001 0 0 .001 0 0]def/ct_1000Mtx[1000 0 0 1000 0 0]def/ct_raise{exch cvx exch errordict exch get exec stop}bind def/ct_reraise{cvx $error/errorname get (Error: )print dup( )cvs print errordict exch get exec stop }bind def/ct_cvnsi{1 index add 1 sub 1 exch 0 4 1 roll{2 index exch get exch 8 bitshift add}for exch pop}bind def/ct_GetInterval{Adobe_CoolType_Utility /ct_BuildCharDict get begin/dst_index 0 def dup dst_string length gt{dup string/dst_string exch def}if 1 index ct_CID_STR_SIZE idiv/arrayIndex exch def 2 index arrayIndex get 2 index arrayIndex ct_CID_STR_SIZE mul sub{dup 3 index add 2 index length le{2 index getinterval dst_string dst_index 2 index putinterval length dst_index add/dst_index exch def exit}{1 index length 1 index sub dup 4 1 roll getinterval dst_string dst_index 2 index putinterval pop dup dst_index add/dst_index exch def sub/arrayIndex arrayIndex 1 add def 2 index dup length arrayIndex gt{arrayIndex get}{pop exit}ifelse 0}ifelse}loop pop pop pop dst_string 0 dst_index getinterval end}bind def ct_Level2?{ /ct_resourcestatus currentglobal mark true setglobal{/unknowninstancename /Category resourcestatus}stopped{cleartomark setglobal true}{cleartomark currentglobal not exch setglobal}ifelse{{mark 3 1 roll/Category findresource begin ct_Vars/vm currentglobal put({ResourceStatus} stopped)0()/SubFileDecode filter cvx exec{cleartomark false}{{3 2 roll pop true}{cleartomark false} ifelse}ifelse ct_Vars/vm get setglobal end}}{{resourcestatus}}ifelse bind def /CIDFont/Category ct_resourcestatus{pop pop}{currentglobal true setglobal /Generic/Category findresource dup length dict copy dup/InstanceType/dicttype put/CIDFont exch/Category defineresource pop setglobal}ifelse ct_UseNativeCapability?{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering(Identity) def/Supplement 0 def end def/CMapName/Identity-H def/CMapVersion 1 def /CMapType 1 def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end}if}{/ct_Category 2 dict begin/CIDFont 10 dict def /ProcSet 2 dict def currentdict end def/defineresource{ct_Category 1 index 2 copy known{get dup dup maxlength exch length eq{dup length 10 add dict copy ct_Category 2 index 2 index put}if 3 index 3 index put pop exch pop}{pop pop /defineresource/undefined ct_raise}ifelse}bind def/findresource{ct_Category 1 index 2 copy known{get 2 index 2 copy known{get 3 1 roll pop pop}{pop pop /findresource/undefinedresource ct_raise}ifelse}{pop pop/findresource /undefined ct_raise}ifelse}bind def/resourcestatus{ct_Category 1 index 2 copy known{get 2 index known exch pop exch pop{0 -1 true}{false}ifelse}{pop pop /findresource/undefined ct_raise}ifelse}bind def/ct_resourcestatus /resourcestatus load def}ifelse/ct_CIDInit 2 dict begin/ct_cidfont_stream_init {{dup(Binary)eq{pop null currentfile ct_Level2?{{cid_BYTE_COUNT() /SubFileDecode filter}stopped{pop pop pop}if}if/readstring load exit}if dup (Hex)eq{pop currentfile ct_Level2?{{null exch/ASCIIHexDecode filter/readstring }stopped{pop exch pop(>)exch/readhexstring}if}{(>)exch/readhexstring}ifelse load exit}if/StartData/typecheck ct_raise}loop cid_BYTE_COUNT ct_CID_STR_SIZE le{2 copy cid_BYTE_COUNT string exch exec pop 1 array dup 3 -1 roll 0 exch put }{cid_BYTE_COUNT ct_CID_STR_SIZE div ceiling cvi dup array exch 2 sub 0 exch 1 exch{2 copy 5 index ct_CID_STR_SIZE string 6 index exec pop put pop}for 2 index cid_BYTE_COUNT ct_CID_STR_SIZE mod string 3 index exec pop 1 index exch 1 index length 1 sub exch put}ifelse cid_CIDFONT exch/GlyphData exch put 2 index null eq{pop pop pop}{pop/readstring load 1 string exch{3 copy exec pop dup length 0 eq{pop pop pop pop pop true exit}if 4 index eq{pop pop pop pop false exit}if}loop pop}ifelse}bind def/StartData{mark{currentdict dup/FDArray get 0 get/FontMatrix get 0 get .001 eq{dup/CDevProc known not{/CDevProc 1183615869 internaldict/stdCDevProc 2 copy known{get}{pop pop{pop pop pop pop pop 0 -1000 7 index 2 div 880}}ifelse def}if}{/CDevProc{pop pop pop pop pop 0 1 cid_temp/cid_CIDFONT get/FDArray get 0 get/FontMatrix get 0 get div 7 index 2 div 1 index .88 mul}def}ifelse/cid_temp 15 dict def cid_temp begin /cid_CIDFONT exch def 3 copy pop dup/cid_BYTE_COUNT exch def 0 gt{ ct_cidfont_stream_init FDArray{/Private get dup/SubrMapOffset known{begin /Subrs SubrCount array def Subrs SubrMapOffset SubrCount SDBytes ct_Level2?{ currentdict dup/SubrMapOffset undef dup/SubrCount undef/SDBytes undef}if end /cid_SD_BYTES exch def/cid_SUBR_COUNT exch def/cid_SUBR_MAP_OFFSET exch def /cid_SUBRS exch def cid_SUBR_COUNT 0 gt{GlyphData cid_SUBR_MAP_OFFSET cid_SD_BYTES ct_GetInterval 0 cid_SD_BYTES ct_cvnsi 0 1 cid_SUBR_COUNT 1 sub{ exch 1 index 1 add cid_SD_BYTES mul cid_SUBR_MAP_OFFSET add GlyphData exch cid_SD_BYTES ct_GetInterval 0 cid_SD_BYTES ct_cvnsi cid_SUBRS 4 2 roll GlyphData exch 4 index 1 index sub ct_GetInterval dup length string copy put} for pop}if}{pop}ifelse}forall}if cleartomark pop pop end CIDFontName currentdict/CIDFont defineresource pop end end}stopped{cleartomark/StartData ct_reraise}if}bind def currentdict end def/ct_saveCIDInit{/CIDInit/ProcSet ct_resourcestatus{true}{/CIDInitC/ProcSet ct_resourcestatus}ifelse{pop pop /CIDInit/ProcSet findresource ct_UseNativeCapability?{pop null}{/CIDInit ct_CIDInit/ProcSet defineresource pop}ifelse}{/CIDInit ct_CIDInit/ProcSet defineresource pop null}ifelse ct_Vars exch/ct_oldCIDInit exch put}bind def /ct_restoreCIDInit{ct_Vars/ct_oldCIDInit get dup null ne{/CIDInit exch/ProcSet defineresource pop}{pop}ifelse}bind def/ct_BuildCharSetUp{1 index begin CIDFont begin Adobe_CoolType_Utility/ct_BuildCharDict get begin/ct_dfCharCode exch def/ct_dfDict exch def CIDFirstByte ct_dfCharCode add dup CIDCount ge{pop 0}if/cid exch def{GlyphDirectory cid 2 copy known{get}{pop pop nullstring} ifelse dup length FDBytes sub 0 gt{dup FDBytes 0 ne{0 FDBytes ct_cvnsi}{pop 0} ifelse/fdIndex exch def dup length FDBytes sub FDBytes exch getinterval /charstring exch def exit}{pop cid 0 eq{/charstring nullstring def exit}if/cid 0 def}ifelse}loop}def/ct_SetCacheDevice{0 0 moveto dup stringwidth 3 -1 roll true charpath pathbbox 0 -1000 7 index 2 div 880 setcachedevice2 0 0 moveto} def/ct_CloneSetCacheProc{1 eq{stringwidth pop -2 div -880 0 -1000 setcharwidth moveto}{usewidths?{currentfont/Widths get cid 2 copy known{get exch pop aload pop}{pop pop stringwidth}ifelse}{stringwidth}ifelse setcharwidth 0 0 moveto} ifelse}def/ct_Type3ShowCharString{ct_FDDict fdIndex 2 copy known{get}{ currentglobal 3 1 roll 1 index gcheck setglobal ct_Type1FontTemplate dup maxlength dict copy begin FDArray fdIndex get dup/FontMatrix 2 copy known{get} {pop pop ct_defaultFontMtx}ifelse/FontMatrix exch dup length array copy def /Private get/Private exch def/Widths rootfont/Widths get def/CharStrings 1 dict dup/.notdef<d841272cf18f54fc13>dup length string copy put def currentdict end/ct_Type1Font exch definefont dup 5 1 roll put setglobal}ifelse dup /CharStrings get 1 index/Encoding get ct_dfCharCode get charstring put rootfont/WMode 2 copy known{get}{pop pop 0}ifelse exch 1000 scalefont setfont ct_str1 0 ct_dfCharCode put ct_str1 exch ct_dfSetCacheProc ct_SyntheticBold{ currentpoint ct_str1 show newpath moveto ct_str1 true charpath ct_StrokeWidth setlinewidth stroke}{ct_str1 show}ifelse}def/ct_Type4ShowCharString{ct_dfDict ct_dfCharCode charstring FDArray fdIndex get dup/FontMatrix get dup ct_defaultFontMtx ct_matrixeq not{ct_1000Mtx matrix concatmatrix concat}{pop} ifelse/Private get Adobe_CoolType_Utility/ct_Level2? get not{ct_dfDict/Private 3 -1 roll{put}1183615869 internaldict/superexec get exec}if 1183615869 internaldict Adobe_CoolType_Utility/ct_Level2? get{1 index}{3 index/Private get mark 6 1 roll}ifelse dup/RunInt known{/RunInt get}{pop/CCRun}ifelse get exec Adobe_CoolType_Utility/ct_Level2? get not{cleartomark}if}bind def /ct_BuildCharIncremental{{Adobe_CoolType_Utility/ct_MakeOCF get begin ct_BuildCharSetUp ct_ShowCharString}stopped{stop}if end end end end}bind def /BaseFontNameStr(BF00)def/ct_Type1FontTemplate 14 dict begin/FontType 1 def /FontMatrix[.001 0 0 .001 0 0]def/FontBBox[-250 -250 1250 1250]def/Encoding ct_cHexEncoding def/PaintType 0 def currentdict end def/BaseFontTemplate 11 dict begin/FontMatrix[.001 0 0 .001 0 0]def/FontBBox[-250 -250 1250 1250]def /Encoding ct_cHexEncoding def/BuildChar/ct_BuildCharIncremental load def ct_Clone?{/FontType 3 def/ct_ShowCharString/ct_Type3ShowCharString load def /ct_dfSetCacheProc/ct_CloneSetCacheProc load def/ct_SyntheticBold false def /ct_StrokeWidth 1 def}{/FontType 4 def/Private 1 dict dup/lenIV 4 put def /CharStrings 1 dict dup/.notdef<d841272cf18f54fc13>put def/PaintType 0 def /ct_ShowCharString/ct_Type4ShowCharString load def}ifelse/ct_str1 1 string def currentdict end def/BaseFontDictSize BaseFontTemplate length 5 add def /ct_matrixeq{true 0 1 5{dup 4 index exch get exch 3 index exch get eq and dup not{exit}if}for exch pop exch pop}bind def/ct_makeocf{15 dict begin exch/WMode exch def exch/FontName exch def/FontType 0 def/FMapType 2 def/FontMatrix matrix def/bfCount 1 index/CIDCount get 256 idiv 1 add dup 256 gt{pop 256}if def/Encoding 256 array 0 1 bfCount 1 sub{2 copy dup put pop}for bfCount 1 255{ 2 copy bfCount put pop}for def/FDepVector bfCount dup 256 lt{1 add}if array def BaseFontTemplate BaseFontDictSize dict copy begin/CIDFont exch def CIDFont /FontBBox known{CIDFont/FontBBox get/FontBBox exch def}if CIDFont/CDevProc known{CIDFont/CDevProc get/CDevProc exch def}if currentdict end BaseFontNameStr 3(0)putinterval 0 1 bfCount dup 256 eq{1 sub}if{FDepVector exch 2 index BaseFontDictSize dict copy begin dup/CIDFirstByte exch 256 mul def FontType 3 eq{/ct_FDDict 2 dict def}if currentdict end 1 index 16 BaseFontNameStr 2 2 getinterval cvrs pop BaseFontNameStr exch definefont put} for ct_Clone?{/Widths 1 index/CIDFont get/GlyphDirectory get length dict def} if FontName currentdict end definefont ct_Clone?{gsave dup 1000 scalefont setfont ct_BuildCharDict begin/usewidths? false def currentfont/Widths get begin exch/CIDFont get/GlyphDirectory get{pop dup charcode exch 1 index 0 2 index 256 idiv put 1 index exch 1 exch 256 mod put stringwidth 2 array astore def}forall end/usewidths? true def end grestore}{exch pop}ifelse}bind def /ct_ComposeFont{ct_UseNativeCapability?{2 index/CMap ct_resourcestatus{pop pop exch pop}{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CMapName 3 index def/CMapVersion 1 def/CMapType 1 def exch/WMode exch def/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering CMapName ct_mkocfStr100 cvs (Adobe-)search{pop pop(-)search{dup length string copy exch pop exch pop}{pop (Identity)}ifelse}{pop(Identity)}ifelse def/Supplement 0 def end def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end} ifelse composefont}{3 2 roll pop 0 get/CIDFont findresource ct_makeocf}ifelse} bind def/ct_MakeIdentity{ct_UseNativeCapability?{1 index/CMap ct_resourcestatus{pop pop}{/CIDInit/ProcSet findresource begin 12 dict begin begincmap/CMapName 2 index def/CMapVersion 1 def/CMapType 1 def/CIDSystemInfo 3 dict dup begin/Registry(Adobe)def/Ordering CMapName ct_mkocfStr100 cvs (Adobe-)search{pop pop(-)search{dup length string copy exch pop exch pop}{pop (Identity)}ifelse}{pop(Identity)}ifelse def/Supplement 0 def end def 1 begincodespacerange<0000><ffff>endcodespacerange 1 begincidrange<0000><ffff>0 endcidrange endcmap CMapName currentdict/CMap defineresource pop end end} ifelse composefont}{exch pop 0 get/CIDFont findresource ct_makeocf}ifelse}bind def currentdict readonly pop end end %%EndResource Adobe_CoolType_Core begin /$Oblique SetSubstituteStrategy end %%BeginResource: procset Adobe_AGM_Image 1.0 0 %%Version: 1.0 0 %%Copyright: Copyright (C) 2000-2000 Adobe Systems, Inc. All Rights Reserved. systemdict /setpacking known { currentpacking true setpacking } if userdict /Adobe_AGM_Image 65 dict dup begin put /Adobe_AGM_Image_Id /Adobe_AGM_Image_1.0_0 def /nd{ null def }bind def /AGMIMG_&image nd /AGMIMG_&colorimage nd %%don't initialize AGMIMG_&customcolorimage, it wrecks havoc in a nested environment %%AGMIMG_ccimage_exists not {/AGMIMG_&customcolorimage nd} if /AGMIMG_&imagemask nd /AGMIMG_mbuf () def /AGMIMG_ybuf () def /AGMIMG_kbuf () def /AGMIMG_c 0 def /AGMIMG_m 0 def /AGMIMG_y 0 def /AGMIMG_k 0 def /AGMIMG_tmp nd /AGMIMG_imagestring0 nd /AGMIMG_imagestring1 nd /AGMIMG_imagestring2 nd /AGMIMG_imagestring3 nd /AGMIMG_imagestring4 nd /AGMIMG_imagestring5 nd /AGMIMG_cnt nd /AGMIMG_fsave nd /AGMIMG_colorAry nd /AGMIMG_override nd /AGMIMG_name nd /invert_image_samples nd /knockout_image_samples nd /img nd /sepimg nd /idximg nd /doc_setup { Adobe_AGM_Core begin Adobe_AGM_Image begin /AGMIMG_&image systemdict/image get def /AGMIMG_&imagemask systemdict/imagemask get def /colorimage where{ pop /AGMIMG_&colorimage /colorimage ldf }if end end }def /page_setup { Adobe_AGM_Image begin /AGMIMG_ccimage_exists {/customcolorimage where { pop /Adobe_AGM_OnHost_Seps where { pop false }{ /Adobe_AGM_InRip_Seps where { pop false }{ true }ifelse }ifelse }{ false }ifelse }bdf level2{ /invert_image_samples { Adobe_AGM_Image/AGMIMG_tmp Decode length ddf /Decode [ Decode 1 get Decode 0 get] def }def /knockout_image_samples { Operator/imagemask ne{ /Decode [1 1] def }if }def } }{ /invert_image_samples { {1 exch sub} currenttransfer addprocs settransfer }def /knockout_image_samples { { pop 1 } currenttransfer addprocs settransfer }def }ifelse /img /imageormask ldf /sepimg /sep_imageormask ldf /idximg /indexed_imageormask ldf currentdict{ dup xcheck 1 index type dup /arraytype eq exch /packedarraytype eq or and{ }if def }forall bind }def /page_trailer { end }def /doc_trailer { }def /imageormask_sys { begin save mark level2{ currentdict Operator /imagemask eq{ AGMIMG_&imagemask }{ AGMIMG_&image }ifelse }{ Width Height Operator /imagemask eq{ Decode 0 get 1 eq Decode 1 get 0 eq and ImageMatrix /DataSource load AGMIMG_&imagemask }{ BitsPerComponent ImageMatrix /DataSource load AGMIMG_&image }ifelse }ifelse cleartomark restore end }def /overprint_plate { currentoverprint{ 0 get dup /DeviceGray eq{ pop AGMCORE_black_plate not }{ /DeviceCMYK eq{ AGMCORE_is_cmyk_sep not }if }ifelse }{ false }ifelse }def /imageormask { begin SkipImageProc not{ save mark level2 AGMCORE_host_sep not and{ currentdict Operator /imagemask eq{ imagemask }{ AGMCORE_in_rip_sep currentoverprint and currentcolorspace 0 get /DeviceGray eq and{ [/Separation /Black /DeviceGray {}] setcolorspace /Decode [ Decode 1 get Decode 0 get ] def }if image }ifelse }{ Width Height Operator /imagemask eq{ Decode 0 get 1 eq Decode 1 get 0 eq and ImageMatrix /DataSource load AGMCORE_host_sep{ currentgray 1 ne{ currentdict imageormask_sys }{ currentoverprint not{ 1 AGMCORE_&setgray knockout_image_samples currentdict imageormask_sys }{ currentdict ignoreimagedata }ifelse }ifelse }{ imagemask }ifelse }{ BitsPerComponent ImageMatrix MultipleDataSources{ 0 1 NComponents 1 sub{ DataSource exch get }for }{ /DataSource load }ifelse Operator /colorimage eq{ AGMCORE_host_sep{ MultipleDataSources level2 or NComponents 4 eq and{ MultipleDataSources{ 4 {pop} repeat /DataSource [ DataSource 0 get /exec cvx cvx cvx cvx cvx }{ filter_cmyk 0 () /SubFileDecode filter def DataSource 1 get /exec DataSource 2 get /exec DataSource 3 get /exec /AGMCORE_get_ink_data ] cvx def /DataSource /DataSource load } }ifelse /Decode [ Decode 0 get Decode 1 get ] def /MultipleDataSources false def /NComponents 1 def /Operator /image def AGMCORE_is_cmyk_sep{ currentoverprint InksUsed currentdict }{ invert_image_samples 1 AGMCORE_&setgray currentdict }{ }ifelse currentdict } }{ }ifelse MultipleDataSources NComponents current_ink not and{ consumeimagedata imageormask_sys ignoreimagedata A AGMIMG_&colorimage }{ }{ }ifelse true NComponents colorimage }ifelse Operator /image eq{ AGMCORE_host_sep{ /DoImage true def HostSepColorImage{ invert_image_samples }{ AGMCORE_black_plate not{ /DoImage false def currentdict }if }ifelse 1 AGMCORE_&setgray ignoreimagedata DoImage {currentdict imageormask_sys} if }{ image }ifelse }{ Operator/knockout eq{ pop pop pop pop pop currentoverprint InksUsed }{ currentcolorspace }if }ifelse knockout_unitsq current_ink not and{ overprint_plate not{ }if end }if }ifelse }ifelse }ifelse }ifelse cleartomark restore }def /sep_imageormask { /sep_colorspace_dict AGMCORE_gget begin /MappedCSA CSA map_csa def begin SkipImageProc not{ s save mark AGMCORE_avoid_L2_sep_space{ /Decode [ Decode 0 get 255 mul Decode 1 get 255 mul ] def }if AGMIMG_ccimage_exists MappedCSA 0 get /DeviceCMYK eq and currentdict/Components known and Name () ne and Name (All) ne and Operator /image eq and AGMCORE_producing_seps not and level2 not and { Width Height BitsPerComponent ImageMatrix [ /DataSource load /exec cvx { 0 1 2 index length 1 sub{ 1 index exch 2 copy get 255 xor put }for } /exec cvx ] cvx bind MappedCSA 0 get /DeviceCMYK eq{ Components aload pop }{ 0 0 0 Components aload pop 1 exch sub }ifelse Name findcmykcustomcolor customcolorimage AGMCORE_producing_seps not{ level2{ AGMCORE_avoid_L2_sep_space not currentcolorspace 0 get /Separation ne and{ [/Separation Name MappedCSA sep_proc_name exch 0 get exch load ] setcolorspace_opt /sep_tint AGMCORE_gget setcolor }if currentdict imageormask }{ currentdict Operator /imagemask eq{ imageormask }{ sep_imageormask_lev1 }ifelse }ifelse }{ AGMCORE_host_sep{ Operator/knockout eq{ currentoverprint InksUsed current_ink not and{ }{ currentdict/ImageMatrix get concat knockout_unitsq }ifelse }{ currentgray 1 ne{ AGMCORE_is_cmyk_sep Name (All) ne and{ level2{ [ /Separation Name [/DeviceGray] { sep_colorspace_proc AGMCORE_get_ink_data 1 exch sub } bind ] AGMCORE_&setcolorspace /sep_tint AGMCORE_gget AGMCORE_&setcolor currentdict imageormask_sys }{ currentdict Operator /imagemask eq{ imageormask_sys }{ sep_image_lev1_sep }ifelse }ifelse }{ Operator/imagemask ne{ invert_image_samples }if currentdict imageormask_sys }ifelse }{ }{ currentdict consumeimagedata currentoverprint not Name (All) eq or{ gsave knockout_unitsq grestore }if }ifelse }ifelse }{ currentcolorspace 0 get /Separation ne{ [/Separation Name MappedCSA sep_proc_name exch 0 get exch load ] setcolorspace_opt /sep_tint AGMCORE_gget setcolor }if currentoverprint MappedCSA 0 get /DeviceCMYK eq and Name inRip_spot_has_ink not and Name (All) ne and { imageormask_l2_overprint }{ currentdict imageormask }ifelse }ifelse }ifelse }ifelse cleartomark restore }if end end }def /imageormask_l2_overprint { currentdict currentcmykcolor add add add 0 eq{ currentdict consumeimagedata }{ l level3{ currentcmykcolor /AGMIMG_k xdf /AGMIMG_y xdf /AGMIMG_m xdf /AGMIMG_c xdf Operator/imagemask eq{ [/DeviceN [ AGMIMG_c 0 ne {/Cyan} if AGMIMG_m 0 ne {/Magenta} if AGMIMG_y 0 ne {/Yellow} if AGMIMG_k 0 ne {/Black} if ] /DeviceCMYK {}] setcolorspace AGMIMG_c AGMIMG_m AGMIMG_y AGMIMG_k s setcolor } }{ 0 0 0 0 ne ne ne ne {AGMIMG_c} {AGMIMG_m} {AGMIMG_y} {AGMIMG_k} if if if if /Decode [ Decode 0 get 255 [ [/Indexed [ /DeviceN [ AGMIMG_c AGMIMG_m AGMIMG_y AGMIMG_k ] /DeviceCMYK { AGMIMG_k AGMIMG_y AGMIMG_m A AGMIMG_c } ] 255 { mul Decode 1 get 255 mul ] def 0 0 0 0 0 0 0 0 ne ne ne ne eq eq eq eq {/Cyan} if {/Magenta} if {/Yellow} if {/Black} if {0} if {0 exch} if {0 3 1 roll} if {0 4 1 roll} if 2 255 div mark exch dup d dup dup AGMIMG_k 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 1 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_y 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 2 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_m 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec 4 3 roll pop pop pop s counttomark 1 roll }{ pop } }ifelse AGMIMG_c 0 ne{ /sep_tint AGMCORE_gget mul MappedCSA sep_proc_name exch pop load exec pop pop pop s counttomark 1 roll }{ pop }ifelse counttomark 1 add -1 roll pop } ] setcolorspace } }ifelse imageormask_sys }{ write_image_file{ currentcmykcolor 0 ne{ [/Separation /Black /DeviceGray {}] setcolorspace gsave /Black [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 1 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Yellow /DeviceGray {}] setcolorspace gsave /Yellow [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 2 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Magenta /DeviceGray {}] setcolorspace gsave /Magenta [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {4 3 roll pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore }if 0 ne{ [/Separation /Cyan /DeviceGray {}] setcolorspace gsave /Cyan [{1 exch sub /sep_tint AGMCORE_gget mul} /exec cvx MappedCSA sep_proc_name cvx exch pop {pop pop pop 1 exch sub} /exec cvx] cvx modify_halftone_xfer Operator currentdict read_image_file grestore } if close_image_file }{ imageormask }ifelse }ifelse }ifelse } def /indexed_imageormask { begin s save mark currentdict AGMCORE_host_sep{ Operator/knockout eq{ /indexed_colorspace_dict AGMCORE_gget /CSA get map_csa overprint_plate not{ knockout_unitsq }if }{ AGMCORE_is_cmyk_sep{ Operator /imagemask eq{ imageormask_sys }{ level2{ indexed_image_lev2_sep }{ indexed_image_lev1_sep }ifelse }ifelse }{ currentoverprint not{ knockout_image_samples imageormask_sys }{ currentdict consumeimagedata }ifelse }ifelse }ifelse }{ level2{ imageormask }{ Operator /imagemask eq{ imageormask }{ indexed_imageormask_lev1 }ifelse }ifelse }ifelse cleartomark restore end }def /indexed_image_lev2_sep { /indexed_colorspace_dict AGMCORE_gget begin b begin currentcolorspace dup 1 /DeviceGray put dup 3 [ currentcolorspace 3 get { exch 4 mul 4 getinterval {} forall AGMCORE_get_ink_data 255 div 1 exch sub } /exec cvx ] cvx put s setcolorspace currentdict Operator /imagemask eq{ }{ AGMIMG_&imagemask AGMIMG_&image } }ifelse end end }def /OPIimage { dup type /dicttype ne{ 10 dict begin /DataSource xdf /ImageMatrix xdf /BitsPerComponent xdf /Height xdf /Width xdf /ImageType 1 def /Decode [0 1 def] currentdict end }if dup begin /NComponents 1 cdndf /MultipleDataSources false cdndf /SkipImageProc {false} cdndf /HostSepColorImage false cdndf /Decode [ 0 currentcolorspace 0 get /Indexed eq{ 2 BitsPerComponent exp 1 sub }{ 1 }ifelse ] cdndf /Operator /image cdndf end /sep_colorspace_dict AGMCORE_gget null eq{ imageormask }{ gsave dup begin invert_image_samples end sep_imageormask grestore }ifelse }def /spot_alias { /mapto_sep_imageormask { dup type /dicttype ne{ 12 dict begin /ImageType 1 def /DataSource xdf /ImageMatrix xdf /BitsPerComponent xdf /Height xdf /Width xdf /MultipleDataSources false def }{ begin }ifelse /Decode [/customcolor_tint AGMCORE_gget 0] def /Operator /image def /HostSepColorImage false def /InksUsed [] def /SkipImageProc {false} def currentdict end sep_imageormask }bdf /customcolorimage { Adobe_AGM_Image/AGMIMG_colorAry xddf /customcolor_tint AGMCORE_gget bdict /Name AGMIMG_colorAry 4 get /CSA [ /DeviceCMYK ] /TintMethod /Subtractive /TintProc null /MappedCSA null /NComponents 4 /Components [ AGMIMG_colorAry aload pop pop ] edict setsepcolorspace mapto_sep_imageormask }ndf Adobe_AGM_Image/AGMIMG_&customcolorimage /customcolorimage load put /customcolorimage { Adobe_AGM_Image/AGMIMG_override false put dup 4 get map_alias{ /customcolor_tint AGMCORE_gget exch setsepcolorspace pop mapto_sep_imageormask }{ AGMIMG_&customcolorimage } }ifelse }bdf }def level2 not{ /colorbuf { 0 1 2 index length 1 sub{ dup 2 index exch get 255 exch sub 2 index 3 1 roll put }for }def /tint_image_to_color { begin Width Height BitsPerComponent ImageMatrix /DataSource load end Adobe_AGM_Image begin /AGMIMG_mbuf 0 string def /AGMIMG_ybuf 0 string def /AGMIMG_kbuf 0 string def { colorbuf dup length AGMIMG_mbuf length ne { dup length dup dup /AGMIMG_mbuf exch string def /AGMIMG_ybuf exch string def /AGMIMG_kbuf exch string def } if dup AGMIMG_mbuf copy AGMIMG_ybuf copy AGMIMG_kbuf copy pop } addprocs { {AGMIMG_mbuf}{AGMIMG_ybuf}{AGMIMG_kbuf} true 4 colorimage end } def /sep_imageormask_lev1 { begin MappedCSA 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or has_color not and{ h { 255 mul round cvi GrayLookup exch get } currenttransfer addprocs settransfer currentdict imageormask }{ /sep_colorspace_dict AGMCORE_gget/Components known{ MappedCSA 0 get /DeviceCMYK eq{ Components aload pop }{ 0 0 0 Components aload pop 1 exch sub } }ifelse Adobe_AGM_Image/AGMIMG_k Adobe_AGM_Image/AGMIMG_y Adobe_AGM_Image/AGMIMG_m A Adobe_AGM_Image/AGMIMG_c and{ addprocs settransfer } }{ currentcolortransfer {AGMIMG_k mul 1 exch sub} exch addprocs 4 1 roll roll roll roll {AGMIMG_y mul 1 exch sub} exch addprocs 4 1 {AGMIMG_m mul 1 exch sub} exch addprocs 4 1 {AGMIMG_c mul 1 exch sub} exch addprocs 4 1 setcolortransfer currentdict tint_image_to_color }ifelse }{ xddf xddf xddf xddf AGMIMG_y 0.0 eq AGMIMG_m 0.0 eq and AGMIMG_c 0.0 eq {AGMIMG_k mul 1 exch sub} currenttransfer currentdict imageormask MappedCSA 0 get /DeviceGray eq { {255 mul round cvi ColorLookup exch get 0 currenttransfer addprocs settransfer currentdict imageormask }{ MappedCSA 0 get /DeviceCMYK eq { currentcolortransfer {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get 1 exch sub} exch addprocs 4 1 roll setcolortransfer currentdict tint_image_to_color }{ currentcolortransfer {pop 1} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll {255 mul round cvi ColorLookup exch get} exch addprocs 4 1 roll setcolortransfer currentdict tint_image_to_color }ifelse }ifelse }ifelse }ifelse end }def /sep_image_lev1_sep { begin /sep_colorspace_dict AGMCORE_gget/Components known{ C Components aload pop Adobe_AGM_Image/AGMIMG_k Adobe_AGM_Image/AGMIMG_y Adobe_AGM_Image/AGMIMG_m A Adobe_AGM_Image/AGMIMG_c {AGMIMG_c {AGMIMG_m {AGMIMG_y {AGMIMG_k }{ {255 {255 {255 {255 }ifelse } mul mul mul mul mul mul mul mul round round round round 1 1 1 1 exch exch exch exch cvi cvi cvi cvi sub} sub} sub} sub} exch exch exch exch get get get get 0 1 2 3 get get get get 1 1 1 1 exch exch exch exch xddf xddf xddf xddf get} get 3 get 2 get 1 get 0 get 2 get 1 get 0 ColorLookup ColorLookup ColorLookup ColorLookup sub} sub} sub} sub} A AGMCORE_get_ink_data currenttransfer addprocs settransfer } c currentdict imageormask_sys end }def /indexed_imageormask_lev1 { /indexed_colorspace_dict AGMCORE_gget begin begin currentdict MappedCSA 0 get dup /DeviceRGB eq exch /DeviceCMYK eq or has_color not and{ h {HiVal mul round cvi GrayLookup exch get HiVal div} currenttransfer addprocs settransfer imageormask } }{ MappedCSA 0 get /DeviceGray eq { {HiVal mul round cvi Lookup exch get HiVal div} currenttransfer addprocs settransfer imageormask }{ MappedCSA 0 get /DeviceCMYK eq { currentcolortransfer {4 mul HiVal mul round cvi 3 add Lookup exch get HiVal div 1 exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi 2 add Lookup exch get HiVal div 1 exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi 1 add Lookup exch get HiVal div 1 exch sub} exch addprocs 4 1 roll {4 mul HiVal mul round cvi Lookup exch get HiVal div 1 exch sub} exch addprocs 4 1 roll setcolortransfer tint_image_to_color }{ currentcolortransfer {pop 1} exch addprocs 4 1 roll {3 mul HiVal mul round cvi 2 add Lookup exch get HiVal div} exch addprocs 4 1 roll {3 mul HiVal mul round cvi 1 add Lookup exch get HiVal div} exch addprocs 4 1 roll {3 mul HiVal mul round cvi Lookup exch get HiVal div} exch addprocs 4 1 roll setcolortransfer tint_image_to_color }ifelse }ifelse }ifelse end end }def /indexed_image_lev1_sep { /indexed_colorspace_dict AGMCORE_gget begin begin {4 mul HiVal mul round cvi Lookup exch get HiVal div 1 exch sub} {4 mul HiVal mul round cvi 1 add Lookup exch get HiVal div 1 exch sub} {4 mul HiVal mul round cvi 2 add Lookup exch get HiVal div 1 exch sub} s sub} {4 mul HiVal mul round cvi 3 add Lookup exch get HiVal div 1 exch A AGMCORE_get_ink_data currenttransfer addprocs settransfer c currentdict imageormask_sys }def end end }if end systemdict /setpacking known { setpacking } if %%EndResource %ADOBeginClientInjection: DocumentProlog End "AI10" %ADOEndClientInjection: DocumentProlog End "AI10" currentdict Adobe_AGM_Utils eq {end} if %%EndProlog %%BeginSetup %ADOBeginClientInjection: DocumentSetup Start "AI10" %ADOEndClientInjection: DocumentSetup Start "AI10" Adobe_AGM_Utils begin 2 2010 true Adobe_AGM_Core/doc_setup get exec Adobe_CoolType_Core/doc_setup get exec Adobe_AGM_Image/doc_setup get exec %ADOBeginClientInjection: DocumentSetup End "AI10" %ADOEndClientInjection: DocumentSetup End "AI10" currentdict Adobe_AGM_Utils eq {end} if %%EndSetup %%Page: CPCS1_Infer.eps 1 %%EndPageComments %%BeginPageSetup %ADOBeginClientInjection: PageSetup Start "AI10" %ADOEndClientInjection: PageSetup Start "AI10" Adobe_AGM_Utils begin Adobe_AGM_Core/page_setup get exec Adobe_CoolType_Core/page_setup get exec Adobe_AGM_Image/page_setup get exec %ADOBeginClientInjection: PageSetup End "AI10" %ADOEndClientInjection: PageSetup End "AI10" %%EndPageSetup Adobe_AGM_Core/AGMCORE_save save ddf 1 -1 scale 0 -209.044 translate [1 0 0 1 0 0 ] concat mark /0 [/DeviceGray] add_csa /CSA /0 /1 [/DeviceCMYK] add_csa /CSA /1 /2 [/DeviceRGB] add_csa /CSA /2 cleartomark 800 path_rez % page clip gsave newpath gsave % PSGState 0 0 mo 0 209.044 li 333.281 209.044 li 333.281 0 li clp [1 0 0 1 0 0 ] concat %ADOBeginClientInjection: BeginPageContent "AI10" %ADOEndClientInjection: BeginPageContent "AI10" gsave % PSGState 0 0 mo 333 0 li 333 209 li 0 209 li 0 0 li clp gsave % PSGState 0 0 mo 333.281 0 li 333.281 209.044 li 0 209.044 li 0 0 li eclp 3.51563 3.74609 mo 329.063 3.74609 li 329.063 205.297 li 3.51563 205.297 li 3.51563 3.74609 li false sop 0 0 0 0 cmyk ef 0 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 3.51563 3.74609 mo 329.063 3.74609 li 329.063 205.297 li 3.51563 205.297 li 3.51563 3.74609 li cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 0 0 mo 333.281 0 li 333.281 209.044 li 0 209.044 li 0 0 li eclp 56.9531 34.4658 mo 234.141 34.4658 li 234.141 189.563 li 56.9531 189.563 li 56.9531 34.4658 li false sop 0 0 0 0 cmyk ef grestore % PSGState gsave % PSGState 0 0 mo 0 222.773 li 333.27 222.773 li 333.27 0 li 0 0 li cp 240.469 79.4219 mo 326.953 79.4219 li 326.953 143.109 li 241.172 143.109 li 241.172 80.1709 li 240.469 79.4219 li eclp 54.1406 34.4658 mo 236.953 34.4658 li 236.953 189.563 li 54.1406 189.563 li 54.1406 34.4658 li eclp 0 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 101.25 34.4658 mo 101.25 189.563 li false sop .227451 .160784 .129412 .0196078 cmyk s 189.844 34.4658 mo 189.844 189.563 li .227451 .160784 .129412 .0196078 cmyk s grestore % PSGState gsave % PSGState 0 0 mo 0 222.773 li 333.27 222.773 li 333.27 0 li 0 0 li cp 240.469 79.4219 mo 326.953 79.4219 li 326.953 143.109 li 241.172 143.109 li 241.172 80.1709 li 240.469 79.4219 li eclp 54.1406 34.4658 mo 236.953 34.4658 li 236.953 189.563 li 54.1406 189.563 li 54.1406 34.4658 li eclp 0 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 145.547 34.4658 mo 145.547 189.563 li false sop .427451 .309804 .282353 s 234.141 34.4658 mo 234.141 189.563 li .427451 .309804 .282353 s grestore % PSGState gsave % PSGState 0 0 mo 0 222.773 li 333.27 222.773 li 333.27 0 li 0 0 li cp 240.469 79.4219 mo 326.953 79.4219 li 326.953 143.109 li 241.172 143.109 li 241.172 80.1709 li 240.469 79.4219 li eclp 0 0 mo 333.281 0 li 333.281 209.044 li 0 209.044 li 0 0 li eclp .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 56.9531 34.4658 mo 234.141 34.4658 li false sop .623529 .486274 .486274 s 234.141 34.4658 mo 234.141 189.563 li .623529 .486274 .486274 s 234.141 189.563 mo 56.9531 189.563 li .623529 .486274 .486274 s 56.9531 189.563 mo .12549 cmyk .12549 cmyk .478431 cmyk .478431 cmyk .478431 cmyk 56.9531 34.4658 li .623529 .486274 .486274 .478431 cmyk s grestore % PSGState gsave % PSGState 0 0 mo 333.281 0 li 333.281 209.044 li 0 209.044 li 0 0 li eclp 0 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 56.9531 34.4658 mo 56.9531 189.563 li false sop 0 0 0 1 cmyk s 54.1406 189.563 mo 59.7656 189.563 li 0 0 0 1 cmyk s 54.1406 164.088 mo 59.7656 164.088 li 0 0 0 1 cmyk s 54.1406 137.864 mo 59.7656 137.864 li 0 0 0 1 cmyk s 54.1406 112.389 mo 59.7656 112.389 li 0 0 0 1 cmyk s 54.1406 86.165 mo 59.7656 86.165 li 0 0 0 1 cmyk s 54.1406 60.6899 mo 59.7656 60.6899 li 0 0 0 1 cmyk s 54.1406 34.4658 mo 59.7656 34.4658 li 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 79.4531 57.6929 mo 80.8594 57.6929 80.8594 58.4424 79.4531 58.4424 79.4531 57.6929 false sop 0 0 0 1 cmyk ef 83.6719 57.6929 85.0781 57.6929 85.0781 58.4424 83.6719 58.4424 83.6719 57.6929 0 0 0 1 cmyk ef 87.8906 57.6929 89.2969 57.6929 89.2969 58.4424 87.8906 58.4424 87.8906 57.6929 0 0 0 1 cmyk ef 92.1094 57.6929 93.5156 57.6929 93.5156 58.4424 92.1094 58.4424 92.1094 57.6929 0 0 0 1 cmyk ef 96.3281 57.6929 97.7344 57.6929 97.7344 58.4424 96.3281 58.4424 96.3281 57.6929 0 0 0 1 cmyk ef 100.547 57.6929 101.953 57.6929 101.953 58.4424 100.547 58.4424 100.547 57.6929 0 0 0 1 cmyk ef 104.766 57.6929 106.172 57.6929 106.172 58.4424 104.766 58.4424 104.766 57.6929 0 0 0 1 cmyk ef 108.984 57.6929 110.391 57.6929 110.391 58.4424 108.984 58.4424 108.984 57.6929 0 0 0 1 cmyk ef 113.203 57.6929 114.609 57.6929 114.609 58.4424 li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li 113.203 113.203 0 0 0 1 ef 117.422 118.828 118.828 117.422 117.422 0 0 0 1 ef 121.641 123.047 123.047 121.641 121.641 0 0 0 1 ef 125.859 127.266 127.266 125.859 125.859 0 0 0 1 ef 130.078 131.484 131.484 130.078 130.078 0 0 0 1 ef 134.297 135.703 135.703 134.297 134.297 0 0 0 1 ef 138.516 139.922 139.922 138.516 138.516 0 0 0 1 ef 142.734 144.141 144.141 142.734 142.734 0 0 0 1 ef 146.953 148.359 148.359 146.953 146.953 0 0 0 1 58.4424 li 57.6929 li cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li ef 151.172 152.578 152.578 151.172 151.172 0 0 0 1 ef 155.391 156.797 156.797 155.391 155.391 0 0 0 1 ef 159.609 161.016 161.016 159.609 159.609 0 0 0 1 ef 163.828 165.234 165.234 163.828 163.828 0 0 0 1 ef 168.047 169.453 169.453 168.047 168.047 0 0 0 1 ef 172.266 173.672 173.672 172.266 172.266 0 0 0 1 ef 176.484 177.891 177.891 176.484 176.484 0 0 0 1 ef 180.703 182.109 182.109 180.703 180.703 0 0 0 1 ef 184.922 186.328 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk 57.6929 57.6929 58.4424 58.4424 57.6929 cmyk mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li mo li li li li 57.6929 mo 57.6929 li 186.328 58.4424 li 184.922 58.4424 li 184.922 57.6929 li 0 0 0 1 cmyk ef 189.141 57.6929 mo 190.547 57.6929 li 190.547 58.4424 li 189.141 58.4424 li 189.141 57.6929 li 0 0 0 1 cmyk ef 193.359 57.6929 mo 194.766 57.6929 li 194.766 58.4424 li 193.359 58.4424 li 193.359 57.6929 li 0 0 0 1 cmyk ef 197.578 57.6929 mo 198.984 57.6929 li 198.984 58.4424 li 197.578 58.4424 li 197.578 57.6929 li 0 0 0 1 cmyk ef 201.797 57.6929 mo 203.203 57.6929 li 203.203 58.4424 li 201.797 58.4424 li 201.797 57.6929 li 0 0 0 1 cmyk ef 206.016 57.6929 mo 207.422 57.6929 li 207.422 58.4424 li 206.016 58.4424 li 206.016 57.6929 li 0 0 0 1 cmyk ef 210.234 57.6929 mo 211.641 57.6929 li 211.641 58.4424 li 210.234 58.4424 li 210.234 57.6929 li 0 0 0 1 cmyk ef 0 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 79.4531 57.6929 mo 79.4531 59.9409 li 0 0 0 1 cmyk s 123.75 57.6929 mo 123.75 58.4424 li 0 0 0 1 cmyk s 168.047 38.2124 mo 168.047 178.324 li 0 0 0 1 cmyk s 212.344 38.9614 mo 212.344 153.598 li 0 0 0 1 cmyk s 77.3438 56.9438 mo 81.5625 56.9438 li 81.5625 57.6929 li 77.3438 57.6929 li 77.3438 56.9438 li .937255 .392157 .996078 ef .749262 lw 77.3438 56.9438 mo 81.5625 56.9438 li 81.5625 57.6929 li 77.3438 57.6929 li 77.3438 56.9438 li cp .937255 .392157 .996078 s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 121.641 56.9438 mo 125.859 56.9438 li 125.859 57.6929 li 121.641 57.6929 li 121.641 56.9438 li false sop .937255 .392157 .996078 ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 121.641 56.9438 mo 125.859 56.9438 li 125.859 57.6929 li 121.641 57.6929 li 121.641 56.9438 li cp .937255 .392157 .996078 s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo .4 cmyk .4 cmyk .4 cmyk .4 cmyk 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 165.938 37.4629 mo 170.156 37.4629 li 170.156 38.2124 li 165.938 38.2124 li 165.938 37.4629 li false sop .937255 .392157 .996078 ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 165.938 37.4629 mo 170.156 37.4629 li 170.156 38.2124 li 165.938 38.2124 li 165.938 37.4629 li cp .937255 .392157 .996078 s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 210.234 38.2124 mo 214.453 38.2124 li 214.453 38.9614 li 210.234 38.9614 li 210.234 38.2124 li false sop .937255 .392157 .996078 ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 210.234 38.2124 mo 214.453 38.2124 li 214.453 38.9614 li 210.234 38.9614 li 210.234 38.2124 li cp .937255 .392157 .996078 s grestore % PSGState gsave % PSGState .4 cmyk .4 cmyk .4 cmyk .4 cmyk 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 77.3438 58.0679 mo 77.3438 57.0269 78.125 56.1943 79.1016 56.1943 cv 80.0781 56.1943 80.8594 57.0269 80.8594 58.0679 cv 80.8594 59.1084 80.0781 59.9409 79.1016 59.9409 cv 78.125 59.9409 77.3438 59.1084 77.3438 58.0679 cv false sop 0 0 0 0 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 77.3438 58.0679 mo 77.3438 57.0269 78.125 56.1943 79.1016 56.1943 cv 80.0781 56.1943 80.8594 57.0269 80.8594 58.0679 cv 80.8594 59.1084 80.0781 59.9409 79.1016 59.9409 cv 78.125 59.9409 77.3438 59.1084 77.3438 58.0679 cv cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 121.641 58.0679 mo 121.641 57.0269 122.422 56.1943 123.398 56.1943 cv 124.375 56.1943 125.156 57.0269 125.156 58.0679 cv 125.156 59.1084 124.375 59.9409 123.398 59.9409 cv 122.422 59.9409 121.641 59.1084 121.641 58.0679 cv false sop 0 0 0 0 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 121.641 58.0679 mo 121.641 57.0269 122.422 56.1943 123.398 56.1943 cv 124.375 56.1943 125.156 57.0269 125.156 58.0679 cv 125.156 59.1084 124.375 59.9409 123.398 59.9409 cv 122.422 59.9409 121.641 59.1084 121.641 58.0679 cv cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 165.938 57.3184 mo 165.938 56.2778 166.719 55.4453 167.695 55.4453 cv 168.672 55.4453 169.453 56.2778 169.453 57.3184 cv 169.453 58.3589 168.672 59.1914 167.695 59.1914 cv 166.719 59.1914 165.938 58.3589 165.938 57.3184 cv false sop 0 0 0 0 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 165.938 57.3184 mo 165.938 56.2778 166.719 55.4453 167.695 55.4453 cv 168.672 55.4453 169.453 56.2778 169.453 57.3184 cv 169.453 58.3589 168.672 59.1914 167.695 59.1914 cv 166.719 59.1914 165.938 58.3589 165.938 57.3184 cv cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 210.234 58.0679 mo 210.234 57.0269 211.016 56.1943 211.992 56.1943 cv 212.969 56.1943 213.75 57.0269 213.75 58.0679 cv 213.75 59.1084 212.969 59.9409 211.992 59.9409 cv 211.016 59.9409 210.234 59.1084 210.234 58.0679 cv false sop 0 0 0 0 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 210.234 58.0679 mo 210.234 57.0269 211.016 56.1943 211.992 56.1943 cv 212.969 56.1943 213.75 57.0269 213.75 58.0679 cv 213.75 59.1084 212.969 59.9409 211.992 59.9409 cv 211.016 59.9409 210.234 59.1084 210.234 58.0679 cv cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 77.3438 59.1914 mo 81.5625 59.1914 li 81.5625 59.9409 li 77.3438 59.9409 li 77.3438 59.1914 li false sop 0 0 0 1 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 77.3438 59.1914 mo 81.5625 59.1914 li 81.5625 59.9409 li 77.3438 59.9409 li 77.3438 59.1914 li cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 121.641 57.6929 mo 125.859 57.6929 li 125.859 58.4424 li 121.641 58.4424 li 121.641 57.6929 li false sop 0 0 0 1 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 121.641 57.6929 mo 125.859 57.6929 li 125.859 58.4424 li 121.641 58.4424 li 121.641 57.6929 li cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 165.938 177.575 mo 170.156 177.575 li 170.156 178.324 li 165.938 178.324 li 165.938 177.575 li false sop 0 0 0 1 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 165.938 177.575 mo 170.156 177.575 li 170.156 178.324 li 165.938 178.324 li 165.938 177.575 li cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 54.8438 32.2183 mo 236.953 32.2183 li 236.953 191.811 li 54.8438 191.811 li 54.8438 32.2183 li eclp 210.234 152.849 mo 214.453 152.849 li 214.453 153.598 li 210.234 153.598 li 210.234 152.849 li false sop 0 0 0 1 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 210.234 152.849 mo 214.453 152.849 li 214.453 153.598 li 210.234 153.598 li 210.234 152.849 li cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 0 0 mo 333.281 0 li 333.281 209.044 li 0 209.044 li 0 0 li eclp false sop 0 0 0 1 cmyk %ADOBeginSubsetFont: ArialMT Initial 11 dict begin /FontName /ArialMT def /FontMatrix [1 1000 div 0 0 1 1000 div 0 0 ] def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for /PaintType 0 def /FontType 1 def /FontBBox { 0 0 0 0 } def /FontInfo 1 dict dup begin /OrigFontType /TrueType def end readonly def currentdict e end systemdict begin dup /Private 7 dict dup begin /BlueValues [-15 0 600 650] def /MinFeature {16 16} def /password 5839 def /ND {def} def /NP {put} def /RD {string currentfile exch readhexstring pop} def 2 index /CharStrings 1320 dict dup begin /.notdef <10bf317005b6d50bd3b903bc9f60e6e804630266f839393d56ae50a85fbe ffec110deebde9f8a007323688ac> ND /hyphen <10bf31705995db6ed81c8e93e5d1d568f767c41aee4b2647d0> ND /period <10bf317014482feecab94451e2e92893e6ea1ac0> ND /zero <10bf317047276c49b351d9623648ba231144bc53a0ca0f7137dd26acafd7 a97e034bcb411e070b28033a95585d14cc3049211cd8d6dbdc740e7e557b 8b0bae35a0f458c915f0c42d4639db9a6f5be8ea13662c7ddbf896c5212e 82bb811e04cfd3e7e4c6b33f992c4b804c27926604f71ad62c4caff5ad28 f37dca9db86e540c19061066e9956293f0fe2d5a7761fabb37f03c88ecf7 f39a88f359b0b2fcad10a34d95> ND /one <10bf317005a6bd48c4a6ac17ff781e4d9d43b0d3b470defa64830ce9e82c a42843f3746bb6c5816fc2f2acc9616849f0fb06de8ffab0e186> ND /two <10bf31705ac903dc9a7655fb1cbe16b0c7e0879796676cfad704f90dc700 a86b567dfb510d73e1eda2d25481e3e3d20a511167bf4f5111151f12fb5e 5148b97bc9e8b92f2397a19c4772d4ba061304f4dbf35b8f856430b2bb0f 08d2f25a6aab8461d96e2c6ffa85eccdebf2e249af74bf434f3c62413f00 2a31d30ba682cae0ea90b106d10c83845aabfb8f0d6840476b9cba1b1b33 8d> ND def /three <10bf317047276c49b32f77fc0b1d0c5740dcd2446a925ec070d898870164 1dba6c5defb41d909040a164fdb0a088fefa45fff299b57b0e194251a4a8 b9cf3bc1815fd2c5ba06e651f9d7799098b4541de9c35043282b335f2de1 7def94eec0695fa30f7aaa5574cd9d280a8b4d225396feeeafb4b20c3fcc 9f12e751228b7464328a957a71c1d6fc11ef53a8f692024ab80f5e0d7623 62b42a462a2bf96d5a0db86097e421e5cb8c7d7a0900e6cfd70978f26b60 122332f14359637710d630381bc4f9c629fd5be208af03ab6a69f0ba40b9 a2> ND /four <10bf31706ae035c09f45a3341524b986c2b652ea6a39cb8af0e0fc5bbd6e 2bc3cdf03d1f50c6012a6a62d7d13e3b061a175eb1dcdf7d528d2a646f> ND /five <10bf317047276c49b09acfa7bc79efc344047909ce1f733e1cd354b07630 213f625adb3ae8b5aa6a51c1055a59d5f55e13f6cd6e1d9a82c372ef809e 0ee864af865bf5dd5f7dae9a46388470afbd9e2e8c39b7ea4fc9ab800d6e 8ab2edc1e3d36e194904842b1236ff6f70f88f5551621a9fa448c516e732 df410d140d211e3fe0becb6d0a54202b80a6977f> ND /eight <10bf317046e8724abd4524a50020e9dc3980c715ec740ae6d67b383e7a21 bbe3be56c8d2784f6ec387931b917e7c302623ca7662f45cd71e99c5e15d 8a11f992831c451f3679822c2af303300e984e0eefcb133e310f6a46109a 9d146b93f55052b2f78ef3224c87d699d722a73d34d859dd1f2bd96bf673 baaddbf695f6c3bf7769f7e07a5e24b82d87f50426587e10e40ded624e17 eff02597ffc635ab9595a4af117c1f6c691cc04f7505cc8cd1a327aaa560 a5ede63a1ca5db943a0e1404d814d511720bef0253fd39fd1556e76c68f9 95550a0b50407412fbd7a8b2eeb8d21996172d225bcaa7fc25ecc9c8768d c697b0249278711014c6dbcc84d68426> ND end end put put dup /FontName get exch definefont pop end /ArialMT findfont /Encoding get dup 45 /hyphen put dup 46 /period put dup 48 /zero put dup 49 /one put dup 50 /two put dup 51 /three put dup 52 /four put dup 53 /five put dup 56 /eight put pop %ADOEndSubsetFont /ArialMT*1 [ 45{/.notdef}repeat /hyphen /period /.notdef /zero /one /two /three /four /five 2{/.notdef}repeat /eight 199{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [9.14063 0 0 -9.7404 0 0 ]mfnt sfnt 29.5313 193.367 mov (-) sh 32.3466 193.367 mov (5) sh 37.2657 193.367 mov (.) sh 40.0795 193.367 mov (8) sh 44.9985 (5) sh 29.5313 (-) sh 32.3466 (4) sh 37.2657 (.) sh 40.0795 (8) sh 44.9985 (5) sh 29.5313 (-) sh 32.3466 (3) sh 37.2657 (.) sh 40.0795 (8) sh 44.9985 (5) sh 29.5313 (-) sh 32.3466 (2) sh 37.2657 (.) sh 40.0795 (8) sh 44.9985 (5) sh 29.5313 (-) sh 32.3466 (1) sh 37.2657 (.) sh 40.0795 (8) sh 44.9985 (5) sh 29.5313 (-) sh 32.3466 (0) sh 37.2657 (.) sh 40.0795 (8) sh 44.9985 (5) sh 32.3438 (0) sh 37.2628 (.) sh 40.0766 (1) sh 193.367 mov 167.892 mov 167.892 mov 167.892 mov 167.892 mov 167.892 mov 141.667 mov 141.667 mov 141.667 mov 141.667 mov 141.667 mov 116.193 mov 116.193 mov 116.193 mov 116.193 mov 116.193 mov 89.9683 mov 89.9683 mov 89.9683 mov 89.9683 mov 89.9683 mov 64.4937 mov 64.4937 mov 64.4937 mov 64.4937 mov 64.4937 mov 38.2695 mov 38.2695 mov 38.2695 mov 44.9956 38.2695 mov (5) sh grestore % PSGState gsave % PSGState 0 0 mo 333.281 0 li 333.281 209.044 li 0 209.044 li 0 0 li eclp false sop 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /space <10bf317079c7734bf7> ND /parenleft <10bf31703a9458c05db7ba7a58bcd7a2c9e91ffe666d66d67924090fad2e 914020d503aadf9240d9b1c6a63953b30ccff5415597f5a6c26fdee68dec bc331692c1b3543bfce7c82b9d704f4fab4f> ND /parenright <10bf31703a9458c05d79d3ca9c0e25cc2a0b35ceb7dd46fb51adbfd88390 4d8bf636baa28a31c262d1a3078da5849c1c2b98c958c72994f2c3f78ea4 d099458941ceee627e3f06f9f9a16a1d0c> ND /equal <10bf317031d9337efec57cde6d0e2594940fb2f7d43f8231e7e886eb65b9 941cfa14b36a37f61b> ND /A <10bf3170789bec1ccf5fb017e1dd1362ac54cb2fa3a278c1c5e8b8e0184d 7cbeaa35d4ddaa02f35f83f589e53f609414a1e8dd86a2916a5d28875546 282a3c313b2605b04804> ND /B <10bf317026ba62063ac1fc9b1b7e78ffd02405a6073c267edcf7d4772d8b d58886357b255f6a34ffdb28ea7dd3bcde9e8d86152df16bbf95464b3da5 81a80241ab3a15cb834fac879964bca12ae45a2346542b45e7f82e769dc6 0e9db083a82e08534c9f6f82aa9d811f6505bf0b1bb832cbb587ac8320f0 ae1ae42aea897a566c4e8001af359257dc731487787c0d93ef9b2f1ed840 41901425e5e82bd0ae3793e0dd4c50ff12905ccd193e1ae08c7b651a3ee6 9ac2a8d60e0001b1e2cb724d65cbbbc80d6c9cf4edb8b286a76ac8c6d7e6 c234df3f063f1d91> ND /D <10bf31702a859cc72343fc5a00cbe95321e18bb8a769a7bb762c302002c9 2b982836fa4260fe2a0c8ce27d8958937313533c8e6b2532aa8f3c2ccda0 580c74d4a11a4bc549192867065c4c563d8e65b752154cdb3b974ad93d22 39c345160f109954785d974e06de814d5117d5cceba690e455cf1260fe1e 56dd78848498e3603eee9eb4dfbe5866301d46b163af11b944ec34affd> ND /M <10bf317027e82ad35cdddc2b5c741dc6db294c8b4a0d6704b3828695c903 74c6f490906b329d29d44205638a69fbd75880845cec3cf05cb08dd78863 8da26e9aec39bfd95b1a> ND /i <10bf31703f9c43ec382ac71b0be91f29c503cae1b1e6095503cc0fe0ac65 3b18436e1776> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 32 /space put dup 40 /parenleft put dup 41 /parenright put dup 61 /equal put dup 65 /A put dup 66 /B put dup 68 /D put dup 77 /M put dup 105 /i put pop %ADOEndSubsetFont /ArialMT*1 [ 32{/.notdef}repeat /space 7{/.notdef}repeat /parenleft /parenright 3{/.notdef}repeat /hyphen /period /.notdef /zero /one /two /three /four /five 2{/.notdef}repeat /eight 4{/.notdef}repeat /equal 3{/.notdef}repeat /A /B /.notdef /D 8{/.notdef}repeat /M 27{/.notdef}repeat /i 150{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [9.14063 0 0 -9.7404 0 0 ]mfnt sfnt 60.4688 23.2842 mov (A) sh 66.794 23.2842 mov (D) sh 73.1208 23.2842 mov ( ) sh 75.9346 23.2842 mov (\() sh 78.75 23.2842 mov (i) sh 80.863 23.2842 mov (=) sh 86.4844 23.2842 mov (1) sh 91.4034 23.2842 mov (1) sh 96.3224 23.2842 mov (\)) sh 104.766 23.2842 mov (A) sh 111.091 23.2842 mov (D) sh 117.418 23.2842 mov ( ) sh 120.231 23.2842 mov (\() sh 123.047 23.2842 mov (i) sh 125.16 23.2842 mov (=) sh 130.781 23.2842 mov (1) sh 135.7 23.2842 mov (2) sh 140.619 23.2842 mov (\)) sh 148.359 23.2842 mov (M) sh 156.092 23.2842 mov (B) sh 162.418 23.2842 mov ( ) sh 165.231 23.2842 mov (\() sh 168.047 23.2842 mov (i) sh 170.16 23.2842 mov (=) sh 175.781 23.2842 mov (1) sh 180.7 23.2842 mov (2) sh 185.619 23.2842 mov (\)) sh 192.656 23.2842 mov (M) sh 200.389 23.2842 mov (B) sh 206.715 23.2842 mov ( ) sh 209.528 23.2842 mov (\() sh 212.344 23.2842 mov (i) sh 214.457 23.2842 mov (=) sh 220.078 23.2842 mov (1) sh 224.997 23.2842 mov (3) sh 229.916 23.2842 mov (\)) sh grestore % PSGState gsave % PSGState 11.25 50.2007 mo 28.125 50.2007 li 28.125 173.829 li 11.25 173.829 li 11.25 50.2007 li eclp false sop 0 0 0 1 cmyk %ADOBeginSubsetFont: Arial-BoldMT Initial 11 dict begin /FontName /Arial-BoldMT def /FontMatrix [1 1000 div 0 0 1 1000 div 0 0 ] def /Encoding 256 array 0 1 255 {1 index exch /.notdef put} for /PaintType 0 def /FontType 1 def /FontBBox { 0 0 0 0 } def /FontInfo 1 dict dup begin /OrigFontType /TrueType def end readonly def currentdict end def systemdict begin dup /Private 7 dict dup begin /BlueValues [-15 0 600 650] def /MinFeature {16 16} def /password 5839 def /ND {def} def /NP {put} def /RD {string currentfile exch readhexstring pop} def 2 index /CharStrings 1320 dict dup begin /.notdef <10bf317005b6d50bd3b903bc9f60e6e804630266f839393d56ae50a85fbe ffec110deebde9f8a007323688ac> ND /space <10bf317079c7734bf7> ND /period <10bf317021cc67b2bc301f516a49c5d2eaf38d05e04c6bb061> ND /A <10bf317079c9131fe82aed0960139938c7dd11f84d3486e157364ddfe73e c1324c5f0a78446dd85572d81f76d5fdc971afc3b2e06bf4dc47bc679667 2b63> ND /L <10bf31702a84dbf05e19cf614950deb745919e83632147afa81652f9b5b3 9e> ND /P <10bf317026ba62063a41a530d6e25ee764c7f37e357d9f4340ad256cb4c6 3eb336efd9daf309283a29cbee7e81d5cb35b4e414d564fb43d54f1be124 58e12175036224baa1ddd853331407c204e3c541751c1c73505c6c30ec2d 6cdf96d9fde307c47b2bc88392f53a36b4a782bd0cc150cc752b44d84c5e c0ddf42bd181226665ff> ND /Q <10bf3170448a2f19272427a3de62ea1443e9e24514b04f93ac287fdd2f39 16baeb1f1e5bbd8fac9e4d682ee617a16703464e55c70f98c9bbebfba8bb 9332193e624c4c88188a86a94f1868ff3baf24ad47e7dd3aa8269e7453c8 74dec63b672aee11c8969294223d86d8558c7e0e41e37bb70c9b8b81fe0e 62bb3e07e7daf4f81699e1c9450008b5e58129194ea031460410a6837a47 9cd7e824a3a12ee979d61c4aecc42c9fee8f7b8ca18134da39b4327cde62 adbcae68e52d90663597fa> ND /a <10bf31705d64e193f644676913533d4f242b6181368ed1350652c8cb7a6f e958f60841a88d1088c20f893090b458ae087d16aa8691f1ae44882b0528 d32f3e9827d4294992e18a57652ae7d531994f09c8f3899ddffaad39408b 1529cb6c6e94b8c5c36f6038811d22f304b6662d870ece2886bb4e9f799a c37faedbf994154341e467f29126a4c489a05c6fef9ee5143f581ea41499 e4aecea25c0711d5cc7b9f01a37e7c0b7e59d5ee83c610a480921138ec2c f957d766614f6ccaa7ceb4e20fd6f9ac362e8c090b1abb9485ee8c51fdeb 7fc72063a72ab3373c0c6872cf9ba20b3513a2189f8a98cd5a1ee87742> ND /b <10bf31703f9318caa8e536358c1266caf254cc8f2204fcc8145cad8eae84 6e0467fc8ff5935dc2e3c66fc2d770a8a0985949d0b65840457ea91ad410 0aa2463bfc69f77dc3f3312af4f5af8db671604929816f2472f541a92a18 726d0ec028a1dec3ccc92634e9b9280c8c5edb353f275531b9bfb7d0ec96 fab4f34fad063d2eb0f72538e85a0c78ae> ND /e <10bf3170599a82aebce2d0d9cd696e2d2232ae83b1d98ff884add96e0282 26fcd2cbd306888649029fbc75f18f771bf21f4d5f53f71cd70d56907fb2 0780ae57f65359db4c49ca929cb86ae96dd2f43742f720ffcefc0d1d3194 c72a55a6bfcf26d975c031741b09b969ea0410af02ae1e13b6c1d337a6b3 96eba6c714d73f9b5d2c2499a66a60f107d1dad4da56ef> ND e /g <10bf317046e845f3a98cff800425d1e47efda6f93f2fdd525c77c3453d1a 5e534db0cae85fbce98bb5ca5f47fa32549eab242b2025aefed2d610bbf0 6f24782b52049bc84326280fdfdce9e463ff0c9d2e0190f45ca1ab273572 b5f79171f7dbd792007c476977a4b53bce011cf0e92e698d6282b0b9222e bd3b058614b2c9e264b28dba3668c3539137f5b095545405b333f4b3110b 2fb338e04ce879be7da6a452862962a7d3f1cb08789ab6d63a503b5ef454 f6e05a3bf2b30ad6118d901cf95ac9a2f16a6ecd0ace88c3f682cbf939bf 9cf23a93fd92> ND /i <10bf317021cc67b2bc312fc6a7ad37016808b8c74342617d801906e8ad23 4c7210637a5c2e2ea339f24d0c> ND /l <10bf317021cc67b2bc31c11814793bc69b430b318ded78131a> ND /o <10bf317041f0d680f4930f6b0672f7536ce2eb70a2366463cc9006c590f6 6bbb22b4a706eff4a93c95880cecbbf82d6e623efa721926a49ba75b71ef 97d0e3d8c35761734c54d6d734cb61cf4c4d7050d90fa115600d26f47050 dfb8739452ed0059ffdca41c137f0b71425a690a4da83dcf8abcf17c206e c5eff5dd0d7b85b999c37123dfb769cd075b5a162cb33d72426c> ND /r <10bf31703f93f6c49808fdd8544fecb184adc28a087f99360dbfdf8b0375 9b819135c930698375e13c34125773b22d251f861dc05246608ab0d559df 442670f87f9615eabcaf25ab4b613b44e059b394bfb9> ND /t <10bf3170688ce4cb1d2f5bf487137bec8ecb87b4485146ce17824d997ac5 95ab4afb2e80a065a802ee3f010bb37eac91d0f6ed42677aa9dde7e1ad01 769b95b971dec6d1669588801bb2fb04109e79e9771f019783524f2f268e 35dce126a03e55d028a6951cc9b40e649071f577> ND /u <10bf317022f1ca2cc2a22c3ff97c1232bc55839582d9c5ff7e86bfa4508d 4c6c2a32b8a91c23bc7417819a6d61bb6c4ffa588f9ea417cfc189ff4ca4 86806cfbdc09b2f0ef54b54c53e50d4afcfcb2df030b19aa33138b0a422d d58054461b41c9166e86f2fb1f6b43052b68dc3202c1cc> ND /v <10bf3170625c727453162c8fc1a6c3317db0654c8d1cf399154810b2ea75 644b7bf3ca097b70d6244faa15faeaddcd0f234039d4b32fccf18d> ND /y <10bf317060ff2cd2175fcbd5188f2ead34c280175b68fa58eaeb7ff989f6 0b87f35441d734b6a71e070b5e34de773fbdfd6c4fe3b673d4b7999a1cea 703a048c48b5f433a740261363d7015ad7ad31dd41dc6049fa5a3516c28b 7faaad85929b64ac7256bc9d> ND end end put put dup /FontName get exch definefont pop end /Arial-BoldMT findfont /Encoding get dup 32 /space put dup 46 /period put dup 65 /A put dup 76 /L put dup 80 /P put dup 81 /Q put dup 97 /a put dup 98 /b put dup 101 /e put dup 103 /g put dup 105 /i put dup 108 /l put dup 111 /o put dup 114 /r put dup 116 /t put dup 117 /u put dup 118 /v put dup 121 /y put pop %ADOEndSubsetFont /Arial-BoldMT*1 [ 32{/.notdef}repeat /space 13{/.notdef}repeat /period 18{/.notdef}repeat /A 10{/.notdef}repeat /L 3{/.notdef}repeat /P /Q 15{/.notdef}repeat /a /b 2{/.notdef}repeat /e /.notdef /g /.notdef /i 2{/.notdef}repeat /l 2{/.notdef}repeat /o 2{/.notdef}repeat /r /.notdef /t /u /v 2{/.notdef}repeat /y 134{/.notdef}repeat ] /Arial-BoldMT nfnt /Arial-BoldMT*1 findfont [0 -9.7404 -9.14063 0 0 0 ]mfnt sfnt 22.5938 172.331 mov (A) sh 22.5938 165.589 mov (v) sh 22.5938 160.347 mov (g) sh 22.5938 154.348 mov ( ) sh 22.5938 151.35 mov (L) sh 22.5938 145.351 mov (o) sh 22.5938 139.353 mov (g) sh 22.5938 133.354 mov ( ) sh 22.5938 130.356 mov (Q) sh 22.5938 122.867 mov (u) sh 22.5938 116.869 mov (e) sh 22.5938 111.627 mov (r) sh 22.5938 107.885 mov (y) sh 22.5938 102.643 mov ( ) sh 22.5938 99.6446 mov (P) sh 22.5938 92.9043 mov (r) sh 22.5938 89.1625 mov (o) sh 22.5938 83.1639 mov (b) sh 22.5938 77.1654 mov (a) sh 22.5938 71.9236 mov (b) sh 22.5938 65.9251 mov (i) sh 22.5938 62.9267 mov (l) sh 22.5938 59.9282 mov (i) sh 22.5938 56.9298 mov (t) sh 22.5938 53.9297 mov (y) sh 22.5938 48.6879 mov (.) sh grestore % PSGState gsave % PSGState 0 0 mo 333.281 0 li 333.281 209.044 li 0 209.044 li 0 0 li eclp 241.172 80.1709 mo 326.25 80.1709 li 326.25 143.109 li 241.172 143.109 li 241.172 80.1709 li false sop 0 0 0 0 cmyk ef 0 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 241.172 80.1709 mo 326.25 80.1709 li 326.25 143.109 li 241.172 143.109 li 241.172 80.1709 li cp 0 0 0 1 cmyk s grestore % PSGState gsave % PSGState 241.875 80.9204 mo 326.25 80.9204 li 326.25 142.36 li 241.875 142.36 li 241.875 80.9204 li eclp 255.234 88.4126 mo 259.453 88.4126 li 259.453 89.1621 li 255.234 89.1621 li 255.234 88.4126 li false sop .937255 .392157 .996078 .4 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 255.234 88.4126 mo 259.453 88.4126 li 259.453 89.1621 li 255.234 89.1621 li 255.234 88.4126 li cp .937255 .392157 .996078 .4 cmyk s 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /U <10bf31702819c97bed0771866d6f6e4b5d808a62a968b85d231a0eb8e402 4d132e7e5f4f0774e52ea7ca2947d76cb6d91e5a49bfa24e8dbb70178037 670107e5c5ec344c839ecf8a09e3ebbb33f834e608ca891bbd12e5864287 c5461e81e0b9ea158473ff6b117e14cc8296> ND /b <10bf31703e65fd7e1217c9f29c64bb1b9e17851bf25dd0466fa484e27564 2ef62da05fc0e561425aa7c0cf759f2df2fed9f5cab4e563d9d485ca6e49 6a23023cc7d5336a38ed163f6d25eac0416c891913363ad8aab5312feed7 de0b0bbcc0db8b66958d96174480f5040af2cfb1590a9410022fc6398cb1 d4435f6325a11aad4c77347983eb4748b4ada02263a3> ND /d <10bf31705fc19346123ea144938c3fcda937cd4a672f67877e80be643ef8 5a01cff57f62859595ad9c2a1ef16f4c22144c6fc4d200f23642de52d57f 47e47c78a8b6713f5cb6dcd4a475047f70e7386f0baddd9f1c37f1598f60 1bc5b6005acf2115ed4aa52ed6ed621e5045f115e6c8ed146247e81ce086 3c881ef71e6e234403d5f37c528c6ebb0616bbdc05a29ca9d830ed27448f > ND /e <10bf3170422fdb64737aa996af2c16aa574465e2c930c2d6c70f2c72ffe1 f5ae975a706a2cc8ae00b6163837b6e50d4221eaf76eb409c442c6352c58 b6f53cd585b0d4d507cc48acee66f883df189a3c8bf101622dd4022876bd 14603c08f3944b80e2f5e4e7a62999282a391fd9d657c5f0af2673747752 c83501ca742ca70911b84f52143e873794bcaff697373392d39b09bb> ND /n <10bf31703f932f5ecb68c849e33d657776fc326fe2f54f4bc03b7f3fa95b 3e37550287a3822f66bab52dc802d77dcc608442caba0a099550a895735f 067f96366abd71cd4bfcf52bc4da085550e8eac7df2e04a58377ae472993 06a8805e14d9bcbf32aaef31> ND /o <10bf31705e921373942a1df751ebc6db4ec72c05404f7de2844dacd3e4cf 31126a38f288b6ae9b7d8f2dfbc6da8ac0d7c81b1e33f3b0d42a36c4711f eaf8cb9fa6d4a4a92b6ac2214800466fb64367d9087f85fe66540f2cdace 637f2d8f1a779e763ea7643d7ab1f37b5e7c3da5a24dc2e927da3937c07b 4fef169bc767237647c3151dea42fc9d1c> ND /p <10bf31703f932f5ecb85f9f26ec0d7d79e55a006319a903b4934e0296676 bb7a5df970714192f29a85860f4cb191aa4b83ebc5b58328ecf58ed9d6ff d0d3a63dd21733d64450e3abce2a149390b0894b2fb0fce1ee78d045f446 04c31c787e13fdae7e79785a1956f734ed54b976e123646b63ce5bee0b68 59b26a26c2ad993325ab7bd77cdd1be893a8ccd1451854fed772889a0d7d 7791ac97d81ac7> ND /r <10bf31703e6aa4be08d01c511eaadd0473a3483c7b936ed6e6cf91cffcbd a815b8df60ae150c20432c17a46c0682480f6226770a8905e960aec3fe5e 934f4cc994b08abf0fc9d432168086e4> ND /u <10bf3170396d6c263643d7ba7494b52feb74e74b6fa68562a82a97fbbf5e bed8907781d8ac84572229182c5c4b88be68c16550f8f2c56a1aafc9bc96 2dd9615eeaed29124f4b67a26151f4cd2e0ab6ff1b11f4d5d3a9d63d9288 f75e43ea4479033e77ce4d726627ff6cb14d9150> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 85 /U put dup 98 /b put dup 100 /d put dup 101 /e put dup 110 /n put dup 111 /o put dup 112 /p put dup 114 /r put dup 117 /u put pop %ADOEndSubsetFont /ArialMT*1 [ 32{/.notdef}repeat /space 7{/.notdef}repeat /parenleft /parenright 3{/.notdef}repeat /hyphen /period /.notdef /zero /one /two /three /four /five 2{/.notdef}repeat /eight 4{/.notdef}repeat /equal 3{/.notdef}repeat /A /B /.notdef /D 8{/.notdef}repeat /M 7{/.notdef}repeat /U 12{/.notdef}repeat /b /.notdef /d /e 3{/.notdef}repeat /i 4{/.notdef}repeat /n /o /p /.notdef /r 2{/.notdef}repeat /u 138{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [9.14063 0 0 -9.7404 0 0 ]mfnt sfnt 272.813 92.2163 mov (U) sh 279.139 92.2163 mov (p) sh 284.058 92.2163 mov (p) sh 288.977 92.2163 mov (e) sh 293.896 92.2163 mov (r) sh 296.712 92.2163 mov ( ) sh 299.526 92.2163 mov (b) sh 304.445 92.2163 mov (o) sh 309.364 92.2163 mov (u) sh 314.283 92.2163 mov (n) sh 319.202 92.2163 mov (d) sh grestore % PSGState gsave % PSGState 241.875 80.9204 mo 326.25 80.9204 li 326.25 142.36 li 241.875 142.36 li 241.875 80.9204 li eclp 255.234 104.522 mo 255.234 103.481 256.016 102.649 256.992 102.649 cv 257.969 102.649 258.75 103.481 258.75 104.522 cv 258.75 105.563 257.969 106.395 256.992 106.395 cv 256.016 106.395 255.234 105.563 255.234 104.522 cv false sop 0 0 0 0 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 255.234 104.522 mo 255.234 103.481 256.016 102.649 256.992 102.649 cv 257.969 102.649 258.75 103.481 258.75 104.522 cv 258.75 105.563 257.969 106.395 256.992 106.395 cv 256.016 106.395 255.234 105.563 255.234 104.522 cv cp 0 0 0 1 cmyk s 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /E <10bf317028198094ce8cd275e305c79a7a258ddd928bd9dc896c51a549b4 869242612fc9caa06c2483d03d9996ef> ND /a <10bf31705d64e193f9f1f8a567d03549fa73483ae9b672d7b7797200c526 6d55e0abf05d082c89da2ef3d2f91996aeea18b52bf494757c5251c9374c 9401f98b0cace0d4875f7ed6fd1c3b2afb70e988b112b201a9d47e0c13f4 1047852d209bb94beef969307b8c216c427c9903125ecb96a03389115b44 edc7e2e2478a1fd25f07acc3624f3ed1b5defe5adc0d2b5c9f2461afba44 82f331b79ca3a770e50164bc5ea7976dee8e016d390d83fcc1fa4202137b 503516f93235eba4c56226d091ad7f8be6c874f34a5fb2592031776db147 88325910cfdd12dfbef218194f528860b4df22c468e92140ddaed77110f7 ac35f3eb45ccb9aa77fa9fad75c6eb6c0fb7ca> ND /m <10bf31703f92f56d921ff977e5d6963369571a0659b0c0d4b90a5d6fb9cf 6faeef66a6b161cb3d25beb050c083e79f2022ade1c13065af4f750db4fe 1ad2e1c991cb72a1a606eb51e0d41e91fb4441b42920d1b3a1093a55a67e 1a1fd7d653f510dbcf49e0790e917a5508d455454558a59585ba63bcbeb1 95200dede71b995b075a583acbe0294673e1e62af20184e1e4ef7c875961 9374c008bd7ea0a3f8> ND /s <10bf3170586c182310772ef569c52e8a28e70ab0d8a07df40f23a570f6b8 110b6ca531096c401daf049a20dcabf79d56164e73db3a474a30573096a7 404eb97e5ce29f730842fc393ad09b95ed0671e10fb71efb1a363521b013 915cc88b3ac6f0ba589395594814da911281623368756fb16579fa9358a8 75b177830c9cbc6555453d35bc648383a53ae4cf9040fc62716099ee082d 9b7578cf9dde30b64249b8b9795ff42c9c8ae9907909c29f306594b1c23c 555bcd231348fd1800442f0eb86aff30c0e412f71e22a228c30832473ba4 3b655be973df9c78943b851583a400b4a0e41168da8a907e9f2f> ND /t <10bf31706fd71d386b6c99b1d09bb1ad104eda9ab80d9f94a735d54116f5 9c58b6bda429b5392910a11f88b68881d1c7fdb07e40a06d14aa641d6e68 4a64544555b97e482a6c7cb4aa6fb83472e09b52ff42b290b85900fae15f 7904eb69f44b98bcd014> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 69 /E put dup 97 /a put dup 109 /m put dup 115 /s put dup 116 /t put pop %ADOEndSubsetFont /ArialMT*1 [ 32{/.notdef}repeat /space 7{/.notdef}repeat /parenleft /parenright 3{/.notdef}repeat /hyphen /period /.notdef /zero /one /two /three /four /five 2{/.notdef}repeat /eight 4{/.notdef}repeat /equal 3{/.notdef}repeat /A /B /.notdef /D /E 7{/.notdef}repeat /M 7{/.notdef}repeat /U 11{/.notdef}repeat /a /b /.notdef /d /e 3{/.notdef}repeat /i 3{/.notdef}repeat /m /n /o /p /.notdef /r /s /t /u 138{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [9.14063 0 0 -9.7404 0 0 ]mfnt sfnt 272.813 107.951 mov (E) sh 279.138 107.951 mov (s) sh 284.055 107.951 mov (t) sh 286.869 107.951 mov (i) sh 288.982 107.951 mov (m) sh 296.715 107.951 mov (a) sh 301.634 107.951 mov (t) sh 304.448 107.951 mov (e) sh grestore % PSGState gsave % PSGState 241.875 80.9204 mo 326.25 80.9204 li 326.25 142.36 li 241.875 142.36 li 241.875 80.9204 li eclp 255.234 119.881 mo 259.453 119.881 li 259.453 120.631 li 255.234 120.631 li 255.234 119.881 li false sop 0 0 0 1 cmyk ef .749262 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 255.234 119.881 mo 259.453 119.881 li 259.453 120.631 li 255.234 120.631 li 255.234 119.881 li cp 0 0 0 1 cmyk s 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /L <10bf317026bbdb3a0b5fa193bb84a78137b0c1eca959bcd3e291fc955f> ND /w <10bf31707c6251ab9dc02dac0cfe6b2ad0a1717407cbd63b737120f851f4 8bf643a435f165b7893dd828fd2da9e1185df5d44f0e3e41505c0548c1d2 65fe2f6b93f7702905dcf1946733a5e23d> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 76 /L put dup 119 /w put pop %ADOEndSubsetFont /ArialMT*1 [ 32{/.notdef}repeat /space 7{/.notdef}repeat /parenleft /parenright 3{/.notdef}repeat /hyphen /period /.notdef /zero /one /two /three /four /five 2{/.notdef}repeat /eight 4{/.notdef}repeat /equal 3{/.notdef}repeat /A /B /.notdef /D /E 6{/.notdef}repeat /L /M 7{/.notdef}repeat /U 11{/.notdef}repeat /a /b /.notdef /d /e 3{/.notdef}repeat /i 3{/.notdef}repeat /m /n /o /p /.notdef /r /s /t /u /.notdef /w 136{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [9.14063 0 0 -9.7404 0 0 ]mfnt sfnt 272.813 123.685 mov (L) sh 277.732 123.685 mov (o) sh 282.651 123.685 mov (w) sh 288.977 123.685 mov (e) sh 293.896 123.685 mov (r) sh 296.712 123.685 mov ( ) sh 299.526 123.685 mov (b) sh 304.445 123.685 mov (o) sh 309.364 123.685 mov (u) sh 314.283 123.685 mov (n) sh 319.202 123.685 mov (d) sh grestore % PSGState gsave % PSGState 241.875 80.9204 mo 326.25 80.9204 li 326.25 142.36 li 241.875 142.36 li 241.875 80.9204 li eclp 244.688 135.617 mo 246.094 135.617 li 246.094 136.366 li 244.688 136.366 li 244.688 135.617 li false sop 0 0 0 1 cmyk ef 248.906 135.617 mo 250.313 135.617 li 250.313 136.366 li 248.906 136.366 li 248.906 135.617 li 0 0 0 1 cmyk ef 253.125 135.617 mo 254.531 135.617 li 254.531 136.366 li 253.125 136.366 li 253.125 135.617 li 0 0 0 1 cmyk ef 257.344 135.617 mo 258.75 135.617 li 258.75 136.366 li 257.344 136.366 li 257.344 135.617 li 0 0 0 1 cmyk ef 261.563 135.617 mo 262.969 135.617 li 262.969 136.366 li 261.563 136.366 li 261.563 135.617 li 0 0 0 1 cmyk ef 265.781 135.617 mo 267.188 135.617 li 267.188 136.366 li 265.781 136.366 li 265.781 135.617 li 0 0 0 1 cmyk ef 270 135.617 mo 270.703 135.617 li 270.703 136.366 li 270 136.366 li 270 135.617 li 0 0 0 1 cmyk ef 0 0 0 1 cmyk % %ADOBeginSubsetFont: ArialMT AddGlyphs systemdict begin /ArialMT findfont dup /Private get begin /CharStrings get begin systemdict /gcheck known {currentglobal currentdict gcheck setglobal} if /c <10bf317040c2e74a5fc1787aadb34082a8ba9190bcda4e6309e8a2068a81 15bfd146d0733468211951e54d63b47a4bb20769a10fe2c7ab6af1003e92 c307e62580c4fc4fcb30f321670fe8ea6fc382860db4ab478167543744c2 7eee42bb190b50ff8a3de3702b096b5a0dbc687d9934d27330861f8f151c 46c0261f0a9972bb3873263c80a2161987b9c9> ND /x <10bf317060ff640a97f40d52fc73b98a64469b3f084ceb61cbde39a670a8 6bdd66d38d792d8bbe1de58b050ff75d7a6d9ab8ab83f71f1130ffc9a46b 7d934ffb8ab93375fd62539cb08006> ND systemdict /gcheck known {setglobal} if end end end /ArialMT findfont /Encoding get dup 99 /c put dup 120 /x put pop %ADOEndSubsetFont /ArialMT*1 [ 32{/.notdef}repeat /space 7{/.notdef}repeat /parenleft /parenright 3{/.notdef}repeat /hyphen /period /.notdef /zero /one /two /three /four /five 2{/.notdef}repeat /eight 4{/.notdef}repeat /equal 3{/.notdef}repeat /A /B /.notdef /D /E 6{/.notdef}repeat /L /M 7{/.notdef}repeat /U 11{/.notdef}repeat /a /b /c /d /e 3{/.notdef}repeat /i 3{/.notdef}repeat /m /n /o /p /.notdef /r /s /t /u /.notdef /w /x 135{/.notdef}repeat ] /ArialMT nfnt /ArialMT*1 findfont [9.14063 0 0 -9.7404 0 0 ]mfnt sfnt 272.813 139.419 mov (E) sh 279.138 139.419 mov (x) sh 284.055 139.419 mov (a) sh 288.974 139.419 mov (c) sh 293.892 139.419 mov (t) sh grestore % PSGState gsave % PSGState 0 0 mo 333.281 0 li 333.281 209.044 li 0 209.044 li 0 0 li eclp 0 lw 2 lc 0 lj 10 ml [] 0 dsh true sadj 3.51563 3.74609 mo 329.063 3.74609 li 329.063 205.297 li 3.51563 205.297 li 3.51563 3.74609 li cp false sop 0 0 0 1 cmyk s grestore % PSGState grestore % PSGState %ADOBeginClientInjection: EndPageContent "AI10" u userdict /annotatepage 2 copy known {get exec}{pop pop} ifelse %ADOEndClientInjection: EndPageContent "AI10" % page clip grestore grestore % PSGState Adobe_AGM_Core/AGMCORE_save get restore %%PageTrailer %ADOBeginClientInjection: PageTrailer Start "AI10" %ADOEndClientInjection: PageTrailer Start "AI10" Adobe_AGM_Image/page_trailer get exec Adobe_CoolType_Core/page_trailer get exec Adobe_AGM_Core/page_trailer get exec currentdict Adobe_AGM_Utils eq {end} if %ADOBeginClientInjection: PageTrailer End "AI10" %ADOEndClientInjection: PageTrailer End "AI10" %%Trailer %ADOBeginClientInjection: DocumentTrailer Start "AI10" %ADOEndClientInjection: DocumentTrailer Start "AI10" Adobe_AGM_Image/doc_trailer get exec Adobe_CoolType_Core/doc_trailer get exec Adobe_AGM_Core/doc_trailer get exec %ADOBeginClientInjection: DocumentTrailer End "AI10" %ADOEndClientInjection: DocumentTrailer End "AI10" %%EOF % %AI9_PrintingDataEnd userdict /AI9_read_buffer 256 string put userdict begin /ai9_skip_data { mark { currentfile AI9_read_buffer { readline } stopped { } { not { exit } if (%AI9_PrivateDataEnd) eq { exit } if } ifelse } loop cleartomark } def end userdict /ai9_skip_data get exec %AI9_PrivateDataBegin %!PS-Adobe-3.0 EPSF-3.0 %%Creator: Adobe Illustrator(R) 10.0 %%AI8_CreatorVersion: 10.0 %%For: (David Larkin) (UCI) %%Title: (CPCS2_Infer.eps) %%CreationDate: 3/25/2003 11:25 AM %AI9_DataStream %Gb"-6H#k7QFXQtYQ<AWkr't@pXT4%3iEVepO9t!(UZQ"Ok)?Za@r5mYFuP^HC/? <V4YhH[ID9uN*#Z8dcltn&UC%n'l0dO0r8$hP %kMQ6oqW?i2]8Q"Df/Na'Mj4Z]j_J#<i`<$/Dr:KKhu2$Cmrff8Pn$/V*]4HqF?NXm %WfjNg>p/uB9.cp2s29dG1UrQ]tHG`IJC%W %\\,KOn;GiZa0Y*^YKjk[DpDD`]">Vfq9s),H$91BELZ@? oc;RG^:cM<r7+mDk5U_X#O@l&G>_mm^\mm+rT2#dh%SK^s"]#/]suj7 %Df2c(mT0.fj219p&+906BN-fRghZ^=YKnjd^>&UP`j^<hb:EGg"+O7`i=B;`md:?1oMgV/D1;/]s#cl) ($kP!YCF%Yro1iOmFg=7 %c1V,53GKZ91<XaRgq>q90;q*Lo/$5`FgCo4m,R2u$tqNJU>*;PY@N7"H&n+! ga]KgHB\ALl/VYA@+TtI^S0B\*U`kUXJ.i?\%b)B %1V?].h'scJg1pf"pAeG_j$<a*?gY#Q? _6*@(juJE86U_9n9;COWjFmGAb_U,?'X94BgAZR+"qeeqSha/)Zeo!^YE^LI?/=8^:a5* %[#Wi8<N0;_J+rJRGPh:'$_W<?<GD<1Rs2J;/*#dHb;3JQdF@rpf(eOspA<Yd&]N#V7f`Q*X1kq/If8g %MmFLL[u(cBaD]r(Y.qRD %+$A>2OPHj[eD"D'/(\omQ".;oZ?!*PojP4FegYo1Hg@*Ao!a:$^U_&Qro3bj$n9#knBGmthX>?3[l_A %`;u5;kSSsXc<H!0dI=![ %Jc9k"EVdH+?G%4R] (f8YIsC[BrTJa=s#N^Qg"kKPg1FX)q<E`r=5R>V>nCP;mg2=]*WoLX'jRB$h44R[dBEO`pM[,*O*=8t*PFe T %hjj5G<rCciX>C'mLOa;1^pbK.\%MFc/8%r*)4tq=[@C)GkO$h]XVGtn7@d%(DI+ineV\+O_d? BtCf"uT6.='_heY3LZeaWqm5ATp %^>5O#Ft8P_cn],LOZZRV78s(I@-R08C7#h:U)N0*Z^'u5.JuUT9F?8pmKO/8NXA85%.@aMlm1bdPWA*^H?_qTG[:;;['$R!`[(e %n/$5U>Emejn_aT!!_WP/r^p+W]hC\G0;F`ooAFJbXGXYe%<KHpF<q;D1RIQPiGaEaR%pdjJ4:GeNqeN.R %W@<rp&E=KYOI?3T@4n %VP&hI=%7^Q)D:O;%?kVmA;C;6<"n1-Ch35p!? Sl^9qEnagTjBcH_CorBK1kUEc[YZI#U/G0<,>]@u^U,BoKg*K*bFs_fDLt!M;JA %0\t+/ON-dM#;7JM87=nqCFdbunHnRDaT=RG]If)e:POpFp3c+23frglV1TRN(! MuO(B@#C>CHl.&(E7LW4>do5\C;&JIVh3N<TS\ %jQ6P&)<DC0D6P'^"(O**Eq9;W2I%3,4]sh3VTs>^_Rm*GV_@N#X5R>j1!8\<?!c#C,q0bhj].1c*o? #/p[Yl`gXCLt*?WI+_n3S4 %C\^**bDVg]S4M&s0! E`&q)l=5X(sBMo2nBXQ1^Egp.=*q7isZED,5Jeh3J^ZaZoHhRQn:'pmmn(>19,;kl;1k4Xh>!++6c<5,%cS %?b7lH-',@lrj^!-o_5/>-th>$#'f9,76XAtn9sVI/+:h+qJe7XVj3E0m^\f#T>oo5M4]e4> %'M:HPhePh&^%pOcHfZ<O-7AQdSSg %OaCFhkA_k3GNk%_4RmCm\n"g;gZc&T\Q-Z2$P=tg>6sM2DU5g293N!,FX[K0;Wn8`\mnTRKq/sFjeAMT6.b')3n0Lhtq52T.S2Q %W72jJJb$A1r:VD>a%]CP+E%P'bF:4$qla])h#@Sm:M`4@3mDKLg).?Y]<&Pkj.fVU&)IcFiVO$qKh0&U^#`0+pED`U]YlIjE7Gt %:[Yh:T!<g&@2K<sI;!#:NuL8>!_&TVNF9LGC>Q`\)M* %<hlr$Mrj^iBXIFh&WUN_r2>$3m0*J/9DEV4(7HcGdpP4N!QoStP@jn<@ %0!__4_$K4$]\+nJHO^Ef7ToI6Zn@&%:WDqZW/<8cP_$alYEKJtKLY0?paf\ [Ig;"OBJXTBlfP^d.M"*R6[fmE5hdVcFFCLN)[H3j %S0(*jdDd$`7)h?pk308Dq1m&^rp`:0\JI(``.gDOUM2^f&:CAm3$b/hOb$8:kt.V"+trVk0]#Xf_Yks*t:n7k(/eGA7RIj1?]?\ %`-qPhEIRo;;do]*<bZg2%H:5fjff0eXF49eDbUG;1OX,8F?PS\2\k;cFcXNFp.0?'0^ducMmMcC'_QVs< %hKid(r[=6Lg_lN!F#7 %AiUaHA-0>4Ul<+mA(\!g:'4:$An>`/TZ8rJCo!L/3&"_bKC5-/auVUASDOfQSmoECgW>*7@bNV%$ $P\DXt^NJfYpdFEsZso!?LSI %i6pi#NIY.8oN2)a_hXZB#j7fdmj&SiGDp[^3ZJ(W=j"VPrd"j\?o5[pg;4Qlr+@@G^@94A>9u0iuAE]oVCIDVr=.)<k6-Q"t`2% %hgM#-KJr^,ju_$?`e31B@SsP25G--c9A"T9.H %9#'nabtYoYUO1/D)^3@QDPAnKHcm*k(OhVakEBuZIEkp=!+k"cZ:,HOi78WDIA %VC=.dnN>2EpUM?Ob2kWJ"To"cAn0/O&N'LkM[S+k:f_q)3<]99=TcK;a135FIH*R+&*3:Qal#G8>]OVJ:S',f)$iAIFIN%r+4'+ %clC1.0M<F3Z1Ls,M9hp"qsH2KUEKcL;Oi8-A@XAq_)-VPNap?iN'BuuAle\KW\]obO6QrKCNiD_;$m+6"a %>W%r.A*HWPFK&gR0n %Un-i'R6N8uD1o9WR= %YBnO,6\^'DKuJJkQ$XWXSPI_"t^'f2W*I@Gk]hMhF1,^k.a7+;o+A<l#2RNG&WVUsWg^q%N%(*Xt"IMm@u %J-S<V`6%p^+g"r0nrP"M+!dVq/_osAhXO-9_Tm`,0RJ9<ktcF&gcP8D-^Fdeh$! buI"(%R5a([#q4e)UB2A,:ER!+Pbf;]BK:gK] %TdQ;5!kW2nSV[\'FS#]6^Rk!+DR8gI1W1Y_J`[JB.<uF*Q,Q^;AfsoklCWOH_*.`l""PnfW+8@mhDpSGC'2tR1XbW\[b&($PF[0 %CZ;h42jZJ\laOb:rpItch8f8.,tE[tIWt="GPh*Yq8_5olK%osq&_5l^L,gQIb_%hmO>u2b0;f[JJkKO1XjuY4#EC2g;<PDuClV %C6VS<eF$RF]t68=>J9q/Ie>:-d[-p1la*YJWqH4+pRRV"p#Gr*.Z=^`F`qtUnSbJ3=5>%:m %m7ud.kNY)HB$$E)-",\^&5ml,c\X %%mh--rT3kB`VVa^@45<_DtmbAKB0[e_gh"jVq:)jaDY;YPZMM,[q@qre2RaaV:E>aNXc@N<-S$7UWiR! <o;`gY28'Kf,cPG8!b%D %]=XQ_jiuI?/\G7-?/>Eu<d;>>U32ljY!65t^>&R)Fpmg>?cVVQ^>45/bKJ(iS25>0q[F0hrciV`@C?! Ao,h"'hgBcjGBrfIO*<Z7 %TOC!k)6`Y\)KG]t0)./l<2TqqB=kg6.r#:8Sc=gU!&U %SlgO:k=T.TYIm3^"mI28Cmu3A&Ecq*DS[EjnYlCs)EBJ!M[IWpYpHS4P %9Ibej/8B3FICHiej4U8hT7LqaGlMMKK/in8qL3WIo_6CAreqHH!HjG?ZFu6s)15[1L<.*P6gIOm/2Xp]A4P^c?H>hTGmi*cpBI0 %s/1d!"H3:^?$s,nr34q&qNhVAjeqSHD0Q! Qc$uh/]sq)o$2m'@rUV`tAmFZcT250=I()r'UQ#1Xn,DtY$u6QgZo[]`W`O,rGh`rm %\:dhh`:#mfeN(]8XTGnRfrm_b.n:j(;rFkUI[.LKnm,Ls7-*CW.b0S4:OOP_OY4PJVTMXq5`0</M.M0b1*U&DNtPlUN<J<,ANLN %MVbK)d$X=b1UfhjqQA<_4l!TXin?$YX+R!7\0Bgm7YccgjN^7/V'hjAhL*ttr;T-8rnYQTjW:eo**OU %kYV=[?h!8EF2gK7Y!^)Y %#3uRf(d$l_Zgf3\"T'Y^p=[6D? %W>Z":Hd_4Zu^I(Hm>5.foDodJO=om^\r\,=:",.S\YZa6SD&>rpd3C=4oB\p./@?iUBE9LF?m %"H"tdo;=tAA0891@7(9EiAT%JW)`>^4+)H:e9o9iSBdbh.Zu9bjMhcu;O\RoGMKm]HMV\L\+^ko<t>Ncq7\J+-;TS^#sS^6-+Em %!68(biCUORjY9=V/Rc<Xke2ShR#3#_I$[n@-r]1iAF9l80bA>UpJsT]>0I\*D1Pg)W(? qEa<2)C6sd8l\=X-D@CS/YckE_Lk\/b* %O<dZCKgprNiuQ3-=GL,48#em((9,2$FADdI6E)"_:#C-dA1-E4U! X^o.Rnm9ERUJVMOEU!/4%*qh>fN@"%QkBKE]SS$;U`QRgE;I %n+[nJpOR6MUV2fPKKFYNJ<e`_3$&[H[3)OJ0:dKWdkH'b'=.Z^S8m+YH4BR61lcZdX*<#kFF<DNr*dG>Ej>[$uYTG7nbUJ HB_1h %I$i_GnBUDuPHGOs$1JI..&Wu>LbeTh,::3;@_9ht!1_+m4+X.dYR_U$h'.1f";-3GZp)u!'$gXOP>`T#! tZp4)OpiL=+ljdX\`n" %]$W5qFc(X/Zj8CCZ%B?gd',bV/3PbeH!6Iu/2ME37RaBDH,bE^$@mrj2M?+ON^9IMD3f3"#["ofSVg&_KusHNWo'?=HN'":o]1" %l^37d:g)l@dL3e:Hl`(08jp3%Ocs!>Ug>#D'G43g+GHbhV^CK8'>4sU]o"ED0qkKt8>;D&7:uIXGY %PBX_@&kPS"/C80c9Ml/O;Y %)pl[a2BL&>mm4\)/\WD[MM/:n=4)>flC! oGY*`SSlu/=7N>sbhKH5XrGjoqjQ)dYFX,IlS[-3in %q4E4(@>R"b/BjLfK17FT)(a<_1I3%jYlfmRP,9LLd&h&Z'aXqg0=$[">[V97+C0hu,)nA! >/q&#8%@V1K+#=<<5fD8(^I42R"%VF %-NR-kbpE(O42S;p]3ll@ibN/jNa#o7!4-do3";;&%SSkop(u?&Ukis<EWg1Z^hT,g? t3)NKE.*6b<:=Y<Xt(cIk5n^%'4LQOdFQP %B\j>EA7?".L6m=RNbN$#pk#G#^-mE7(O;%q!! P&BOoZ;.Uck;=J:cu/cHblUa;;<BOMK>CGDMG.fLSr$9P&bee,uR3)lr*FY[;ha %%ZC<XS-,<eU)*FBqJ9RY!U8NJ8I)^JGHA=YXKLk`W/)WfW0E1PMsc7&k*`k",; [0HXpF8'`2Pt_I:1P<117Bk;F0t%8>_ZNaXg5l %1(flYSK]a,()cBeo4_A5(Vo`GG`\Toe!2_(3MVh[4+"-k`YE+@$ (Q1Konat1CU(co#qW\S7X>I=P4)go9D]:UppRN[F575H4rRd" %4YU)W@U40Ep8N+-qcn]V,mm^%'<Y.N=3-qO"ZQj8h@<VEn>VH@QNW %5fS=YmX0@<#Mk"I_6G\NZ3P.cX&38,:JPWLaH9k/t38B+R %7m\>Sk89cZGL+/';Dc#5D=Jeh#e0Jm5_::i&g^Ke,0Z5V,dp9pA$n'Q1G+.=d@u5kBYYZ)SDl'lLtf_bSS (;6#g-TtJ_@MgIt!a# %iYL;LdZfMPeqeAkN)F3gn>o@cb./r8."LLaR.H[FJ9s"*lZG%(hfXnY66cKN"@,59'n$8elrh% +1\3j=H=C:X8DHMfS4m8^hme90 %hE`uS$:rT^V"Mc_6V2q>\41%8>T,l,W5'P@KggH"*l&VWfE%7F7T:4^"F70X94j1u@5!17!K0p]O>qjg! G`k`Lks%u7Ar2S/0M(i %4fYUa?)D8[R\?efa8t8A<6VpIb^0PF;hH4eU<E>/b7J%)e9-=WlgU2aNuW@#3fJY? <^8uPR<c=&<Q=Mo9faLM3$nor%j[oc1L4<g %HPSau&`=@Rk_Ud8qEac#+Be?`>X\4WQ-'o`JhD4QXJWl4MGs#I2bk`)>'Cm?\lL9O>P=VSeZl5F=e]l72:bX>ClN;3%%gFaRYo` %_=kg1%ol`-lF^`8K`H3`$mKgCOIubk_'$UAP?jFWXN7QeXdF2Rja'B=[cR$3jp5ju %P[,O`rtkBBIYj1$me3u.\rQ0J8,a2+IrWA %Y_\s4SCe>Sg2LMM3*8];ek&R#GkXrb-(oZslLJ= %3nJ#+o:E93dGpDbZ'_1PMIiCQV0kG;9m_mCPkl<*]bd8m4#,Lbld9R?)mBj4 %2XVH(nFDCAU5'E#$\Rd32A,t$6(%O[k#F<Zl\T<Jp-8e]F>k3OoG.U$J5$9;!85.G$IIR]pOacu)+30d/d@o:]Ut5EpHV&4hIgh %d!Ka*HZi_g[27Yo_Z\ntLa!4l?P7[H&Hp;dCjE%nKn9UXk$]TeP+<^iL'eS%e%&t&di/h\>P<BbU7uW=]n8(!6^*K'Yk2D4&oQ) %O_pi2"PtkDU1fGk)JCe!&G*+\&\c6`>[\6en0dL1nQb\UoG[hrq/$A]$M?d3T]WA3W$\'VI(>A7D+? *5m^k'Jg@HJqd`)&M/ %NU0@GCnP=H=l>#)?uUhY!c''\BW3"J+jq3+lK);g7GPaZL-5sZ;WQ=26J0`$jJSJ'UY._>BTN#:df:6Timba4aV<8H5lTp@NgPF %#\Qr364&?a+U+S56s=i! R:lRYNCE9RQiILU(FPZtYj0/S:'6C3(+s)Tr.qm0k$ruJE1]DoJX,QOEMptaecr6/1'<2I/%>\o;*tm> %-!NVK0[*#R>b0J&88(eI%oGn(7].(cYV>$t11<s'Jpm_5!ZEQq"X,&Zj$>AU3<Rc]('f2J4V!/8h?sW %HGI'#?5*\*q-=aW[kQ!G %&LVc,3Jk>08\KZO!k'0-"!<G74g9R3NH?:p^kQikB7WJf64q9n-3jH#`)%C<$d:/6k$U<6g,FCoKj@VM]?M*=^A=5(gqqG"BYX5 %:$g719a7[4Z\0@C',MG'YRjHuh.$GOF9m=!Y6\C?:i&/k(j[DM3$.$qJj'KeEEt@;.U80tZ%aT?=OXo- 3jWI,c(6']DTGq4)s_Zp %(W:q2-9&L>WG.(6XUYP1MUAQ/;*Vc.;9$q2`oo@.,! H,II1l$ScA?:DQ8>ru/YDS"4nSl85m2A6lrY5(5%C`BY)0erYZi_1*8T0b %*EO;@k?'bl1u'FFcd5Tul?H0l]5/r]N5(0V%`C3Q\ %#lPRs]_Fc:7NGM5NM$JL_B'RObq&4cn;i.kL[iqA>(4<akhn*9'DOB+,8D %35KG4,uX7R*a;0RhnaVlK,7Rhkf9XT8XR]A_XBdX/oI!e/@\ID4M_K\CiN-W:.5W=SOsM79.QC_?57]E+ [[XF!&-8fj^=1V.0o#k %9c-CX(u;MVO[-#dHF1aRpfs48BSu:IiB<!ZLKbcK+?6s_37nnr-LYZ2i0H\@^,] +\Fm@nc@Kr;jr"2&")HJ9a<MlT4(]N6h$7NiY %(Z2_9YBTVJ4@7uDggo#Aa&\5s1Oum;E.P,2U4NbYjDcU;V"a3[9^Dcir6CBW;? Zt;`0FrKn/r;Kk9LP]NcJHTKX7?63HfrdT7s1> %9as'jf`U59P@F+foRg:^a;Lis]]R^.9P4&Gn899Y<X1/@GmoD"7\cn#ll`8r*@8S/3sdS04%(XVK? i7n"9R9_A1"o1412!jiu$%? %6]BN1L^eUK_5WINL@"dM7h!TEW,9=&G$')k6NZR+62JEepkn==C7G<h-_^oR'@3h-p0>,irIQaNcA] %iaR&k)gD<U<Q:_8hpbfA2 %QG=&d$X:T!eX?'$EuXg1Kco)uiBRm3D>9=RCNAFR_*W_o! 4#VdT6cYV:E#U"7<9.*F2nGXEeUF@2\=Q_8fPBAnLb[!\#JO(YCLKV %D!Emi6#:aO$8<_Z'&g"O9Am$.bWL6'/ +XTH)Yh1Bg9OWfg1JWb)*U1'7*PPE0_dOO(tQTE6lkP:e["AGKZY2Yr#;*a$53PKl<XbE %(Y+2TR62u^E/o!9U\DbS&?KIs;N,E7."uVR[u,YL0% %HE/W&m\TnEXj0kuAkfr^uJ/d.58:KWW&50n9Vp6[ZVhmKCM]?0Z+OFraO %d.0dkr*VcT?q=];'&G>o8C1V\"UeX6#Oa5'!cVELnXSUp<\C<iLY\(]P$OU'e$EQ,pYm*jo2m`H,)E! `(>e66N<No<0*TRThc7\8 %T&IZa1iV[EPb.:Daa:9GGe.QgfNNkN5c^DdUs;FJMN&<i<CD78Y/XeB%m9a-mg9WH0Ts7>NFp4sJ. [70W+e-uI-AZZHmcCS^ZsH9 %"j?C?ZmK/mQmpg?i78[B7o2j1#-euV0s\k9<g,S(+D(8`_h;J2dLZ*gnpkWicKkm9hH/@HB0h:I)&! H(4UZ]MZKF/"+qsApJkups %f"ljp4HM6l>\Wf2O4\0t#>pa3+pbcrG8f"foU<@dme %a;K83hcW9*SB=7[:8Yohu)8_kr*.>Htrcs+S3emp99s5E[)N=X4TW#H'c %I)>CM!8=D1BZ'cLBX=*#/:*I+4ESG/?niqQ'&-ZPoFQ]L=NE1b-%R(01cS>g7jKtL! [1<p#+uPk+KOMafW"rEo,?]:epsDG\f=*] %lcUW\/.,D+^=<KYkGi&'7H#Xs5%k85Dd#IT$3Qq7iEGC5TCgu_loG5DZ&? MV[X0V]6mciN[*c4iE#,k35bTlnd]uXMVkYA\K?;R\ %3H^hn.00^7]GH%+$pCh;R%1FF";dWW1D"4qpBN;Db\*%I:`Oi-0[eZ78ed;;OClh!"4mu]! kgcgU_@WXYJ)\!3f4Qo&iGPkb$Nsu %'3"Z5R,fQ6DXJk0*>GQM3b4ifPS@F(5;[b)+BrDK^d7,[e;iG!AkiUZK^/c8T9Ekt#4.EC/u[9B6_)24#! p%MM*PdKB))<+PCV\< %HF1$bejPEEfn;'';leDG(n]-[T`XhH.nSWVd._!I-<p0iSE']+2g%h\$T5=C.#oLn<ue;bU+@O^! *Z/s)*RYtcbPs^'M56*#k_C/ %L'mYE?.RMWe8E<*:[4[i%:$]sB"2VnT4?L8I=j]uHVS!\gVTjpV/hkJe*ne'%L9+D![*YX+L-1&=Ss>=! 9%9/,%q0X\XJjI.g2WO %Lb&`VFcQXE8.:0PV:TqU0UV/KQI/EgkQB^SnNjL\"kG);#*0FqZbZ9#at;\\$m[&:$:XFe,GPCU? 1DoTOs!^@`3l8m^qVCUc?Y'3 %i?=.bS@m&7E@Y@TIWQ5KV[U$g*(pkMK@JIS).sOKKYnPh^`ZUd;Nu?'&i*4Q36bRt-d@%<@X>o2lm-d&$ $/JV&gko(C_SQ@1FSuG %6:"71*%'AHAg*+6Qm#9`T^#[I&sfM+g\@p-%!`WFmAHqDn_;ZMc,`.YO*E&/O/PW.? 4sA#1(E<E,NK2h>]HQL<AUO\^BW9A"#CmP %H^7W6FC0iLFNV.7_S<Zs,'%c-hn%WU8Xs9P(in'(o;>1hLCJ"%c2eAl"C?@A8NG1Tqpce-;MqRADpcXQjnW]S6G>+:8e22c:<18 %Y-?`Cb98s(QNsDV=NqdaN1aolJJ_cunN'g/(nQ$c1fgjj;i@tK3<Yg.WD\g!N#?Z;;`=g:B4<KoR*uA#4IDcMGlTFKKBJhWL*ce %8]&9]*qI`(X6usc3ZD&B9ml,V?%p?(kB<g?"Nb&c&h+I*8eSX-l9MK7n9AO1#4Gmc8,+poPnMWM8qUE7-? `C&>*'F@\Y+gMcSZ[A %5qOL@U'80/4P-_cq[)/5<<oaN9INK4%J+"':4]mo+g4Fr_1Tt<(9O8Pd&&;HE52[\(nj"/k-9:SV? n3^GtgK)m#g4b,:=@"C-Js! %"$[kA)K7/#hc.FH>Y*"#E=W9.aia9C47MM@X),H#B=4S/_K3.u2?Nrj/#tMR1(^OB)c/>^;n#;V %'@\bjQ?/_)!q"4O[H=4!D\4q %$Eq7SS6ZHSakfQ_kS>BnZI_Au",gnt=n,1)"BPO2c[qYNYXo186q&;NAedZjMSag%!?(,/3qFa? YoBa1*2R<-fg>E(6mLrc7`+C7 %?k]E"aLZoV_T`1.%2=Ji/<0rpXPgk`5pWC)]h)*I&)\3u)U<)Kk;f&<jE]UPbp,oCn]Q>hCKR'<Y"Jcq3a4!Kj=r&Pb).bWat&] %`Ir!Z:]'Mj"(9bi8@emodLqQ;3mljDMa!4&VGf-#gj&+#@/mM9[H!.nV#j.!pg')bMIsT=?%n\B5\leT,9CmLnH1&@'<.&E+?c) %L-.q["4A\VY8_d1)bQBDnZ\cf(M!Zd_F)(n_\5U*UAf5^'JMFYnf9]-kKIWR25<!C*)]c= %cT3ImDYZICm>JjZRO'e*B;3pOH%Ks %$oA9*aTkS=pEnlcS'Vb?76s%d-:-$!lYIV><ZV%X3!($kd0=J)`hYdJ %gmY)#3K/jZD^)GKfPn<*YhKWdP\t\cH_Ba/f2XC<S`4i %TWjT\\?HOmCi#E&8-@pI1[MM>599W)CZQj1&uZna#'&AB]V6kd.=\)9ElH>0L$8h5"ss5@thrpc5Sg^;gNF<WY14\)Nm"?L]s>? %ljg)t,(u5pN?DbC>)j&1R+@cp)Dq>AD/N*Oc/S!MlsAY#Sc`AeP1\E, +oo9>69ENO>^MJXD"B*pXOU4;bc[J<XSR)nNcd$Rh;u]@ %R)JE)1/%2@49I#W=d"ec*8`7G5_[U&&Yg-<K5<4+LTg=5:-7aYkRNiZGF`7\AIMO0"q^?gh^4K=C05Et)\ ET+OEmLe[X8=bEY'OW %,9f#i#)OcsQ8J*o"',K9o*33I0Z#u69sdW6P.9PjcSrE-Ou:ImCe?_(7Q@u5l4EALn,u/)F-"VN&Md6>J\ h565e3k/U,??WLhQX$ %1.l_F+E+-DSPrC.LL.hP9Lg,<HO6:Kf2b>Yp^Y3,45PtDF5B'a?N`$5%[g`Z=*YmC\p_Ec,nAG24%9E$JM %@uj[:*<1hUQ,i^@b+ %:/"[.eL5b#(.&qkhDS9>!T=BFh2p4K,iQ@K(_+*u`3p/i_'(`7k<2t:%IV3EXM_At!oD %pHS$0k5V(4+QC\PL^etS!"Rd(*jTjSe %Z`6*[Orqb98*6FXEg==#CcLPp(bfs'9q^*E;G&Z_K/O^#iiL`04I;5D@hTi\h/eNP447D.Cp6m! dtLoJaQ*e?&8Togk-?;O"'_k1 %p&NAV.,s,\]u<-)DqWO_A-Y)4=at+OpXb*.>K;RVfE4PAp&'DbHi^Ku<95_&fEV>N2IV<>g4h<? CX6^lHHiK(mVshZhlj`u7mIP%Fq;dak7Z7V?,Y*g[^E/3D<Fr)gY/3#45DQKZjQZEf.=&6Z8F_OC %9b]fbEfI)W_]8eOCg#^IFq9o'2VN^q_ECmksE4>hPQ+CZ[V! %&D.)hhl<ihY-miOMYG%8fr$]GPQ4.PC5p*e#fC+-!0Ja8Ze._QhBLDUH]>8X<7Mn`]k?<u@H(TLi"K,! ApnIW[96`S,%)K2IKWhe %A>*I>0tU^::O<U81=*&(1KF9TEifg*1O(VjAsRufZ%8JNVN! Q4.eBh+rC.W3CnN/)nTB\U(FL=LpMm/E:a7k8&m":]H9qLYYn8Z7 %2@.<^6'kg,RJMJW:9:7XV&CQ:HYPlJ+@'DZJqn<LeL"';_R91:5dAC^b<(rk(`@+\Hn4DHDILcRoMR&2mDJ"n_'@rV 5I>/0K6d[ %i&p$OB4X*VV7Z4R5VY3fcOK%tEC)S$/3F@K$J2_0%IIRRhEO$!7U4^%&VK\lGF8W4`MH%7Pj;MR[VXa! o_n?eG]%BSnnE_%H]r2M %CrOgG2tiQH1Pe<'/[j]-D67+.7SdNL%QM:66ZA.8(aCIb`q+bFlsX"2'j"Yl>.+#5? 5B[pXuFds\@/f'`q#hS8^\.f"oHP032Na$ %C$V=riX%+tqsApYV6)\=P0shp>(TsrKS?2$eu6'g6*4Q`?>/E)DFI]<;]P/^RR(qdYMR! e]8LGbbj#)NHTa"hB-9M?\G4?EERGrJ %Hc!m#mH=)$VB;FL#*_:35OT^Cde@)ZJpKQclEC./.,kLcH4\S4>S=kM0uH!/k/?U+h2/]*p:"9hDs&(f&Uc9qI*0(2tI0!2V*e^ %1qRpHC$jQ8.^lk\2B<CbeSqp&aaQ]qICg2K/kRdP$I>*\rb_k^Y/6/31E=frd;>#mBrRjhZ"4_lO<.*=h[ <&m_XB%-il,[9f7i&S %=a#%r?aXAMl8;q\8t%$4Eql?53Cs+qfO,LT`AXtk'V!a,S6Z<;'d8"l'8i<RPqB)U\ (DdUmG8,Ro0sjZ;o(hS""iHMKOjIs5$!Kq %le"!u3>n3.qRBt3ce^PaRI+gQnX*'qLDALoaCe-[c=P,/M%LUuSSZVHS<s?S6:QL4[3Y9lW7_$NgF[Z6? ^*]kLi^F/,L/Q-U(Cqq %J@F/1]'659/Xm@HHrPp33B>B])^o^WOSF3>$I:tj4aI/<OY:[-o_?Y%XHM)Ak)9u,PF^bS!c528]Yu37U_9kk$;*2Bqe)[g*(=` %o.@U1VugS(XcU95Td32FD@_Vfl]1>D,RsD@!SPp.`5=6i!_`h+[2f!#Oa;-M@SJ@m^Loa$/9%c7! OejKb>3LEYjr9s?dj$9jMH^p %+R.,S*d4FT_C5dj#IuF6FHrRU4OC=MY^Ih<PsOne!9WAoKfud&kXo<?b)G8Gid>?%UoiZ"Ki1%lM+=>jEbgOFD`OW6*_@/>0_sl %HpH"WEcSYqdZ9NsMt`l9\5a_eW00-J&81Cp)EHZeae9(fj*1(>OHj$<Dc$\m<4*HaFi! $e_m@]EhK9"t()B[tSB@)S51@3Kf^4Es %G`=1skk(5NGfM@8%6QscG!:HF)0m*H=H8J8oZHY1n)O#PT.f`.7$^c*Qkj^nJo3W/fqPdbZNI0[=cPi/GM PX4q5E:hjDCcV_pIn? %i[bu%HA"Emn<G6$at_nu6/$BD>L%:"4&[6LH?<(bj? O">2i+au6T7*2J"#sKYW"q1jJ#LjJEC7(Ff9a]3NOLqh@-'`KQ@\^i;aOg %>klG(RTG\4\s,$#<V*@*Eo;aa?&;YU>]RhP,[n7s!(M87R"9.+:%4fqZBU]>*YIqhDfcpK-Y[a5LE`(DH %Mnj(HL>C[L#N!0F=-i %jM2]>1u2f7aR+*05SbRZi@O*8HpRp1K]@aVj=Q7E=G(Gll6Z+ ['*1@7Y,2,Y0JMu3f49>Tm+I'=6b4iss!]pkk0tRe!$W(#hEoA4 %15M8[S%e:^os-^m\l.(\Ca(;g&_?8nE^=lP\CAC$r#_hETMt!>rP0546lN>n7(9]]%Wn5H&Ya*,j! gg4=KVT":Z$b%D:9a0.(;`# %m/CVV_c]XFKtq)9&=Ic&HBM4]9'>kH'V7.b]q0!F@)E;ub9:MTFV[9S53n %.Em,2Y1DW]j(&'"t4ED.YOI?_AbuW1)$%4ac[_',< %MQ1;UmVe9LNBL:%7HJ$-,\)M<$_Ju:)HR5cA/#9\TnGtD=/+e>,:P!CE1C&+K'.Q#S/$u#,.f182PXXr&? s;C%?`XVQ35)X8Kc7_ %akAnEe)knm')!;jl.Ki;OZ0(YSD&SAZ;'WKZ/12)n0hN!Y9a,bK64ar%h_UFYp$FS"W1_s44Tj&! iR*p'hf,h4>_$&fhI(%Eq"], %;Y'p(\`L)JRjU@AO-a&! 8C(jo+0uC4e'rF]=&[\5L]M1W@#;_*G_2e0G+:nMF*\CQIl\&T<m0IeL)h<R*(8AG*_82fP0=oNo>Jfq %2\o$1'&Y:/QGt;e8f101D3N34[b[5e)K3El][;kh\^L['ae[rr'? It<5Y2bk#55@I#.Zshcps4hNI4JA+7E89l1XK"W-_CdbWZg! %>u#U\0b0;@i],)\8LrG-#aWQPbQ;u3[+cb;8It%h&KS)>_+J+5q3CFf=#j@G!4\4PW@-qE>ZdjOB,_o=bf@'%O;UVcnSRWLW47( %%fpAnCsi";gR.Ws!"k)3klo2Cc9Y"DOcoJrF0%j/sYP*$S46pml;9L>V[r^954I(g6iNY3&8p5&KqW6\tY8P@7T/cb:ba2E)_@@ %G6o5%lp62S$sG[<'I>0I71f-B:QM7GbHh7s3BK6QiW,-5p5U^.8fLV7LkM+JoL72&iMLP_51jR#>fV,NYE8*R_B)Epu2d,!oA/T %`I[0>bMA-%]%YeQPbT[Q_[R.ooW'ql7+L=^;t'B1/7f*Xm!nMFn1c"cVilY@D+_MTCN#:j8P_A;XP6XBDbbY`uMGLmMHE]QL_IQ %c %IWq]Sp>3FRia[H[m)QJh"uYF^EDP[/5VQZ[ONu&iZ2rEHIQ/E+>q/LM\f-:.k[;EHKf8gLoVAml<]]cWM1 JV`eZG2k+q!c5OZA %A[8.gGFrHk^R"7p9VK\+?.2*t`&Q*q"hY/WG(h7!C"BP)!3-jlD$*Zh-g[O! AGak8.0QNa4)B#ZWuEA5C3l])4`Pk(8/!LMN2u<% %/'1\4PNYZdj.P%H %=pT9bXf$N>Gj^).*pD9oHSWuSknV7Gu2(,,]I5(DJOHBfO(iZ?'RiIfoa<hUM@s3QDKH$Zn1(BO]60G&>=k %:&s35h/q'9/YChV6m^5]69dbZ^,paE"1OW;1]=N]j_][CS57<5"_Tiu*Tr>.Gqf@[Lcm]V+e/8=iUhR.5[q3+-@m!l+E^i$^U&& %HS>04]VP@beN@DVOdpaV6lL'N,OiWq%8U^V'UU$?b0t=&.A,W#hM&&43p_<o&+"c7[XH%?rf! qKKp4bmI(>EpipD7*SE1u>Mn*u5 %lF4YO<%P^-RFd?pLjVHZZE0R3a(^t:6B9N6EfL;o7P`7H,EUt\cY8+)!t=Ni"3A)"HF %9PEr7[SgLT3<kJMKVDuXma-O'bW(I^@% %eV@bs+Zi6A\?ONg("EIN_Ba)X-"D2nWdIHp/<rZkj!:pRgX:s_?I:.`qB\3l %6(/o\1kXNDPahH(a1FrBp!U'#pmJH'kR7[c?<_+ %=HtT\O9";6I$ujOa:sJcK/8U"`W1,IoM@sl.?2V7Ki/U6.H95HnXOmtDX`"V#&XN4EMGVO)-oY"jtlTb %X/Mg$\lZJF?i5Eh3G+B %/FkF\N7Z]W9<bPP//Y*0i(Ys"P"hQZX*Lo3"K:'8/KDCri*tdoZUkt6?W\l)C!6?W#_b3a#! SkQ;NLoAAfBYCnB;VX8!"d\_qZhZ %&>c)<OLXI2_BS#b`_?*V''tGF_H!<%Gp[M0h %4h0MOpb4:p4nag&WstO^rI)B2%kOFM*g)'iAe:YI]>ub'pOfOolI4Sc2(^G@a!D %OfB2j6)sHnQ^GZYC^)mDrW##=i4hBnP)@J41cXP-IQE!iPlinn2qP=^f/'Vm;8UI=."b<l+ [jMQ*N0l<Nfn:.anpu=OF)P3_0_o%J"[1$/JF2?LqK\`c^8;'+g"D#.l[tf/E^3]ZFVrpY;;f(`,R\'Z&7F3s-TWWO_gG]Jq`=aU98k.4'qUJs(XmLfa6h.G8Kk4IY@! %8Xg("/+mUj;_g#_<>O4cp4TfP+cf3H/o\'X-',%Xj.[l8MRgCH&9s>\,QULQ3q>TjVWth5]*+DMC5kNV_[KZS\jHZ'W>.a'/G_c %D2D23?GN<R8^[*rSA_N2B0u#"b!Kj*@\f>fVY$\6U23KCq1#@p2ZcOKW\pe.O %GZih32+IOHfT.fgXqnQfHtuU[Rm-ke;e#EV."1 %hV@K^d.`kg;B(Y1^HMJS%Q`,'Mf6p*m#Jfl]HKHdV=2-`ZJFX(`VU/^+)$,lcG'=GH5ZSrR(G[mJ4f'mk/haG4^6-HhYG&`t)h7 %muG+E5J+V>55P9=`?k8,\bkg_kVoEd+f'#j:k*kBHh%%FGO:MteNV&UhgVBL]@BrfnUZ0G$"TbGB*FrGBA%Up25(sG5DO0m)/1` %deIEuo^:l0EqeP1"oS9gs8).mG=sakYWDVG0LHII4Hc?'49#n>4cd=j^ %oS6qV/>\B[cpBeNZBhMtVGnm^q<*`AK4SN6A!>S*r#U %cRuD>mZ)bknbj!1l_@Ys#Tm_p]6?bHBBL,_Xo.nMqob$BW9)&17sBHoq='MsG&_SMFSE]?DV% (CSU\<,*F4)HA3JqXG=]+#hTg?6 %84]:K:H-lm$Q@CBfn]0[QTV"Va-Zi'j4Q#l_<hbGQf#n@[."/A/P!j?#"UJ4-Q\=Lo2sptgh) %p#ojtX*c6!)8#P/?k`d#2Megi? %['fe-eG?"(ig6E$^MJ$fms[7m2*[26q2I6+NAUFTW53C_9YY</Y!-1K? +drMn`VnR/qF\N[gE">)ZP99q"Lo@^WMmMrGZgNfWr-& %,)lKoo#&kC4S[._F#Ic]-BC? +SX_Doc?;_@#*,62hb!:KTeU\tC[EaMeqMVb(d6lQe_(NoY2t3n;Z4VTF>IZNUK(L0G8GbA5_/pq %UGVot:\m$gcc=W!8,<"AJaoKM^O>_(.<CZ:rqeW]IJA&pqo.jPKLk-1]/3jfMq'c[e!'0c._e0QZM(VhUsD%s1UAie9KqR[i]g$ %EGjD"*b]hZdf`6hZkc>6,+gn%H/LV<K&>!;h_FBpqE9#qXk)+a.f\lO."SJET<0c'"98>bJ,XD, [p/fkMU*o)rq=TG1%H5alZ^RC %s5E@7m<3if4kX_]lg=5NDYn;(k&&hlD:n]egNKLLe'ld0e'7.Ro_>ebp8@"/T;L(^)G^7147,eO-`8=>_$=mamhqcl/038.4=p: %S]$_2i_LPCRs/qb3SA4,lcnssDYd)\jA"@H:"]6#gN;cKqK..khQ5>pj)nZ%la"h% [#XIVp1q/*hS)#,*hOLG*,gkha2c5cJ%mi_ %VrN"ANr?4Emcq6Pes!\ElZufOm;&]3VAa6KA1?'3htEuH8\aNArGc1k)Im.Ngo!@0U %^\fN+H3gb=UBOFZCe^XtQX4P"I9V'M,O6 %ni!-&PJ#$'I%5!?F3-G?*(a?[.lbupdl*boPI*pIFA.R)T1[6Olm$4h5.T1^D*3e*E>-so37c_PdM? >M0o"m:WP`-`:;]ZUKQT6a %2=qkAaruHUa8cMl0)a@nq@gX6COb\$fs8S0T01f*hNP5!\ZIr9Z7tqmatOk]AbSK`FNMB^itgYf[4__Zln29,G909m4NT>[#R39 %a?Y+Ljr]_BpNPMr7<Y0oNJ.0DQ[_U%pW]darP<50.>"NXXZQ@\ [FZd``^Bra`:kDJk2ng`);qgW6'W@^0**)$(Vg.F!'\2Z"i(aY %&[2[GLql5j9T-a1JH`lQ?r=Z=I<Toa78_.JZqPJ86@2i'UFUlMjFeZL*aa3@G,2MB^+_1]QdPm"I#;k&^,uaUo!.kPi]i8@S*i' %=B6thcbD3+H$Q[1ZG]jU> %URR6q`NY`c>S*Z/f#//3=VRQ6(sFjTbhe"b6`9Q^H^.KJFj=.Bt^M@:C+<bEQD%A<;#36o--Y.H*rl %7u9`-B1b:?P6V<oRZc$^Lo+]>-6soa,: $TP0elDEBhD3#P1gc.^lVlc*PqcT&:PdGKG.`39OEGn6&?\VpcN_1E+AebY5,,f?Gre> %fBMXrIYj2HYKbq3SmBCCX%k>5Z(G<5G3.DBAlkL/e0A)]o^]>(DsHn&\2e>s+#dcB3fuTEhePi69WJU[d?-+lU7oc?YdB9q5R'' %^ph0?#HS$adD^CHTP2]ZA+4;cKoL+2:UoPjj*"G9HG,,!JG%"Qf$+'. (=p]c_+qfZH.fZ#YFo"EXACM4<[cR5Q`-5b%6pTF7`.+d %;K %l)Id\b]b5e"'@Z^bt5s7P'nuO/u7cH",VlVS/aonOIC6L&@U,n_5AEm)lTElmb91kGnJ@XHS/YL5BQ"O/: ?'.p8M(54cnkE/a %]OG2T&kcc$8?G0q29EflSd"@9V[)4!KO%9+W/RDR`^AZ/?GK? EC1YTmOoUuV&A[ff@m;#g8J9"$jPlVYI6su1g+]c<7i2gD3td`B %+e5Nb4_n48i7$r\Q>k%[N!!QsU'DEbI\g&[CFhE?cEtTGf'RRm-$JB`2$9srU1"g@m:0>q %H5+eAkSNM#Y+r)9qhq._QQ#[X+1`= %PSe/&'LXe9$+R,Uc@@l^:TM8]icpHe>$*kf,sYR[5DM&",&ehb!qub'"/c7Z!Q(FR-b(Tr %9s]_$k?!:Ri.Z)1h^C[K0cEqPYp9r %::E4._Y=M(KrC3C-]eF$#u[=9.qZ57//ecE^n:[Z7:Ea#UHqt6L9P:g%0QucNq<Q? &u];7&!'0>aBAcZ$sFg]6YM<a)d)eCP;KX< %dOJB6!-p;(4>`qRq+!\EW(53/TqaqU"ks)ET0SIF2.`-o]G!ZDDc#:EI('Mea,lRO+/$/V3&21ZV %K#/cmoO6is)beL6Z6s"booe %p]tum$lOYS6Gs6_3,)_B;&KQWRm56To;j1_\aXEPVO6P4C"=[j0s1.semr>ah(Xh+R782qBa^4TF5I#Q!!aK(a3#IC"\Z:G(^2' %91"0RUe16T;&uuT[3cp[KQO=J+Xm]6e"e1=5*JG?h7!m,]to('nL;,KclU).+g#]1-o8%a3)?51L@Gtp %DE8,.;ZJ`A8SQA6?W^f %&QGY>S\_Y:c9B$b$I(:VVf8.mZ&Ugk8^Jp,SFT>7Q6VdOCT[gYc^A-]D(=o:>I!^sq)-d\N/(2M$DUS_Ra^2ouZ5WNRN.3kb9,X %92;\$L9!FYIdMao\Io:RWP6%n5Nar$b3,`e3EVJVd@)mdS]8hK\7sd>l<`\Dest77&=Uo!)&AUW6Z(t@/< %VT*]-nWcGsg`4f??+ %gZ'Bkp#f);kLhuhdBG7pn6#)raW`l!?VbuBB^LX.B)7g=<Q)'bSe^dtLj);c.m[0&Ph(#["tnS]IiJg+_ZcScX%Er6-\jBSepq1 %Lik?l)"GEF<B-Op@asNfhS\ng4>Po[0sAg+H=k)Se#SUqbsTB! Cd+;\C+LqSk>HNK>9b0kn_&`M7f51(\Im^nSS6SaNL:#glT;F@ %#!9c9#],2O:P.4Bl\Ws-4::FR^nqtA/!ss8HoG!mc.%5Q4pLO4R%HZm369iR44:+! GcFg'\p5=mAciP"*:l=LpVHb<KKHhn2lda( %lI@Ur`(%#*2XfDYg[WPWAj3\HZccr5kg+B:ZXl.:6%?&XLNJZH$i4p-4ubZGl@T"?O&+e! pNp2qpTf&2qd3;@:le7iEF4#Epgj$^ %mubcidX0YCZg=e3q.rNhK3eAC`j5VVfo+l;r"H7*_[\'[FGI$:3C&?0WK;Mi79FMt5G^-Ih %)lmQ@Zs/iJ5VeF,_4U$SnJRYtq,i %+0R2C7fG9M_h.g@m]a`-$.0S&''rXF**,7GDqsjr)a%iQ3BV`.<-JU3BKRKWjZ!F/bOZa_7!+3U2ch! YO@DJN5OQgY*Ar>ZWm1l? %U!rL'7>8J60V?5m4)DI!+&D+*Wm;*7r9iq2qV.K(+[0AESGk7#n%Ct[Dp2%7h7c-JDp2$L*54[3Dp2%? C]*u_]eMlc"mE:&H=M(q %P`*kIl&?EM6H,?b.Ik&<JrUYu^<? XCq9g=Ng$L.meDgr12XBlsEUh82H@2EXmce^4LA6F;5F<V(0[],\qoMh[\;hZ@eojoOle/[k %i&Z/AdMMSds4Z=Z/Ju^VE0cD! U0G/*"'<#,@b$`iN/Lb`i6(e#`3lPaEmN9#E7OL/r52>&=$>)<7;V:Hri2lBX)Og#e,33Aoi;\% %J"j^C.GcQLm7AWheT9V4m^jj? 8n0.:H:"RE-'d2HfF9*T'8b\bP^(EZ"$5'imWum]`;"nKVP.j2CuHG;q.\HER)dCVUH],"rc<pf %cP!M[D#5BQqX?@TchF^3cb/stHq8WIl(T5kgZBZ! 7Mkam8<)e=g11/^=(BqBAZrl<*ncUpK'Ge.^UtV)I6YdK>-biu^A/c7CWZ9r %qrVt$Y9hp2kCn>qosJ=W]m]K4f %6)PKq2YEDLHYMJQ72;'QL:@nI[^P'h+X.Ac.J[T+sebCM!:oPg>73cF'seDsl)t5#j*XmHYh, %luB//BjFMm0TN?W24DR.WQ4YAOZ/PO>k5-PH".qP==uupQf=? m7l(r+RhL;C,E^:)FjFh;&+tug$\D)UoM^JCbGm4fULHC,nm8sM %<%K,seaL2M`s8aDkJ*VS%iAYHm.igms*`K]8?e?Jq0CStL[AZ$G!DOQm=dZ>:GD3#_#Q@PIOS(&l! gH<]oXVsF>4DQ0B<Eu?&\EZ %(\36K0#f>W0B*9s?&\EZ(\36K*urd?5&_=\K`!,CfAX1ufg1WX9]3gjQbm_QerqLY/NJgU3'L_K!c-i! *iu5%Fd9jmV2tO2rc&2M %GYNL1W1*F51FZ0InhWXI<T9gPLT3pA11qU\6dr(1$(r?>VEJAB14>M$ITC%.d0$eJ)'f %Dp?"M]aKE8TGl;&pLKN6BM"b%fbcI"U %h1s)F0dCFaE8-DB1<nUAASmBI2U^TF)^FBQS<,JNfQ]5[UMAZ"ASf;)[Q^50D)^! WZCC.<]i=m@WJ:@NUnu:UHg])DZ.pDDmdUt6 %GpFIX2n*?uDs_j9Bsl,IIM"+):V=Qn0'X$LaRcS,cp^+Ss) %b"MgAVX0;!]u9;3sV`66a[\oOFEbrdq^q)keH6*5,mcWj3h\c:AV %0);lM^ldmX!\)EIF+P_4$`#`mc3[44s6LH__)]=McjQX/&'bL4dN/Z4h<1;q)4BXe/a]j7=K,Sp4aF %FNi0Ts\u,`j2>&Bn=^/QD %Mp#FrG-1EuDV'7l'7l)9E\D9<Z;"$_,dbaU[PBktcnsJ+ZrLEZu'`E/Pc#F4^c=tWd=@*1'TNgWIZ'"m*h?*Z0HnV>?9I$]jqU2 %C0M#WT.X@rHe1ZU;!5_KVtkJJE7MY&T3cmPIIG=qPo$U1E%O)XQe_.)rfX,069b7?5Nf#6KF9enM] %1DboWB%5l:`Q1[.Dud'/-W %bkEdE%S#9F4OoAD5',"bSa/dE%;Dge: %t0]pGF5Q?'ALdlT"@DBg\*_k9gYJcBCA'S,bUlEjhP&j1XZSZi0+:*U2$9kt-*u:&"NZ %GPXJ,bAW'?%4=$31uR&#GCebrYcHAVHVbb_aM70+q9RsEo,LOgZ0NcL83Gsi?XV_Dl[_&C7! _uH9Hf&]AN_`[XmebB0V6:/^B\@; %>.,`!fFV5tl#tE^1[*7fd+#LTMGP71"$IN=?ejN?WZ+rTqr_YaBA<:)\X!%r5Kd_Mj)j&=G-o)*]&? SsHh+Ea$emhtA8k/\_ktI: %g#b<JjJgn"*?W`ahR5O_>&NOeF'!>k1@hOD75*3^f:!h1=H`ZWY<k9DpecrK%Z-*<&uHbPpR!HZV8MZrb4l:Whs=u\G:A4o/jq/ %)T0(cqs-cprA`KbeO/9LW;5H)cZCH2rqcKXCA2W=]b\GJZrcsiIf5^arL/2KeDk0GKq8krqRdl! P'k;Gf\-(rlb?D[0D9_kIb)8e %*p7lb?h<_noC$&XmpG\TT9(Z)ipu<Z,)-&%]#SIJ=T9e+!hm=TiP_us(/"M^O2)lTdfRdhrAJbrnfsRrhlQ85&rfsa!V,bWQ42! %!W6O%ph-iapWb.6h-oib_d^+sf3'3IQ="i<f_)hnicU$qF*Caa_[Ch>IThfnk? WSZden0.R)QN6pptV1FmI9;esY-l1]KI>B@u>> %`;ML@](^-;):a(U-dB$drS)$sVomK^e4f3Qetn$c[Ap+V2P[0V>eLq&[/M#<Hc$tNk\<An`mE*FkOF=CgLC*Y:c;GQd)SSk!.C%o9uuSV!BmLiMT4#GkiE\65'c6;\i\<(1'oTr^(u0ZY1D`C#? +.hlgbOYA)mtC#;^.A&"7<r3P2ObA#k;gGrWMF1uPTjQeT^a_,UX %kOeP5nBokTSDELScMaC1H]\U39BHBT'H%9C8S5q;O9+om)(M8D'B,:A,5gNKd=:'oL>er&qZ<S:B#UKQn\ BuMbCS+=b_p(@]R;Rj %0p[fXqZ<W>1SZ\N(C:##%44sS*Y866b?Q5[jg.=h0ULKHeV]p2*Nhs:E&_%HO011JiohR? PG'T6"Qn*37b=r8@6(tY%=$\FRT_WG %pPet%3F'Hn>f0]L",7>20OVbJ$PPYc;u.K+3#3j]!ED=cCcra@`0`7rdf[>10V2()FX%kDbj#4-#$` %MA\],%R(8]!U'feU$no4A %(Y)q4kC"iMZ;UVaYG`*ca,9DmC4'Bca%/5![JhtM$.!SI,$!\MN.dMG,d+.%p5b7s**d %7f9ijU6+5pu].Y9acuW>L0Qc:#;!N%H %FQiAl:d<r"j+A4>*(gEM1EM"k>M!FgR:0reeJZT@@>uUY9.R;c-PdKr4a(nS)tjd-26>H7AhsiB, $aG:K7,gk:f_MMirP?Jf$[si %Z(lR4[#S5`r$n=Gjn#O#I[/6_o(c9Ls+SR-G/)Dai#!Rp:gq[?r!b+,-):M1]!eR^'mKlpfB? ogjr>fJ@Fs*lEU5eg=8I=>fdRol %i:E/QC@rYfYCFQ:rA2IjFJsZ&1M,7+_QFS;rV`%"IfAqKU9njgCQ#e=MK,4q0Xi+9CcPljZFBgI8nN9:$:o5#BZNW:4uqE6uOHM %J$se`I3M7WcUrWC%i5m[I9,Y1I^kbe_'c+o58Gl+'"Qg^Wc&? V3FM$#T7cQK(ofQq^KP#i3b[LNk]#Sr3uE5R<sNP!HmM@iJ?qV; %_4[8^Wc9c]%U/^Z^B5el\27TWiR<<S"&:ROm;[TZ*-eH>!A-&'jfe>bA8nJr_+h]=c"HXNZHTrg[`? @L,<,g3,!3=raY+=kEfEl! %?9Z9\:!^'+T+`%M`JM`">=)g``dS*r1mj6^glX<QQnj=T93>d5N@b]7\8Om]',Z? 6f.5og+nl>Srt:D4)<-_<JN[59j0p.IF^Fs: %of`8mN+;]J;dE2-eg]bu<R*0_AeFTkOB!R:hEsKSIQ! >N'>8h3)+B]e`*#O(+#c=@+)kD)IaN04RDYUPN=';;Ac9_<q:S-L#g\T` %A=&onoA<$ClbQO1hM:p$f@,)R[=*c+/)4LjrX/Cl'^cXT)"Ljbs('I*6W,ljSst)L^PUUI:r+`5M,)t3pd_e7fV;e"o@X@9n/sM %Z%fVucVjYTi7#<9_Ijg*FkL`70\f!93utoG59jSu[G%5e2;@!o0_-`nQ/4YY/n. [7o.LP;:h2dd6i`[#R`&66pi.KY+9rWZI8A+. %GPiDuCq[T3_a!mb=KN9!hNZ4+$KeVIoP=D28,]j;Om@D'%g,5H[TL1/oG++ (&H,gbkX;AcT/Z]*$UlUqXZna&q[,Q/<eFbu#FZ0G %mM/2T*W!LN%gsY`oXR:;0$9tLM1cuO]%rrq:UZb[H@,Q&HWTtYJKNZIr7nt9AEuFbX8'5P=4fV)i3))&#/ 0!2IX"raF8)gK+[<95 %ppjgO4u6g>.&Ib8[=DsMELSVkb/[\LPE3WUXl+9J2l/t@V;dn!HnUNSP/$&Rgg>)giWAcc(bl`V4=T3/8aI.,7ZboInUl'k)p\C %C(a[UBO:(e-c`gN`XP-mA7U#Sh/l;NfFcTMPP>uj[r9tt8Fo3.VT0?E %i^rWfq@jdM7Jd(a/^PRfiD,5>fZ5%6.[SV2u<-=p(O-i %F/3ME3^HqX43P]O6*JqDUfVG8Bii(=o:*gmH-qH0g-%0&\aRc&\>?<HZW! q(*9sfk=kV,qDX;T#25.s3<sor!dMRdl3jdq!6TaW& %8XF$<=1sXe=t`6\oHWh"?_AL;f'(Gt\!++6M.PW="7u)9o0c1rKTc<W]dXK_PP+JKp;\/^? $#@U_suIpNo=_bh^"OaoCq+UdG2DY %>AqU/)fkM(XnA!&2e:WFAt<g:kO%NBja>]I?9'Ko\F<\!bgBka@YbS:TYQ-_)kHo+KFB1n"62p>KQ\Cp? sQV(dtC(OTF['7#>;^e %\J=;QS]mi.e+irlpu&m(n!Ki*\t2Jlp\mR`rlT$#LD]Z`*WeUUYjPBme`u)&E%-(5e/ri[f2W67TSg! hpINQFjl(jjn8(65M&f[: %*J-/or#YT5;aGee9i"D$R$PI5VKi(^(H7\m]@H/,4%SJ\-hKCK-KR*L! +M+P[b]01p$=`JMgDc-\p#`s[BOa2_rMdBl;?u8c[T%\ %0d8f#eq@s5KM0qFR21^[L?"2<>Y7;ps*EN.E6gb4m^_N;4m@'m(H=#5jj3XHM&nnCCp00i/aTmccgL<F#7 L?,\^n@^U;$/`e2W+? %W`GQFg0$AIi7$=^b&:0N3j_:]9AMaBX854! PVl[sa/lrGHp0r,jbC+>:.UXXCHJIU"N@<L]6h`0pSk/k)n*T7Ckj+=/IlR/B8aF, %<=ZV\(\J'i5kGH3&QQ;Pc!K)1&><i:dd^LIa*Lb"37pRWVI-B*B? abWFj_f*AU9>SQYH/>`9Qk8(^QXMh^H=3Ztn-n2MC,\X,a?3 %FK*TCH7\De(ggut`Q8j,Q_.X7UYEBr%[YufDL= %/jkD`lIe)F)H1Y8N(\P:ei&Z>d76SfLMnQ(0qd06!?.@m^[f!>bURM,lS`0,' %-^,hL-G@LnPFcslk;o+#YNp:kiHk$X1L>EUmIBF(2E_L1)RQif3Z2XAXG9+AK'! 5b$^qhf/8/)2V^,:Dbt6n/d#]MBO]Vhq)POD1 %KLI9T>cf/%0gm=b0o8aqK)#.$-Lm=!:@F0585/%1Rhh8+a!HJ]`3:E2@M9NJQu;o_(^6WJljT %JKu>Gd=s<En@2i<VpQ>WZAi&'t %0lC*I4!&5E/%hk5[Y<DC7bo'(b]qmNLn1cM.E\9!'s$W4/@oC$&J&]c&LX^U,\7&q/n) %p>bC;)Z4i7TCcF&Qer=7H\ZBh9KWhk' %eA7[J8pZmmgAIW+3?DK/'-%nWfO/ASnOD."RfLpp%[a2HpRME=cBrq#l$:HmqVe'cH%An%7hY? gV9KD=MjNbqVsA>G,4&\;m%<`P %Almj$demjL9#k##?%26_HWQ- n:le7R:YYTlagM.`5(DVTos7GKSoRM@I=&i^j_$u#M,Slc\^1u*>n2]JLbo3<NSN7#!54+F7\5-W %r;cUIUf6pfQj:Fns2"8e)O:&+l)U)!U=*t^(;8AjR4S3aiqQYFH+e>9XJKH8OeWj&+X_']1K&@CHbqp(<Dr"j>7_*Jm1TMbCWoq %D-L5rJlok+<dNDOmD1d5JF:F/.AJ_gq'NR3$D37iC#6Rlm(/R%F1Z@Kk(B-Lq/l5A]bWiSDfTr\n? G3]p$mj_AMc6(`dS]8fOktq %C-D/2q8ZAsOK8%'%-.>O%p!0]rUm;+PRg#p#p/sTfk6uT0O^mk.88^+&".julnd*&F9l(Ik6i, [p0k<=V7k@qK%:R1p0k?6XhR3/ %s7;Vq4Y<O!q)*%%N9kKh!,e?^=FE6sUG&Bujb) +U6qBMenhAV\L=g*+<dO5TLI"+'9nTYq9+\1aaf8lqQpREG3?AgV0&oLhUNJFj %S.Vsd`4iBia)742d/,fjn)8S0$hEMOLn%^Q#Zm)$HtI?lJ,XD,\,6'QqXX"N%g_W!5/3s&^8;9%,@.NX\] +O?dkCFAH=$?FHg7Tk %RpY&Xs7Z0GqX3A>qh'MUMN>MtqrZN!q7@d,rV#UGDKgG%fRNgK52P^.^S<h3JGeGg/ +8<Kq+p;K&'"D7/]R$sV#U"\N;LB=rVoBa %Ip0hAY?#$1YAX#nli##qnGU_a<Vsk.IY!Q^qp@p:o#7sfJ%Xo]J#DWBLSs'DhAUYrs31E4Yb]gAW*8Ph? [aJSN:\jtGnp6cN*T_/ %+ns9+kM-)d9[u^+*&WW)+'6@Xgf$-aY,k4:efEXf4aRm0E1b]r(a)oX?t16#`? 2Y^nX/'mpI;6<etU]2"6Md:"(%Gr"?-1u=q.m; %"6MhcJ3u79n?@R5>8ohsLc('RYqX82l'M\Y).7*<iY$fX2]D;7+iZVegf6^$>@VP/RJ[=Eh&aqMeSI)? d8nq(%I67:L-:Mh\@o9g %`],"4J/eF6<k8aPNI#Nif%?G8(52-mTdMXe6"'g<*e^p>"umXpJ0%V%RuVbZ^S.b=? l5]IRN\^s^7,UZKE_=%fE5N`ePNjeHWUe" %[OduP26YA;rZcOPpY]Yr@lg&-+6Z33_K? %kZ);RJs05TlmHLh[%,m8Ughk\\e9chV0fSe\?'?]f(sd:.KaEEW&CtS5i,m0FL.LuT %3p)"+7\f4g$tRS*B)"FK#5nfpAi+*q)cjaX%:a4lrr(SM'r`I5<M1tffZi+"c,]9*cbAT7_9jW2$;t@;n;1c/6C68Q/#2#/0DF; %G3e57fo8PKhrp)"<ooko*G=h4FT+Rt4I,F6J?)7K6hd?g%KlOp/K]7=UZ5:u4:>nLoC<; [E/q154mQbJ2<Mg)#=&7@Si!eq4jV5) %ohH"JYB&&0TB%>[F>O3b)qadm4=lL^<Y%?R\+bZ+mt,u1f\+ct_J>9$5&)3N3qR. [+WU2%1tdSGEepf'<.c--n$@4n>pY.<TkK/M %OCq<oGQ%FQbr_iU)PE&1.s-KLqCq^tm=!36>pMj1fV"P\_pWg691P2Bl2F;;)`'7Lm=7C0'0a?).ZS<oHV`jWUU<D.uT1fMh)(1 %aMum0f]-p6Dr]h4Z7"TI,\Z<[gtp(>_!;n`V5t_!1+cP8QLm2I5.8dj*ubt0L %IbOTAb]V[edp43jKo4J*lk&RB9<+7>il<VgY.1 %XVL-nac^isL&K>-#[3ofR6'TSmb[t+=sto-`MCmBZ>TA#NtJ*$.an*>(hu`kTnm8$3`<ON@_Dbn)G7oXj@?hj8?-cn9I\oX\aku %_p+:khWHVU>+(PYXg?HcI<:&U"%*n[Om3s3UR)'*.sjA=LHh/_7&#I"N/-UEF:Tuh;! [)B_8H0DEBHE8CQ&ApRCMa3_Fpt,Tg_a' %PM>PSSq+Hgb-DSYhuN#TO1_]S%9=mXT7K%6db"HD@h`[3N+ZCpi7-!Hk:s-J1<&FD#V%_#I@_! =.oaZJi:OD+H_8@>B8)>3OQ?"] %h>]TG/lnq+5ZcX+Kmkl8Ot*.q)J#%[VWuR@MF0qFlU! t<[)DYukJQY"gqj)od)0]jP>$`pBPd[93[`.Y7TN'-^%7Ui#FRON85no& %KtJ.`.c_eN#X;Qbqk$G%FIbUn'mB5^Jh^53b5>`tLV@[Hh$O7`>U6*XnVj":hIg2PCGkWmKc(h!ANcHDuQ0o0c2jT6;e,1:W/bc %E<+):q<(-a:=_n:clE<d4VPn/b\llj+ [jDN6(?'7@4hH#<]LN/fLP$SNCu+JnoU/eT5LfU5G$b;I1)$Sp]/:Gp4Q5%*gqhN'$Bng %&IY^9/u^ced]JPe0.Cn%WKYo(Fap6BqW+&ON!o<p;E,W?ZuFIkRKn*^@o?[Z]nbXR;oc47V)VH#l_d(6LD&ecjGW7GJo0Kd)@;3 %9$eq/)O2^:dLel/Wb5noiM81_7Mgs6H-@?.Kc'q^a1$7?([#uY2qM]O5H]HdntWmMj4i<E^%\S&? XDWlrZ:h6cg#.MmOnP(m#F-# %_VOT4:HiaJT?HuhG!E#l?QFQ?GC+?.rI3djZb*P`_sqqXSUGjq_hdY@r"7R#T#ah!nMX6lr3^kM]dJ1?\! m*A#k\k</`LSpW%%kV %O9iD_h%Y[-8>S*Z&haLQ)V;;NlYsE:O_E,kd``g3kpm>E@TL8meVN0U<'X\HQ7A7=AHfFHW(m!(TK`d)P`CEO_ob_1p(D%gmrN8 %`ZThGfKO`Oh^ALjiGsB:!*2'KC]iX`!!:!J`$k^hf`\Drr5SpoJ+R(Q!B^JS!K@M['CfO0Tf&41L%,) [<1A9XI3^<l&0,KW9hakD %5:KBt5iM'n0%g)YIiV)[FDalH5F%>Li^g7OAhR`bkTrHG*>qqScPD3TBk:EUae>RH>*kH80csH %Pa1'#TD^^(lijtB@FP[]..F@# %&@q7(Yosi4GO./,#j[BO-"6'71p(GFggs6EemosaDlY^Ep>6_@^qasSkZ^b2QkZYKbb:^Qg1H`K2VfNM0_NX2kF!U6L/[IRS;Ql %kY8Brs39Lcphu\_]bO;h3E5L23^nF"$>qc$Bn[5=\)rYF_1L">VuM`b5! ^dphG#`^$7?,8J.L.Rb45k&@gr=CVA5iO5nh]/N;M.) %U"Rop3cP,J2>g.`8[V;mI,a+5DTH]VAc_M3@#lf0PF>Nc>u$h)HtgYcHhLeO! IV2A&#UP7Q\h.A2c,>e+=<,C9m-;(74p.*FZE_/ %)H?+P<7.>fr*,s!F1P$N_$VRbh:rHL8hf_ZUo"l%&DW^Mt3,I^JRl_^WV9EXDidM#/r;GR"&aHd0_6,hUZ(.$M0&Q23>](rP8I3 %j7W/5]+pq:I`E=PZ]Z&Sfl7E_c'%[iSjX],W/RF!>"jEfl\pUaFpfD[`uu>HXlR%m/<? <4&+h@&0]">IPAW$nq^';<K'!c2#*=K1 %;]f`IqmV<Ur2b+$>H=CpI.]/mo6GlceaD5sh;4`/n'8(;? X6nD[$Q[/d##\7*&=.=7rZYh6]a:e2dM*7]A@1k?B*+7kGC1tSi/%( %[U1TXf2g+Y5BLk5l_,qU%X43qUf,XH#]pS_XIRU8>$(bRgO5/=o;KHR`tH5S1)*%=o)W!_aqM:% %4eT"KfC`eX&@OCX_dW70)G:D %G05(\8/<8d6_&X+T]a5uT!LC#T+?9Ufj@]GB2UjJ(<\<XH9#@<l<9FYV\]Wn`V^F(aif8@!"U];3k=baB_$q'E/TL&P5fZ*q!b( %:ft:_N3Y,'bf\5U$LsYKi6mJ*[-h3hN-l+qX*XlVeEPE! 3S7T"QC/<#N+iI+EL7L3A'E<^k#BD(ZGORLqc:T1`MXKt2rnm4/n=-f %<DCDOg#DQeMA*<;\I:d>3P_d==p<jK;V<8$-\Zf0Ttcc/J87fRLEqe3Z6aN0Q[SUO=9icX7=mp,2f4u3U:ZGUOc;ie2*d4AK4?S %HW2nu]]V^uJ,A9ng""&'Q58jop?bgi;V$-Ar$NfbEF1J1lZNQr7O_7I[1Pc.IsibXPl/P*VZB*EK:<+9lEZKEJJ16Np9phd#]uu %9JEaTDf:=Fi")U!hU=K51O@3R>>612njBKb*n"Ime/tQ,>3L#ig2Wai1*cqkT9UiILY`U\rF %b;LHr*MQ3ZsC;`8Lbo%j09j+e^[ %?U+G\mS>A36rO$IfMZaK5QC;P[r4IESZ_96V?rh7Pb-G2a.+2[?S:Jf:eH?6/;-mr(\;YP=k$*TGOk#[(_!I@JpD*q0q1%JACF: %fa_EPdN3k40<@!@ZC\<78Wmc\7\m^oq02QM#X:C97T<H(*d%7NXk1VVk9$mVGB7t_b#<-t:[j.DM! +m=O9DYk@0RW^mA7IV2;<XD %Vo6[O1N>(IMo/hs0GT`U;DD. %;BuF+FInJ7cm<r[4#Y8SJPr=mJS/:4;T[GM6;EHm(o23=ZoePZojM,B["mL^D$7h(aCJom,Od<T %m@i"f]#3Ct<Z#T"_Ao(@N:XK4*b;nd1[:YCTkN9/`M/'V)p*dd7lPND"o=.\.ZL.cCl4/LYc7`G8?ue\s4ji[ZM)9l>t@8HV]:M %ZlY;n,aE.:=uchk4_,AGC2!'W"5GU9R9&?4gQSSXb[oPqZ@uQs*o-2OCQu0-P/`F]hOU57+6#JTu=V8MN&Nh"*t1ICN$ %Xp#"\77[I/U%kEp\[1FH+RO>^bu;\e?BObrI3tFW$J*,eq(KHoq9XmLNLkHj]sL]/\8Z;3gr5Oq,LY*q^9KH['G5GXg0IsY)!([ %ckh=H)KjCS*>rMBC/lO8#lPBkejA7BK=W//VXKL">fnhULihBbPYo(/VS4H2#,F)b&Tf`r@1+rgC/<ZYd1&E>7RHjDKTVQPNoU_ %hA9P7HSI>c.%5r&)PE7u!+Zj;TrZ_)$JXWi[E=T;g+-El! tY3'_,2bE+]@OZ^fH&\;@0U"BI&$G[n3:'TmYS;Mt7:]M#52O+<[kh %4>t.I.2cS'KMYlUJkn[7@ZF/L(ICLLgp&oV=i=$nLNK>nC*B^?+sn[+[N6pRRA)g.L<$uP$\Ui? 9GCAQN,Eo-MfX787IJk&iXpLX %LoXQ]SJ6jPE9_-<PDX]j?tY1AY8rR5#F1J_YN8pMfHV3EFmE+%"*j&J+osfoTIr^4=fha&4U*ag?,IT<A<806\*>Y6s#"b]1G:a %[^+1@o>q;B9U<-<,tg]>U^*,<F##)J!e[kc`W.J;@uZRZlQA)ZW`<.,Ss6qJ,3b8! kb7I.,'iGfPq"NQWoJtbL^O(6#@5bMdUH=l %k_eVpYoaP/ABP*hN#>[AgU6*n>m]5AO34S?dlBRLn2=b5B:WAGBboDgZ9mD]UlVMW? Jo&/UE5kqSr>:;X,P:tg"%_[JZfaUcGo?! %We_i6<cp_Y,X^'<h^nWC*2@raN9r^Ec($k63:"fN+F&!k6)DQ:5hae(^QY!r]K+ %c#t;14fk$5.8/+6nD'fq=>qmWLM&MS?0$q,8 %!o5);W'HD_Ao+Q$Lg<,q`Z^%"RD$Eu*jcJ?+b\]uh[_k\he@?\:)ZiH.UBY17T0f&b>\ [M6L+[39\EDLR;-"B+S<$?U)$c<>nFC_ %cn)t`U;[,)Q9!P9VJFRE.'`J5lTRp8-eqhD`4K-IDA:OE8N %I/qL`P;"KF6^Vtri:aqi#eY4e<Djl#nFl[V#KI:G]t=B[qX2A_R_ %-o)s7Bos=DApEq,"QZi.eI:u!IWWi"ZUR<I:s2[8n][E4`HMc<!e;M<aeEPFB/@b3JNk6lMpIKl6sD? aV5mYN"_VW:SK`Z$fYLco %*l<p_<emp,<nA50D6ofss2F/Vc"j2'"n0>_6P;Ij(@[$C2keFgr"fI<>4pB&Ep9(XcMHDW"(@H4XYt$qZ_P^C?=_;:bN+^@H\G3 %T;&bHk)ckjM-jCB2UiECfr(XZ2Gma[H)8Bo3Z0Y0;9cF=[(]`*e6o;&#^f`<3]!j8)@`AP^I_W&CB5pM[g0e8OeAc0+"/H.4sm\ %eB6#Q._Xa]$B\@3c[p(0H[n(oQ=)9G1ZT\N=ugaH@s"\[RrNsGW?VV@5VKgd?cNnF(3[uFS(JQG+d9! r-'>O44N53(BZ_"tFVK#) %AP$XRTN:oioJ?_ik>DtaF_#t,2<qG\d@f6nc9u6`! Pl;CU"bZt'/>;4Li&(#`$oW+e0ef`6_a0ikb2dX858Y/m$r+@@?tJ(A0?T% %O%RP6U`>.!Rs8mQH&u:].DmWprH`HaZlW[j4a1@>BC*/dWp8-jR! %;leATsu]B.a/@T<RsDD(+gX+6YdJEse.L)s5kj:0/VKCTL# %"ka5-,2C$nC\-:Y3N\nk4G:fP3&5oF;0F%_0W&<Z68sLlH!%`k\KZ[jb.9^3'*C_d5WEFZ$H'j<.h"1! ZJog+SZ+nACBaEliFuA! %YD%DR@:CjKHpDkP62+jFQ*Ek('.%C%Vm'#-Z-eW92&JArf#)0Le06D74PB9RfV5JQ5!D<q% (<0Wb:VH+KF^odF$Kc:DhZj&XK$@e %leK^270]k4%:!4u'.U&R2f/e[GjSmtqj_pY4CiE&Qu&n2HCY^A$7<TeRWW8Q#kiNL0n]C_SL\T=jT4nF"hm6USY9!ZW.i'*S_2Y %&$2mj%qS!Q/TfMGP0_eg4(iT:2THSupIPT*P5#dh:,X=)&E0mX_AnN1CFDos+GHqbS %A3G\&A$s^`4M:Up-sH/#a^P@cN'c\M+XZ %9c%j0-YN,+lq%:sO$"A>=,]71<1\G(nt9_r5K%$hlu4;`Gl<>>a26.R*\Vl^V6HE#V'r+S%*^fe\`Rs %e^@-&hjaDC6`4Z`mqX(" %Y34$,G\+i@1;/JV("l\s.J,YkR(:(\2:OV,pDb^e=UdiQ*fD8)%EQqu4>mKbP[*f%G8d)@TlNZ5mm@gdXR]<fK3;-%EWT8eC\Li %h+GS[;M\`2`d4k6Pm/;;0K/Q"1&KF0![tdOTi\g9*b;3VbuMt#6OU6rfQ*UC_(7'N4\j? Yk*q(no\E'i=2PgO`FVst@=N1_);.YE %8*C7&RRn%GW_M="-G,0l7U1r'0OK0/&e%N;G3EXKF2B]t09+o/QT$ha*/o#B?CV %XCd..N7-.g1hK8)9>]HFCVJI#9Mla3_>6%9J %\&\<7>.;s8qulA&i1eFPY0>m^bo=\)nV^uc[2&C`0_`Y;5;/":23,%M[Y/1e2)Ht"'R,u[RdZX=J=8>1b( W8+=WGV2<+kXW-o+N^ %`m1)r*8Zj9_6bl$'D'T-oUgB,H#b>$ABU),X,a['DegG!fVXG;Ab7$6,,&r_]'*?e$kOoK]j3tZY %o'QQ5C5!VutVPV-M7M.a6"& %6HZ<n5W(B8$\KCE8Cag1-tsMt2lc<Wrc8gp\b2t">jWY<n/]<HVQj% (lW^#Sm<9P/A"F(r9_`l"c.BlDW$Vg1MbmjEX7bDpN&+1m %C6m^9-bFl8#GO3DTF9.P#_W#YW'4"2N>,81235jATLGER<+thd/#/i,G'sbm`aJq$($EOSPP0D\pL5o! 1'.)#r6RLG9fZUJ:BU!W %=;ckT(3W.E^tY=PS_7bZ6+)_)+Rd9q(IYJU0:o&TMBZM&T%-n$_O>"1<0h]7=S\Vf2gjs^A'=smr;rliWi!,[GtReA$+Lp3TJUV %A#Zk>.S!j^N6Us`,q_uIWL?>W_]_31XBE6tlE];(,&RZpmQjfiRT<9]II6*?U1$&c %j;cbG$1'FMIWs9s.,*-n;.MG/?"IGRmh&f %%@a4UY\%F7UnjHeKb1,f8FmAmENRNUeS$*P.V.5-G!U1$<7a0c7l2]RoNa3JOk<.rbs_3`b1H@$+J4,nUFuk]5,7I`b(@Ediq)X %g".oUTK3562qGkXNaX*cHHseQ\=$&+IZ`b*&oUoAnrFR&r8*gJl(%:WTQr?f(07>em/ (HZ3(p_9^GM2blXQ=m(&8u\P'ur@:u1+_ %8m0\o"X,j9G1fK.cLcR=+!YG:0V*Gp0j=8>B[YA(BROkXUPsRk1tea<gs7AQpCbrDG1)k4R#dtGm.mKu? 72-V=a'=+Gn%3LVX2lS %3#MBb]PUVKRW"jP-35U.8=I(>0$[Wifeb7m[>3$I\"aE?NppdLDt0mY?M7[I@]D:RKrML#X!Umjho61+.s*;2Dfh$Ke8dN:!qNZ %)0ntF6`=N#"Hs41%!<88*]^[V6Z[L!nIG7u-efF6k! P=RGX&eaH:p0XSh5o'RAJ\k\oa\bh^BIl?'\Nejc)iIljSTnS*))sGEACr %>I)2?-W+kt^3.uj\_#P?2mF&K1bUo^Ja.(X:/XUZ(-+W'E56(U>`qGK\?]h][;.r#QFmlJ0i@/(! Z&biLdL\`6t(bN#IV]F3JH:& %FY+\cj/=`cg@BoU(S`gRQA6jIp7?OiAA^7dB(?u(k.H]5:]8/]`tB,#^rarFd.,A#:p[!X7EN\cPX6(! rBbZ,_TFqJT2_"2=e'o? %abgRaIUgQW*k_2Gc7,L1"BqZ]Pn3\K*cb-c3N#4oM\=#3DR#*Cj@&)^2IBR)K,CDjiF? c8Y:b0=T12GCqWt/^AFm-2Gb#1/1V*$C %M8K<Ms)CR^_4Z03&q]YN_'(k^i8/+905_@K6"g9(Z5'OD4IbF)6Q-I^lHOb%^6C;=l/j? 1W4AXB'NX[WJbICU7Wgb%n;RY&@>D/F %_HsY=`]2B`e7ahD`=ou;(4J/l(D`/Vgo^tMML`NC@gO`"S?8kGXP?Vi$@X"^2t>K;_fIfTd %kC`DRK8X(S;@G1.<A.e?!^hf#$O= %$S%[XC0k,/,B0K@ZsdN-6aRCe2)X'_&f-a\j#cN<k8m;7J>KC8U##Gp$SPM^C0l'@[AAt\GiXY2M*nd3nZW]6C*&B-'_KJco-9) %RG'\=3AP>Oc-+T`?\%-oY>[`?bD_5Xp%k!@&I)t#2e$\T'+0XV<]+E&UHJ8Q %o1\Ao/h&bf<QQG`$Sf+D]&V*cmj@p;lQ4;(Ecd6 %U&*nFclT-uM\[iZNf+q_/%V0?mj6^a`^!WdoM@DQNGt)fa/'rp?Y!c/% +oB(FM6cWU3t=41ceEK92=3h6KV2pm$a6.F6gW$,&nM* %6fF,Kb$5j=6OK#qM="K<RgUUKhZ,fAG3>M;EM:M=_;!C"RSl!h;c<fqkgb? G(1'9M8(@CtF_a.ijq199'WjJk9lnc[aOZ3tlp`#V %(=T3kIJ+/pU?,`QF:O!V<6`"KFq?YO8_R\ %KOs..i+CbWKl.N]:SoZ>G=ZKejlCX1^OYlM<I;539K=<qN0\OneY.3#k[cf4-r@+B %34^pG-&Tr*+7CiJ4^9;1rH[(!KoTZtKG>146fMo!P6DGWZoCsU3ZCHDG+q"MfmtNI@_EQ7gQ[+6H6*,P*[5Y^+TfJW9Ie"\L[Q? %nfdl858:,_q)INNq#[@rB%NE[q*]H9/M3*Uk9tFm_Rm)t(>gM[9Eo[0Bb.plbA`i;k8EC3fTEa/HEX\ +8/27Pr%b-q2;5E>k8)dG %7:?^)BP*_0&@;ZI@Ss#KC9^IB1U0LgRrm14ZRSS)Z`\7#_0)/LE'gbHk`^j%T1da %McsUd8n^1NjiRdjn9uhn/Q+i[CpcU[P6]W/ %Lk8n]IG:d$IK'9%]hP\I3H$6&2c0OJ-3:]1<40G)P#:snAnR@D%:msBY%,A*NuKe>(\#2cHH:l+p025/]Tdf"9hcTjjhqF.#R"C %]@hMmE1g#=(Js:`_,$c(GlTN+]\rrdi %R'R\r#os0=0na1^1tYcu3G9S(fs,,s\X00\.p]E4)Z6]@fjs)QkD9lV)1-B2G0^/#H+! %NFTXpD@M]_aA7;,4^i3u@0o2\R:qte2aTn2V9KSL\SB<"-#1Q"JLttUe'G)G#C/<=N(bBXOGUgG`? QQ]fF6o9K+R(l=r8DVGY>`Q %>GRb8e>L,u=;HI*PIRGcg0%6764s?dd/"BO;D\U*6VO"X#qC&&aEjU;agB8. (K!/)B3$"&h)m`A`XnF/=P$8B0srV=)nCPa7-?O$ %>!H;WCMr)[b.>;,:.J?i&/7.iC8MI#Q#G!`q7BWXEEB#KXDDmUi44T7]upZ8rA(U&;_G<Egi! *Q`WQ@Q]_a34juW3/<cj@)Hu/Lq %<!ijXY5`Q=nZFXWhDG1;RF8FZ19(3M4Y_NV2V?N;IF`+#E)Tq:cs^a.iS3Nh+?sO&59!,Pg)+GZE? +YWHYP_R]Ip_,I%TS)I^83I %,Wo2ZKMFU#JTa! K>',;1h&m;>;u$YiM5J4k+6,*Ccc0iTY)OgReGD"GBBH;8%t6Rl'=@VcBDDU8igEB+j;? 4"J+h=V$73fg=R4+: %Z><YT@7YRG7gLs5JET2V@dFFU'Y %jB4kRr8PYhrEA5.b$AXKLR+3Jo;\V=8:I,X[W`C/B[6K)q+3`MKN#fbk2qkOL!X,"5"opU9\ %Sh6\=BEJb(B:4c;F9',B$+9Y6/c&jSRWU(M8a-2Y0A/EbMhb>=)bY8LEA] (0o06W^]>Zb1pf3OO(/l2Rf+BLVl"WSfk,fS#WOLTn %Y&[&B]91tK[[5-YEJ*?@PDU+ld'@SIeu&OfGif8KQMDg,mj;3nKObdAPJZ^/0Ap73:\ig6:]S4? *Xa]dYd5Kqg[kt\#8CqtYe,e, %;C=q:R4!]>`%q$pkpjZe6m&7$+HHGf#u6["cU]R$;"3@LkTC0Gbq0*<:M]6Q_\WtmGM>E7c,! D57O2U=r0%]a5*ii!JqRYo"-\Be %/ur;\&<:Od'fsHk</S.X,M1^`#c;"!Lka2W_6&MB)Gk_g;=Y-E%N!eF2O@VIK>Fd1S5#I/ZU2$F(A]Xh&:,VB^""E\Pa"q^F9'% %[a>E.?RqKuXm0$a]pU^3L3$g3GB$`ZL"?Z:KC(K?PneG(onha9)&LDN;kN$[h59m6'rP/Y:rguaPK/C\ %l:skc9lf^C[?>u@*S;0 %`?OLKg=HHD*Uq!h@,&gq<15u@$Jq[?c_!/j?k`q&jm,pU3>`AU:R\8d$n!#t<c,! jkVg:_[X:8qg)t?\,m5-=0uJmg6>lgl+[k?t %8Y=/4jd\d=5.NsACO?kHT/M*Q-.NrUgoQ'jf0"g?,Z9#KS,qa(9GsW^? %CJ_;VjJ9g.4g8jp^c`H8fWC-:80FqN4^Mbt0KQj#)o0 %K<*ZV`3[Xj2)E$d93@K>M=^:4jC.\c\NeQU,^P*t4)b54=")1<*Rd:CSQQ#gD_=blq! $2(m\V2X2/dB[:bupfXrnG1[a@O^lsM?^ %&E)VX5]n=^*NnmiT:!E.@I'EK4WtW`,XKtrUef_:A1D.aBb)n&Th4.`U+<RP-FF=k]5G;p=q#q>pdCPF0\ k/mp(oM`$Gq``<LTXZ %5Md"`7GmYB/i;9d:F!EW(TG"pDa94/>NKaAS<f/Y"JsF%Zc-D`1[to5AXRl^Yf&4@"CCbl*__>G`A\s! _W.eXeq7/FFFr5T$&6>& %@N1h:?Sdp;mX@*_@3cM5d0WV+!k<Pn%Wb>&dO-u(Ek*&@RctC.X)?$2F:! B>`j$<Ekf(>VNE=Isp4*jm;t;1Yc/euh94$W$[ZKlK %,gGT7n+1_#i_WQh/mbE6-`k*]/E\D3['A)O:"U9>\[$M(FO$=tAjEskrm56;3I; [ZH5`HeX@dF(]f*c2=8nWN+pm%]M&-4I:UFMa %\,\\#Fh*YfE1WBmBK"6G=?N]:Zt^9Hr:GaFChX!1&-f5e?jTRH5H9o*$Zbq\4?T;f)V6Mi)N8Kb9T)HheJ'R8_O9phsdIuRIkm? %pS#.V5P/;W>)4MFGr6.lFjhHX9',fh`&5Xa0mNZE1^N20H$\4W@UZH89T1XQUN>V`e;>HZhV)36n<o7O^o5G88T,hlu>3#nN9b) %OGFCCfof4NCoY8_QY1E>,qltCHLqAS;.Ci^J9O0N(*Vo'r?1,HO&p8MjM'V"CNsV;iYK/ %UX$/ohdbG[e#*N+Z$T',7*P_tn[NV! %Lk`-PZ'\4)FEPD_O:k@\l$?%45b1Xg&P^>QcV2H]5Y!_0HW/iqZe?>Nno0A+RPg-/;of. +c@&:Lp'JskPr/bLJWaHAl^\a6S*&su %?[@)83YQ>8'/cu-&Pb$#kdj6tP?&eo'\0<nTUK$k+sGe8gbhn<? 1(@/gQoU2AU6nUQa@F.3Z@B>^`C5G/_Y.)%KLC`d*hnC.]AZF %69"RKd;P#KX^Q2<$8."?*fA&I,g!$gJoNS:USr)h'dZeP6d#LsXp;YKW(uRYA6:m(NI,r]o`2nn:ks, +ChATf>_T</llN?rVOq_J %\u99mQAH"JAT5tcYY*OT[YtRWd<RA>-'m2!aG6t7]&Wm8FIG<Vq#A3sDJNK]WlESQh8?*)TQrqNI! `8?]3e/DE*@`-R-uG=aJPos %]\W!'qL5S]Z8mL-Sc!L9@*EN;;NV@[jc\d_)hn%2RpJ!G?[%LPlI>%!X6N87i,&cbh>Z-;d+#M: (YDMA*[U10c(&j#W]^FU0[J'/ %NfL$^*9sb:kX'XE)DM:/A(.?l/NU@C's^Kc;6uo*Q6ZsUdP0glMN@kqWu2u?h? $e9i`^k+^B;igkGemR+1?j\G3):]Wst+h]u39L %HEEU.=a'VGXf0sJ`@Q+HD,m(Tnr81YQ[r10<mD[_pWC^UAHcGMlss,HIeIJp5%7Nq'OZ9T2<4[ke0D$4R3 ut[fUPl_Rl5S@LZ1'3 %J;G2UajI'@<\0t_PC=EJ%W)YtKX`?=DN)^Plqkj.=l`''!aYkq8%n-Rili4Og!$",N+eaL)31e: $K*\`[M9`(jTNiM7dUEq!_;+o %NXIU*lE7(O:L5_\__+j(e](?gPXb$@jt#8hA16Is30o8H!40W)C'J1t]$/j! lgE_.>IdBp=9RYr.nRP[<fD.*E0]\'f+tEkj5$^C %ZMK^O+o.B9&p>7^hI#ntq_YhEEE'DJ!b%Z`p/D,^<J(B_m8ALHtJ;R&bMOZ4IGb_IEOFl2uJ7EZAG+6;e`9N9<n=06DY`O-1RXd %H<4s%9DXbYi)OJB>sbOmg*70Z>&rFaft4Q@'pF?_A8^CelE%eiPF&B$ $o@^B#Bi]jV(ZXb33b8SX0_s99W@10QGKlj\pOh;j.>HQ %Bura?Me.;;BGLnJ@'qTe?\gNdpR1-=AWU,M*Wb]Xmb2fJD6^D-\K1?EK-WZh2<hT_'f]sU;EBM! H@j>9"m+PKMclih=ZV):!`ic% %;U2t-9.dcO[4Q&P\IB4kOK,uoVP%82mXaH:L^#"BXso@;:#L_?#46E/2oN:e7K8E62j`YAEJKEH/rX! i9,j=RoCD`/%@`$d$&60@ %b4L:@m%IT_11k9G5SGkAE?\R[=kWK50B7-I4B'&OH'P^#qGD%]nh&IL#F %Q4PCCV=4g6:e<`>7VmEHt*AullGNbE?t`L/hVOe44j %Tk6VFf>kg>nR_2*/X&c#E^+t7%A^tCi!n1>asMP`/<-AtoNTo&D:hoj-G@b?G'pMWY5fo9*N"UmaC'F>X! PgoYhJKW\8qQ@\@J5k %^(EK2]kU`)U2NFq"KRhB0>J,nkYZIDY\F9:RlE?`MJilk,:RuW;RD=FgM;Ej`IZj,2rb(pZ3UN\iG:Dop9.LNCI:Ks.VfoS7#>A %W4UW:$<Y]o@'=OLX#=Ll9VYf\t,P]NX<M5bL,qtU&l.ACXj4d5II;i\Uk\"%q@^Jnb0R&:;V`*S>S.Z0CpUU(`n@Pcp\Z/U ?T16 %ORG&I3\KEPj$d>P,oKoQN(PT)Wi\8$n82P!M4TZH48r,/G,d8b*2Qe#l/c@]s4)j-H:tO: +TPh>oEYsBp/"2T=cCGqZD$%_F,?o^ %OcgTV7AVh.c@cI:bFNO=+2Mab(9LX<@.H#GW[+@TV'rFn3e1/sY#[&`LbZQ(L06NaLfM=[`H %<5euBge,uJKR:8rkeY"5s#9gGU6 %=h`@g$ZX9&]9`BlbD3Pt;X>Ss^(g4Xmansteh2@;I,fR_8h8-tkDuG74.i&*Vt74X,mLDLVfYsOmLf*(;! Tjg(8]iecE2#0)(#j5 %YfRk;R$Eu=DX\Vr*l%+TrK!6B</pp]I[Sb%numM)Q:h2C5Q8oC6`! #uBW9c+/SSGDF1\8AniSj98lF&d.Q)V05UD7%8(ii_dM"Ci %Eb;JB5-;qi/kK4u+k6Wg*RW\8g2Nm(E=oK93]m<f%NHt)Pp4\DGtQ.T&N$? Q#R"9:=cq&Z<TG&8TeL6Yr=?5ZA.8R@d0G<@A[OEs %Y7NWVQ.>_Jj3YJCM(gnH=26FmeZ&l%;WTRreC.,S:5'?P\CqJ"GD%GA'7(?IiOotid %t_Z1+Po[+pZXDSt$n"__Jb"g6a:L^PS;0 %[=2LfVJloUPA^IV69i[+8#IB]jj8pF-k>2\FdY>?Kk3tt6BiI1V0%:s?7P-'Q9>S5C9dl %)10Ie7i2k'2QA2FcKV)tgR5D)(`])D %9;>t2k5Tj+bn&T2cs&qK1phH2[Cm+a/1_jI/Js[mJC0"uQ==@OB7SA;n8Rl$g(E>")=)Fdu#)3**aSl*B5M$QYmMgR'Gm""65*/ %FX?;ueYjGpG]N3&JFn'aE(^;l`<R3(+EYA4`<8ms#a@N.0]s^uEjXR>&5Qg%*N@pkfJ[_6@GCDPKK$! 9'8CNLP(d>X*h+8@NM5.: %Z$I2QHd:d(foT/2fNp6\*\Y:0##FQDf)ZU6P5R(]:%ole3k-4#E7u7[(?k=k$k"O=n[gBSm0D.R@Hoaf#<rd^VPGZCD<F?Dhn'G %/(h-L&KRl@0bj"4? XC+1&ba,FQ/QnGFV98&lOc0?)oKLE6AdYRHm,f\aaG*c/qcI8g^3&qcLpW,;E5>FT^+ldlV\_+cb$f4]U6_ i %r4)/j0!N]AUp2.%^*DGYSY%OQ&Wq":IQ3q>8KJ@d,Q8>q3V/^RF#ro;Vbs3D*j=&!_&nofYdl^ %jP>eVhS&ML4l,D`rI=<o3t$o1 %KYGVQ4aM3p/,lfIK2l5STa?kp#!)jZbm7&a?M.p^(X7h;MFLFJY18&Ho%4.6MW! FR9OZr]EVH4m3Q$hA()'ipAin)STe?U()u;*Y %J(6W7(q7(TaMu2Z]^ZO&;,Yl*mS:rR\ $\H=7t:G^D#G50rpDr*c9/eE9;dj3[(PU9>Q:G.WRmQ)@F=6ppWuCNl,bHf[c+l+Kr,H+ %O/l)? W2+^dT>';]d8,O5c+>5[/R,.iB9e;D+FQ0dX6e:OY^S3%kTV+OO\<uN.B5RlYjETd)dKl<ZBCbFp8;K6G3] R.kOm)(pq4uJ %_d3$4`$F4/P9]NVEiB:6]:\MOKHkc4ki`Jt*Qdn@a%%,`6hp1b*ln%8h%pQMjHW6<H=Xj1*l<n'\ $LK+Aj>(Am/=?EYK4`O?g^kQ %C:D)pl?^5$dbLI=G:LI7'"5D.em%E.,d5C$B>3FEfMn3);bcrA-31o1Cb]p=3,n3s>co$9`0@V&)MfG+\/ jXX8`&:,Fmf4%lG2m_ %oY0f%5Mu@3IJ],^GgPE"]5'H'[e>FZ*nfY;Ys+QEP;b-7*!t[s9(2!38>Jar5%3t %`fFd(36/r,DU6Uj`Ll"=_lN<.OmV;*k^@Z? %+]Z\D-?m4d^+J:)RcGd>Dg.)N\DKK>@DAcH9bpd[3%VZFKY`QZg].ikK+"1J/[sQPd^l %,@@V_H@P257qC#*_N^`G5LQe&?X %:U"@:KU-e.Of_Q,<'*:'=aMgB:pO<3VKH?)1W:O@"$R! $m[ELf6VQ)]IZ=fpcU7a3oqi*5go;rI<jDQVnI-.EbH_p&c@Pfa#]S1l %dl"n+oFW[h(f]3G`-J,=q;guhS=f8\[6T!`Yo#TL_2,HZHL#ZnDJB>q %^1P,/_JiPa89hoj'/>BNGoO54'kZ;URq)UKJD+0kJ&'X %*7G<t;`lRDPX%W#:[QKCi,Ho9V5UIW;-i26DGTe8C;4Gom(Haue%8tjn*U,7VC,.Z=Q"D3s8*On+ +K`uf]ppRbt7b+15".cH[(bK %_,?XB@Bh\0j:[=qQD2D]PH_b#q3R<cjalX7I#` %.bgDHpn&Qgt/G5$:VK018BVo>,`:PTK;KpDpa]5QK's"K>eePB0M\<:H,"K4* %U%'/GF7k'djMeKf>nnqk8((RH=g]Y!Y@8t"Cp?;DAi&<mM.mSWu/8$TBE@_a>W`U;R)XXeJ[2DOl;mkAHTL`Ghpd;3Z)&,f.$"= %3UHAP]tMVS!^b?4I[,!$\aj`2fZC?lANd3c`o$dBMhmR:*.Td<E'C@;&I_9Wg-jscET-! FEql#nI8\42i_q[_gQV"g+=,t %`d$<\oCDLtb7g+c^PGu7di-skA_?Pq:*o>ZGn4OGp^?O>AU-Y5q&&V@IC?E%B]jXm\b(@hf57n*Zf4FKsLl!hjhRJ^^fQ(TR\Cu %Ci6eIfC\95IHQMOq/&q,h4n'?PrRbr$L#B1q"-*Y4H:B*+"?PMM[-hA-cW@g1,A"X-L@&\EL>?*ll`? A*]4UbUk2(ARpXU4f+bfe %3153b6H:tY(#*Go6eB3ag?$_pgnZNInMNeOLr3rh"=nhJh@#B"Qi>:SS<! %4qp)TjhsAtTc>p*9m(L=/ku=ZaC>4cP\J8a]lYg8, %0CuWSe,CGf]&1FB?A=iL.d9<S"VXlA@)X\@0jP&=>-#7qX.m[cFRL[%1idu+ %a=8[h`ER6\'4K_H&k)aaj:QWINu$@/Y@juF?eX% %%ab%p&J-!8;j-6&m+a7uoIH:Cb7hXKiHU@Vcq:CCOWi1YIOg5M`Or-b$TQNd2Rh%tV? mG[@4^ffkqDGh<El5.WYT6SD'=J0?GGn$ %K^2fXXLc!.c";F89u)?pl0bCH79QfMqpZS:ej_KO#^&*,_d*nZDqt`<2SC@:m3*]/.Mh'M`NiIlrf; %PYh0^[YET/fTeU7a;j=>? %V?#J/k$'k(*i-,rVq_B#NhJ\pKF-J6nOU+/jhBL''*I,8lQ/lEN]]?j.D<-M %D0.eeHlb1q\]3o<((/1)@\)@8HO:A.s%[Oh:>kX %9oanhG,4L`/E"*"IF!mZi2I'Xa0Mmn(OJYQi6^sDne,IIr6=("P.I:<$=0ru]uX,phQ.e7>SED7T! lI25J@.?f83^T5HWb`m[CGI %M-pJ:G1CNOp>(B#fZ63`CKpBJ5A+4BnU<Nla'%7D2-rV<NZhcMi35.kAETVl;g@"F-L18[\+lq$Ut %7PlZ'irjEm\d1I[kUmr*\9 %np,F^4<K:;oC;7N3Bg-W-g^BYh(S.'@3=t:O[He?-:c@&jAEsenb*ll0&6&A5*#9sM*J_Mk;W/5l^4)5:r23rfgMse=feq>6<b$ %:gQ',*k,B3amsNQkn1H(ptm.A/4MK')\P:lmTqqG'/!roSh,S!WrSFD(,:'61o%-G/O&u=XJT_9SEpF0m`-S?tMZ`hG'[Z.t<,Z %Sf*ggHd.n=a*'U%SHXbVGI_t)h!G88M8=$! de;D41oO^pN<prJGHJ<[K`pEOBPX<nOPg:l[69>Jc/:U,Pnb'tg["r:Uq[Z1U"8P* %0-S0^9.+R-;ecI!Jqmu@[,Biq3B<TXRNYRaQ[3J %eSajhd(e)AMs>6umWk+7f[Z@3qe8qc'B0V5a855^Djmh[T2gAcLdqc?oC.^u %SN8(6XpuL-dq;kS>!hO#?3:p$priQD:1t06p(NT:M'[*/B`CQMHeHI=C(r2reQ0Y4]]WH3^TAi'Lre %LJK:r"W*khC^]t1:_'AhS %hR88QN!.M1e]Y`i70]'V.:/`XQcO\p1LOdED=Bm^MU,InHk#aq_>J=!DPr/\93/N)k?4<+T1JiKc? `BGA,&;i-N\Znl\>eq2p=>u %5EG&VTVmd^g[uFKG?c1c]Ytk^Do1ba*&#q`2WKJ])O=R-[5ZmY;QFhP!D<#?V+Gja\U[msTN\IJ&0c_#g+G^$4")+3[d\NPis9> %/K:f1n;cFDE%*t1/](g^r"@$B,jmaKf0re#Ak0cACYu,;ccbN3IU:gi %=bU7%q>i'e:62jLN>MJk\2:1G5]JV`/d-5b!3qGhK%Da %Sat&:j9EU5Xu!E[Y5jI]=as.rBe,Ri>2T[f=lle_+\=1n+? Bd>UB*cJ2IRYtSaTl>nIfuO_=sV=NF5h4hF?5R4s$3mNak7*NH<>, %"ZtSZa0klM$#YRjl[6M=nN9SDGdlonHL@_Z@/)$on]VYAguHIjhY9aA(! u/=NF#s=SuNb(d`eMcT$pJ+POU4G"D4c&Jlabbp@&^) %pHhk1BWYf\4pSC;a]pTt141QS$1>iS5JH/WO'D,HB%'sU[JLc$9=o&Ye)K)m<l`F=7Ni\O)JLI]*G<1/U-=hp=A71c*XR#38dh% %'c4e\.d!Ts.t[L#J-1O+UC$j,qlhEDgYc'Q"(p#,iu[^VLK3&VVi+: +6K+'B#cG[gZ))b(_;MbVkFOoPM;5ZUn^e_m3IVG[>YBu] %^Lu;Gk2PHFn2TFmRShPWms9#dXAqRDsqPIigjpBa>,E^/]E$O._FsiM43Ya"K`RblB"aFO>+kDIOGC$H,ZZZj.G 4_q`G/3,NiC2 %ojXXn,XA,&Qll(.<!J>qmVA*TIT#""WQJ813dNBe1GQY>r&<6gFJ!GTIX?aHfVe)u-!! I/l@fR(cQH]m[FaX)6^4;\PoeEA"mR.o %='54a2\p[poHJH^64g>tWVPP>o8:! _n^I2`ASNkc[sFu0LUs930XsT11ar&G;-/7(Ph9dX)\SLF@>+frQmP5cGaL$gS@$8Ygi(K^ %Fhi>8M')5fO0j0+`bfZhNo2K%qL38<#/&bHZ)giIU`FFO49ckQ_cZ$@o.Y!O$t)T;c0GDL4[JsQ%XQcf %Q5Un\;*dm467\M*,+Nk %"5$m'P":+:r1tcVnUTpB1buPP.0O48c!iE0$jI?c<^/sM[9@bjK< %ulUaV)XYS\teS)''Bd0s$5T/#s]>*[u6A/6Ao'BG#jGp-K5 %\l6/GmJTW_nDj3^gnR9W"%L0F_Ur65o=tShXiFV(j`gf;e868W*'1Q=peIQ5+RI8[H,D? XC9W:"XRgQ8Xm+$@1II]cQ(=`4%Vsf5 %N=m"7@mIKD<dob5i8;H\_;\!3HYJmUKr@Z<!f8.+okp#%DC["X=j*"\;L?Y6$WPR %_R)Rtq8%gCDQ>M$/I_0)bplhGG0,P@W8d'4 %3&.=TN9nXVhX\]31Hi&"#EM(<m[Gp$V! 8Wh^UYeK96Imqa/^]hZ@C=rHoR"ma7_XS,:,IoL?.uOT)ECfht$B>s%YsAaV0/kU',2V %C\["uqV\\mNdTh*Djeh+*Be\7HPpbre*l8e17rI_>7PX`-RZoTjAKn!5qcI>)Y-jcoc:e: $jM2(ePg7Vf'$Dfi2+lMU$tsrD!ER6 %-!)Vo:/Fc#<pIA9l*o-Q$t't&!1&c52.T8Ci1!A\"=nW1Nkq3WF7VTGZR0@7Yt[/ [/hBd\d.1Z*l;ED_>JF:F>4Gh<bj*e,OYns= %54JQRg%41Do2Bs]rD)dsV^lbt(gdg"V7Gb\+)0`EOa"E$j6%@l5! >&6fB(E)q:=sONK]8.hW;27Xgk>)l`3H6ZYF6O^84LM.0"UM %!eAZ674Atqgjoj3"Uf,=k/'8`GshY;0?S_! $EVg`fD]R)9\'it;S9$3lDp*,eZH4Inl'Fg0[$BI]kd0/IS-]^h.7sB*=(P.@R-[` %]%5f;,K>7p/(\nJ(XDF)p*H7'bmE^@,*.BR:==K*jR2WqGC@?S)dK!)IQX=EEV_EISABZu:WN"Q_gM/I+ $J4g+8<T+qg-?,M0jF? %5((8/6RI!F)V@e6-^m(/TZTiea5G-OqWH%AHt/`YdYD,`gO8uVq!%2f0DUGJ*1=j0boB=Ph*! aTR)elGS4L=2"V8r@iE\U\_(SYO %s7/oNB(NPJEV!`GK^(ug[n%Lk]iP_1ejf*L3K8p3`GJBjfn2mp0"\A*/HVer[0j;uPTb@RHAPkNP_EP? o^+MH[o5Def=k>1hbX\# %(kda2`B'Qt<C\(WJ\$H1&\B[,YnIk0?r%S)fh<GEXD>;#3bjl9eob[k%%D&OKc1fp>m]*l3s %oOc.D.CJbQXj+&WEPAYS7J)j<[1 %^6fMknnqt'Y`N=fJ(t+N`@EQ0gVLXls,-ROmG6C:IR$VBmO$b[M80B=:_<i1`Us"2?>J3eTF25WgM^>TUr*]oW!Od%WLEn4F,pt %a5=BdUqXIlqVa'@%"9q$BEoW\cop\h2^u=L^d`pO_Y%?[S[S.mPsc-b7nRkEFS&a9_F8Iq80`FFKQb? F8padagDr?]j6l#`@;fiR %H5<tAJ+LZD:YEkQ8.nGPGpP9X.(Q%rpMn.AnMHj7ph%t[oK7*WCO8L`0C;$C7rgiMNAnFO=(+Goq(nD! 9k"jeKh.J9?ht>U4fru2 %3g$a]fuk]`o^ceSH]m*>-6MmWnRfJ,hoOd,F6%ss3W:f0HpjAB.f*$^X*'PWHck[WN9K&c %L(=PD`c6N.f4A3R>,W/m&W4qqU!XU %C.cWi\_m2]hB(H^&pO6q^3Ei8@iHI3F?=/s??m1&Oa8'!Idd4Sm+?gq%rO^f\i9"*8pT.QCG90MB47g96&\f.M@C^o9+joC]q$0 %!bC:oIls,3W.$X=-nr? denqtTq$`m:\BEt&_;iCMHgn`)W7(E`Vr&/Q5AnE[S(2t/h;IhTmSPZMXbL5[H,l,YMQbqu2.rjE#$2ql %:Tp7?*.N9W`'e>4#9p!!1a(#rOs53\GiU(RA\co+NR?A%[l&Yaj)9E@ie2UP,%ONN_sV;Up-d^pf^BdR %9<oo?c7B*"ZHedGdH8Q %5OWN?&YsChD!(N(Y.AbMMIfnL6L4Q:]^e4eK,,?/AIC]9pLjEjYB0Ku%c8d`%jbF_p/^F]BEu59d+t@_.Ls`S2cR?r1K[Co9/!? %*b)PFU<tCdAO^XA\^As(K3;_,I"3EP6l?+SJT(*Ai7d<cS:&jlia%I;(3VZ7TGYYtFg)dBTk:D %CrPhN$AW:>1pk(<C,3TWAs,^6 %C)Pjrm7iL*%][BQ<%bfDRr[(SE-aZ-<*&:(4AKe[^48freU'?U;Z]gbAQTJ,)rA?9N]q[XjVW=1qAjlg;! AgGeIin?7ud)4HbNEX %^Xm4E' ePt^T/Ta9PC.kSgY1Mt*hYg1,_g'+hT;I)mgCl*"=labeK@dI=&`Vp`WTdRNpa7_kj;"fO>T1a!YhY;h#Em/rU)9 %c.n4T=iM.fo8FnN7l?!9Eu+BPT\=;Q?G\P>)),1h;G$P]At;7(-_Jtb,5Dha'"kc`DtLbh]Sh!6sgR,g0oZ6?IB$sm5bK%F!&qN %LQE6WRpV4HnVrF7+Ur"j]X$jW@:8%q7c?"=F-K0,AjLaZ^H"8p-ksa,/QpN&mg,OD8F`@E4^@]\R/d=AJne2iS]GEpJB]`j/9_S %>kH*Uh_F:A-O7t!ft.E+/r'g"D2nmFRPK:FY.#NXi,JFF;GUW`4S2*X:*k"_? ppJJEF<@n@T`M^g9jisr33^MhMF"088HM(Do?.o %f]TEhZZneKRrA>3B/)o7%Z7VZ8i8ZGOn:8*jnea?OBPaYr=Yfl$30_\Gt %\Kd,ULRkBT+96dYYc*V"M>Ome[fK<lSDi&c[=jK<Fr %n@Q;^A/#97E[IKDW!2!(>L=O\alBAQ_$?k8YaU;lHigr'dl_]!=&H?<<!2\<24EK<$UXc.R.qT>RdQ^C'a[4eWFs'K<muUh;7)N %%DuPSZ:R&n+PLFT`R/_DrH*[_f.EL0Z/.SKP[gc2qI+D8gGrsX]t*QO_iN_5SM$Kk9&T<=V'inf:.t.<qFcf:MY<dNK \qlN@Fj< %A`&kt]DB1i.t^Y5=tQ)URd]O>_9MK+]oO\t;edd%9(Xr`!:%]E*[\e0omb_5L=9K"NS#!XR; $3*TPKhCUuSVA0IU#k^"3!6D\N:1 %-!d($hX6m4`d.g>`%:YV]e$qDh?&c$Gad=Cf]0k@Q@7c;-U&`Bh@402WiYX! iX[g(kN2G'T`_2PZ'5Ljq)D<8q[="VIre<(1HcAd %R8b5Lj\*5U/*BQ$k'#g;-]\#o.KQ>eY68gI!>*Ql!4$f67_+E=c.&TQTn,BDBQttZeN3L4g4#t(! &XBK="MUu0P'M$s+M4OUZ5fD %8Y0iLq7tpmEll)UGKmVtf,a`i(VEb^Yn-iOS&t]Hr8(GS7q`lcWlkXoW]\piN8CR!%2ZDaeb? 8M#5$h^NnM/CR+jg9n00G]Wp_fI %mrW9:itZ+XWY+1s:]g[IUqnbj<<TS5r50!.2Yjf5&Xd/VFY\? JCq>1p!:4;N4bPVBf0u0EYEJK'r((Y\^=UuIm@sh3=7'Sd2F@g@ %!+!ZW+_5GfGb%bSlW_eNO=<-?D>jbbM)FBZr62e%_S>F)=>rItAlmhT_iajGO1k#>l^tVOJ#db5jJbaF*@1m/KsPJJp^-F%5AJA %>V%Y2Nfk>;`%Mn%j\']kgANWYoF`OK8\V-!,11%K7dj_:[ft)D*p<\\^&50\g[i@k)ICW? s'DK8/7pU/Up*.mHnI55dip_^@0L(Z %5E%9Q_Zm`W?H'GJ-o?GP:NAJWM$MK=T^G:fb$oTcO5"6&Qc?.XVr2R81I,d#'Di/T]bV7$l<9$KaIO[I? (/7o"BYsW\r#U<<KR7m %!NgUsYj$a?h`o>]J>,Ri5mU0D\?Iu$*l6I0KAcum/N$hcoh=!]8X1CR[(TaVW"l*2W%Q;DHJlTVI%Un! EL(Rc&BcFLZ&':d;MM,. %>sN,$.s!OJj0%SG%uqtA'_c'5b$QgT_)(>;LFZ@7nn_-P'Nhb0SF!]F/\4R? ScR\p0s@"$55:N+N0>u_=\'!.O<9$:Eb<t@FYmFQ %A*CXqG'ACE^_&B1OF%:DkK)6fAe"n2f!<9=Otq[1&`EM=XQL^?D-Rq3]#: [_ersa49O1_=.AifKIOMkF0T:<GS<P:`$*MB%IRC[p %bL]GH^4=oX=`t#?iXBE-^`Fs-@8NRhZiY&gA?-UJM?AnE7s, (+N"Vh9Pe'0nidb\KGY(SPOuQd9)&Z,cC64=f7b1r]WGmhW&6tA] %TQF\nh8.#i>eDXL"+"["PsN=74&M?oebNb8CYj*3PJL[5j]Xd`F*CSNBLAc@MF^Lji3XqU,OW"gBOk\:!.SP*;S!n>-G@B^G5"Z %[^,Vb,u)^]M7;PAG/#?E>h4-3X?"LoZlsYOT1kBWBV$a#o[G^@e1N1c? no].G>Y:p1PAh$;eq@/p_^3<rlJO</2n!:-)#[n<_1[C %YmncHplgV-!q$\1BC<bdT!q@u]bk@h-(ks:*h[W^f@T5\!<CO$%E9t? N&p0.p<dQ0d^Nc&PIFT4<>:<b"nG_=X)_2%UrU;_<+Y\< %L6D:G7b'takp6fs.<$#!,PFaBP`r!DrPpAekn1-9N?V7X9? oCSJ\QJW@&ZA@k3^cY(Td6RlbD@Q:X)AD7OkmI?kq4M[A>3uRBMsS %X(MpHU4)2X+H"K\;TcDhM]Dl8(DBR0ih\n1%H*C(Y<WP0/U.b>ktFsl(h?nqH3AQ2-)eD1^dcs*C\55TfM %,t//V`Nbq*8\36<E+ %,!&JT#RbODRc8HF7GWj2kY1W.+<Rjc#9*5`fE<Wr_@2e\q-ufO-t0`4<3oorM#'5>#DVAhKqi:K"=S=0$ [(uk-:L>+VoLop0j?GX %YU*O;T7Co[TG%ZC&U!;*;[(XH..]iYUBbWi7*^eU'p(#55)Mag?c7Jjo#epG9a\P1\THn#TUO5H7fHT3.! ^l*1t+3hTM5j@.RU;@ %M+$LT%;5F=>ruLn9OM7r!b2r;2cR9%$ +&6)kUL(]L1*5VjLb7GA=JIr&YnEp*\h'4#urj7lYj'YrJI(p3Y+ToV5_7V_*fQ7=c,[8 %#:]'`H^LgcE+RC+']-7`!e<^DVCN^o()$nkFkn!1-([jJ&u4ma=h4l58<p@^L8p(Mg21b<qgEBL3? Z0WD$@dK047Y6q1o-n:6=2; %f3dJ7>KCg'.<^]7k1ZJL?,5a,2L#c.R%5XJ@SJie-FNeNT5[F[4\KrCl'E7.3`Hp"j!g8NpPD`Z1m0i&I8PJZ`pKd)H]^HkfVkg %iCb-G-Fbm>=kNC\.Bgc!Cpbml4]$*EXFk*!i1%msQRF%`-[!NPG)\+tU.. +I4kLnVA=*3<PG*mKG,fY3Bln1or^g0$D9Q$E[?uhf %7un352k\ +hambgTKQ^p@;D:\Kf=)WU0@Ap3ZJ/ot5KE5AmqCI8qDS>pDD'o")_>p,E[>Pl=7L4F[B*k:VAp_T*1.8'T GqVFTVN$X %3#EOsC,P?W6K7pVg627($SkiUsc.MqLZRXgEKKVe0]GaAr&<D*tfJ"YI/KlGs1V:q_#NVXat^ZhYT+rO7\@Yri2@#.daDHrN"BG %mkI**eNa&n?[r$HJ+IH7GN6T@Pkg)o&=8]5fASd99.#:V/?%+\H?Y*5mO\.r/ %hS76tXDhD4Yt@I3(7M4:E!l/q`)al\3%_'<P:! %Wk70p;nfE9^nl@eN4htf+B!5I7j3*DK#*qt9EKc<%2FF]$e/NNTb3BPm1i`U&1G=tr9$N'EsYrB;4e&2? nV;d"N<`Y(#E\.=-Y7$ %VerD)>gS[r.9IMbfec`8&pP7[*$K94P60f%BHi\6p*qc>JR#ukZr@HHY)-Q!M@.NT_QLZgCf[,IAdtiludH]]U:u#S,ju0+&3cZ %Xb$Mn?s2ElPGE(Jn/S=,l[#!\N.q[uTb:JD7Kk3LT#\Z6jqg.dXir@"uR,D^#nrk"Y,l>08Wu2=b0X&Nrks#q%_P[NJ67`@2H1! %XBumcqRtNE"J,Su&GD]mX$s&s:5RRg\!:&$;;b0(7TK-r(8oOCJ.1;_Y6Pb&eH@Hh!WUq$%S"&WJ7h %;Tjm)\_2HadOCf(-_'C?] %YtcfGU)4#XO_M9.:P?))\G#/'@&gl:b7Iu05^ArD@M+G2LqGF4(^oql@=T/5T1W\Q0R2k9TP;1C$rGOZ(b T+1-@cZ_34RrXIMt=< %)m?ZkjbR=6<aaB.6TS4VRel[P][GU$H4,>W%s0541BK$P'SGYi=#u\2g1#i6SLMFNCiuK;A:Id:PDNR4qkKeN$m,OEb)@K?kV7> %!>A*Dkk>6^1Td0^!EV_A9Nj4De)2%KiZ-KNehn<(\c<[#1n5D&c3g)HCbq,e?q3OTZ3QUb)q--n\luO? oA>=d'q>s-K"/CfF/j8[ %I%i!KbLpbSX:::V(J5r,kulu6B4EAbn'crn51F`L@M\NfKc(qO"\SG@!=nIM\ $S#F/^u[(:hPLR1+f<;pbE7,/PQ.-eGX',=)9)o %,hOi/!mT9@9U_#.fG)%VFqd[s3srX0dX2@Re(-PhGeM.&X*ABM\h=3.g+&<B"INpLbU?MpAQGI;(I! CT.Y/D:JL^Cs=Z5EH#7@n, %S%+`"S>PTAJt"\\?\nNkEl$Jl7tA;D`)OVdfRQ+NcFbu\ZD %JG$W'_T'R#>`7^;^tIpVMkPZZQ+`BUNW8XeuPYiNag;.5J3:g")W %=KZ5[^m@am+slc=KK?4W9?l><8FjRieuKbW0#0s-m:-rf-BlQ")R*_0b.4V,XA6QdloL(d#179])2! R4_5s.L,3O+m&T/$Jhbe6, %(Z#<"hP)Sf]VCC5J(SfeN^8(H^oY'LHPYt.4Pqk0*`,/="p^?L! [CtGi+/\3CW"LSF_P7b"8<a^CI,TI6c!M0(Z7tR8in^5f2l(T %IW9=WJM0PH\ha=Zk8U.e#6i,hXUUfm&"=^mjl%eOeQ/pD<V4Z,)#.O,.DIt'bAP("(p1e[^]Sh9+9ls(UgqI^<r==g_(EEZTcCe %+;4K>?n`'W_L[Z8N@T\7g6uH3NF)+G',g?5Ot&"#ZU-OI*:938ZIjMZ^8O\\`?rZRZS(sCaRek&:r5NUL? mh+F+bo'Ue,uHU>9sf %I&Eh_!KKX#2C+*L!pbEcE3V5'RC?/S!Z1cDi.Y[I^-(H0--C]eE@M&YAFc8KTm>uI,k@4M),hnLC;bMq"7jT'BE3f#u&cJOlh6q %&54? G1k,O4\B>3n2\@FQWDj5HqJaNW]KKDM(lh./oQK74>E<S$MfhJ0<NgoQ>Ms);"7h<Z$mnP(10t.MP9rU@:I 9ulOh5.UEcP8, %m0^Llfo2'/@j/Y=$-ON)lTh'b(9.KuZ!QC)?a8AKQ0nVce(eC3NgL,uLHN.65TjYcr7G$.4V?in;sA>] +Z0Tu.kiHDUL<0T]hL@l %bEF'n?PM.^^9j$aZirEL_Z_"uH%jES+D>;g+Ymerj-;c01E"IX.HYA>ps\XhJk0mK*\gd57Gnkd^_Fa,,/ @%QBe%S>1E65YI3XSR %,IqP(AtgQ9..-bC-R-iQr]Y3F&TZgB)+Id><XshmX[PHQB@V(8o'hPV>D<<JK8nR!!,kDIoRQ`R*aV; +^m>^NcdWIXOaJ'if?*W" %iYPZO/0%b^? +Z")SgbO,V#ZWm#dAe,nG9:Z.PO`rmUhK4B9@I"_k^PuKSdl4.,W'=8QOE(P+2_eYhU]W`T;8cA12"J<K`N &f,s<r %KP?$81/a<*QRWh<:KCjq.`fL+_ru(<=ri:*B(pJI8dCa>QcD+rUk'04H5E%d,]d*5#C.:9H;? G#Tq^*S_&K-:"qrQ!_FC:E/E%NL %>cEH-R>drg6p!^2SOs>S=bHrIqG98:9-@.&:#Hp: +U0QU2%cKc5I/;t$;auUD@IPT\VlQFZX1L\;cnXSYJ<FE\7o'e>!ed5GN_RN %nd^2HgU&opqRpPTfV+Wnd[hrH<&61K.oj[r<O(qG_tD23DUq>^4lf&_9jMb=\??d5)? <3V:6@eTFirlffd:BGd]$`MgQP4*8qrlP %X;:@>YMs\WX1fgbp1uu++\tY]KGZLA9m*:\\I^MHT*TQu$#n2*c"UTf6'!I#n#)f7"@U@#Y'c99o.^Z6A0V4"A5Vg:2AZ_"`Cc[ %CYKD[#ukL<`[ls#3c0$M52nIf<)FC?W-k\/=>Bc9C]F'`#KKXp'3\<r"q_Qf=<M"ZD[K2/VZf %@+10sp6q?6nb?+dUVr/8X9e_e` %"3=OOW_]<2&6!V('FhhP(fm`RW(_1fXlt,a^^o1&;P@?\fMYtm8pi]DF@+PU=KIY#:9mPG>A %Ms+81&HL@BQ5:_dpYPEL$nPIor_ %@2d1a>l.Wj/\*_Ap&LLmqq!+rT&m?`4=RfJclECV>Q@GA^S1FB8k(99B<Pc5C6TN!*SuBn)koqW! 6V#:P=1DZdYrd>e$%A80\0#9 %%Bn>27P7gRX)#M+*4Eu685C4r<)H?r]&6,!c^]3B\re/9@Ro%E!J! &A)5HN"k3ncYB"R1s.57_1"S/t[X=obrbW3%*$bWr<<F%BC %'\Lq%,m(5i^g:_j\7!q]1t_rgA88f4hWP+=`/*2)C]Z=lWAk&^k;/? obg8D9b@&"4(e[K$JH;-")/D/eSSl<sf?C5i&r\%mR#eaZ %eR*8iOc895ctS,hLPh.`d9A(mo5R$,</uoVUS`/FK+'H6bkGfVS5bDu/0\Lr!Z\St7EomT&lFtq-@jA %_^LJ);>cuDY.J!b6;KBE %/(#+T[NtmdR8sn/>3oI9"I&d1+Q<Gh4DJ,9XP(*g?V3mhPLeoK(ZHf>kJAK!RJm4cKE? Gi5l3`"_H7N:e4,RBd^s9[Wa&,jK,1r& %oEk;)i;)g;\d[^Sno`@74qQfn8:,&VT8AG@7Zq_Z-u`]0FR'F+fa,/? ih,_Sf[/"^AnVoeUMFaJh\Csq`UOQRDgItLX_C/`=R1,R %LN`2EhEY<J*N@ZqqiO3h-XPn>%!u&%GDd>;pk\X*JS"X@f) %:FWsbMR4d+*uTK(Wq6s2^&dFNnZ;AgDlf;uth"WlIaQ4&b7aod;! %>Y5(<LaFiu].o\HklWsaX! YV[C,7S2hs0AC2FY#snDFdjfmID3o"\l\n1$=OlA72/l<lD<JFb6=m9656dJ]5O`Fm1^YmQ%6H1A=n %m1:rI0i;^?YYE5_,a6Ca*R@@S1p[Fh/%skiH'7(A`<VUsmDfH[.FgP/#W^.a,fF)jPV?3CJ\],M70;!R(? q@V^SeYFC#Do9V6]JW %RHd3-l<uc%h3Wh3J4Xb&6])W89]._[Y.MpkZqOV,dM`Qq>Um>#`MS?bq730`Y$=jEJBG> %Um1d^fXBj6^bZ'`SoH?mR9:_m]Y5dC %E6>W)A/F#9,(GN/"I1I\*r*e=Hm/"+];>_W&/UL'GK(ke7"531*Lie`0-p)rbj %?;E*aJXaUkXBZG@iVD+b3=-nqT$,DZ?Dhb1e0 %Jk[,FUcgN$Kr0$_/fE'Y.!o/`;"(S#r3Y!h=9dWO;PO7c+E1911ssV,H1B"4O@-b<d@Ld! l"d_?;^[=04m[;Z4PUIbmRSssd(Iej %\o75kZc=M3@SLSi,p4MY1c=;dpf\pjFg:.M^4,XtZ$(t&+`4^! (-:O+KWpB*d&bDEH)]2[dkpgPn$DgTdGCn8N2q!^X;[sZ>_4U] %Qk'gqf[u/I[;#V$^u5l,TUUoeLOcU;/eTg:V %Y\lcq+YVIa)`O(C$eRe6FmWC2T/e)'iYKU:^PnCBj&`UJ^,i$ar'+h+-a+'!03g %Tp`>,][T\t!A=mU<Cm1kneEFe%SCfKAKqNr@oVOkWa?nn&o.'f]VZ02! Hp90=i:om\i5ia'1snJi3M6"oJeRtV77$2qe5<<oL*_5 %VTmG'RHV\_bTAD<LelB,VO&`q[C52AL%AJZiYH6C(XH$_CP%\n,;kfWBX(-ZNbh8! KEsW]NFS_OAL<[gR7kL8h=C5_B*0PfWTk]: %.MT:%.'HDrd9ra&Vl':Tjhuci+5hO74E9T2RCFu((4ajL&DG?DL,plG^^SLZK^"? 7a]3UF1/=PK&_&Yh$q5TRi^$J_;3Ut_Uq0]b %Rlf:a4Vs.ud<$;TF&A"0U1/0"Kgs42.(u#m_[U.a>Zc.B>r>*(5^+iLAm_qC[,NFC>g_=7=>a<<$V6"Al %XUg^@)FE:/q0[*mub2 %7>kas9H*^!C#D\=9Bl^anCMA<f*B_\7jm`p2STEXLq(,FZBGpC`PJaaf^pRq^;WROf;VB'<?m4! a+/3fc*!js@k06R+l;Tk_52,t %V5h3/?Y`-?)OtbM_T,iM4b:u8B3L4g/Q<.>H>G>rEptBh1]h<oQV,-XI<?=WnhL;1[$,rP>@$FZBuBlsn@#8d)>W:i4Bgo`_c,# %(#bIGB[I\%i8"sBU.]Xd&7Dkh!SD6lAcl*o2)M"@-%7*t#'Z$T98t2H]+?DO-Ufp.[noN %jj;e=0F2k0ZS8,RV0r+9lJ=iEKr<]? %,[>LS)g`u1d'VN.-0;CDTLlDk*_-9<_*KC`ibQY)$2O`Y;U'HmWVj1ODStD>R%f^*Ea14WEiee\OV[m"KH<n9<!jW0D^DrEHMU? %RM;I"3Op[i'!PCj,N7HL*A<$sG=nZe!0*,L<VSlSVST0LWAIr`@iM+MAik)*=KkHF3hKpmT\/U&6LH? %:U!*ag5GCA6_F%Fc3slF %Bl%H!T1(^ra@o<l;0$L#<Zu<B'kl1/W<N@;4cuNFG<;c,^JeY7d%Cl^IkdC)Wk4N#? olmV3CH=Qr40a0F;6BD*]NWF.F8Rg`IO"C %<>q`RE66,^DF?g\8dd+S.RAe8@_mb+<*`cq_f,et19Z3Yj4dhlV#81)bYF19!0m,5P5CTN!n/=^._G? C*<3Q]14N96G43:(H8Ma# %aR"/"NqWcnctD-rDh6N-0@\?ZG(g/W4eT<CaH$=ZG@A><?@mJ9\Lm;fp<VhV(df\98j_r%(o#&o$ %WQJ*e<H"YgLt1M?I3>8T[N> %>LF!U#<FiFpts<8.pmp3n$iLM\NI0)JuRP*-9ZRsM'=5EC %0mPcS\XE@S#q.6`t^:c;@.m'$Wu\j,4$p^f[Sg5X4W0MoBG%F^8:u %h.4c@PJ/YWgZ.@;D&TJNAS`aD8iA3a<PCtE1KMUf?f9OMI-^8Q236;TVL9X-M=G63"^2>sg,$'`"DGO;X? MCMS&+NAf%=L7X.=h: %;iYY_m:Z/p=0_(2EJXTl]rA#(pM"SF>H01+%Y(%hG9>Z<51N<A&&8a[]:\NJWJD.AeD(Y9,B:% +&;H(1'I]5m\U288<Ws;n)c8)Z %%#()VWC9'4E$XV.<QiK7QuOjZ'dco.&`+(!G=VH5Z1ML9[72PG:D+0>pk9Dd!@.NIYH$4BM$11g6MNh<8E%^:7mbX#(ot\83J!^ %R)I;X:gF,.Y/nj?L6Ttlj@.G1<`<,K)sR*AD.Aa[F&LN:`e>C,:;GPMWDVDeMcO["k[=mj$@BUJ&3bX#mpN/5_`LSd'&OkUp1/P %'f_Qf8]7.Gpme>a;Bs?8<HogfAfpjPN2G@TU:@rN&N1'b! Dl1(4j)Fn)Q:Wki2=5d9XE\P^UA0AqEiSPjN"Jm%.fgMkun]f"f5*B %pOuAde7E(j-.$UA0sNbk9kB-%;()-kPW&J-o%+E\hWn''7,J$tS<0m!!,18A$Dhr %AdL\DaX'KR,P'O3oEEbiaC?Zus4u3WFY$YW %S'Nd:Yc1[JCf(2$HrAC]diDE4+r@JdTqX8PQHHlJ.2!sd6oS+)q'HT',GS21Obo>@5`:]6U! IX0UteSQ[YJ7\;sN1\`^'4Uc3dB. %9h&DE>R5i'o=7u0g0Qj=''A2t;NO/:H)eu]AdY74b1!FWQ-')CTt&U@eK#%%\ [\HL9B[juQjH)#JOu4JS#`ngTgY-p*fHaM`P`oo %UDI;f.Vqd1)!m<,b*`WV]r9:Q-9Eni>fn1/U_KZq-!]oq+:\tD`i#d=cJU'r_kE!]JOsuIYk %4K4XuU<#&p8M]:.M,5cQoUY>HAF %=N'!&:aQo0)9h8FDLADdFq$&9G-:&.b(tK`cP^hn;&/-S7%a];<T>;NbY_[>LJ`[,AHGeDK,Q9APB %@*K)!Il$.22^-ZY.ko5o[6 %BkXlJ:#M.G;S+mg%aQ_()ekn&9`_=P_ciX9QB`^ZIMt>:oeqra!lbJ#\R*=13VVRqc$>X:28! 7_+#+1$<34-W4;c^',;![iXPalD %:+:m9^Fg]Z&XH\L<D/_[gP]C/Kn<fS"1E;21JU"gC_a1A\VHWoVH+)Z-3MSk`@"7)&Z.GjBAFWgacKoR=qY3ZXfer*qLAE9t9*\ %3Sm:.Aa(K9;<0G+@Q5$qBfkFW8j`huNgmsDB\Y(/hcR[?E=73:[)S"Tf.$)4.9%ED9fis>N0MW#JY %C]fHWe#A./\Y'e;L\0c\L[ %\0ld&UK.!"e!#h@(K2[InO&s:&!dZ&$l$o^..KMDp3X9:>u]W?[^^>0%(:*re#,WU](-,[oslg %iabkfZdEN#"?\qIQMD;[].?H` %?=iYokL'(OX!Q)(ba(@>#($;l)o^'C$sKSN[pP]F>en-oS>,.gT><k,X1mj!((\B=7mULEnY5k3bLUX! 2p;X<&kDB00LKPN]:W'. %[`"XrljZ6M7s,2&,JfJRmEUL*BIP4B,h%I#*Ng,f#"G)!H":tT2)WnS9@W3p30Vnp1fjffqWI? pNRik*NeU>?@ODQ"QKQ.ukf#*( %k1:Ip-0[iU!Ek:gB&;BJgr9G<24E+? 1l(uHC'9Xre:]/]WraY;cOZeg5\i5\EiBBKimb?)3F+G)0Si3']7db$L"(1Q_>6"JIRF:\ %'1H:_)-`P4p^GE]-FqNS%6''&[BAJc=%7sdK"3<Vk),@EZU>D;p]Pd-a.?'POar=Cm],?pZ>_;]1&? @#VlQlgbZCH7;6\U@28O%. %g$3rd/$H%VgB`M,(a8bHh,YRa0s'6ARIRg=-$_'s!V+ZeefcOX5.-$:/JtR<AH7L[-;28a+8-T-46LgCtMVHe%n0>Um2#f0CBGb %KO'(>Ta$2L9b#!*/ [8pXKT_J5Dl)>SR#_9K;U77BXZ\19b=Ik6gspLNdKO4i)LT+1XAR.lQqNgWC)L`eo_kYQ[bklI%dYekg%X %Q %/qt<V-^bu!"=P.\^AL5r?E.Bjqj-BPJU^0Iq;o!Z9lkG9+BIFE?4=cE2RB6!'TWA_!LRa7kRD20]W1CJ? ^l=_@"2,0JP9j_T^ctP %G]`,A*itdK<ojN0eLbk9l2oMb*,rQ3o0DpAY]0,TPR#M@-:BX4>#8dB4^kXDFi[n)l<tPCC&VNs<6s+gL) iUT_=!b+!dT&ocpb59 %IINbLZ#bEIjge\WSq`PW'-O'a5p[GDn@X0%V.IXX+b!0[='m9nl %'23.>7qj[8PVd\tD0lA9o^/2OA[pC68dVW't=pKXQh<=JW`c %-RNl^\GV(-1D`;#q\XEW5gP_SIM,2"gr%0q*,QKh\\(RqEN%t[\gggh`MLA/SH@@HJ\15BEg`<fBP\o55-h@X3rFKE2J&^GLO?j %k+_o-0dE30"<6+npU;/jY_'Rdo7&20+BbF9UmBZG08#_tZto'XcSslKf;-e@D8oYhl2f277J"l-V]! SkZfEuD2"Gsd]4>>%MWI4R %ePX>Yk@sKT2V@?I:YSWJQr0ioq[/NV-n)TOJ6uXA/9uBf:jBCLB8PpO4AUGn&k&G8Zn'6(qD(%:e>c! =4"lH,o";hs#(KD.l>X*U %^SH".^22'11(#V")6h>YAua2)?3^p;E\;7b/$WQG%e\0q$>#:%Ir*;;kX\`)/ (]L=_.cJt_^"uLj7a"gIL<EsI>=,%=$3rB#L?L' %T$IOInc4P*[U!(V,/]kZoijsdp,War9Dcr\XPV=XX.a3\31+p]\H,&qllIp?FAmDY7<]b="=0n %m[H\!)]cVj!1,5R^;(AVMZ[3Q %>tAT"@`3#h.gFh^"BmMd;.4j((bGHr0XWH4`Zu_MRl61,9^m^GRIdigd3*S9a+aVbP@YIeIFD"@;#S$, %Xit>;%k63%G^B&&+Xe4 %@A`huqY@@f:Z`-]<CQlLUK^J;Kc)G!.R^KW&I@;F)&1+!0qQm.=!Lc/UVRf&"_3X1>7p4i>on#C&CWC'4F55+4">OZf8Obhp3to %ibG/I3:(5\N\&Qo2,h+5TU-C)%5KCKaDQPB&at5tqGKeBh1Jmm"Rf*h3&IU'(X.g^Pi#1N]PFC3:mfIYZ^b.Ib4eJQ]Pp/NTT;f %K:tL15cr7>R>AS1CfN[Cb_9UW#8t^]n[r9PbD`C)5VOla&<*(jh<nrBf. [Yg7,+]o.KI\)I4_Zc\fFYt>Cg!dWO-j4frVB)eu!&E %kd2&8#cA)0h27/*7? eH.bsp#Rf_/4@)aq$"gpi[.OuEFTY5)f$gN_nrDNoedXLN7%Rn5s)_p_[0bYGK_H(Si*1ZosdbTA.gg2-=l %^tT\(cn[u,nMfJ"s"_]D#Xo&I`UMtu^=D2::"Ib&C? o@B7TT8CNb'X+o33:E,JdqT8\=Xq[%s`n)@*SiDqa51b;?$H^qgYA`oiub %mn9T4U]j5<0F1R-&st!)0>k\J@5PL<>,M+P!M;`q<ZV5p;&WuUZ^BUDZ%'&<[km!5WnJhq"rVAeYu()bh)[,J*eLhP"@,JRm[8= %b8bBm\l^USY`-ZiP0d^)NDB.X&Wo0KZKO.?ded9I*L]eOPK%+go`*Z.p4Y1PSYB&5@XZP$;F$fdKZ<J04(a.b8-W1g%Jft-Ym/G %Fk;K`BNF<Wj0!C7bp;bZPog]ecBk6.=e_pLoPDkEbOEi#C<7b1EJsT[fnBa;KDYHuAde+hQf'lbIj(:/Hg9F0-Es,.M>4J<+BmP %P_;HV++V7^Q-C9M+%EIQ<T^uUAfd4?2'_@rKT0Zi&eNR;kM%*X>h.bAN/8=<? @@oNZuheE/el=R.MUZb"(4">+u:)7\Uon0N4[Uf %>M`]m*nbR3mA5>p6"r?b5CpsugWs0Da>A]@cSU<*isEW@@BZ='=9iU#/,KFP"8.&gZm#sOj#>uX0iP1V2^A?JeS?rk''m;6SHR^ %bHo)*9=+ih1Z7cWr-f<CF5ji6`Q4?he>:#6\Se-Y>C^=\9WHtU:^g"? Ng7iV;5;mud\tB;/CeQ@[j>k5Q0,*(8];ot6r1pB;/oOl %2![f7.[L/OQr.R#8dauuVkM7p,>0u<,La7&r:T[9]#I_, (gN6'DFb030GY2O'^]&*+iRofZ/r&k/pe/8Qlm'YN3ef,-[mVd@Oge_ %"X!%qm1Fe=>D*0B6<Ia8!<o@9^r=0L$o(Ec`[D0+q;SF#Cg! [(D//`b,8d!,f!)8O[0k,0eII"Md*qWN[6%[@X4T9FN8Nst'(e<h %lT+L4=-(?T9^+.AN$BKe,2nTcTPK@p^fS7hA"%96?8MeXCFo.%K*$NGOdA7/n(C_[kOsJ]4SFIc?'O[?DHG\OT=HHd"`hNet<XT %da82jL@qflaG1W^1hB$$VP+i6S".u[k+=1!=L*N-rCGu@B62ViL5-n;\mtju+t)"1&ZG$G? mYf)d`0Lqe1]ZmMak',lNTc`CQ3ts %fdoCgr6McfY8tdo0OW&VX^u=oAN2(H4VY*Q:ihdVj[eNCgN5mu<+KSZ7Pnk<T*s2II9hH./XVb+:Le? iP'WRU*T*k"@!FBgeIDL= %c0(i4?-pT`>M]#=^OPju?aM]O-PVR?pN:h1/Uj<'.k,m\]ZU0SV5!d:>P7jqBQ^Ri1&/N\KoL\kGLH?? $g@2CJuk*.,gTi5XSp[/ %AX+Id$D-U)<4)dt!,H+d+Bk*Jn:uFOm1!A,O/W$?[qWI312@1<s-? qR2P<NH(fdH,m+j"&rf]O@Yhf)=g,)I<6X0"MbY;IULVVcu %gZAh7c"hs&I;HA^Rkh$f\>[u'8loC0j.@air?(P'#1MaF3M,4*Y\uL"HToBBDKrkTO(cehD&d\Ko!! <3#j885]"_nX[KQ40Yh%60 %=)YkrNYcR%ZO\)_BcK%5p'3qa>%r,XCZs=]r.4?5S+pq^Vc.tei^`Q!'%.e7`+upE.)Y? QJWABac#ll]kB^$CopW%2JZJ53e#-oF %E%O2l%UX7Z-p5mE^>YPHa1! <!]adN@H>2TS9oILFD)3_YBTDP\Ans$Pqq40Za5Mfk4<FA])EAG[On9].k#'WWD=?r=W9$SRl!n[` %+aS@u5.ZC"dmmeGG8/^^6@lqB!53oQHnHc%Bp(.i?+U6Q?*Mk_IbR#:57E$ES,-rR&al`kQt4dnAc1HjpJ&(.XZ>BXgXO2FK]^l %g?/>;-og,f%n]qOrZI[dJ\@hu,O$8+r-iBCfFBW]HU_?Rk\n<=gS\P,GD&6a25F*W35g9pG,6mn? CsXdX>U8P>"Fn7j)(_>fnlA5 %l2QHX%;=Fsl[f:-^*[=flQ-=R,%->0IINI>j.'(Q#"eBX1_4q=!HP2_@TdTS! uHHsDQJff/K#R"mRWg;6H3/:`ogLDV&I%`aUrge %0b'J4FC8ulRr298jqD-1^H0<B8*e=)IU:[U(IPU1LGF9p+XQ7HDQbd'c<aAFol[2UWSHVU^+%P? =hIa4,@=K/'S[IFl^lt(o8+g> %`,hZ[^]!8>5hq/'O\\prEV9mUH=gjb'b._7j!\59b//%Q)pltOVKC8C#C#QZq) [m\^W3*/S_;tH&U1ITU``t%;U[<Za,WQfhh?R@ %4<s6>NH_X,XRQADXu%VP80^R==uK5XN-Pfpr::Z)0ZarPSb02HO-<7cqoDYT%LY>! r3=KmqZ^KEBkk8%7n_BMJ8&a_AJ8^Q>oJ5> %O5'X?o_g^_D7>QX-?$u,dE&R0XL,@^isdRmf,er,7/#kQmP=HFqd1rm<U%a4$PIi+0"FI($mn+piS0ABqp[dis'V,A@_.*fPKQO %=tAu;AT'\66#]!SN\/;o!OJ[KG^! E5ZTV4&"(qk,qLLlOCE1ba&pE3$r(s<aUs/K,/ciB&UB>_t@ZTNQ&th/.GsOE@57Cncm%/*I %P<, [MVi>F7j;MK3c^&*c4P'EiTqr#WO7RJ]mqCcM:Ii9K@/1pC5;;tG,"%.)<;IE"a86@u^,HC8,#IAMQ1bKan mWa5V__sb5+"c8 %b?ZomFS4AC1g`a3Zjl9.HNO/],k0`7E+G;:R?V!BVhol.!;<Nl\FtEre! lq$p6J7UgU:F=JcfoL5mc;&5KMtX@.1&a8@h;8J"57Z %Wd^VfS%h28I5mO:7gK-mb6.thPI-N(1_'CcM:u`KB,*O7+D\P5q\dJ$Pb7-dXSI61Ar1mcF_u! 0D1FmLJ_WW)%>LKY/-PjWLj1HC %Z%QN95?Vg1j.7a:@9Z=2h02h?U:<!nT'5r%;Esm>#B`;S&Ud/;:MiOIJ^a9?C:@mK/Ig.u;o4[)$$GWq4! ^??\Xn;I'EmUmA-sJr %rpm0to6fAi!W>%-pL,/524a/Xdc?mD>sQi2kh"?W9r_h&U/pgHUlSJpUn8=*D,U %:Mf.s2U>pp8G:7@_f^XP0p?#=o9\DEe^ZT>> %UkibN7ku0NI;maM:p8?^_t*=g:1nc3k9X@Xkd8F:HdJ(HDLX=H2?`^>.DsBNn.p@M)k)36n>qr+-;! R0SrCg]RD=_4)mCf?[&F?H %5AZ(WR`X(S!/4!910K=06H:B:V<aZDE]"UGdS8h>C`/-IAs! [q41UfuI_cZ>6t:l4VO]p;HU"V&]Ua7N5N:p`d2Vq1Bc!C^%5@R^ %Lpp=tZYnUD+nKAko@Bc-oDr;p\bc+*a!kA]-:o:kY!OsCf=oS]H>sHXO]?9R1s3n!(+mZQ^eNY9W6B^P.;fa.[WgZ6&H#^(j]%Y %`U4)RiuEJ]a"r4l`Y0fidJ$'#"(>!!qRQ8PK-0T)`97=%^@bW^GG0%eLe\KrU84kSC.0k4G>T\a.Pe#X %N,QY5a=>dfj''6a>;PM %G&eg2d(LRT<nQ.*'#I*e`6/uhJ0h]/A$!=5SN0^l@LdijO2H,8JJ*u"F! @iX;#T2#Qba1l3$IU=fFPlXFBFn'iuXj?W)5&u^aXE# %.j1fkJ[$%%&b76P2V.tR%4o9.(YJ7P5Gh\tYqdh[C`GuDa<m3?A86g3M7Nb!s+Ek"?DbgKDq %aJGa^(GUY(pdq>)Wl_.P?".R4F` %&KkgDkXCAHW-HaAA*-?>BC\+2i_?.rmf(DUjb]u^;VrGo4>=;p>`(?'f6Beo-d0Y&OQU! 4[0Nof[3fQJhuuWd6*S0^lUX=gWb@Ai %=]Es5]%Q7c=L?gcAQq0\aKarG(faX(HE$8)Tgl"cR1"nn75G/Q[5!oG"k<dT!CUj? i(,I*\iS9t9r,LAnnTE5JWDaW4/3ZSpFnS/ %Zr5#]m[r9R,uf^neY@#)m?2p^.cKW8;_C)=.B0[B4D.C7Pf86KGu30F0rQ"ll@5cOh^U=X'Y! <a8p+A>l;*9r5cQrm`5/E$>=6&+ %qY$SC<,n_+-`J\SqQ[dg6dPiM8$'D?E7%KG)&o>sIga-(ofT.1Z__Dj,5kK>IM]"BAs8LjJ5[VZ2cO,qKj2(&*.hQLI5AL24UOH %hLUS+7FP*RNF4)RglJVGlnBJ402+R%3*M*X>'IM_JY<MS[AfmJ;3F?O-l%hnfLj*5U`)$1<! B]_2]gQsWDW/qk,1V,N\r$*i8t0' %<C"*=0OB<#2<Ua.OQsX#q@?mtYspVTR^;eam8&?V(OFlbH2gBF]g:uO% (N_uB<DT0^J>kiLP6)<3QS$';cT3.V`g^>.959?5bt.7 %RBTo+j"@.$oheXT5\72]!D;(4bgBB%7)K4-_+3bPg@),p/8u&o^4</BO_Jhad9oh^,Hs"o$.R9gr %ol_SG8L/*[l;h]f0VR_:MV] %IcAXm.]jHh0'-'CF;-(MZQC]H;;e=2G?0V:?jab*0fc?I4_ZUVS4ZnW"?drTT%LK=(j)%AM7X*h? `kGLa;;5ER#EVkqa)uYDo2AB %Gh-1B7sR5g2tV)6V)L5T6h8]"rC"hq/b4G02qYhbc %dH#8q79(cRU7FW#_GuP#NR1/fk@ql+XJ/Xo`t6CZ8A?C^ek*6F@]R<*RUL %lO@HdP,GjZp$>RRZ6H>_j[[+^A0"B(o(iBC.Nk8dZ'jBDq]pm'\L62Q.I9H_2kg#Wr %Iri@BW2&]Km\\iI&#=eu&T]p.nPRV9iNu %7*A-l35_&Ib?-P'29FGu[1a7?e=(uhDc;M&%>tNAdf%8ZRO0@`h>aEgHZ)e#M:T4O&NJu=X]M:#3hHJ? WpOPlUJVk>rcp2#qm4AF %i]Y^W$#[S,*q#r.lp(j^Ou\]W9jE-bs3'nU^srajmg]?frGi]oKJ[>LC,XD,[$m-Z.K1R-a"!S"% (QZd_:M6G<8V)hB2fTa2['iK %jt$U8;^X53[.H;E6tHJ!?oh7m'+m)5"ToK=pjFuc<Beu=mR+IB-M@TTP.@]=,]KQG'4IGfE! ab74an:HKTA4GhVkqW"#ChJBu"K[ % +poki'oa+gDfM:=q*DJS2^I#>__RYOX]V'LC[I:SnI:A:kA`VpdkNM$GsujC7mZsbHN:RkUV59/*.FFU^G9 [G2V[)5a1VhN^kZZ. %\;iS;/QZHY/ssRb.]bZk8I"4\je?[Y^6a4d@*8`A"F*MG2M3:2-p]ocGcpk'Dt!i-+) [6jh;0rfq^i/\AiV@K_D;(&UJL59Ai!&6 %/rDf.$$hmuF@7jPM6aOY:8MWt^q4?,a@tSf6^A-T0$ +9eY2ulOCrrk/>L&!;HB/=$maOuZHmFCbdQX8"nco6PQ<;&#2b9*Dh"EcZ %=0M!S"if1u]DtZu"dDgJ.^pR0X-r`6M:9V8L>$MZ=>WjT$oL=#OHET5P.'_sX9ZVuIrIN@dkRGTr(%oJ.- ZJoK>%266-&?U`if't %ZOFFNnM)p8UN@&I<_dEpC3+"T@%(N=1VaUn;!fU`_^8ZJI;:oP!>Z!JW#D!t:e? m8e)j4ORS##=,7Gok#/;1>_iJGU3;%J@nqNa%K_Ib%;m_$^AXQMi(d+MgE@`2D?>;&/>ql.[iDS;niFA9f_Vj?_jrli[P?Z0Yprl=? UG<>D5UQcRlP'P[4)t9K99FrM6!?Q*R8&,% %I3m:YF>)tdmV/Yr-PM^n+Zs_W(,s(kW@bphY&,cp-u-*j9=#M7"!@Tn3gH_a3=(tO>@XQEPqDcp+:jP+S)EFrIu&rc9>*M7eXHX %OVUMf="a2]p1at:BrItCp<M<L7nNS2T-79AJ+o1t_KL./WS01P'p`6m$P?*r4>?bd?i5Wa%(lj"-? [];&;aJ%G_WCefY@(EM0:_[ %0I;!GUqMki#:5b>;M$t0%!`h,ksTV@!e$NcD]<gdm/\_r4PI@KBUDpP"M,RZ;VuF=^D,Z<D>VT]a/LfQ)\j+2asGTX[so+ePbRF %ZOU"0/qM#[9W+k_MPT4)5muU;&#;3@)]BI<q@Q,=S&q>O+KjXTmC&t4@-)IqsAAFB]BO:4\9NIW8I@EA`*YSNgP0KjsJ;QBLJW %L%V7Q\^^[Zf0[Y[lnZ4j5AUBmRo\p<m]F? 056;gH6,,k[nP"t@G<"i`+Uf'u2Wsq6kRJGOe2GV]E<9c^9RiRI&fJf>ZY8^ccg^F_ %#*7j_8]o6`3(::hNl9#-VJ]TA,s;b.J#Y^.>jIH+h#7#dQ^Omq[V5Is6=#V%(-:E>():q0Xp^'*A*_871F&N>sfPh$TJP@<]%>; %r39;QYjiZ\'V/R)bp)YqT4?u=m,P?5na[,%&'04=fi.0bic"Eb,RXq"bOO$25,F`80,b! 0ocZX@:GdWGbH@f/X)S*]`?Jl0dI7bP %1:.m! UfP]V+m`Qdd>\Q1FFP5,GW)He4<F9[3o893%;?'*q?):d;4$]Kl4hO8:"_0p3\o[GNh)87XBu'=U:Z+G&8M*eo2=r>5;Uj %#VL6mellM;7F(11]R[O`J6Yb*,3EL1]\J,(F7.D[4=3Jd7&Pb9! BKq"R"o1$6R$Hiks0J(,TeT&&&c&u:J0RQ]WAaQ7.)p*e^8PQ %@NN89DY]Qh@.gO11E"'C$n?4G;9\0LQU8Fi-@07Jp"n)q9(n=!`"fD49tTs*=qOV]Pg@"82`s>HQ__9Bb#XZs3"Xa:L'HPqE0<> %ZdE*ZQLViV8J"V-eI8!:ij=/5];l8RXXu %`kb_J/f>qIHXRYYZmVWKuOfAE_N0/\O5f6Ygo$pkG9#0`h#F!4_9>B!H'(<K/`p'SQ %Y#ip"HPrh"7\)uho.CsVhNP;o&X`=o'YA>lo<p4?&&\7'BUhj\$1(3>aLEW_N4)6\XV]3WY8.biZD0<SM2MZiUVo%"ErB`X"*C6 %-'Gj(m;O#T`Csgm!HeQCS_b2GMYT8YmYkV:o3&f)OEe;]. [5QYit6Gj"(.:r&5,+CDQBub[">)@"5`Q=R&-a16N@@+GsbXD)Vf/i %O8XJEr.'_Ng>:eu)MLamDa,JB(s2nmA(j?$IVam6=K-bZ,9q<MYV=!bRRdX#]<r? f_slV9hOWB\M#[18s7'HFq2>%6?iKU4YPCE5 %6fHB?H=[R]/If;L^PVnq@dmq6DN\?l7*%>df\f>AdU$N;ei$uEJcTuq\1(U<YCk"T)/md2_U0H_:N_ZXP:ad=J4+3Q\M<8)5Tl0 %?5^.BRfYAi8BDN'342gYY;I*!#d2FG3Rh4S6bVFtUC)]lWP8uRTdV7Db26o]\^&dt.gG %NU"M.Q*0G):Dpl&-TmAmN6%9CiMAoNK %s&Fff=id2AjNcPHWJ1ot-r'Zj07U7SeSFU#&S7lNO/mN?iof`)BR#H@'7S7TEBLW"q&V!DLbbm-M0Q;A %8IEc!N@DOpK0r64VAIW %\>N[E](jXNYBa`"[`&5a'U4PletHAQIZrh0qPGkEQSW"_R5PLE#6JO! 0u'QC8j`ci(62CG"VJ1sK9O^0Zs\K#K`Fnn3)S7BZIJ9* %?B=3P^>huFD>T-a,<"GQrch2Y'0U40/WPkD4JDb.B//:7HLsYP.;M+K;,4&3Yc %t@8ghe2e[QZ7jPAtP,>4"e8q4>H08>SV/oG&g %'dTS/L-7'2:cbsn^i.G\P]AgH(?W! RB*nVu.>SO1iZgs^dem4*,NP$Dj04`YTu"jo$0o7NYQ)B(oA=uO\&rXh%r8^=9"FoD0E7ni %DV%dM2=m-N]"q#-"Y%)(2u)Pd*+b4#"T!M:k8erB#K>O8$du%no$8VQC&<c1$'m,P.6Y4DFDlCSP,TagJ! 1f16^n=8<@0DDDt&Qh %TrZ_j%elEbh(+j&NS.-9A)Bi\\ZSsVecAQmHa6"?*krXB2--MBOc7CoTb>eoh]no'E<XckVm32G_pNJJ_m[cWiB4/l$:rcfSn,@ %S=6m6_<P'KZ=I`2Co,)IhDuVgIEcMD8uZJ($i@tY/+ggc2URG$cIM%X%Z4_t776@k? r.1;.qYh>.*QKW4gaMS&">hsnq*>DXj'RQ %l-efZ+=2nlY^:cDeI%5P#?$aCD.Q3>Be)A-\4*N0/<XdV*D\,#TmO;6$*3q`e4T6M.egg-/`[6V7a %^(XdiAcG8f$McnS=2B6qI% %D3ma`C"hWUTOYX!.nAjH9ANo=Dn/shiM %>50R1_U@_S(tCque$A5TWl2ChSX.pJ&ANUo'8FcJncg4%Mj[6[IS(2Z"1BU"Uak&kIm %Z5]KhNAIB1Sc#:lO:ki]W`'ut6"buDN5,I2\;CMjaX1e:5Cd.$/2?%>,I)hiVM\0_IfB,FY;5cc]LIIDehr'Xlh4gc;#lS>eP3a %(G8c[eE58ld-;),!7uCk+aZ"g!(jV%QY4+L>tr>%'$Se?R0@dR_lEqhY6TU!\5'qlaX8LfE_/<N! 7LM("XKe:!*Yjn!No&,#UHKP %O*CjtTW#&RWu>f.#[fG4(fh^B+tkCs4d=X*]p!ORdV?=F[cnF/^guhr`Ei[9O=U&DTc5Di;uXE"SQDmU4<;<c.ITOF\Yc8H$59Y %G):jZ!M3+HBU1G6o+W,5)79:)Ehr&S>:$&WFHPuI6l+[FP''!2#/h*2p9^2i>POkGCEpip? 5d46rEuI6p13O0"V4'.BMkXTi_\/h %'[hqPbXaNV<rZ_8$]e_p:a>HJ[H"H4.d>M! JE2Db),goO#OS@\1X'Ui(8@6`A67K3;OT1f>NpFpAA,SXkiZWE^S<tZT*FJ$Nmn.' %b^F;`4L3s"ER7f=T6R@MJG$]!TYT\IHR60eJW_U]_! %kC>2R0]h<[32MegY=XS@D7Z5%P7D5MjiqpOKSdS+V%5+*TVC6uN2cNV`8 %_s4Gdm=4WjGOP%.j9?A/Y3Xbr8WI(MY>8? nR4NJkfUbdBO;0`rZ$p=[S*=AcXX=2\Dp;=kDX#_eZUTok0%.eiG]ib@cpKT8Ii,)R %+VSaAj-)?g>.'G(d+Wb!dYjE]"s2o=-'F1keOp$S2.kljW.?q]7qHHU %9onKDB9K':t\:,/PO8-;c/2o=Hj)ACLR;*.0=js<,8:c %4r`)"7'+?=$(JC0#oXWM_rO<Ge7GW]@*(JFBBQ_OE2TsZ_.m3o]T!WZ)/*g6^]6"t<C(*9af)\>PnO_+o5`o\g>OcK3PU(iBtQg %@Ju0;dTZ:/XYF]&R$FXb)l..\Pb&RSJu"C[h1or?;U"K["Kpl]"s_:MOAgu>>n8-'j%-NO3DB,meo!.l.: +[!^l1*;jib@ET4jd+ %jo2mc1d^\()rpT'7NdDl7$d-:(>C&-_tYmR-@=j%X$[C\YB0_hZGM'pW9Oa1e=B*!? XN\AaN(SMR#iMUemg?O4j??Y<&PpSZC)ON %WK]DFP,8p1k?prZe=7K9Om9L2)YgjOCf]8&%PH_;#`2pTJ,!s^ks,3s5QBj&s7kcls6p! _fDkKH^])QG[eSbZ_f+bgEG;uR5Q:MO %rqCpAVn`8P^\d[gr0RHST7?e6Q`pGV^]3n4A+5!Gomaj*rrrFShY!3b8P7;C12&DSW4pg0TM*mi-n/.HHM %J+nB\$7du3L$HFoMg %dUC<T?6GPC'r[mO*M<2XU3fpR8#G.PB&./Hp&ur4PoZt_I>E!sSp'U%&I#M\Dq^5_%.! SU]i+eogfJ(igHm%l3KqG:ij-Nj8$[7] %"%Xa?#s<lYL%q^WIcs*<XM^ZPpO0GCNEQ>JLJLaK%R5<=j'slJJ$kq!#/ %NXmr9*"P3"_<R[o3HdJ(NS"c$\a]qn_iZE"tSY21r< %,"I9?oW3lPn6&hL6ELBJMq(fOCRGYO1qTDnc/@22`*gC862^MGa/oK8fl9'QUo?l?R^LQ_h4&RRM](5&Y %r#<E]S%\O4H[C=BtZ5 %7j9IIQI,uIQ=AZnpbJ[SD:57p@BcM%.)afkcpfu>J=3crT&*WGC4\ZeZ5mE`Y'OFDVQ]t9P)c7jD72LY4NUM^r.9sE_\jcpXe6e %[.Y1KVinEd<Z!i#Op5:*<JW1gBQ_aih4e(<f$7$]od(?.NpW:@]j[Wn-E^Cf/3Omq;7`]@n\JYeP6A*s01PNU':n9CL7MNg!ML` %mL5cE+d%jMCkC5iodae+BOg6g70SUZC[<Q;csd5Vf@bq_3s,4"&.R)=2(X[2/Z5GnbI9"h`G[X=Z>BVKmUZc1IHuIT!TVH>(0R! %5^s<17`@8g^Tk><m(r&*^?SRlgYYCT/_+fVV.Kj8qs#BR)omh@YFPe`2:Y`T?HUaP3[*Er;OAorf*"Mgn\ dX"@?J`Vs#Ql&NUKj# %q4o!TjOZ8P>"osd3`_.563IL.1c!9L._"<h`CEYO^0gmE@f!<]c,8:?2K-RZ(;tb9@L=(prB[;a]N=8Q$o`W:t/gIqG]RJk\'Kc %#sT$$1Bo]tI6!RW6DIiR.e^6CJ_DsXWERcI6\CcBdbaT,Hgg? h]Us)nC,TNV$UbV"Dl\a;=]"UC9i.jW"Cfrjg'UM3elYma3B%tG %S/3;=6Og%MW1d3MV@CcM1dN,_2c5N!&Xq1[CX$C4^o*YSosS<62I4"(=Z]? OUJ,aR"Roi01G(d=,HGiBE8G;6HQ9uM53c"YDbnnY %*a^6%%VdGXOZ1,tYM#mCZa"B]Rk@ne9@2+B]tGYp0mta):qY=TeS;=7:!qEVJ'[a?"da*l:p/R;2[FAY]`J6$SWl.6//[ijF%5U %Y0/o%(tS'16SCi_%\kD(la%gi@B']mSU@`'C(fXVIK4$8hQ00fKk9AF=lXC:@,[p@iGoo? ce[ZnQ8l4P+#e=U=OT>8<AC&-d%j5u %1H;!1fYf7jRPdGT"]`\*F]6LpPBR<'C3%+k-"hQ*U+KbP1A0tm[WPY`kr+h72pPg"<(r>S@W6&>8` %<\iK6o,@fF"?o/(W_E\Us5 %bGqA.JLi1)f0\TN;=0d\cHTLELOKm?b,"\]C<[8&Q"qLj];.Q<^SFH0,0r), $hYrX@;N#'_*gJ;di@9($'/+0GpfS^.MfgsND%Y< %*3'82SMW2P*-q`>K.WK_9Pfe,&F+?"$uWShi'RsFEgm4=-%Pf)UX.UnZ4nBg<r$,5c!(#'^SUVU"0C$EM,#\(XF:A2J&>r(UIko %cO2?[-44:epn@[:Ko,%p-SWeEQ5V/W0R!_Jl?'Qo_=0.Bn_aSS/%"_r8!Ed^@I]gL-]O0*KM`\A*6:H.Rc2FK)^1=pg>A/G\=i# %kn8;]e"=dds1e"fQChLLIp3;d/<Ac@)9a86K@$0WMd<^'om=4Cf@oD8D+B>1U:@&'+ %eWsRi7.*q9.]P3$b#*?3)SiU]B=`-?rOG %J,j)b&4i5ATM;2H!Gdf\S0Zt_\:P6gb&<aVC7tR3c$$3a1BJLZb;AQi,/?=U? Q52en]@_@$kfXP1+Nbq;8XoV9CTo#Mp4KtU-:KR %YtCq4p3XVoQnF.F"gt/'2Ne(pB/WI^'BNrjm@7PkF.`J8AMQ0`EWkj"[4e<#31j,ipb\bhGk'UDj$8BZ9B/_2Mj;Rcr=gM.]-p4 %,rLc/@q2.:iTY^8M>`XcEd7jU:ofBO75Yqiga^?M^rDCIE=^ji8\9,MgA6TLct_\O*p\SqRgiu %UurX)jffP&CV(>n<m3rlB!D\* %-G,%E=reP"h?tP4REYb?Z.RR\]_4eDQE67&1SQcRoi1P>-(fI=%E&TN<Xk0\mLkF/+oPG'.j<*8O0^li#sGJ`<'0'a-8`Z<a]]q %9Wt;XHI^5#%hu?^6<25#Gj>lGnc^(.dKN;p`FBD?<'Mc0=QEmr\?r30;hrWGZjAXA9b %@&+/N*DE,r6Z@u=3?R!08dLNdo6eURkO %U7dke1>g,U^qMFrk;$$"'.cd6-rLHd?`1^BPER:3FrHG[T`@Q98K%(0Rt(rajS1hTXpiMI*D,! 1F,hGi_(qCoc]=n_Q=8>4ep%Q+ %@(jZOC(_;A`0]8]/A)blJqZ<fX#-HVL'nDZ:h2b;Jti4!MWZ@&h,;O+<<\seGThW7m='C'AlYlc_/ +#Z1,aFjpbd#Uo)cE9@j\Vr %`#?\ZUi.(YX-!]AE>E,HA7Y/mdhY+_a,Q8\$hESSK2;YCrW(/Y<FN"_Bj?D.0! ^o"4`GjChCKuDWl:I6XIE>9LD@^V?,3(D6s\nf %AX6@1!j-hZD6m>QM\qHR>.o$</V`q1ChQR*M@u1JhXdGJAe$:ko-*J8-]09Lqa! NlU_p/<DX+6n$IF.AlgK*m6.>K$Yq@IeQpD*^ %4;VBu_c)r1Ir*Pf+"kpF"?YPB\dmX]nFg#h;?3a"2'M9GZ$d7m#rS1IqO> %V,f#U$*=Zh1eMUb<Y8.e*O=St=4jCqR8AG)XW("EX %m+l.ea`@J)Q::A6Uh5<!m:,gT`gNoSKN.U`<^^i0;s#CfGr`U;Ntc!a]b`Zo3-Ws#niY9n[8Y %uf@gG\_B$=))SO$k3Y(b7DE3-H %$A0.O<AQ>dd/J]#SX0rm*ut!Mc'8N:/WC9gDTf+NXd$t^Lu@?5mAsIT.[&RTZ!T!`m__pu-g.V+EcDuA, (h1/edImU\CMmic`s2n %;F$]r,MMB#A$4P>gI]3n-SMR!WJ3G/3lq3#5]7'FD&k^4=AptmZtcg?WrrZ^`6)[_%G%7GP/S;? ^2PBjPFO1r5r=*h[?RSS<L&q' %>m'*O#h4_T_WXJFeh@hSBP5VlfP/$*-#'g@)Gk?CJSipsL(^2C4kNQ;*Acptpg@o %"u`I]_NXrm/G5#0;DL9kPsaJtR3KMPF:-K% %ONp#!f%#Wp0lY:e]=%akO\ooNb2G/Z?7H%QCoafMTpb@sUGYGi$jT;q>@t-+:8q3<<Z),2! g;BdZlB7T)G=FC*_0+0L&`e1RI`J/ %('L`2s),uY-0U2i2#'U3B'*F8Y4\>Uckq/&=j%q=V/+=fn2"p+X4cm&5RDh5EZ4QG4j3SNs&6<BI+55l. +i8$'XtNB85E!pScStK %ehE8qcB0>?P39&WK&ic/e2?XWh1WDG4YSG#ZAF@hXB,/uL00LS#(Fk[+9@.g"POq/n@HJbS7,#s39Dip=>@2BnP:Pe:6DC#!B[t %N]eSu51urZ_pe5ZQ`$`#K7Uk5=>%<7`HnqV?2a(:T<gsshKq\KA>rJTL!ac50Q(F&dMQ.b;=e#JT8+1i[ZH3h%Yu&!`#C+VJ`)h %NTIgpQ7^(\"]"V9@Zm6mC]MA9_O0E(:45h,I0t=2@c0ig/R(CaZm]P?Lref+*Y]d3FU^IiYhhVuF@\E_H:_!3``YoToN"]]PI=G %ccN&^SF1+W*1&QfBJ'M.S<oJNT+U<k5rTU;El:1o=5HF/PeL)V:]n'%Dr\KXlV^d1WIa+ZWu4]dFgpH5n=#cE:t?YG-#uW"<,,B %"VfmhTFj@(*A$&E@s,`PfjmqWJ2JOm:q2pL<u2nrjOg;*'h18?\&MQEA`2RJ"N@Wt*jM:doH9o]AVNM6BW 8WW".'0lETan+&/f#7 %KGuFT!]UB3pU,j&:pmS_%Pi.96c+u6KA>'.jf1T<=`cl'r*TOWW'6h7e.,dgQ`JEBknj[Lp+Dj589D6)Q1E?Zlk2'\;4Ie*l+)A %*CSBe#R*MiE%:'\^FqmTE*@,e7*_1=SJ,34hL*lTgB((`[K:o? >>O`f/XqQm9hJA^<.K:r#@VnL0g_;J2[ZuF8=M0'c"Bk%mlL)) %`$a4Wcb.Ye!:&'ED-UU'&/&DP#0YE)9PeI..=R? a]<PtrKhS#B_"6[Y(8+)D,KO`s]h<+b/>@6j=',rqM^C+K1QMWJ.r3I8i4K,g %9kG_k@]c]I=;B%'VP9dXZe<5aW9S1YG#\@3Kn=:PqHHoNEuJ\of7L,4UA?U1^U)JF."$'KLt.FRlh13,AWld#;)tH=IVWDpN:1V %Yld)jR,R"rH?ngJWsCY&5Z0kpB_$RH*b+>HfbfQFP7H;c4r$A:i!WM^<NutGqD+MTXTu6PJ4g(M? sqBQL<H(h3!;Zg=ES*Y;Wo!2 %-:t32`kR`#58pbZ=N\N`WYbG"P<T!\-u`c]1KHZD+0M>j:;dmO^kNuZS6H %X`Hj.6HWIl^"V[iMj2>>$J4a/!N-$'(U"U02CM&:W %!.m<J0n3o*%'B!B7jhi$95`=u!)3[!W0XfqU)+V3_5<R'.K$I/-X[5%I\0c;i">! QSLIibJOqQWRfV"K"upA22I!G<_q7!:2JMD( %0\?l8/-REBkb(K)C0F,@Ej)a9CtF!%3m-97nEI"Y2MeHNi0X\#Pq.T=M'4,[6\)PfFfn8R#mt:Hnq %QQZl\:n_c)TOOgPLQ/VA=B %/<9gY-gNL^%(fH[m$FOl&1QkrS))"=@OVtg&l%-s`"Z=hRk,(aUXhes1En"_Lqpf&cVU1"`? @mH/J?\Wf584Mn>^cMirM8nh'%LF %7cm`#,+bV0fV=5!VV<Li"I#-r_=Ls6'WtNH! ^09OHSK_'%1+29WRS;KA'3CQ[m>0^]T@#eog'Q-,l@>AaK39H5RLgJX>UZ.U<+aH %YcRDjo=`(ZeXB%)fOQLIh!I]>^D0+c,D-.a\5Uh9l(Jjn`?^CKI['8iNbjULXq$cXP]n0mTZ^%*?? >rUcce9>*Qfmeg8Q9h3(=Ri %*g0,9$I2>J%dd9@"hE:!7[1)r6RmDaZ<nC5"Oa`$D-b1>RCEYRc:nZ.2?OFneOMQ4Yt`WtM'#rMDIkad3! P^5do@1i*6BTl0^pFF %5F.H&65&Nt"+$p2LR[@I6oI%A'H$Qf0s7J18lH[Z0[!&qWV8ho+[oR*/63aN=O]W**61*:f88sQl'W9)k %18&!du<W[3d/#gBc>X %\iUfLiRnVESs@h>je<AXK6gQ3(0IB9Q<mqOnhDk,k:%_:X%_V7nNqPXG"Ak51%r_;b&hc_Go4SJs/9]Ta*#%9fK($P=9i%O"if\ %9GE_'\sAP/:2S\Sff69>eLCuWZut]Q3>MA,K,?RLKc:Ca#,[6uf4* %6Nh(HhMU+Z'o2_Wc,Xjf:VN4]W>gKf4l-5i:^gU''PVWHY %^qs(Z5-JZG<7oNnZj_dO<=? @<r@"lfN/7TZ7MiQE[>*54&=CXD&*dM]ecPuqjfW_ODE+PXZ4'/@"$23=4XEX=`l$X`EE.VXFgr'i %<=:0ilI)+=SN8:4#+,;()hQXgG/eNR=^QBdpOcP^$J2!7`SBD:m\9@A_*-YV]c,GK=<(pNi9YQHJ,Qp$ +=P$I<36E.h!)7m$E?HN %fop/*P?)u?N4#MmDf`'RJLNX.CDXN:5\$Z;HoD2<Kfb/M5K$9)6A1T\^iKh#;@qFY*oWg6"a8%c:Cs/L$51ObjtSW@MB?C=7KI%g)1tuJ\e?%C*6tPmi\T7e@6i!Wf#e2_RC5l0;bWPY#f3U38\NmqIX8l$R`YCjafUp5`iDCVq@O$7&g(N[`&m:SrO8ilnZC1FC>L %)&G_=R39UL_LAGe))9n/3ej@r<jOn"LV"iZ)<`g*-YY(WJuTUI>&>YM("Ybe>UJWWV/ugR41*ddd;Sc_S#r^m/&jr:fGK5)qc2U %4XB>Z4EaC47!FeE'Zk[PYuN:;7='Nt/K4B#>)#mbPA(bC)_g)J%[uhlf1oZs11jb2!m+-m"5/U.^nkQH(\ m0lYo7@rm6d@2R.IJ% %%YP$6$!FQlfWD?KH0Zo1T=6BML@1h3nrhG)3\ukG)cQtM!Wn=fdAGn<70Q3ecIDP15V;mgY! 16"a.79TOe&:6$Pu),`LprKeP!5X %&^?\E&@3kEg4Sh,ebYgbcUoJ:ACX6_9Ve,!8m6Vo%XO>c"OO#Zde?j@<hEmJ5\W,1E>N%>UdW^MTj7dJNZ5GIEGfe%uiG1$+rE% %m@e`>LVsh+(s>+1=J20)(*=o/S.IfN3-DEd1KtPC#')FCMUnDA_".ESC"uDu(EfVNVZ("E,5SiV?35? c.Mg@I#g]SBh12P1o\3(6 %6&\\9LFdA7G=r*AZ0*9[hPgpGU/_I*HLaBp6\T.R]Z)E$fZ3hgDBrk_M^@/`@H:*J4>]K24nfDZGU@.P?!D_>#6s6.+ZsX^/`)! %O>.Z*<`%CHL<Nl*JKI$;UCM>qKBk1Kh]'s\>c)h'je*/E[?QaU/NoI5#=GOmS#3q8[_/OIXMH9K`$ %8dqbpi@/M@[!DH]!MTHK+\ %K-Un^k)M;=70%[3)8>p3s"d+rc\@`;=D@@Tat>e"RJ!Eolk'u-+?(jK@1?NTP`5>Ls% +P)d,;k4EEKE4(a_%`4"c72!ATe?Qa9lY %$_f`rT^b4/TA=>]dGgN?`d2#rZY3?a%\i-<,9.cZqGD>I7LV57pk>Z^OqSS4Lba``9T5!(%tpo)d:m8AbE?75claiD/)P1`*GNN %5LBM8U#>dgXB>1rNKWmX"XI7X1[(_*Lf!=[UE."\!?o";k`1ihfO6Ob*hGS+L^:,<;@dRM\ [5TiTh4W@D(GM).3Cn*03R->d7*[/ %^CtRr:mHrJC6M+K<EVUsrV#j0oQ1[gN_IZsn\B%@iRsLolpC;13Y[5^H^) %5Y(G;XXqnZY9MDbQ'3d:G["f^-jT?IC6SX_BYoAm` %`D#X;jNN`,9cBqQsLG`Waa916])a;dt5NE@^nug]l[0Y)G_7edY'KQ=6A,eT/u4U7J.rg6qP&s#n<Xb_b!)5W\X]TZI <+JJ`rdt %9jue^So[eoXisuk7<!RM`L)I#PFD&p5@q$=_[*dH3pC8fNJ8YOFaD0$acf$19%<^."ruKTT(T3o*(770K!Kc^ueQH>_/VINF@1: %.g;Ok(qCBC'=Aa&31*? ipo]rSH]`,A,)ctFn:_W.&LMc+n<ug2]FY^i$bEjH6(FH=g)5ZY/J&LXh@8SVFC<)#&+o5PDRPe2I[\2r %f$UuJ,o;=SUdS%u.$kA`Lm!B>,iu5c]M8XEoTX%e<:"U?bnN %2e$@5pdR2k5C'jE"rS4@5WC#+mCb=ELfsO=dQTUS3RO%l3MmYh> %P`VbOdECa(V-b_7Cgh7E_?;-%Y*DRinB?b@%[dSA+Nh)E*R'@/ql8C9R %:.L7q`/F6[Gtqa^tVLqQY0K];U&L2&mY%7?^GIrX8cp %NT$`.d!dV`:'q"Xb? hJj"n\;.1^D8Q8osP^Fu!\KOE]S+!)q68B7p<lVaj1GVCSj(c;S2JHm2J7(T)46gJWT(LUtRd/qtOsiQ3Xu %(c&s59X1XAehpD2g,'$H&-tg)HUH"GG+XYoS+^cu8n3Mfrok]6YU!02-!Q)sduG>H%<O@8g8-U%/! E7HP:<&fUH#cUC!u3mEJG`W %EiL$q?e_C"(Aeo;+B)>j:8g"m;@qS+M! P,7c'X6YInend'kLeWA&ek24VE,iNa'S26S,Y7)W7WbNiQ\HnoZ-VW4*iE`?f.<'Dp4F %Xja9J$L:oO=S2SHOJV&4l'!]P#,._'e"k$>`l#_^3?32OK%X@Dd#8,@_bN_.2tir3$ %_&>T'9^Y$B3G/=):K`\uW\C)*R6J6,_&b %$3cCb:,fLnl;D.G"gncp.KId(j4k=Fl8J3D/"AVqa665b34"Dq)B>knCKZP2&<ZUEm_j'*"q&Lb,3? tS1&O$><!87?N4tgFZ?B'o %q^%;5@S7TJUHhQujrSZ0X[7/)IJ>KM8d?9F$.i>.T]O"3"aY7<3/^</:JU4C:cFm(C/1-s(k/ [f*Ot]n3qX-+p=7CL/GTqUEi[]J %h\cGIFjn?>(;rf0Zt3:&FWa*h.$;D>JAD]:iF=`L)3=3C`RcC%Df;cedf\q"=sJl\EYbr'! >A2mb>Fh"dG`4T-_LYq]+hDcH(>M^ %@/cj3)-!$M[PaCr2-M+<7fdW_U0uuTR]#66Q?%/UR20jFgi-"?*6)ca70<T9G;V&R'GsWU:i\tR:B8K*.bu\AV$k9,K*0VG%geK %Q`*YrKY2NjU]gASie(]q,\#8.!>/3A\.F:'1*hN;n*,DTVMJ/^-:q%o.7\O %M*`JiM&HZCW(L.7<J_VH<I5]8[</_G_b5q:&@%0> %HS\;m7jL652?r9TM35P('#r&DJCdn=Tr9oX-Na?md2pKbK5=1hYRrlm<`,*# %'#gSP3$ujqoR\;/XnP1m9m`&8Gkht(8RSBm()CL %Fe]OQ<%j+8E@;0=:QK?^[ABh$)b&1qWgDB8e>lc0:QDtZZp<4]\@PI?-#/(X/oFk?WhFQ59H0mr3s:P1XCER*Z;_;V%FHhPP&JO %#]n;/4k8SX)9#ZZLp5)EC(6o6@?)PIiLYBcNCMB*Gfm1p#(<QWr1**BI&3,iM<9@!!O%l %]Z)RT(Q2sf@)o:m;40*%6j0?$;%^'H %8.YoWectH7fYCIfQ6+]N$DJm"mYpQ/U2iTL";Wj"g/\n'r*WCr-A^hC6kKifQed*ISJ7bm(*lPgDf6nr<oIbPCY@c1s[d#UT["] %3do\rIG"ZQ+=+Ni[tS50ZUr>@D5udZU,IPKU-;j?KV:Gi>fFSJkabJfVRJVgiuYA%*Z)a! $J&'R().Jg_0o&N+`^(U#Ms7UP$5p7 %eI:#QT_NhP#^d";BG;H.=`u'Q<Jo@XF"/RRA9O3:`^FfU&9!LpX;G$;+aGbT#NDa2jZ-MJ[H1g? Xb1H5UFo/d9r;/HA7@;;XXlef %-GkS9V6'51*dZ>&C[f!7lk\&28G'0O?+'2FYA1?k1cQtt?Kp0DKUmPrU]PrcJPTsU32es#(YcpQ-DDt`S? bbaV+JQ,]\/d/80?3, %0hro6l"SM&22DeE#0tt>\r8ZsmoJbI1D5WFfpRLG+Ae=k9Wa7JH)&f?"M@VkEqFu257jDR<2,<5K5#1a? t*-r:-`hi(QILO2ni6\ %f/lqLnu]B6VZdKkR14lfSm&+^8k1sAd7GOd^j,S6llh!Fc@0]u9WB!Z5R-bu!#hh<M`/ol_+5<P\G)HR %&G_(V,Z2BU3[0O48k&5 %-FSrq:s=:8e*hHm1!WRXZQ#sV2elDjH$\`V,ZQ?fP0H!;;&o7nc!XE48J7Sp+KS5b8PN,%! (HQ9P-"Uq<iB11*/gfXe#VItd)UH# %aDtCk5-)5bNGglSC3nZLV/5G9OqmpH(3`]8pqZ,@aPIJq\;[^!gIrVbTT6I2GP%tqYM)"5@N1NaiK=DfXN %ntlX;F[@nu.[k=4\f %Wo^(s0SD!Ufq\1;fDtG?o.i\Jmd'\Zp5nWO;,%;]\XAGq_Pgqi!`_VWhN%DF<\k+`(<,\ +8[KkV5m4ceaOGfDqh;%R#+.BHS\nIR %p.^3fW'QZ4%9l(hri``M67%W`Wm,oC+Gtb3hnL/u3%$<-7V>$qIWn_m=U'))TS&/g? DhZQ&OJ&pO5(p^23R/\Pc[io$?NrMoV4&T %%-UDKPk8qPW;*FEkD=?01SkI_')CQ@b^9_EUs`I&W9+:GXJQh<\99cY$R+Y&fO:IFR1Z>(4/QSe1NUSlK6*N-+06%2O"<EIDUS3 %Wo*pP%\e^$WkCAq809l@(;4a%#ccKP4bd@m+AKugX?%s?c_kdUYQ1^\8rf"3N?sSsbfoAmPT.'Ym>2=)? 9[t`1^fCe(2JqD&9@tK %D%*mF8Y7pk*.5nk'IL:[1`h@19R=]n)T#(O='(r)"%9,)+KNjVD3fsn6[qHE2P$ea6o];PAW4T*dLI3JXX$q3`$BLE@VdaC@;]< %Y*pn]e$5P:7d8p_JTk5Vm#hQ13KladV<CZPjP/Xd:O6'Xgk7M/LuueZDV>E$^5_+ikf5,)19]AUf.f14#@(3QH'sjAfTWA<g\J: %m4O"\9]Kpl0k78J<H+bXpb2j?9hmbo+j!&(]2'IB)P(\19MUHO;[f:Q %onUH>E<9f_9`'j$]oCX(hN4qb1slCZ_\)JT9al&0>$IZ %%JCtpgRb3;1u<#pZ1moHB^@GKlNYXTYa+^9QFQ&d1Em(R%F\uYafqW"Esm=HD2]r_)S;KUf$C9P,;ai$P]MM:eWEXLaq$?J0(\E %cUEiK)Cs9Km=C-?pG!@FM.F&-,1Q_R.;MmCihX7mb>MO4+9r;"ESWkl2#<=g*[G);Wif!g %q;d"=l@7ra`TjJ+R?S':t,n$L=>?E %nS7+pHF;MP@[CLA%)P,=9jU%^HHqg8TcT<L:/cB`qP$YHLt)+e<WHn_$eb,XZUZm#bWXD`\ +TJ3COga$?;W/m[4I+nd;k0#B`5"J %VgootCF?aR,j2goWp.G'I=m)4'96L;eB^!df[inU`nb&T3&S(POCb"/-l^BljGZ`:i0cHhh? 4halp*LB*QNtf2E:CB(3BA'Kg.'B %@i^cF#f;[[ajSeWr1E<D=8a`S-I!=eS"D(9jC!4uG#-'\%$m^lC=EDlbGlYT(kG7mL*o!gm0fAi-! 2ZaoEl>1*^tB*Uk;PL1^2dC %bQX8ohIDOW<!r^mfB<O@d=`Cs1NFRh64P0#c-R %Jm#b12M[VJ24+r7bK\E,G>1,o0j0r.Qe>_"[+onnBPOaEcNA`1'KWAF+T_M>i %G)Mm+b-4Bk!3$Ci7M'\jL-*%p%J=<)!]qqPQL4$>"1hV&U-@#D&rcp&73a&;KgqSh8-aui#kaF? f5(qWQ.Y9R6&5k<2EEFY?!]1L %0plVfTlbp8,I<DoV>Z<&%I-R9G=E7X+St@DVYC>l^#! 0_/dc2g@j_pA3jC$"6IjkR&Tt(PdoiI4AI&M9=XBX]iiq@YL0etda'`WG %Wf>Ld^`cOQUJ/P1g'8FR!%J@`0jG5VRNb$?krMM,J=)_C+'ojSM=<&:#VcPBXI? ar$gpD`X4+:3RPX6Mfda%&1_j5I;"s?okLOa< %WeqXaiJ@;p/q]L#?'9q-C77(F*A";H]_<[N2@J? c"#c/MqFHP/W>VcO"[t3h>)d:m.QY9$Ut8YtO/jUL:_^98GR)J#GNOX^:*gE) %`akKXJ2XU2fT8&FI!i7kVnpVTYj@mrs)]7>l4)mmZ0ir%j8,b?TO&#uO;,r3D+hL)>PjPI]lF1! pZQ<e)D.DI,.>eW',6UG-o^@< %[,ZL+LlftEEnP.ZK&ua/5JIue,b]?p`WSH']oYpc9Pca&Vl>rH"V`;,/<*mDolZu9X?r-&eb*U? W[[jJk87Fl5]**VSMB2R7ud;p %";Q%EFf3<sd"gNfcRbs!*!=kCEk#TloBmB"*Qoj4DgJa[[,#k0S,kV(q:3BTq_M+e`/+q3GT77+u2If4VQ*,niPZp6a&X'l8fbE %-3W"q:5I$Q?NJ.i6ao"J<Y=G.GG]uYc!'#;,*+RslYDGW, [Y$10m]p[jUq9EFHGk`OrdrK>&l+F.iNS,cU\#K`5CPU-UUiFJA[DL %rJhJS8KmF7Q_lT.]W'Fjc5/l!pr]3:$:G.5U`lc%3`#s+lh':FQk5c*28! (bR;bG[Z`1uKi>R7]*YgY2EIKI.Ob,@c]9;7^,@;Gr %?GZ.[I(i_Ff^9"\g].L'WZDt.`04],G&$Oo&?q&GA1(609<ju: (i@,0ZBFU06f)DA;D^1aZ4XbC+VAWmC.f1:;Iq=XDR+-`OD@s1 %ks>f@Kl8/0^n;!2,>aDjinB:AeG9oZPrsF[k9faCRJ)7CG-tKi$_9n")M8pA'_%HE+TOn!q?ecgAr? s/]*!<]D^o#'[;i#$UlD.g %LQ[p<rV>P-:E4T7%&2E3B_<rM\_K!;drs.ua7'.Bm*4Orc44qlk8uPfqpM_ES0c3Ah(4Ej(G)/c=o^4L@* ,0l!;3G2G9fKEUP8?? %+=_9`cM,So>qB,nJI.t9YTeGF/"B"-P`$<:F9!j[ljuIj"c=!neTWKphQcZt)d'NW8AOjk#,Rq$l7JIr#/ m&1crc)/E(Hk)(r>c6 %B$63m*<IB'S:qZ$l+^Sc9_mM+mGh=u0dpZjZDeutd*&RAS9G=d9\p1$`n6K*p,5t4:sX<k]gLM71N&:C90i^PRJ%hY*tNMp_??$ %d7d"=M[?WGX0bouXU!R+K4G6V)g?\-0o]g+KT!QbfcUD'7G(X99[oM/Gq*N6.b7MggUfpV3I-kp,IY:LZ0=O$WubS_>J"rYjmlh %8_d-KD4IC/H-N6#k6G]L1M?]*D;92l/HOOIRg&,;d<1,$B)3O^Uc@^@: (V(C3p&;rEbD<eh'n_SNf+OobpaK&$VG&-8[)HHB7W8i %7a8"+?*d$+H@FB3&qbaL3+L^T,8_DdeLSKWXce['!bHUL,i1H]'PPqU2p#!Z4Xtp?<"L!R/*7BT %/cNl"rt\))i$m1NB9%oi!a,2 %Q=J(FSG(4E4<I>;G_5d*(.$mF6:<9H77;\3+=e! Z1Enkk3aLl<\kc@+"PW<#V+]e_&3u"=EC4.)4l(ND2B-cm3%^fWR2\.0Rp.H` %Jl@H)WC>':qWq$G"W*k2nD$(o<ic9B;+p:ZI8DpSP(>/AL>iAI.-hQmb8o$,\md@N+? %2n<ompPbNQM1Ykk"%,nBBG*MO#48EdBH %^&e[]:_jgn/5'M-"mSLddVdC>'9kC_:Kas\+s?2#JpjcWSWqC:'pgPY<Auh8@TYI<PQ,t$;GuF! b.>#HP`GW,0_4AH>4lA4>;S1I %YRn34?^7GMPqZBY`GSO>B8g@FZOj>N32+lM&;4s!9:ZL',C&)<'GB^,0@^D";6[?p?:/ (+_R*C+cOr6gNWJ\cfg)5qGC$-)0'[OA %^1:;o<66aFejbqQ:cOXG3c[Y[?_q5&dEe-N6HG7ii!eE]+HO4/K\)e>? <"@ncjI=hB9[$9F[;TZ.dHH@"3<@Z8p+$P1]o\%M%gFg %[5t):qkPEAigQ^6s#/=g,6@qW#"@UQ<2:a`Eir+)jePa`&sTmU4LrYGUn&#_A=GfkCfI!hb13O[P3?/ +&Tl<7d$f:Pd?m]BbXUWE %\]>Akp@H: (klZQi/nde\OP^.Y.o#qgdL.\AOHOo($q_NoDT6,l*'7BEWM3XFe[KL&>NZi6K8FH>U8cFZ^^9BD"m6ilq/ R.>fU7$& %.>*TU%%/ULJf*VHC11X.@FXhW-s2p!NQFb%! WlqBV/"Q0e,r0sg]5bhF@Oq,,*b@T\qD@-'/=HKD^A^@cR2^Y"<KeZ-(M8ab8ADj %UiJAa-t=ZqLJ0ib=rJ!$F'A"98\%3Y5HYu03fF0gamR8m1.NmO_K;.n`JAji.f!808sJs7F)f=? e\kNW.IW(U!mroXi"<BfVO(;5 %(@@jIIP+3J\]1]c^0Mb*R'MrESg>3pDF@m;'Mg'@NJRq*i?HG`3):8E-h!j12+_]/%\P6uW_r#B0c[#.Q-HrLT&0R.Ii@2>2q?A %#f8u2\Jh:9C)uBX74p_N">:]U0m#([7HdUK]a'=[==t$<UnB#!@uD%u6jkbUp>-,&0U5Q1Pamg+RP/7m:C5E:^sq_BZlUj#q\Rr %FZN,?B/8#ZAfC1E/lbM-0d8["C>;^X="*)dh[_qCg"o=9B0k"H_<fSm>&I5ER/Ge2Ese4p1YMhP_?Emd@/ s0Oq.F1!(iM%C$IbO; %:tWKCN0_$aNZ/e_SX@t8Q`R=EPmq/890bK/2(_4&"PT<eKhdX %/,'lk)M4a<e^cMi)qVR$XH@N8==5E4`Bbmm!;muo'D,1L)4VgG %Q#,Wc5ktQ+$53GmQF69;`^>HKM<TAid>OP2L9#"57&806C.[*NdR,3W%6Z"'.M#HPdi>l7TUN&@KYhl? EA\I5T/V`ZC6'CN?L#^k %W/CZ8<-%=%TT-;QhKTcM)]r0G1JEX_PVOkbjLOcJj6E^69O.77Jq:RHIc(n)^=XK'VD6I+'g<dM5]A=f`I7'5;ahu7.sFX8=X(h %Q:8!b(CnI>&LnH8ol2qqZ8-[iVRg#`.PTqA@o1/AaO>;(B]8<YTBaQ[,#ul6W9#2=DU:*FcGtP$H&8944D:O,nH<k.7`UH?6S^q %*CXlIb;Zc`Gi+t!:*eH+dm'JD6',@XJr!9D^<;9Q8`!@k]m>f)m2[R#'V'h>h4Y($p;jD'Z@Q+H@`q$4%ID@<doI;78>.[>q[-5 %:1j^7EH5DNe9h;TDMTd#13P^D\E9+_7&m-l,!7+s %c'_fW,>I62h:IMppBco:"o.t#sNlY9iU7,rVRkD2``+FN3[XFSq"6pe4%YT %.J>\mN`8anis_BT\c,RN4WWgj=(V$'Ynmn/1_")&hFJIZ4=Wc5)sZ]QR<h#KPsmkjM9CriNFL^V&.m_,6JY$1QkhIkOS^b5P\` %IbGfSOO[Jm%gRjXAGAs5k=(tHH.m/eHC*F^Zeb=XEAdI_o@+._%ff^kH?T)k! UQ,_9ls=K/=es5FLRkQ`J.5KMI4NM\H^93)mE7? %MGPAJ&@<<dq)Lp(Wkh2Nf,$bICQ-5.F@LW<dd[l8fci]\<9eXY7)ZCY1g(@Y]eQpP`.YF&NJH''.$Q2sC/ 1E-hWHpWV%:HI]R)2& %8SD`K4rb+,<.?F$2Lt%?"6;kOgZt!YgWu')FkVh><%b%J[ZaUAmN1cq\hW@e&2D?>;tiutSReW^F=)b)g? SHD1U3a9/@r$?1Snk7 %?"c];ZX9\R]fWj(49@Y;)G2! (Ehi8)]cX+nVXtFA5`BtV`$qgdK0fo_]TgaMK2*L,ldloje^0n6maV_kbG/"d'KOt<Z#/(Jl&97/ %,ViYaG)9_Mer;\_J):g/G`GUtKX41/'Y.?s;j#I*R$_XY9Vce%Fj!@m@@5nD)X'7N@ALMFGg]0hckRom. +]e1W0pSLm_PE,k1><? %,Bhr,],gB_fQIQDi\VR-GDG\;)i<d=3Y([Ll)iHT1hXFB!`_J>mH5$dqg%1bW7lH_[HQ6RU:_kfVu/2a %4D?5:b1ih6s]^SE5pJC %:HeZg\R0(X%*1ja-&RJi;)45[(\Xm02!W#F.Se25>4QL-:;YD9[AA"geEDf'=48K&SE:CRBr:=X<uFjT<E<-@LqUi1c$kR&^O=e %*n)nALt]f+446FQCaPkijpKKSK"JVYR#)uec'>$_=`k1(W%)8djiYOu&\dXH@?I,t %2m6'_\9pB&&C1W.`fLRK/+#NA`$4eU\APE %4oL$0SJp7-eKE,-7_^X\dTBf93<3qlolj*S"Yoa1Wa\OM)oOig@ALOFKVlV``GC]I5e8)-BWLpAM(>K6:;/jginiDPQ?O]!B<^9 %gB:oiH83R<!45->58+Rao+!C02>I/[XEskBg;JYZNGWl3L^;tq7iXkTd9Bgth@M8sIm@nUbU?@]$^ %4RT&-hHXdhQ3s%n=Fb'6*a %E"p\?ht0K*H:EhfYet4tUioq>SZVb;:1Kepp5$gYpQ"0!Z/`g3NH;!!4*d4Bfn&imr!(0b=`iJf_? 5ZF)hJMrW?;`kKbnr>51?Ie %LDTZ!<N>2i!dRT69ZSI.32]=d1B])5D! M#b3\=/7=r*u,T_qJ/i!]BEV8b,WjZC7>c+oYm02.KE#-\`W8A"$i0[er+QBtBnOI2O* %J-$=V-:PUDQ!Op8B$X]#]0qGUdK)tjn0=hp=sCC(0;%+W? $L*eNO$UY0L@jF0'1g_`S#h):G$ncmk0V@3J[PipsA^CaA#*KTP(a3 %3O&8Nr7"A2M:1D2X,;3noO=RE_pGAVmFkhPl, %i:'ZNp:nm(l[51^jQR,cUNM#q@)2>*N&4n7#0UoG=<D`^b.!!&NWa'%W")c8"D %(R&`2gd4E)%-Es[/R4;"Co] %&Ao`P)3V*hL1LV2UVLaK]_4G@q<]-'k#BLQL'$cp/GqkaQ3e5<1o@/lMG,,3AX2F1Rh'=^Zar(uO %^dR/a9[$gI;P'i[5Y1J<2$s\&@ZA;U-n`u8PN?2+-p>?O:OJC!DGAQf`[EYN&0k@j[m!lm[O%T! @ms_'6ZtC&W[Z-Z+Tf2#mXo3A %m`?G<jVSis9Lk@-:5*^8>O1nmq2<Nl6^cr-d0Y@GYl((! KSsQlRJRmoGFi>S64.0sN_I/\]ctY$3Sj<s\pC&\W]k!`$G!F/-1k1o %d&_4).@"un(/9epZM5l]M,uI\8l-^icCn3p7*tiGl[XMbL`Wjn4$q9YD9$^QoFkjB59mFeI/B/GdY] $LH)iG/),6`,dTMupWE6uD %1e,UIU*mDQTlK>MnMCofC`,9q!tAMo-@5s`>]&gORpo4^PPf? q7aAK+*g/MK5j)Zi,0mB=A0ON7EOWm@J_kp'o;op(&gQ'N0jt8L %T8ASPA0qNBGtG+rTN,Vo9iN4q#cek(!uaR<5k)T_P"n_'*FcX*_+Ra%%#nE^,g:XZ3)V/? *B&mkU51CF14eE,caBal<tm.a&PpDY %PtPi5O-Aj[a<6[fLq7So!n&JMODTFp"BVEm6Y3!0UT`\YkFnb"f:T+1nY<r_K^[7i5BpQ6;a/u&ADXG_L,fk@WY>S(O9UG["HMQ %g!'K/X<5e9dul!YViPXZ+;ts3Yh!3_Ptg:(Ugk!Y@)0m;J$AD\>Mh_`gtr)skQPjoV'+Z)W4?! OV5XW0pGN.^+#t2k?$/?"@ctO3 %O\]QO=<jsmA++r(G[H>?dg:X4"(t.dX+2]9f[cbH(&3Ma)&Lmi(th2*4c=(FB#.KsJm:Bh>$=+#L]rqhQ\ q$K*;XWRZq6QDA<&Zc %!c#bD(=-V3^$=#H/=7+rf:!BlU1$%lXsCJW/kZtRL7J]XKLFUg9i?2(H50:`U\q&rbX %1V<jc^JK>Fi]Bk&(C(PNm_gSPEk!%N7Z %Snb>Z(FelE6r(t_-Or;E]Z'+HZ:("02:E]s7^7f,m44k? WifR(AX8%j(dOgRQ(]AdeSF2GeT)Bmg=RF^;i?mZVLj5?-;okG7Znm' %aeUD\Jh@uZ$0@PXBI&BIOXUSKHWl5("`h.o\\bUg!,aG>G#?L_q0f! %>3_BRh[utkjrDcX<Ib;"0s&7f0(f#qYk06</=8t`O,0$W %ai"sP15!T424dq>fe3M2ACMsn<nYU_)LaYU%b;MZ*q\hRp"eY!gOX3nQ;o&o-N[E$njk&Z=RfXG5L<& %QN.%tbNgrq23KM:%_C2" %B[A&f4_ZCAS*5c/iUY8`<F'0u#1aId?ksu00\E'4F]/AWMl!\_Rit34f8E`Y/0M3V@$ $"X:!';cc\4cLiji,m5@P\P)iGi`;&_;( %,DVNgH5I@?qK.NN2+cPW&2K0#Q19XRp#D5ocXO7[H"KX+AJ2i"GCbPYV5Xp8Jb:OAFIB-J"0%f!d>1f-&r_XQ>78CD<7#Q2,PQQ %Q[00F+dK2k;E%BM.DK\-X<P;Jc=%65An$o?!hj9Kj7:R<D_9t6h5R&C#1)l(SNPT+B0;p1;N#'""34^^GR"Lb"39o:p*0pWN^Y. %=mQkLV(Yml\VR6Q##,V5Gp&Q=gdA?S,kWYL\Ic>^RMH-d$?PC9]E_!FJo(C5Gq]OF/88q*fW? SGX_F\RZ7-;E%&)k<Z0+Z_jUueJ %@?F":+SD9KLsnk0*:Um;+l^K[nn[u`8gBhR\6&ni!h:]&2=7s<7sIX:fC5#oNB[nJtB6=-/`*jVtKE/X[ZE[0qYNdHY$5&;*um" %[lF5\+_"'iGi#rBH?1hq$-1fH%>,=[P0E2HTu\c8YG.2";_l0BN!O)g0iDVQkWLV*/LU*Dp)'f/ +a[/m5&T+(/Bf.gEa8F:R'HMs %I*afY-'Ur0oZd6sBCa_.3GWoS<A0-kd`iG\.5Xm^`Sf>'9l(p`_/[_E2"8#QQ;DI8)kMXm^E: [DB]h`"Y"_G/N!1;ipI71%EpCLn %enH]\/(Z0;&:5\W5YpU*V-5^IlI*,F1P;;B1r\]WN(Z!fgIp>khY'a[QNu?? SX7KdDUppKnLYR4\6F:,&no<I01G'#MasI"%ea/1 %L@>5?>EPIuLc9\EhD2I&337oVV1h>G8"&1Tj$JagHak6"+[#F+m&XE_<L[JiBkN)K+F+"/?8bL&]G;uS%? aEJ!"5NE\NClFVR/<& %<,YRX*(,DJ)unCEes/X5[oI"<TpjGf:ANIR]DW_DCHip/G,J1-+E?;?DnV*P/[5%V! R,U^Z*j;5C`LF_eucZu@sI8J*6#O0P*-rt %&rid8<Wa=T?HYD`AA6#nP^b8#DDcqTaM?kSaqX5\pNoS4=p5M@r+nIN4E^K(_!L^*A/LDQ<-YI\Y\n)Gp? _9Pd<E0IH=>&m@8JlK % [YReS3R.h;@M>rO'2XZSaHgtU]@*0P<bGKd#0gaCJ1&&\eUf'/^4u^U)l6JUmY/pe5kCF445j'r1GNXg)QY Pi;V;FAZ'0klZO5o8 %2e"I<4>8#J&^bZY.rDB-d@MUVN-^\iY1?-5le>$1,ilQ_h+j]umOl@T"qtG^"/8]4lV+f+(1+jTDhFg %'%f"GDABQg3ACk=8_gJ^ %414?WO]is?Us;? 1+s/0LepWf)XI(9\$\Kc[6Jj5gqFji8;2NQ"U$`FAVJXQ2[M5D)S<0ejSEu[G1&p&e=l_Uh$V_Te[:Gqj5o J;l %(cdM2ij$?A/`5Pb`etWMO)\mOg=_7ZhIsU*HC/VO00V\^#2^_XAb2g3?Rh"8PST-DA>@p3$jYtoCk)$e. $lo97AtY*7d3ltH4ba[ %gVAi5dDCaO,C),ZfH!icE'cG%DnL>.=!:`PSR.LCSH-_"@Vn$@Ekf9LAFHd'9*RD%FXefq! ji4Sb"P/lAl3g2]bgk+.Ls^50J,<X %2Agbm@M4C1/XCTV.OJ=(SZc".>/RX=MDNjS@[M%?nmY]4TS4^[FmN'PmjgC2[*p$j[90RX? 23NsmLBe697:.'jgn^87GGqfB%ro" %[0J:!Vup[;/jclqT=t@7'0P! 3CCdVCZ[L6G&k9:C$d&.AnW@]Y7pocj*KQYgZuaE^=IanCeh<Wi)l7m_AWl?.QsYNtb"<_BM7)&[ %mFWE"<c,GEf#,errqf()fgpkeIb6MV0gnOI`ZsZim)#iMkig>&FS""6[L1O\h&@#tF'XcGft(n[e"0=+pg )PD)!HNg>X%[irC@3B %FXt^leus2%>dG_l'DgCN"nZY6IrN`iC`QDcB?3<"4^9t<dj``\YtLrVCZ/j[D?&*pL-88smF'%O0i$ %]L`?)m5D>"g^XM]d%ig^a %=kWF$nucU6K3T&N0\!%?8BY\n"hjQA=EL9WVMekr]\Mr-Sj%*UBbW %Vd,N&Fr90'QYPD+pW?\&`et'KV4<;!L9;45aUV@"cpUq_C %,:r:63aeJc@EB>!k!@,B);<PHTN\4$i9LsR'tYBQ+!=K8*t4%D_Z`"/N9<[pF^![0VMj+sGOOl`59E]&! KaKK!K%,f,3tsUL&*ZT %g!'cVK4(tAXJO]#=YLgsDo1.s*6iioU?k"IBiaTEqV<b_"gL'%?oY>1oeN$`D0UPSqL)7Z8MX*K)Y) [s)_@;d?kNca16X><lCa_) %Oj1,aakiV]3c%^s8l-9,nbkC=Sd>@k'\*"lPSN*uF7`':5\_WD\I'P#Q7YqgXSW9,j&"ZuAfA-Q(AA, [8hqFoY-%nA#F)&$'],@T %L4(Do7tW&#=l<uO9I(%>a4;T1[$(N%*%f$<C$"OR''/6?(h,N>.B?% [&5hTkgK.4uW`WB9"Dja(kG4gFb>iq!dh1qe8OcGIX[EjP %MN9dd;XbZ778V6_Vd1SE(Ss<iXp'L^Ri.Gf/,LB]KI'.HQ#(/m?"/qNAqqs0I]bdh2n\0@NsulU\"n44RMn&j"..%;H?9E;RsX\ %'.H"r<Zjgei!c@a! e(R$'pte=^n)9garO[$>iYdMk<Is)ci<t'MdM^H7)b`=Ko0.T@XTRUZC'c+Oa7=V$<DA9a_*+Z[bNgBY\Cc j %UA&P3mXrHL]1/XJ+I.GTLuOEB)gEaZ4]bT+r6VGiG:'Itkbuq![.G7P9lttMiuYN)? A^`TH3\q5Jh_pO&#ir,FE.e/V'7ZN'<t4s %La`lpqOT.KMb0]A7]WB@qteXVp0*@e1[J[EB6rV?T!^&\4D9p:j[sR=Nshb?J4uSm'RnK)aj(E\To9R, [Oe9)($:lFBY!N;ND0d0 %q.rE#c/>Rf-nn,GPhjd!"TU9cJSV5t5U1WX+/NQ4JTXk\/4PReCF&s1`C@! fi6cC:6&Ap[>n5iX:B<IIpcs.lqC/AGBUQ!>`QLQk %3ZHtc<c0XpPa('.;Annpp:I2-g>4V^PLk0((&3=L4DA@X_L?j`!_]A#faTRSj!4n08r#8e7&pLdE %=UJJ6Y]!klSo"a1V)?mq%2\ %6F-iU[Mk)7+Et$3X;M-:6VMIU"0TC/<Mr4!-)C$NR0oUK$S`?p3Q,SF6qgi@PKNE!j^qor2lD@L,M2De% $oGHKqJEL6AbK=`1hCT %J;<9fQ5u8X3rm1)U,DcM+CS6)7C>CWK;/6/-'GdV*`,7GQ"hp&9?b=\AK&k1=EL/jh]=Ds_Gu! a)6>])agWbo]I'%5bZ;Ck]4[ts %Vpb4V8j^[<dPiF>YJo.PR-J<F9\rtBdo0Em&V\\a3;Fi<&<^'?Z>)RrpCTqf:41>]=c*>ZFqMJk: $N&4ZM,.kB^Ja8H/r["feLPC %Hi"<$diMHo**TDLG)Zj:*!"G?XICu:M&'$SP)p_tn%ZCb_QAaeIP1!oU(ej?pT>]&a\"ltWF8q*#a/=O:/ h6%1s.;5HC;-0+Spq0 %%$SZOfnLb&gXrl^$P?s8)qQ?u*h5uMeokit+UB;\\RAiV`[Ok1;F*EO19%X=Q7gl. +J`'V6V&q&j.V\c(Rj*bkYJsoF=MPrJtT=[ %>me"u/[&,&q,(bAE$XnB@\0;F5J\lW;;NhYTk93^[9P33gp.t6daFqH8V[k_%Z?aqjdAV^bF6>$n<(Xj8!Fo_PPqp##EM($S0`> %hn9^B:hlg`DrY6Z3q"fp=udOeGTKJq3&rWU-Y;h>$;,!*fYmHcIGh[TZH9>fF*FnXAL$bBNeE&MU4%oZ47.A#"4#ZB;-1(+M,Y& %JgAZ!Wg^dm.7*EbEgO.E[XqsP0p7SSAmXV^^$^$[NpA->5SRl8>7/Q*^\.ADj*&]9lIE)`6$Y0B_'AlKHA[FCE@R+Ym)(bSGF)& %SRAG],QfZ%H72Zk*`FTC\?[*/AWTcs.QHYI128s]L2l<=l_H).9[b! a81lF)PA8BncgPFm4dXOfM(7&s=g[1[*hH3q5RY*tgoh[[ %h%2/.]l%76Tb2-o*\lQ8Y#jNRJTtQ*fp5:S<mnXX\iPf=3!gdP2lfbH>8u#1oB4k.hi,I9M^YleMO`aZN0$J0W*REjSEF=4Mh#% %0Tk_FdXu@/!BV3k[L;JQdf+Mm?3Z:SXsETLEDg8.lVY28V$pf3?U]`H$WkLBOG-]cAL%XP5S+nkIppsl;DsE@TLUC,P.;DQ,ZdV %mQH@[d%#&#"Bt#u$J-'s/aI1ba^mld[^o^`BdQGK"Uj9e?._q(^56B,X9Sm-k`Y7F6aorM$.'fhe? 6`A(E5_\m*t)f85\d43!t[1 %#=%I&C1@<MP\lb5T8;3D`YM^l#ZMirm=*? %PQ$#N\'5gmd;^lpWtml5%h(.m\BI8`,=1l]QkCbR+0Cr;SB4pIf6qN1G5@42ll#6J %M&fn+?/J+@B@,f8D:+S^>p;$8';EqX7W^sLP"r%qN %3R#hD'UFS$mNfGL"(;&'jI)rO4]A4d(.&n"Gr*So`?fh7@2>n\$D]B@ds* %8kUYicMJY$&soDU2&@'uf+?"A7>S)8]9PLrE=e8&R+t&ldS*'lABC7l:]uBiOKDu)p-T^8ilKmWTU],P! EtT7T.Yu,2lUd2"hbPI %O-hgS(moXME):%I1C.[89Pb-T6:B+?XUU^Q^COcmjb7N-^TN8jWM$!N#dUU(q6:_\ (K3&NB3M*A,6NAC[n5UfV2rkKk[)DPL7Uk! %djrTmXL<Bif4qP!AErjF-`Y-[*CQkn1fJ&KgN.(;Xu_F0<2h(da;7fB>08?Cm#6fB"OtB)9d]VqTSL*Rh7Q>T-9j\Uo(UR77MKk %l$+]2TFe/=KFJ)%g%#\$G)(#I-N9]<2-4BaWaO-h5T`^r<bd3K./GZp$r4'7HNL`%H5?#_QSqjGndPRm^r_$'1@d+HNE>(bA/n; %'tqSGO-JAC7Ij#J6e-.#l,@^8X/[P4'$,JOgKhMA+Z*5!>MpXe$[Y6-Pf[WnH9?LO-Pq&,8U:i %;\V;`Qbr9/MjZu_=3sk:;LUG^ %knL(^dc[ENbUemD9r8YjrE?4)'NL%0Hg&Co>/P_g#/SCc`i8W!Cf768$D9/Z<3>:EM6_9H8qW/*MX2UKg7/Bf;+j/8<_ak@\3_' %X-8oc>%?EI\rpl1`j!%/-'''IWtlY*]ks@&37_S>cUHVTE5_nQl<tR2HpUl7Z2@RC)Rb>`EF#i&V\3@/iB'l"aG4+ab[p[C#eKB %f\BHL"0i\uJ9T=c8<\!6Vq/,0$M:Q:8nseV6k!hDFHYW:o_5t7p\/ssqg/R[G?Xmq!!+! (5%jkG1A@GR0Ii`C9%H9H+qa'nI'-L; %d97kd,Z#CPp6/c[-[;ae%+.*a%!9]69*o0%?HUthj;RHh9AI<#SBUUsG&nOR/(db\UWTge4`dO`RNjZM6;I*,a_Z?1eqn@B"`%t %K+sHN`83f&WfDq>%!/@RokLcIbA=kY:Us_&? cFkcMq<&$U&Ct4U&l"q5IGKQ.cmVU@)cYdKs560E65_sD6gIiN_u$cD(7(0Y1rEB %%dq.RR.Ss+HfK4? iT4>G`t,E@JF=elPBBqUEOi#KNSmJN:K')U[]4q[@aWW4POo"s[6^Ttl=M!)c*M`I<9k!!)pEpP-;@7m0FH 'd %'4<qJ22c[hinnsJT"+PPO\^YEG.GA[_`b9SFJElTYbNBpF/&_D(1P?fs4JIADP?<? B4X2Thtb48qM4rp4tq`A@))ZWTDWR!#KJeB %j*-/5NgWMiL7MW]OF%43a1Mp8oAG@a.;>:iCug'!RFqU]msmU! 699rTnfat^8]h;603KDF[o28="*PuCWL.%`dTJ2%qBf\ih[p[3 %Lq6Y'QTT>P)E<V?'slh`mHi8H)AQh^78)aP@A;.,A8SC;mB)t\,SH6(QOE1GmshdViG5MG?mpoL"2g6<iXq"M>#>.BQJ["M/H<K %bI0sH8aL@]30C4;Ku4D9>:1-t#dQD3DK$$89_>2j7eOe7b*%LX;!PT5&D=$Fe%KG&lI[ii,WC5,O[YbFkX(WiZ-l#a:"/.?X,ak %,qob7b^`/Zi\Lm"aXhS+P/9WD"TEhNl4ZWX>-+HRP-=s2/G-%;7PgX$M1oK3f+cbc#OO=P-VOkin1O5-? M_9iBW+Ds8J-01SOSc# %:lUkND=Q"*RGP.Lq16jJ<5@(\gJhAB91p\G7&T49M$/nHJWIM,9GI4T#-/>Ze?^-"B;u4of#VLO$g^ %D3*#>mU3!2-_>KJ[r]ss% %\]KfP<^Y^*-8S"@q7mAU5cD'&KV?RJK)KK;#i@J5Jn+^lb6ZIH0:t%a6:kDb\rF`!&k6Z$B6/AgS<01? Wk<`'Kg^&$9IiC+F><(Z %AH=EA]8oGin%&+aYtCEkGl:mslcVZJ4jOp[p.@8OCALb$Cg! S<k#C$E(BJa<NR'B=.N9P9`3q^l>mQ/MK#utqZsn-uUsFm]Pi[uA %4_3)WN"[3eQc1pOHrUXomojl#A<TCCVr!%Z9b/,JYqg=#WZ3d[GioScG@[V[9gREW&Lin+4!hV,Nft] %XdhQpA.Imo;k;_:,g6>E %>:;6,Tu"k8T$&0#<`4__rKJMNM1<076_\R"?S9;]W9-G=ZR %aXEQX>\oe'hRm7W^_g'Nh",2E2,$;b4PPi@K`^^5)Q+/"h(ruYU` %gZga&[UggXn1mU$09Cb/M,=RIgaRQ8:jnl&@0Lu? 6oP<)8J_&"#uB7'k[@C8ZO_j3XcXrYQmrLoL_dfX&QN<>@_t^5Q2pteV]9K< %ML94%D3O2`@Tn=/+EU8<'E&?VHRKfd,.:;YW8sUDbf!s\E;Tj.mOLo!T=VuDVH6q<#k'CE8! m#E*_:n5G:SQs[+4[@MXX"$16>=o %`"WLbc/kWgF$tbu$T\eLn=+o"p:,sW)Zs/NT8E/(4hYVZaqC6t6&b0YS*<KH1hKL?%R? 4;T2RNCYo:YJiMpuhYF]*OMG&1jKL;1& %As2^CVei6-K*bNKmXIQO'H"iG?6"#A'M&O1)E3,[@b/SP7d<tB8s/]KB5WUj+h$Aq\00?fm#cQd! Yuq@ef^G`ZfXu@-d.[3RXl(f %)ju%iS@/9iRCsMY8>'38ERRn[,NMC,<W5ok>U:#@c'] +#W@6gAjcFI`/AR&S(T;siP=<fRF*a\gNo^GL5%A"H,O@'!Tomne'>^C8 %Hm&,/(QqUX4i;A]fW:K7FK:X/6RO^V_+mLo2OS*]=9X;D`l2a4D<ha:863/I)&^jg<V'M?A,)&Y:! bjo*#R\bGDlkjAhC+f_a0>h %N#f]skbLnr<3NWIlpmqJO6B;W%u>_B?kM'QP<;Iq<N4?JTf/Dg)^]fph-GbO5sEqB:b9@=>+d_=>E<n:q!l7,Zo,0".2QIilPLJ %3Y12=!t)Y%q:4q?^,c#NYCG`kai3YlpU>'J^,UE:h>-f3-TALf/ltV;b1,T3!ak]=[:(4*lT*XU:"OIX! dT*KkF8O#*fAT1g'n,M %B?+AT9B,d>6Gt\c&dA3X=0(h&Y`(2SG5tHZ/1ri=)`,MD@ca?Ld.g)ZJ;9<3E&XDF5b+^)? @/7`$GJF338u(G;(AQL^j/OQ,]P-L %_IBuZ#!a-Uf0egX?O5"$\IY!@5?0^!Y\DS(7-p&3#QtJ=HJ4M:n'+N;.p)-`hWRi8L=\J3[@$)ap94[X %52J@]R!+sRE0GG4Nfaj %e:JFX.l"<g7dEibc`A[/YuD?uY!80B*hnbcY0h5A#X)Y['%eQNg#gWNcQcL/-*'K&HrYc"o-CU@a9QJ@-\ E'dZXNtW;X"@PpP!Lr %r#W>2\K;!Vb'lu#I>3*/"%6"5N-O6mH?i+4p4CN+9To[0dSd\KLh`L<?2ofbqf49O3\5W76Di[`JMm? pr@3MR<B[]RH$^iZNVGp* %Y'lK3B4@[7`nk3B>:ebmOEaBYoYa0L5bp4XiD]qpEhNt$.QBoa11YQC:N@[h'2VJF"d@"o9Ut*Wbsb=Ig@ TJba8g^kd_<srW^Va\ %8GJTXH?q?b6^P`rPH(:cO[P>"Xem:F;Uh\h'F:(Ha'tjao3sXr>U1-p4h.:T? rJN^:KC@D:ctRd4ZU>(bClflVaID:f[3A<]hO<> %YCC$?_0RNrO!S3Z8mB\E;W**^O\QLF71JVO65MqXN-P$JP`Bd\bYfUjR.n<i,eZUlO:FE=6Waepb? h,MB.GO4blWDfH9N!<6e%/U %AJB5!1Ah\"PRmr#B9p\Pm5rBP6>fA]UQ:b.A$-GPMM`+9TP#1nCeI'*\P<OS7onJ<ot3]g^G0pKkPDW<Ql*k8YL9YT#1''b?cI\ %q';n3,%[?O)[/7m5'SEp@Ub^X$M]Gu!iHY201*/!-=sV-)Mp<mGlDO)6#gUJmVl]^%D;D9e\ddg<?.ZB%;Utg1i1%+JOH)f)0K%=[S@EVSILN*T@u.Y*rm4)[@Kp\N*QZQ<U+nGP49_fVcs4dDW(Fq`a1afiHdB02U">1r&C=)CB[("T]fHX2im"u9/$XkGD5^`J[: %phYGPU:Tn,8V)#jVMaOQ-9BRV@E1.&#MQp2Ot-:c`RHk3;19.io2MMR245C@1pX>>DtM/0rp<%nSK*5B %nWQR\l5**$E*Zr`nN@' %O)4O\jUfO?rYE@>_LrI>dR=P2DV.R7nG$V(dttr&8HpEQn=%I!"]ZhS_BO$&c %QXT$qReXC2j_WLPZhkdHFN)-Wr@e\ske7422nN %ebS0P`CjaTGVQVd-)sFAcUhJT2<g6oQCs1ToE0Z0gkn]`g.`]j0kk^)"8B'I0abI"0Lb^an`@2.XZi_:.@ cPh(97^&YcYS1,E@Fm %2/qdui#T'CR74$B`O;4d\pM+Ol*/6']@?b[cNpC7ROF,DJC:[H?4KeVKpfF66,RP2\ [BhceaFp1RlW8iDBp*]_OtIo+@6]BSQh:s %FD[=Z?cCJ_@7Qm6qJD?uiR_hBSe%FFV!1V>m9LD2-i(Z>Y(8pnPl)J?7EJI?%h6'CN)#Eg/IhsGpE! FaSF:9J*7KtKf^)JMc3B9F %1l_bL'=G=KLRj;:J%6otb3E+J(`Uo"dceQ,8V>ErI22lCb;ulg6`cF/^lCj]N53*TeENfLnen %24O@lp$VP3h7Mgt>?0%a'P9jjQ %03prh.("4^?dPR-F*G@*'([MCH1FcCNPh#o9t<Pc3^m)_B3R?C#+]t"]Yt9hXZJ$E:?0?>P%.=K*5F %`'aXi-07Op$`*sk/#UX`" %'-#,6Yhdrsk98-a'AXF*gUhIhI8Rean.+m5bBR'Gn[H^J3d)d&^ZCTWQ7>g%=C#Qd";\5bZ2M"C %lNR(i2o?>J\<,*"d%O[XNAY2 %9H>'t6*K<9=@bU&p`/bPH]:*7m`LC<mn=U`aNDFVr'4!si?i429UDqW?,d`G]RCdj[? `stoOf[tqG^AF'=\F=G_F\"&40\`k.ut; %X>3CW];4E+pBug[N+(P]rXU"dd_6$8qo&i`7ZS[-`RrdWntqPc5bTXL[jcq^4WTESF,d98$JRI"Mi+L<>q'j3upV//mD.<;mX[k %](U2gT`7H^#bGL^fntE($b##lJ]r.oVH-Xn<F-9\khdKG<UF7*YNhc#^/ (OJR_(*i#0XLr3pafHf/nBtC@AOUBg$n;]CnGh0;Wg% %dAET/`FSLl86"J3'HLatAK3c<Q7M! l;X@k36JP_7TlH^qd&dm]A*EPn^t.m4[@MHMke\n0K<84R1ik8CDT\d&c,0bkiaR##5"qes %4&!5H@C\]Q+I$nN2,:01O51^o224jJ#&N+U;qkH1h %epJI'Xl`H0P4IqUlpGMmGRnqq3#O[Bi#DhTkh8+a_\Pi^9?/\/[c3&#8O* %g8n?(^Y!i0T)9T;lZ[<T7>1QOL/mkuK>Dh-3BsuXri`Ua0`8KAlMS]VK=3.plk_HEG_EdB@BWKJ'YfVrFEp:pouGI=tNPI8X:_e %8r>r1<7F1OU.)pYZo[G70$OGIN)$&N#ST7'p2c$Rp@FI6Ds7oCBPS]Y3dYao`Xfr-;sG(eFTmW'7"I,g$tL^E[f"@Xft_M<HSD^ %`6+2f!$V91p*@qh:ur+DPVq2X<!tGcUg%92`N4*U?n"KpV>-IMHOmnLUu[`$\R$?k.<1mUD-"WIkdT)\E=ET\rd&^kX&&G9(6C* %<sjNK#K3kLX%F)PX[JSm\)[YGa+=";OUQq0Wn;cZ:Iu(9W0(l:= %,#t6USMK8.h:M":T0<;LZtCndm'c"7[EGcaPV;(7YSn&\r:( %%=<&ok!Vc@QP##gK]nkUM0P$%Ml3IeH<*uZ"q\IZZGid,KX"\T9$Ea8!P_lI1]0? TcY5cIn*@\mI$o'2;A>?r>'0G[GRO3hHp:eS %pdl1uT6<q<\<6hb0Mt^fi-iuT.5<r(hZRiuO>o3>fTI`IV4=jOdrT"R_!oG\OU$C(njCu)%lfm9lt^dS@bC=3_h/ldgRW8_1&O[ %5-YKMM%ldU`$!1`p^h'B@D)h!R-BWrm+<j#2$9(o@rO29SaX2@EsKIJ\^FOnM$6*Yb-tFL=7K4? 3>hQ/J(N!Xi[+E3a;#k)k(scI %3*Ks([g2o#GmcCH%!(u4X9`nZO/Ul?(c$umMdda;0n,O(_.+bp: $`UV7/0Y\5)qBS5"R_4&6FA.`Y)*=d5QG%Yr3cHq3\X.6K?rE %8maP(4Ri0Hg`+6J%TGj(<Hqsbi`.1*f&me0V$p4r>EP(Q$k+c(Am`O+>:]U %&QfdimLTr0icQgTguq/H_20.G2W%)@6L-n`9![qT %/Sce>KI^N$=qg'DKehB!$Pj*e*C>1"jl&tr?nnkufLUZZF0!GL084H`AZ$(Q6M/V]7N<4r#Dc&KU`'((V+eNI?HaLQnM?ZOQ@"E %b\b2e843G\&l*.4]dtVk*^.c>rpi!8PHPQ#o:,'hQS2r2i4IlpV/?4l@%4q/q#,*C%!#Vo18O,gA[7F[+ +6?or'F<8Ggh!Tbb0W! %,(VCuU9`m"QtnkeigXX#m)*@kH)>6#(%J@qp)rqT.i]XZEHDo-q+73;J3;Y^4@PuPk9jb'HpXosK1$n#K_K9V+/jR4baSPNi/-c %G3D51Pa3,4RM.Ad3>e/jU+q3Y,^m,T<3eBa?AUJ)rQuNbjbu6.`2%X`iC5OQ1/Znp31(K>e0jE0(fT?3#LorUOd(7F63O[6!4rY %SI<,&b*K&=&`S*C^FO,+BB&iLNGE;m`%9sn=sWTQ3O34.j3^:AB$SXjjB5PZBtX'R7JBL=)A? fsTs70fhFrscSp*0tbKn+JlQr-5 %C7LWR-j![7'$#AD1*fb^h0br+%qNKTV_"`H)/pj=?! 4,*`@ectGE>4^T(%`4*Yk_b$5U:k=nHAYWG5fKPB7_5^9<)n=WC9P3+3'd %Jir/)@QrF5W3e(jVC2k;K:"/EfHE\nJYtTD]FJiM^FLCt[pGF[-"l#sF_dL*! tLpibCVL(gScp;a9oMs(4d/Jn6Uc1NESij8=;kj %'r3Dm.B.r<Ysk0k9dTfE5s?859p-T&q-n^uH/=@EjnqJNh4?6['1rmZ/0#VJ7n%ogK32+ (/l$:Q$lUA8jK.G)X_Ai55?_8$jMGJ* %Bok"ioNcD3CrIg;-[jVK`i@hfb0Pe>^@K's'QI[uJk9l'!$84oaa;uM,Y8B+,Q&*:Wo*":K*WncjR)AfSNOGKZNlp@^N'@&5.9L %!Z1J`=]?d2/BS:H<Laa<$n)SmLh'Im^N$8JTIq3\JEn]<30E4!p_:t^>>pBkaV-s+PSYgtlgH"!8rs]# %qZ7VT22Jf#Tnd,j$N+a %ea^m0]Fo/!=6q7[:^*[!-\4d^)m6s$`g5M[5\llNjg2[gleIEa:IP;NuAB#Ko.""O>Q5RE_$:PFQA1'St&lS!u5u %#!i;$U$C,W@9/VN-L4)(kn<HP-LH>a$7fueaNa$KHr-@IaTCd11Yh\;Z"=V;N;)-uST/8r! $GLGko\PD@9c^a6f*-SS>rA3TEDc3 %_-(b?iMDK8'-]rVbJ\E9eN$7??;,+)TFIH.'rl8G@]@ihpls'W^S"19JXFnINj"sCY+ %gcB2uHlr\qrj.6I[m`uO4+P1"'209de%J7\o"!5MGDGZ:^mqQ$B1ESuXX^E]`R4XA*U5ICVSJo?:\9BI+H*A!Eh+c%+19!!Bf9.(SX,YlRRa! >C`)NhG8CR$klNETMLFm3(: %2CEM<,jP`dl(^Gk.?E'DC4M-<9dWIf"bPogBDmIO2'a@O#=R']5N\/+E/-9qMDI.L<dP/"#c4e=ZnuKe3g^jWWEA)K<6O2a&1PW %PNO)"*>]/-M4uS)@kertQ4](CGKTO`,'V`r;^*A:W/?5c%!6c(icLY3%d`N1*64(.0],^KpBP%qE2)kj+ %3Qc="og18iX>\=8^u5 %ZZ#NP%#P^9')g_J;\0MbGrZrA,2Sd+>SSNr-j,+CkRoY/9I=1bUh7t;&EH-^Td2d!KUKnD %i.`_Bt]&3r1N2]R>FG22i3L6$c#:f %:9`r2:eTK[=lXBTGbJdT8+.$;Y.?&M.b:-k0I&lV&AGHs8.E%g,npk]=[Cb&N`_F`.JK+!Em;0I/hA101]DO[>V<%ZVPmjE'@$i %9VD#)ik*]."Qit2+pb.OknH'Kc]$N`&P&KK426L-"r[ArXY;VDN,CtJ_]T8Y!(dps@e(iOJ00Z>8C[i@eLO+AjCm3g@B!i9!eHZ %SUQ'5dNqE1Br'Ft37k`D,<Q:$k2cCK`pl&t;dG[AGXhAg[_]+#`9s;,:6h9SSu\)Y7I;E^f('BD\7TR8d:nZ^pf6`S_jN%;O*2* %;RqH_U*S>"=!W(gTVUnsEFM10qK&6S@t>pth&*H(6r1NM.?U_CBrjVp71bm? d&Q1Pa]9m;.qLqjc,fGAd(k9k7$A_"'>Y+_b>Y$& %<^]Eu5N%"He0,,#hNGN[.#9E7=75$;*JPgO#,H'.>0bE\J,CG`&Q.CVZPq':KZU8>6I? ZZ.VIX*Pe9gIng5u4atL))Q.Gn_M#3RQ %M6)hNKH%=PWd1SAfk/$HA4[m`N\Lt0$l9M>fk6DM,_r2$KDe;] +"Z$^XQ5RY/<Sm0hXs=`#_Qq*&D4;t"LKRp4kHg>i-F!I2PaN; %.YCmOOQfO?T^seTM>"!l[C_@hjBLXlgD[K1B?(kM]HD+%OdSjGd*#]0O1e3BKTSWKVq2#C*jUn.JHC"fp#k6K=rZ!Uhl"<Eik6I %3D0r]b@2#3$:T`Fg=!b:,^9A>M3'%-hHnGT(nu_R,.5aDR:;@NQCW:cl!hCJ_rO36k[j) $r$"t5Ymo55P+nu:d+5;(N$*bmmeqfe %`iK&Nl?;4koIi)s[\=)bOr+=U</hu+"&#?kTU9:a+A1Vn]c%S8%*=!_,k! [sCaELBP2YIZM[/]_G)DV5krM'?OT\,6"\IF&j'63> %2\I]LgqQ-rV@X3s]UJ_"6_Sl;"/LIPPc]JH_d"F/Y=t,8k_dj%qaNK?m(&.7\Zhp9! deY*1<2uLA5S]FG.iU"Mi(_.&g07j[-V6] %mf-q*s6kic6)HDM6lcfR-[>\?OQq\Z&EM.('\HV(RX<*@ZAKX[dfh6;4.]m'("gY_0k*!h.B,AY8)Q] (P0`"'KF:`k8Pr:MGqiSR %EStpkL+o4)#6)CM*ik+tjVd/'V4]a8"G! gMJM4V1%;&K21J[k>n"&2D&s[oA^AI`.be6$bkI!.M[rPOR(a$s>aB1C`2.N*uKNY8m %7St@(/A"VA!"u<7,gfdEB$N^E9EJ9;9JWEa+P8Zd@Zj2MT%/jBi>$j4>e^>Jn'i<@H^GCk? p"gXi&>ebVSomt$$.DK<u4[KW-Jfj %aJ<h6P9l+H9Uok6*>!m)S(M_08hp('BSR">`OIQ.S)XSQCg3"1+P?fb<os_lG=GBEoG_$@"*(SQ$EdZd<]:V?O+u.?pA0\9h.+r %h8&b!"HV=;8T+RA\aFJ;5IpaML`! X3'/f\4&b,m&;lWlqQkrBBFNi<fZ5<utM^91e)).@mJAHRCa:i8-'Ta(?8ML@aiYE7$M'+Ot %#3I4$TQ0hn.@Y(j>V!%!Ai:8i#fbQQS_AE^JY1o<glib,Ah3J:bCEB\TXBuUFU)*or_+7r,:4d! p<AJZ\TifR,Xj;)G(=D.98c![ %Zn2'(&sG]&jn.R%R%Gda*3:&680%sm$c,(#nF(*<%mds2<F+ekNDV5j@oAE1"W>! pU]^*3MriRZHr\VYa]Qh3aV<\nNM?m`#==,% %/.e4V&H^g.ES^R7ntMK:<Gin_B,j*2JQpA]6_Q6!*"NnX]29;7kkJ&bXlIZaBpW/ $/<b6ep]eitA.J7u'KSkf#&P1M2;]G9*Qq(R %-\6Z=J8FgBVel<e!R&>]^PBPPc+\>6lQipGEsdI??F70.E!cVT`7D? XEN:*`HpLgbp>H-,^37OPdCnS1pr2J"KF2)#jZ1dn#U=&] %MtI]G4kJCZRsYe!b#PM-!'A'!VFCcF6HnL'l! R66+.qrho-'X)AAo<jNbkA8`q["pE9mf[EBh,`Nb1"V&2%ieh&Ai*mUtuJ4]H'4 %>,Io]X[ktTc0^\s^%]5.iZWNh(0iM1LQ%=@!fIF\osu"kdu@`taHd;mN[;A_ml>`8:%#^0P9! Y'+,WIa=a>\=YrjNhX8VK10=puD %n(LMHmZZG7iqM9;&D*7c8QgYXm.<hmD8aF40AXH3>Qj/uT\)`=SS9&f.s-]PUZMn<L?,u4rOp:'\FZ^r<d ;kcObtK3ouFJ(jF+8a %+sh7uct?Q%cUlnbB$AO-brSrciumc2Os;V@jo#\D-j?q*lcu_0'&s8$[]V&'k?->+8^d4`rXYV! 1lslr$*+il`Q\+,jh3,=M],$" %^$:71&_,XKrg;D6<N?H#9f<WZU:%sgh^.O0/04s^/L&h/`!CMDU9T2'/_Nrg?-=eEbCS^ %,6\l_;I#]gSY2WGZU/7P=Wp#]6K/)= %_kH4"9+WUu(CWXVok\^F4o?X"eIb1dOTYs]OFUO'NrQXVQT3:-j<5YH? 20X_$oPgP'rr]]S78Mdcr^19knaD&1a=@r<Pl""Wm`DR %KK7As!AA\31C*l2aI2ruI'.:cZCO[951j_-_=94tklS`Jb=N:tPB^\,@gqjYRZD9M>L'"1+^%P-H(VP? P!,^CoTtu^*V9U18ZC17 %m>\jHB$I1](1KO^5Qp?"R"XK[A\jNQ1jLT)6Yf)GE+C$O]r[6ZLh+ %u=A<tm""=Ks[ca]BU[4&3iL)*F=V^`??AZ"Y,iCWA2?lHZ %XA[l9LVVmg$J.k^2!H\t!A\mMjZ.]^Wg:`H]YN$en;AISGeg7t#/sE%Ao4;A8SSLA>[ct2j<IGe&,KZ<54%.rOGP0Eo4mFR;k?g %Z%>dgjB#,DUfppL6d[_;P[b=^DQ+Os9d4K+\k'1(,Z'JBae %fc9+fIm`fo6tT_cb_;@J1CSgbahaka9\C`!5h89kM=f>'g,j.n7O %-e^[a78d/Va@tV2$N`$BE/GQNAHE+R4]ae]e$Tl\N<VZdQ+^5AHO%W)[E? W`e(_prWpubT6il3efe3&[D*hg_,*T!r#.G>M%EM3L %A4;U^fpONp'F2u9f,krY:_63_haqYEUXE"2<#Nlm6_u<d6U2>e/(DRXL/c-h.M>t/,.(q)X[]9hVe(R)! Dl`qO>gD'>m7)Gf5NDr %L`\>+$`'b([-3l0.*mHYH;YEOj')cB[\"6`))a(u%cbqu6q\f? moB94k5RQ;lF$PdeX2d^HasLIe9^fgBs(SHJ.&7K^fbUj8i2IS %=PA*/>$anb9@[O[OJ';iMbd1iY'%O7WabY^)\nd-l>q8)Z'1+fUC:(MmkoM,28gcFGo1DL)Z];g'qT? R`8F9gW`No1!fA=jW&4^1 %*<BSoM(:I<"S>pGJGsQ.8]8CJ(L3JZKRg#Te'3Z/Gq3nG:?<5.:,<U;Q37^h[6kemr[CtS.TPeFigHj<Qg %Z9s*[2,>fgIXL;C?] %b*`Dbp!,"t!,q8;X*J8*F'IgK=WCdJ"dJ;"rJU_@\P$p%BS##j;CqZTBO%V]p-?h1::&D:Z<%/u"Yqbd^d]".D!\4W9S/\%Z6LZ %K`@1d/,!c/9X]cdo4%Vf?<=e;HJRMEA[=i_F;eQCEcN*bTNbQ<j(gnOQ(ib22]lL\T=! UTpd.ul1'T4"32IFKe'aQj;%,RWq2iaD %p5"Ma%ae)[=p(so+*3B,A-mSf[@oaZ.T$C3Kk4.)$@$?_3%pk.k0,NIFB2Fu=31Y^.<q?uRIPkW'r? e@(n*E,g_`4)iV=ec98JIk %SF]&AJ5b5DJk76A1&%\O8[[P,`Onokn4b<oF&Pd<Tn7Uu%o;q:.K25[60OL-,Sg2)o7>Z=P.+a %ctJV7cV2mkY0K:AJ7$Q@"i,YT %ZS[0Q[4912MX%YOaMHCfSYmsg`tP_h-,5rOCuKV_XU! 6A!"^`.<7_qdPWN.a,6GW]#9@$U4d2QQmnM&@h85Frrg\[i[rRi(3:>RN %7(=7E1,^t)$,o_Mm? V+qPZ#(4Q)qKlb0@`SZ:)MAr64b4#>-)mihVg;7npbJpm&'6X7TdAUJeM1/W"^ZZbAKMXZcX2=Qp'I:$6Jo %"*q\LrThCb9l(YukWfs,HmSV#d`9:k6GS!s0*U-j),6Ru6'%u#3:MFC0u=l0<ICc8UQht$\69`)YeT_"? 4W"q@SK`$>*2eI%_Q2e %90WAb'm>>9gN[YG#KHfu4-?3!oi-%h`kM2u6_1L+S52eI=2Xfd. $cV'=6(Sq[@3L3qhqSB8\"`^;<_h3>IWdn7HIiof4Q4\`Dr>%B0Y613Kd=U.RkrKaG+J5qsXF\C]47/;/AZoA#n$t)Xk*g+UT$]6O>((e:JO2%91>1"C')^KGq4>'+R6^$RE;/sa:9,mR+c[JW;2 %j+?C]`^0m;=U>b^8IB'PT7tmrGB7UnP`R[mE220qORRb51P4q!r?MQP'8[sQ[2L8H<(Bt0OLsQ"]p.14+:aC(0GFTohOE@;-3h# %)fJ^XOgrOU7GSTWQ9n"g\`@ZI&HULSB^_1OR,t[)ErMdIO/)Ds;$+tA7EeRKZlo %T.DqnJoW93p@ke7%JW;/G<i`Bu9aQ>Hd[KL# %)k!a8/]g)&lUR(rdM1*@=sCIl2Fp>,41Q:8riWprgEkJG1f5VeSnq1m1?'Lg?q]V"C*BcNUj$BfHk'Khq0g/l]XG-LLZ5\@;aL6 %lCZkr=WBkcMDaok,IV;?]j=/NfHs>He#B?P9"&;aF %UTX&4r<"T<n7IS0%B&c8;q40tibVfMT(-:W&\&H,CkX3ac/+p65Hf!dp^c %)VIZo*SiL-7dkFE0J_?QJmHgA"ZL:KZHnH[ERKJt0H"YsD"7sWOb6rM1gHd1O81cNS8B4FhQ9_^WHN;($ +.%=B`J%fmVMF$<hRW> %I>5nM=1^"eJW=oj^? V..s!;rrH::aS3\&TZXq64k:0Of6cUY25'euDD'e*_EH4:ODAld8dW&7T"0TsNmC$/C'B&^$]j4Sb.g;&;4 %@UoYI;hVkD_E1A"-^=#&>XD?@3^)aFE<c=1REQ85@:Zk0eQDbE<Zsq8H4bfSg\YC'/"g9d:0NGr&'P? cQL1O7?e(UL<-@t^s,n<G %cbhM-F#kISdE)9TK^n0i<tJ27p3QAM7BV^ljY/e_4.il9$^[A:WX5WZJ9Z-\S4CR%kdA^'lpc*@1j! 2BKrFaC;W5DRC^J4d*:t@L %N/p;9Z8)^!BRKT4%P]E4b@]2<JWW.46uMYi9]_l4X%nF"F)8OWW6CA!a4P$ $"=6i=f$#AlMbj'Dde\g\@cN_h'j[<%)cZ\VH<GaG %7#f=>[W2uK)uZdLYX:08gK+DGbl*aNA*4gKi)T%??i]FlN_p]akpA\d`)Z/VUa! uJY+jaSrhq$:W(h_r4B?lO73B"XrC"VM2+*M" %e/k8j9JZ<oR"hBD39Ideo81?nm"nt!U+U@WI=-[C:=\ [scM*bQD)h4HFn.GNcPd5ArE8G^I9J0)ETk)9m&[j]8U10^YoXjK+Q7`_ %i6QZ)A81'Pm/sndQ\DHQ.FT1nB^!*-WL-PL^EsCjalD2Q(9A!qD'-orCPJJ`q]o/uZf]/p3_Xk)2,n3? kA_f6-.u[;jZ0*W;ZBQ! %]&ekDUNUd9mb+%B$rrU^Hl)r2L<O-n? B"^VrebCoorikTIJKdB="iH9^&6XLWR+4F*WP]L0E1H(rQRG'j4F>,n%ZQIT"FjY(Vd8* %,6n0Ls7Q8q5MWu_`4pft/Wkfbr.!R.^RY=KMZ3q[QX]LZs7qHAlaQe90.#Do^V3Pf_d0;eZ89`GJAP$Qaa04H$au8o&B3BIK.LI %io7SNlPH`W3S!%hb9Ve\0Y*Zs&+>j'm[?]hC3\1#%aF-GoBPV1[r3m+;oADa^"[NnY:a1s]mb% +.;`cS3pcN]^,^[kq:eu;s822r %qENgs/&[NeBi_:^Y:')8mEH_+hOOUr+5ATWYbc&nj'L'rop`!@(Z52QlM;QcH?oBF[GK?e(?>EZhq`N? pMV^Whqia1qtfU&Q<E(p %b<%ZFleAnP/h[2&ebSss?!V8\GHP9?T"(hfLG$Vjfc?&t4d"Lf0419b\\7UF5.lM4b?XnJn %LCb3NrIqS*g7!QIb)g]/tA#QYTMu %f^i/Bj6FUQ6]ATP_n0b[6q4k]b]fCTJ,AYO+_b_ud:)K_^__2ijk%9El`[M,s6ffgIS1? k^iphs;Ha"fQWJ+n(*IM0q-TI)Dgld) %p>q4CeSf=9Z&5/bEf5e0_&@gre`F7f?QN4XT3RZYp=8si\R,<pp?M<JRG5;. [jbYVFLk`2d^5%GgejD"l>fC#m\n;LFh-Tj[\j!C %Fh+n4[jaW&W69T/]%k&m^O?(WlMTa^Y2=],&cAGf%:+Z>SX"VDbrlfPD[u6XVASmDdIg6q88Jj\U@0:c>r"7XV:X&gM^G+hRS^% %^,B1WA<45R\$R1Ei+/=g2)"A5*B/+B?L/7E?ed6LDefj_I)%?6qYSHo\(BfHc6/k+oD! SPl9F*2]mOmE+5up+j>V9)LXYU[gX;4/ %OA:!\lOVa=`h(BL5BfmJCi(*jo2D%q5-L=Bous`@q"@Or9g+-4hu %_I\"i(hGjjn9mIfkIJ,RE3LCLLQP9<H'fU:OL=5TTV>^h*@ %IZHL,.TUCHnst'JPPB(rr;QEOjidPR>;e@LS`(ZZi:G]iYMYl-B7a?X? Q]5n$U(,<]46JPnFL&RpMo#*eme5rH>l&B%e*=U4R^As %Y-6^[l29i)X7XdoJdq:Ya"`/:=''=S]=E<qXV80O#)e?:rK*:VE+<d"-5c3s*"Ig5>FgE(1PbaF$ (;_"c5c8dn(X9uGeiA7qo`&j %qbRg`^/*d=J)'M`2N@B2%rh]",!3)!WT&C(nH<41IkU8+n.+311jPJ %HXi7aGSF*1ejLPs`O)o'4>)NU2jZa6?@Vq0q2=!WCbd[* %,ED?jrU$ZS^Uq1nrS*lErF^MP?Cej@H@'jHR")QDlt7@3Y29'Gg:n\FR+TnN %Tt(FXi8&b\j##;S*@-]Ih*=,WQhsY:Yd7/+5,9N %g"<aYeK_p_[ks-jo@i]r4G\92'#C<3g4`%%ohFZe#@/_O\/(R&aM+I2H\Ar$DC\3K`s5l;@nQYp]e0+ [ipXdk[WP"[_6gWs0Kr?7 %s/%.9FBSR3$Kh5UZMNJU"l7Z/I#qn7e^a!SYKnjSD_>D2q>L-`)h*?%.s??^QbOtmI@p#! NEqZpOZE0HkaU:eIA6:ncbDPkq==+Q %lc\V;Mu2`5^Y[CtG"9<=h`p"BIXg5&r,tTFo9A)^b^WR3n?p70^Yb7H*,8)5G-]dklK\Q_K5=O=aXb[cDJn<A)>L*=TfdUT@q^^ %p,tGnOLmr2GG>*tg%hOQr,YLEf#bTaJ,:*k0btunIsH0XfR1F;hYQWip%:J,8XGeDZRI[C %su"Kf'X&*oXhujn&E!7=m!/]`QkH3 %FaN_"L$%r^fCO6.qf,bG0])IB? JNe+I[L^dje'RErcX@@4%kVN^V@HDnF`."="c5Q2\kT3LVCY7/hZ#;]R>S0F>Sfeg_=rOLV>RH %(GDrJ>lAX9Ug@>i2/-"\ZE`j1.,UQ0\jp;Zofp`Ogsh%`Oft\T %1;se/Waga1,A"(jfG)sC:GiUq[o:CVOjs2BKhoSa?Il3]jT#A %,o7S1b<D=bP`&6VX@M(?D,')bOXP'>P;l%+Hs2X\)nR;T?s9%?#TemhBBIHas;=m7JU'ReM.j$dp^muEXY,Y(1guWjFOQagY.]u %/B[,oMm=dSk89-J.E/#tN5[s>mG*q?q(WYR9hj[t@o<.Y(?O^lE;/;tgH'nHi!Gl.'g.3uChb.a0? nJ'Nt?AnAiJI*g^cRO+9,)P %bSg<rn&-!X3h@[/j<k3q\PG5TJ(`8%4q-4b@jl@.#P[iER`H)r:Mka!qs3k.g[!a5/fOXiV,[G7` %QN9l[)FcY>*]h*fXM$OVCjk %<+*%]![6`Ur;/!JQbRG'n/cRP\&?n@QB&tIY9!Gmqs_!f*Sr#JgCdlJe<>+;CTCTD^:HI@P5C3kg:q'! NmcXDWu\%E,?Oc\\D!g? %m`3Z(5*GDupPK(*<1M)-`W?!ZpLi:H^M[eGNn7s&f;NTOLhu]%D/,%op1s;W^g=^c]X^02['CkX*_k@q@im?E$miqs50Bks7bXQ %n+j`5SH!Q6V-+9O[Z>t5ioC(%K+#"SCp3`o8bm3h`]O`-lLjn %PhOQ5Ndt#_g#3N>l9eZN5#";Aea@g7H2cs,HZ6TtQS0u+]m=t3 %/Z72SrjsK/O&Nsk/.5g6Z`uRRNre\&fMio_''s`cYma9^O:NtWI6$#? uouI&ZK0L,Cb)fW:@;U^capu2XFDrK=>f<YKF\6 %\TsOaVo]+NH?Gg8)f-uAnaYsRKAtTpR)/U!X#Jql>e\l,K0*<_p[<n821l+BV3t`(4**B'-+5i>^Ln %3Jnd34KoGQibi.tO^TBML %#<\0ir9:,,T/Um6[[oF(5< %SoY5W]lrMSuQ+9/pS`Vl<IiqCUeYiB@Ec/DFgVI$92k]^9jU]:)Ps4,6He,N(=*?O.s^>.Mc5Pfal %)kZT(LsUo;G"81n+e-<qkPJ1Qk32D"qL! c><V#AFh:,Da52UnrI!,,L[r5V\ScO:QT$U=f46gB>SKBMgYAaI2jkjBM?G?>X^;?4D %c4Aj`hep4,iTg.5o$*N)/mj!Oqs++@5r7^pXKZ!RD)f3/qY-<<pCpfcZ1R?ZCHH9J8$20W[Jc&2oPgr"X/ gMq?bSP4&'j4]-o5.8 %cel:"3*eFRnf>``_s.0`lK7J^TL.D1An8fnql'H]lM9R!^k_7;03DT8dVKtuRW!.'HaWISYJ-PRLTg/HG %affi6.8OM!M_OcYm/' %9E2N]Ap+Bns$kg_dl'(i`PC*3\sI<E<hm,\]Cc<`>6+Kqqoan#(O1)0)'*Q`42Nm,6u4Xl!tq#^N]*Zc0/gs3nfO1O#Ec.c02's %bgC%pZ.b0)Ts7q=@g\^Q=-'enXj$!Bqg(T`f5"7]2O73caStj=<[7VVR>l;1rp??8cSFC+lpf`ugs5C": %8.:YtZsDh;PObpmssN %=`<0Fr#T]@qF"6*2p)Xq*tJ>(k*I1+-FUl"2N2A@? s[f#p#]'5<sKi)O,afgdFWXHR933u;e"Ma5peMOb'Y>Q`4#Bu@3?6<R_qKX %-9dR4EJk@L'>06m]'#-"(cNr:+!8Nt1UJA.dl-?-6t#l,Tgt^`!n/J<Z;1pXlNGcN3Df.^9jEjjtLI4&bMnEgq]5@R]Uk7&,LD* %-Vo4j]_@P6qLAG:gXhd]NnsN466U5\42AsE?,"r2,<0dl?JJ[fG[&=1#AH]*"k<@3er2+Q(+Csf51>9hG;>j1j<Qt^=&'Ip&+Zu %o,"n9326EOCjP8A6e`$5fdblDC1oB%ZDAEZ271UKZD3/_40c5jGs"njgX[@))VS%U4)/G! %IMO]g>._VeE;>7dYe$FQ[Rci!c;ce %HetEF>eRXCZ=7jDRYZoK4dkakmut6X9-:W#)]eWu3q$Y#fTZp0BZKm-lkk4tqs'Z[f9\-$! _468M*;qrUA'<)q<%VJj_nL3rpR>f %krA=`D%WW-gK1jCG=P^ugJjn#O*NmP2n/OKa/1!Q1#a3"pDu:<8'n'(E^!"? Ur/`"#b(BoCj>hCP<LLmTng]24RP;^k1`u#(N7U& %s)<=mXea4um<b:%0"0l*ICO"i@T,nP+]J5c,e_H[:9247kP"K6boc,ln\[NLRC<? Z1(J[pWRl'khHYI&Q`KG!bj+<Wf@5+>F'FV' %!Ci,e>q<1&]Uo6&'?OA4fM:ele48S`:!D^IOA?p><psZNI<3--4P-@%<;pnpPWk[Ihb.0uF4X)DUat5! bf5mU1mt6S[,!)ZBl>K" %j`;'A5>)l:CY[ksV1,jNlJ5l%gBpW!:sdCoVXX):(UpN'4>Pu/A$^Gca@hl>s*=s)k,? NF[COUKS,9^C5G,JM\#FK8Vc2b:26EW7 %G?!aclJ,7-40!?lF`,A0cr$@gX3PS)idFeh4q;`';aY'IDF3<[N5olJ?F@2?lsil\"Y6i,ea3VmZ+U85\\ UnnK*g>Il^VgH%3,rg %58&@&hd53shKe=67]pmk;"o1`BDgD"pu^_Es.02[*n=H/`TcCQPQ1L(p %cSa^H>rQmJ#c[=)WQcf8Wq0AQJ8JM`qa5k4VR,B.!]7 %_fWNXR=2@Vh"PC?Y6c'+q<"j06h3[[igPg=;Gd/OZ*Sh#79,f&mUN!h3Vi$t7tV.)D_$ $CcP(eR4ce]Rn;s-^>oUesT$mH7>i!'+ %O1@GlaqAO.^AHn2/H^2kAV9Ye+/(6%E&N'nKt"8"4hnN)qVqDo>/R6*hK%[=2? I4akI3,/D7Z4ACh[WGKAV0Rm^Ho"Rb;0.lWIMO %'Qa+'Ff/%%+5^oDp0g,`pQjsUQ9q<9EUF.P\LjA6UGR1ZjusGmDPKX_&#/KAU2l? 5_nZ0AqqII(pCW':`FO.IIqXEUVkgd`qP-mZ %Bq"NMaq$]Y%Y"o$hS`[U-i!Pej92)a0V=XthpQTf_[*\a]mCG,3.H)Dk.@,+NPQSTp>c,M;# %kgJZtu=@(\RB3$`6V<#ET!GNNim %Oa=)*&GOE-mea`#3J>`QESTP@EdS\40(U1B`_H'2LV8]%R`!&"`biEX%so8)22?t"NQ54TO+! >'*npD96h0^8bSDL`%p<N6#iYB+ %2tt/M)`DJ:IB[gCk@*,0I/eZ"7%Z$Qm'[n(7pMe+#*%s'=2- tlgYJ:c[rk`#o<)5D>YKO7/FO05r86[G]REB#a/2ru%H\]_m_m4s %pAN/_>FMhBm(M)jVZu_^.EP(aeJA`#JK6I#52PV3e\h*:qt%j&>?q`pU3f.!S8Ls.GTb#El) $GUK0UbI&Z=S7A[k7cHYa(-rEhI; %C&/[miO4$b0uE>l';i6bKq=)NCaqsR8]5>XXno;`'WC8)7DcoK?CeiYrU%pbJGIs/0/*=;iJW(:le.d! Dmo>Eml-ic0`U`n#+BM: %.3nIokjNrNEQJ.XGfVdeaI^oqGI"1s4o1QEk'5+YGKftTc-21tl+Mess-i&:hd4"Me<C0jo<U9%Cis) +H.:I_ZF*7e5.,?n=^O\J %a"^'UM-/.`n*Q=Y,<gdWd163QqKbemErVKt+U`?%pPId.XdTJp6/ ($<*aT(#DegPXXFmmbffZDIdf4B8qr2OtcF<Jr*fD/_?aL*e %^\mqPhYm-)?G<XQ84:WDrUg]10E3lTNIXi#L&RRb^KnMms74,^rp[Vp6\#%1a.%! bY;s&Mo&MIe0E:`qI.7Sgnn\0<s8'bP^NfVZ %s2U].&L@A%hsjL%pA1s7n\>(,q-X/;VZ#O#Sc&KJs8DuQac#sRs7PP.IW8QGe=MA]dRhWGHfeN\T=`&ccQqfDpu&>>WgubhDl*U %HfdrE6nHZ3ScZAPad&%tmNFefZ"EDaKZ];G1LDW\Ei[[2O5.0+$Yc? Dr`LhU;VS`D2pp"7Y4DV=hRiGqQ5nM-mfN>Me-c<"5aCnh %_)ui^=gl=]fT8d/K>F3H(0d"m4JG-(^ARlMLfc/O^[G.2Rb\rL%jiDV)8/gp\T;CQ`b!,H<((t[A+! @SXc^nVHZ&VdFlloo&pZ\0 %Z1QY6r7@B3R!R:kV[V.2%!u<YjS\F77i;+cD"@R6pQ=Rr0gE%5jQ1R\0RMJ&llS\g")g(j`uISI0W2)! 4Hn:ZNq-Uk*V@ER*?2k] %=#XP@ao=PSfHiJ?+0j'UKLLUT6_BX]elb(fjfA\V-m)K(`T1m,mq:*! 2<i$W_cc77@7kC+YdJJ10^#S_D]e\m*;YH?m,@LYm6.[1 %\T`HWSY\@Hg.%ImIgqsd>dDd=_Q;oPP)M*@MWXa&s0?:`G<_]c`+R? X[]`^rN4`^BkP;MbFj83(cSf;WBD\o2>23\%i2YdV^2RE2 %3'.Y?fLVcGj/oDtFPa(nA7LfEn_)G3cdl'QX\Chuau=%X$&`#/iU60PQ3NuE^[pDeq! dj<Z=bf`IIjZPI1BH;@q!lqr:le)_KYGj %HF<-bhQ5?>.qeCQ*6OhtDOS#QnqXM4?>ZUH9;`5hc:dGZ&>?1u4e-RH&E]7T %9q/^E.kPCZM[4A5"Wp"5I^Nqdp?T6)rR65fa?n` %W%u-gkM:)RcL7'(naLgnA\r^Nc9(p&iJ4V7G"jVM2,).M=A1(=W\6a&$mnRVC+fUNqM:YOZoR]<r\]=1\:4!Zde%56atT1peU66 %9_[VR[qS*i:V9RTNUM.)?L3I!eD7E/4g1_)jTt1BS9[<Q_-Z`3Kk:SSI+0@Phc? rQng'a26"]H`b(lMnHVN$bp.\4/$W<2&_YJ_W %>Z2K7?tZE]`(+Zf&?oF]Q<=E*]5`N#ToB@qOAaca!G/`04dY&SFqM"U6PRH67m3=#/:0GdFg(d*CNak]r\ 0><T3`u(ZU"'C;)/XD %DS#Y(E1Fh_/#DoV$b_mB;k;"6Mdd`E$.Yb#.^Gi7<AsRWcd$D:do@hO.G`#Mge_fXnl8n.-'UIF>j)H;c^YA=/>GAW(PA`hL""q %aqt5L]?IO"Kf6[W-kso=(P9_TK6G,X*G)lV`O@nk5[Qj, $gR-'7Pl;q6>e@qi@*_Am6WeD[Vjn;U5[DFH=s7&2;PJ,haZX[+Fe%H %puq"<;"Ro$RHHK9h3P83[]<:_FK'sQo3#'N,`YuLK7'.Eo4C<dgG\>"^#! lBS_lPBXbMkU[<cWn.e>fsQfbZI^GL5F*U%uY<h%I2 %\P-\r\e5dk9c&h[E7=)`'UmZ<qK\@:m??c?D40nW;4GI+K! QGoK3DHi"FoqF+o))QO#kGG/\d;UGkI,'##'_\1N`&D<&:\>Zb^<> %XM/qg:g^9.Tm*2dc`5ur5P>,L4h>2jL`?&hai6Fd?QEoaoAm)l;skj"dg$]n)fnsBX`80n[W0! ^CtIN(1c)18F1,<!Yem:$IM`3f %]WbV#53S6s@C#9`nphpR1\!AO]O>/lnZL)s=NeLTX1-ASm/H_mIm.G! qVU>L;Qqh"rnEVq0l;lUXlb4I4MU==m;2>uQL2pp])DW= %$_!Vrftp[3d.rCeg/sYHHk!!PIGJd>5"?VQhn/*;-g,L%`/Y!Z=4\g\<P4cM`cD-g=le6h %f'YShVos"3OuiIR[1G(1L3)A/6d)h %^+f?->7>>:1in@elig=eSu9Jj>rWm<opT[,@HZjUUKsiC4L;tl4'$KaXf,Ua#(Y^]%? =@klDTg+L@9PVHc6-[%%2LZCd,^=2NHGc %YC)$qX'>"K0ZM/QXk_+X"DCCLJ)_qb/n4-+\3$nh$E`XmTcOp! CJr3027^u34,S#:1S;T1nah,le>i)]jLRCDd"DM.g;4Sh<mK?* %ZCtZBLn!DTENuLBqdPoEfqQ`Oa; +kdD\sY<:kHHKA;e/uq;m=rl8Vq1#"uF2Zd(&mb2_PLH16OQ[iZjC`]Yt<0nWp_8hT?290.Q9 %WmnL[QnrW@A*Cc0UfLG@Ttb_Uc+5O;Y2pjPTndWPcSfdDG4a+_#fB]FDeuRtL":o7<36MBnD)Ja&+>fK1Q =4Zq.+18F-eN7bSWXI %]CU0U':KsC>HVHcq/KZlMPG!ZOJf/<P?:Zm\(g^A<NNC,Xa2Y/P/iI=h/o&Vr''9GNsmhD+1! M9[qaJmVb&Da<h!Cnk+g;4%<,@2 %k0/)[E?/kDNYQTC?Emd>c`Mt.Rak+l?Hree9'<7OL:sccVVfat`FM@!:5s[&[:8/CWnaL0:`K!R?iSfG^\ utuGipG]s7H7M1AMol %)cugb='pFQo_[7TqT\I1g%U]6-$o0jcfDo6oL7WmbmiDZZC>rmbR/E"+4.WJ-@\>76&VU?9mU?r? 9#EF]_:$']%sU1l6)\uP1+0N %`,k-[',t]]7nQ]ErRoK]l.Hss2[[k)EI@[7+)PNepUPk'EO@LVo=Jr\oO!)c %K<n,5.5a+hfk43]3kAsjpe_H9OHW%J+3[Xp=SDK %LiP_'kURI3[aib9Z^Wa#f8O %qij4t>#IBe`5JNr]lJ<p_2E<W0^@+(1Gto=;S=0dng2p3\&`b]HAL9KXPm.0u5.Rb71YE>o*d5nD %0u0G\-o$qGhrE=%1*j2Ii+fEH+GT/EN"Fj[HhFh`bX=P %<l8N39+5>"\5hiMO3I<)nrdQ]2pB+R7%2mO`r`@;7(r"b(h[<^rPY0\ %#;ef;?%IiB%BI4)du^n_V+6SB?1B/CH,-c+>1mJ[c?DZ;;X*]T&A/ZH2: [^/@f/PL8/mV^j]G*VjmZra3.>J6cT2nkW;9,,@>_aX %D<-/ZHDWn+F$QbIGKp%ja2R429P%[8252ZtYp62E/C\2TQe\j!,nDD@? F7mlILDM)4#XHi_aTbEga<E:fTA4p`O=0,:6YM8%j&i4 %i^TBHiEAkG_<(+? oMsGU["hl>=R7e:>os`0_=]dO5<mHJpP]M2X>/KU*bAF\ftp@RR=e9,B4("L5Q0&TJ+I"ngg*j)pZ6<\M+k 0P %e$@0c9S`IjAj=aWXM3YhgUB;fUJ:U/a2%:[6?0n[Gq>tO=)AJ?,?Dt[;eF8@26iL.6$ufD;!f1/>kg%DAc@TItC^LbBW:B&4+R% %5;,4MAi-;@=trgVrrQup9E59Ppe^.fH"B78jT8F^lr',,L$`KWZh %XnUXkA/ch=&BEIP/NL6mroCn=mSjb$omYX+s&qggKq.=V;k %4S-VOF%XN"n9*3K\/q)/`3.5%n"7'=Fi)&`G+.9jJ1f*`#sqC2]G>@Jh,F9XD,E0=?'F,UA+&L*&M[-.uWTYH%\@<8TI!fl':!6 %H&q=ke<.T8Ja=%o0B+DSZ_A*?[aa!<ohd-G[JO9spui65n[e9'YK2\rT0&?Q8_hEP;h?48LpBb. [2HP@1Ch_trQIG-aMg[fK0NDV %IU(O7?\&FMgXU`6g"I(B6&<M:is8`BGZY'9&&O+P\\q-]45<3dE+32JJL0@NU! 17^6Sd9"k>Toi6U6k4>F.:\B/n^+Q!\;9dGA0R %5EGK2cpN_JkE+""q,eU)TWe,=I/$ $pI/C/b]eq.F\XH.J[a"jGMu<"ds7VOs`8=cE<BT.*p@BRp5J&Zq)Qgliejt\3/n<?AqN?oU %-231Q\M4Vi?:%?%G9l7.bWQ@bc;RL:E=N]ZP1tAfBB-t6;;\OnbFDK`PmpG[XVT=Oh8PEK9j@nMHaq#L';o]pN6dJ3L6C"eEc'< %*#9O/L:r6u"Wnl*)In"/<H=Y*NQ3JEk\GkIh@JKsb[KD1_P]?%IJV.t4/PBfH4?JS-Au1.8pR! 9Z"KpB7;/;pgo>+O&rF#5\lcR5 %R!Y:hWK*0,/C@=Cc[!6R_Po^':nd@qN&2J1MF72-]LPqOk%Q,(d1c7&r3e&BdOX3/VQ*q,L!K_<O4Brtg\ KH4j2JU_0^AJ9pjRiV %8FC1[lDJuhq8;W*Q`!:%'E.gsOfab5/64bQ)igtKoO,!#oEZ7,GmQ$DL[?K5(a^;=G40NFOD/ +m'=+j*1>[27,[$=VkRm$AghtE( %L7ga[DNSXUdBgo#,tm(R8[F41Mp_E5gXM3VakWaWchjNTr:KgK'I"*/Q9e<j-Q9U$/I.9i>,4b1IS7b? &D<--<W"H[438`11k0u[ %qn]SamMR0+o?*D"K3(:_A->WD<;Q*PCZYAYi4$\cAHSbARn`YKOXH"T/\K`))\6/q:;RRuL.o#M? S=K$\d#M!Euhl>+I/!eYPrfI %Mbh4L&uG=CZa,?H$I`1tNr(Q3i>Ku(@H:sU`YY7tUni`nnSVf,i`[l<[hi0iG06\VF6g.G+tKNq2Da3aPkdnjDi_OLH]u(=2?V% %XMOI,a`d,:f?S72oF\ib_jk<+q0PVB/tMl&rbK<>!)EAA?Kq4!O?0;cJ<bTS[JZZM %R9bmJP5/J+*o>\ObQ+$9Hs9PKLt5+@f"3u %mkpV-_a1a+UJ/$-[`J8DlMO:ohEJO1E:?(Vi@cKJ1*7RdaGh3D%Mkcrq3N6<f6oF#Uk=Z64qPZ^j+ $VY3OS0-It8I'IS]pcDqtYB %Z.r^dh9Z,U2dcO[Rt(@tJ,]94rpDH>*'<)Vs5@1Sq(G.eSYs4"q!k]:rPtN<^Y`tDqW;^Go@n1)2jJj2a %ok[^F:b7#+n@0TW`;5 %NImAPm7=<h+ipM=WqVg9hPFLEY,CEW7XKN1M8RS['aG3lkM]ph^DW@4\HeFFpMoiF_`V2fhj)[) +2;,F#(F0*hu/8Dr0R8s?iKH] %^A70f#<o`WCKCqOeZRq-#=5SNpAob-hZ"!Jn`aH]ct! #A&+pGrdQd@hs6Dempq4XQ50)mG9=D6GYc5=_[&B5-OonN!E\VJgNpg*q %]e7@0HiC]*pL[@UJ3s9bkG"RZ%nk]#k1UkG]nDo-7rBL-Mb.V)<Ba>>\:DnUZM:)&4?OK7'dLFu!; $6/kAO.s([K2nCPJmtAFp.H %Ls%Y31qE!H;W$iBaBfViOeDViq%@!^)V'W5YXGF6;%. (GHO2\;O1dn5$,AmWNK&5mUCX[q9E68D4I^+K)"/1!]mYA_?4kuL_r:tl %l$;f6lV,u)1AUT70!<9M@='>s?C7B69'(g]Xk^e/&?3&WccTuBUTQ]fH3lS6?TQ9SX0t0JB %'Ug7>Ob""=T2IlfI*IGc,>q[gU"% %95Qho?>RV`]uWajRTlj7j;0"1]hsce*)HQ]$.HG:^JeX56H@"QMdFHARYYY^/G!:'+m0D>)j:Y! DZ]RH@3nR[Ylm5q(WI*QK^X]V %eZN?<XofHE\uOd/[aa39iQg,M+>(VP68$"CU@,()kn6V@A7G8=C+LC2!#8N,62XSS+q789q2gr %59C1ZP7(!K=B#b[.l'`B%hioU %0:tu4IQ63L)YWP2E;B?X?GAJK>X+&e1o,khTLE1Zj:WR8#[ZZ#e:H%1MYYg)DHaGR6:\n_7HtBo9D[9`? nlE;3!1]T`<+F1(7/OR %U@A,0!\TEHeCi[ha*V+0^0LlEi;(^J$;+4TGm2r5*3fdjiq5kqY4(Se5VuuQ:=XfbKC&;oG('M65fd,A1dOjm:"X?a>mW;?*4K%qhdT(OMpEdj^AWOoL6+nh[dc.?,OB^#;2b+6B@$AatXZOp5L_u! 85sOq6BZm+1t.ud/9*GRt*J'Jl,>`PX6pq6T=%6c(8iC%Pd;r %j;`OZ)3:D&$)Z`s=3%nBc!;CQi5/SaSacSs]\570gNC:UQ8@(37BF,fVaVTL;4QBH;O4MI@YpZX$@75ZULH2F+i;DS@c4j98Fn< %QL]9FGY<F-4q/Gt:&uTLHr$Ij@TZcu%/\Q;i'Ld;S+B\^Y(L0Rml6:b$mOei#>&;m9L1WY8dp@\V+Y,I_>ahZnlo6ZU>[A^3[i+ %I!eo`>W^gf?6]<W6^]'`!\q?tO#aRZ!bOQEhhA=W]feLumrT$9Fof*tDf0#5XEn28^^1\uO_-cjiO7YR*qQIUg<oj-1?*cYl^)d %9D.g`3AX3na0:mAEsMc*aT\49!5B$pbG$0[HO_Ze2:Mri&'(_V_nKC]Y$l3DGKFtla!. +#i<9oBq>)YgL)RH[NMaSG,X-*iM1B7k %1B=+%@bKl5=TK\RqD`000EGNH'+9Cdgjj1]+g<2W,k0u&(o\:Alhte8eMZXH-,BB=SY!! H@sL:#F+U&/pdPlOYKpYY7Q'$HMY4D[ %"@+\nFuO@rKf8t-l0A*>YXFY#CQHA>6CWT(dLZeP(DTn5WiV*? <phEH0U>PuHTrKgFq+=\'tAj*4Pq;jho#l1hMH48qcZ>/V*qQZ %(7>HB+6-a3pjPdE.(;k59;n8YLPH%A3Xj.D_d5[R_4<p6[fZ?7L,Q+aMrHDY3OmGfcmF-)*3XMpqfX! iLoies,>pi(]SK`:B=WK% %QsQEHKjcd*db'@3N5@&JP\uoq$RchFI!AI.Z8j!2]O^g-b9o*Q@pJ6>Knl+1q`["pTM1[eo"SP+eFZP\d!T[qHUWk=)aO]>WP0! %iUh%C4C=`!`Onp7d)lOk=G6cuD?El(;<WpnEk1LEJXnkBQc!,r9YmiNa<_Z`@(LD]=d6? G39kR(Ts(+`pjUlQll,QA,%1ApC-=uf %bF[#ih=7NZ&J?!iH@:sW^BEah"lMj*pM"^Bdi\f.@Ke,f)V;l)I@>2**&WD>K!-<Y;? 18'7NYZNl_kit3OgbDY`Hh;Y8<3rhl[$I %E9='[i+6'3&pC;hdOXb&e<j5$mL#Y4a$SOh."iO1m^oBB$%2tU.Z_n*iikTVl8&6^pL><["(Q?<F? h:`T1kR?a'BNTV_c".^>:\9 %I=?UI>anOZ^iE3GS!@2fj3&t(p[q*1Z-#oaDU9*(VQ^O47S=NJ+JKQZmDaE'k*l+M_"ES9%V+&EXluB;a03>E`cJ0g1u2*K+!)6 %D8Q%bf.2pZ:d;&a(U;JfYi+W0E"N749J#)bUBXO-EZkbi? %U:7Z-]Vi0\hD`G8Z]CYVg8\4=UUm$\)GlL6*'f)j9c#)7b)nagQ%c %\bQY=(b<+BH[PU7h\c(S,(05<#jtE]oDQ.o3?R<H.*;;a8#J<gjZb$,Gu+3jV)SES9$GJKi+f0G>(l*J,]"s58d.=rq+B@roP$S %]TZ]KVdo\STBa>7s7i)`I)]htgg&RD? BY>$V3YH[5P*3B1Kbd`bHK4kBJlACJ"AjuT47h6q6U)Zr<<2lR6PWOmGf^FobYr(.^R!a %J**<NQ-]ES%Bg0PL@ULj5!_WO;Qbi`K9s$d&r-j9\dJTQ`*g_gELUr>PRDI+RUQ7N6l_CE %C.5nWt\RN);jmd-rX7Cf97#nCb=c& %!Se@S5+=#c;jbiC,Bcq"\BmifVOD(YBRQGkJrYi/Z+-iM754_r?+N/CMI]T$@Kk:DZU4ID$i+'Uk.O/<O>[?J&.WPCk?`\ld#E) %PqY?-)AMAdfX%kGSWTP`l:T%R`pL3nYfAH%h4l-l"JK*HT4;K!+0TkdGtj1A&sA01,s"LrXXHllFG: +<&L96QZ4B'+PSP,O>5*s^ %Wk-U`F0+4L^iqB7@'S#mSUN,ql?cs<?@Md@J,6'es'Bfs>9MI=$M,@`piMg$;dF.Hp? Z2o<*GYHgF`=H.3.A^f\:0tcWW2IC;`eM %q]ahJ3O?d2!+[Nj6HOr^itLg%j;fMmIoV*?`iE,LAO8QG.c`2U,V55$ZPXd<rS4J2b_dPOKh)2TaGI>Ks=d](S7rq_G^6@YZ=!C %j]>QgV<b)!=h9V'q[g"VG("X#]B9.l>JA([;?%d=AoHJ64_f3eL6=I3"'WrZDk.P=hA\<]] (0Hk']g-sM7b %$3u5q0<ZPC<4U0cpFDoo_^hhL,p[B/0@?fg'Tq]SW*JWM+@LeiggHa[L)AlHmL+6QOB:)8/q0Y %1g2&FMgI#1Z,r*Sp*Rn>&G0I& %cu"q8.lH%Xc)qN_2-03J/LSS0[^0:&@T&!A3"=ZB-/l4k;:$^X,sa? GoUqH`ak5,e]=o0>6s_&hj;>8Pd5EQFoc)MLRuE0la>UgK %Wo`jV[jCj71]g-:U3deWhK./Qj#`c$/"M\aMuWb9GJF2sjSX%MZ+!!I7ZR;0Ik`[klm@=gDY+ +O:TU_'HWX*4gp6;*:8sD]Jt"3C %q3_cRgPH$V<uK!i@mW0\0ALKZ]$&/*/QL8;<F[cF(Xg+reK"Z@d5Q,diG*h^=(Y%p@"%+*Fmp! 7jBT7_Q+"S(IcjN/>MjBq5V#SW %9'H&P[(nQn9DIKKfXH0Q\2qYMLOGbF/+c?:cWFpP2el'A^^shO>-LU86\beENE&HJ- s/]`L/&W'*i8FmCc)dY?:d$5N$U:+7$rrH %7O)%l:3j%^C\Y#L6-`d)J>LWCf(cFsHd16XGZ;2YndQsg)fLbMlNRI>Rfs(rdA,K`XE_Z:htQgs1p#! ^'G*-6G63gSPo%."4\0mp %dF!2Mg[h/llHF^A3b#Y([MImAVXAVKV1:+Walh[$'D4o81mA;j=hM4:^VY7)F(uEkZe>SFgECGt %17-"Li:Z"<WgELGf5]4f-T_o %WY53q3l\l..)/eHQ%:u6`O>SJXK#9ui\BdkN]>^L4#*-/</U%]i.quU@0\39^<73CTTYON,=At6hP&;c! =_H)(X)YgPoNG+=#.R\ %(5&nL/sg@k"0%qP73j*>$E3,o:;Ts8lJXV@l0G4bM^Im61rPLiiOdDg@f6%sgi)cN?D,ea3h0",M4q8]L!?*q/7Sg[/#9^7W2T> %.&G6lS*f9-Z@T9l6aAaH*A(oI\G/Z3CU*PqXo,uVl:E7Q>[:G;"RXJYTm)I+]M_AV3.:Xrbs? ODSW(C)UV\a+=&prMN-4's\Q;F: %qq39S,QB1d73<"lOC]@m]S!Ok0T-[5$ (Ir^OW]s]@j[Ed`suBt/ca_YANs>Vjk=G6:B,NUCXN9m0I`M*6P($Dq).#;2<l2%MjtVA %9fRjDLs[AEU9i1[E7bS[o#nm\/a5%9]N=NZC(,DtRW%VfZ5Rs2]^GFUNGV'A6Kd?-F](.(QUEH:O.[lUq?(F'NS\[=SQJ5e@-cS %:+DBr"h.up'io3lf#hjeb;Bo,ipG:Z_R2*[[`]`]M;Be9O74E="#!o[Eq9o7P/+`SFh(c?FP=XR! 890p`Y#%`Kq0Jfb2&L_l+%d+ %3rg._4$1()BKAu4\jYr]o`I:pFeG*4]fQ#.$Q*;f$ [#M2P,')BL_5;sM_#3n`5qM\i7rUi"rQ<YgfI2m#UHV&=uSBuX53['!_RW& %5ia,3EEpWJQ4hgQrRT!(;KfJaQOOG3PdH(E:EeOpDO2rUi9Lm//SiT%T<5-DZG7`-! 8Eo1V(\\GZ&p!.09U*"n&U5A-?InqAag;' %jM#ThatRsl[/Bog`s`cPln$d-b-eZT&P;D %3ROk*Kmk7/,KN<`"99_P[DLS)aE8;YUlWpP]*9e.UTU\Z[/O!VTeaBoT %C_u[t7;9PKP>"*k<jE<mg+!)R<qN]fYl/;C,bd)+;S*Jk< %VVPfi>rrDre&C3rsXG2M`kOaQOO-;A8\N=t@:J+kL*7G)MVO.PQ'P %]>YJPQ3fM<'nAK6>FACCS`.L9_29o"YQH>tg'um^FeOYk]E)a^^#B82_M,V$N#BahY-+#QesC?uLQTndm %q4d)V?;DadA%AZ&hiY %1M[h1ZUah>.tOe4l]b\a,5/E`f@WDdiF_,&[L^Nj:pqVF_@O>=0hLKf.Dru'^*d:\Or@Xp0:u? iYV+Kd>06`EDS[hA\Kn:TZ<9+, %eeg*O8tUYFbp7J/g[_uaE@3o*IFYWa]^8%)*>*j>gceX+ $\Ht/JZKl4,@OoP=[ecmJ+Kk_*@`lb2i/VR6nNS.*nPOd6=fUFg\)$q %aB#aRP4K;5J37OW^rqpn;/tdQ+AAP`.#BGAB`VJZ4ir3P`6e!:"5/1ol^tq@o2"6Z_\VIU&mB2NA#'irV, b9[<*QlBFomA!Q7`<D %oVW:.'*Aot+VL2oj!MDjM*f*I.!J+p?s]lI`T]MAa.luL/q'nA\bA^9Y-"Y8C*&r%!Ea6ka&)3*pDPXbs/ lJ?X&l>0fOpEHLJa1> %R7EDn"O3hVFRG92#M(J-XmlB.6W1YF8<QAY!YJ0K2,1pa'X2-5M\l6LjJP2"LJ9A:k`u(M#%T"6dFFk! ID1kn(;dtFR$b;!Ii(qZ %DWq>5@TWp'."`uH^:jdV8<\GVb/NDgdkO,Q=,E*sUs`(7Bhr[rU/A%+%6_GPCP&`6lEAS %)Xr[G6<k5U9&d=<8Qm.D`0lTWf+6bD %=A^60h>DeLF"SlqC4cBY45naLn9S\GQ-'@4_F\jJ`WoZ=0Z8jQNq&BKS4sn1#GYFi_pB9_2qu+ioJ@*\4d/:Mfi/J/Gi`hcYhe, %c%oc2JRALMB'!S?'+4C5\4P8['nN@/,IS3GY[LW-*.a>lqE(?(="lUfYl_=K/J5<P(i2hqprp0p)bdTV%! l%RFnLcY6+mtRfQp`( %pl7V,`N"Tjdo&0dCbcg-]+E45p:C)M/<)t/lJ9jC7;8ikg\*[mZ`D@=Q7%$43Q7=Y! 8Pn'4M5;Pe&V4+::4<lL4<KU^d"Yn&[!r^ %Yf%":WH)Do6S$&NL<t2EpB*\6DQ."B=PkIT. %2#ZIBdgr\,G5tU<HU$k$`oje6HdG#@pKn;6u@`/AEDUhi^gt4/-4Y9(oj>dK:iO %eZd?JW&T//C9\[ODV-WY/!bB-bp,N[V[RL8Y>g<TX6esBZ!`hd`C?B]R\S7Vel$2+_$_o11Y>f5pED=s$e;c`m+$[ZN2,NCt>5g %#`=f_$:%]u0Va4@g?IS\c]=*"oC@S*@R#RPBkA&qDDb-rNh?p(2Hl;8-BYU %LLtG]gB0CO'XbJS^::@o#ke*BOf3S'CHsjufufMJ %'ZFhI^N`MN:MapN["+^4NH&-B!K3S(fjYD^m]^P@AS#ElRm]/^G\LF!A4b*uNZ..9j\FNg;tWRX0+FnOR-6oXP<ohL+cWd!2#@4 %R`&0r^_&2Ps!O;@kf6lM?--ORFDSD=BsP%rq2d(H+cRX(h71p3`5XY>i%4>D,_:4rhBu*Y$ $IY&c7EhAj95A3YU*B[QUf,sc/FAW %aGUeL3XhL7S46YS;?LJU7a@=AE=T@8JXJH1M'9oTJ:bL5_^%]1Pqg$YYrbtq=12*`5AMLu;%SrA`$lg(MWp)]L4VIS%'7j\o;d@ %A`7jsN@c1CK(?$s8A<q"^f4+4XVuJK%'68j?"QY&1=hGH=5ajJqE!br!"lA<L; $>WhY^b*+E#XcEa<7gEo2dDVXhRMRKe1gi]%W! %8ncJj_sjn2;gqDY``*B=rap[#/8C*jjE:&l=h>d_q;lWWX6`'U/QuuZ<R&P3!_r,.#3_1! LN;oGfmTWhRG>n%7O#n>FRR?tQf1C! %^5pW56Y(mJ2'n@dg6N1H7+UVWCNHcUqZKMm(<MHSm[H[EE-Mr#&ti%=e2h$aROZ2!`%&($8/HGk-_@2D]6!I#;!NR)l#rF'=sNg %e*EjPXp$+u%THI_AH`#<kkQO+L-4#U3CtfHG"R#dj^BA]p;dj?%BWI&>dV;hD"n(bHl8K@qBYe/6?$ %pX'iqMOm(.T,Qf$MdDq7%KY<!0H,pX4e'8s\e8ed*a'*)?,<O-:3uK``&W!Dkkt'Z8EP82fV8jG[+^83gBm]#s0i5;'f#@"R0eC.[X %iEs@:@oMQ';Tb[]Za: %F3L08d8WHApF(&ffL@I8m&nL#ZW#8d@O<_E$9)dS=tWke1]7f;g%\f2+ %F/FQ(7&Ad)DUNYJmi36Lqc#$>cQ#N#0`1,g_,WTEt)K %&-Be.F*P*PWj7YlNc=n31*3/GRSqU8,U]`E0B'Q/l^$KL1!=&((-%rA*Si=JV9t2r.-s,? DZFt@600t*XC8SO]9VA;l:=,-i6,jO %*#elGcD"M^HH^Vm?M%NFJ/TJ0Q5)ZiK03u"eIpN'JB@,[!`trpD1)QZ'G)0li4XjlUUCJ%Xs@""2)DW$l4$5NEK)07?`tHYRC-= %<>(TAi1i]aDJT]Yop?jFn`[;EMf`G!Q'rA-BS9BcG1Hc/V]?GQk/k7QPgs#mM6%%?Qt=croUD[YOr][\? `jlSQ8kV:i/1Tdd![7# %[6j:aDC*!)T7]5+5d>u&jArF`PAN/L@iC6f]`r;W[dp9hE'TKO>+'63b\kH? N9M3LD(8r,/66k/>T^1R,u7%8WMR>6MWQ*hh#l_H %lS5:+BhVp'&$$pg?Tj=LML%!nJjOg,fB?urp-gh,>:6hQ0;<\s"d@KX]a:_X/ttl&f%3*0kZa=r/ +`kh*C@;gmDgse't-TT9rP9O %D)Q^BnI!2_'a$e^f0F(iF=S_hW83+Ki"N>&Kc[RPNX=Q)<*;d#qdZ!"XIQ-"U.q/n? %dYN3e>9RfW$3]=_uQa0OF[*6Qg3>YRUOH %O;&?m@JcDr6e$5Ch3eg+_'D7M'%_)IgFDYc. (rMm\j]OW"`F(O>15Bck(YglW>Ku91Y9R8MuFCp(t'9&))0uj7(A1n=4&kPMSlQl %0K#tLAcjN!e2?c8c6NH]gJ28(U1+#AW.j;t;FOCT@[n2]e_!#3-<MH-7!O1bm4_sK\h9\,b]gjWQ;6]Fr8/c$I*>XpoN(?TT>'J %!$p"bf0.fM"56e7IPHG&+mGaY_DCl&QNWMcG<aO)ChkAE6Re[Hd^6"^(-bca$X&]fHYmqLM,7$ $IgQ=QV;<GLS#1Q]$ur\\VJiA, %"%m<E?[/@X7,?@N[WsZ=ABqd)ki8m*.)(YZ% $fYN'u\"FfG=+tGGo=$R_>;!)6P<\\7Q<9H17Oa7/:@&dF2$06G0%;7j,DTWP92E %'"'IH8r4__Aj$h^J](#`K")+6+8Ba-1^r1V2fEbWpnRA_d&NJ0U! <*G+.`sh4\D;_C`.71(F-)=$Q2pD=l!]tB#6=+XFJtiI&=0. %piZ5%"e#C;/NPVU8jgC1HUKMe>=D'> %s8ToK3YAQPDF<m61EZ#;)AEW24c15q26Vo>b4Ps<W"Sg&2(-'bDV<H>+nL7p25LM>%9CF %@rJQO'q@tf:/gkdE=0'h#&/j(D*'H2"t1qZ_B0J7CWV;qT6,LHRBEiHbWo^]! HF^:>;*d7@7\X[4(=pnl %(Su]tWZ$JhfYGiDN?Cu7^GnA$<ih:C^V_cZ=<ba:UTL5jrENbI][!mtQo_ca?U-\R=>HWG,k"`fu:c$a@d$&Ynat8q*(j*cm#gY %WBIh6h7/([lkKl%-MKN27Wp_0T=bjA[CiegMRJgN@\Vi.`cf7r*KdW')S`4`J;R\s#+flkrVM1rqqgWPt>H4ZXJNB:j<l=+3/%8 %=8mEX.4n6[?mBi.8`$L.)*[VO6#&n9lt=^p)_sBU_E6?F`Ms[Cb/ +1b[0a1`(ekpG'/TgRXBJZma#\,q"I'I>iO*TIP4`q>?rl"/ %lrbhSmEVluo."t3@-tH_11,n[coGh?2ue529\HsEA5M&hfteb7S %;Q4f&>/tEhkac1:dNm"I)Jhe]odP9Z4(gn)N<1[a$Y<(klYS %E#oPL4A*Jg`WR-#BagJ(mOp4um!TIj5LJ`-5;8Ubp8omF#Hug(8l+heep2;`<C*K+SOd %9_r);9L`ijZ0ID&hQ4H'MB85dif,dUR %8qZ>%[(r+e"5kXZ"&Ht\l@Tqh>q(Uc+aU$N-UFfLdT"2Wn\NcEo)Z/+)Cj71m]FZ%5kcA",-`HpMYE-! qk-k=gTC_AZ#r_U#QgR8 %]4pJ+mG<J>3Y1K;7BSS+>G)EC:5M@*JU"i9TCb,H4<bpj/'G.&UmM.2lh/E#c4WrUdEWVQ;G)<Nr?11LRD`?Q*n;?Xf>Scf>UO1 %Klu1FW"H2Z,).Rf=@7[U_5"9>cHt(^AX2VfnED1'TS4Y? j(+lZ[Vt7_fMVWW8eaEJq.U0rma/45=*pg]<C*]OpeL"^NY;J$i<1^L %kQA)s6#1?!6]fQkiiOcR:hGgO/*IDL^%3.qp6IE)FL9h8q4REMlQk:sX83\cRZ$o7(cT? b(8;RDOE^e^0MZ4>H2\;=9Om9AqSE9a %UmRrG;"aN>3OpqcjGjcc,)O`EZs^f`.noD]]*M&`Ml2:<GoD71.ak'`^t<Wj)5mEnSY9ndj/PAoFA_<kD@0a 5jhjYJbC.1W']-c %QE'%,OD!D[aXQj1'flFA-'2,Yc7k;,>8$68#Cs$'Ao)VKVPK;fP$A+LbmG<X^J-8be)Q'N2gsc<>uh %7(T<a]PeIo\TMMTM]s,uq %6mIlel?k8j`Pm]KRNTFDqCn>V>7SAFnfZ!fXb#"ANj]Y#rSdtDY %34hQu$VO(t*No@[X]:RcIF,J(m^;HkQeh7pI[5&J[M$ib\8` %0!K^Uj82M<bQOneO.s'?SRZ(G5IUqNbUMtf2,:QB)\rIP#J<Z?:;<HO]AS_? PID^uS0mYmfVpHc+\"4j5Wk#t$Wcd+cUbH*^F[b: %/eqU1.EMljDj'd,8';<o=,dd(5ZGds=b%#2SXIRpi*3^\[B6$ghGlaiKcN!? diGNnhPWYT[Sr::@oY)'<AL\a]iK_K*UTjqUP;qR %Nc>e%(rQ`GX<#$KfX7gLf>>2p^r9&n\"9J#rhNX3l(5bbF%U,"'Y+ [ah&Cd(0B'4DRZF+9rlhjO7&EWgdl;$>')!sDGTEX?Hit)# %mjr#fgP*-LjNT70/t]&c$ZgA_>9!hN)ah,L,SkF*T+O]9VHreF&tA#[Y;48tiE>jK%e1%R\9! $0ZDe/<#8ZWY1)UG+[C+0DR@X7V %=1A_jLMA,&A'(456D=Of>Q2lR'*Dc`Edkj-*LS?o.!hLW>25b"Gk+L$TgE(b%5WA-WmdJ? d(j+YZ`18UC0.tP:f?uO#6IYhUXs,M %7r8H#G-"*L4rQ^[OfVl5=`mgnF9l"k%64QiI8eP;a:E4`?\UX-![>JHNa! k=W'/Ub)=4934>p4.QU(=Jm`AkCOXdTPgbY'Wg80[n %TXQ4<E$I4PH\8M8Gp`8C<Wla<J]R@5_ri$(!j0Be"rfg<@H]X_ciR0K/n)!s?apH>0n?C>0(=! E0fFuBBg4+kPL`sj2a\rs'e<!g %P:Cg]E'GOe/+k5<.Ui#U0.t=spE1*\3XAHR)[iEUHSZb:(s/dY+unCY5ljNp1'N)ZNhG3+B"eV^$8*iL$\!UU@)KPS`GAH$6Ej%"P:MJpP.HPm/8pH"ZG$a[g1\s1@H[r-7eU`Jrb4Wo1V%qPY6#O"`.%kjk\-C,:t80bT %B@A1`2^([qW#Fnn4BZ=K[S'i>j8f68o5 %?OC*\C?Q:'P1&u/dFrD8dm"M-$-bLC'bL<W-.kLilkN'f.+gp:@n)1X*ZJW$Hh:j4+'s(P*o0VbY/rR9k'0J6-]_fJ2R]3&3qkc %c-P\=Ih?:E`C=[_5t%L)[DRK2YoLCV#bo0C4OB$6")L7O?PfP0F"i%d9p7kL+:eNm0d#nD4\Ss!?+I_/#r$*Y<emWI)S:G#9Uic %f*a-U.a2)>F643/5bdBkbMJHCKEdaH31=,^Pb"rIL^0*m<jW,D1;o?$]iO-?d*k88H89VRGHn4! iOj,_<>d"a]L3Yb!f\g8iQe%9 %*gf^'#52^cBUB@6QEJZEN@oV<E5a&^DS?,r3(Y%ZSOAF0Q`sf.K+JC.?fZ5G0u@HK:l2B? 7W8P`IaPrE@Qg*OeP+3Z(?UhY8fB'I %/)\T3B*_^=*/!>Xm^#N/5N?WK(0#i=`hK0c<45fq1VjNHq")ntoF5H<AEM'?=3*Z,[BC"N%\))i(l9o:Wi %mlG`@4X%L^;R#cq&E %ILXG(\X'&1/mi5.n*e[m"=purWa8q2;H#Zm:Kp] [+Su>$*tK5P"W&^$A1lBu#g`a_7.ROp[lr`hb&:1)m)3FmX5.El&Ki$(H?\pO %mSbDun0oL8Y2GS`QF:UW3?J`uKioc/o)(<Kc1Zn\V9RARaVK+$"fF4.i!29h`H"M*8ncaVHj? AQQ$BUH=@\h6"[Un-d^#.OD%L\Q %l@?uj$j,/d&LF?m%g"GB;O%W:?Uh9[/8qae+mH4hV!LBZ`B60YaVi#RZP=@lJ@ng:s`Ag7D[.9lWnKUKdXp"_Prb[C^lB`/bsF= %7ec@b*h>4(@;F@\Rr/5@C>UOE@oblejnO^05-gcQa3ag/#5XaBntTo.*m9k\T_e"=cVX21BN5>HDk$6Mj=@,$I">.kcL&LTTn); %SKD.BCPgUCN*Sl_H"t\EK/AcJqQ&/]HMds734sh`Gt\s!N^XGfA]"af@c(B4`=dNt?o.V&?t %,ef=Kt(r"-c)VtUu+FBFm`\F2$! %CM&kp)8,hR1Tbm`!o]@mhB?NkI#S8kc-&H+(5WuoFha@lZb3"<#uep`36B5.d>0<ZgeAB`K4#3,#`;VFpWjmo(.Jg?,`9Iikd5_ %U47+''KOjY&c[DiN^0o*_CubQ!iVDP?Ab?pE@sUl$*@pP3?J5uA^SN;DJ?jtQnI(XfuYOU-VeI%$\ ($Ne&XQ:%b?5#,HVPUis=:D %dQG%sF3#-F'j+loeR-1Lp,a9]r@R>ueuouM`</C^&(Y[`R_*NC%T7f! Ni=uP3Ij>^;*h<3QqVC@oXira(^!sc<a>RmE\@M,<'ib5 %TGtJ2M3[%WNnIrn(;:[qd/<U_J_H7)"g>uT1p^ltpD.OpNOr@:\10-OV3!%7.QPhdJa`O@R,JljAY#F$U5nCoK,gR=K5POi<Z!Z %rEUEf`+d?8D>^j+\Ls/QklNXFI46([-oc+kM?g>t!>OdV.K,A^!_Y8*\b6#,TamhWl<0:tNT? OPRV$i6VUJYs/2sLQ]X=7%5biJZ %0-FN)^'\VnToaM7\KJ"f[%mFjrr*'pjOSRi:]8<t-@3H-,Wbq?W%F\_A0,+r]m://TgU? 2S4kiifopH86m2nC[X!"X7!B\HB53Y. %!GtDoG\Nsn+Cu:DpV"'Y-In2EFhG);#b:/Dc!_*mV`iJ0d8nB8K'=SO[\9qJ41Z4($XaJjoD;Q)dXm)&9)2(bjO$+.t:h!h#Y[L %@//f_GX`Q"o^rdT<RPu4Mo[+TE7A!HFX<7i@6)>AKOZj?3ah*:mL4D0(+!T>;X=dlj]Bq8C)I+? BLFCO@c"CV(JUbA,8Pc5q5SNa %]KiQ@Do9D=^T\:b-5&8*kUmM&k.YGJAkF=db]c>m6s_>U;n:]ql_$W! NV5V+FCYQhUTnK7p=i$JfWIh#et>X(`J@:?KnSY<n+F9$ %R"L)U[DpE.%hTD?9FE*JWDk"g?hidi*_W;fBUE6#.-<\c_@cQLh9qh`$C2ctkS6]_AJ$\1la2C@\R8+e? 51m%60[I2?4OJsQ+q8U %RaA+lXpSfaauq`\S0`Vl9]0'F%nM^qm'66r^r@V?(kcOQ)1.adYW2r?^nT_d %/9lPnrU<i3p#d:60i=g_U-EX:e6T&BR7b::(De6 %]0na4]O$.*Up(+b#%E*`[!@U#q3Vh5kS\b*P(522m9Z&OJ;^nAQ3N]b$tF;ajZFdfcEGm6<dsqJ.t! W*AR:^KK9D*6VIiXl4D`PN %)H+btKoFmQhXDuDmIt4)U0YUM.V!ut;r3JiNEWN?Ke,)td@8LrBR+%]PmYU4r/c>5AK/n%I6hU8q)!? k#7BI6\rc'"n#L4E/L\0i %]Li>"\>mHO_ihFV=b]?1I\_\:U#O@.c:,-DGPFoWM? %7enf-/<FHBAq7=.mQgTX;9d<CuiHu9RON$G0DFs9P'I'8<<,W<+RM0[.P %-/EM(5?UQW!@beM^e+3pfXd_#CIQfcH0N1"Sk]s9=h-9fU.uK'<##<JflUVnVNE[f_q\, +=lkRZjkU[tMKLW'EjK_$,4-Xq>kerU %@1&QHn,t?SI29lQ.fOui:hTK(7&?rBkARR0bHM:h<:j#+Df %aN<&f^S#soPm,<o<fmYB[q6n:=m6A.>);&o?2"LBGaBbXK6gOX(P %je]s@>X:P-*2&R"1h>sG)t?I"@;Ac; +o#9FXY=_ckS<"X+I&a3l/k<&+B6YeC1Ipu>aFI9ICTr7-"N5$&f-Joo*S%Xi=UoN&&F&Z %fdge8Muga36Z0JG\.=boS5/Y`_aOAU3F=O_Y2.MV5)3]((bm_s"M%eqV,qm6m1K4G$[Ki?n?N<d@$8$ %*pihGJ9`^G(G.gRk>5CB %_h;Jg7K2<G/C&_f>.kKf1ktb@#+E"(4%Uaq\j1F:Yj/Tri45r*'n@Y`]8hH=B %SlFD7u:*d[h`:`tspW+`5EVjd6ScgMPQ&@hPZV %,!?H1<d;Ff<YlN4:AKG^D9';T[gtqoXHHG+=4odiND&;R0-#NS-$_H^K/"<rCWrk4^V'<Y+r66W? gY<XCKD7=k'ScaAu<1HH"BKh %UnD`XmPmTu8I7hRbgCC\bOZ!nYm8OE"-b)k]M0`28_%hVNtM]&)SCJAHI@T2<dp+DJ@.0V+4ZVhH@NSFWTSI+''fU9^P8b\W<s6 %Mq+uT!*GC46c;_GbO3<:o>8Zs7_LWcfXrIE<^Cu='$UH4qD?^m$R;ckNbS^KAB\Km2^Pjr_M6U-,>9St %GPH_@tl%#lo^qafT$PO %Ea<Oj'jIpS73Z.,,1EKldCe]>f0^F3-:/?7\Y8:XK45e:c33TZ&9Kj'F&2)I7_1i4nQQEeW6gB$! #lL]K[cpp#SA(TFqGBGB/5-Q %,meQn<o(RE(TtP*AYsO^p0:R@aUFsm:\BbRIN+Go1_6QZYOc2c#lGH)(X3eT,:u\n! %A.*;Nbcc=,bkT<'&aI=?ANM[$8QLDcD3% %S.i"dARgq)dA(.V)DMAfrD\NA%9CZ0ri_Ksl? H,7M+GhEeL.q`M_GFP'h*s#`fe`"cR7rTFV1D,2UKI.PB<oT0@:][3aKi*GSPsi %]E-F>bUO4ABjNnS6MLmcUX8&i&WTe)mE? YfM]V\ac6DQqC<cFoi1Mbi#t,Eb&QDK@$E1<Y<'aT6R7+82*@^+u=[bA3oL6;:Eh+=F %\3RO_huKRHBF_eLer"mm]Mj=U]k6Dh#ZL%C\600pB9@g+6%\uWWmuHb,R\&>8[?.Q$V-S;j`_nk.[K.##X(#3MJT(g_**n+MRfA %FfVn@8OY! %\]UPmD@VfQlb&8QA8WrQCLD*"mM:Yij/GG;bI\"sI4WT56#4@oh7t.4$YjoeS(2MtO]>mQ^c7f %a#)`aD[QS7>2)pB %Q0^>*m'T";Kf.9IU$\.*MqJX:oZ[;nL.!g3;YI&eckXf@"I=-'pfcAFCl=:8*Ng^MfD1#ci.qL7kC3n] %Z.t"q0W:/*CMMuB=0qb9mPXLj,u49$r-Tjc.]7nY=0bkBNXR&0an?J`8rHRR%2b'kR"b\.]r7dnU,@MTd32VN-;1>cQGWMBg/'L %%#m/8I'^b\;#-!Q2MouJ,$[ETPZV7o1`WrfKJCJE+!SX0PRO96`Y=?iVZF1N+t(Eko5lBQWtB@PLkVRk4? +URP0N^[jhd7LF/r7K %hT*'4@a4>j:E0D>[9;>@P$uUg;W(F2*4#)Zb[T?h4p%IQZ@$Hkl\q309Vb+q&NCu! ^aAi2'@Z.H&)Do8+T=*]QS$6If*$+N2_)b5 %$/`gqm"k&NGp9AC)-HqUmDb,[1]N.rL@iQYjH.<)Ef;TMGD+0gV$m8-LN2r/'3p? #>RC:ab*13^"Q]7tR$C/832'Hf()R[)*QFR( %?V=ss)[t4^pU\%,DSE8a9UW:Q>f-f<+H9?`EM^#m1qWejn609M? X.i]#&U_,k)47m_k"0>"j5i<*6HefX^Qm8"&LDA:__7f,WboK %N1=iAMHWH+oo%H)$U0uTd.EtcKBPcAU^OG*2Sk#*nWr9Y43$*Ee.kNiajDZ%lS^stp? YDC;_J&aRhVMF1q\hKnI0E5e&!QI$(k4X %Es(,J)\cBneC@d/4b;BW,M)kWJF1K.S_LshG&<+J1+(TV8;;uhT931[P=qbH@gk:2C1<;EU%! pOGX8K6;Ac?Vd7P/e23^Q7'FQlG %j/mmHNK%=*J-k>MnmG4[G`'UH@!rY)Z[$O*CTb12[L.uBqJ2;NeOlJMaHsB;&QO3MJ?61ZE8W %Dcp1n#8=3I:9tp?gB%jMO^e?[> %m/@VS2&W&$2<BH;kAIa6GQ(ILaGl?&kM3-SmY)n0]O4$MYLdmLrQ]pmh[;WRK2`l_EpV"97lJ^bab8%UkN3,>UrWY<]JM&AtL!M %M_UJ^&#J'`)RX=H:@g`oK=rpN@^$[8G5@e=-oHJ\cmWUYf?;$FZ#,+R^AhGETBH:NqI0Wl5LafaF? lJEn:2,81_"'17Uk*s&;Jn9 %@A;qEN^=q2a8OfMY$M?UPBtnZ=UcplK6Hn/aUHkAJ3F7XdHFtL()Y+;faTXtZm<ql'")"F_:t? LeB.FF36Ps(JLX?\._-^LD<2hT %Tes*]JChDsBq %JR&VVF6Ni:0>,d7m\Eqt^5A(_h5C"sFM]<(09E:WEVIh=Gd&]rnTMHnD`q4BGso15\9]M62sBVH+OM/Le# `%E/> %h/U4C_FI:p7kUmKQ<loNF^BdD3H>'4_5]A^%IZaJOc#ZfAhRX'lZIXnM:*(G>>4JIn %bH&]7V<]=HQq(pCr_CC1\q3dK*3eY0CS% %S_L92_iN3T]_CM^;;I5=I=5LnBYFbkZn@#A;.6.X]6P@1@c$L1In@.)-'G4OUQQq5>+.sTMWNhBa$88:Q9 =BB$6<Ot"dWQ8e&'Nq %2F_)/9tlI6#o&!5O[N)8ZIYd,^(o5nG+(Ec3-^=-Gdq?dn1>=Z92mjo`XmU3HXnBgKni<[<L>`o@H&5V)`S24OBNkKW%nNJO1dq %(9?S/7[>+G+P"9R=G?09ec5koX(Qtu+]\V7JJ-&'U9Fgu3m5,o!\@1iG`N!aL(?l-;p48<``-g]'b3"JA(SD,eA[oPb;&M@%N6o %AXU6\N(Q8=C:,aoU'XcU>Li'5$*5T<OhCGh:,:u^34$W;\9"YE,6g0s09?d4dFi\p %*6:i^$"bU8kVf=>nDQ\F^O*QZP02b&($:# %eOlr+UFUHW[!$**)@<A$Y.2O`P.)&i0%07j<r,Mj#G+@^]<b1<ksI?Ri+6.!"U)*;$@<@l^g!m %<+"n&]ld.JAnWh.#'SE%0EP3W %-P)";Uj.T!\*Mb.QYBb,((EGCfZm13eg]u5%CtC#Em&_DT55oMM-3Qn(iqHoYnWM5$:8iQ+qreYat([Bb-%ekC*@m)S2kb`h.l+ %AGS46Sg+p5SE[OoCL'Z];drsdkZ]'DZb]uks&rI=hgf:,!.UAt=MGRk09uhKQT6KY#A+#jZ@V,Hrq+R@! u@-[^itrfh&_&@UcUj' %q/Y@]5mWHhc&7'5BFlfAoJHs:eqPWCpk[.MG&q[rF9YoT[Aj+Jfp4"@$k^NsA8)M\?pG\_GpWroaP@ %t"_<Wg2gr-e.[am*>9J,j %<Nq#*KY=^r\;]WLek)8Yb(;a^h)QU@KelFo@ZY+$N_^XG-Yu:;QL7nJD7fL=\;WWp7T^)`P'pNEin9SI_. (bO,X>DV0$*Puki8>s %k(>6R6)-W7)LZbSjNIuQ^<e@R[S6<l6-F3BoIR0Ui@m5d$rH/EORG\JNZ0D\,"\%ARu25lg"_&L/ZWsk324K07c#3%OCeQ'KX=V %g,6nt0\G._^=,4-g(!Ne,<.E<__AkjX.@iL-ZB)H_c@P.GVQbN;F&K.dC)R99at7*mm-IWXDVsrgi`:qh! S^sih6.mdc,"?kFFPi %USS%2M#&#'"tWs\Te@AdKlejYHuJ5'bWIm/F_jZ[33['L;681+Z>.7mB/;d*iXRVC0mYM6-acV]Ug'(C_tDZFiH0nfC-iB1@Aa3 %Si>dpk`]jLN0Crk@'dY=isJuaP](%W1hmXCDNtOKm7-sE_N]L<L8P48:@b&FZh+BRmVaKX5!T-Vr2l! sQO#1iXOTDB8-5T4*VP:' %k&t]SZ&G+XGs]l?*5YH!kLC;cDQh0`f";)O*7E")k!eVgqmq):Tn!^$HD=WZ&;6I^o8?(h#*H>_M? 14W`NShlp\%97HRhlF9Ei'f %E!a%5Wu%k^`>G_g4O/.9<E60MOb_Y/LF&/Q+M8Y:^_S*:s4`gU$o9+63L-7%j4DpWc? mhfKN07n5MWglhUSF4'i4!ki=]soH'-Y" %#`U(5VG[b)@4RVAY+=EX]f[!t:G:r]hQ^kAbFeEag$.ds5%LE9PGnp! r[>^>VQuZ>af_ZV0uO'K_&VWdLshAs5mJ't61K8o)k>bA %9ER5;&-C@jWRY:AN!Z?<p4[=UB'[b?+uqD'='D/nDlr\DZ'Act!`re*'X_SNdh=_9epGF/$Y4T! 0I^oBd7s+N,T_t?/o22mOCAGh %J[Im<>*0RWmJ,)oKiVS%^OcnS^m.ZsY(``3Y`h%p@f(@^LoIOok(fUtS#l0ZlP+! 0O<JXi?)CZ^Z9YBrh4q=23nrD0B_m&&_??Gg %o![iN7"K6eTRk4knne3j9]VKi/5GB4n!(*[QtPL<B`Ursff6ZI;_'cg"jTA"7X'Z<1KMtIfp*Gl8R! PR/rc.M@N\O%.Fh)R@G!,/ %%Y]>[iFjled`)\B/?&`0S"0&B3?o'%A.a0@@s7F.+1$i>\L1ic$CC_9$V*Hq;Q4@@8s4VfGi'N$fjNU`uf@NoU*$@oOQYk+&ZNl %K0n:^adOcqpg16F9)I*c66WSNA_;N=9Q-KWUYWu7oI^RT7hQ=ZUr.ABr]:n8'KjsVYlTadrWF? ZYAL^L+Uq$JJm)+Gq5SYJ/>T]p %EfL6H5h[:$aUm)071@QdZUqf?7CeL1A#%kPAD>034==AB&nCoKGK*5Al`gu(1[X"o@];*[t)aT`]*;;"Rn5^YP42Z-[%h">blle %O;U0X=*&V>a=#_AV!\`q'dOIJ,G7(9/(>>)2&:bf;5Vf3:?MtJ`,57.!&e`:0jff<9]Ub@Iq-s,aq@7Bp04O\Z&)K5RS$:Bk6IS %<*KWpK-:6+([+SS4,j/(@Bl1;&:'_imPL',0@>T'1`$$sNSW*'`S[Qnh]b<JJf% (aJVF/LLob<ra9qI,`M23nQip!'@GDHW'HCLl %]/><:cm[Zf!AX6-"c\h%):@J;1+#bYO<,g$8a8"r9>B)s*c</F(]_\/Fp^&P?^MY? 5$)`OfUdj,U'A83Ug-ocY"EKJOrkMB<h`:B %fWbn&7fGW!`JJc60IYLkhH539Z?m+rN= %IL/)&+a;rSqT(_3HFTc#N+`KOSp^m3=1h4Oe"kFjIgrE81;RpN12ciugT1ia?V1`Th? %&Q@=HCjL^,7OI2s1fomuQKXM_F=cD_Y] $pj9]=]'1DfBA(ch7]AARb))^I4R<j@IF]&($)4jcKe/6"#)]ZUaleRG2R`):S5G=!ZB %*rt\*7#Ptr*PhZEKAceF=uoCGJ?*?JZe@_p?!(l[S_97)VD0*N@W_^S'u/h==,+hR#Dr6,&1]mh=bGV&#D&6(J9DsE`YV_9t*%b %<Uk+)4';b%TlPA$P#lgCJhTWZ#.l,h_YhDJZ];Hro(0bg/J6*o,.5''ae(+flRtNAH85bkl%AA> %O=.LC=`mhi!rd.-,c<cs,`I> %oZ:WU6aJ3gA59HL07TW%OPOZf2*W^$k"+@1j"Zs?OFVQ7ikNZi!TZ`RJ9V]GqN>E7? Ra$.eeVI27Wi_Y&,*;QSg(u8(!o>BCG"hM %%"+bb`@C;/M#dqG^"eE2c#dQp2p!nF$+?,_9.+9q1'-K'p1S,L1/ZVc?X8f&ASmhA1#bIo'es>oGL2=Pd$:6AbJ]K:3&:ZF1Wq/ %U1`S$NI'i\HErB6.p325Sa2^H&8J>s/aSP? D_KL41u3#oN7DiAW9NDM$4U*ZQTE=*)_$dSaX*j=m+pF]T'LUUI.c-41DgbkoQP5J %(]C?iQt5n/er7WH"<ppF"8'DekC1#T#:LZdo1#jtW,<6GW6ba9k_p8Z/9\E:N38X<$Gj#Hu.<Xl:&Fshk"4MZbS0:27;0pf9N$F %E=@3(]SM6?3K=#fe)@pl\Mg=O %LJEI72Y9SfkN0WY(BA`(p0KKH'G1bB&AS^*YYgIp$RcBLm;JD5e1sp`=(OE]/e::*m8BGC!DY< %cn3X1LtGm>c>4"Z*?"?Z#AZeB?Vkb! T)c6+U+G=MCD5(scl.6fM[bJ]9QF<Vc)l1p:<N.j8a"GiC^r"a8WP<GQ.-g%g($6lZkSaD %T%g;W&Xpm8cM:UcqWU(f`;J@SG)r#7dbI:F_8uZ*ORbWgq`B"UK%M#^?Hp@qW(tAOU?1PJX@^Cu-LjV5! P\'H!)KH:_h]Xrpj7aO %'Vg6JEp76\#;?F`ddAEIp6-V;>E.6]9lC[OW!I2m7,6(6OJAt&OdK33*]jflb<1^MoG=AY=Ue2d1Dn!J9njmPj-2(=UZC&!T=`@ %kcO1#1m3?)/1\GscpVsuf&dMab01aPa0dPF! q1G6,Nes9C&uH'`HBIK]PJiORrp<gH.IAJCh!\8C)]u4NLF[;9c0akU4%Cl0UsK1 %jiO>\BK=>^3a!$CaYAaYjRSt%Z=A6--*DRdM:9U:7$t;\c?mii4L<]Cg1lI!pbY7? UID0d)b)X:4p&A<q)NI$Dr/5Wg,0a&K]PtH %C'SgG^biL;T$FKAj/sC4+K>(o&KjQ"=H,N4m6Y!<&jri!)DsM"4<^&qj(7Oe! 0'k9ifOfB57h)E`c)h^"CuSZYooEq-+M%u#.T*h %:T9Z%qgHXlFBL4"%m+?u\(%!#p"'uBf7f1i^;eR,P7rQh%QS>=?7^%sN1%B@PVR,67KG[OF\GlVofu %r'3m7W+cKo30=[,mPPJpE %N%Ycg-=1$co"s`K+NeB1)T:Td@ispD's2Z6*J`""c=$Fl^V`Cqe'YgLX; [W+IZCW>L(HdK)Q.s;3%DCt>n,UW6p'+sGs/5C:+us8 %h7a`eku#(/UE`s>mY6@j9P:6UA=^IBkQ"h,JhZ7"jo[KEE75aY:Qm_qLgq831C+!;>]67uq&I:GeCQd(V> UX&,c#!WefO80Db7:m %j=I&o;i15RY<MT^(A+L`O=kZ_pS#Fu1m^*?AB?@MgK[bQmH*GDD/ZVg<! N'AYD,e.RU4/OZ;^HRZ<3&.mOug_&ijd*lAWcL2^D3# %ajR-7K$31'4*m_'=$(VfA9`+&<j9VM..>t(Ppa(=^a=n25_FPHf:/6#?;9jY@AGLc[DLKFh2CA %#='<hS.D\WK5@,70YkM^ZKYJY %9i.$q'j5d<&f"H`Z9`C*pOJDX^V<A4dG<:YH?Qi4;<]Fq@O4_Q@[=TF2h_7JBaUSA=#asdB(jC3kENS6@]CCpo@s$AHtN._@VDg %8W"87,95.2<7#5\);ZCSOW>-O>7/L[BtDNKeEVIg3;iLMP8bI[RrV6L!3? g7n&nl)"hBbuqijfsMa=LbB4M7dP1k(5+td26NV%YK %D!.9ZQ`30Rf)/"O'05_8B:h#7fsg4WT9e4XE^_06ZYhoYo!YdG61(Vc<`u9`)'W]"< %Zb*&b*e\B6tpan20_[/jTH;h#qfJEUiW% %@Upj+D6E02=;IZHHJ,W0'/t>so)7Y)ZI=>tmuaee#dq._0b)k<8$%,Y]O? Y"W1sR8/ZuF[&1TmS#U;ZP1=TS=[#]hgC[>j]]HD6Q %J>iR-$]<L#&CDXj3X&9)`bF5[+X2bq/Ln-KbO[$QHIgitJAdW.&TE<YL2_YU\"Zk&, +[887$6%cQCQ@HBor6Eg0jLAJa/KP+>1QG %jYrgFh>B0qNhPWtb(%TOni!#>3KU?i;-kmWih\]KYZ;-FYarHKV"']tg(M*G]7`1+JK_7eO&>i:HkslIa! 7G67)'7(Vn7nFO-_-` %NGB/X%eR,uK&VO?Nfq"_'QCQ,/`<RNB-k\;2S$KR %PZH\&40'9ii_u46:Hq<AZ"fJB/M^-,LFYoAcbSa`^T@/'"tc2.&eTs'"N.W %</ie\"!diA%sqYA<5H\\&*@9LKo`bMX0jpuCnB_8>YpXJ#PPml,d@S@7Be7bFO^5-^aQL,+q,`a! Z)6'SI?Qf/HPIA:bY1d(JX7o %I:(&hlRrbn8hde0I@l$T;C%?Ndpfl&:kR])D+DgnNGQCsgW? TLO;&k4kU'q:qY"C&FYc#S'Q1):8%Kj')bM(1ku!$IPNVu-b2/(% %cIDH6V_ZB1p*e[*An't)DpQoEf$P%qa.jNpgI@<_W9Z9putk)FC"":f(s";OFRjHY@Kj@>_G*SQBBu`qfSU,i^b[*fHo8GV'GK` %5i8O^l@^@okZ7B+'3`bXmg<ghB/G!:*q9OF6&ue@dgKq&#hM/`r[2Cp-)$AoT5Vrfgjnn;<l! S_`G;*mZ=H!q>$Sjb]=5FqWp@$* %.lOQ-B$MtU_D"UC1uRL1k-@b53lI6&704;$oV01G:Xhqn?Q[h1VJ+H<_5dFqFNBJ,OD]Z! (ZC<dIt>T(Aer=/-AV4OCb1Cgjgkke %m:66T=E<X\Pm]R3ef\1S=XYB)=b[-RdCu<Zcs7Y`+E)Rj(;798GT@-JG1! qkfYmeThZ5(4kg)]<:ob#h4g7qtBEXBX&WO94&;`$8 %)m]W!:hQoCoe<*P[[>jK5(Xp5K)B)@Q;D6KU.G]:D[.af@A'>85eZ-/U8&-N3Jnobn3BGt]@N8KTr_+/Y@:EB!S&]I\G3<=#u/R %ZJK/h:BSgSO\`BL1f4q_j^EeL214!U^nCM5:Y[famXX7"h`[F%,gr\2!s"d? 7+3U@9U:"RYg2m\j*8([piio7akY@;%"O-P@T/.Z %/=U<G362^Ukd:6a>tWgF84"Q#*Se"'21/k"DYmoV$IW_'qh#8K99ZfV1LtbMm[16KgE:ccVT(oMR9U2%&m:T[@IJ8c%B[JE=6gl %(.**3ZBgJlUpuqUo_C1h="<:S5CP*CSR`-ND_iZ0`i[8IV#CCI6Ai0f'/iXO&b+31FN_`1Mh2?'a#lR*AuX>9$2ufSUt'=6SdF< %"n0'_#<r)`M4)`m7%C_-[>pOOnea<lV%ge9KqcAX9L=,k%G]khD=ds#Om42%M? >RMXmfT#Y&H+CX9_'.m#u.*obm@L5"rpd0!l.T %m=U<jo9bBRbLVSJO(,k%I:1J;?P:)MP)s:C\f&#1c2LO=W1Hjq=Lq^!_U];YDj^Vdf%C(VV:s&=&Mde/>G=6S:a.]ippQp']-,p %_0Z<DOaq%hBF)k2S6,(/qdg-&d>;0$0P0rOnID7V`kY"8&ZkZVH,acg<KqcCa037[P>4i;0/,#K:F7qYPH-.YSM0/2&bjEdT]:b %RmmnI,K3415;?VtgKD=$_t+F?od\_)HHj=eH+`SneAL^>`A('.4ORa:YQT[gRYGXfs4T*kX`4A.?'9T_`2Pi/12N<o?%,o,;K,! %]hi-]l!fYG^aqSJ;&]A4d$oX?jDD\,2%Z;MbmK%]"bYC(@WK"? JWNr^H6NHoqFg@lOgGoe.Z">EVQ[]*U=:8)4NU.854M,$iJ\VA %(3q-HYPG!gG7%V2.Im7,QX7M[6V_"i`_XUE(@(7ob6:!'6tAZG! KIAG9]@(&"(uO6YG(1f(83<cZm4XJrg&rCWA'=X0M;$-j)U*8 %A08BMafe6Uokk0&1:+k8[emYJNbN]+7gG^VH.Jo@*c@]Q0.AiK'YLQVo(F<_F8)VfgLdr/-@3VejPBk#`GQ9>%q2O]S"p#361g( %;LR'ZnDU[Bjh<sV2\$FM-JG8PF,-QXp'E!NlJX!pL\<.7#N3E%s4p.%p?Jsf?'rP2P>;u<d,`G %`Td&U=5$EtX]Z?>N8``(bnPB] %SWh(sRe)fhBHatBP8(Ln+sf0ieUS6JhqbVdGE]@Yom09C0s^rE?.34WRr;"pFihK0"6oc/+SeMm5ZB+8? 8%PK.%[lNgLe6ATl'5g %*g:ooS^sA(:tZb,8#c`^0)N&TD%d7oC\MtgSM+&qS['&ChX&=-8HH"0#2=70KTdl$'i]\RqDrLOMH*gK1lO+qqZJ'_N:CIi3YtJ %B&aT&LSmtL:rpPO66g_SgSA.#! 559@2a.XHU*@;7@2J49MmYLDH0(,"Ca-,1g>r)r9aK_fZ/0P@&X5pAAWk+>6"FsJg#u25PsMRl %"d8r\1:sF1%%_1q'HGqI%ciP??A"&C685p,iO`D6"Cj?b3:?*)Je`3,Ul3+@F(IT*^DFD,m&k$@R5c5R[\ N>SM/-),4FZX2]+/.l %U5pjmWqZI6AV/^OW24qp(%F2uT;$1e]nE2,FRNoY^<;(Qq'.sT5Pr= %\f"UU`U*TpMa&*JIeou2roUu<"$cVP06@!dhu;Xhs8%5Y %ro,lO5(BJ^YJ0h_hu=oi5Q,f`r;=$R.Y%Gor4g#B+(+rfn%\Yr(]WXlo"Y1Q1E\Zjq`iDVqgX[nJ %TRcro:Wjqu97VIX*:22h*.R %mT10[W8(FrKmsTGD%=N$1?1mJ=n%<:?lN3\U4o.j:6V8m&=#ts"+-b(rZgOU? pMq9OCLmS:*WM&A+:m6)F9<C0e+mHp*.cBA5?YR %&Qql)9VN=^5u-c45F*p<O)Rd5b@sCc-+bgqdB_EL$Y)-^QoYpkn^0]bM]!;.'-? T.FJn"5@>l>Sk<U6kh*fMLf6(AV$?6\a)gGu> %TECe@@u<]=bIOc>1.W<8=r44?$gWq^fsd`-RG[4o+n<2ia?(atg>4&A\D\HBZN,4S<lm#/c+:\a&V4>I@! ^eW%,rna=!ei/%d=UA %NquPbB7Dd<bc5:E;Cg,8MS`!WEO*aa*6lZts$?EdS#9U4$Z)1PR,4N)[@dVZVoL6m@H0RM %M5*t5`+hC(T@sq$YCR<?=q)d,7Sqg %5XsL(<Gu&q8>-8<PLn5obO`DD^NNA3A8+]S&6MGC?q@ZLVNn4o`W,q=)luCYEV\gEHc#ZL_20iY@M=+#d\ ZmEMUk$\=<WEbHpr\l %No&\;<apWskb6L']XWYYq15r&pL?2+Ab23=9P(KQ-95k:(3;8B4tb&QB.-,PU#H2-@pkABj8h! D3),.1F:XOr3@@^)gM4$#MD_sH %(*sKlZ:MJ-F3to$E_fn%9a#>>4;,E-o<TkWf;! Y)M]eRo\;H>bUK5BSSJs,BOEOaY_.8)LMi6=6VNdK>\YtLsF*rdUXBsDcpLIuL %NAP[9@.&#>pt\>sUf"inTk[YsPD]=B<+_uUU.t"bVUBB."MM%HB7a(TrES\LDjF`e %@9U*d*L80<2&ucS&QG@i^_(l;f70nBfA%" %%_%TlI:O>bS9^Ll%Hr[$);e,ZC4`Q6+kj/E0)2$nNt\P3/"_LL)scGHO`^i_;C'?ec#4n`'>-- QbZGh.fTHLZ!kjJG_Z5^0\S1Ld %b^s542JWOUe*/,foOan?)QNXfaf"1['31,Q1I$[=/68MrnZ(UX8:IJuQ)-/=0>i77SCo9hfIG`Of4qM&)QO$.N(_<_fo'S2WMKY %]0E'0Ze8D[.q)t,nQXI1N`lhi?C93I!OQ:[>b"qPRSK5CbIbYM6CuQ*7tm8G>NLGplNjqg</W*oi1? PfA_q$iC@pfG%^NiWRpst[ %8$<W8'HXRl&jo;"_ucP"4'rn"4)/Kih7C(:&j-0HVMBAJlkWuZYd-\`o_VQIpc`:$&'L90+BV18j&: %V(BPTHKh3F#@p2rnNtgVp %&hgk-DtRBOK]j,HMc2+;1e<MP(N"<#7p$)10)DO+ks`r=uU2LA#!?,@2ROS0GZFgRX"ES[Uh/eWWZNU>kMP3mj"N3Kq?JK^/]%# %,onj(Rn4iZ--E6_ZabDNL)+Qn)"Gk21E_4I4aC4OZc6$u"JK!S4"4.?N>F&mkg#/ [_2jg*'/&k>5n&ZP+M*cj:oA2jhNf,Hd]Zb9 %AGJBA]L6gACO@o*B#ArHW_flW=&@_U$V;@/@puL*<M9JG0LE1XXp<dn9k1?"ACYST$+?nXknn`r/+o-DT80Xm6W*:*C=^/g7<Ii %kB@3Z42K86*go?f3^b3nQB`'S=M-=ZPVhGG;pasJ*uRT"qH9@DRT%@'2Z5M%6aa!0>mHJ`TAP? i6o**/A4_3FTtk['YM/,.7@G+` %]3&nb&U+Gr`@9uVKJ[LWg@W@q"-9k*BT#td[r_(hUj.sK9MW/:D2MNhD5Ft0L4_) $1cs0=gO#=;E=rTR>5;ZO379&.M@$]ZL<$11 %T@$H0f&oP\X+kU^c@"XR.D1(!gg\F7\FHApDR]Db((`LlP-q.R^eS9CU]f-Z+5B/SfjQ>o'Nh\/!5Sn>nNlq="Ogm?DZ=IPaWLk %;,F`>:g9KCX;]hqM,dlN:2NFd5cLC/']sEn\? d$RaO(2s8_H*RaXOS,bJ*hW:u_qYb<9if'QWr1EXVO*9=l"'X6oK;P[mf#<D>HJ %,hSR,i8Ke]gU*,\hVnR^8HWdj1]STN6M*\,N&56#^:g$LrfH26.6I4#QKK'LjsB?"c+"ZV;JruVg$;+uM %%X*'FGligG^VpuO&l_\HLb.OcM)S"m/h0*s`lH.NCrj:BWW?`__A"CN!!jka?13n+eGj]GZL\@Kk,]cZ7<te[PgYH2ujMpg2qeK %N=]:[$FY-pQLb)703Ft:3@8_`[ng'^rC>! >GH0@.PkG_(R*_Z=C28(]TI/@TM?".OIfpXAi3>[s2C:_OM0-+%CJF5hg+GK+JB`BJ %-;JA4i@#LSbA7ZA&CA-fj5b$=9O_rPb.%X2ODH,2a+7CslR@_H\cgWDqIVr? (^W0))H0Om=0%n.7e1B6/AW&TUD?LI@>+&5LL(W9 %.0gjDfZ/,njupf&R2aQ1'd\:#4G([eoK3hNkJ`K.)r?&.C<S! r'ct\2%H4VlR3&=9T&,;<RWu0qW7%Z(QFHQkQK4&C.,&N6_m`QH %=IbH%q,hirq8fLnTXPb5:8+XCEb.ukjQ.uKpsr9$Y<1L12nL>! 1;HO(^ueAd7WhIM'Y(gU>_r/:,3OIL/GMHdrUe9?roP$SI/W/6 %m]XqYr:TOXf<;sb3hCYVPNR-sr\sZQJ'MispiHcW.hLm/=,JGE%1TY,6X\]Nc.nmIM,)R#(*^Xo-? tC#Q;Ac-k%0HR;HRLg<RMAu %Ogpch!*+(:bsp222\:WB!HlNK'cmbI-0)P?rhP>_@V8`cDdMF! 95sn.X'`pdrUab&pl@XhrT9I8IeDHfs75Wnq8_C+.t@E`]tgGh %oBG*.@f]15->dT?1,P?0j<hZ,+[)8_f'pc,%[D!LHhZ'o^A*mEcE>[;%8#d)`iB1+OBE=_02`.RVFsS6l`,b2u_(t6oAgHf;^T> %M1PX!Y?,00R4TJp[#Y"JdguK;YJ0`AT+*TY?\$,)`.7XjC%&7>dTudkhqA%lBA\'o5P0$qfjB1! o3_O<TE">gJ,_apcen]njibF: %GM!T/j_oY?gK48rSBi98D+uV\GpJ@*mcRZk(>j$/cQA?h4&_b3J"Jm&hf5[RBRnF/MU*? DcQ9jIT$kq+l2TWTih&$,I-snN*7$CT %df)WdQ?Cd^?Qd4%aZCA@kD[+feUl@)\Gm/.;4P@$s/>)sV%qh1U3r5G.:dA7H7$?n %'==ThZo"WeGlof)&j`E=EAC]U?CoKDM^?B %N#%#k0E9@u5RF&]""Fi1&(,nb_:Yb+Prc*HPZIfXZcLo?l,,CEZpkhclF6hg!K31YM]-=3j:Pk) [su#qEXKtP46DW5UI>Xjd,4fe %HiEFqp7'[V/@3t.\,-"$lE=B9&D[&a'W8e(lrpCpmC+PZh$eg&XdW.od^KVSV(Keg:."EM`V+J,2_ATUTE `$N,*epM3]fd,='j6] %-6'QAoH-QDk(:/C_qY[(65=b##1-DuSUIgQrrO+C92pHcmd&kp_Ab:Y!BrthTWsFNA@$jR*+Hh`_#W5`U! n&#$%qY8pC#DJm:4QV %gsoYJjST]cWYPD+>B?;pKT,/5b6g0\S@0g8Q1$_c:&7sH$l>a+\e2t,]ig*YTae>;:TC?\/MiDlL94fNGu6of)!rMs/bf/C0C!% %9W":9&hqOu*u&;]^3%0mT"DHYJUO+Op?gat+s@I'mZi>M/u"SZfWTbsI=KeWpEoi! 3KF,D'n0Li\B/ZtQ4`]&19QU?E/Do9U.o^> %WA+[MM<2+)_aD%JH@>'Hj#[W+"/;R/_?5(D2%hG:8FY/hXR?fI*`2p]Y"Yp7[5;Xm1d:N8O %<r`2se></S<,Q#IFk35-MH=n1ULD %QWH_M[jtPEb??0&mLf/6i_T"i>eD^d[i@:AY->U%-Id[<c5NuAV[Z[#U`MQ+cE59nX[U^Rat9&bH'm/N!/ b%>EqCp#,f0&M.[<C2 %#aKH"XqXNllPg@T[_5guIo[@D@7-hC>f$S[LcPA4WopDWON1Vf5Du13c5"BLE[PR;ZV+3lfY4BKZ<!tGPpW:rj"0m.+Dk=;q5nQ %kVp9QI_WELl6c/akRINp8]Ud<"97_Gr<GY9s8C8npZ_,LV"rWWqoq? Qo+jHV1uneap/e1M48[u$HlJSR#`h3&W7:deADZlR'bDF5 %*7O4IkHDYq_r'D4huE!1IeScXs8!OM-SNsK:GM#kS?UlS! OY'J83X0]qt3NC4>EhkN#NugP>L't>J5]^ka&r2f#Q:-^j_M"X#g4O %o^`m^Qk-a@<TNiE&ACsEM%OaL*Fr^FmqW?Z.pdq`]O.MYY%`SLhB7Q32na\>@9#MgXH+5L*AW#,kF\ (J2=Hcc+b^?%Q`$I2nG27N %B73GS9X^i6Z.>/c^RjgNGo/7RE:rbQ+`o7[^D5fOT=.@N&`5g%.qJCU65oHV&`Z$X?[l1AcT^Z)`]Cjp`TBe1rg9^*_?*AN**9% %`5`6u(FrOF'[JFGldf#gTgSZK1HZ]=%d?'(kBn7;]hp:kM4], +lI>a=4NTfObF>u#^4*555UPcb>.a:8f:/0&,K5&r(r9;:qPEA/ %I/3^:IZuKoT6Mt0YN6/l+P(AeH\9K[$;lg(lo:]t+KN9"I,V,m'oCSpI5Md*\g]$U9NDPl`u]p"? M6nZa(OqLf'&/Z2Qc!.@:G=D %;B)e?Yp4Gfat^iB3:UKs(@pSS67sn'?(NpEJ,]-]"Y$0_, [h5eA"A'([dlM;#ET+aS9RD=AZ9U&&$WV\,K;B1<VH_q=5ZftJbVjV %npej*koFHHMWGSD/4a!dc[c457e8.,[7=u<U^Qm[2WHNL&UA:3R+>]77dk$3'Y*!P&.J9I"teF6&.>c? fc$ZS.QqqmOLu#NIqqAr %a[29\ZnJtj;Uj9'A'?(MMdKD[,Sj2?e/XIPHQUk?I!h*tCPtoN %*o^T,Cnn,bO\mU`TDPQG4#=hTjk5dBqlJsET(\Z*crcPe+rZ$ %50@`;E+[-T)u#(B."Of[Z2*2(lrjgB*#7MCZK8?CBaLnVWt.9W9o=O`YZh2I %j(*^@31Oa*`t<G+#u;kZlAr2Qgg2SR$?mr_d]T( %'/j?+s6L?GHYDsEKbXkn4flp?rMj0AC-)?oCnE>ub2&PmApq/sE2hrS$+o[?,AsG@],qf?? ZT#G@3nUgli$+:olb3pc"I%Sq*/U%$%I>l55E=P[RN@5LYgU<rK[CPg5\oN^sHm_:s$;*(&<M\c:aO`UuR.r#V#iBmD^=0^Ar\4n0?l";M:Xd0e54h$s,:`@/f$WM"]s %q3@h"Dh>?+$[ISO,[bT!SDuo6A2VBIC1BZVL,dV``sa8)<lc'91heC! Mf/6Cd^f'UaMC<cN&n+k_nib=QsEWMOCap$__3KXI';0" %I.57#iB)I8o5CcXONq0iR_'A/KSWPhXmOWhAF8ncB[MK%B]GkERS:X)D(&L*6W,VO>he8ugOE-Rb[j"! Vkq7X]*Z^'PR'52-Oql4 %HrpmK5cpG#o(9F.-cHmL>$'WdQD/ $XV4g7),Yeqg=mDk2WQOSIdu7,nT"/"(M*pK:#[h2Na2bZNK'MZ5oSWG13R]^s[<V8C5B?;T %:VJ_[q^5aS#M$&<mn#P1ZU!V>2(3HH+cKGElE>.+9eq/Y';F&S!*uD1(qc %]r"Ro8ML"Zg2\)jHlZHl=[TYbD[&3D2oa(l4Uak]d %F#I-3E>m.r=KN,#[0cVHcsdX>'QACs&V6,!"cL3Nf:+%9B<T@0_6":W8f#!u@Pe8-U? *@ro_^\QL:kU2AT#dgrV!:>pI>!hdg5p5 %l^s`?o'd#35?C7l/Qn(5I-^Is#6e6oHVOJ&9Bo`aW#pLTrV5^CgFfBGI5QH`Uoq/V/Nu1If,K'j"I3H]8h@4Ab;b$U*"jsrV10l %?gJD/[u\-p.EMIo,Y-kAT4KmT]"+':_nf3j*FRKmNp6pBk:JeYag>"D7[]dpXnct:UQ?K:l!\G'dSR==F2D^2C;;$3ZeArEDi:F %6G%-*S%<*Rp'q-^<C,WO#c^KLY7R1^EeH$X,SG8TWB"KVmg;kh;-g#((?LNu44k=#YHBZ2&? Xe8)'u#<&@DlG=U8BlBIkHc)UC1? %!b>ML]-jN=OSkL4X%I!LBagE@LY3M?9'1(LWo;UDRUPChQDHT,Ai547#t7At;[p69N-bEmX8fU@Q0HS+! t[JIMUiTYN\*6oE&M]J %kKV#c$DSJ]oMXk3FWmB.2H@+!F<:4VIHOlUWlW!,;CeBWLW1^kNl:qk8$DH0cf1KmF]!9o0FD%2`Du`7K! _so<A]P*./S*W6h<o" %&X(%;43+k"<YA*IX7o&RkRl`pSC?5L9]P.*! IA(&aH[GU"feVY(HgrKl8Z.644B9h*:Kd,fu]P6CtoA]E0(YUm5pPUlmGc1Ap!)K %e^6<HSOrhM<hI$<e4n/cX?(#$\p$aDl-_k.%@G]Nh0%)T$]u(*/<,cc8@3Cd?N5\!j(2A&pY*$3]?+]\(/ f;Gd$m:R`Odn6Mlm[\ %@Zn95DHJkP\5gW%V*[iK2l!dt#i4^iX<8(6?hOI6Y&!]8U1u/^oD0)-'NWYdD326`DLi3Hp!dJ+]! LK:<(DWe2!H^XP8La^>L01C %-F"R`c_HH3EF#Q;iB!nc*L^XAir?D^?\5_r3,+/K&3Xm5K:3MhB($,7PZekYei>3PJ_0+C!N$g#\JXWLQb0sb&#hhcsK(G,*f3? %GuE'!IGsCOIf-1)V9+Q;5pPn</:A".Ot1Xee,1J72is*L>o.4cLC)]u! YXKj70BOo6$B&aYci9*/lqFXeZa+#h<,0'7U,).@BF/C %.<,KD##CS0'Ff37aPu$=F"<Eh60L3S_']MB;<T6<)]5nCX!bM19W_#b.\i.TT[@RT^=? (0,c=(XmmTtb[R)aCU+@E<=$2nh`?O3" %?<^0^O8_[g<D09cDX'dlYlr22l=`4slnT2X%mup;!e\W)^E&6=]kU85/&8-eh]VJFXXqW.! oodp`95h.=bN3f.*'42b+beQ5j]J+ %MC2Q!E8`Xm@]6M8!>`(.'C*q^qlG@B:Wp'kJ24'7g;4H34gYdO:a`PR)tk%+a=?Lq(Se_##W,4'npJ5QXZje8UTCt[Bs?>CGTS/ %VNmN6&+T1$7Kf<BlqpNj)H#t$Z+pesSV6@1`3],9WNc&RlV(NiS,@"64pSL@EnVFC:fao84u<CBXI(KTeA E9S(XC-ZWO9qIL*gZ_ %@7\[_g5'-u\k,jgfn_g;o^&&`+K+OM[8`8P-nOmu %qKrfNC*S+d&/A;0U9Y$mZCmJQ1(:V0G/'4L0Al3[>M5SlLrrJ1TRUbR?`,o %;^8JX%3:.$VL-4LanD-+Ol1Ngf!WYi[riY^#"ZEV_G.n)k"YS&a*8QB+uE05JP=hC[Bji\2IURc@]qQ0(4<7KLa37e;'scfCIKt %_u"I(gj).Tl:*W71=Ld(_'6J"=sZ"fYs^7MO2P>='G2cf`4fqA'N&$9X<+\Hcue)Gf-Qu(/;/9fHR]hMm@G)8A0Gm,(Yc9cR/3H %m_-sKBnfujCcrH-(J;.2hXWneK*HF`.a+,GHX*O>TcmIG;909hZ`FEtCeF0A-B2e;]rNEH5/<iF@FL! +.O>7,JrP5CN*(a*II%%I %hAN`?&dD28>*!8=Ajd<WHAn,Q`cVln`,kY'8j]eY^!9#-YdKYP]bRfQ684^o0! `u/M7/sAb`H8roWahVeuoMB-bB4MFCnHg=F1lR %)V`IbMud)7"BD8T``5n'nB>tr^IRdk6V13<AR$UoZ3"AB2=gdPpMRg5?fdiG-&iAbE543H`,T %g+XLerd7<MO!TPX%OT^7OC:Z]% %J4d6Ho^;."cD>qA'&k&FN`-ZK)4\3U'fMCdRk^: (Y[a3Q,W1FL<9;@81RZkUEUr,36h2q1MN`&ZhfZ($hYUQh:Z!G/\Oc\d[F\`# %rR_'Rhtet??a6]rLSngnK>@1qNNNQs];?1\=aRq6FF<6-b6V! cJrIPC'>ZCDhq<B=;\4+.Yh`TU;EPU'*osCAN@PNscI$56d<&R1 %"9tt7;PKbj?Ie<iJUY";7;07?*^bl/#F^eu#fjM"YUP$/:'f59ltA?E, $.8\W.Jbi62e^.;\E\;Q`UD.^*Z"9Iu36<.LG_NgaViP %/?0E766<JAiKf7#k0haU+uD]V2k1djU7RN>,%oPWcqRXM2.A=m8^1X<\Fe0,4le'P! T>r;oY;FKR'<Vk#_U792$E,<dN1A)%"7X\ %OXg*-kpRgaUFQc\CO>sr[Z50fqhA.2;$9K+cH8Gs6$>f!2Z!>KXuI`9.fY+D*%g\Aeg';65R3fTFN5Q,iBn-HG6O!?H:3uDtk7* %@(RnUQ7LmpP-5;[_-4mW.`I+Z %7GjiVi,-)>**MB#=rM`qjrIq'R(s2jXags2._GKn>Hh\^5']t<^sr,,C$=E$"Srl>t!mR&?`"( %'pn$?$#64\1<""Eg:X:SfRme$Qn.b/7t,.#gcndM+`)f!JX[KbPRI<h$&^TuHskXZ#%M4C3&\PsAG1! eFon>(K^'$Z<jLN5R.AnY %AZDT5'EY]5D%Rp&,-6KMkakq^Z-[XF4"j,$d'&T441SiDW[8%76(,ls;J-V>[TYCX? A[8r+`8n>)1ml=QM#RF/(A94>aSqQo2W.U %R-$E2dPOfF9a$$K_%Ol'45.JF]<FXRY]qf5d$=oN40)$9@isJ>_R2]=_/mFKPJg=A`=9^a+Z]@8bBs6J'ZaMps,l\ZAtMReYjbK %@`TcrRu=CP6@U7*gSlJ*8QM';L!d+M5_V(R,=,RNLcQ\e8KEpQb,rac'>? OH(a9nZja=>/08q4SXm7.:3s9OhBFI-k:9S5/YJ9$( %?D3jW.O);+i#]gMrWmK1PIQ[\ar*&m#ug8L$<&?hlO8N&G_K&28V#+F %>4tWA+'q/`2b*).<B!'P>GR0)'TR7Z*=IW0*pV>ZR>f%V4&e9R;ua9*aF`(#IG9ds%uJ&\u7NV@pLN.=+Pu[Z$/rY3]a:@Ef.S[Igu=0df/9.RSq6)aU;P,1t@>gnBufqGe8MWH9CIJJKC7 %&-t&2P725!W*HtbSec?a9,2_d@/L:SeCQ:(&9$GO<('OSb[f:.L%>JpFlXAt0`%NHC]_l"\(? XfIR*t)S[,Y$=:Zic\Ln-?Xc2b\ %K&9e?;'T[Qa(6H<!U?!,:Q(Z1[1S,A_(&(853[0OnH(fcQ,=K0&LpLD[#Q:Z\^Iu"^c3Q"$ %sdEGI'u=I3c!g<\24`9(bbt&s_:% %FYH*b%uJR3oNiKI`RlYXBVA-e6>k,(2R4I0*WT#D._jqg!n %0A$pdY5U_mf&$hQhD(gk3[P9[Lm:#[b8@,\i:L6<4K3D14h>mH3d %Oj_)!<ApJ4EkZ!\Z/sb4`2(p3D%)fQ!r&?5)#bj`<Z0R=.ks(t8kNmC*LcUKMk#^!;HhZKK;UgT7DDt/0D5bRj,.KCDk*P,=Nkt %D#o%k9Hj[^kbqbeqk$rV#nTW6A9K%PJfhKX"Y4?%QHl9t?Kr0n6GgSb.6c!'_@S.V[td %9lQDD>W/Z]rA,\%6bS!qWNPgR0M4Ukb %U<Lt]WVP2qYfk-:WoU?r?0!g1nu1?O`35[j#SW192254?Tu]<nMj`'&4&M";6#<.f2;jD"^`>]rK=O*,&4B'X-_,UnP*bYZ1u+a %7*s+JX^Di:c)<rc)MK?dPK3oLD_N8mAYBX'g,`7d9c&pI9#RJd]\0<EU/>WE4:8/>P7M<_Z? q^W2JRkh`\^;Q'(Q9u(>\K.] %YaLj5PP3Og6jP0LW[#I95]p&.'*Eh(<C-6Gc*&Un$H?gZdmbZF2Tm=r[%^X!#Z_lGa,r %i\H1>hSWRq_\Yq;Dc]+SZ7ZIORIWd+j %Z0ri)^4o1k*"2&,QjFa97Ul58l6pc`D4+=>5T-633f=k&=;FJs,>4#U9d2qPXK&% (c\T2)d$G1<DrCL^a]Ci%/4AP\h8+^b%]g50 %`=1:ZQ]Smo(iYH<<_)q*W]I/5?t>F$Zm%!4@._S.(GALG/(h*E,? fJ\'7dJG#W5\^o+r"d*=AA'HDl3];ab-f;,a7tS4H6?BK9!\ %5UK0KeON%.=s_i-h\+Y:ijhJB1;`?O4WHF2.>jaoSqGU5'IW0/2flcsA:6Gpo$ (lnrJVDtj0N02`[&TDD,VA^,90DmYu@!)*_<o1 %%eIQ</))Ok17V%<MMA#F\-J]D"6SmaL5/Yn0Be[uM_aN@E#U)'_!,qQF#JRn"5[lD/EN$O&-jduQE7C^oS,J`"9SS3_[ln1FtJ3 %o`k#qMW%&%!ElFf=ZZ>nn3'gM>nf:"iE!Xf%cf%m6u)`fQm<geYHaN+^t%^XQ)?1dJ<:FH9e4UG%%iS>! 8t'-*`A$"@3iij)5A;& %BG'i:KSBLe]::.,pQI)d9-oNU3!"^J0Fkmd2HF/Ek&sMh2b/`*CX>Wf;=Xa&N? F(jeRhZ(\O4%c8a]Zs,m`@mbgmQ`U83Wn.f;ZE %G5E(#1oL]u&f:3P9q[,u)7CLgp7Nt6lbIS-$HuO'\nI9=;Jf59@1[IF"7qJM %PS=<C'hnDKe<RL/@j>aGagB9WqF/=5?4,)^djqu %%HSFkZQq>qF.^+eeB)MY"ng\ubDN5jP328EZ])VSOHuo&R#__O>rA<*;*! SYDafem:FD,_a95RuE_Pt177<ODGcB%T^+eS89!E+I %/j"6f>@q<9+'NH=^C)Y>_T)dfo3$SjMLr7-"@kEOjX9dFlaWln<"h\m/66r<B/T0&HRtgA2$YMHW!:#Rhb$_`X4\7FC392h$88J %-no&rEWYgug$A")%M1Xbf`e2F*OG!\0WJ98G$,Qmd&M?n=GK[UVq %dc@SMBZbp@L8<H7:Igp]2].hHt>WlhW;\JRi`%SC>%,fSR^ %WsuMl,SbVp#=]!:ej47k'F>jDL(PqO,39GgRqc?+#jqV6=\"Kq)=HfA7a!d$D %/K08EV88f*3DZ,]F9K#k:G<#aC&fk[`pgoijMl %MkQVCG;,c!Z7[]Q-us,<WEBu2bX>:kWat/jm`Sa!WA,)Jid[]WX0X"W2$s1cWLYNCAJFI^C*(e1=1t@M]AW-dc$<l#7g39kiA%M %#"L'sj>u@ZC=##p9%^nu/sour4-iQ7;Ehp"+I7hOBP#9JL1CGsZ8FE>2p'b7J?G`mTS %kcg>sg+CR4fFS2H>gSn$KA$rH^&7YZK# %lpIL$>T.1.k@S$7V^[n]ZReUh+M!S%ekFPeas&;1&XZ;Ga_sTsMO`-F9bC5p&cO! V14Q3Y*:YXhFN`f9m#I38=uT3o5Um-2dijJd %lRYMEK^.Su>n.F^e/7P$1$!@`Hsn9j-=L;<,=<8ArVgbO8%EOPMP.(-="(,$"SH7ae\AK\(Yj80V? P'c<HWAMp1?\G<g;(cet2de %Rj+c8eK1aKU+=/bAQ0]bL>7oCe%l@Z)aA#S2Bi=FLoI1o"_G=Xrdnl/Ug>>D6i;,! pfuKM;9iY3Xs$Nf+jkk-WJ[4>RNPtVMCqgT %"dBVB7Ei2.m4;MqU^aA06]AFSMi@.O"fXa@OH%b!E1TV(EQWlHMQs2(#,B&Q4$#/gd?e/O@&T1JbdihG$/ O;pm0mhP[\3-ODW,gj %)$(T$+<a[<f;aM<BZ8(?6i1FhXZK:hcNrB!\gSrLV;$R#\e'^iO&esH<*b0$;j7Xo*@<+ %nU8SD(VGRLMU;'R8MS?Ag77'GB'*FI %"@^C=PkWc6hrDO4_`\t$"GV7BV6**! am6W7dPQ#@_@8,767NeM.6/<1r*7[=k;hAHoFWAbTm[UaK[iI40sN[?&YcG.5*F?f\uJGm %N"ccYA5<.p@.)1kUr0G<Gnaq5:1=<@N`$A&B2c3>/d/K`=eaV`ka%FW'`/[6_31R\"dUj#b9-YF=k! %P[1k&s=A'$CZ;Y:9Fe$Vu %/=a^nkm8/Xj.mT@j<@!h%1ubjBg?S5eq5c[N3p;_'945M,K]N[/'r?#? 0uBkL@7QOITJ9Mka><?"k89)8i&j^kn9bW3V]Rp&A*\c %ar/Yd[0O7;;1^n+UQ+RlBo"?3$F-r\)GR<?;@#fDXfRF7Whd4^9/!t^1kT,Bi^;0WB?I322nC')9:t:mMfA'8O6hR,AJ%U6nu*] %h\!%0HB/tp>V8np>:&1R$eRSWB/G7\1W:>9io8IF6=X#\]`Wl`+mOdmSIT[o;)^5_O,]qbKM4u9DrOe %@3<KZ<.7__<cNT09naoZ %eKf!4.[BQug0kUW;[3R;*6.oQ=1*2Za)Y&@\so,7IT>*uZj-]\RMW]m03'@! J.gBo#H0foW@p>c1'"lK2@`g0pn@%M]Dsa*?][#S %jFB/j-L</$&q)b\.1FcXP#ugk%p@2<&elXa=;n7+X#7u.j")upodBqb_j5BR.]Z8CO^mS@G#C?Y7! f(jIV-EN.M<!*.oi\<g[)M* %D/U>.Hu[Ap@l1M"Br":#9&G2^/E//)/2YY?V'^6]#=_fN(SPtZLa?`O:"?7*aIlprE7M$&aQ7@j/;eOXs!AKU)@GtR6%n&l9pdU %0tfekAn<`kZfD],R-n=OP(b4=<FTM08d.s66*?j"S!9$WKO+2:[!.g!0nh8l9O3BF6!/$9u<ML*Kj'%U8,"Fp;j3?_U&&OQMMXh %i!UNj4-39$k_;&;Bs>+J\V.nF3f&@F+UVG4grb_C(JdS1gOd4i8^+r(jHlm$,`)N\J6$_9M>S">V<)BC(jFrUA0TEL@Q=kp<;59 %Vgm8G4sa2Pcu@.(5=cFA%qqN>,,4EM&/r77e_oNFdRm*91dmS-Q^f8XZ1LK)i'e<=[7X@cPZ! 2)ZN)/4%fNJlWu0jNWR[TVib-)0 %il>,fNeicd^"?kp$=n<]p'n%G#PRXdJSt.]jKc[LCEo)O,tVZk=)Ltsc%H]Fj]2N'\;Bqeeq/^^C9_m`! _XH>Z7YSnEH3>q]k+== %aG*LL_*[?JmYNGo*PLI\3-,BbQ>T7:_Fhspq3g06/UZbl[NOh+RY<Ul=:YIed- scLP*^;s`^7+<+_McX1qJR=JnUZW(q2sX``lCa %%2WBcg'&N!"NcO2I3]C9LsY9h`UB!PCYkE!)GT.M80>*Xg1N#5^aFiB! #Q/F7mO.M1WDpR_Vm]!\iRAQQaOuf.WEq6cG`/"7$L?1 %1]FGA;ag:UV/uomjCg\YbPEUkjjGnU;Nc\ [(iPP)DejTRW'9c4b'ctiVWksS[7<euq\YsDSY&fHgDHp,'#`el@UMbARbScQR9Ll, %GZ.(RgO]PCWT@.$EB*KBk$-mEeb6T]mq\1-8+.-Ud@jJHj2Y"/[0XPXKT1*a.lpq"*f?hVUs)o1%Ms+ [Z`#dVa;O7e@r8E-7(7Mp %4]Wt#,ZQ1:PhU`YQ">fqVVm>.oPhmr=7!oh"a(VjeGuYSPg*]_ObN1R)W,<d-fl79rD_u7.`A %CeBd2KT3TfLk!nohUeVP-jrq&K %,`jOD[k'.fg71Q.MB0LnM42diZ=Q*gLc)H6jHs8N5,uQSJaC*R4PHo2`rN6aXI8kR)I,q,hFIi(SX=IZ4RKb3R\"*7q'>jGCZks %8-6dMYS+tuaa)8W:?E3?,?(X&"p>X8d^?,),Ampt!:";VVQb%c-7TSaOo*:?$AN;jl4%A@WCtA! [5Tr=5"m$Zji+`?],d:fUlLH3 %cC2[$9"dW!@1aM+FuC^DQ;ihf&UVjgBR!k6+Cc6f)dh]'051qrkDQ$9\]r"?[%-qFW83PNP_FiMQrf*JT?$%c;@Y>8Dk7OTs.=C %6Ai/KI2>[KVIn!l(o-B;$4%juY6YPEfp3Jo6%*jV+L5%O74-<$FJ?(K7)845bRI\T2IVm],iW? k,a7R)3H5il9@H=/p45728ht`q %fMK)l0*+G:.O4C;lOlY[FAtel_GZ<ikV*)>nF8(pd0XADB#ui)Kp+nQJB&5`&LT#++D`Ki? F>,,F8%5tUlk^HE!\q*gBori>#H;k %2WXDj6a(iI>pT*%+AA2C.e*C5<J#qsAF=\P[;f^r8? 0;,A`B$34Y^neF3f#4Jg<sXUf\@>F##XaVHDliXs-<iiK]bm?l9[fPlihZ %6a^o2[uF6'_Mf5'Q/u=\LK0WDX.sWG*t#gbV]2">A<;"R)t=l?:WnXm(4kLc@^Z"[Qj*g46#QSp? @/i/aV'm4A<5,aB/@+Cl#VrU %+p\idXm.A+:c-%D'p:Sc*eL7qn2Uh?(TbR.MI+c+_PMB$80C][*@ %0;W9)WmD=$<fMpWA&>HR/X=;W7C2_'VQO2Zr#<7:q)h$6<^ %)%lNn3]Z#SW%=f26oYj>j'1Kg_CJ4P*2E"&'J76D/e<P\&iEC?ZM$jl]<VsaG9C!/-*O#$GoW0\>o2! _dmR^^@3(g2I0#c_>#&$! %kW.B1H"##/#Enlf(`4o'&g.KtP\c9)&tP^7SD^h@cIKp*^_U'TS/+j+B6g4Li24`nBP=XP82B:)-::? *,*Ycae1,VQUs&;=WBTdd %9V/bL,r$mr#%PQJG05INVGQeR7S[?p![2D\m3)fUF)?%i0F#8T73t5eS'Q%%? Q"=.WYMCGlaftpRuKh3S;,1Rn-cBieHtL`"^T3( %daETSO]=uCe0Nqo8B'*2.o\q,XSIJ8$mRlF:or2^W/\=(<It,=mA,"68g:5Z\o8lT+kIul-].GhK3j*p7o _hY`"\PMPHY+Dcs[Ot %1KJPD):IlG@CpLi[L;2LK@R9ql?aq"@2B*4`9ls'^_I8Y]E?8Ih?%<m6#>GX-f=HsNDpjsW^KOW81m,70p__Q+*3cKg@qhN=l8t %<kq/+!j%W@#YrpOd4f2-LuaG2:XKsW1"-c&n<Qj:YH`L\H4ktXDbZR@'XKM'.;QZe#W/_r6*7(8.[3e`L %u4akrVmU.00K+-!CJ@ %j]"042GFgRO`fsi8\dV>*?`)LRd.C$39hq&J#M=91T,71?P7$$oA4X5o.C3,D0XH2E99_YRp %84_I[iI.9naiAJA0)C:ne6;hM+u %Lg%UZ%hrJ,^%J$`OIXll13W\"-Oqp:0*>A-]n]ZbcRPm#En+,KL@9_[Nldt*LKmn?`l21j'IHCE7&M? r"PldP"&XcFm8O0Z=XZYZ %cupnHZ9`#b(*TAO5XK+pK@C[NE1mjr)CVip$Ck`=j?JZ;&:rY@2%Y?'Ta %ethK>Wt`q:ffN22[o58^J$mM(3Hjog.+.1:A=6.*YW %'n9L<>mH$,6%R>:6'4eeWgGc;b]MWFBG>1l3D*VR,_?L.[o0`%99=k4]]6Od[-8^1dS;s*! M1$J:hN4F9ic"t``9C!"+_oX78%O? %It0k`nU"bLopk9LAr%g'Ej&'kT%u*"!Q8SNq'=0ir8.>)fB(D'Uq?c_5[r2GH=Z1(8>mp"=eH-'<><XB_]8K^$Cu?)<M'<Od<pY %=fpnrA$iRO.4C.lm'P1FjFu)SF"Uk^6"#0b? ZQB1KOg1]XW:s'/jNZL"C7414o270'IH[:/U[_=NBtidF==At=PhZ7W[WNBBD>s. %"Xd&1a?[R0]`G#R-2'NI@I-Nk%X7OHCC`/h]`^@.=R.Xj=JA4sD([cUL3P+k#_`7Q(#$l %_j44:i8V>jhhS"Vhm7`h2-$BJd,l05 %(t;28=BJ<Zkem-Qk`:#<6>1sg+rRDRMGfa:IArbp7)2d+#jPJ#K!YlrW+ZIM0__9A89WtKl9h[1.YQhebd)Nr?A*@$dnq$F@hQ= %7At?+_2-]IX7SPT+4@-S;Ek:5s-M(E<82C9@p)h)@X[7r41B#=Y`huEQSURA-?'-4VBe\jPX8g)WO[H';-Vrs-='Xcp^jt/[-$/ %bGV-G!I3#a8Q)rTb1.PRNn%hSiKbdF'2u,7&Q(#-b.1[Y@j7q7V9! abX#*75kckVlq9J_GB82BP$qESqUhV*q2QT%`"da3p[=\<% %<oKgTZiUu$jTNjXXGeA-j7<T]`"9O'XA\\.)^#KNdhWF;?tfXG:S)t7Y#28902SI3d]XZ^?H]!^,S4jEX] +/9K50&%N2i2l.FSn] %lR0NX_E4fb8i"4QZ)_-lg$Ze[9GtDidZu"!HDF+C3Ro]]$6kZ! P(57B+5cf&ij2,ED0pHVJ\D^)2N5_ZbMH[/1C12]LAYF)q+tk: %$e]>ACfnf8nR\NZS3+*$E<ceb&1$A\XULmT<"GZ[LPm:.lu5r4Z=6f^YBo;`]U3L"B&^B35fHA/WKW76= %3bjN0b_,X'P9P4#P*4 %P*!6;I"0;^L_<P5<-bj==pJBNCj`o#"j<l4Pp"Y&Bl]LA(kQi&Qu]q'TFg*D9[)Y;A+U>.0`?]3K"QaLa3Mb(eICmBWJ'ec:J)2 %M-X9h_/5q'Pf1^<D]K.BZK-iIV3%D"FA\-,928AqR>_i^M]cs2S6f@akfXG^;W-`L5bg$!h[52A:$NE, $DQm)R6Y13^D6SJIY=UA %:S9!q%<]Nn,>S %#$8ET(ANUh/H"H*b,ZG+=iAlI-:U$J)a0G0=ZX19uoDs0c6029[NW(@RQo4f*T,PqSd@]@O^CO[1bPjJ=C 6sBa %T&Dp'FZ7pa>ARWi\Ru,qHh:;T('",n3=C8Ro-4`1"**Ob*9&NdQFe@:C%srY!.mb.d %eBIqpfb:/d_b,\V2UdH'i:FJD<Rg25q"O %#f7]&g.$e,n]A+!%_[YOK7MQmL$`#tMZ?UShZ;j>Gtrp5C6_+>5)=H.G82B"K.4+,! BJ+iSk<'t;PgN"@lI<S#rud;J'-;ZE>=O\ %"+]Z\:q"Jh]DUHp-eHr\[P%"7:SI<'Mpj? S/5SU1hR>nENUh!),pN[ro'NIoGTa9e_#LFbjq&m#fA'26`*#PSb$7!`Sl4T:'1-2X %H<In%.4X[AXXIN.I08A>i:T3A&'\"b>YAQF9q'pU)uo*<.NGkA?mZALTfM?mO4\AhQ3d5ql/q@! 1UF4B+3UU%JYCj3O"[fJ'Z^T3 %N0)S//$pmI((10p*&,#Ciga+X,'dfgSel\cp2?JVLS\tuChCOojC^IgEY!;t1%HHA_! dDdAR=RlLctBN.ufYrEFEJNMf?U@0U!lU %h;4coJHn,:hq>TGF0L((Z3NnCA8CANCuKf[U4LB3*8l`VTR$nSfnM9cg %H&d(RbUShhUup3f>,iP/VFKEUl#UI,4)>;u_!@9oCoP %SP6WeF0]rA+4Z7t8"'Xp7uTi-Isgm*Yl$j02_B)FM9']g>Ee6]f[MLsV]*<dl6)[*V<,!:\+ %&2_SS+/i9oN9>ZI*PSi_EbC"&kP %Zc^.JY:oqKiYMjWFm8(<S`fF,%!9$Rk&/1Ga/h,Q[-V%s=FaI4S!Ds?5StAIgeu.M5!/3XpV8][\8`X+ $kVR=L>]SsLi-%nr&e/e %UPG^"c0Z/[DpF1QKF6OG/>M<QD8'`L2J&_pFc)'P$s*o?C_U=4ku:m62qH$O^ %Sbe^F;l^.91L9`:?,Kf0Q8M@(q7u<u^['%ZXCq %]0V,h;CBs(gp4q;8[!%-!1XN7,=<\aK%0c'iS5&&Z"!osWi6? 0XrNr6\7h=_#e>_@m_*UEhlV+/G*Y;o'kb.W(3s]/+\I/6<\dp7 %#KIGoAL6Lj<^Z+I0?C=7Y0i#,UQs5I+X+KmXTJTMjS)EOeO63B@(2RS`\&"27`<CZ!mfHSo'VY)Roc&)? 7p"SVYds`>X;=Z_'hP? %8=e.C/Q$Kn\@Ksc2ZY7R[q`Q9"abSkmD&[(pucMXkCE!87\ar-;ZXuA87bO)ZG]Tn0`NG/ [1``WdR&*I`m1-jjW?MXB\6i#EfmVg %Drtq?j.HEL:(\KS! t"X<065Y_]>^0i/Age]Z'(kFbnpO[.PdI*2VO`taAJb<0Mi9qo0#@l*]X:cit)72"^*3r/b>nG:Ga0<Yb2Y %V9fOF-6pKT+[9Uqme\ck(iceYS?V8q7Qg_Q<Y=7#Bai\ni_*5pK.nZ_-X9p)'I'MSTIj,W?%+8RHA! p(M_W/D379;kSl<S'/@\kX %(^NK%rQ6=.MS7RIN@$J?@DNYa[*Smhil/n\j/SdP8\cb]$&o5BAJmgjo8VdF@,)W2ILoBEj.%TQ! jrTI@Glc(dt^m.$J(9Q+5"l% %oR3D+%Usf7X&pXGeL"8!2TFIjNItjA\]-)OKU,G_],j)hML? #BlejU\DGGq)A5a9gDK)t6f^I0,dVtQ6N2]Wt1=c2[)B7YW8@^%+ %2.>`t5u!qF"6VQ_dtWtb75$2bH`/3&'q9on7l$YE`ALVlhfh_^qIP*O6O"ZR8/b? 3.^/GAp&Gg[/:uIgbF(\M?t*Tt"P-VH+As@T %[O+tMA/?14Y)L/6\MgB"((*7hn\oOeKs99uiFNJS29%u;".=9%B'CS7e %kq+oc6UZC/i8aLfDMWC)ctF`"[K'aA-CtWnV[CMRdLC %2hjC$-[9gO9Vf/h4[<9Ze!).tRM<aM=7%'kL$NbKQ,Uc187_2/dW=unZ^Ek(R3=68`C2H3c#u[M2@_7^2d7PcBsCfVlKEW,Tfbh %K(9a2J<s;ShBR5Q\hQn:WTiM5IpDFZ?]@#3IRCWV<[?dI$U+;.R7AYib7R %F767,MHEg;ai<8+kY$4Q+VdLooh.TiVM&PTK,0+Vs %RXqaQT/crjPB(k=[[?G"Q;&j!1`2-? Y9:#&8::Wm?\;tm.9"=*SZ6orYk2>+LM@ZqZi@QCkRpmY.BlVcDdO4j.SQe9o`64&-DG.. %_2A)Tp]0C,WhqNTb(h,&$l3%e-M198^caNb(,UTH($Ka+$m@RgRe._CG*S! jL?'X=NL)qalZ:6GUme"Z6Uqd=]gBXY($Q>5afp_T %^E3`U&_2_4W;jG?bfmjg:C$DQl-qPtZrQ$E+K\tYF,^i1To=]1K4O4nL]Z8`XX!CfpbLP`8;XIQ0OqXO% [*:`f`4,@W/AMS,aPQj %T8D>srRV(/-H/a$DB](P+O\-0EA-C#K3gO/mkKe4&`R_C&!>MtE]Z` %B*.D8gVDNI3F8tqHthW;6Dm'eTP0_FXCYLA=K,Y6dMJE* %0Ufm]^9$^rbkDZ$<>#%JX'\]bFJob5!]3[(jA$OLNY+<ECK&P=.7fO.af9%&;$Tfd %G/U'=8P.3d.\ja&:1=o>hAqC-1'<)%u*@$ %FU78_+\*Xh^dS9+oE:Zf4tqQAWsf"_r]9+.P6'68!:8<njc&#_\q[!#3,1!?%.^<K#n') [Sa1rtZf$W\U2QP.6ts"k1S5@UfPGZh %(rIU9]'(D8TQ$YI@]$eSGji4;``OX+[9%Ri_Jt]67+NDO,YV7]8*-Z$]'\TP)FIe1@B5FJ>U! [a&@+#^bhAK/G(Q3#RMefs6jd9< %HFST"7@q3<#@X8n6A3Q>697^&ZRT4L>K*abWkp#@P0N["6YLM^Fm4S'1&$FX%1TYY>GB4_qZn) (:mdGegTfE877ak`oCm8p#45rm %_T/k%FZ_EJ--J5=SsWaa@;D:Q&`/u98pAjH(4mLjS5md'FXKhHh(pFrX>8VBngmnW3A5"FdnOgLg? M$QVu)W2rcUWarZYU2NJ<_M %j2PMmLoG_=^kG:ffKh0'pJN@hUaGl>jM_M_'eshUkSic&dIh5[YC"Q,l<[-aUZLRaY&RIkS+Zn-;J+ [_N_s@f5$G3t-n@+*5psYT %a3D/oeOGlbqD$*VB_.LTlZ7BJ=d4=F:,/6$@qm1rD*h9`c:rV.R]Y%]3taT[\jf`f\7[8_n#"\/T[nI[VN18BWPVnP."(.GGM/J %?%bJ$X!Q\@UI4[.nYGe'ietTCNIX0S9]nfT%dV9i#YV@.95es? MKgWfcPs4Hanb2prbQe*=Y^9GJ7/%,TG1+^3uRM0mcH0t>lQV8 %Q^MQ%9+Q-&dhrY'NqNO6K0`TG$^$B29=`a(K?!D^`Hu5)6rnTIr?B3Y(ZhESCm(FM@/-? hf9S^BEuO4OYJ=A4<[iY@bS@p"h4"?d %2r5$(h&I?]a_;&=64_/pfBM%'EYC<DCK[beT_kn8-Bm>R*qY)bN%1r2@W* %OJF;n(m5ED,V,""4\N#**iR"['F13ZLo$!<\cS'/0 %giS&EqIausc*$L$cM;`,H\F4rg[g(bJ^Q^+*!j:sbn=*K50`KtVa/ (+1fAi['ggY<M`&Y)7Z1*o'QbuDJ+Uu/5D]i@eo<(5@;$JR %!E;2e.c"n=!o.P?&o'-9==AU);0U:>r47n)<o`CVHeWRNO*e<2?6+.:r1b:^gFID1K="Q_A$sk%a#Bj! QG)abH.u-lY+OiN5OEfH %J%k%3)(.D.WpeX1,T9,._(*K"W_=Q[@_-*T2[@WG:??7XW;0GJJ0rR$4&S,!#uW4(5eV+r9SBt^N:D&? (n>/XX4CT=@6]?=gd^%E %mH:me#4#MZ`QJJ,b(d&"rOP"_/4YAiXVR38aDG@=M3T*[Jg3+8$+7&W_(5i>!%*!=?=>RaZrVsT6? W&Y)b"P$Y!_?>eo!S.BFLHE %NE:Jo-apMlF"7JU=toXk_E'C:1=fqpc,Bf0],H)FW=&n`)a_QRh.<<[.prKZVu=[enka$Cs^0E6Hp3#`')inUO,sG.GSbf*0$YU %G6;a=G#MUMLUjf;o\BpuY5R&Xak9&jlRb[O+Y;U++O38q.XbN&0g+qkq3c'cOJ&cHNh$CSXF<t,&G8q6$p@(#%+WtXj!=ofk:@[ %g^U^bfhH7%$-(/#.RpBM,\?Yl7^!>-"ha7_5tMVB?&)ZV%'#7(:h3d3H(B,Ju;Is8%@.bQ$BQn5_SFf,c$^.0k=0+a*?KY-QJ,> %Qa[")DVNAN(1D+:@%0HJ^[IMK]k<Ff>8/jqiaU&MfQBI&oTg>o(-.q#u+chf&T(Xi7/pfh'OI!)N>o"(lT#f"J(IQECCS4'Lpo% %_U03HGoL_g[[Z"13m9/r+=ii0#dM6qm>)kfb;[(!6=NuOlbmG`*QU4NOEHm</[,o*$)C,p9oc %27M8Orf*&&>7A9]p"<u?OU8(gU %CCEKDETV&?ST$E=?J`]V]'X+<\-d:-(U+r7JA15J/s0"ePS%%O^kjH^S")#:js!ShB%"lL26N(k-?`! `ebXqU5(8(;!(==L/q$6M %qUW.p,K\T?gKrMCTp']<D;BC,>$Q`kKgV4Z@*ksLL#\%c+PnqiOpnA@)rJcjU'R#)UdC7! K]m8dh""1b>d:&A;cXmo2?jcag,VJu %)`7i(MeLnUgJ0^H6^)]rDV]J7>?lro[3IK[_g0k;S[Ifq6m\OBa %YtHVfRtd).A"N\4mWKk)`f6UKQZ<9S63O.2.4&BFH*GRG0>g %8/`_kM@8H^45ji]:#6>hFk]W-E?3V#ot0fZJjVX'VtU^lg,j8"hnZ3S"8AX!i/ZF@RO@Q;IB=T@FD-*)+ +G"pFa/<djG9"TUbD"c %6mn$#4'huDld:<&KM6$cd4jYmrTei`#5BROLoVT>OR5S`LA3BJcNOP]&4HoP,:Mu*$"+B7H-D7b1.'J %2)"NP(l<buCFsS).ICeB %CrA]'#hUcm7Ef^_+D6q[#Vf\t"[M?C9=i<2lbKS\ReMTiBU!TH+e&"CJJHJPXJqaEA8@P48P\/ $A>CDJWo+._0SW<Ui=sMaF/J#: %Ou"Kp"HA!efZ>nH,V7IWW[h@#Pb?#-@LgIHcAN^(J/W)>7trdLb;3Z-"$0Q8=H]#PgsuNZ*2*bMZrEO[,])H8O[poL':#Y"mU^b %0%juWFs;ar2%=)"b3FT*JlCi[<oDh,=K1IPm7+g)k!jR_PfY?e\ +0o9N91`jF]iX2YYP=qPmTf,BY)oS3(G,)=S]I@;QAQG!BVQ* %WDQ^Q.VKMPNoRL3FYY[)0.,ue55@k"=C@UK_%G+c@J>!kSHB&KGqms)8MLj&10lA(Q) $V0.9Znso<iTnF@W'c,XOs[4IPn1^fp8j %$kMVL3Gap\/LJeD7p,ao"L'8@lpM?Zeq2Sm$m1iS`?[E3d! [<J9(l*/6m'):"^r978*,#Y46E^HDCW@^@c]2!(o%s!#(t,;_2L5: %$V@f8&O"9)+F,OoLCq6g,kD_bK\.iHd+H]c2Ec(1XNC4aG/<ne'dNHgjir? $erd;]8d#NV:m3jKOG/JHBs"c-jHtadD!RHeH@\8\ %W5G!4?%BSO@M'cq7$L4LKS9>]2EUtfSejDN>U'seN=C8pKW:G5]*5Qm-!Ktq!@Q%? iWnY6Q7QM@O@V0+pqZEON)AYI6Gtku193f3 %"F3$Y$s&8L5!e$flBXEO?rKpK"D4G? s7V'"M(>lIi:1><8^_^(.0;*7+BBd==jWe6H1eQYHdrcUoQb^L#ZVOiljU^`3*PDA9uJd\ %JspT,F]=GEjDGRM$=5m@@egohR:*5^(g7TD@&W.MEIM%j,Yf`jLDKqFSeoZ2M3J3>D8*Vongh)=?]Zn %DN3^($QDAai]'n0h4W>: %5X#Y.RYK8<8M&LM8S^(jj00;p,$:C2CI40t_A],SNJ[<.3eiFq_-mi9r_(\l&gB3)BLtu,b7r]546jF&iNOOlRu^;SJT<K&m!Bp %c8;^8RHRdF?BWYm? j11WK`YS1YR9"FU@IjWhUTCKUM#[Eko'T*MpedUW[T.&[fYSBLdmsYR/2Gn7;CG\dEj`SFCBJK6,Q>iMIe %b %bY?/1WJ\6[.-VmJeXnPFAo\=.Z=RbV#@e)]0atmLJb`gnGQ\'%.@:0l9GWp:? 6^""Xf03Z9[@`F#nqbZC2=ahYnFPI#of973kg8Z %f.c5Dm/&8](0cZ\Ia1(^9W"Hs?\4#a/c`7p99bi=Ndjt%&A[g,8AI'0^a/8Uup\69G*AAaIZkeFC\K>(cfE5\<T<MJAM:l'U@Sl %Nd;$JBgi5b9/^$a;RSIeXQ49`^a]P!hD/sU$VAQKM^tGnA&QlIXHt@)k9(:)0"_TkM5eCgdc%W=X(Yg0Y? W7%2bc)?K*S[dPF)[5 %>J<BWF"-C'/(oh-#!Luu@8::lPdGr@d4I([e*!fJCC@b'3r",B2KM"nUM?h"kEMj^GrtX@*;,in/X)`*F:\;U=8=f8uk5pZ&OLI %FabBtkVjqd0/,R]e3($19V?\E$Gl[KJe0LfoFS#V?t=j3_?H5D##'*dghNQS5jW:;gfW4SkCeM6N3FSX;r4W<i,@XHF&tF&'.nK %^4SjbUBQa5JI^oC!j;riA4tch0&e?UlcS0[USQVlC,JkTG`MRLXsc)?9;EG'\14\'&kCB(Tb:)B\0E/fat+A'Og[BZ#tF;*R6:" %EC>V6cr?KHWZfQV7kMn"6R:cfZlGTEmkJNm>n."BWI0?tcghc8a9Qi6jq:9YNZF<@(MgmY-jYqm)g[&.Ej+HO$FeIecN`t%4QGr %E$B-;FF@aua<ZCb?]A6GDoG)'L5"KHM#IrkI1Di'/ghU&pSe/)oM2(KEBcG/#gWc=WiiRSr,UWF/NY"5"$+</=I8(7p\&C"ip8^ %,^*2/>>7GhRXiJd+UCPLfg`Xd'gaSfZRXT9<N)aqaT<sN[.G21:Y'eg6X#mKc=tBf&CTLIkC? >69&mp/bU&['CifEj+`0X@ebhL. %mWaL"eh),DMpT^X7#M`o\K/'_otlmg+jf6$dd.);G<n>0a6(I$h%/AsDX^os($MLMR[8X=V@; %Omh+fDb5i`[?]sl2l@a=SU"L@9 %7d]H*^n_W54CR"2NBj&78`+h7[ZDUq[iqtP\$:n$2=>(B>#"n21/J*]q; [6[AD;fqYmeq_El2]N6PP[*6r#COYp=G9Q)m:p9PmoM %SNJic>d=