BCFRANKLIN-KRAFT PAPER MILL V2

BCFRANKLIN-KRAFT PAPER MILL V2 - [WINGEMS PROJECT HEADER]...

Info iconThis preview shows pages 1–3. Sign up to view the full content.

View Full Document Right Arrow Icon

Info iconThis preview has intentionally blurred sections. Sign up to view the full version.

View Full DocumentRight Arrow Icon
This is the end of the preview. Sign up to access the rest of the document.

Unformatted text preview: [WINGEMS PROJECT HEADER] SOURCE FILE = C:\DOCUMENTS AND SETTINGS\THTREASU\MY DOCUMENTS\SHELL MODELS\BASE CASE\BCFRANKLIN-KRAFT PAPER MILL V2.WG DATE = Wednesday, May 19, 2010 TIME = 2:49 PM VERSION DESC = 5.3 (Build 305) WINGEMS VERSION = 400 PROJECT VERSION = 3048 COMPATIBILITY = 48 LICENSE KEY = NETWORK C CLICKS = 2631 1262 [FILE OPTIONS] LST CLEAN = 0 KOP = 11 KPORT = 0 ADDL LST REPORT = 0 STREAM TOPOLOGY = 1 DEBUGGING INFO = 1 KPWIDE = 72 NRLINE = 60 OUT CLEAN = 0 ADDL OUT REPORTS = 0 RTWINDOW = 106 116 106 116 0 LSTWINDOW = 112 59 112 59 0 OUTWINDOW = 0 0 0 0 0 S SHOW = 4892 4380 13 [BROWSER TEXT] COUNT = 5 0 0 Liquor: %s#:Flow %u / %s#:SSol %u / %s#:Temp %u / %s#:TSuspSol %u 1 0 Steam: %s#:Flow %u / %s#:GasPress %u / %s#:Temp %u 2 0 Gas: %s#:Flow %u / %s#:GasPress %u / %s#:Temp %u 3 0 Special gas: %s#:SGFlow %u / %s#:SGTemp %u 4 0 Generic [STREAM TAG TEXT] %s#:Flow / %s#:SSol / %s#:Temp %s#:Flow / %s#:GasPress / %s#:Temp %s#:Flow / %s#:GasPress / %s#:Temp %s#:SGFlow / %s#:SGTemp Generic STRM_TAG_SIZE = 8 S STRM_TAG_FONT = Arial [STREAM TYPE COLORS] LIQUOR = 0 STEAM = 0 GAS = 0 SPGAS = 0 G GENERIC = 0 [UNITS] COUNT = 106 ARITY = 5 frac cons% hr m % moist-frac day cm ratio-frac moist% weeks mm ratio% sec months um cons-frac min years ft in in2 ft3 Igal DC inHg Pa Dpsia mol g total od Btu MJ kW k-num H2O/dry m2 m3 in3 deg K DF inH2O psia DPa kmol kg total ad kBtu kWH J/s mN-m2/g iter cm2 dm3 l deg C atm kPa psig DkPa lbmol lb liquor cal MMBtu MWH kJ/s Nm/g ppm mm2 cm3 ml deg R bars mmHg DmmHg Datm mt klb liquor kcal J Hpdays hp asNaOH pH ft2 mm3 gal deg F ftH2O mmH2O DinHg Dbars st %mass solids Mcal kJ W kappa asNa2O %RelHum [RESOURCES] 0 BLOCKSET 1 1 1 COMPONENTS 0 0 2 STREAMSTRUCTURE 0 0 3 UNITSET 0 0 4 UNITSET 1 0 5 UNITSET 2 0 6 UNITSET 3 0 7 DIAGRAM 0 0 8 CBPROFILE 0 1 9 END 0 0 [UNIT RULES] SETS = 4 CURRENT = 1 SET1 = 0 Native Units SET2 = 33 English Units 1 0 0 0 0 3 0 0 0 0 5 0 0 0 0 22 0 0 0 0 22 -67 0 0 0 27 0 0 0 0 27 -11 0 0 0 33 -61 0 0 0 38 0 0 0 0 41 0 0 0 0 49 0 0 0 0 54 0 0 0 0 64 -11 0 0 0 66 -61 0 0 0 67 -67 0 0 0 67 -64 0 0 0 67 -27 0 0 0 67 -22 -11 -54 22 67 -11 0 0 0 72 27 -11 0 0 73 64 -11 0 0 76 64 -11 0 0 79 -67 0 0 0 2 6 6 25 25 35 35 35 40 42 53 56 65 68 68 70 68 68 68 72 72 76 81 0 0 0 0 -68 0 -10 1 0 0 0 0 -11 1 -68 0 -31 -25 -11 35 35 65 -68 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 -11 0 -10 -10 -11 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 -56 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 25 0 0 0 0 0 79 -62 79 -22 79 -11 80 -67 80 -64 80 -25 80 -22 80 -22 80 -11 88 -76 SET3 = 20 1 0 3 0 5 0 27 -11 49 0 54 0 67 -64 67 -22 72 27 73 64 79 -67 79 -62 79 -22 79 -11 80 -67 80 -64 80 -25 80 -22 80 -22 80 -11 SET4 = 27 1 0 3 0 5 0 22 0 22 -67 27 0 27 -11 33 -61 49 0 54 0 64 -11 67 -67 67 -22 67 -11 72 27 76 64 79 -67 79 -62 79 -22 79 -11 80 -67 80 -64 80 -25 80 -22 80 -22 80 -11 88 -76 0 0 0 -11 -41 0 -41 0 0 0 0 0 0 0 0 -11 -41 0 -11 -41 0 -11 -41 22 0 0 0 -64 0 0 Metric Units 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 -11 -54 22 -11 0 0 -11 0 0 0 0 0 0 0 0 -11 -41 0 -41 0 0 0 0 0 0 0 0 -11 -41 0 -11 -41 0 -11 -41 22 0 0 0 English modified 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 -11 -54 22 0 0 0 -11 0 0 -11 0 0 0 0 0 0 0 0 -11 -41 0 -41 0 0 0 0 0 0 0 0 -11 -41 0 -11 -41 0 -11 -41 22 0 0 0 -64 0 0 81 81 81 81 81 81 81 81 81 88 1 -25 -11 -68 -68 -25 -25 -25 -11 -76 0 -11 -42 0 0 -11 -11 -11 0 -65 0 -42 0 0 0 -42 -42 -42 0 0 0 0 0 0 0 0 0 25 0 0 2 6 6 33 48 58 70 67 72 72 86 85 85 86 86 86 86 86 86 86 0 0 0 -10 0 0 0 -22 33 33 -64 -62 -22 -11 -64 -64 -22 -22 -22 -11 0 0 0 0 0 0 0 -11 -10 -10 0 0 -11 -41 0 0 -11 -11 -11 0 0 0 0 0 0 0 0 -58 0 0 0 0 -41 0 0 0 -41 -41 -41 0 0 0 0 0 0 0 0 22 0 0 0 0 0 0 0 0 0 0 22 0 2 6 6 25 25 35 35 35 53 56 65 68 68 68 72 76 81 81 81 81 81 81 81 81 81 81 88 0 0 0 0 -68 0 -10 1 0 0 -11 -68 -25 -11 35 65 -68 1 -25 -11 -68 -68 -25 -25 -25 -11 -76 0 0 0 0 0 0 0 0 0 0 0 0 -11 0 -10 -11 0 0 -11 -42 0 0 -11 -11 -11 0 -65 0 0 0 0 0 0 0 0 0 0 0 0 -56 0 0 0 0 0 -42 0 0 0 -42 -42 -42 0 0 0 0 0 0 0 0 0 0 0 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 25 0 0 [COMPONENT LIST] COUNT = 175 0 0 0 0 00000 1 3 1 -1 Liquor flow 00000 2 3 1 -1 Suspended solids 00000 2 3 1 -1 Susp. solid/Gas pr. 00000 3 3 1 -1 Temperature 00000 0 3 1 3 Gas temperature 00000 2 13 1 32 Gas pressure 00000 48 13 1 14 Liquid pressure 00000 4 5 1 1 Pulp 00000 12 5 1 45 Calcium oxide 00000 13 5 1 46 Calcium carbonate 00000 14 5 1 47 Calcium hydroxide 00000 15 5 1 48 Calcium sulfate 00000 17 5 1 49 Inerts 00000 0 7 1 10 Active chloride 00000 24 7 1 13 Carbonate 00000 27 7 1 9 Chloride 00000 19 7 1 6 Diss. wood solids 00000 21 7 1 5 Hydroxide 00000 29 7 1 50 Peroxide 00000 26 7 1 44 Thiosulfate 00000 0 7 1 11 Magnesium 00000 0 7 1 12 Potassium 00000 20 7 1 4 Sodium 00000 22 7 1 8 Sulfate 00000 23 7 1 7 Hydrosulfide 00000 0 5 1 52 Spec. surf. area 00000 0 5 1 53 Yield 00000 0.000000 0 0.000000 0.000000 Flow 0.001000 0 0.000000 0.000000 SuspSol 0.001000 0 0.000000 0.000000 SSol/Pr 0.001000 0 0.000000 0.000000 Temp 0.001000 0 0.000000 0.000000 GasTemp 0.001000 0 0.000000 0.000000 GasPress 0.001000 0 0.000000 0.000000 LiqPress 0.001000 0 0.000000 0.000000 Pulp 0.001000 0 0.000000 0.000000 CaO 0.001000 0 0.000000 0.000000 CaCO3 0.001000 0 0.000000 0.000000 Ca(OH)2 0.001000 0 0.000000 0.000000 CaSO4 0.001000 0 0.000000 0.000000 Inert 0.001000 0 0.000000 0.000000 ClA 0.001000 0 0.000000 0.000000 CO3 0.001000 0 0.000000 0.000000 Cl 0.001000 0 0.000000 0.000000 DissSol 0.001000 0 0.000000 0.000000 OH 0.001000 0 0.000000 0.000000 H2O2 0.001000 0 0.000000 0.000000 S2O3 0.001000 0 0.000000 0.000000 Mg 0.001000 0 0.000000 0.000000 K 0.001000 0 0.000000 0.000000 Na 0.001000 1 2.430000 53.000000 SO4 0.001000 0 0.000000 0.000000 HS 0.001000 0 0.000000 0.000000 SurfArea 0.001000 0 0.000000 0.000000 Yield 0.001000 0 0.000000 0.000000 9 00 5 00 0 00 6 00 0 00 25 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 46 00 0 00 0 00 0 00 0 00 45 00 44 00 43 00 0 00 42 00 0 00 0 00 0 00 0 5 00 5 00 5 00 5 00 5 00 7 00 7 00 7 00 5 00 5 00 7 00 7 00 7 00 7 00 7 00 9 00 9 00 9 00 9 00 9 00 9 00 9 00 9 00 9 00 9 00 9 00 9 00 9 00 9 00 11 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 54 Extractives Extract 0.001000 0 0.000000 0.000000 1 55 Lignin Lignin 0.001000 0 0.000000 0.000000 1 56 Hemicellulose Hemicell 0.001000 0 0.000000 0.000000 1 57 Cellulose Cell 0.001000 0 0.000000 0.000000 1 58 Sulfonation Sulfonat 0.001000 0 0.000000 0.000000 1 42 Sulfite SO3 0.001000 0 0.000000 0.000000 1 43 Disulfite HSO3 0.001000 0 0.000000 0.000000 1 51 H+ (acid) H+ 0.001000 0 0.000000 0.000000 1 59 Chromophore groups Chromo 0.001000 0 0.000000 0.000000 1 15 Kappa number Kappa 0.001000 0 0.000000 0.000000 1 16 Diss. concent. 1 D1 0.001000 0 0.000000 0.000000 1 17 Diss. concent. 2 D2 0.001000 0 0.000000 0.000000 1 18 Diss. concent. 3 D3 0.001000 0 0.000000 0.000000 1 19 Diss. concent. 4 D4 0.001000 0 0.000000 0.000000 1 20 Diss. concent. 5 D5 0.001000 0 0.000000 0.000000 1 21 Air (dry) Air 0.001000 0 0.000000 0.000000 1 24 Carbon dioxide CO2 0.001000 0 0.000000 0.000000 1 40 Carbon monoxide CO 0.001000 0 0.000000 0.000000 1 39 Hydrogen H2 0.001000 0 0.000000 0.000000 1 38 Hydrogen chloride HCl 0.001000 0 0.000000 0.000000 1 41 Methane CH4 0.001000 0 0.000000 0.000000 1 23 Nitrogen N2 0.001000 0 0.000000 0.000000 1 25 Oxygen O2 0.001000 0 0.000000 0.000000 1 36 Sulfur dioxide SO2 0.001000 0 0.000000 0.000000 1 37 Tot. Reduced Sulfur TRS 0.001000 0 0.000000 0.000000 1 22 Water vapor WV 0.001000 0 0.000000 0.000000 1 34 NaCO3 dust NaCO3D 0.001000 0 0.000000 0.000000 1 35 NaCl dust NaClD 0.001000 0 0.000000 0.000000 1 33 Na2SO4 dust Na2SO4D 0.001000 0 0.000000 0.000000 1 60 Sodium hydroxide NaOH 0.001000 0 0.000000 0.000000 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 54 00 0 00 50 00 59 00 0 00 0 00 0 00 52 00 51 00 0 00 0 00 00 11 00 11 00 11 00 11 00 11 00 11 00 11 00 11 00 11 00 11 00 11 00 11 00 11 00 11 00 13 00 13 00 13 00 13 00 101 00 13 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 61 Sodium sulfide Na2S 0.001000 0 0.000000 0.000000 1 62 Potassium chloride KCl 0.001000 0 0.000000 0.000000 1 63 Potassium hydroxide KOH 0.001000 0 0.000000 0.000000 1 64 Potassium sulfide K2S 0.001000 0 0.000000 0.000000 1 65 Potassium sulfate K2SO4 0.001000 0 0.000000 0.000000 1 66 Carbon C 0.001000 0 0.000000 0.000000 1 67 Potassium carbonate K2CO3 0.001000 0 0.000000 0.000000 1 68 Sodium hydroxide gas NaOHG 0.001000 0 0.000000 0.000000 1 69 Sodium gas NaG 0.001000 0 0.000000 0.000000 1 70 Sodium chloride gas NaClG 0.001000 0 0.000000 0.000000 1 71 Potass. chloride gas KClG 0.001000 0 0.000000 0.000000 1 72 Potass. hydrox. gas KOHG 0.001000 0 0.000000 0.000000 1 73 Potassium gas KG 0.001000 0 0.000000 0.000000 1 74 Solids Solid 0.001000 0 0.000000 0.000000 1 26 Wet bulb temp. WB 0.001000 0 0.000000 0.000000 1 27 Dew point temp. DP 0.001000 0 0.000000 0.000000 1 28 Relative humidity RH 0.001000 0 0.000000 0.000000 1 29 Absolute humidity AH 0.001000 0 0.000000 0.000000 1 30 Enthalpy H 0.001000 0 0.000000 0.000000 1 31 Specific volume SpecVol 0.001000 0 0.000000 0.000000 1 0 Tot diss solids/gas TDS 0.001000 0 0.000000 0.000000 1 0 Sulfidity Sulf 0.001000 0 0.000000 0.000000 1 0 Liquor activity LiqAct 0.001000 0 0.000000 0.000000 1 0 Brightness Bright 0.001000 0 0.000000 0.000000 1 0 Effective alkali EA 0.001000 0 0.000000 0.000000 1 0 Active alkali AA 0.001000 0 0.000000 0.000000 1 0 Total tit. alkali TTA 0.001000 0 0.000000 0.000000 1 0 pH pH 0.001000 0 0.000000 0.000000 1 0 $ Caustic on wood $Caustic 0.001000 0 0.000000 0.000000 0 00 0 00 53 00 0 00 49 00 0 00 57 00 58 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 101 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 101 00 103 00 103 00 103 00 103 00 103 00 103 00 103 00 103 00 103 00 103 00 103 00 103 00 5 00 5 00 5 00 5 00 5 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 0 Liquor/wood ratio Liq/Wood 0.001000 0 0.000000 0.000000 1 0 MgSO4/HS ratio MgSO4/HS 0.001000 0 0.000000 0.000000 1 0 Total mass flow TotMass 0.001000 0 0.000000 0.000000 1 0 Total volume flow TotVol 0.001000 0 0.000000 0.000000 1 0 Total susp. solids TSuspSol 0.001000 0 0.000000 0.000000 1 0 NaOH flow rate NaOHflow 0.001000 0 0.000000 0.000000 1 0 Consistency Consis 0.001000 0 0.000000 0.000000 1 0 Density Density 0.001000 0 0.000000 0.000000 1 0 Specific enthalpy SpecEnth 0.001000 0 0.000000 0.000000 1 0 $ EA on wood $EAWood 0.001000 0 0.000000 0.000000 1 0 $ AA on wood $AAWood 0.001000 0 0.000000 0.000000 1 0 $ TTA on wood $TTAwood 0.001000 0 0.000000 0.000000 1 0 Liquid Density LiqDens 0.001000 0 0.000000 0.000000 1 0 Start of special gas 0.001000 0 0.000000 0.000000 1 0 SpGas: dry gas flow SGFlow 0.001000 0 0.000000 0.000000 1 0 SpGas: temperature SGTemp 0.001000 0 0.000000 0.000000 1 0 SpGas: Na2SO4 SGNa2SO4 0.001000 0 0.000000 0.000000 1 0 SpGas: Na2CO3 SGNa2CO3 0.001000 0 0.000000 0.000000 1 0 SpGas: NaCl SGNaCl 0.001000 0 0.000000 0.000000 1 0 SpGas: SO2 SGSO2 0.001000 0 0.000000 0.000000 1 0 SpGas: CO2 SGCO2 0.001000 0 0.000000 0.000000 1 0 SpGas: HCl SGHCl 0.001000 0 0.000000 0.000000 1 0 SpGas: H2O SGH2O 0.001000 0 0.000000 0.000000 1 0 SpGas: O2 SGO2 0.001000 0 0.000000 0.000000 1 0 SpGas: N2 SGN2 0.001000 0 0.000000 0.000000 1 82 Carbon in Lignin C_Lignin 0.001000 0 0.000000 0.000000 1 83 Oxygen in Lignin O_Lignin 0.001000 0 0.000000 0.000000 1 84 Hydrogen in Lignin H_Lignin 0.001000 0 0.000000 0.000000 1 85 Carbon in Carbo C_Carbo 0.001000 0 0.000000 0.000000 1 86 Oxygen in Carbo O_Carbo 0.001000 0 0.000000 0.000000 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 55 00 56 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 0 00 28 00 0 00 0 00 0 00 0 00 00 5 00 5 00 5 00 5 00 7 00 7 00 7 00 101 00 101 00 101 00 101 00 101 00 101 00 103 00 103 00 103 00 5 00 5 00 101 00 101 00 101 00 7 00 7 00 7 00 7 00 7 00 9 00 101 00 101 00 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 87 Hydrogen in Carbo H_Carbo 0.001000 0 0.000000 0.000000 1 88 Carbon in Extract C_Extr 0.001000 0 0.000000 0.000000 1 89 Oxygen in Extract O_Extr 0.001000 0 0.000000 0.000000 1 90 Hydrogen in Extract H_Extr 0.001000 0 0.000000 0.000000 1 91 Carbon in Diss. Org. C_Diss 0.001000 0 0.000000 0.000000 1 92 Oxygen in Diss. Org. O_Diss 0.001000 0 0.000000 0.000000 1 93 Hy'gen in Diss. Org. H_Diss 0.001000 0 0.000000 0.000000 1 0 Dissolved organics DissOrg 0.001000 0 0.000000 0.000000 1 0 Dissolved inorganics DissInorg 0.001000 0 0.000000 0.000000 1 0 Total liquor flow TotLiq 0.001000 0 0.000000 0.000000 1 0 Water Water 0.001000 0 0.000000 0.000000 1 0 Total enthalpy TotEnth 0.001000 0 0.000000 0.000000 1 0 Freeness Freeness 0.001000 0 0.000000 0.000000 1 0 SpGas: K2SO4 SGK2SO4 0.001000 0 0.000000 0.000000 1 0 SpGas: K2CO3 SGK2CO3 0.001000 0 0.000000 0.000000 1 0 SpGas: KCl SGKCl 0.001000 0 0.000000 0.000000 1 94 Sorbed sodium Na_Sorb 0.001000 0 0.000000 0.000000 1 95 Sorbed potassium K_Sorb 0.001000 0 0.000000 0.000000 1 0 Degrees Superheat Superheat 0.001000 0 0.000000 0.000000 1 0 Temp of Saturation TempSat 0.001000 0 0.000000 0.000000 1 0 Press of Saturation PressSat 0.001000 0 0.000000 0.000000 1 75 Chlorate CLO3 0.001000 0 0.000000 0.000000 1 76 Hypochlorite OCL 0.001000 0 0.000000 0.000000 1 77 Dichromate CR2O7 0.001000 0 0.000000 0.000000 1 78 Chlorine Dioxide CLO2 0.001000 0 0.000000 0.000000 1 79 Aqueous Chlorine CL2AQ 0.001000 0 0.000000 0.000000 1 80 Chlorine CL2 0.001000 0 0.000000 0.000000 1 0 Effective alkali(T) EA_2 0.001000 0 0.000000 0.000000 1 0 Active alkali(T) AA_2 0.001000 0 0.000000 0.000000 0 7 1 125 00000 0 7 1 126 00000 0 7 1 127 00000 0 5 1 128 00000 0 5 1 129 00000 0 5 1 130 00000 0 5 1 131 00000 0 13 1 96 00000 0 0 1 0 00000 0 8 0 0 00000 10 6 0 0 00000 11 6 0 0 00000 16 6 0 0 00000 7 6 0 0 00000 8 6 0 0 00000 30 8 0 0 00000 31 8 0 0 00000 18 6 0 0 00000 32 8 0 0 00000 33 8 0 0 00000 34 8 0 0 00000 35 8 0 0 00000 36 8 0 0 00000 37 8 0 0 00000 38 8 0 0 00000 39 8 0 0 00000 40 8 0 0 00000 41 8 0 0 00000 47 10 0 0 00000 SORPTION FLAG = Ca++ CA 0.001000 0 0.000000 0.000000 Mn++ MN 0.001000 0 0.000000 0.000000 Methanol CH3OH 0.001000 0 0.000000 0.000000 Sorbed Calcium CA_SORB 0.001000 0 0.000000 0.000000 Sorbed Magnesium MN_SORB 0.001000 0 0.000000 0.000000 Chlorine Dioxide MG_SORB 0.001000 0 0.000000 0.000000 Bounded Hydrogen H_BOND 0.001000 0 0.000000 0.000000 Dust Solids DUSTSOL 0.001000 0 0.000000 0.000000 0.001000 0 0.000000 0.000000 Turpentine USER1 0.001000 0 0.000000 0.000000 Filler Filler 0.001000 0 0.000000 0.000000 Starch Starch 0.001000 0 0.000000 0.000000 Other Other 0.001000 0 0.000000 0.000000 Hexose Hexose 0.001000 0 0.000000 0.000000 Pentose Pentose 0.001000 0 0.000000 0.000000 Tall Oil talloil 0.001000 0 0.000000 0.000000 Glucose Glu 0.001000 0 0.000000 0.000000 Z.mobilis Zymo 0.001000 0 0.000000 0.000000 Hexose Oligomer HexOlig 0.001000 0 0.000000 0.000000 Acetate Ace 0.001000 0 0.000000 0.000000 Xylose Xyl 0.001000 0 0.000000 0.000000 Xylitol Xylitol 0.001000 0 0.000000 0.000000 Pentose Oligomer PentOlig 0.001000 0 0.000000 0.000000 Furfurals Furfurals 0.001000 0 0.000000 0.000000 Cellulase aq ENZaq 0.001000 0 0.000000 0.000000 Corn steep liquor CSL 0.001000 0 0.000000 0.000000 Diammonium phosphate DAP 0.001000 0 0.000000 0.000000 Ethanol Eth 0.001000 0 0.000000 0.000000 Ethanol vapor EV 0.001000 0 0.000000 0.000000 1 [USER DEFINED DERIVED COMPS] Num = 0 A ADDIN = [NONCONVERGENCE] METRIC TYPE = 2 COMPONENT = Flow M MAX STREAMS = 10 [DIAGRAM STRUCTURE] 7 7 0 0 0 452 777 [COMPOUND BLOCK PROFILES] C COUNT = 1 [CBP] NUM = 8 DIAGRAM = 7 SYMBOL = TOPLEVEL COMMENT = 0 L LEN = 0 0 0 [PROJECT PROTECTION] OPENING = ìñË©Ù£w È INPUT = qHã¤Úã âtÝï« ¥ ©t¤ÞÐñ½ªª CONTENTS = Q ÝÓÍsÙÑéÌù¸É¬´èÑ©® ÚاÒÇá COMPOUND BLOCKS = ÒQ ·Áÿúû¸QÔÐ ÒýÒQö®¸ ½¸Ò TPS = ëqåþ öÓº ï¥Ãïñ¨Ì ¢¡ÁìÓ¸¤ê SCRIPTS STAT = Çë«QßØÆ ðþÒü ¤ µ¡òÞÚ ®ï ENABLED = ҹפ Úìʶ¯Ù³²íû°¿²ó«ë ´ë¯Q P PASSWORD = Qèøá Òøï ç±×ùë¿£±ÅÅÊÇë°¸ [DIAGRAM HEADER] NUM = 7 NAME = Diagram1 MASTER = 1 NUMBLOCKS = 452 NUMSTREAMS = 777 NUMTEXT = 248 NUMCONDS = 2 NUMSCRIPTS = 2 M MASTER SCRIPT = 0 [DRAW DATA] PAGE AREA = 1,1 PAGE SIZE = 55.000000,80.000000 MARGINS = 0.750000,0.750000,0.750000,0.750000 H/F DIST = 0.500000,0.500000 COMMENT = 1 LEN = 8 %f -- %d COMMENT = 1 LEN = 13 Page %p of %q NUMBER PAGES DOWN = 0 ORIGIN = 43,128 ZOOM = 27,32 WINDOW = 0 0 1276 846 20 S COLOR = 11775918 [BLOCK] NUM = 1 TYPE = 1:SPLIT,2 NAME = Split1 LABEL = POS = 157,38,167,48 ICON = FLAGS = 0 VIEW = 4 IN = 364 OUT = 2 3 IV = 0 2 0 0.5 0.479999989 CV = 0 2 0 0.5 0.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 2 Frm = b1:3 A ADDIN = [BLOCK] NUM = 2 TYPE = 1:STORE,1 NAME = Store2 LABEL = POS = 63,54,73,64 ICON = FLAGS = 0 VIEW = 4 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 107 1. HW mt/hr to T/hr\n2. SW mt/hr~ to T/hr\n3. purchased chips mt/~ hr to T/hr\n4. purchased bark mt~ /hr to T/hr OPT = CP CmpPs Num = 4 PSpec = 3 Frm = s456:totmass /.907 PSpec = 2 Frm = s379:totmass /.907 PSpec = 1 Frm = s222:totmass /.907 PSpec = 0 Frm = s219:totmass /.907 ADDIN = [BLOCK] NUM = 3 TYPE = 1:STMIX,4 NAME = Stmix3 LABEL = POS = 108,264,118,274 ICON = FLAGS = 0 VIEW = 8 IN = 12 OUT = 7 IV = 0 4 0 0 130 8517.21289 CV = 0 4 0 0 130 8517.21 0 0 0 12.1109 5797.75 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 4 TYPE = 1:STMIX,4 NAME = Stmix4 LABEL = POS = 108,283,118,293 ICON = FLAGS = 0 VIEW = 4 IN = 7 OUT = 8 IV = 0 4 0 0 160 8517.20996 CV = 0 4 0 0 160 8517.21 0 0 0 7.97235 3816.52 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 5 TYPE = 2:REACTION,2 NAME = Reaction5 LABEL = POS = 108,302,118,312 ICON = FLAGS = 0 VIEW = 4 IN = 8 OUT = 9 IV = 0 2 0 0 21 0.200000003 19 1 9 0.774999976 19 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 21 0.2 19 1 9 0.775 19 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = A ADDIN = C COMMENT = 0 [BLOCK] NUM = 6 TYPE = 1:REACT,1 NAME = React6 LABEL = POS = 108,340,118,350 ICON = FLAGS = 0 VIEW = 4 IN = 440 OUT = 6 IV = 0 0 0 0 12 CV = 0 0 0 0 12 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 7 TYPE = 1:SPLIT,3 NAME = Split7 LABEL = POS = 108,360,118,370 ICON = FLAGS = 0 VIEW = 4 IN = 6 OUT = 10 11 IV = 0 3 0.300000012 0 1 CV = 0 3 0.3 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 8 TYPE = 1:MIX,1 NAME = Mix8 LABEL = POS = 131,360,141,370 ICON = FLAGS = 0 VIEW = 4 IN = 11 21 OUT = 31 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 10 TYPE = 1:FLASH,1 NAME = Flash10 LABEL = POS = 157,360,167,370 ICON = FLAGS = 0 VIEW = 4 IN = 31 OUT = 676 891 IV = 0 0 1551 0 0 0 19.0149994 23.0249996 CV = 0 0 1551 0 0 0 19.015 23.025 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 11 TYPE = 1:WZONE,1 NAME = Wzone11 LABEL = POS = 108,379,118,389 ICON = FLAGS = 0 VIEW = 4 IN = 10 20 OUT = 14 21 IV = 0 0 0.119999997 CV = 0 0 0.12 0 0 0 2.05981 0.694745 0 2.4729 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 12 TYPE = 1:MIX,1 NAME = Mix12 LABEL = POS = 108,398,118,408 ICON = FLAGS = 0 VIEW = 4 IN = 14 26 OUT = 15 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 13 TYPE = 1:SPLIT,3 NAME = Split13 LABEL = POS = 109,418,119,428 ICON = FLAGS = 0 VIEW = 4 IN = 15 OUT = 16 23 IV = 0 3 0.100000001 0 1 CV = 0 3 0.1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 14 TYPE = 1:STMIX,4 NAME = Stmix14 LABEL = POS = 91,398,101,408 ICON = FLAGS = 0 VIEW = 4 IN = 16 OUT = 20 IV = 0 4 0 0 130 3862.88525 CV = 0 4 0 0 130 3862.89 0 0 0 5.33542 2686.84 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 15 TYPE = 1:DILUTE,2 NAME = Dilute15 LABEL = POS = 129,418,139,428 ICON = FLAGS = 0 VIEW = 4 IN = 23 27 OUT = 24 26 IV = 0 2 0.0450000018 CV = 0 2 0.045 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 16 TYPE = 1:SPLIT,3 NAME = Split16 LABEL = POS = 148,418,158,428 ICON = FLAGS = 0 VIEW = 4 IN = 24 OUT = 25 28 IV = 0 3 0.340000004 0 0 0 5.00995016 6.00497293 7.00260019 8.00395966 9.00949955 CV = 0 3 0.34 0 0 0 5.00995 6.00497 7.0026 8.00396 9.0095 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 17 TYPE = 1:WASH,1 NAME = Wash17 LABEL = POS = 167,418,177,428 ICON = FLAGS = 0 VIEW = 4 IN = 25 29 OUT = 30 27 IV = 0 2 0.119999997 0 0 1 0 1 CV = 0 2 0.12 0 0 1 0 1 0 0.661943 1.34021 2.4949 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 18 TYPE = 1:WASH,1 NAME = Wash18 LABEL = POS = 186,418,196,428 ICON = FLAGS = 0 VIEW = 4 IN = 30 33 OUT = 32 29 IV = 0 2 0.119999997 0 0 1 0 1 CV = 0 2 0.12 0 0 1 0 1 0 0.758244 1.34022 2.49494 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 19 TYPE = 1:DILUTE,2 NAME = Dilute19 LABEL = POS = 205,418,215,428 ICON = FLAGS = 0 VIEW = 4 IN = 32 41 OUT = 33 42 IV = 0 2 0.0179999992 CV = 0 2 0.018 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 20 TYPE = 1:CHARGE,6 NAME = Charge2 LABEL = POS = 108,245,118,255 ICON = FLAGS = 0 VIEW = 4 IN = 353 360 OUT = 12 IV = 0 7 0 0 0.180645168 129.032257 0.25 0.949999988 0.850000024 85 1 1.10000002 CV = 0 7 0 0 0.180645 129.032 0.25 0.95 0.85 85 2 1.1 LINKS = 0 UNITS = 2 50 66 -33 100 0 0 40 1 100 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 21 TYPE = 1:WASH,1 NAME = Wash21 LABEL = Decker POS = 265,418,275,428 ICON = FLAGS = 256 VIEW = 4 IN = 387 220 OUT = 41 43 IV = 0 2 0.119999997 0 0 1 5 1 5 CV = 0 2 0.12 0 0 1 5 1 5 0.632866 1.44403 3.25622 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 22 TYPE = 1:SPLIT,3 NAME = Split20 LABEL = Screening POS = 227,418,237,428 ICON = FLAGS = 256 VIEW = 4 IN = 42 OUT = 37 40 IV = 0 3 0.0219999999 0 0 0 5.01949978 6.00995016 7.00549984 8.00800037 9.01949978 CV = 0 3 0.022 0 0 0 5.0195 6.00995 7.0055 8.008 9.0195 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 23 TYPE = 1:STORE,1 NAME = Store201~1 LABEL = POS = 244,692,254,702 ICON = FLAGS = 256 VIEW = 8 IN = OUT = IV = 0 0 0 1.29999995 CV = 0 0 0 1.3 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 168 P1 & P2 = TSS brown pulp\nP3 = t~ sesq/t ClO2\nP4 = Sesq to sulfa~ te factor\nP5 = t ClO2 generated~ \nP6 = t sesq produced\nP7 = t s~ ulfate produced\n\n\nP5 = t ClO2~ /hr used OPT = CP CmpPs Num = 4 PSpec = 3 Frm = b201:3/262*142*2 PSpec Frm = PSpec Frm = PSpec Frm = ADDIN = A =6 b201:4*b201:5 =5 b201:3*b201:5 =0 s53:TSuspSol [BLOCK] NUM = 24 TYPE = 1:SPLIT,3 NAME = Split20~1 LABEL = Screening POS = 229,721,239,731 ICON = FLAGS = 256 VIEW = 4 IN = 45 OUT = 50 46 IV = 0 3 0.0219999999 0 0 0 5.01949978 6.00995016 7.00549984 8.00800037 9.01949978 CV = 0 3 0.022 0 0 0 5.0195 6.00995 7.0055 8.008 9.0195 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 25 TYPE = 1:WASH,1 NAME = Wash21~1 LABEL = Decker POS = 267,721,277,731 ICON = FLAGS = 256 VIEW = 4 IN = 52 105 OUT = 54 53 IV = 0 2 0.119999997 0 0 1 5 1 5 CV = 0 2 0.12 0 0 1 5 1 5 0.632867 1.44403 3.25623 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 26 TYPE = 1:CHARGE,6 NAME = Charge2~1 LABEL = POS = 110,528,120,538 ICON = FLAGS = 0 VIEW = 4 IN = 161 361 OUT = 60 IV = 0 7 0 0 0.180645168 129.032257 0.25 0.949999988 0.850000024 85 1 1.10000002 CV = 0 7 0 0 0.180645 129.032 0.25 0.95 0.85 85 2 1.1 LINKS = 0 UNITS = 2 50 66 -33 100 0 0 40 1 100 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 30 TYPE = 1:STMIX,4 NAME = Stmix3~1 LABEL = POS = 110,547,120,557 ICON = FLAGS = 0 VIEW = 4 IN = 60 OUT = 61 IV = 0 4 0 0 130 8517.20996 CV = 0 4 0 0 130 8517.21 0 0 0 12.111 5797.76 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 31 TYPE = 1:STMIX,4 NAME = Stmix4~1 LABEL = POS = 110,566,120,576 ICON = FLAGS = 0 VIEW = 4 IN = 61 OUT = 62 IV = 0 4 0 0 160 8517.20996 CV = 0 4 0 0 160 8517.21 0 0 0 7.97235 3816.52 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 32 TYPE = 2:REACTION,2 NAME = Reaction5~1 LABEL = POS = 110,585,120,595 ICON = FLAGS = 0 VIEW = 4 IN = 62 OUT = 63 IV = 0 2 0 0 21 0.200000003 19 1 9 0.774999976 19 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 21 0.2 19 1 9 0.775 19 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 33 TYPE = 1:REACT,1 NAME = React6~1 LABEL = POS = 110,623,120,633 ICON = FLAGS = 0 VIEW = 4 IN = 64 OUT = 65 IV = 0 0 0 0 12 CV = 0 0 0 0 12 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 34 TYPE = 1:SPLIT,3 NAME = Split7~1 LABEL = POS = 110,663,120,673 ICON = FLAGS = 0 VIEW = 4 IN = 22 OUT = 70 66 IV = 0 3 0.300000012 0 1 CV = 0 3 0.3 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 35 TYPE = 1:MIX,1 NAME = Mix8~1 LABEL = POS = 133,663,143,673 ICON = FLAGS = 0 VIEW = 4 IN = 66 71 OUT = 72 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 36 TYPE = 1:FLASH,1 NAME = Flash10~1 LABEL = POS = 159,663,169,673 ICON = FLAGS = 0 VIEW = 4 IN = 72 OUT = 901 902 IV = 0 0 1551 0 0 0 19.0149994 23.0249996 CV = 0 0 1551 0 0 0 19.015 23.025 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 40 TYPE = 1:WZONE,1 NAME = Wzone11~1 LABEL = POS = 110,682,120,692 ICON = FLAGS = 0 VIEW = 4 IN = 70 75 OUT = 76 71 IV = 0 0 0.119999997 CV = 0 0 0.12 0 0 0 2.05984 0.694746 0 2.47295 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 41 TYPE = 1:MIX,1 NAME = Mix12~1 LABEL = POS = 110,701,120,711 ICON = FLAGS = 0 VIEW = 4 IN = 76 80 OUT = 81 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 42 TYPE = 1:SPLIT,3 NAME = Split13~1 LABEL = POS = 111,721,121,731 ICON = FLAGS = 0 VIEW = 4 IN = 81 OUT = 83 82 IV = 0 3 0.100000001 0 1 CV = 0 3 0.1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 43 TYPE = 1:STMIX,4 NAME = Stmix14~1 LABEL = POS = 93,701,103,711 ICON = FLAGS = 0 VIEW = 4 IN = 83 OUT = 75 IV = 0 4 0 0 130 3862.88525 CV = 0 4 0 0 130 3862.89 0 0 0 5.33542 2686.84 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 44 TYPE = 1:DILUTE,2 NAME = Dilute15~1 LABEL = POS = 131,721,141,731 ICON = FLAGS = 0 VIEW = 4 IN = 82 84 OUT = 85 80 IV = 0 2 0.0450000018 CV = 0 2 0.045 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 45 TYPE = 1:SPLIT,3 NAME = Split16~1 LABEL = POS = 150,721,160,731 ICON = FLAGS = 0 VIEW = 4 IN = 85 OUT = 90 86 IV = 0 3 0.340000004 0 0 0 5.00950003 6.00497293 7.00260019 8.00395966 9.00949955 CV = 0 3 0.34 0 0 0 5.0095 6.00497 7.0026 8.00396 9.0095 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 46 TYPE = 1:WASH,1 NAME = Wash17~1 LABEL = POS = 169,721,179,731 ICON = FLAGS = 0 VIEW = 4 IN = 90 91 OUT = 93 84 IV = 0 2 0.119999997 0 0 1 0 1 CV = 0 2 0.12 0 0 1 0 1 0 0.661945 1.34022 2.49496 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 50 TYPE = 1:WASH,1 NAME = Wash18~1 LABEL = POS = 188,721,198,731 ICON = FLAGS = 0 VIEW = 4 IN = 93 94 OUT = 95 91 IV = 0 2 0.119999997 0 0 1 0 1 CV = 0 2 0.12 0 0 1 0 1 0 0.758243 1.34021 2.49489 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 51 TYPE = 1:DILUTE,2 NAME = Dilute19~1 LABEL = POS = 207,721,217,731 ICON = FLAGS = 0 VIEW = 4 IN = 95 54 OUT = 94 45 IV = 0 2 0.0179999992 CV = 0 2 0.018 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 52 TYPE = 1:MIX,1 NAME = Mix62~1 LABEL = POS = 367,701,377,711 ICON = FLAGS = 0 VIEW = 4 IN = 100 275 924 OUT = 51 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 53 TYPE = 2:REACTION,2 NAME = Reaction234~1 LABEL = POS = 110,605,120,615 ICON = FLAGS = 0 VIEW = 4 IN = 63 OUT = 64 IV = 0 2 0 0 5 0.970000029 19 1 6 0.189999998 19 1 7 0.709999979 19 1 8 0.709999979 19 1 CV = 0 2 0 0 5 0.97 19 1 6 0.19 19 1 7 0.71 19 1 8 0.71 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 54 TYPE = 1:SPLIT,2 NAME = Split204~1 LABEL = Miscellaneous spills POS = 248,721,258,731 ICON = FLAGS = 256 VIEW = 4 IN = 50 OUT = 52 101 IV = 0 2 0 0.00499999989 0.00499999989 CV = 0 2 0 0.005 0.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 55 TYPE = 2:REACTION,2 NAME = Conversion~2 LABEL = POS = 221,663,231,673 ICON = FLAGS = 0 VIEW = 4 IN = 73 OUT = 102 IV = 0 2 0 0 33 1 19 1 37 1 19 1 0 0 0 1 0 0 0 1 CV = 0 2 0 0 33 1 19 1 37 1 19 1 0 0 0 1 0 0 0 1 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 53 Covnerts Acetic Acid and Furfura~ l to Diss Wood Solids OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 56 TYPE = 2:REACTION,2 NAME = Conversion~2 LABEL = POS = 240,663,250,673 ICON = FLAGS = 0 VIEW = 4 IN = 102 OUT = 103 IV = 0 2 0 0 39 1 19 1 40 1 19 1 41 1 19 1 38 1 19 1 CV = 0 2 0 0 39 1 19 1 40 1 19 1 41 1 19 1 38 1 19 1 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 53 Covnerts Acetic Acid and Furfura~ l to Diss Wood Solids OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 60 TYPE = 1:CHARGE,6 NAME = Charge60 LABEL = POS = 109,811,119,821 ICON = FLAGS = 0 VIEW = 4 IN = 352 5 OUT = 106 IV = 0 7 0 0 0.180645168 129.032257 0.25 0.949999988 0.850000024 85 1 1.10000002 CV = 0 7 0 0 0.180645 129.032 0.25 0.95 0.85 85 2 1.1 LINKS = 0 UNITS = 2 50 66 -33 100 0 0 40 1 100 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 61 TYPE = 1:DILUTE,2 NAME = Dilute61 LABEL = POS = 109,833,119,843 ICON = FLAGS = 0 VIEW = 4 IN = 106 150 OUT = 112 344 IV = 0 2 0.219999999 CV = 0 2 0.22 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 62 TYPE = 1:MIX,1 NAME = Mix62 LABEL = POS = 362,399,372,409 ICON = FLAGS = 0 VIEW = 4 IN = 36 282 923 OUT = 92 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 63 TYPE = 1:STMIX,4 NAME = Stmix63 LABEL = POS = 109,855,119,865 ICON = FLAGS = 0 VIEW = 4 IN = 112 OUT = 113 IV = 0 4 0 0 160 8517.20996 CV = 0 4 0 0 160 8517.21 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 64 TYPE = 1:STMIX,4 NAME = Stmix64 LABEL = POS = 109,894,119,904 ICON = FLAGS = 0 VIEW = 4 IN = 114 OUT = 115 IV = 0 4 0 0 160 8517.20996 CV = 0 4 0 0 160 8517.21 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 65 TYPE = 1:FLASH,1 NAME = Flash65 LABEL = POS = 109,875,119,885 ICON = FLAGS = 0 VIEW = 4 IN = 113 OUT = 114 121 IV = 0 0 2877 0 0 0 19.0009995 CV = 0 0 2877 0 0 0 19.001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 66 TYPE = 2:REACTION,2 NAME = Reaction234~2 LABEL = POS = 109,934,119,944 ICON = FLAGS = 0 VIEW = 4 IN = 110 OUT = 111 IV = 0 2 0 0 5 0.330500007 19 1 6 0.0428000018 19 1 7 0.796299994 19 1 8 0.281500012 19 1 CV = 0 2 0 0 5 0.3305 19 1 6 0.0428 19 1 7 0.7963 19 1 8 0.2815 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 70 TYPE = 1:REACT,1 NAME = React6~2 LABEL = POS = 109,952,119,962 ICON = FLAGS = 0 VIEW = 4 IN = 111 OUT = 116 IV = 0 0 0 0 12 CV = 0 0 0 0 12 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 71 TYPE = 2:REACTION,2 NAME = Reaction5~2 LABEL = POS = 109,914,119,924 ICON = FLAGS = 0 VIEW = 4 IN = 115 OUT = 110 IV = 0 2 0 0 21 0.200000003 19 1 9 1 19 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 21 0.2 19 1 9 1 19 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 72 TYPE = 1:FLASH,1 NAME = Flash72 LABEL = POS = 109,973,119,983 ICON = FLAGS = 0 VIEW = 4 IN = 116 OUT = 120 146 IV = 0 0 760 0 0 0 19.0100002 23.0400009 CV = 0 0 760 0 0 0 19.01 23.04 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 73 TYPE = 1:SPLIT,2 NAME = Split204~2 LABEL = Miscellaneous spills POS = 256,973,266,983 ICON = FLAGS = 256 VIEW = 4 IN = 122 OUT = 124 123 IV = 0 2 0 0.00499999989 0.00499999989 CV = 0 2 0 0.005 0.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 74 TYPE = 1:MIX,1 NAME = Mix62~2 LABEL = POS = 275,953,285,963 ICON = FLAGS = 0 VIEW = 4 IN = 126 254 283 925 OUT = 130 IV = 0 0 4 CV = 0 0 4 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 75 TYPE = 1:DILUTE,2 NAME = Dilute19~2 LABEL = POS = 215,973,225,983 ICON = FLAGS = 0 VIEW = 4 IN = 132 131 OUT = 134 133 IV = 0 2 0.0179999992 CV = 0 2 0.018 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 76 TYPE = 1:WASH,1 NAME = Wash18~2 LABEL = POS = 196,973,206,983 ICON = FLAGS = 0 VIEW = 4 IN = 135 134 OUT = 132 136 IV = 0 2 0.119999997 0 0 1 0 1 CV = 0 2 0.12 0 0 1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 77 TYPE = 1:CLF,1 NAME = Clf31 LABEL = Green Liquor Clarifier POS = 748,231,758,241 ICON = FLAGS = 256 VIEW = 4 IN = 172 OUT = 190 354 IV = 0 0 0.340000004 50 CV = 0 0 0.34 50 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 78 TYPE = 1:SDT,1 NAME = Sdt30 LABEL = Smelt Dissolving Tank POS = 721,230,731,240 ICON = FLAGS = 256 VIEW = 4 IN = 170 862 OUT = 168 172 IV = 0 415 CV = 0 415 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 79 TYPE = 1:MIX,1 NAME = Mix79 LABEL = POS = 660,230,670,240 ICON = FLAGS = 0 VIEW = 4 IN = 177 569 392 920 OUT = 169 IV = 0 0 4 CV = 0 0 4 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 80 TYPE = 1:WASH,1 NAME = Wash17~2 LABEL = POS = 177,973,187,983 ICON = FLAGS = 0 VIEW = 4 IN = 140 136 OUT = 135 141 IV = 0 2 0.119999997 0 0 1 0 1 CV = 0 2 0.12 0 0 1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 81 TYPE = 1:SPLIT,2 NAME = Split16~2 LABEL = POS = 158,973,168,983 ICON = FLAGS = 0 VIEW = 4 IN = 142 OUT = 140 143 IV = 0 2 CV = 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 82 TYPE = 1:DILUTE,2 NAME = Dilute15~2 LABEL = POS = 139,973,149,983 ICON = FLAGS = 0 VIEW = 4 IN = 141 120 OUT = 142 150 IV = 0 2 0.0450000018 CV = 0 2 0.045 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 83 TYPE = 1:WASH,1 NAME = Wash21~2 LABEL = Decker POS = 275,973,285,983 ICON = FLAGS = 256 VIEW = 4 IN = 124 130 OUT = 131 144 IV = 0 2 0.119999997 0 0 1 5 1 5 CV = 0 2 0.12 0 0 1 5 1 5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 84 TYPE = 1:SPLIT,2 NAME = Split20~2 LABEL = Screening POS = 237,973,247,983 ICON = FLAGS = 256 VIEW = 4 IN = 133 OUT = 122 145 IV = 0 2 CV = 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = A ADDIN = [BLOCK] NUM = 85 TYPE = 1:STORE,1 NAME = Store201~2 LABEL = POS = 252,944,262,954 ICON = FLAGS = 256 VIEW = 8 IN = OUT = IV = 0 0 0 1.29999995 CV = 0 0 0 1.3 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 168 P1 & P2 = TSS brown pulp\nP3 = t~ sesq/t ClO2\nP4 = Sesq to sulfa~ te factor\nP5 = t ClO2 generated~ \nP6 = t sesq produced\nP7 = t s~ ulfate produced\n\n\nP5 = t ClO2~ /hr used OPT = CP CmpPs Num = 4 PSpec = 5 Frm = b201:3*b201:5 PSpec = 6 Frm = b201:4*b201:5 PSpec = 3 Frm = b201:3/262*142*2 PSpec = 0 Frm = s144:TSuspSol A ADDIN = [BLOCK] NUM = 86 TYPE = 1:STORE,1 NAME = Store230 LABEL = Production values POS = 832,1298,842,1308 ICON = FLAGS = 256 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 175 P1=Total production off #1, t/yr~ \nP2=Total production off #2, t/~ yr\nP3=Total product, t/yr\nP3=T~ otal pulp off #1, t/yr\nP5=Total~ pulp off #2, t/yr\nP6=Total pul~ p product, t/yr OPT = CP CmpPs Num = 6 PSpec = 2 Frm = b86:1+b86:2 PSpec = 1 Frm = s347:1*(1+s347:2)*8400 PSpec = 4 Frm = s347:TSuspSol*s347:Pulp*8400 PSpec = 0 Frm = s422:1*(1+s422:2)*8400 PSpec = 3 Frm = s422:TSuspSol*s422:Pulp*8400 PSpec = 5 Frm = b86:4+b86:5 A ADDIN = [BLOCK] NUM = 87 TYPE = 1:EVAPS,1 NAME = Evaps25 LABEL = MEE-post skimming POS = 600,230,610,240 ICON = FLAGS = 256 VIEW = 4 IN = 176 OUT = 180 178 IV = 0 1 0.550000012 85 82.2222214 CV = 0 1 0.55 85 82.2222 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 88 TYPE = 1:EVAPS,1 NAME = Evaps24 LABEL = MEE- pre skimmong POS = 561,230,571,240 ICON = FLAGS = 256 VIEW = 4 IN = 556 OUT = 179 138 IV = 0 1 0.270000011 40 95 0 23.0009995 19.0009995 CV = 0 1 0.27 40 95 0 23.001 19.001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 90 TYPE = 1:GREC,1 NAME = Grec86 LABEL = POS = 699,189,709,199 ICON = FLAGS = 0 VIEW = 4 IN = 174 OUT = 175 177 IV = 0 0.99000001 0.99000001 0.99000001 CV = 0 0.99 0.99 0.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 91 TYPE = 1:SPLIT,2 NAME = Stmix27 LABEL = Soap Removal POS = 580,230,590,240 ICON = FLAGS = 256 VIEW = 4 IN = 179 OUT = 176 253 IV = 0 2 0 0 0 1 CV = 0 2 0 0 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 92 TYPE = 1:KFURN,1 NAME = Kfurn84 LABEL = RB #6 POS = 699,230,709,240 ICON = FLAGS = 256 VIEW = 4 IN = 292 293 571 OUT = 170 173 IV = 0 0.200000003 0.0599999987 1 4.5 -1.10699999 0.949999988 0 800 315.556 0 0 0 0.529999971 0.0599999987 / IV = 0.409999996 1 0 0 0 1 CV = 0 0.2 0.06 1 4.5 -1.107 0.95 3224.66 800 315.556 95280.7 0 0 0.53 0.06 0.41 1 0011 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 93 TYPE = 1:MIX,1 NAME = Mix290~1 LABEL = POS = 582,88,592,98 ICON = FLAGS = 0 VIEW = 4 IN = 164 104 OUT = 165 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 94 TYPE = 1:STORE,1 NAME = Store30~1 LABEL = Calc TTA POS = 937,168,947,178 ICON = FLAGS = 256 VIEW = 8 IN = OUT = IV = CV = LINKS = 6 70 GET 4 0 0 2 7 12 161 23 60 GET 4 0 0 2 7 12 161 18 50 GET 4 0 0 2 7 12 161 24 40 GET 4 0 0 2 7 12 161 15 30 GET 4 0 0 2 7 12 161 25 10 GET 4 1 0 1 3100 2 7 12 UNITS = 0 COMMENT = 1 LEN = 8 TTA calc OPT = CP CmpPs Num = 5 PSpec = 8 Frm = b94:8*62/1000 PSpec = 7 Frm = b94:3+b94:4+b94:6 PSpec = 1 01 01 01 01 01 161 0.0217391 0.0588235 0.0104167 0.0166667 0.030303 84 0 1 1 Frm = PSpec Frm = PSpec Frm = ADDIN = A B94:3/B94:8 = 10 (2*s190:HS *0.03024)/(s190:HS *0.03024 + s190:OH *0.058798) =9 b94:9*S161:1/(s5:49) [BLOCK] NUM = 95 TYPE = 1:MIX,1 NAME = Mix95 LABEL = Cons. Reg at Mud Tank POS = 859,332,869,342 ICON = FLAGS = 256 VIEW = 4 IN = 191 230 OUT = 201 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 96 TYPE = 1:MIX,1 NAME = Mix53~1 LABEL = POS = 955,194,965,204 ICON = FLAGS = 0 VIEW = 4 IN = 182 345 OUT = 352 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 97 TYPE = 2:REACTION,2 NAME = React14~3 LABEL = D2 POS = 320,1384,330,1394 ICON = FLAGS = 256 VIEW = 4 IN = 815 OUT = 149 IV = 0 2 0 1 5 1 19 1 9 1 19 1 19 0.00100000005 6 1 1 0 1 1 CV = 0 2 0 1 5 1 19 1 9 1 19 1 19 0.001 6 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 98 TYPE = 1:DILUTE,2 NAME = Dilute15~5 LABEL = D2 POS = 337,1345,347,1355 ICON = FLAGS = 256 VIEW = 4 IN = 149 128 OUT = 785 813 IV = 0 2 0.0160000008 1 CV = 0 2 0.016 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 100 TYPE = 1:SPLIT,1 NAME = Split289~1 LABEL = POS = 582,69,592,79 ICON = FLAGS = 0 VIEW = 4 IN = 166 OUT = 164 185 IV = 0 1 0 0 0 1 30.8850002 19.7000008 CV = 0 1 0 0 0 1 30.885 19.7 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 101 TYPE = 1:REACT,1 NAME = React76~2 LABEL = POS = 621,50,631,60 ICON = FLAGS = 0 VIEW = 4 IN = 192 OUT = 390 IV = 0 0 0 1 0 0 0 22 23.2909107 19 30 CV = 0 0 0 1 0 0 0 22 23.2909 19 30 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 102 TYPE = 1:MIX,1 NAME = Mix74 LABEL = POS = 666,49,676,59 ICON = FLAGS = 0 VIEW = 4 IN = 194 291 394 921 OUT = 154 IV = 0 0 4 1 CV = 0 0 4 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 103 TYPE = 1:KFURN,1 NAME = Kfurn72 LABEL = RB #5 POS = 707,49,717,59 ICON = FLAGS = 256 VIEW = 4 IN = 196 195 567 OUT = 200 160 IV = 0 0.200000003 0.0599999987 1 4.5 -1.10699999 0.949999988 0 800 315.555542 0 0 0 0.529999971 0.0599999987 / IV = 0.409999996 1 0 0 0 1 CV = 0 0.2 0.06 1 4.5 -1.107 0.95 3224.66 800 315.556 55958.6 0 0 0.53 0.06 0.41 1 0011 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 104 TYPE = 1:EVAPS,1 NAME = Evaps71 LABEL = DCE POS = 644,49,654,59 ICON = FLAGS = 256 VIEW = 4 IN = 390 OUT = 194 155 IV = 0 1 0.680000007 85 85 CV = 0 1 0.68 85 85 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 105 TYPE = 1:SDT,1 NAME = Sdt70 LABEL = POS = 727,49,737,59 ICON = FLAGS = 0 VIEW = 4 IN = 200 863 OUT = 181 202 IV = 0 320 CV = 0 320 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 106 TYPE = 1:CLF,1 NAME = Clf46 LABEL = POS = 762,49,772,59 ICON = FLAGS = 0 VIEW = 4 IN = 181 OUT = 204 203 IV = 0 0 0.340000004 100 CV = 0 0 0.34 100 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 110 TYPE = 1:MIX,1 NAME = Mix110 LABEL = POS = 771,231,781,241 ICON = FLAGS = 0 VIEW = 4 IN = 203 190 OUT = 13 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 111 TYPE = 1:STMIX,4 NAME = Stmix111 LABEL = POS = 958,267,968,277 ICON = FLAGS = 0 VIEW = 4 IN = 346 OUT = 350 IV = 0 4 0 0 85 760 CV = 0 4 0 0 85 760 0 0 0 -4.1911 -2259.47 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 112 TYPE = 1:GREC,2 NAME = Grec45 LABEL = POS = 699,211,709,221 ICON = FLAGS = 0 VIEW = 4 IN = 570 173 OUT = 167 174 IV = CV = 0 0 0 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 113 TYPE = 1:SPLIT,2 NAME = Split113 LABEL = HWD Debarking POS = 118,76,128,86 ICON = FLAGS = 256 VIEW = 4 IN = 219 OUT = 224 225 IV = 0 2 0 0.119999997 0.119999997 CV = 0 2 0 0.12 0.12 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 114 TYPE = 1:GREC,1 NAME = Grec44 LABEL = POS = 706,9,716,19 ICON = FLAGS = 0 VIEW = 4 IN = 565 OUT = 290 291 IV = 0 0.99000001 0.99000001 0.99000001 CV = 0 0.99 0.99 0.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 115 TYPE = 1:WASH,1 NAME = Wash115 LABEL = Mud Filter POS = 835,332,845,342 ICON = FLAGS = 256 VIEW = 4 IN = 201 231 OUT = 212 232 IV = 0 2 0.720000029 1 0 1 0 1 5 CV = 0 2 0.72 1 0 1 0 1 5 0.871592 4.34285 1.3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 116 TYPE = 1:LKILN,1 NAME = Lkiln116 LABEL = POS = 809,332,819,342 ICON = FLAGS = 0 VIEW = 4 IN = 212 864 865 866 OUT = 213 870 871 IV = 0 0.100000001 1232 149 0.119999997 0 0 85 0.0599999987 0.100000001 0.5 CV = 0 0.1 1232 149 0.12 0 0 85 0.06 0.1 0.5 1785.4 2100.47 1 1799.13 176.58 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 117 TYPE = 2:REACTION,2 NAME = React14 LABEL = POS = 207,1384,217,1394 ICON = FLAGS = 0 VIEW = 4 IN = 811 OUT = 812 IV = 0 2 0 1 5 0.150000006 19 1 9 0.200000003 19 1 1 0 1 1 1 0 1 1 CV = 0 2 0 1 5 0.15 19 1 9 0.2 19 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 118 TYPE = 1:STMIX,3 NAME = Stmix13 LABEL = POS = 207,1365,217,1375 ICON = FLAGS = 0 VIEW = 4 IN = 810 806 OUT = 811 IV = 0 3 0 1 82 3862.88989 CV = 0 3 0 1 82 3862.89 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 119 TYPE = 1:SPLIT,2 NAME = Split119 LABEL = SWD Debarking POS = 116,159,126,169 ICON = FLAGS = 256 VIEW = 4 IN = 222 OUT = 255 257 IV = 0 2 CV = 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 120 TYPE = 1:STMIX,4 NAME = Stmix120 LABEL = misc heat losses POS = 785,332,795,342 ICON = FLAGS = 256 VIEW = 4 IN = 213 OUT = 214 IV = 0 4 0 0 800 760 CV = 0 4 0 0 800 760 0 0 0 -2.85937 -1541.52 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 121 TYPE = 2:REACTION,2 NAME = Reaction121 LABEL = POS = 110,642,120,652 ICON = FLAGS = 0 VIEW = 4 IN = 65 OUT = 22 IV = 0 2 0 0 19 0 30 1 1 0 1 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 19 0 30 1 1 0 1 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = COMMENT = 0 [BLOCK] NUM = 122 TYPE = 1:SPLIT,1 NAME = Split37 LABEL = NCGs off Evaporators POS = 561,257,571,267 ICON = FLAGS = 256 VIEW = 4 IN = 138 OUT = 139 221 IV = 0 1 0 0 0 1 23.6000004 CV = 0 1 0 0 0 1 23.6 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 123 TYPE = 2:REACTION,2 NAME = Reaction123 LABEL = POS = 611,142,621,152 ICON = FLAGS = 0 VIEW = 4 IN = 56 OUT = 205 IV = 0 2 0 0 17 1 19 1 30 1 19 1 31 1 19 1 32 1 19 1 CV = 0 2 0 0 17 1 19 1 30 1 19 1 31 1 19 1 32 1 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 124 TYPE = 1:MIX,1 NAME = Mix65~2 LABEL = Chemical Add + Cons Ctrl POS = 318,721,328,731 ICON = FLAGS = 256 VIEW = 4 IN = 935 250 OUT = 216 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 125 TYPE = 2:REACTION,2 NAME = Reaction125 LABEL = POS = 631,142,641,152 ICON = FLAGS = 0 VIEW = 4 IN = 205 OUT = 206 IV = 0 2 0 0 34 1 19 1 36 1 19 1 38 1 19 1 40 1 19 1 CV = 0 2 0 0 34 1 19 1 36 1 19 1 38 1 19 1 40 1 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 126 TYPE = 1:CTRL,5 NAME = Ctrl126 LABEL = POS = 1028,266,1038,276 ICON = FLAGS = 0 VIEW = 4 IN = 884 804 OUT = 880 881 876 IV = 0 8 0.20645161 0.300000012 0 1 0 0 1 CV = 0 8 0.206452 0.3 0 1 0 0 1 LINKS = 0 UNITS = 1 20 1 100 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 127 TYPE = 2:REACTION,2 NAME = React4 LABEL = POS = 99,1377,109,1387 ICON = FLAGS = 0 VIEW = 4 IN = 248 OUT = 247 IV = 0 2 0 1 5 0.300000012 19 1 9 0.400000006 19 1 1 0 1 1 1 0 1 1 CV = 0 2 0 1 5 0.3 19 1 9 0.4 19 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 128 TYPE = 1:CHARGE,4 NAME = Charge3 LABEL = D0 ClO2 POS = 99,1345,109,1355 ICON = FLAGS = 256 VIEW = 4 IN = 792 249 OUT = 248 IV = 0 5 0 3 28.0219994 CV = 0 5 0 3 28.022 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 129 TYPE = 1:MIX,1 NAME = Mix129 LABEL = POS = 126,1391,136,1401 ICON = FLAGS = 0 VIEW = 4 IN = 239 790 OUT = 791 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 130 TYPE = 1:SPLIT,2 NAME = Split130 LABEL = POS = 953,317,963,327 ICON = FLAGS = 0 VIEW = 4 IN = 881 OUT = 882 883 IV = 0 2 CV = 0 2 0 0.63 0.63 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 2 PSpec = 1 Frm = b226:3 PSpec = 2 Frm = b130:3 A ADDIN = [BLOCK] NUM = 131 TYPE = 1:SPLIT,2 NAME = Split131 LABEL = HWD Chip Screen POS = 139,76,149,86 ICON = FLAGS = 256 VIEW = 4 IN = 225 OUT = 233 1 IV = 0 2 0 0.0299999993 0.0299999993 CV = 0 2 0 0.03 0.03 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 132 TYPE = 1:FLASH,1 NAME = Flash132 LABEL = POS = 182,360,192,370 ICON = FLAGS = 0 VIEW = 4 IN = 676 OUT = 156 171 IV = 0 0 760 0 0 0 19.0100002 23.0200005 CV = 0 0 760 0 0 0 19.01 23.02 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 133 TYPE = 1:SPLIT,1 NAME = Split37~1 LABEL = NCGs off Evaporators POS = 562,77,572,87 ICON = FLAGS = 256 VIEW = 4 IN = 193 OUT = 363 236 IV = 0 1 0 0 0 1 23.6000004 CV = 0 1 0 0 0 1 23.6 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 134 TYPE = 1:REACT,1 NAME = React76~1 LABEL = POS = 620,230,630,240 ICON = FLAGS = 0 VIEW = 4 IN = 178 OUT = 241 IV = 0 0 0 1 0 0 0 22 23.2909107 19 30 CV = 0 0 0 1 0 0 0 22 23.2909 19 30 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 135 TYPE = 2:REACTION,2 NAME = Reaction60~2 LABEL = O2 delig POS = 342,721,352,731 ICON = FLAGS = 256 VIEW = 4 IN = 216 OUT = 223 IV = 0 2 0 0 5 0.289999992 19 1 6 0.0120000001 19 1 7 0.0280000009 19 1 8 0.0130000003 19 1 CV = 0 2 0 0 5 0.866763 19 1 6 0.00407523 19 1 7 0.00407523 19 1 8 0.00407523 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 4 PSpec = 9 Frm = if(b526:4=0,0,b526:4) PSpec = 14 Frm = PSpec Frm = PSpec Frm = ADDIN = A if(b526:5=0,0,b526:5) = 19 if(b526:5=0,0,b526:5) = 24 if(b526:5=0,0,b526:5) C COMMENT = 0 [BLOCK] NUM = 136 TYPE = 1:WASH,1 NAME = Split73~2 LABEL = Post-O2 Press POS = 367,721,377,731 ICON = FLAGS = 256 VIEW = 4 IN = 223 51 OUT = 226 242 IV = 0 3.5 0.25 0 0 1 5 1 5 CV = 0 3.5 0.25 0 0 1 5 1 5 0.927967 2 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 137 TYPE = 1:SPLIT,2 NAME = Split137 LABEL = SWD Chip Screen POS = 137,159,147,169 ICON = FLAGS = 256 VIEW = 4 IN = 257 OUT = 258 336 IV = 0 2 0 0.0299999993 0.0299999993 CV = 0 2 0 0.03 0.03 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 138 TYPE = 1:WASH,1 NAME = Wash11~1 LABEL = POS = 291,1163,301,1173 ICON = FLAGS = 0 VIEW = 4 IN = 713 714 OUT = 715 712 IV = 0 2 0.111599997 0 0 1 0 1 CV = 0 2 0.1116 0 0 1 0 1 0 0.578261 1.18843 1.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 139 TYPE = 1:DILUTE,2 NAME = Dilute10~2 LABEL = POS = 272,1163,282,1173 ICON = FLAGS = 0 VIEW = 4 IN = 711 712 OUT = 713 696 IV = 0 2 0.0160000008 CV = 0 2 0.016 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 140 TYPE = 1:MIX,1 NAME = Mix65~3 LABEL = Chemical Add + Cons Ctrl POS = 296,973,306,983 ICON = FLAGS = 256 VIEW = 4 IN = 244 243 144 OUT = 246 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 141 TYPE = 2:REACTION,2 NAME = Reaction60~3 LABEL = O2 delig POS = 320,973,330,983 ICON = FLAGS = 256 VIEW = 4 IN = 246 OUT = 251 IV = 0 2 0 0 5 0.289999992 19 1 6 0.0120000001 19 1 7 0.0219999999 19 1 8 0.0130000003 19 1 CV = 0 2 0 0 5 0.29 19 1 6 0.012 19 1 7 0.022 19 1 8 0.013 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 142 TYPE = 1:SPLIT,3 NAME = Split73~3 LABEL = Post-O2 Press POS = 345,973,355,983 ICON = FLAGS = 256 VIEW = 4 IN = 251 OUT = 256 254 IV = 0 3 0.119999997 0 1 CV = 0 3 0.12 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 143 TYPE = 1:WASH,1 NAME = Split73~1 LABEL = Post-O2 Wash Press POS = 362,418,372,428 ICON = FLAGS = 256 VIEW = 4 IN = 96 92 OUT = 125 252 IV = 0 3.5 0.25 0 0 1 5 1 5 CV = 0 3.5 0.25 0 0 1 5 1 5 0.927967 2 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 144 TYPE = 2:REACTION,2 NAME = Reaction60~1 LABEL = O2 delig POS = 337,418,347,428 ICON = FLAGS = 256 VIEW = 4 IN = 943 OUT = 96 IV = 0 2 0 0 5 0.289999992 19 1 6 0.0120000001 19 1 7 0.0219999999 19 1 8 0.0130000003 19 1 CV = 0 2 0 0 5 0.86715 19 1 6 0.00407519 19 1 7 0.00407519 19 1 8 0.00407519 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 4 PSpec = 14 Frm = if(b220:5=0,0,b220:5) PSpec = 9 Frm = if(b220:4=0,0,b220:4) PSpec = 24 Frm = if(b220:5=0,0,b220:5) PSpec = 19 Frm = if(b220:5=0,0,b220:5) A ADDIN = C COMMENT = 0 [BLOCK] NUM = 145 TYPE = 1:MIX,1 NAME = Mix65~1 LABEL = Chemical Add + Cons Ctrl POS = 313,418,323,428 ICON = FLAGS = 256 VIEW = 4 IN = 934 245 OUT = 943 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 146 TYPE = 1:SPLIT,3 NAME = Split92 LABEL = POS = 683,893,693,903 ICON = FLAGS = 0 VIEW = 4 IN = 266 OUT = 271 270 IV = 0 3 0.5 0 1 0 31.0000992 34.0000992 CV = 0 3 0.5 0 1 0 31.0001 34.0001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 147 TYPE = 1:MIX,1 NAME = Mix2~3 LABEL = POS = 220,1254,230,1264 ICON = FLAGS = 0 VIEW = 4 IN = 696 287 OUT = 288 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 148 TYPE = 1:DILUTE,2 NAME = Dilute148 LABEL = Hi-D POS = 175,1163,185,1173 ICON = FLAGS = 256 VIEW = 4 IN = 693 125 OUT = 694 287 IV = 0 2 0.0350000001 CV = 0 2 0.035 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 150 TYPE = 1:MIX,1 NAME = Mix91 LABEL = POS = 711,935,721,945 ICON = FLAGS = 0 VIEW = 4 IN = 271 263 OUT = 652 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 151 TYPE = 1:MIX,1 NAME = Mix90 LABEL = POS = 683,914,693,924 ICON = FLAGS = 0 VIEW = 4 IN = 685 272 OUT = 266 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 152 TYPE = 1:SPLIT,3 NAME = Split62 LABEL = POS = 597,956,607,966 ICON = FLAGS = 0 VIEW = 4 IN = 273 OUT = 661 274 IV = 0 3 0.25 0 1 0 38.75 CV = 0 3 0.25 0 1 0 38.75 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 153 TYPE = 1:DILUTE,2 NAME = Dilute61 LABEL = POS = 577,956,587,966 ICON = FLAGS = 0 VIEW = 4 IN = 262 274 OUT = 273 281 IV = 0 2 0.0500000007 CV = 0 2 0.05 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 154 TYPE = 1:STORE,1 NAME = Store56 LABEL = POS = 591,894,601,904 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 4 PSpec = 2 Frm = b56:1/b56:2 PSpec = 0 Frm = s661:38*s661:1/1000 PSpec = 1 Frm = s661:6*s661:49 PSpec = 3 Frm = s661:49/(s661:49+s661:1) A ADDIN = [BLOCK] NUM = 155 TYPE = 1:HEATX,1 NAME = Heatx405~1 LABEL = POS = 735,966,745,976 ICON = FLAGS = 0 VIEW = 4 IN = 592 652 OUT = 260 265 IV = 0 1 0.100000001 1200 500 CV = 0 1 0.1 1200 500 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 156 TYPE = 1:MIX,1 NAME = Mix156 LABEL = POS = 768,966,778,976 ICON = FLAGS = 0 VIEW = 4 IN = 260 342 OUT = 276 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 159 TYPE = 1:SPLIT,2 NAME = Split22~1 LABEL = POS = 620,1274,630,1284 ICON = FLAGS = 0 VIEW = 4 IN = 674 OUT = 675 630 IV = 0 2 0 0.989000022 0.99000001 CV = 0 2 0 0.989 0.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 160 TYPE = 1:MIX,1 NAME = Mix160 LABEL = POS = 500,935,510,945 ICON = FLAGS = 0 VIEW = 4 IN = 840 841 OUT = 280 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 161 TYPE = 1:SPLIT,2 NAME = Split161 LABEL = POS = 539,962,549,972 ICON = FLAGS = 0 VIEW = 8 IN = 281 OUT = 282 283 IV = 0 2 CV = 0 2 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 105 Compute is to split filtrate to ~ BS washers according to how much~ pulp is coming from either batc~ hes or K1 OPT = CP CmpPs Num = 2 PSpec = 2 Frm = if((s125:tsuspsol + s256:tsuspsol )=0,0,s125:tsuspsol /(s125:tsuspsol + s256:tsuspsol )) PSpec = 1 Frm = if((s125:tsuspsol + s256:tsuspsol )=0,0,s125:tsuspsol /(s125:tsuspsol + s256:tsuspsol )) A ADDIN = [BLOCK] NUM = 162 TYPE = 2:REACTION,2 NAME = Conversion~3 LABEL = POS = 182,833,192,843 ICON = FLAGS = 0 VIEW = 4 IN = 343 OUT = 152 IV = 0 2 0 0 39 1 19 1 40 1 19 1 41 1 19 1 38 1 19 1 CV = 0 2 0 0 39 1 19 1 40 1 19 1 41 1 19 1 38 1 19 1 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 53 Covnerts Acetic Acid and Furfura~ l to Diss Wood Solids OPT = ADDIN = C COMMENT = 0 A [BLOCK] NUM = 163 TYPE = 1:HEATX,1 NAME = Heatx405~2 LABEL = POS = 744,760,754,770 ICON = FLAGS = 0 VIEW = 4 IN = 285 284 OUT = 286 342 IV = 0 1 0.100000001 1200 500 CV = 0 1 0.1 1200 500 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 164 TYPE = 1:STORE,1 NAME = Store56~1 LABEL = POS = 600,688,610,698 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 4 PSpec = 2 Frm = b56:1/b56:2 PSpec = 0 Frm = s661:38*s661:1/1000 PSpec = 1 Frm = s661:6*s661:49 PSpec = 3 Frm = s661:49/(s661:49+s661:1) A ADDIN = [BLOCK] NUM = 165 TYPE = 1:DILUTE,2 NAME = Dilute61~1 LABEL = POS = 586,750,596,760 ICON = FLAGS = 0 VIEW = 4 IN = 295 294 OUT = 296 275 IV = 0 2 0.0500000007 CV = 0 2 0.05 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 166 TYPE = 1:SPLIT,3 NAME = Split62~1 LABEL = POS = 606,750,616,760 ICON = FLAGS = 0 VIEW = 4 IN = 296 OUT = 300 294 IV = 0 3 0.25 0 1 0 38.75 CV = 0 3 0.25 0 1 0 38.75 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 167 TYPE = 1:SPLIT,2 NAME = Split167 LABEL = Trays POS = 682,1255,692,1265 ICON = FLAGS = 256 VIEW = 4 IN = 327 OUT = 660 656 IV = 0 2 0 0.25999999 0 0 4.73999977 10.5 16.5 CV = 0 2 0 0.26 0 0 4.74 10.5 16.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 168 TYPE = 1:MIX,1 NAME = Mix168 LABEL = POS = 662,1255,672,1265 ICON = FLAGS = 0 VIEW = 4 IN = 329 328 OUT = 327 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 169 TYPE = 1:SPLIT,2 NAME = Split169 LABEL = POS = 642,1255,652,1265 ICON = FLAGS = 0 VIEW = 4 IN = 640 OUT = 329 655 IV = 0 2 0 0.976000011 0.930000007 CV = 0 2 0 0.976 0.93 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 170 TYPE = 1:MIX,1 NAME = Mix90~1 LABEL = POS = 692,708,702,718 ICON = FLAGS = 0 VIEW = 4 IN = 302 301 OUT = 303 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 171 TYPE = 1:MIX,1 NAME = Mix91~1 LABEL = POS = 720,729,730,739 ICON = FLAGS = 0 VIEW = 4 IN = 305 304 OUT = 284 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 172 TYPE = 1:SPLIT,3 NAME = Split92~1 LABEL = POS = 692,687,702,697 ICON = FLAGS = 0 VIEW = 4 IN = 303 OUT = 305 306 IV = 0 3 0.5 0 1 0 31.0000992 34.0000992 CV = 0 3 0.5 0 1 0 31.0001 34.0001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 173 TYPE = 2:REACTION,2 NAME = Reaction6~2 LABEL = Pentose Hydrolysis POS = 654,729,664,739 ICON = FLAGS = 256 VIEW = 4 IN = 310 OUT = 311 IV = 0 2 0 0 8 0.926999986 34 1.13636363 8 0.0399999991 36 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 8 0.927 34 1.13636 8 0.04 36 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 174 TYPE = 1:SPLIT,2 NAME = Split30~1 LABEL = Neutralization by H2SO4 POS = 548,729,558,739 ICON = FLAGS = 256 VIEW = 4 IN = 312 OUT = 314 313 IV = 0 2 0 0 0 1 21.9999008 CV = 0 2 0 0 0 1 21.9999 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 175 TYPE = 1:MIX,1 NAME = Mix31~1 LABEL = Consistency control POS = 567,729,577,739 ICON = FLAGS = 256 VIEW = 4 IN = 313 315 OUT = 316 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 176 TYPE = 2:REACTION,3 NAME = Reaction13~4 LABEL = Fermentator Ethanol from xyl POS = 658,795,668,805 ICON = FLAGS = 256 VIEW = 4 IN = 320 OUT = 321 IV = 0 3 34 0.800000012 1 3 34 150 0 1 0 0 0 0 5 46 44 5 41 46 0 1 0 1 CV = 0 3 34 0.8 1 3 34 150 0 0 0 0 0 0 5 46 44 5 41 46 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ShRef A ADDIN = C COMMENT = 0 [BLOCK] NUM = 177 TYPE = 1:MIX,1 NAME = Mix217~1 LABEL = POS = 750,1401,760,1411 ICON = FLAGS = 0 VIEW = 4 IN = 402 395 OUT = 594 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 178 TYPE = 1:SPLIT,2 NAME = Split178 LABEL = POS = 879,1460,889,1470 ICON = FLAGS = 0 VIEW = 4 IN = 593 OUT = 153 347 IV = 0 2 0 0.150000006 0.150000006 CV = 0 2 0 0.15 0.15 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 179 TYPE = 1:MIX,1 NAME = Mix179 LABEL = POS = 565,1460,575,1470 ICON = FLAGS = 0 VIEW = 4 IN = 581 349 348 OUT = 576 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 180 TYPE = 1:SPLIT,1 NAME = Split15~2 LABEL = Fermentator POS = 592,795,602,805 ICON = FLAGS = 256 VIEW = 4 IN = 322 OUT = 323 285 IV = 0 1 0 0 0 1 0 46 47 CV = 0 1 0 0 0 1 0 46 47 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = GL separation [BLOCK] NUM = 181 TYPE = 2:REACTION,3 NAME = Reaction13~4 LABEL = Fermentator Ethanol from glu POS = 711,795,721,805 ICON = FLAGS = 256 VIEW = 4 IN = 324 OUT = 325 IV = 0 3 31 0.899999976 1 1 31 180 0 1 0 0 0 0 2 46 44 2 41 46 0 1 0 1 CV = 0 3 31 0.9 1 1 31 180 0 0 0 0 0 0 2 46 44 2 41 46 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ShRef A ADDIN = C COMMENT = 0 [BLOCK] NUM = 182 TYPE = 1:MIX,1 NAME = Mix11~1 LABEL = Charge organism and POS = 711,774,721,784 ICON = FLAGS = 256 VIEW = 8 IN = 332 331 330 326 OUT = 324 IV = 0 0 4 1 CV = 0 0 4 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] nutritions NUM = 183 TYPE = 2:REACTION,2 NAME = Reaction13~4 LABEL = Fermentator Others from xyl POS = 638,795,648,805 ICON = FLAGS = 256 VIEW = 4 IN = 321 OUT = 333 IV = 0 2 0 0 34 0.200000003 18 1 34 0.075000003 33 1 34 0.0500000007 19 1 34 0.25 35 1.01333296 CV = 0 2 0 0 34 0.2 18 1 34 0.075 33 1 34 0.05 19 1 34 0.25 35 1.01333 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ShRef A ADDIN = C COMMENT = 0 [BLOCK] NUM = 184 TYPE = 1:STMIX,4 NAME = Heatd7~1 LABEL = Cellulase POS = 712,751,722,761 ICON = FLAGS = 1024 VIEW = 4 IN = 286 OUT = 330 IV = 0 4 0 0 41 760 CV = 0 4 0 0 41 760 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CLR CLR = 255 0 0 A ADDIN = adsorption [BLOCK] NUM = 185 TYPE = 2:REACTION,2 NAME = Reaction6~2 LABEL = Cellulose Hydrolysis POS = 629,729,639,739 ICON = FLAGS = 256 VIEW = 4 IN = 334 OUT = 310 IV = 0 2 0 0 6 0.926999986 31 1.11109996 6 0.0399999991 32 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 6 0.927 31 1.1111 6 0.04 32 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 186 TYPE = 2:REACTION,2 NAME = Reaction5~4 LABEL = Hexose Hydrolysis POS = 606,729,616,739 ICON = FLAGS = 256 VIEW = 4 IN = 300 OUT = 334 IV = 0 2 0 0 7 0.926999986 31 1.11110997 7 0.0399999991 32 1 0 0 0 1 0 1 0 1 CV = 0 2 0 0 7 0.927 31 1.11111 7 0.04 32 1 0 0 0 1 0 1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 187 TYPE = 1:MIX,1 NAME = Mix187 LABEL = POS = 545,1460,555,1470 ICON = FLAGS = 0 VIEW = 4 IN = 580 405 OUT = 581 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 188 TYPE = 1:MIX,1 NAME = Mix188 LABEL = POS = 584,1460,594,1470 ICON = FLAGS = 0 VIEW = 4 IN = 367 576 OUT = 368 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 189 TYPE = 1:SPLIT,2 NAME = Split189 LABEL = POS = 606,1460,616,1470 ICON = FLAGS = 0 VIEW = 4 IN = 368 OUT = 575 369 IV = 0 2 0 0.976000011 0.930000007 CV = 0 2 0 0.976 0.93 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 190 TYPE = 2:REACTION,2 NAME = Reaction13~4 LABEL = Fermentator Others from glu POS = 692,795,702,805 ICON = FLAGS = 256 VIEW = 4 IN = 325 OUT = 320 IV = 0 2 0 0 31 0.400000006 18 1 31 0.150000006 33 1 31 0.150000006 19 1 1 0 1 1 CV = 0 2 0 0 31 0.4 18 1 31 0.15 33 1 31 0.15 19 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ShRef A ADDIN = C COMMENT = 0 [BLOCK] NUM = 191 TYPE = 1:MIX,1 NAME = Mix370~1 LABEL = POS = 673,729,683,739 ICON = FLAGS = 0 VIEW = 4 IN = 311 335 OUT = 340 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 192 TYPE = 1:SPLIT,3 NAME = Split375~1 LABEL = POS = 692,729,702,739 ICON = FLAGS = 0 VIEW = 4 IN = 340 OUT = 302 304 IV = 0 3 0.699999988 0 0.899999976 CV = 0 3 0.7 0 0.9 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 193 TYPE = 1:STMIX,4 NAME = Stmix391~1 LABEL = POS = 529,729,539,739 ICON = FLAGS = 0 VIEW = 4 IN = 842 OUT = 312 IV = 0 4 0 0 55 760 CV = 0 4 0 0 55 760 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CLR CLR = 255 0 0 A ADDIN = [BLOCK] NUM = 194 TYPE = 1:MIX,1 NAME = Mix2~2 LABEL = Charge cellulase POS = 586,729,596,739 ICON = FLAGS = 256 VIEW = 8 IN = 341 316 OUT = 295 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 195 TYPE = 2:REACTION,2 NAME = Reaction63~1 LABEL = Fermentator Move to gas phase POS = 616,795,626,805 ICON = FLAGS = 256 VIEW = 4 IN = 333 OUT = 322 IV = 0 2 0 1 41 0.0199999996 47 1 0 1 0 1 1 0 1 1 1 0 1 1 CV = 0 2 0 1 41 0.02 47 1 0 1 0 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 196 TYPE = 2:REACTION,2 NAME = Conversion~3 LABEL = POS = 163,833,173,843 ICON = FLAGS = 0 VIEW = 4 IN = 344 OUT = 343 IV = 0 2 0 0 33 1 19 1 37 1 19 1 0 0 0 1 0 0 0 1 CV = 0 2 0 0 33 1 19 1 37 1 19 1 0 0 0 1 0 0 0 1 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 53 Covnerts Acetic Acid and Furfura~ l to Diss Wood Solids OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 197 TYPE = 1:EVAPS,2 NAME = Evaps197 LABEL = Pre-size dryer POS = 802,1460,812,1470 ICON = FLAGS = 256 VIEW = 4 IN = 543 OUT = 357 544 IV = 0 2 0.99000001 0 95 CV = 0 2 0.99 0 95 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 198 TYPE = 1:MIX,1 NAME = Mix198 LABEL = POS = 156,159,166,169 ICON = FLAGS = 0 VIEW = 4 IN = 336 381 OUT = 5 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 199 TYPE = 1:SPLIT,2 NAME = Split199 LABEL = POS = 137,129,147,139 ICON = FLAGS = 0 VIEW = 4 IN = 379 OUT = 380 381 IV = 0 2 0 0.0399999991 0.0399999991 CV = 0 2 0 0.04 0.04 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 200 TYPE = 1:SPLIT,2 NAME = Split200 LABEL = POS = 916,231,926,241 ICON = FLAGS = 0 VIEW = 4 IN = 855 OUT = 345 351 IV = 0 2 CV = 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 2 Frm = b200:3 A ADDIN = [BLOCK] NUM = 201 TYPE = 1:STORE,1 NAME = Store201 LABEL = POS = 242,389,252,399 ICON = FLAGS = 256 VIEW = 4 IN = OUT = IV = 0 0 0 1.29999995 CV = 0 0 0 1.3 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 168 P1 & P2 = TSS brown pulp\nP3 = t~ sesq/t ClO2\nP4 = Sesq to sulfa~ te factor\nP5 = t ClO2 generated~ \nP6 = t sesq produced\nP7 = t s~ ulfate produced\n\n\nP5 = t ClO2~ /hr used OPT = CP CmpPs Num = 4 PSpec = 0 Frm = s43:TSuspSol PSpec = 5 Frm = b201:3*b201:5 PSpec = 6 Frm = b201:4*b201:5 PSpec = 3 Frm = b201:3/262*142*2 A ADDIN = [BLOCK] NUM = 202 TYPE = 1:STORE,1 NAME = Store30~2 LABEL = Calc TTA POS = 959,224,969,234 ICON = FLAGS = 256 VIEW = 4 IN = OUT = IV = CV = LINKS = 6 70 GET 4 0 0 2 7 12 880 23 0 1 0.0217391 60 GET 4 0 0 2 7 12 880 18 0 1 0.0588235 50 GET 4 0 0 2 7 12 880 24 0 1 0.0104167 40 GET 4 0 0 2 7 12 880 15 0 1 0.0166667 30 GET 4 0 0 2 7 12 880 25 0 1 0.030303 10 GET 4 1 0 1 3100 2 7 12 880 84 0 1 1 UNITS = 0 COMMENT = 1 LEN = 8 TTA calc OPT = CP CmpPs Num = 6 PSpec = 1 Frm = B202:3/B202:8 PSpec = 7 Frm = b202:3+b202:4+b202:6 PSpec = 8 Frm = b202:8*62/1000 PSpec = 9 Frm = b202:9*S880:1/(s1:49) PSpec = 10 Frm = (2*s880:HS *0.03024)/(s880:HS *0.03024 + s880:OH *0.058798) PSpec = 14 Frm = s880:TTA *s880:1 / s880:density /1000 /s364:tsuspsol A ADDIN = [BLOCK] NUM = 203 TYPE = 1:SPLIT,2 NAME = GL split~1 LABEL = POS = 1058,266,1068,276 ICON = FLAGS = 0 VIEW = 4 IN = 880 OUT = 353 161 IV = 0 2 CV = 0 2 0 0.5 0.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = PSpec Frm = PSpec Frm = ADDIN = A 2 =1 b1:3 =2 b1:4 [BLOCK] NUM = 204 TYPE = 1:SPLIT,2 NAME = Split204 LABEL = Miscellaneous spills POS = 246,418,256,428 ICON = FLAGS = 256 VIEW = 4 IN = 37 OUT = 387 388 IV = 0 2 0 0.00499999989 0.00499999989 CV = 0 2 0 0.005 0.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 205 TYPE = 1:MIX,1 NAME = Mix53~2 LABEL = POS = 936,267,946,277 ICON = FLAGS = 0 VIEW = 4 IN = 351 876 OUT = 346 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 206 TYPE = 1:GREC,2 NAME = Grec206 LABEL = kiln gas scrubber POS = 817,303,827,313 ICON = FLAGS = 256 VIEW = 4 IN = 870 184 OUT = 872 873 IV = 0 0.99000001 0.949999988 0.949999988 0.699999988 CV = 0 0.99 0.95 0.95 0.7 0 0 0 0 0 8 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 207 TYPE = 1:CHARGE,1 NAME = Charge207 LABEL = Hwd EOP Oxygen POS = 256,1201,266,1211 ICON = FLAGS = 256 VIEW = 4 IN = 683 682 OUT = 684 IV = 0 1 0 0 7 CV = 0 1 0 0 7 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 208 TYPE = 1:CHARGE,4 NAME = Charge208 LABEL = Swd EOP H2O2 POS = 153,1364,163,1374 ICON = FLAGS = 256 VIEW = 4 IN = 776 775 OUT = 780 IV = 0 5 0 0 29.0049992 CV = 0 5 0 0 29.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 209 TYPE = 1:MIX,1 NAME = Mix209 LABEL = POS = 499,1308,509,1318 ICON = FLAGS = 0 VIEW = 4 IN = 834 835 836 OUT = 397 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 210 TYPE = 1:STORE,1 NAME = Store73 LABEL = POS = 526,506,536,516 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 3 PSpec = 2 Frm = if(b210:2=0,0,b210:1/b210:2) PSpec = 1 Frm = s365:Tsuspsol + s365:tds * s365:1/1000 PSpec = 0 Frm = s365:Lignin * s365:TSuspsol A ADDIN = [BLOCK] NUM = 211 TYPE = 1:MIX,1 NAME = Mix54~2 LABEL = POS = 526,540,536,550 ICON = FLAGS = 0 VIEW = 4 IN = 306 270 OUT = 365 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 212 TYPE = 1:COMB,1 NAME = Comb240~1 LABEL = hog fuel boiler (Lignin) POS = 562,492,572,502 ICON = FLAGS = 256 VIEW = 8 IN = 370 366 OUT = 373 372 371 IV = 0 1.10000002 0.5 0.150000006 0.592800021 0.0592800006 0.335920006 176.666672 5900 0 0 0.00100000005 0.00100000005 / IV = 35 0.0199999996 0.0109999999 CV = 0 1.1 0.5 0.15 0.5928 0.05928 0.33592 176.667 4200 0 0 0.001 0.001 35 0.02 0.011 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 23 Frm = b210:3*6100+((1-b210:3)*4200) A ADDIN = [BLOCK] NUM = 213 TYPE = 2:REACTION,2 NAME = Reaction35 LABEL = Lignin to Fuel Component POS = 517,476,527,486 ICON = FLAGS = 256 VIEW = 4 IN = 4 OUT = 355 IV = 0 2 0 0 4 1 19 1 1 0 1 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 4 1 19 1 1 0 1 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 214 TYPE = 1:STMIX,1 NAME = Stmix214 LABEL = POS = 70,245,80,255 ICON = FLAGS = 0 VIEW = 8 IN = 3 34 OUT = 360 IV = 0 1 2 CV = 0 1 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 215 TYPE = 2:REACTION,2 NAME = Reaction31 LABEL = Lignin to Fuel Component POS = 556,539,566,549 ICON = FLAGS = 256 VIEW = 4 IN = 365 OUT = 366 IV = 0 2 0 0 5 1 19 1 7 1 19 1 8 1 19 1 6 1 19 1 CV = 0 2 0 0 5 1 19 1 7 1 19 1 8 1 19 1 6 1 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 216 TYPE = 1:STMIX,1 NAME = Stmix216 LABEL = POS = 80,528,90,538 ICON = FLAGS = 0 VIEW = 4 IN = 74 2 OUT = 361 IV = 0 1 2 CV = 0 1 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 217 TYPE = 1:MIX,1 NAME = Mix217 LABEL = POS = 770,1196,780,1206 ICON = FLAGS = 0 VIEW = 4 IN = 420 415 OUT = 413 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 218 TYPE = 1:MIX,1 NAME = Mix218 LABEL = POS = 751,1196,761,1206 ICON = FLAGS = 0 VIEW = 4 IN = 412 413 OUT = 414 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 219 TYPE = 1:MIX,1 NAME = Mix219 LABEL = POS = 727,1235,737,1245 ICON = FLAGS = 0 VIEW = 4 IN = 411 406 OUT = 416 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 220 TYPE = 1:STORE,1 NAME = Store220 LABEL = POS = 312,462,322,472 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 111 1. yield loss odmt/hr\n2. frac t~ hat is lignin\n3. frac that is c~ arbs\n4. lignin yield loss\n5. c~ arbs yield loss OPT = CP CmpPs Num = 6 PSpec = 2 Frm = b220:1*0.2 PSpec = 1 Frm = b220:1*0.8 PSpec = 0 Frm = s245:tsuspsol * 0.02 PSpec = 3 Frm = b220:2/( s245:tsuspsol * s245:lignin ) PSpec = 4 Frm = b220:3/(s245:tsuspsol * (1-s245:lignin )) PSpec = 5 Frm = (s92:1-s125:1)/s125:tsuspsol A ADDIN = [BLOCK] NUM = 221 TYPE = 1:MIX,1 NAME = Mix221 LABEL = POS = 157,61,167,71 ICON = FLAGS = 0 VIEW = 4 IN = 1 374 OUT = 364 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 222 TYPE = 1:SPLIT,2 NAME = Split222 LABEL = POS = 137,102,147,112 ICON = FLAGS = 0 VIEW = 4 IN = 376 OUT = 374 375 IV = 0 2 0 0.0399999991 0.0399999991 CV = 0 2 0 0.04 0.04 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 223 TYPE = 1:SPLIT,2 NAME = Stmix27~1 LABEL = Soap Removal POS = 581,50,591,60 ICON = FLAGS = 256 VIEW = 4 IN = 382 OUT = 383 166 IV = 0 2 0 0 0 1 CV = 0 2 0 0 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 224 TYPE = 1:EVAPS,1 NAME = Evaps24~1 LABEL = MEE- pre skimmong POS = 562,50,572,60 ICON = FLAGS = 256 VIEW = 4 IN = 385 OUT = 382 193 IV = 0 1 0.270000011 40 95 0 23.0009995 19.0009995 CV = 0 1 0.27 40 95 0 23.001 19.001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 225 TYPE = 1:EVAPS,1 NAME = Evaps25~1 LABEL = MEE-post skimming POS = 601,50,611,60 ICON = FLAGS = 256 VIEW = 4 IN = 383 OUT = 384 192 IV = 0 1 0.550000012 85 82.2222214 CV = 0 1 0.55 85 82.2222 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 226 TYPE = 1:SPLIT,2 NAME = Split226 LABEL = POS = 525,144,535,154 ICON = FLAGS = 8192 VIEW = 4 IN = 386 OUT = 556 385 IV = 0 2 0 0.629999995 CV = 0 2 0 0.63 0.63 LINKS = 1 30 CTRL 17 0 2 7 3 283 100 0 1 1500 1 0.00053 0 1 3 0 0 0 0 0 0 1 0.8 1 0.63 0 1 15 1 1 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 2 Frm = b226:3 A ADDIN = [BLOCK] NUM = 227 TYPE = 1:SPLIT,2 NAME = Split31~2 LABEL = POS = 707,1420,717,1430 ICON = FLAGS = 0 VIEW = 4 IN = 432 OUT = 338 396 IV = 0 2 0 0.349999994 0.985000014 CV = 0 2 0 0.35 0.985 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 228 TYPE = 1:MIX,1 NAME = Mix228 LABEL = POS = 722,1485,732,1495 ICON = FLAGS = 0 VIEW = 4 IN = 418 377 433 OUT = 395 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 230 TYPE = 1:SPLIT,2 NAME = Split230 LABEL = POS = 653,142,663,152 ICON = FLAGS = 8192 VIEW = 4 IN = 206 OUT = 391 392 IV = 0 2 0 0.400000006 CV = 0 2 0 0.4 0.4 LINKS = 1 30 CTRL 17 0 2 7 12 571 89 0 1 1500 1 0.00085 0 1 15 0 0 0 0 0 0 1 0.45 1 0.4 0 1 1.5 1 1 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 2 Frm = b230:3 A ADDIN = [BLOCK] NUM = 231 TYPE = 1:SPLIT,2 NAME = Split231 LABEL = POS = 653,117,663,127 ICON = FLAGS = 8192 VIEW = 8 IN = 391 OUT = 393 394 IV = 0 2 0 0.25 CV = 0 2 0 0.25 0.25 LINKS = 1 30 CTRL 17 0 2 7 12 567 89 0 1 875 1 0.0015 0 1 20 0 0 0 0 0 0 1 0.3 1 0.25 0 1 0.875 1 1 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 2 Frm = b231:3 A ADDIN = [BLOCK] NUM = 232 TYPE = 1:STORE,1 NAME = Store232 LABEL = POS = 703,81,713,91 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 9 PSpec = 11 Frm = if(s206:totmass =0,0,s393:totmass / s206:totmass ) PSpec = 1 Frm = s394:totmass PSpec = 0 Frm = s194:totmass PSpec = 3 Frm = 1-b232:3 PSpec = 2 Frm = if(b232:1+b232:2=0,0,b232:1/(b232:1+b232:2)) PSpec = 9 Frm = s392:totmass / s206:totmass PSpec = 10 Frm = s394:totmass / s206:totmass PSpec = 4 Frm = if(2500*b232:3 + b232:4*b212:8>4400,4000,2500*b232:3 + b232:4*b212:8) PSpec = 14 Frm = s567:totmass *s567:tds /1000 A ADDIN = [BLOCK] NUM = 233 TYPE = 2:REACTION,2 NAME = Reaction233 LABEL = Move fiber components to pulp POS = 520,1308,530,1318 ICON = FLAGS = 256 VIEW = 4 IN = 397 OUT = 843 IV = 0 2 0 0 5 1 4 1 6 1 4 1 7 1 4 1 8 1 4 1 CV = 0 2 0 0 5 1 4 1 6 1 4 1 7 1 4 1 8 1 4 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 234 TYPE = 2:REACTION,2 NAME = Reaction234 LABEL = POS = 108,322,118,332 ICON = FLAGS = 0 VIEW = 4 IN = 9 OUT = 440 IV = 0 2 0 0 5 0.970000029 19 1 6 0.189999998 19 1 7 0.709999979 19 1 8 0.709999979 19 1 CV = 0 2 0 0 5 0.97 19 1 6 0.19 19 1 7 0.71 19 1 8 0.71 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 235 TYPE = 1:MIX,1 NAME = Mix235 LABEL = POS = 179,102,189,112 ICON = FLAGS = 0 VIEW = 4 IN = 233 224 380 258 255 456 375 OUT = 441 IV = 0 0 7 CV = 0 0 7 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 236 TYPE = 2:REACTION,2 NAME = Reaction236 LABEL = POS = 200,102,210,112 ICON = FLAGS = 0 VIEW = 4 IN = 441 OUT = 442 IV = 0 2 0 0 5 1 4 1 6 1 4 1 7 1 4 1 8 1 4 1 CV = 0 2 0 0 5 1 4 1 6 1 4 1 7 1 4 1 8 1 4 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 237 TYPE = 2:REACTION,2 NAME = Reaction237 LABEL = POS = 218,102,228,112 ICON = FLAGS = 0 VIEW = 4 IN = 442 OUT = 4 IV = 0 2 0 0 9 1 4 1 1 0 1 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 9 1 4 1 1 0 1 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 238 TYPE = 1:HREC,1 NAME = Hrec238 LABEL = RB #5 POS = 593,424,603,434 ICON = FLAGS = 256 VIEW = 8 IN = 444 OUT = 447 448 446 IV = 0 1 0 398.888885 33081.7188 0 30 0.0199999996 CV = 0 1 55958.6 398.889 33081.7 0 30 0.02 0 28 55958.6 LINKS = 0 UNITS = 2 30 40 0 0 0 0 40 53 0 0 0 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = b103:10 ADDIN = A [BLOCK] NUM = 239 TYPE = 1:HREC,1 NAME = Hrec239 LABEL = RB #6 POS = 593,447,603,457 ICON = FLAGS = 256 VIEW = 8 IN = 445 OUT = 449 450 451 IV = 0 1 0 468.333344 78332.125 0 30 0.0199999996 CV = 0 1 95280.7 468.333 78332.1 0 30 0.02 0 28 95280.7 LINKS = 0 UNITS = 2 30 40 0 0 0 0 40 53 0 0 0 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = b92:10 A ADDIN = [BLOCK] NUM = 240 TYPE = 1:COMB,1 NAME = Comb240 LABEL = hog fuel boiler POS = 583,479,593,489 ICON = FLAGS = 256 VIEW = 8 IN = 452 355 OUT = 453 454 455 IV = 0 1.10000002 0.5 0.150000006 0.514999986 0.0610000007 0.411000013 176.666672 4900 0 0 0.00100000005 0.00100000005 / IV = 35 0.0199999996 0.0109999999 CV = 0 1.1 0.5 0.15 0.515 0.061 0.411 176.667 4900 0.703408 49816 0.001 0.001 35 0.02 0.011 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 241 TYPE = 1:HREC,1 NAME = Hrec241 LABEL = bark and lignin steam POS = 629,481,639,491 ICON = FLAGS = 256 VIEW = 8 IN = 457 OUT = 458 459 460 IV = 0 1 0 398.888885 33081.7188 0 30 0.0199999996 CV = 0 1 49816 398.889 33081.7 0 30 0.02 0 28 49816 LINKS = 0 UNITS = 2 40 53 0 0 0 0 30 40 0 0 0 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = b240:10 +b232:12*b212:10 A ADDIN = [BLOCK] NUM = 242 TYPE = 1:HREC,1 NAME = Hrec242 LABEL = Coal steam POS = 631,515,641,525 ICON = FLAGS = 256 VIEW = 4 IN = 466 OUT = 468 469 467 IV = 0 1 0 398.888885 33081.7188 0 30 0.0199999996 CV = 0 1 85772 398.889 33081.7 0 30 0.02 0 28 85772 LINKS = 0 UNITS = 2 30 40 0 0 0 0 40 53 0 0 0 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = b243:10 A ADDIN = [BLOCK] NUM = 243 TYPE = 1:COMB,1 NAME = Comb243 LABEL = Combined power & swing hog POS = 583,515,593,525 ICON = FLAGS = 256 VIEW = 4 IN = 461 462 OUT = 463 464 465 IV = 0 1.20000005 0.0399999991 0.119999997 0.769999981 0.0599999987 0.0500000007 0.75 7700 0 0 0.0299999993 / IV = 0.0199999996 0 0.0199999996 0.0700000003 CV = 0 1.2 0.04 0.12 0.77 0.06 0.05 0.75 7700 421.165 85772 0.03 0.02 0 0.02 0.07 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 244 TYPE = 1:STMIX,2 NAME = Stmix244 LABEL = Combined steam generated POS = 686,441,696,451 ICON = FLAGS = 256 VIEW = 4 IN = 448 460 469 OUT = 470 IV = 0 2 3 CV = 0 2 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 245 TYPE = 1:SPLIT,12 NAME = Split245 LABEL = POS = 712,440,722,450 ICON = FLAGS = 0 VIEW = 4 IN = 470 OUT = 471 473 487 488 IV = 0 13 4 25 1.5 1.5 CV = 0 13 4 18.4404 1.04495 1.04495 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 3 PSpec = 2 Frm = .06*s470:1 PSpec = 3 Frm = .0034*s470:1 PSpec = 4 Frm = .0034*s470:1 A ADDIN = [BLOCK] NUM = 246 TYPE = 1:TURB,1 NAME = Turb246 LABEL = #1 POS = 719,476,729,486 ICON = FLAGS = 256 VIEW = 8 IN = 451 OUT = 474 IV = 0 1 8517.21289 0.699999988 CV = 0 1 8517.21 0.7 0 0 0 0 0 90.2861 13358.3 1 LINKS = 0 UNITS = 2 20 53 0 0 0 0 100 87 -11 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 247 TYPE = 1:TURB,1 NAME = Turb247 LABEL = #2 POS = 734,440,744,450 ICON = FLAGS = 256 VIEW = 8 IN = 471 OUT = 483 IV = 0 1 8517.21289 0.75 CV = 0 1 8517.21 0.75 0 0 0 0 0 61.0291 17503.7 1 LINKS = 0 UNITS = 2 100 87 -11 0 0 0 20 53 0 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 248 TYPE = 1:SPLIT,10 NAME = Split248 LABEL = #1 1st Extraction POS = 748,476,758,486 ICON = FLAGS = 256 VIEW = 8 IN = 474 OUT = 475 476 IV = 0 11 CV = 0 11 LINKS = 0 UNITS = 1 30 68 -11 0 0 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = if(s474:1-393000<0,0,s474:1-393000) A ADDIN = [BLOCK] NUM = 249 TYPE = 1:TURB,1 NAME = Turb249 LABEL = #1 POS = 768,476,778,486 ICON = FLAGS = 256 VIEW = 8 IN = 476 OUT = 477 IV = 0 1 3862.88525 0.699999988 CV = 0 1 3862.89 0.7 0 0 0 0 0 27.1449 4016.24 1 LINKS = 0 UNITS = 2 20 53 0 0 0 0 100 87 -11 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 250 TYPE = 1:DESUP,1 NAME = Desup250 LABEL = POS = 698,515,708,525 ICON = FLAGS = 0 VIEW = 4 IN = 486 480 OUT = 478 IV = 0 166.666672 CV = 0 166.667 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 251 TYPE = 1:SPLIT,12 NAME = Split251 LABEL = POS = 698,534,708,544 ICON = FLAGS = 0 VIEW = 4 IN = 478 OUT = 484 IV = 0 13 CV = 0 13 LINKS = 0 UNITS = 0 COMMENT = OPT = ADDIN = 485 489 501 502 5 0.949999988 0.949999988 2.29999995 1.79999995 5 0.95 0.95 2.3 1.8 0 [BLOCK] NUM = 252 TYPE = 1:TURB,1 NAME = Turb252 LABEL = #2 POS = 774,440,784,450 ICON = FLAGS = 256 VIEW = 8 IN = 481 OUT = 479 IV = 0 1 3862.88525 0.75 CV = 0 1 3862.89 0.75 0 0 0 0 0 30.3011 3236.54 1 LINKS = 0 UNITS = 2 20 53 0 0 0 0 100 87 -11 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 253 TYPE = 1:SPLIT,10 NAME = Split253 LABEL = #2 1st Extraction POS = 755,440,765,450 ICON = FLAGS = 256 VIEW = 4 IN = 483 OUT = 482 481 IV = 0 11 CV = 0 11 0 179.997 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = if(b255:6-s475:1<0,0,b255:6-s475:1) A ADDIN = [BLOCK] NUM = 254 TYPE = 1:PDROP,1 NAME = Pdrop254 LABEL = PRV to 400 psig POS = 698,496,708,506 ICON = FLAGS = 256 VIEW = 4 IN = 473 OUT = 486 IV = 0 11635.8193 CV = 0 11635.8 LINKS = 0 UNITS = 1 10 56 0 0 COMMENT = 0 OPT = ADDIN = 0 0 [BLOCK] NUM = 255 TYPE = 1:STORE,1 NAME = Store255 LABEL = POS = 758,390,768,400 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 753 P1=Steam for MEEs @ 5.3 econ\nP2~ =Steam in digesters\nP3=Steam in~ PM dryers @ 1.65 steam/H2O econ~ \nP4=Steam in bleaching\nP5=Stea~ m for GL heaters & Wire Pits & S~ BL heater\nP6=Total 160 psig ste~ am\nP7=Total 60 psig steam\nP8=P~ ower gen in #2 turb\nP9=Power ge~ n in #1 turb\nP10=Combined power~ gen per ton product\nP11=Power ~ gen in BFW pump turbs\nP12=Mcal/~ hr from all turbines\nP13=MW fro~ m all turbines\np14=MW Turbine #~ 1\nP15=MW Turbine #2\nP16=Natura~ l gas at Power boiler, GJ\nP17=N~ atural gas at Kilns, GJ\nP18=?\n~ P19=Steam for HW Prehydrolysis, ~ mt/hr 160 psig steam, add to P6\~ nP20=Steam for SW Prehydrolysis,~ mt/hr 160 psig steam, add to P6~ \nP21=Steam for Distillation, mt~ /hr 60 psig Steam from Store345:~ 3 (using 3.2 mt steam/mt EtOH pr~ oduced) add to P7 OPT = CP CmpPs Num = 24 PSpec = 0 Frm = (s193:1+s384:1+s138:1+s180:1)/5.3 PSpec = 12 Frm = (b247:10+b252:10+b260:10+b246:10+b249:10)/1000 PSpec = 14 Frm = (b247:10+b252:10+b260:10)*3969/1000000*.2903071 PSpec = 7 Frm = (b247:10+b252:10+b260:10)*8400 PSpec = 9 Frm = b255:8+b255:9+b255:11 PSpec = 13 Frm = (b246:10+b249:10)*3969/1000000*.2903071 PSpec = 15 Frm = s461:1*8400*13783.7*3969/1000000*1.05506 PSpec = 8 Frm = (b246:10+b249:10)*8400 PSpec = 11 Frm = (b246:10+b249:10+b247:10+b252:10+b260:10+b257:10+b258:10) PSpec = 10 Frm = (b257:10+b258:10)*8400 PSpec = 1 Frm = b255:39 + b255:38 PSpec = 3 Frm = b426:9+b341:9+b491:9+b474:9+b118:9+b484:9+b452:9+b456:9 PSpec = 4 Frm = b410:9+b303:9+b495:9 PSpec = 2 Frm = (s318:1+s443:1+s544:1+s590:1)*1.65 PSpec = 5 Frm = (b255:2+b255:3*.75)+b255:25 PSpec = 6 Frm = (b255:1+b255:4+b255:5) + .25*b255:3 + (s505:1 - s512:1) + b255:21+b255:25 PSpec = 17 Frm = b255:16+b255:17 PSpec = 20 Frm = b345:3 PSpec = 21 Frm = b255:3 - b255:20 PSpec = 19 Frm = (s318:1+s443:1+s544:1+s590:1)*.75*1.65 PSpec = 24 Frm = 0.065*(s448:1+s460:1+s469:1+s451:1)/2000/1.1 PSpec = 38 Frm = b3:9+b4:9+b30:9+b31:9+b63:9+b64:9 PSpec = 37 Frm = s561:1 + s568:1 PSpec = 39 Frm = s505:1 - s512:1 A ADDIN = [BLOCK] NUM = 256 TYPE = 1:PDROP,1 NAME = Pdrop256 LABEL = POS = 717,533,727,543 ICON = FLAGS = 0 VIEW = 4 IN = 489 OUT = 490 IV = 0 12928.6885 CV = 0 12928.7 LINKS = 0 UNITS = 1 10 56 0 0 COMMENT = 0 OPT = ADDIN = 0 0 [BLOCK] NUM = 257 TYPE = 1:TURB,1 NAME = Turb257 LABEL = BFW Pump turbine POS = 694,568,704,578 ICON = FLAGS = 256 VIEW = 8 IN = 484 OUT = 491 IV = 0 1 3862.88525 0.400000006 CV = 0 1 3862.89 0.4 0 0 0 0 0 39.6195 37.6385 1 LINKS = 0 UNITS = 1 100 87 -11 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 258 TYPE = 1:TURB,1 NAME = Turb258 LABEL = BFW Pump Turbine POS = 712,561,722,571 ICON = FLAGS = 256 VIEW = 8 IN = 485 OUT = 492 IV = 0 1 3862.88989 0.400000006 CV = 0 1 3862.89 0.4 0 0 0 0 0 39.6195 37.6385 1 LINKS = 0 UNITS = 1 100 87 -11 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 259 TYPE = 1:SPLIT,10 NAME = Split259 LABEL = #2 2nd Extraction POS = 794,440,804,450 ICON = FLAGS = 256 VIEW = 4 IN = 479 OUT = 494 495 IV = 0 11 CV = 0 11 0 9.38765 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = if((b255:7-s477:1/2000/1.1)<0,0,b255:7-s477:1/2000/1.1) A ADDIN = [BLOCK] NUM = 260 TYPE = 1:TURB,1 NAME = Turb260 LABEL = POS = 814,440,824,450 ICON = FLAGS = 0 VIEW = 8 IN = 495 OUT = 496 500 IV = 0 1 50.8021393 0.75 CV = 0 1 50.8021 0.75 0 0 0 0 0 118.171 11512.8 0.898573 LINKS = 0 UNITS = 2 20 53 0 0 0 0 100 87 -11 0 0 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 261 TYPE = 1:CND,1 NAME = Cnd261 LABEL = POS = 835,440,845,450 ICON = FLAGS = 0 VIEW = 4 IN = 496 498 OUT = 497 499 IV = 0 0 6.0999999 CV = 0 0 6.1 0 0 0 0 0 0 0 50412.6 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 262 TYPE = 1:STMIX,2 NAME = Stmix262 LABEL = Combined 160 psig POS = 743,533,753,543 ICON = FLAGS = 256 VIEW = 8 IN = 475 490 482 493 507 OUT = 504 IV = 0 2 5 CV = 0 2 5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 263 TYPE = 1:SPLIT,6 NAME = Split263 LABEL = Atomizing steam POS = 729,555,739,565 ICON = FLAGS = 256 VIEW = 4 IN = 502 OUT = 493 503 IV = 0 6 2 0.5 CV = 0 6 2 0.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 264 TYPE = 1:STMIX,2 NAME = Stmix264 LABEL = Combined 60 psig POS = 794,577,804,587 ICON = FLAGS = 256 VIEW = 4 IN = 503 492 491 494 477 509 OUT = 505 IV = 0 2 6 CV = 0 2 6 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 265 TYPE = 1:MIX,1 NAME = Mix265 LABEL = Combined Blowdown POS = 645,408,655,418 ICON = FLAGS = 256 VIEW = 4 IN = 447 450 459 467 OUT = 506 IV = 0 0 4 CV = 0 0 4 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 266 TYPE = 1:FLASH,1 NAME = Flash266 LABEL = BD 1st flash POS = 664,408,674,418 ICON = FLAGS = 256 VIEW = 4 IN = 506 OUT = 507 508 IV = 0 0 9034.36035 CV = 0 0 9034.36 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 267 TYPE = 1:SPLIT,12 NAME = Split267 LABEL = To 60 psig line POS = 764,533,774,543 ICON = FLAGS = 256 VIEW = 4 IN = 504 OUT = 509 IV = 0 13 CV = 0 13 LINKS = 0 UNITS = 0 COMMENT = OPT = ADDIN = 510 2 0.899999976 2 0.9 0 [BLOCK] NUM = 269 TYPE = 1:FLASH,1 NAME = Flash269 LABEL = BD 2nd flash POS = 688,593,698,603 ICON = FLAGS = 256 VIEW = 4 IN = 508 OUT = 529 530 IV = 0 0 3862.88525 CV = 0 0 3862.89 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 270 TYPE = 1:SPLIT,6 NAME = Split270 LABEL = 60% Cnd Return POS = 851,532,861,542 ICON = FLAGS = 256 VIEW = 8 IN = 519 OUT = 536 537 IV = 0 6 2 0.600000024 CV = 0 6 2 0.6 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 271 TYPE = 1:DESUP,1 NAME = Desup271 LABEL = 60 psig process uses POS = 832,577,842,587 ICON = FLAGS = 256 VIEW = 4 IN = 512 520 OUT = 518 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 272 TYPE = 1:MIX,1 NAME = Mix272 LABEL = Total Condensate return POS = 832,532,842,542 ICON = FLAGS = 256 VIEW = 4 IN = 515 516 517 OUT = 519 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 273 TYPE = 1:CND,1 NAME = Cnd273 LABEL = 60 psig process uses POS = 832,558,842,568 ICON = FLAGS = 256 VIEW = 4 IN = 518 531 OUT = 517 532 IV = 0 0 10 CV = 0 0 10 0 0 0 0 0 0 0 64440.7 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 274 TYPE = 1:STMIX,1 NAME = Stmix274 LABEL = Deaerator POS = 814,601,824,611 ICON = FLAGS = 256 VIEW = 4 IN = 530 523 OUT = 541 IV = 0 1 2 CV = 0 1 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 275 TYPE = 1:MIX,1 NAME = Mix275 LABEL = Total cond to BFW system POS = 855,601,865,611 ICON = FLAGS = 256 VIEW = 4 IN = 536 533 892 OUT = 526 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 276 TYPE = 1:SPLIT,7 NAME = Split276 LABEL = BFW header POS = 542,443,552,453 ICON = FLAGS = 256 VIEW = 8 IN = 525 OUT = 444 445 466 457 IV = 0 7 4 195.677002 195.677002 252.121002 CV = 0 7 4 91.6189 150.975 81.5617 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 3 PSpec = 4 Frm = 50+s458:1 PSpec = 2 Frm = 30+s446:1 PSpec = 3 Frm = 30+s449:1 ADDIN = [BLOCK] NUM = 277 TYPE = 1:PUMP,1 NAME = Pump277 LABEL = POS = 834,601,844,611 ICON = FLAGS = 0 VIEW = 4 IN = 526 OUT = 523 IV = 0 1 3309.74414 0.649999976 CV = 0 1 3309.74 0.65 0 0 0 0 0 100.095 64.2207 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 278 TYPE = 1:PUMP,1 NAME = Pump278 LABEL = POS = 854,440,864,450 ICON = FLAGS = 0 VIEW = 4 IN = 497 OUT = 533 IV = 0 1 1551.44263 0.649999976 CV = 0 1 1551.44 0.65 0 0 0 0 0 10.0482 6.44692 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 279 TYPE = 1:DESUP,1 NAME = Desup279 LABEL = 160 psig desuperheat POS = 785,533,795,543 ICON = FLAGS = 256 VIEW = 4 IN = 510 528 OUT = 527 IV = 0 10 CV = 0 10 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 280 TYPE = 1:CND,1 NAME = Cnd280 LABEL = 160 psig process uses POS = 804,533,814,543 ICON = FLAGS = 256 VIEW = 4 IN = 527 521 OUT = 515 522 IV = 0 0 20 CV = 0 0 20 0 0 0 0 0 0 0 94015.7 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 281 TYPE = 1:DESUP,1 NAME = Desup281 LABEL = 400 psig desuperheat POS = 773,551,783,561 ICON = FLAGS = 256 VIEW = 4 IN = 501 514 OUT = 513 IV = 0 10 CV = 0 10 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 282 TYPE = 1:CND,1 NAME = Cnd282 LABEL = 400 psig process uses POS = 804,551,814,561 ICON = FLAGS = 256 VIEW = 4 IN = 513 534 OUT = 516 535 IV = 0 0 50 CV = 0 0 50 0 0 0 0 0 0 0 6298.11 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 283 TYPE = 1:STORE,1 NAME = Store232~1 LABEL = POS = 691,259,701,269 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 6 PSpec = 9 Frm = s571:totmass *s571:tds /1000 PSpec = 2 Frm = if(b232:1+b232:2=0,0,b232:1/(b232:1+b232:2)) PSpec = 1 Frm = s392:totmass PSpec = 0 Frm = s569:totmass PSpec = 3 Frm = 1-b232:3 PSpec = 4 Frm = if(2500*b232:3 + b232:4*b212:8>4400,4000,2500*b232:3 + b232:4*b212:8) A ADDIN = [BLOCK] NUM = 284 TYPE = 1:HEATX,1 NAME = Heatx284 LABEL = POS = 716,598,726,608 ICON = FLAGS = 0 VIEW = 8 IN = 529 539 OUT = 540 525 IV = 0 1 0.00999999978 10 2442.8479 CV = 0 1 0.01 10 2442.85 0 0 0 0 0 58.5672 LINKS = 0 UNITS = 1 40 85 -25 -11 -41 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 285 TYPE = 1:STORE,1 NAME = Store300 LABEL = Ethanol properties POS = 880,942,890,952 ICON = FLAGS = 256 VIEW = 4 IN = OUT = IV = 0 2.42304301 1.42304301 838.260925 CV = 0 2.42304 1.42304 838.261 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 77 1. Cp(liquid) MJ/K mt\n2. Cp(gas~ ) MJ/K mt\n3. Evaporation enthal~ py @78C MJ/mt OPT = CLR CLR = 255 255 0 A ADDIN = [BLOCK] NUM = 286 TYPE = 1:SPLIT,3 NAME = Split30~2 LABEL = POS = 707,1401,717,1411 ICON = FLAGS = 0 VIEW = 4 IN = 400 OUT = 401 432 IV = 0 3 0.109999999 0 0 0 4.95599985 10.9499998 11.9499998 16.9500008 CV = 0 3 0.11 0 0 0 4.956 10.95 11.95 16.95 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 289 TYPE = 1:SPLIT,1 NAME = Split289 LABEL = POS = 581,249,591,259 ICON = FLAGS = 0 VIEW = 4 IN = 253 OUT = 552 553 I AV = 0 1 0 0 0 1 30.8850002 19.7000008 CV = 0 1 0 0 0 1 30.885 19.7 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 290 TYPE = 1:MIX,1 NAME = Mix290 LABEL = POS = 581,268,591,278 ICON = FLAGS = 0 VIEW = 4 IN = 552 554 OUT = 555 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 291 TYPE = 1:MIX,1 NAME = Mix291 LABEL = POS = 505,144,515,154 ICON = FLAGS = 0 VIEW = 4 IN = 235 234 186 OUT = 386 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 292 TYPE = 1:DILUTE,2 NAME = Dilute292 LABEL = POS = 899,1192,909,1202 ICON = FLAGS = 0 VIEW = 4 IN = 564 416 OUT = 558 559 IV = 0 2 0.0500000007 CV = 0 2 0.05 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 293 TYPE = 1:DILUTE,2 NAME = Dilute293 LABEL = POS = 878,1400,888,1410 ICON = FLAGS = 0 VIEW = 4 IN = 563 339 OUT = 560 562 IV = 0 2 0.0500000007 CV = 0 2 0.05 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 294 TYPE = 1:MIX,1 NAME = Mix294 LABEL = POS = 879,1424,889,1434 ICON = FLAGS = 0 VIEW = 4 IN = 153 151 OUT = 563 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 295 TYPE = 1:MIX,1 NAME = Mix295 LABEL = POS = 898,1212,908,1222 ICON = FLAGS = 0 VIEW = 4 IN = 410 407 OUT = 564 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 296 TYPE = 1:GREC,2 NAME = Grec296 LABEL = POS = 706,29,716,39 ICON = FLAGS = 0 VIEW = 4 IN = 160 155 OUT = 565 566 IV = CV = 0 0 0 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 297 TYPE = 1:STMIX,3 NAME = Stmix297 LABEL = POS = 686,49,696,59 ICON = FLAGS = 0 VIEW = 4 IN = 568 154 OUT = 567 IV = 0 3 0 0 104.444443 8517.20996 CV = 0 3 0 0 104.444 8517.21 0 0 0 0.758574 424.612 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 298 TYPE = 1:EVAPS,1 NAME = Evaps298 LABEL = DCE POS = 641,230,651,240 ICON = FLAGS = 256 VIEW = 4 IN = 241 OUT = 569 570 IV = 0 1 0.680000007 85 85 CV = 0 1 0.68 85 85 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 299 TYPE = 1:STMIX,3 NAME = Stmix299 LABEL = POS = 680,230,690,240 ICON = FLAGS = 0 VIEW = 4 IN = 169 561 OUT = 571 IV = 0 3 0 0 104.444 8517.20996 CV = 0 3 0 0 104.444 8517.21 0 0 0 1.2916 722.972 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 300 TYPE = 1:STMIX,6 NAME = Stmix300 LABEL = POS = 793,601,803,611 ICON = FLAGS = 0 VIEW = 8 IN = 541 505 OUT = 539 512 IV = 0 3.0999999 0 0 144.300003 CV = 0 3.1 0 0 144.3 3862.89 0 0 0 35.6177 18700 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 301 TYPE = 1:SPLIT,2 NAME = Split225 LABEL = POS = 693,1503,703,1513 ICON = FLAGS = 0 VIEW = 4 IN = 431 OUT = 402 427 IV = 0 2 0 0.75 0.75 CV = 0 2 0 0.75 0.75 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 302 TYPE = 1:MIX,1 NAME = Mix224 LABEL = Dropleg Pit POS = 693,1484,703,1494 ICON = FLAGS = 256 VIEW = 4 IN = 403 430 OUT = 431 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 303 TYPE = 1:STMIX,4 NAME = Stmix223 LABEL = POS = 646,1497,656,1507 ICON = FLAGS = 0 VIEW = 8 IN = 429 OUT = 424 IV = 0 4 0 0 50 3862.88989 CV = 0 4 0 0 50 3862.89 0 0 0 1.26135 635.199 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 304 TYPE = 1:MIX,1 NAME = Mix222 LABEL = Wire Pit POS = 646,1479,656,1489 ICON = FLAGS = 256 VIEW = 4 IN = 404 428 427 OUT = 429 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 305 TYPE = 1:SPLIT,2 NAME = Split221 LABEL = POS = 584,1479,594,1489 ICON = FLAGS = 0 VIEW = 4 IN = 425 OUT = 426 367 IV = 0 2 0 0.989000022 0.99000001 CV = 0 2 0 0.989 0.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 306 TYPE = 1:DILUTE,2 NAME = Dilute220 LABEL = POS = 606,1479,616,1489 ICON = FLAGS = 0 VIEW = 4 IN = 369 424 OUT = 425 405 IV = 0 2 0.00499999989 0 1 CV = 0 2 0.005 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 310 TYPE = 1:SPLIT,2 NAME = Split216 LABEL = POS = 899,1255,909,1265 ICON = FLAGS = 0 VIEW = 4 IN = 421 OUT = 410 422 IV = 0 2 0 0.150000006 0.150000006 CV = 0 2 0 0.15 0.15 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 311 TYPE = 1:STMIX,4 NAME = Stmix1~1 LABEL = POS = 829,1075,839,1085 ICON = FLAGS = 0 VIEW = 4 IN = 595 OUT = 596 IV = 0 4 0 0 100 3862.88525 CV = 0 4 0 0 100 3862.89 LINKS = 0 UNITS = 1 50 53 0 0 0 COMMENT = 0 OPT = ADDIN = 0 [BLOCK] NUM = 312 TYPE = 1:SPLIT,1 NAME = Split2 LABEL = Beer distillation split ethanol POS = 829,1037,839,1047 ICON = FLAGS = 1280 VIEW = 8 IN = 600 OUT = 602 601 IV = 0 1 0 0 0 0 41.9920006 CV = 0 1 0 0 0 0 41.0001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 2 PSpec = 1 Frm = if(b314:2<0.0005,0,b314:3 * (b314:2-0.0005) / (0.4-0.0005)) PSpec = 6 Frm = if(b314:2=0,0,0.4*(b314:2-0.0005)/b314:2/(0.4-0.0005)) A ADDIN = [BLOCK] NUM = 313 TYPE = 2:REACTION,2 NAME = Reaction6~1 LABEL = Pentose Hydrolysis POS = 645,935,655,945 ICON = FLAGS = 256 VIEW = 4 IN = 583 OUT = 651 IV = 0 2 0 0 8 0.75 34 1.13636363 8 0.0399999991 36 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 8 0.75 34 1.13636 8 0.04 36 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 314 TYPE = 1:STORE,1 NAME = Store4 LABEL = POS = 823,987,833,997 ICON = FLAGS = 0 VIEW = 4 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 11 2: xf\n3: F OPT = CP CLR CmpPs Num = 8 PSpec = 6 Frm = B314:5*(B400:1*(s635:3-0)) PSpec = 7 Frm = b314:6 + b314:7 PSpec = 2 Frm = s635:1 * b314:1 /1000 PSpec = 3 Frm = s635:1 * s635:eth /1000 PSpec = 4 Frm = s635:1 * s635:water /1000 PSpec = 5 Frm = B314:4*(B285:1*(s635:3-0)) PSpec = 1 Frm = s635:eth / b314:1 A PSpec = 0 Frm = s635:eth + s635:water CLR = 128 255 255 A ADDIN = [BLOCK] NUM = 315 TYPE = 1:SPLIT,2 NAME = Split6~1 LABEL = Beer Distillation split 32-40 POS = 829,1017,839,1027 ICON = FLAGS = 256 VIEW = 4 IN = 605 OUT = 606 600 IV = 0 2 0 0.949999988 0 0 31.0000992 38.0000992 32.0000992 36.0000992 39.0000992 40.0000992 33.0000992 37.0000992 / IV = 34.0000992 41 35.0000992 CV = 0 2 0 0.95 0 0 31.0001 38.0001 32.0001 36.0001 39.0001 40.0001 33.0001 37.0001 34.0001 41 35.0001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 316 TYPE = 1:MIX,1 NAME = Mix10 LABEL = POS = 829,1056,839,1066 ICON = FLAGS = 0 VIEW = 4 IN = 610 606 602 OUT = 595 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 320 TYPE = 1:STORE,1 NAME = Store320 LABEL = Steam demand (beer distillatio) POS = 880,971,890,981 ICON = FLAGS = 256 VIEW = 8 IN = OUT = IV = 0 2.20000005 0.5 2.03999996 CV = 0 2.2 0.5 2.04 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 57 4. Steam demand mt/mt-99.5wt% Et~ OH\n5. Steam demand mt/hr OPT = CP CLR CmpPs Num = 2 PSpec = 3 Frm = b320:1 + b320:2 * b320:3 PSpec = 4 Frm = s634:1 * b320:4 CLR = 128 255 255 A ADDIN = [BLOCK] NUM = 321 TYPE = 1:STORE,1 NAME = Store320~1 LABEL = Steam demand POS = 945,970,955,980 ICON = FLAGS = 256 VIEW = 4 IN = OUT = IV = 0 -1.57000005 3.20000005 CV = 0 -1.57 3.2 0.61 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 57 4. Steam demand mt/mt-99.5wt% OH\n5. Steam demand mt/hr OPT = CP CLR CmpPs Num = 2 PSpec = 4 Frm = s634:1 * b321:4 PSpec = 3 Frm = b321:1 + b321:2 * CLR = 128 255 255 A ADDIN = [BLOCK] NUM = 322 TYPE = 1:SPLIT,2 NAME = Split3~1 LABEL = Distillation POS = 922,1037,932,1047 ICON = FLAGS = 256 VIEW = 4 IN = 613 OUT = 615 264 (distillation) 0.610000014 Et~ b321:3 IV = 0 2 0 0 0 0 41 CV = 0 2 0 0 0 0 41.0001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 2 PSpec = 7 Frm = if(s613:eth < 0.5, 0, (s613:eth - 0.5)*925/(925-0.5)/s613:Eth ) PSpec = 1 Frm = if(s613:eth <0.5, 0, (s613:eth - 0.5)/(925-0.5)) A ADDIN = [BLOCK] NUM = 323 TYPE = 1:MIX,1 NAME = Mix1 LABEL = POS = 881,1037,891,1047 ICON = FLAGS = 0 VIEW = 8 IN = 616 601 OUT = 613 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 324 TYPE = 1:SPLIT,2 NAME = Split1~1 LABEL = Dehydration POS = 962,1037,972,1047 ICON = FLAGS = 256 VIEW = 4 IN = 615 OUT = 616 620 IV = 0 2 0 0 0 0 41 CV = 0 2 0 0 0 0 41.0001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 2 PSpec = 7 Frm = if(s615:eth<723, 0, (s615:eth - 723)/(995-723)*995/925) PSpec = 1 Frm = if(s615:eth<723, 0, (s615:eth - 723)/(995-723)) ADDIN = [BLOCK] NUM = 325 TYPE = 1:SPLIT,2 NAME = Split30~3 LABEL = Neutralization by H2SO4 POS = 539,935,549,945 ICON = FLAGS = 256 VIEW = 4 IN = 695 OUT = 623 622 IV = 0 2 0 0 0 1 21.9999008 CV = 0 2 0 0 0 1 21.9999 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 326 TYPE = 1:MIX,1 NAME = Mix31 LABEL = Consistency control POS = 558,935,568,945 ICON = FLAGS = 256 VIEW = 4 IN = 622 624 OUT = 625 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 330 TYPE = 1:MIX,1 NAME = Mix215 LABEL = POS = 601,1255,611,1265 ICON = FLAGS = 0 VIEW = 4 IN = 434 409 423 OUT = 408 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = A ADDIN = [BLOCK] NUM = 331 TYPE = 2:REACTION,3 NAME = Reaction13~3 LABEL = Fermentator Ethanol from xyl POS = 649,1001,659,1011 ICON = FLAGS = 256 VIEW = 4 IN = 632 OUT = 633 IV = 0 3 34 0.800000012 1 3 34 150 0 1 0 0 0 0 5 46 44 5 41 46 0 1 0 1 CV = 0 3 34 0.8 1 3 34 150 0 0 0 0 0 0 5 46 44 5 41 46 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ShRef A ADDIN = C COMMENT = 0 [BLOCK] NUM = 332 TYPE = 1:STMIX,4 NAME = Stmix34 LABEL = POS = 988,1021,998,1031 ICON = FLAGS = 0 VIEW = 8 IN = 620 OUT = 634 IV = 0 4 0 0 30 760 CV = 0 4 0 0 30 760 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 333 TYPE = 1:SPLIT,2 NAME = Split16~3 LABEL = Beer Distillation split 19-30 POS = 829,998,839,1008 ICON = FLAGS = 1280 VIEW = 4 IN = 635 OUT = 605 610 IV = 0 2 0 0.949999988 0 0 41 19.0000992 20.0000992 21.0000992 22.0000992 23.0000992 24.0000992 25.0000992 / IV = 26.0000992 27.0000992 28.0000992 29.0000992 30.0000992 CV = 0 2 0 0.95 0 0 41 19.0001 20.0001 21.0001 22.0001 23.0001 24.0001 25.0001 26.0001 27.0001 28.0001 29.0001 / CV = 30.0001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 334 TYPE = 1:SPLIT,1 NAME = Split15~1 LABEL = Fermentator POS = 583,1001,593,1011 ICON = FLAGS = 256 VIEW = 4 IN = 636 OUT = 641 592 IV = 0 1 0 0 0 1 0 46 47 CV = 0 1 0 0 0 1 0 46 47 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = GL separation [BLOCK] NUM = 335 TYPE = 2:REACTION,3 NAME = Reaction13 LABEL = Fermentator Ethanol from glu POS = 702,1001,712,1011 ICON = FLAGS = 256 VIEW = 4 IN = 642 OUT = 643 IV = 0 3 31 0.899999976 1 1 31 180 0 1 0 0 0 0 2 46 44 2 41 46 0 1 0 1 CV = 0 3 31 0.9 1 1 31 180 0 0 0 0 0 0 2 46 44 2 41 46 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ShRef A ADDIN = C COMMENT = 0 [BLOCK] NUM = 336 TYPE = 1:MIX,1 NAME = Mix11 LABEL = Charge organism and POS = 702,980,712,990 ICON = FLAGS = 256 VIEW = 8 nutritions IN = 646 645 631 644 OUT = 642 IV = 0 0 4 1 CV = 0 0 4 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 340 TYPE = 2:REACTION,2 NAME = Reaction13~2 LABEL = Fermentator Others from xyl POS = 629,1001,639,1011 ICON = FLAGS = 256 VIEW = 4 IN = 633 OUT = 650 IV = 0 2 0 0 34 0.200000003 18 1 34 0.075000003 33 1 34 0.0500000007 19 1 34 0.25 35 1.01333296 CV = 0 2 0 0 34 0.2 18 1 34 0.075 33 1 34 0.05 19 1 34 0.25 35 1.01333 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ShRef A ADDIN = C COMMENT = 0 [BLOCK] NUM = 341 TYPE = 1:STMIX,4 NAME = Heatd7 LABEL = Cellulase POS = 703,957,713,967 ICON = FLAGS = 1024 VIEW = 4 IN = 265 OUT = 631 IV = 0 4 0 0 41 760 CV = 0 4 0 0 41 760 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CLR CLR = 255 0 0 A ADDIN = [BLOCK] NUM = 342 TYPE = 2:REACTION,2 NAME = Reaction6 LABEL = Cellulose adsorption Hydrolysis POS = 620,935,630,945 ICON = FLAGS = 256 VIEW = 4 IN = 654 OUT = 583 IV = 0 2 0 0 6 0.75 31 1.11109996 6 0.0399999991 32 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 6 0.75 31 1.1111 6 0.04 32 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 343 TYPE = 1:SPLIT,2 NAME = Split214 LABEL = Reel Trim POS = 880,1255,890,1265 ICON = FLAGS = 256 VIEW = 4 IN = 435 OUT = 421 407 IV = 0 2 0 0.0399999991 0.0399999991 CV = 0 2 0 0.04 0.04 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 344 TYPE = 2:REACTION,2 NAME = Reaction5~3 LABEL = Hexose Hydrolysis POS = 597,935,607,945 ICON = FLAGS = 256 VIEW = 4 IN = 661 OUT = 654 IV = 0 2 0 0 7 0.75 31 1.11110997 7 0.0399999991 32 1 0 0 0 1 0 1 0 1 CV = 0 2 0 0 7 0.75 31 1.11111 7 0.04 32 1 0 0 0 1 0 1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 345 TYPE = 1:STORE,1 NAME = EtOH Production LABEL = POS = 1007,999,1017,1009 ICON = FLAGS = 0 VIEW = 4 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 3 PSpec = 2 Frm = b320:5 + b321:5 PSpec = 0 Frm = s634:1*s634:Eth / 1000 PSpec = 1 Frm = (b345:1/.79)/3.8*8400/1000 A ADDIN = [BLOCK] NUM = 346 TYPE = 1:EVAPS,2 NAME = Evaps213 LABEL = Post size press drying POS = 861,1255,871,1265 ICON = FLAGS = 256 VIEW = 4 IN = 436 OUT = 435 443 IV = 0 2 0.959999979 0 95 CV = 0 2 0.96 0 95 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 350 TYPE = 1:MIX,1 NAME = Mix212 LABEL = POS = 841,1255,851,1265 ICON = FLAGS = 0 VIEW = 4 IN = 319 472 OUT = 436 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 351 TYPE = 1:SPLIT,3 NAME = Split211 LABEL = Press 3 POS = 802,1255,812,1265 ICON = FLAGS = 256 VIEW = 4 IN = 317 OUT = 542 511 IV = 0 3 0.400000006 0 1 CV = 0 3 0.4 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 352 TYPE = 1:SPLIT,2 NAME = Split210 LABEL = POS = 560,1308,570,1318 ICON = FLAGS = 0 VIEW = 4 IN = 439 OUT = 398 399 IV = 0 2 0 0.5 0.5 CV = 0 2 0 0.5 0.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 353 TYPE = 1:SPLIT,3 NAME = Split196 LABEL = Press 2 POS = 762,1460,772,1470 ICON = FLAGS = 256 VIEW = 4 IN = 545 OUT = 358 546 IV = 0 3 0.319999993 0 0 0 4 10.9899998 16.9899998 CV = 0 3 0.32 0 0 0 4 10.99 16.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 354 TYPE = 1:SPLIT,3 NAME = Split195 LABEL = Press 1 POS = 742,1460,752,1470 ICON = FLAGS = 256 VIEW = 4 IN = 419 OUT = 545 550 IV = 0 3 0.26699999 0 0 0 4 10.9899998 16.9899998 CV = 0 3 0.267 0 0 0 4 10.99 16.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 355 TYPE = 1:SPLIT,2 NAME = Split194 LABEL = Machine Trim POS = 722,1460,732,1470 ICON = FLAGS = 256 VIEW = 4 IN = 417 OUT = 419 418 IV = 0 2 0 0.0299999993 0.0299999993 CV = 0 2 0 0.03 0.03 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 356 TYPE = 1:SPLIT,3 NAME = Split193 LABEL = Couch Roll POS = 702,1460,712,1470 ICON = FLAGS = 256 VIEW = 4 IN = 551 OUT = 417 377 IV = 0 3 0.159999996 0 0 0 4.99499989 10.9399996 16.9400005 CV = 0 3 0.16 0 0 0 4.995 10.94 16.94 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 360 TYPE = 1:SPLIT,3 NAME = Split192 LABEL = Flat Boxes POS = 682,1460,692,1470 ICON = FLAGS = 256 VIEW = 4 IN = 572 OUT = 551 403 IV = 0 3 0.115999997 0 0 0 4.96999979 10.8000002 16.7999992 CV = 0 3 0.116 0 0 0 4.97 10.8 16.8 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 361 TYPE = 2:REACTION,2 NAME = Reaction13~1 LABEL = Fermentator Others from glu POS = 683,1001,693,1011 ICON = FLAGS = 256 VIEW = 4 IN = 643 OUT = 632 IV = 0 2 0 0 31 0.400000006 18 1 31 0.150000006 33 1 31 0.150000006 19 1 1 0 1 1 CV = 0 2 0 0 31 0.4 18 1 31 0.15 33 1 31 0.15 19 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ShRef A ADDIN = C COMMENT = 0 [BLOCK] NUM = 362 TYPE = 1:HEATD,1 NAME = Heatd65 LABEL = POS = 829,976,839,986 ICON = FLAGS = 0 VIEW = 4 IN = 596 276 OUT = 635 261 IV = 0 1 0.00999999978 0 1000 CV = 0 1 0.01 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 363 TYPE = 2:REACTION,2 NAME = Conversion LABEL = POS = 210,360,220,370 ICON = FLAGS = 0 VIEW = 4 IN = 156 OUT = 722 IV = 0 2 0 0 33 1 19 1 37 1 19 1 0 0 0 1 0 0 0 1 CV = 0 2 0 0 33 1 19 1 37 1 19 1 0 0 0 1 0 0 0 1 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 53 Covnerts Acetic Acid and Furfura~ l to Diss Wood Solids OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 364 TYPE = 1:SPLIT,2 NAME = Split191 LABEL = Trays POS = 646,1460,656,1470 ICON = FLAGS = 256 VIEW = 4 IN = 573 OUT = 572 404 IV = 0 2 0 0.25999999 0 0 4.73999977 10.5 16.5 CV = 0 2 0 0.26 0 0 4.74 10.5 16.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 365 TYPE = 1:MIX,1 NAME = Mix190 LABEL = POS = 626,1460,636,1470 ICON = FLAGS = 0 VIEW = 4 IN = 575 574 OUT = 573 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 366 TYPE = 1:DILUTE,2 NAME = Dilute186 LABEL = POS = 545,1421,555,1431 ICON = FLAGS = 0 VIEW = 4 IN = 582 396 OUT = 584 337 IV = 0 2 0.0299999993 CV = 0 2 0.03 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 370 TYPE = 1:MIX,1 NAME = Mix370 LABEL = POS = 664,935,674,945 ICON = FLAGS = 0 VIEW = 4 IN = 651 686 OUT = 653 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 371 TYPE = 1:MIX,1 NAME = Mix185 LABEL = POS = 545,1401,555,1411 ICON = FLAGS = 0 VIEW = 8 IN = 401 399 560 OUT = 582 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 372 TYPE = 1:REACT,1 NAME = React184 LABEL = POS = 545,1441,555,1451 ICON = FLAGS = 0 VIEW = 4 IN = 584 OUT = 580 IV = 0 0 0 0 0 19.0020008 CV = 0 0 0 0 0 19.002 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 373 TYPE = 1:SPLIT,3 NAME = Split183 LABEL = Press 3 POS = 782,1460,792,1470 ICON = FLAGS = 256 VIEW = 4 IN = 358 OUT = 543 359 IV = 0 3 0.400000006 0 1 CV = 0 3 0.4 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 374 TYPE = 1:MIX,1 NAME = Mix182 LABEL = POS = 821,1460,831,1470 ICON = FLAGS = 0 VIEW = 4 IN = 357 585 OUT = 586 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 375 TYPE = 1:SPLIT,3 NAME = Split375 LABEL = POS = 683,935,693,945 ICON = FLAGS = 0 VIEW = 4 IN = 653 OUT = 685 263 IV = 0 3 0.5 0 1 CV = 0 3 0.5 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 376 TYPE = 1:EVAPS,2 NAME = Evaps181 LABEL = POS = 841,1460,851,1470 ICON = FLAGS = 0 VIEW = 4 IN = 586 OUT = 591 590 IV = 0 2 0.959999979 0 95 CV = 0 2 0.96 0 95 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 380 TYPE = 1:SPLIT,2 NAME = Split180 LABEL = Reel Trim POS = 860,1460,870,1470 ICON = FLAGS = 256 VIEW = 4 IN = 591 OUT = 593 151 IV = 0 2 0 0.0399999991 0.0399999991 CV = 0 2 0 0.04 0.04 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 381 TYPE = 1:MIX,1 NAME = Mix218~1 LABEL = POS = 731,1401,741,1411 ICON = FLAGS = 0 VIEW = 4 IN = 603 594 OUT = 400 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 382 TYPE = 1:MIX,1 NAME = Mix219~1 LABEL = POS = 707,1440,717,1450 ICON = FLAGS = 0 VIEW = 4 IN = 338 337 OUT = 339 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 383 TYPE = 1:REACT,1 NAME = React1 LABEL = POS = 581,1236,591,1246 ICON = FLAGS = 0 VIEW = 4 IN = 604 OUT = 611 IV = 0 0 0 0 0 19.0020008 CV = 0 0 0 0 0 19.002 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 384 TYPE = 1:MIX,1 NAME = Mix173 LABEL = POS = 581,1196,591,1206 ICON = FLAGS = 0 VIEW = 8 IN = 612 398 558 OUT = 614 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 385 TYPE = 1:DILUTE,2 NAME = Dilute172 LABEL = POS = 581,1216,591,1226 ICON = FLAGS = 0 VIEW = 4 IN = 614 621 OUT = 604 406 IV = 0 2 0.0299999993 CV = 0 2 0.03 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 386 TYPE = 1:MIX,1 NAME = Mix4 LABEL = POS = 581,1255,591,1265 ICON = FLAGS = 0 VIEW = 4 IN = 611 626 OUT = 434 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 390 TYPE = 1:MIX,1 NAME = Mix170 LABEL = POS = 620,1255,630,1265 ICON = FLAGS = 0 VIEW = 4 IN = 630 408 OUT = 640 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 391 TYPE = 1:STMIX,4 NAME = Stmix391 LABEL = POS = 520,935,530,945 ICON = FLAGS = 0 VIEW = 4 IN = 280 OUT = 695 IV = 0 4 0 0 55 760 CV = 0 4 0 0 55 760 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CLR A CLR = 255 0 0 ADDIN = [BLOCK] NUM = 392 TYPE = 1:MIX,1 NAME = Mix2~1 LABEL = Charge cellulase POS = 577,935,587,945 ICON = FLAGS = 256 VIEW = 8 IN = 750 625 OUT = 262 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 393 TYPE = 1:SPLIT,3 NAME = Split166 LABEL = Flat Boxes POS = 702,1255,712,1265 ICON = FLAGS = 256 VIEW = 4 IN = 660 OUT = 662 307 IV = 0 3 0.115999997 0 0 0 4.96999979 10.8000002 16.7999992 CV = 0 3 0.116 0 0 0 4.97 10.8 16.8 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 394 TYPE = 1:SPLIT,3 NAME = Split165 LABEL = Couch Roll POS = 722,1255,732,1265 ICON = FLAGS = 256 VIEW = 4 IN = 662 OUT = 664 663 IV = 0 3 0.159999996 0 0 0 4.99499989 10.9399996 16.9400005 CV = 0 3 0.16 0 0 0 4.995 10.94 16.94 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 395 TYPE = 1:SPLIT,2 NAME = Split14 LABEL = Machine Trim POS = 742,1255,752,1265 ICON = FLAGS = 256 VIEW = 4 IN = 664 OUT = 666 665 IV = 0 2 0 0.0299999993 0.0299999993 CV = 0 2 0 0.03 0.03 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 396 TYPE = 2:REACTION,2 NAME = Conversion~1 LABEL = POS = 229,360,239,370 ICON = FLAGS = 0 VIEW = 4 IN = 722 OUT = 35 IV = 0 2 0 0 39 1 19 1 40 1 19 1 41 1 19 1 38 1 19 1 CV = 0 2 0 0 39 1 19 1 40 1 19 1 41 1 19 1 38 1 19 1 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 53 Covnerts Acetic Acid and Furfura~ l to Diss Wood Solids OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 400 TYPE = 1:STORE,1 NAME = Store400 LABEL = Water POS = 892,942,902,952 ICON = FLAGS = 256 VIEW = 4 IN = OUT = properties IV = 0 4.18283319 1.865556 2258.66699 CV = 0 4.18283 1.86556 2258.67 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 78 1. Cp(liquid) MJ/K mt\n2. Cp(gas~ ) MJ/K mt\n3. Evaporation enthal~ py @100C MJ/mt OPT = CLR CLR = 255 255 0 A ADDIN = [BLOCK] NUM = 401 TYPE = 1:SPLIT,3 NAME = Split15 LABEL = Press 1 POS = 762,1255,772,1265 ICON = FLAGS = 256 VIEW = 4 IN = 666 OUT = 671 670 IV = 0 3 0.26699999 0 0 0 4 10.9899998 16.9899998 CV = 0 3 0.267 0 0 0 4 10.99 16.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 402 TYPE = 1:SPLIT,3 NAME = Split162 LABEL = Press 2 POS = 782,1255,792,1265 ICON = FLAGS = 256 VIEW = 4 IN = 671 OUT = 317 672 IV = 0 3 0.319999993 0 0 0 4 10.9899998 16.9899998 CV = 0 3 0.32 0 0 0 4 10.99 16.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 403 TYPE = 2:REACTION,2 NAME = Reaction63 LABEL = Fermentator Move to gas phase POS = 607,1001,617,1011 ICON = FLAGS = 256 VIEW = 4 IN = 650 OUT = 636 IV = 0 2 0 1 41 0.0199999996 47 1 0 1 0 1 1 0 1 1 1 0 1 1 CV = 0 2 0 1 41 0.02 47 1 0 1 0 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 404 TYPE = 1:EVAPS,2 NAME = Evaps161 LABEL = Pre-size dryer POS = 822,1255,832,1265 ICON = FLAGS = 256 VIEW = 4 IN = 542 OUT = 319 318 IV = 0 2 0.99000001 0 95 CV = 0 2 0.99 0 95 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 405 TYPE = 1:DILUTE,2 NAME = Dilute21 LABEL = POS = 642,1274,652,1284 ICON = FLAGS = 0 VIEW = 4 IN = 655 673 OUT = 674 626 IV = 0 2 0.00499999989 0 1 CV = 0 2 0.005 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 406 TYPE = 1:MIX,1 NAME = Mix155 LABEL = Wire Pit POS = 682,1273,692,1283 ICON = FLAGS = 256 VIEW = 4 IN = 656 309 680 OUT = 681 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 410 TYPE = 1:STMIX,4 NAME = Stmix154 LABEL = POS = 682,1292,692,1302 ICON = FLAGS = 0 VIEW = 4 IN = 681 OUT = 673 IV = 0 4 0 0 50 3862.88989 CV = 0 4 0 0 50 3862.89 0 0 0 1.26128 635.161 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 411 TYPE = 1:MIX,1 NAME = Mix92 LABEL = Dropleg Pit POS = 713,1279,723,1289 ICON = FLAGS = 256 VIEW = 4 IN = 307 297 OUT = 308 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 412 TYPE = 1:SPLIT,2 NAME = Split26 LABEL = POS = 713,1298,723,1308 ICON = FLAGS = 0 VIEW = 4 IN = 308 OUT = 420 680 IV = 0 2 0 0.75 0.75 CV = 0 2 0 0.75 0.75 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 413 TYPE = 1:SPLIT,3 NAME = Split30~2 LABEL = POS = 727,1196,737,1206 ICON = FLAGS = 0 VIEW = 4 IN = 414 OUT = 612 299 IV = 0 3 0.109999999 0 0 0 4.95599985 10.9499998 11.9499998 16.9500008 CV = 0 3 0.11 0 0 0 4.956 10.95 11.95 16.95 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 414 TYPE = 1:SPLIT,2 NAME = Split31~1 LABEL = POS = 727,1215,737,1225 ICON = FLAGS = 0 VIEW = 4 IN = 299 OUT = 411 621 IV = 0 2 0 0.349999994 0.985000014 CV = 0 2 0 0.35 0.985 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 415 TYPE = 1:MIX,1 NAME = Mix46 LABEL = POS = 742,1280,752,1290 ICON = FLAGS = 0 VIEW = 4 IN = 665 663 298 OUT = 415 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 416 TYPE = 1:CHARGE,4 NAME = Charge206 LABEL = Hwd EOP H2O2 POS = 256,1182,266,1192 ICON = FLAGS = 256 VIEW = 4 IN = 278 690 OUT = 683 IV = 0 5 0 0 29.0049992 CV = 0 5 0 0 29.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 420 TYPE = 1:SPLIT,2 NAME = Split205 LABEL = Miscellaneous Spills POS = 366,1162,376,1172 ICON = FLAGS = 256 VIEW = 4 IN = 691 OUT = 692 836 IV = 0 2 0 0.00499999989 0.00499999989 CV = 0 2 0 0.005 0.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 421 TYPE = 1:CHARGE,4 NAME = Charge146 LABEL = Hwd D0 ClO2 POS = 193,1163,203,1173 ICON = FLAGS = 256 VIEW = 4 IN = 700 694 OUT = 701 IV = 0 5 0 3 28.0146675 CV = 0 5 0 3 28.0147 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 422 TYPE = 2:REACTION,2 NAME = React4~1 LABEL = POS = 193,1204,203,1214 ICON = FLAGS = 0 VIEW = 4 IN = 701 OUT = 702 IV = 0 2 0 1 5 0.300000012 19 1 6 0.0000999999975 19 1 7 0.125 19 1 8 0.00999999978 19 1 CV = 0 2 0 1 5 0.3 19 1 6 0.0001 19 1 7 0.125 19 1 8 0.01 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 423 TYPE = 1:DILUTE,2 NAME = Dilute5~1 LABEL = POS = 209,1163,219,1173 ICON = FLAGS = 0 VIEW = 4 IN = 702 703 OUT = 704 693 IV = 0 2 0.0160000008 1 CV = 0 2 0.016 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 424 TYPE = 1:WASH,1 NAME = Wash6~1 LABEL = POS = 226,1163,236,1173 ICON = FLAGS = 0 VIEW = 4 IN = 704 705 OUT = 706 703 IV = 0 2 0.0799999982 1 0 1 0 1 CV = 0 2 0.08 1 0 1 0 1 0 0.549865 1.02507 0.288309 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 425 TYPE = 1:CHARGE,4 NAME = Charge142 LABEL = Hwd EOP NaOH POS = 256,1163,266,1173 ICON = FLAGS = 256 VIEW = 4 IN = 706 279 OUT = 278 IV = 0 5 0 2 20.0095005 CV = 0 5 0 2 20.0095 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 426 TYPE = 1:STMIX,3 NAME = Stmix141 LABEL = Hwd EOP POS = 256,1220,266,1230 ICON = FLAGS = 256 VIEW = 4 IN = 277 684 OUT = 710 IV = 0 3 0 0 70 3862.88525 CV = 0 3 0 0 70 3862.89 0 0 0 2.25026 1319.86 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 430 TYPE = 2:REACTION,2 NAME = React9~2 LABEL = POS = 256,1239,266,1249 ICON = FLAGS = 0 VIEW = 4 IN = 710 OUT = 711 IV = 0 2 0 0 5 0.400000006 19 1 7 0.159999996 19 1 8 0.0149999997 19 1 9 1 19 1 CV = 0 2 0 0 5 0.4 19 1 7 0.16 19 1 8 0.015 19 1 9 1 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 431 TYPE = 1:STMIX,3 NAME = Stmix13~1 LABEL = POS = 311,1183,321,1193 ICON = FLAGS = 0 VIEW = 4 IN = 269 268 OUT = 267 IV = 0 3 0 1 82 3862.88989 CV = 0 3 0 1 82 3862.89 0 0 0 12.5561 7213.95 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 432 TYPE = 2:REACTION,2 NAME = React14~1 LABEL = POS = 312,1202,322,1212 ICON = FLAGS = 0 VIEW = 4 IN = 267 OUT = 716 IV = 0 2 0 1 5 1 19 1 6 0.000500000024 19 1 7 0.0615000017 19 1 8 0.00600000005 19 1 CV = 0 2 0 1 5 1 19 1 6 0.0005 19 1 7 0.0615 19 1 8 0.006 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 433 TYPE = 1:DILUTE,2 NAME = Dilute15~3 LABEL = POS = 327,1163,337,1173 ICON = FLAGS = 0 VIEW = 4 IN = 716 720 OUT = 721 705 IV = 0 2 0.0160000008 1 CV = 0 2 0.016 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 434 TYPE = 1:WASH,1 NAME = Wash16~1 LABEL = POS = 346,1163,356,1173 ICON = FLAGS = 0 VIEW = 4 IN = 721 723 OUT = 691 720 IV = 0 2 0.0799999982 1 0 1 0 1 CV = 0 2 0.08 1 0 1 0 1 0 0.599121 1.21739 2.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 435 TYPE = 1:CHARGE,4 NAME = Charge132 LABEL = Hwd D1 ClO2 POS = 310,1163,320,1173 ICON = FLAGS = 256 VIEW = 4 IN = 259 715 OUT = 269 IV = 0 5 0 3 28.0073338 CV = 0 5 0 3 28.0073 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 436 TYPE = 1:CHARGE,1 NAME = Charge207~1 LABEL = Hwd EOP Oxygen POS = 248,1551,258,1561 ICON = FLAGS = 256 VIEW = 4 IN = 725 724 OUT = 726 IV = 0 1 0 0 7 CV = 0 1 0 0 7 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 440 TYPE = 1:CHARGE,4 NAME = Charge206~1 LABEL = Hwd EOP H2O2 POS = 248,1532,258,1542 ICON = FLAGS = 256 VIEW = 4 IN = 731 730 OUT = 725 IV = 0 5 0 0 29.0049992 CV = 0 5 0 0 29.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 441 TYPE = 1:SPLIT,2 NAME = Split205~1 LABEL = Miscellaneous Spills POS = 358,1512,368,1522 ICON = FLAGS = 256 VIEW = 4 IN = 732 OUT = 733 834 IV = 0 2 0 0.00499999989 0.00499999989 CV = 0 2 0 0.005 0.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 442 TYPE = 1:DILUTE,2 NAME = Dilute148~1 LABEL = Hi-D POS = 167,1513,177,1523 ICON = FLAGS = 256 VIEW = 4 IN = 734 226 OUT = 736 735 IV = 0 2 0.0350000001 CV = 0 2 0.035 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 443 TYPE = 1:MIX,1 NAME = Mix2~4 LABEL = POS = 212,1604,222,1614 ICON = FLAGS = 0 VIEW = 4 IN = 740 735 OUT = 741 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 444 TYPE = 1:CHARGE,4 NAME = Charge146~1 LABEL = Hwd D0 ClO2 POS = 185,1513,195,1523 ICON = FLAGS = 256 VIEW = 4 IN = 742 736 OUT = 743 IV = 0 5 0 3 28.0146675 CV = 0 5 0 3 28.0147 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 445 TYPE = 2:REACTION,2 NAME = React4~2 LABEL = POS = 185,1554,195,1564 ICON = FLAGS = 0 VIEW = 4 IN = 743 OUT = 744 IV = 0 2 0 1 5 0.300000012 19 1 6 0.0000999999975 19 1 7 0.125 19 1 8 0.00999999978 19 1 CV = 0 2 0 1 5 0.3 19 1 6 0.0001 19 1 7 0.125 19 1 8 0.01 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 446 TYPE = 1:DILUTE,2 NAME = Dilute5~2 LABEL = POS = 201,1513,211,1523 ICON = FLAGS = 0 VIEW = 4 IN = 744 745 OUT = 746 734 IV = 0 2 0.0160000008 1 CV = 0 2 0.016 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 450 TYPE = 1:WASH,1 NAME = Wash6~2 LABEL = POS = 218,1513,228,1523 ICON = FLAGS = 0 VIEW = 4 IN = 746 751 OUT = 752 745 IV = 0 2 0.0799999982 1 0 1 0 1 CV = 0 2 0.08 1 0 1 0 1 0 0.549865 1.02507 0.288303 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 451 TYPE = 1:CHARGE,4 NAME = Charge142~1 LABEL = Hwd EOP NaOH POS = 248,1513,258,1523 ICON = FLAGS = 256 VIEW = 4 IN = 752 753 OUT = 731 IV = 0 5 0 2 20.0095005 CV = 0 5 0 2 20.0095 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 452 TYPE = 1:STMIX,3 NAME = Stmix141~1 LABEL = Hwd EOP POS = 248,1570,258,1580 ICON = FLAGS = 256 VIEW = 4 IN = 754 726 OUT = 755 IV = 0 3 0 0 70 3862.88525 CV = 0 3 0 0 70 3862.89 0 0 0 2.25027 1319.87 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 453 TYPE = 2:REACTION,2 NAME = React9~1 LABEL = POS = 248,1589,258,1599 ICON = FLAGS = 0 VIEW = 4 IN = 755 OUT = 756 IV = 0 2 0 0 5 0.400000006 19 1 7 0.159999996 19 1 8 0.0149999997 19 1 9 1 19 1 CV = 0 2 0 0 5 0.4 19 1 7 0.16 19 1 8 0.015 19 1 9 1 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 454 TYPE = 1:DILUTE,2 NAME = Dilute10~1 LABEL = POS = 264,1513,274,1523 ICON = FLAGS = 0 VIEW = 4 IN = 756 760 OUT = 761 740 IV = 0 2 0.0160000008 CV = 0 2 0.016 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 455 TYPE = 1:WASH,1 NAME = Wash11~2 LABEL = POS = 283,1513,293,1523 ICON = FLAGS = 0 VIEW = 4 IN = 761 762 OUT = 763 760 IV = 0 2 0.111599997 0 0 1 0 1 CV = 0 2 0.1116 0 0 1 0 1 0 0.578261 1.18843 1.50001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 456 TYPE = 1:STMIX,3 NAME = Stmix13~2 LABEL = POS = 303,1533,313,1543 ICON = FLAGS = 0 VIEW = 4 IN = 765 764 OUT = 766 IV = 0 3 0 1 82 3862.88989 CV = 0 3 0 1 82 3862.89 0 0 0 12.5561 7213.97 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 460 TYPE = 2:REACTION,2 NAME = React14~2 LABEL = POS = 304,1552,314,1562 ICON = FLAGS = 0 VIEW = 4 IN = 766 OUT = 770 IV = 0 2 0 1 5 1 19 1 6 0.000500000024 19 1 7 0.0615000017 19 1 8 0.00600000005 19 1 CV = 0 2 0 1 5 1 19 1 6 0.0005 19 1 7 0.0615 19 1 8 0.006 19 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 461 TYPE = 1:DILUTE,2 NAME = Dilute15~4 LABEL = POS = 319,1513,329,1523 ICON = FLAGS = 0 VIEW = 4 IN = 770 771 OUT = 772 751 IV = 0 2 0.0160000008 1 CV = 0 2 0.016 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 462 TYPE = 1:WASH,1 NAME = Wash16~2 LABEL = POS = 338,1513,348,1523 ICON = FLAGS = 0 VIEW = 4 IN = 772 773 OUT = 732 771 IV = 0 2 0.0799999982 1 0 1 0 1 CV = 0 2 0.08 1 0 1 0 1 0 0.599122 1.21739 2.50001 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 463 TYPE = 1:CHARGE,4 NAME = Charge132~1 LABEL = Hwd D1 ClO2 POS = 302,1513,312,1523 ICON = FLAGS = 256 VIEW = 4 IN = 774 763 OUT = 765 IV = 0 5 0 3 28.0073338 CV = 0 5 0 3 28.0073 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 464 TYPE = 1:SPLIT,2 NAME = Split203 LABEL = Misc spills POS = 375,1345,385,1355 ICON = FLAGS = 256 VIEW = 4 IN = 781 OUT = 782 835 IV = 0 2 0 0.00300000003 0.00300000003 CV = 0 2 0 0.003 0.003 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 465 TYPE = 1:CHARGE,4 NAME = Charge17~2 LABEL = SWD D2 ClO2 POS = 320,1345,330,1355 ICON = FLAGS = 256 VIEW = 4 IN = 127 832 OUT = 783 IV = 0 5 0 2 28.0039997 CV = 0 5 0 2 28.004 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 466 TYPE = 1:WASH,1 NAME = Wash16~3 LABEL = D2 POS = 356,1345,366,1355 ICON = FLAGS = 256 VIEW = 4 IN = 785 784 OUT = 128 781 IV = 0 2 0.0799999982 1 0 1 0 1 CV = 0 2 0.08 1 0 1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 470 TYPE = 1:DILUTE,2 NAME = Dilute1 LABEL = POS = 80,1345,90,1355 ICON = FLAGS = 0 VIEW = 4 IN = 786 256 OUT = 249 790 IV = 0 2 0.0350000001 CV = 0 2 0.035 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = A ADDIN = [BLOCK] NUM = 471 TYPE = 1:DILUTE,2 NAME = Dilute5 LABEL = POS = 115,1345,125,1355 ICON = FLAGS = 0 VIEW = 4 IN = 247 793 OUT = 794 786 IV = 0 2 0.0160000008 1 CV = 0 2 0.016 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 472 TYPE = 1:WASH,1 NAME = Wash6 LABEL = POS = 134,1345,144,1355 ICON = FLAGS = 0 VIEW = 4 IN = 794 795 OUT = 796 793 IV = 0 2 0.0799999982 1 0 1 0 1 CV = 0 2 0.08 1 0 1 0 1 0 0.544874 1.00741 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 473 TYPE = 1:CHARGE,4 NAME = Charge7 LABEL = Swd EOP NaOH POS = 153,1345,163,1355 ICON = FLAGS = 256 VIEW = 4 IN = 796 800 OUT = 776 IV = 0 5 0 2 20.0143795 CV = 0 5 0 2 20.0144 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = A ADDIN = [BLOCK] NUM = 474 TYPE = 1:STMIX,3 NAME = Stmix8 LABEL = POS = 153,1383,163,1393 ICON = FLAGS = 0 VIEW = 4 IN = 801 780 OUT = 802 IV = 0 3 0 0 70 3862.88989 CV = 0 3 0 0 70 3862.89 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 475 TYPE = 2:REACTION,2 NAME = React9~3 LABEL = POS = 153,1402,163,1412 ICON = FLAGS = 0 VIEW = 4 IN = 802 OUT = 238 IV = 0 2 0 0 5 0.449999988 19 1 9 0.300000012 19 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 5 0.45 19 1 9 0.3 19 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 476 TYPE = 1:DILUTE,2 NAME = Dilute10~3 LABEL = POS = 169,1345,179,1355 ICON = FLAGS = 0 VIEW = 4 IN = 238 237 OUT = 803 239 IV = 0 2 0.0160000008 CV = 0 2 0.016 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 480 TYPE = 1:WASH,1 NAME = Wash11 LABEL = POS = 188,1345,198,1355 ICON = FLAGS = 0 VIEW = 4 IN = 803 833 OUT = 805 237 IV = 0 2 0.111599997 0 0 1 0 1 CV = 0 2 0.1116 0 0 1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 481 TYPE = 1:DILUTE,2 NAME = Dilute116 LABEL = POS = 224,1345,234,1355 ICON = FLAGS = 0 VIEW = 4 IN = 812 228 OUT = 227 795 IV = 0 2 0.0160000008 1 CV = 0 2 0.016 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 482 TYPE = 1:WASH,1 NAME = Wash16 LABEL = POS = 243,1345,253,1355 ICON = FLAGS = 0 VIEW = 4 IN = 227 813 OUT = 229 228 IV = 0 2 0.0799999982 1 0 1 0 1 CV = 0 2 0.08 1 0 1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 483 TYPE = 1:CHARGE,4 NAME = Charge17 LABEL = Swd D1 ClO2 POS = 207,1345,217,1355 ICON = FLAGS = 256 VIEW = 4 IN = 814 805 OUT = 806 IV = 0 5 0 3 28.007 CV = 0 5 0 3 28.007 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 484 TYPE = 1:STMIX,3 NAME = Stmix13~3 LABEL = D2 POS = 320,1365,330,1375 ICON = FLAGS = 256 VIEW = 4 IN = 289 783 OUT = 815 IV = 0 3 0 1 82 3862.88989 CV = 0 3 0 1 82 3862.89 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 485 TYPE = 1:WASH,1 NAME = Wash11~3 LABEL = POS = 300,1345,310,1355 ICON = FLAGS = 0 VIEW = 4 IN = 820 816 OUT = 821 832 IV = 0 2 0.111599997 0 0 1 0 1 CV = 0 2 0.1116 0 0 1 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 486 TYPE = 1:DILUTE,2 NAME = Dilute10~4 LABEL = POS = 281,1345,291,1355 ICON = FLAGS = 0 VIEW = 4 IN = 822 821 OUT = 820 833 IV = 0 2 0.0160000008 CV = 0 2 0.016 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 490 TYPE = 2:REACTION,2 NAME = React9~4 LABEL = POS = 265,1402,275,1412 ICON = FLAGS = 0 VIEW = 4 IN = 823 OUT = 822 IV = 0 2 0 0 5 0.449999988 19 1 9 0.300000012 19 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 5 0.45 19 1 9 0.3 19 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 491 TYPE = 1:STMIX,3 NAME = Stmix8~1 LABEL = POS = 265,1383,275,1393 ICON = FLAGS = 0 VIEW = 4 IN = 825 824 OUT = 823 IV = 0 3 0 0 70 3862.88989 CV = 0 3 0 0 70 3862.89 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 492 TYPE = 1:CHARGE,4 NAME = Charge7~1 LABEL = Swd EOP NaOH POS = 265,1345,275,1355 ICON = FLAGS = 256 VIEW = 4 IN = 826 229 OUT = 830 IV = 0 5 0 2 20.0143795 CV = 0 5 0 2 20.0144 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 493 TYPE = 1:CHARGE,4 NAME = Charge208~1 LABEL = Swd EOP H2O2 POS = 265,1364,275,1374 ICON = FLAGS = 256 VIEW = 4 IN = 830 831 OUT = 824 IV = 0 5 0 0 29.0049992 CV = 0 5 0 0 29.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 494 TYPE = 2:REACTION,2 NAME = Reaction494 LABEL = POS = 540,1308,550,1318 ICON = FLAGS = 0 VIEW = 4 IN = 843 OUT = 439 IV = 0 2 0 0 17 1 4 1 1 0 1 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 17 1 4 1 1 0 1 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 495 TYPE = 1:STMIX,3 NAME = Stmix495 LABEL = GL heater POS = 793,231,803,241 ICON = FLAGS = 256 VIEW = 4 IN = 13 844 OUT = 845 IV = 0 3 0 0 93.3000031 3862.88989 CV = 0 3 0 0 93.3 3862.89 0 0 0 2.73732 1541.77 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 496 TYPE = 1:SLAC,1 NAME = Slac496 LABEL = POS = 815,231,825,241 ICON = FLAGS = 0 VIEW = 4 IN = 845 846 214 OUT = 851 852 IV = 0 0 0 0.894999981 1 0.712000012 760 -20 -50 -50 0 0 0 0 0 0 0.180000007 1.89999998 3 CV = 0 0 0 0.895 1 0.712 760 -20 -50 -50 0.853323 0.836656 50.9166 127.291 127.291 0.0000485921 0.18 1.9 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 500 TYPE = 1:STORE,1 NAME = Store300~1 LABEL = 60psig POS = 880,955,890,965 Steam properties ICON = FLAGS = 256 VIEW = 4 IN = OUT = IV = 0 2100.6001 CV = 0 2100.6 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 32 Vaporization heat @60psig = 153C OPT = CLR CLR = 255 255 0 A ADDIN = [BLOCK] NUM = 501 TYPE = 1:SPLIT,3 NAME = Split501 LABEL = Grits removal POS = 836,231,846,241 ICON = FLAGS = 256 VIEW = 4 IN = 852 OUT = 853 854 IV = 0 3 0.600000024 0 0.00499999989 CV = 0 3 0.6 0 0.005 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 502 TYPE = 1:CLF,1 NAME = Clf502 LABEL = POS = 859,231,869,241 ICON = FLAGS = 0 VIEW = 4 IN = 854 OUT = 855 856 IV = 0 0 0.5 CV = 0 0 0.5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 503 TYPE = 1:MIX,1 NAME = Mix503 LABEL = POS = 859,265,869,275 ICON = FLAGS = 0 VIEW = 4 IN = 856 232 872 875 OUT = 163 IV = 0 0 4 CV = 0 0 4 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 504 TYPE = 1:SPLIT,9 NAME = Split504 LABEL = POS = 859,290,869,300 ICON = FLAGS = 0 VIEW = 8 IN = 163 OUT = 183 215 IV = 0 9 CV = 0 9 0 0.46966 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 1.5* s210:tsuspsol A ADDIN = [BLOCK] NUM = 505 TYPE = 1:CLF,1 NAME = Clf505 LABEL = POS = 859,312,869,322 ICON = FLAGS = 0 VIEW = 4 IN = 183 OUT = 191 240 IV = 0 0 0.300000012 15 CV = 0 0 0.3 15 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 506 TYPE = 1:SPLIT,2 NAME = Split506 LABEL = dust reclaim POS = 802,303,812,313 ICON = FLAGS = 256 VIEW = 4 IN = 871 OUT = 874 875 IV = 0 2 0 0.99000001 0.99000001 CV = 0 2 0 0.99 0.99 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 510 TYPE = 1:MIX,1 NAME = Mix510 LABEL = Dregs Washer POS = 748,253,758,263 ICON = FLAGS = 256 VIEW = 4 IN = 354 204 162 OUT = 356 IV = 0 0 3 CV = 0 0 3 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 511 TYPE = 1:SPLIT,3 NAME = Split511 LABEL = Dregs Washer Effluent POS = 748,276,758,286 ICON = FLAGS = 256 VIEW = 4 IN = 356 OUT = 850 210 IV = 0 3 0.800000012 0 0.980000019 CV = 0 3 0.8 0 0.98 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 512 TYPE = 1:MIX,1 NAME = Mix512 LABEL = Weak Wash Tank POS = 748,312,758,322 ICON = FLAGS = 256 VIEW = 4 IN = 850 240 OUT = 860 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 513 TYPE = 1:SPLIT,2 NAME = Split513 LABEL = Weak Wash Losses POS = 748,332,758,342 ICON = FLAGS = 256 VIEW = 4 IN = 860 OUT = 861 211 IV = 0 2 0 0.0149999997 0.0149999997 CV = 0 2 0 0.015 0.015 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 514 TYPE = 1:SPLIT,2 NAME = Split514 LABEL = POS = 723,332,733,342 ICON = FLAGS = 0 VIEW = 4 IN = 861 OUT = 862 863 IV = 0 2 CV = 0 2 0 0.63 0.63 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = PSpec Frm = PSpec Frm = A ADDIN = 2 =1 b226:3 =2 b514:3 [BLOCK] NUM = 515 TYPE = 1:SPLIT,11 NAME = Split515 LABEL = POS = 157,332,167,342 ICON = FLAGS = 0 VIEW = 4 IN = 891 OUT = 890 34 IV = 0 12 0 0.349999994 CV = 0 12 0 0.35 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 516 TYPE = 1:SPLIT,11 NAME = Split516 LABEL = POS = 182,332,192,342 ICON = FLAGS = 0 VIEW = 4 IN = 171 OUT = 885 886 IV = 0 12 0 0 0 0 23.6000004 CV = 0 12 0 0 0 0 23.6 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 520 TYPE = 1:HEATX,3 NAME = Heatx520 LABEL = POS = 878,601,888,611 ICON = FLAGS = 0 VIEW = 4 IN = 524 893 OUT = 892 894 895 IV = 0 3 10 CV = 0 3 10 0 0 0 0 0 0 0 10825.9 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 521 TYPE = 1:STMIX,2 NAME = Stmix521 LABEL = POS = 878,628,888,638 ICON = FLAGS = 0 VIEW = 4 IN = 885 890 903 904 905 OUT = 893 IV = 0 2 5 CV = 0 2 5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 522 TYPE = 1:SPLIT,11 NAME = Split516~1 LABEL = POS = 186,634,196,644 ICON = FLAGS = 0 VIEW = 4 IN = 896 OUT = 900 903 IV = 0 12 0 0 0 0 23.6000004 CV = 0 12 0 0 0 0 23.6 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 523 TYPE = 1:SPLIT,11 NAME = Split515~1 LABEL = POS = 159,635,169,645 ICON = FLAGS = 0 VIEW = 4 IN = 901 OUT = 74 904 IV = 0 12 0 0.349999994 CV = 0 12 0 0.35 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 524 TYPE = 1:FLASH,1 NAME = Flash132~1 LABEL = POS = 186,663,196,673 ICON = FLAGS = 0 VIEW = 4 IN = 902 OUT = 896 73 IV = 0 0 760 0 0 0 19.0100002 23.0200005 CV = 0 0 760 0 0 0 19.01 23.02 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 525 TYPE = 1:SPLIT,10 NAME = Split525 LABEL = POS = 71,951,81,961 ICON = FLAGS = 0 VIEW = 4 IN = 146 OUT = 905 906 IV = 0 11 0 0 0 0 23.6000004 CV = 0 11 0 0 0 0 23.6 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 526 TYPE = 1:STORE,1 NAME = Store220~1 LABEL = POS = 322,761,332,771 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 111 1. yield loss odmt/hr\n2. frac t~ hat is lignin\n3. frac that is c~ arbs\n4. lignin yield loss\n5. c~ arbs yield loss OPT = CP CmpPs Num = 6 PSpec = 4 Frm = b526:3/(s216:tsuspsol * (1-s216:lignin )) PSpec = 3 Frm = b526:2/( s216:tsuspsol * s216:lignin ) PSpec = 2 Frm = b526:1*0.2 PSpec = 1 Frm = b526:1*0.8 PSpec = 0 Frm = s216:tsuspsol * 0.02 PSpec = 5 Frm = (s51:1-s226:1)/s226:tsuspsol A ADDIN = [BLOCK] NUM = 530 TYPE = 1:MIX,1 NAME = Mix530 LABEL = POS = 281,1114,291,1124 ICON = FLAGS = 0 VIEW = 4 IN = 362 910 OUT = 911 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 531 TYPE = 2:REACTION,2 NAME = Reaction531 LABEL = Nuetralization of Sesqui POS = 303,1114,313,1124 ICON = FLAGS = 256 VIEW = 4 IN = 911 OUT = 912 IV = 0 2 0 0 24 1 46 0.733299971 21 1 1 1 1 0 1 1 1 0 1 1 CV = 0 2 0 0 24 1 46 0.7333 21 1 1 1 1 0 1 1 1 0 1 1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = C COMMENT = 0 [BLOCK] NUM = 532 TYPE = 1:SPLIT,1 NAME = Split532 LABEL = discharge CO2 POS = 324,1114,334,1124 ICON = FLAGS = 256 VIEW = 4 IN = 912 OUT = 913 916 IV = 0 1 0 0 0 0 46 CV = 0 1 0 0 0 0 46 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 533 TYPE = 1:SPLIT,1 NAME = Split533 LABEL = Purge uneeded spent acid POS = 348,1114,358,1124 ICON = FLAGS = 256 VIEW = 4 IN = 913 OUT = 914 915 IV = 0 1 CV = 0 1 0 0.568399 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = if(s913:tds=0,0,s881:1*1000/s913:TDS ) A ADDIN = [BLOCK] NUM = 534 TYPE = 1:STORE,1 NAME = Store534 LABEL = POS = 310,1086,320,1096 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 0 Frm = (s700:1+s259:1+s792:1+s814:1+s127:1+s742:1+s774:1)*s700:clo2 /1000 A ADDIN = [BLOCK] NUM = 535 TYPE = 1:SPLIT,2 NAME = Split535 LABEL = POS = 372,1093,382,1103 ICON = FLAGS = 0 VIEW = 4 IN = 914 OUT = 920 921 IV = 0 2 CV = 0 2 0 0.63 0.63 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 2 PSpec = 1 Frm = b226:3 PSpec = 2 Frm = b535:3 A ADDIN = [BLOCK] NUM = 536 TYPE = 1:SPLIT,6 NAME = Split536 LABEL = Evap Condensate Distribution POS = 386,339,396,349 ICON = FLAGS = 256 VIEW = 8 IN = 922 OUT = 923 924 925 944 IV = 0 6 4 0.0500000007 0 0 0.00999999978 CV = 0 6 4 0.0664804 0.466762 0 0.499998 LINKS = 1 30 CTRL 17 0 2 7 3 551 10 0 1 0 1 0.005 0 1 2 0 0 0 0 0 0 1 0.08 1 0.05 0 1 0.01 1 35 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 3 PSpec = 3 Frm = (if(s387:tsuspsol + s52:tsuspsol + s124:tsuspsol =0,0, s52:tsuspsol / (s387:tsuspsol + s52:tsuspsol + s124:tsuspsol )))*(1-s944:1/s922:1) PSpec = 5 Frm = if(s387:tsuspsol + s52:tsuspsol + s124:tsuspsol =0,1, s387:tsuspsol / (s387:tsuspsol + s52:tsuspsol + s124:tsuspsol )) PSpec = 4 Frm = if(s387:tsuspsol + s52:tsuspsol + s124:tsuspsol =0,0, s124:tsuspsol / (s387:tsuspsol + s52:tsuspsol + s124:tsuspsol )) A ADDIN = [BLOCK] NUM = 540 TYPE = 1:MIX,1 NAME = Mix540 LABEL = Evap Condensate Collection POS = 386,316,396,326 ICON = FLAGS = 256 VIEW = 4 IN = 180 139 363 384 OUT = 922 IV = 0 0 4 CV = 0 0 4 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 541 TYPE = 1:CTRL,1 NAME = Ctrl541 LABEL = POS = 993,267,1003,277 ICON = FLAGS = 0 VIEW = 4 IN = 350 933 OUT = 804 926 IV = 0 2 0.0299999993 CV = 0 2 0.03 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 542 TYPE = 1:MIX,1 NAME = Mix542 LABEL = POS = 993,251,1003,261 ICON = FLAGS = 0 VIEW = 4 IN = 930 931 OUT = 932 IV = 0 0 2 CV = 0 0 2 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 543 TYPE = 1:SPLIT,2 NAME = Split543 LABEL = POS = 993,286,1003,296 ICON = FLAGS = 0 VIEW = 8 IN = 926 OUT = 934 935 IV = 0 2 CV = 0 2 0 0.499998 0.499998 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 2 PSpec = 1 Frm = if(s43:tsuspsol + s53:tsuspsol =0,0,s43:tsuspsol /(s43:tsuspsol + s53:tsuspsol )) PSpec = 2 Frm = b543:3 A ADDIN = [BLOCK] NUM = 544 TYPE = 1:MIX,1 NAME = Mix544 LABEL = POS = 779,359,789,369 ICON = FLAGS = 0 VIEW = 4 IN = 44 55 936 940 942 OUT = 941 IV = 0 0 5 CV = 0 0 5 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 545 TYPE = 1:DILUTE,2 NAME = Dilute545 LABEL = POS = 290,418,300,428 ICON = FLAGS = 0 VIEW = 4 IN = 252 43 OUT = 220 245 IV = 0 2 0.100000001 CV = 0 2 0.1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 546 TYPE = 1:DILUTE,2 NAME = Dilute546 LABEL = POS = 292,721,302,731 ICON = FLAGS = 0 VIEW = 4 IN = 242 53 OUT = 105 250 IV = 0 2 0.100000001 CV = 0 2 0.1 LINKS = 0 UNITS = 0 COMMENT = 0 OPT = ADDIN = [BLOCK] NUM = 550 TYPE = 1:STORE,1 NAME = Store550 LABEL = POS = 83,441,93,451 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = PSpec Frm = PSpec Frm = A ADDIN = 2 =0 s23:tsuspsol /s360:tsuspsol =1 s82:tsuspsol /s361:tsuspsol [BLOCK] NUM = 551 TYPE = 1:STORE,1 NAME = Store551 LABEL = POS = 414,374,424,384 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 0 Frm = s36:1+s100:1 A ADDIN = [BLOCK] NUM = 552 TYPE = 1:STORE,1 NAME = Store552 LABEL = POS = 817,474,827,484 ICON = FLAGS = 0 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = PSpec Frm = PSpec Frm = PSpec Frm = PSpec Frm = PSpec Frm = A ADDIN = 5 =4 s496:1/1000 =3 s477:1/1000 =2 s494:1*2.2 =1 s475:1*2.2 =0 s482:1*2.2 [BLOCK] NUM = 553 TYPE = 1:STORE,1 NAME = Store553 LABEL = 150# balance POS = 766,416,776,426 ICON = FLAGS = 256 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 0 Frm = b255:6-s482:1-s475:1 A ADDIN = [BLOCK] NUM = 554 TYPE = 1:STORE,1 NAME = Store554 LABEL = 50# balance POS = 790,416,800,426 ICON = FLAGS = 256 VIEW = 8 IN = OUT = IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OPT = CP CmpPs Num = 1 PSpec = 0 Frm = b255:7-(s477:1/2000/1.1)-s494:1 ADDIN = A [BLOCK] NUM = 600 TYPE = 1:STORE,1 NAME = Store300~2 LABEL = Cooling water properties POS = 892,955,902,965 ICON = FLAGS = 256 VIEW = 4 IN = OUT = IV = 0 25 60 CV = 0 25 60 LINKS = 0 UNITS = 0 COMMENT = 1 LEN = 55 1. Temp\n2. Outlet temp\n3. Heat~ exchanged MJ/mt-water OPT = CP CLR CmpPs Num = 1 PSpec = 2 Frm = (b600:1-b600:2)*b400:1 CLR = 255 255 0 A ADDIN = [STREAM] NUM = 1 TYPE = 0,1 NAME = S1 FLAGS = 512 VIEW = 8 OUT = 221,1 IN = 131,2 POS = 149,81 162,81 162,71 IV = 0 139.2 1 20 0 0.2795 0.4996 0.0238 0.1763 0.0207 CV = 0 82.9686 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 27 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 2 TYPE = 0,1 NAME = S2 FLAGS = 0 VIEW = 8 OUT = 216,1 IN = 1,1 POS = 167,40 188,40 -1,-1 47,533 80,533 IV = CV = 0 41.4843 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 760 0 0 0 0 0 27 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 3 TYPE = 0,1 NAME = S3 FLAGS = 0 VIEW = 8 OUT = 214,1 IN = 1,2 POS = 167,47 187,47 -1,-1 49,250 70,250 IV = CV = 0 41.4843 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 760 0 0 0 0 0 27 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 4 TYPE = 0,1 NAME = S4 FLAGS = 0 VIEW = 4 OUT = 213,1 IN = 237,1 POS = 228,107 251,107 -1,-1 502,482 517,482 IV = CV = 0 14.2299 1 20 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 5 TYPE = 0,1 NAME = S5 FLAGS = 512 VIEW = 8 OUT = 60,1 IN = 198,1 POS = 161,169 161,195 -1,-1 57,816 109,816 IV = 0 52.8 1 20 0 0.268 0.436 0.198 0.066 0.032 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 0 0 0 0 0 760 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 27 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 6 TYPE = 0,1 NAME = S6 FLAGS = 0 VIEW = 8 OUT = 7,1 IN = 6,1 POS = 113,350 113,360 IV = CV = 0 142.689 0.130739 160 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 166.278 39.0323 / CV = 0.152007 1.84251 7.55653 5.15664 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 144.44 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 7 TYPE = 0,1 NAME = S7 FLAGS = 0 VIEW = 8 OUT = 4,1 IN = 3,1 POS = 113,274 113,283 IV = CV = 0 119.759 0.34724 130 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 1.94415 46.0417 25.8345 2.19529 9.00336 / CV = 6.14397 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 138.096 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 8 TYPE = 0,1 NAME = S8 FLAGS = 0 VIEW = 8 OUT = 5,1 IN = 4,1 POS = 113,293 113,302 IV = CV = 0 119.759 0.34724 160 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 1.94415 46.0417 25.8345 2.19529 9.00336 / CV = 6.14397 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 169.964 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 9 TYPE = 0,1 NAME = S9 FLAGS = 0 VIEW = 8 OUT = 234,1 IN = 5,1 POS = 113,312 113,322 IV = CV = 0 121.048 0.332892 160 0 0.288958 0.464396 0.0515996 0.185759 0.00928792 0 0 0 0 0 0 0 0 0 17.6593 45.5772 / CV = 20.4475 2.17191 8.90747 6.07854 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 10 TYPE = 0,1 NAME = S10 FLAGS = 0 VIEW = 4 OUT = 11,1 IN = 7,1 POS = 113,370 113,379 IV = CV = 0 43.5285 0.428571 160 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 166.278 39.0323 / CV = 0.152007 1.84251 7.55653 5.15664 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 161.118 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 11 TYPE = 0,1 NAME = S11 FLAGS = 0 VIEW = 4 OUT = 8,1 IN = 7,2 POS = 118,365 131,365 IV = CV = 0 99.1606 0 160 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 166.278 39.0323 0.152007 1.84251 7.55653 5.15664 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 137.118 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 12 TYPE = 0,1 NAME = S5~1 FLAGS = 0 VIEW = 8 OUT = 3,1 IN = 20,1 POS = 113,255 113,264 IV = CV = 0 119.759 0.34724 84.4264 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 1.94415 46.0417 25.8345 2.19529 / CV = 9.00336 6.14397 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 89.6843 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 13 TYPE = 0,1 NAME = S13 FLAGS = 0 VIEW = 4 OUT = 495,1 IN = 110,1 POS = 781,236 793,236 IV = CV = 0 179.814 0.0000684114 83.7292 0 0 0 0 0 0 0 0 0.00000420621 0.00692026 0 0 0 0.993075 0 0 72.4299 11.5317 / CV = 2.2843 14.0897 59.8862 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 75.0113 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 14 TYPE = 0,1 NAME = S14 FLAGS = 0 VIEW = 4 OUT = 12,1 IN = 11,1 POS = 113,389 113,398 IV = CV = 0 43.5285 0.428571 130 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 78.3999 21.2438 / CV = 2.03971 1.00107 4.09576 2.80181 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 140.24 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 15 TYPE = 0,1 NAME = S15 FLAGS = 0 VIEW = 4 OUT = 13,1 IN = 12,1 POS = 113,408 113,418 IV = CV = 0 257.557 0.0724308 98.795 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 39.7882 / CV = 13.4279 2.86913 0.631358 2.57518 1.76712 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 97.3786 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 16 TYPE = 0,1 NAME = S16 FLAGS = 0 VIEW = 4 OUT = 14,1 IN = 13,2 POS = 109,423 96,423 96,408 IV = CV = 0 89.6615 0 98.795 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 39.7882 13.4279 2.86913 0.631358 2.57518 1.76712 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 94.874 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 20 TYPE = 0,1 NAME = S20 FLAGS = 512 VIEW = 8 OUT = 11,2 IN = 14,1 POS = 95,398 95,385 108,385 IV = 0 140.49 0 130 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.8907 7.01405 0.0323911 0.206931 1.33698 0.976414 0 0 / IV = 0 0 0 0.00176094 0 0 0 0 0 0 0 9.623E-18 0 0.0437621 0 0 0 0 0 0 0 760 CV = 0 89.6615 0 130 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 39.7882 13.4279 2.86913 0.631358 2.57518 1.76712 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 124.841 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 21 TYPE = 0,1 NAME = S21 FLAGS = 0 VIEW = 4 OUT = 8,2 IN = 11,2 POS = 118,384 136,384 136,370 IV = CV = 0 89.6605 0 145.847 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 82.4514 22.0639 1.95268 1.03986 4.25532 2.91038 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 134.976 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 22 TYPE = 0,1 NAME = S22 FLAGS = 0 VIEW = 4 OUT = 34,1 IN = 121,1 POS = 115,652 115,663 IV = CV = 0 142.689 0.130739 160 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 166.278 39.0323 / CV = 0.152007 1.84251 7.55652 5.15664 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 144.44 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 23 TYPE = 0,1 NAME = S23 FLAGS = 0 VIEW = 8 OUT = 15,1 IN = 13,1 POS = 119,423 129,423 IV = CV = 0 167.895 0.111111 98.795 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 39.7882 / CV = 13.4279 2.86913 0.631358 2.57518 1.76712 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 98.7161 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 24 TYPE = 0,1 NAME = S24 FLAGS = 0 VIEW = 8 OUT = 16,1 IN = 15,1 POS = 139,423 148,423 IV = CV = 0 395.901 0.0471204 94.7737 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 35.2657 / CV = 12.5124 2.96627 0.588054 2.39708 1.64593 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 92.9254 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 25 TYPE = 0,1 NAME = S25 FLAGS = 0 VIEW = 8 OUT = 17,1 IN = 16,2 POS = 158,423 167,423 IV = CV = 0 395.722 0.0469079 94.7737 0 0.018631 0.812519 0.0323995 0.116479 0.0199709 0 0 0 0 0 0 0 0 0 35.2657 / CV = 12.5124 2.96627 0.588054 2.39708 1.64593 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 92.9184 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 26 TYPE = 0,1 NAME = S26 FLAGS = 512 VIEW = 4 OUT = 12,2 IN = 15,2 POS = 134,418 134,403 118,403 IV = 0 347.645 0 84.7203 0 0 0 0.157514 1.01769 0.743239 / IV = 0 0 0 0 0 0.0013404 0 0 0 CV = 0 214.028 0 91.7131 0 0 0 0.556168 2.26593 1.55669 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 0 0 0 0 0 0 0 0 0 0 28.0807 5.34073 0.0246557 0 0 0 0 9.517E-18 0 0.0333111 0 0 0 0 0 0 0 760 0 0 0 0 0 0 0 0 0 0 0 0 31.9355 11.8382 3.03781 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 88.6615 [STREAM] NUM = 27 TYPE = 0,1 NAME = S27 FLAGS = 512 VIEW = 8 OUT = 15,2 IN = 17,2 POS = 172,428 172,441 134,441 134,428 IV = 0 727.43 0 84.7203 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 28.0807 5.34074 0.0246557 0.157514 1.01769 0.743237 / IV = 0 0 0 0 0 0.0013404 0 0 0 0 0 0 0 8.921E-18 0 0.0333111 0 0 0 0 0 0 0 760 CV = 0 442.033 0 91.7131 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 31.9355 11.8382 3.03781 0.556168 2.26593 1.55669 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 88.6615 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 28 TYPE = 512,1 NAME = S28 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 16,1 POS = 153,428 153,438 IV = CV = 0 0.1797 0.515152 94.7737 0 0.0375459 0.814262 0.0169366 0.0928499 0.038406 0 0 0 0 0 0 0 0 0 35.2657 / CV = 12.5124 2.96627 0.588054 2.39708 1.64593 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 108.45 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 29 TYPE = 0,1 NAME = S29 FLAGS = 512 VIEW = 8 OUT = 17,2 IN = 18,2 POS = 191,428 191,440 182,440 182,408 172,408 172,418 IV = 0 294.963 0 69.8951 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 13.3264 2.5382 0.011701 0.074752 0.482972 0.352721 / IV = 0 0 0 0 0 0.000636121 0 0 0 0 0 0 0 5.994E-18 0 0.0158086 CV = 0 182.437 0 79.86 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 19.3341 9.28981 3.31031 0.435631 1.77016 1.21931 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.0246 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 30 TYPE = 0,1 NAME = S30 FLAGS = 0 VIEW = 8 OUT = 18,1 IN = 17,1 POS = 177,423 186,423 IV = CV = 0 136.125 0.136364 85.0512 0 0.018631 0.812519 0.0323995 0.116479 0.0199709 0 0 0 0 0 0 0 0 0 24.728 / CV = 10.3828 3.19506 0.48732 1.98275 1.36399 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 86.7808 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 31 TYPE = 0,1 NAME = S31 FLAGS = 0 VIEW = 4 OUT = 10,1 IN = 8,1 POS = 141,365 157,365 IV = CV = 0 188.821 0 153.008 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 126.474 30.9749 1.00705 1.46137 5.98897 4.09002 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 136.101 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 32 TYPE = 0,1 NAME = S32 FLAGS = 0 VIEW = 8 OUT = 19,1 IN = 18,1 POS = 196,423 205,423 IV = CV = 0 136.125 0.136364 75.8385 0 0.018631 0.812519 0.0323995 0.116479 0.0199709 0 0 0 0 0 0 0 0 0 15.3211 / CV = 8.48088 3.39889 0.397366 1.61276 1.11221 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 77.9633 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 33 TYPE = 0,1 NAME = S33 FLAGS = 512 VIEW = 8 OUT = 18,2 IN = 19,2 POS = 207,428 207,440 202,440 202,407 191,407 191,418 IV = 0 294.958 0 60.4339 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 4.60915 0.881535 0.00404698 0.0258542 0.167044 0.121994 / IV = 0 0 0 0 0 0.000220013 0 0 0 0 0 0 0 3.710E-18 0 0.00546766 0 0 0 0 0 0 0 760 CV = 0 182.437 0 72.6996 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 12.3151 7.87063 3.46239 0.368512 1.4941 1.03145 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 71.4454 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 34 TYPE = 0,2 NAME = S34 FLAGS = 0 VIEW = 8 OUT = 214,2 IN = 515,2 POS = 162,332 162,216 75,216 75,245 IV = CV = 0 6.50421 1551 122.959 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 35.7967 0 0 0 2.82524 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 647.582 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 35 TYPE = 512,1 NAME = S35 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 396,1 POS = 239,365 255,365 IV = CV = 0 172.329 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.134 33.9393 1.10342 1.60123 6.27011 4.48144 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 36 TYPE = 256,1 NAME = S31~1 FLAGS = 8 VIEW = 8 OUT = 62,1 IN = 0,0 POS = 364,385 364,399 IV = 0 458.37 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 0 0 55 0 14042.7 CV = 0 -0.0000305176 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 55 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 3*s125:tsuspsol +s125:1-s282:1-s923:1 A ADDIN = [STREAM] NUM = 37 TYPE = 0,1 NAME = S37 FLAGS = 0 VIEW = 8 OUT = 204,1 IN = 22,2 POS = 237,423 246,423 IV = CV = 0 1004.48 0.0182959 73.1383 0 0.0184513 0.812517 0.0325451 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95267 3.45386 0.372391 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 72.3207 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 40 TYPE = 512,1 NAME = S36 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 22,1 POS = 232,428 232,438 IV = CV = 0 8.20852 0.0224949 73.1383 0 0.0365218 0.812737 0.0179133 0.0936796 0.0391484 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95267 3.45386 0.372391 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 72.4281 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 41 TYPE = 0,1 NAME = S41 FLAGS = 0 VIEW = 4 OUT = 19,2 IN = 21,2 POS = 270,428 270,440 213,440 213,428 IV = CV = 0 1059 0 72.6996 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 12.3151 7.87063 3.46239 0.368512 1.4941 1.03145 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 42 TYPE = 0,1 NAME = S42 FLAGS = 0 VIEW = 4 OUT = 22,1 IN = 19,1 POS = 215,423 227,423 IV = CV = 0 1012.68 0.0183299 73.1383 0 0.018631 0.812519 0.0323995 0.116479 0.0199709 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95267 3.45386 0.372391 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 72.3215 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 43 TYPE = 0,1 NAME = S43 FLAGS = 0 VIEW = 4 OUT = 545,1 IN = 21,1 POS = 275,423 290,423 IV = CV = 0 134.096 0.136364 70.4283 0 0.0184513 0.812517 0.0325451 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 10.2356 / CV = 7.45162 3.50852 0.348698 1.4126 0.975982 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 44 TYPE = 256,1 NAME = S44 FLAGS = 8 VIEW = 8 OUT = 544,1 IN = 0,0 POS = 758,360 779,360 IV = CV = 0 0.0132312 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 35.6192 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 3 PSpec = 3 Frm = s886:temp PSpec = 1 Frm = s886:1 PSpec = 23 Frm = s886:HS A ADDIN = [STREAM] NUM = 45 TYPE = 0,1 NAME = S42~1 FLAGS = 0 VIEW = 4 OUT = 24,1 IN = 51,1 POS = 217,726 229,726 IV = CV = 0 1012.69 0.0183299 73.1383 0 0.0186393 0.812512 0.0323992 0.116478 0.0199708 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95266 3.45386 0.37239 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 72.3216 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 46 TYPE = 512,1 NAME = S36~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 24,1 POS = 234,731 234,741 IV = CV = 0 8.20865 0.0224949 73.1383 0 0.0365378 0.812723 0.017913 0.0936781 0.0391478 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95266 3.45386 0.37239 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 72.4282 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 50 TYPE = 0,1 NAME = S37~1 FLAGS = 0 VIEW = 8 OUT = 54,1 IN = 24,2 POS = 239,726 248,726 IV = C AV = 0 1004.48 0.0182959 73.1383 0 0.0184595 0.81251 0.0325448 0.116707 0.0197781 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95266 3.45386 0.37239 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 72.3207 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 51 TYPE = 0,1 NAME = S92~1 FLAGS = 0 VIEW = 4 OUT = 136,2 IN = 52,1 POS = 372,711 372,721 IV = CV = 0 107.525 0 63.1566 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.202069 0 0 0 0.00375035 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 52 TYPE = 0,1 NAME = S387~1 FLAGS = 0 VIEW = 8 OUT = 25,1 IN = 54,2 POS = 258,726 267,726 IV = CV = 0 999.461 0.0182959 73.1383 0 0.0184595 0.81251 0.0325448 0.116707 0.0197781 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95266 3.45386 0.37239 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 72.3207 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 53 TYPE = 0,1 NAME = S43~1 FLAGS = 0 VIEW = 8 OUT = 546,1 IN = 25,1 POS = 277,726 292,726 IV = CV = 0 134.098 0.136364 70.4283 0 0.0184595 0.81251 0.0325448 0.116707 0.0197781 0 0 0 0 0 0 0 0 0 10.2356 / CV = 7.45163 3.50852 0.348698 1.4126 0.975998 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 72.694 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 54 TYPE = 0,1 NAME = S41~1 FLAGS = 0 VIEW = 4 OUT = 51,2 IN = 25,2 POS = 272,731 272,743 215,743 215,731 IV = CV = 0 1059 0 72.6997 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 12.3151 7.87063 3.4624 0.368512 1.4941 1.03145 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 71.4454 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 55 TYPE = 256,1 NAME = S55 FLAGS = 8 VIEW = 4 OUT = 544,2 IN = 0,0 POS = 758,367 779,367 IV = CV = 0 0.0132312 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 35.6192 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 3 PSpec = 3 Frm = s900:temp PSpec = 1 Frm = s900:1 PSpec = 23 Frm = s900:HS A ADDIN = 0 [STREAM] NUM = 56 TYPE = 1024,1 NAME = S56 FLAGS = 8 VIEW = 8 OUT = 123,1 IN = 0,0 COPY = 7 12 366 4294967295 0 POS = 592,147 611,147 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 60 TYPE = 0,1 NAME = S5~2 FLAGS = 0 VIEW = 8 OUT = 30,1 IN = 26,1 POS = 115,538 115,547 IV = CV = 0 119.759 0.34724 84.4264 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 1.94415 46.0417 25.8345 2.19529 / CV = 9.00336 6.14397 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 89.6843 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 61 TYPE = 0,1 NAME = S7~1 FLAGS = 0 VIEW = 8 OUT = 31,1 IN = 30,1 POS = 115,557 115,566 IV = CV = 0 119.759 0.34724 130 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 1.94415 46.0417 25.8345 2.19529 9.00336 / CV = 6.14397 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 138.096 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 62 TYPE = 0,1 NAME = S8~1 FLAGS = 0 VIEW = 8 OUT = 32,1 IN = 31,1 POS = 115,576 115,585 IV = CV = 0 119.759 0.34724 160 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 1.94415 46.0417 25.8345 2.19529 9.00336 / CV = 6.14397 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 169.964 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 63 TYPE = 0,1 NAME = S9~1 FLAGS = 0 VIEW = 8 OUT = 53,1 IN = 32,1 POS = 115,595 115,605 IV = CV = 0 121.048 0.332892 160 0 0.288958 0.464396 0.0515996 0.185759 0.00928793 0 0 0 0 0 0 0 0 0 17.6593 45.5772 / CV = 20.4475 2.17191 8.90747 6.07854 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 64 TYPE = 0,1 NAME = S440~1 FLAGS = 0 VIEW = 8 OUT = 33,1 IN = 53,1 POS = 114,615 114,623 IV = CV = 0 142.689 0.130739 160 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 166.278 39.0323 / CV = 17.3464 1.84251 7.55652 5.15664 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 142.651 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 65 TYPE = 0,1 NAME = S6~1 FLAGS = 0 VIEW = 8 OUT = 121,1 IN = 33,1 POS = 115,633 115,642 IV = CV = 0 142.689 0.130739 160 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 166.278 39.0323 / CV = 0.152007 1.84251 7.55652 5.15664 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 144.44 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 66 TYPE = 0,1 NAME = S11~1 FLAGS = 0 VIEW = 4 OUT = 35,1 IN = 34,2 POS = 120,668 133,668 IV = CV = 0 99.1606 0 160 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 166.278 39.0323 0.152007 1.84251 7.55652 5.15664 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 137.118 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 70 TYPE = 0,1 NAME = S10~1 FLAGS = 0 VIEW = 4 OUT = 40,1 IN = 34,1 POS = 115,673 115,682 IV = CV = 0 43.5285 0.428571 160 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 166.278 39.0323 / CV = 0.152007 1.84251 7.55652 5.15664 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 71 TYPE = 0,1 NAME = S21~1 FLAGS = 0 VIEW = 4 OUT = 35,2 IN = 40,2 POS = 120,687 138,687 138,673 IV = CV = 0 89.6616 0 145.847 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 82.4508 22.0638 1.9527 1.03985 4.25529 2.91036 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 134.976 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 72 TYPE = 0,1 NAME = S31~2 FLAGS = 0 VIEW = 4 OUT = 36,1 IN = 35,1 POS = 143,668 159,668 IV = CV = 0 188.822 0 153.008 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 126.473 30.9748 1.00706 1.46137 5.98894 4.09 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 136.101 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 73 TYPE = 0,1 NAME = S676~1 FLAGS = 0 VIEW = 4 OUT = 55,1 IN = 524,1 POS = 196,668 221,668 IV = CV = 0 172.33 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.133 33.9392 1.10344 1.60123 6.27009 4.48143 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 74 TYPE = 0,2 NAME = S34~1 FLAGS = 0 VIEW = 8 OUT = 216,2 IN = 523,2 POS = 164,635 164,499 84,499 84,528 IV = CV = 0 6.50421 1551 122.959 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 35.7967 0 0 0 2.82524 LINKS = 0 UNITS = 0 A COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 75 TYPE = 0,1 NAME = S20~1 FLAGS = 512 VIEW = 8 OUT = 40,2 IN = 43,1 POS = 97,701 97,688 110,688 IV = 0 140.49 0 130 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.8907 7.01405 0.0323911 0.206931 1.33698 0.976414 0 0 / IV = 0 0 0 0.00176094 0 0 0 0 0 0 0 9.623E-18 0 0.0437621 0 0 0 0 0 0 0 760 CV = 0 89.6613 0 130 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 39.788 13.4279 2.86913 0.631356 2.57517 1.76712 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 124.841 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 76 TYPE = 0,1 NAME = S14~1 FLAGS = 0 VIEW = 8 OUT = 41,1 IN = 40,1 POS = 115,692 115,701 IV = CV = 0 43.5285 0.428571 130 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 78.3996 21.2437 / CV = 2.03972 1.00106 4.09575 2.8018 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 140.24 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 80 TYPE = 0,1 NAME = S26~1 FLAGS = 512 VIEW = 4 OUT = 41,2 IN = 44,2 POS = 136,721 136,706 120,706 IV = 0 347.645 0 84.7203 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 28.0807 5.34073 0.0246557 0.157514 1.01769 0.743239 / IV = 0 0 0 0 0 0.0013404 0 0 0 0 0 0 0 9.517E-18 0 0.0333111 0 0 0 0 0 0 0 760 CV = 0 214.028 0 91.713 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 31.9353 11.8382 3.03782 0.556166 2.26592 1.55669 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 88.6614 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 81 TYPE = 0,1 NAME = S15~1 FLAGS = 0 VIEW = 4 OUT = 42,1 IN = 41,1 POS = 115,711 115,721 IV = CV = 0 257.557 0.0724308 98.795 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 39.788 / CV = 13.4279 2.86913 0.631356 2.57517 1.76712 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 97.3785 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 82 TYPE = 0,1 NAME = S23~1 FLAGS = 0 VIEW = 8 OUT = 44,1 IN = 42,1 POS = 121,726 131,726 IV = CV = 0 167.895 0.111111 98.795 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 39.788 / CV = 13.4279 2.86913 0.631356 2.57517 1.76712 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 98.716 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 83 TYPE = 0,1 NAME = S16~1 FLAGS = 0 VIEW = 4 OUT = 43,1 IN = 42,2 POS = 111,726 98,726 98,711 IV = CV = 0 89.6613 0 98.795 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 39.788 13.4279 2.86913 0.631356 2.57517 1.76712 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 94.874 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 84 TYPE = 0,1 NAME = S27~1 FLAGS = 512 VIEW = 8 OUT = 44,2 IN = 46,2 POS = 174,731 174,744 136,744 136,731 IV = 0 727.43 0 84.7203 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 28.0807 5.34074 0.0246557 0.157514 1.01769 0.743237 / IV = 0 0 0 0 0 0.0013404 0 0 0 0 0 0 0 8.921E-18 0 0.0333111 0 0 0 0 0 0 0 760 CV = 0 442.035 0 91.713 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 31.9352 11.8382 3.03782 0.556165 2.26592 1.55668 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 88.6614 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 85 TYPE = 0,1 NAME = S24~1 FLAGS = 0 VIEW = 8 OUT = 45,1 IN = 44,1 POS = 141,726 150,726 IV = CV = 0 395.901 0.0471204 94.7736 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 35.2655 / CV = 12.5124 2.96628 0.588052 2.39707 1.64593 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 92.9254 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 86 TYPE = 512,1 NAME = S28~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 45,1 POS = 155,731 155,741 IV = CV = 0 0.179395 0.515152 94.7736 0 0.0359083 0.815647 0.0169655 0.0930079 0.0384714 0 0 0 0 0 0 0 0 0 35.2655 / CV = 12.5124 2.96628 0.588052 2.39707 1.64593 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 108.45 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 90 TYPE = 0,1 NAME = S25~1 FLAGS = 0 VIEW = 8 OUT = 46,1 IN = 45,2 POS = 160,726 169,726 IV = CV = 0 395.722 0.0469082 94.7736 0 0.0186393 0.812512 0.0323993 0.116478 0.0199708 0 0 0 0 0 0 0 0 0 35.2655 / CV = 12.5124 2.96628 0.588052 2.39707 1.64593 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 92.9184 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 91 TYPE = 0,1 NAME = S29~1 FLAGS = 512 VIEW = 8 OUT = 46,2 IN = 50,2 POS = 193,731 193,743 184,743 184,711 174,711 174,721 IV = 0 294.963 0 69.8951 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 13.3264 2.5382 0.011701 0.074752 0.482972 0.352721 / IV = 0 0 0 0 0 0.000636121 0 0 0 0 0 0 0 5.994E-18 0 0.0158086 CV = 0 182.437 0 79.86 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 19.334 9.28979 3.31032 0.43563 1.77016 1.21931 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.0246 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 92 TYPE = 0,1 NAME = S92 FLAGS = 0 VIEW = 4 OUT = 143,2 IN = 62,1 POS = 367,409 367,418 IV = CV = 0 107.524 0 63.1566 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.202069 0 0 0 0.00375035 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 63.1482 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 93 TYPE = 0,1 NAME = S30~1 FLAGS = 0 VIEW = 8 OUT = 50,1 IN = 46,1 POS = 179,726 188,726 IV = CV = 0 136.126 0.136364 85.0511 0 0.0186393 0.812512 0.0323992 0.116478 0.0199708 0 0 0 0 0 0 0 0 0 24.7279 / CV = 10.3827 3.19507 0.487318 1.98274 1.36398 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 86.7808 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 94 TYPE = 0,1 NAME = S33~1 FLAGS = 512 VIEW = 8 OUT = 50,2 IN = 51,2 POS = 209,731 209,743 204,743 204,710 193,710 193,721 IV = 0 294.958 0 60.4339 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 4.60915 0.881535 0.00404698 0.0258542 0.167044 0.121994 / IV = 0 0 0 0 0 0.000220013 0 0 0 0 0 0 0 3.710E-18 0 0.00546766 0 0 0 0 0 0 0 760 CV = 0 182.438 0 72.6997 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 12.3151 7.87063 3.4624 0.368512 1.4941 1.03145 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 71.4454 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 95 TYPE = 0,1 NAME = S32~1 FLAGS = 0 VIEW = 8 OUT = 51,1 IN = 50,1 POS = 198,726 207,726 IV = CV = 0 136.126 0.136364 75.8385 0 0.0186393 0.812512 0.0323992 0.116478 0.0199708 0 0 0 0 0 0 0 0 0 15.321 / CV = 8.48087 3.39889 0.397365 1.61276 1.11221 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 77.9633 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 96 TYPE = 0,1 NAME = S226~1 FLAGS = 0 VIEW = 4 OUT = 143,1 IN = 144,1 POS = 347,423 362,423 IV = CV = 0 170.353 0.105203 70.5538 0 0.00250107 0.825652 0.0330712 0.118595 0.0201802 0 0 0 0 0 0 0 0 0 11.7626 / CV = 9.63477 4.76339 0.450672 1.82325 1.2614 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 71.7898 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 100 TYPE = 256,1 NAME = S31~2 FLAGS = 8 VIEW = 4 OUT = 52,1 IN = 0,0 POS = 368,687 368,701 IV = 0 458.37 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 0 0 55 0 14042.7 CV = 0 -0.0000839233 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 55 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 3*s226:tsuspsol +s226:1-s275:1-s924:1 A ADDIN = [STREAM] NUM = 101 TYPE = 512,1 NAME = S388~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 54,1 POS = 253,731 253,741 IV = CV = 0 5.02242 0.0182959 73.1383 0 0.0184595 0.81251 0.0325448 0.116707 0.0197781 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95266 3.45386 0.37239 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 102 TYPE = 0,1 NAME = S722~1 FLAGS = 0 VIEW = 4 OUT = 56,1 IN = 55,1 POS = 231,668 240,668 IV = CV = 0 172.33 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.133 33.9396 1.10344 1.60123 6.27009 4.48192 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 103 TYPE = 512,1 NAME = S35~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 56,1 POS = 250,668 266,668 IV = CV = 0 172.33 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.133 33.9396 1.10344 1.60123 6.27009 4.48192 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 104 TYPE = 256,1 NAME = S554~1 FLAGS = 8 VIEW = 4 OUT = 93,2 IN = 0,0 POS = 603,93 592,93 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 258.76 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 258.76 CV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 258.76 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 105 TYPE = 0,1 NAME = S105 FLAGS = 0 VIEW = 4 OUT = 25,2 IN = 546,2 POS = 296,721 296,706 272,706 272,721 IV = CV = 0 193.641 0 68.7811 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8.78956 7.157 3.5384 0.334772 1.35533 0.936998 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 106 TYPE = 0,1 NAME = S106 FLAGS = 0 VIEW = 4 OUT = 61,1 IN = 60,1 POS = 114,821 114,833 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 110 TYPE = 0,1 NAME = S9~2 FLAGS = 0 VIEW = 8 OUT = 66,1 IN = 71,1 POS = 114,924 114,934 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 111 TYPE = 0,1 NAME = S440~2 FLAGS = 0 VIEW = 8 OUT = 70,1 IN = 66,1 POS = 114,944 114,952 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 112 TYPE = 0,1 NAME = S112 FLAGS = 0 0 0 VIEW = 8 OUT = 63,1 IN = 61,1 POS = 114,843 114,855 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 113 TYPE = 0,1 NAME = S113 FLAGS = 0 VIEW = 8 OUT = 65,1 IN = 63,1 POS = 114,865 114,875 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 114 TYPE = 0,1 NAME = S114 FLAGS = 0 VIEW = 4 OUT = 64,1 IN = 65,1 POS = 114,885 114,894 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 115 TYPE = 0,1 NAME = S115 0 0 0 FLAGS = 0 VIEW = 4 OUT = 71,1 IN = 64,1 POS = 114,904 114,914 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 116 TYPE = 0,1 NAME = S116 FLAGS = 0 VIEW = 4 OUT = 72,1 IN = 70,1 POS = 114,962 114,973 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 120 TYPE = 0,1 NAME = S120 FLAGS = 0 VIEW = 8 OUT = 82,1 IN = 72,1 POS = 119,981 139,981 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 121 TYPE = 512,2 0 0 0 NAME = S121 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 65,2 POS = 109,880 95,880 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 122 TYPE = 0,1 NAME = S37~2 FLAGS = 0 VIEW = 8 OUT = 73,1 IN = 84,2 POS = 247,978 256,978 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 123 TYPE = 512,1 NAME = S388~2 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 73,1 POS = 261,983 261,993 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 124 0 0 0 TYPE = 0,1 NAME = S387~2 FLAGS = 0 VIEW = 8 OUT = 83,1 IN = 73,2 POS = 266,978 275,978 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 125 TYPE = 0,1 NAME = S244~1 FLAGS = 0 VIEW = 4 OUT = 148,1 IN = 143,1 POS = 372,422 389,422 -1,-1 149,1167 175,1167 IV = CV = 0 53.7619 0.333333 63.8203 0 0.00250107 0.825652 0.0330712 0.118595 0.0201802 0 0 0 0 0 0 0 0 0 1.03503 / CV = 0.713298 0.343144 0.0324654 0.134826 0.0908681 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 / CV = 0 0 0 71.1686 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 126 TYPE = 256,1 NAME = S31~3 FLAGS = 8 VIEW = 8 OUT = 74,1 IN = 0,0 POS = 276,939 276,953 IV = 0 458.37 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 0 0 55 0 14042.7 CV = 0 0 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 55 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 3*b85:1+s144:1-s254:1-s283:1-s925:1 A ADDIN = [STREAM] NUM = 127 TYPE = 256,1 NAME = S127 FLAGS = 8 VIEW = 4 OUT = 465,2 IN = 0,0 POS = 325,1336 325,1345 IV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 0 0 0 000000000008 CV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 128 TYPE = 0,1 NAME = S128 FLAGS = 0 VIEW = 8 OUT = 98,2 IN = 466,2 POS = 361,1355 361,1364 345,1364 345,1355 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 130 TYPE = 0,1 NAME = S92~2 FLAGS = 0 VIEW = 4 OUT = 83,2 IN = 74,1 POS = 282,963 282,973 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 131 TYPE = 0,1 NAME = S41~2 FLAGS = 0 VIEW = 4 OUT = 75,2 IN = 83,2 POS = 280,983 280,995 223,995 223,983 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 132 TYPE = 0,1 NAME = S32~2 FLAGS = 0 VIEW = 8 OUT = 75,1 IN = 76,1 POS = 206,978 215,978 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 133 TYPE = 0,1 NAME = S42~2 FLAGS = 0 0 VIEW = 4 OUT = 84,1 IN = 75,1 POS = 225,978 237,978 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 134 TYPE = 0,1 NAME = S33~2 FLAGS = 512 VIEW = 8 OUT = 76,2 IN = 75,2 POS = 217,983 217,995 212,995 212,962 201,962 201,973 IV = 0 294.958 0 60.4339 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 4.60915 0.881535 0.00404698 0.0258542 0.167044 0.121994 / IV = 0 0 0 0 0 0.000220013 0 0 0 0 0 0 0 3.710E-18 0 0.00546766 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 135 TYPE = 0,1 NAME = S30~2 FLAGS = 0 VIEW = 8 OUT = 76,1 IN = 80,1 POS = 187,978 196,978 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 136 0 TYPE = 0,1 NAME = S29~2 FLAGS = 512 VIEW = 8 OUT = 80,2 IN = 76,2 POS = 201,983 201,995 192,995 192,963 182,963 182,973 IV = 0 294.963 0 69.8951 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 13.3264 2.5382 0.011701 0.074752 0.482972 0.352721 / IV = 0 0 0 0 0 0.000636121 0 0 0 0 0 0 0 5.994E-18 0 0.0158086 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 138 TYPE = 0,1 NAME = S138 FLAGS = 0 VIEW = 8 OUT = 122,1 IN = 88,2 POS = 566,240 566,257 IV = CV = 0 70.4577 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.416222 0 0 0 0.0193124 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 39.9887 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 139 TYPE = 0,1 NAME = S139 FLAGS = 0 VIEW = 8 OUT = 540,1 IN = 122,2 POS = 561,263 552,263 552,276 -1,-1 411,318 396,318 IV = CV = 0 70.4569 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.416227 0 0 0 0.00772505 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 39.989 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 140 TYPE = 0,1 NAME = S25~2 FLAGS = 0 VIEW = 8 OUT = 80,1 IN = 81,2 POS = 168,978 177,978 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 141 TYPE = 0,1 NAME = S27~2 FLAGS = 512 VIEW = 8 OUT = 82,2 IN = 80,2 POS = 182,983 182,996 144,996 144,983 IV = 0 727.43 0 84.7203 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 28.0807 5.34074 0.0246557 0.157514 1.01769 0.743237 / IV = 0 0 0 0 0 0.0013404 0 0 0 0 0 0 0 8.921E-18 0 0.0333111 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 142 TYPE = 0,1 NAME = S24~2 FLAGS = 0 VIEW = 8 OUT = 81,1 IN = 82,1 POS = 149,978 158,978 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 143 TYPE = 512,1 NAME = S28~2 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 81,1 POS = 163,983 163,993 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 [STREAM] NUM = 144 TYPE = 0,1 NAME = S43~2 FLAGS = 0 VIEW = 8 OUT = 140,1 IN = 83,1 POS = 285,978 296,978 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 9.95771 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 145 TYPE = 512,1 NAME = S36~2 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 84,1 POS = 242,983 242,993 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 146 TYPE = 0,2 NAME = S146 FLAGS = 0 VIEW = 4 OUT = 525,1 IN = 72,2 POS = 109,976 76,976 76,961 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 149 TYPE = 0,1 NAME = S149 FLAGS = 0 VIEW = 8 OUT = 98,1 IN = 97,1 POS = 330,1389 335,1389 335,1336 342,1336 342,1345 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 150 TYPE = 0,1 NAME = S150 FLAGS = 0 VIEW = 4 OUT = 61,2 IN = 82,2 POS = 144,973 144,842 119,842 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 151 TYPE = 0,1 NAME = S353~1 FLAGS = 0 VIEW = 4 OUT = 294,2 IN = 380,1 POS = 865,1460 865,1428 879,1428 IV = CV = 0 0.0435934 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.1401 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22459 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 152 TYPE = 512,1 NAME = S152 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 162,1 POS = 192,838 212,838 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 153 TYPE = 0,1 0 NAME = S345~1 FLAGS = 0 VIEW = 4 OUT = 294,1 IN = 178,1 POS = 884,1460 884,1434 IV = CV = 0 0.156936 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.1401 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22459 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 154 TYPE = 0,1 NAME = S136 FLAGS = 0 VIEW = 8 OUT = 297,1 IN = 102,1 POS = 676,54 686,54 IV = CV = 0 38.3067 0 84.271 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 449.412 128.635 3.67335 92.8996 0 18.5151 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 46.3038 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 155 TYPE = 0,1 NAME = S42~3 FLAGS = 0 VIEW = 8 OUT = 296,2 IN = 104,2 POS = 650,49 650,33 706,33 IV = CV = 0 5.84202 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 85 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 156 TYPE = 0,1 NAME = S156 FLAGS = 0 VIEW = 4 OUT = 363,1 IN = 132,1 POS = 192,365 210,365 IV = CV = 0 172.329 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.134 33.9393 1.10342 1.60123 6.27011 4.48144 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 160 TYPE = 0,32 NAME = S41~3 FLAGS = 512 VIEW = 8 OUT = 296,1 IN = 103,2 POS = 712,49 712,39 IV = 0 155.252 315.556 8.85743 0.741076 0 0 193.956 0 150.54 31.128 614.777 CV = 0 157.244 315.556 9.03402 1.56275 0 0 197.131 0 138.904 31.4876 621.881 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 161 TYPE = 0,1 NAME = S66~1 FLAGS = 0 VIEW = 8 OUT = 26,2 IN = 203,1 POS = 1068,271 1095,271 -1,-1 145,534 120,534 IV = CV = 0 71.8712 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1216 43.0474 3.65801 14.7466 10.238 LINKS = 0 UNITS = 1 51 66 -33 100 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 162 TYPE = 256,1 NAME = S162 FLAGS = 8 VIEW = 4 OUT = 510,3 IN = 0,0 POS = 768,260 758,260 IV = 0 0 0 60 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 0 0 0 0.983199 CV = 0 2.53719 0 60 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 2.7*(s204:totmass + s354:totmass ) A ADDIN = [STREAM] NUM = 163 TYPE = 0,1 NAME = S163 FLAGS = 0 VIEW = 4 OUT = 504,1 IN = 503,1 POS = 864,275 864,290 IV = CV = 0 209.31 0.0904414 66.3273 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538194 3.317E-11 0 0.0716802 0 0 7.81583 / CV = 4.25273 0.376227 1.5167 1.07466 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 67.7787 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 164 TYPE = 0,1 NAME = S552~1 FLAGS = 0 VIEW = 4 OUT = 93,1 IN = 100,2 POS = 587,79 587,88 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 165 TYPE = 512,1 NAME = S555~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 93,1 POS = 587,98 587,109 551,109 551,77 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 166 TYPE = 0,1 NAME = S253~1 FLAGS = 0 VIEW = 4 OUT = 100,1 IN = 223,1 POS = 586,60 586,69 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 167 TYPE = 512,1 NAME = S167 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 112,2 POS = 709,216 713,216 713,206 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 168 TYPE = 512,2 NAME = S168 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 78,2 POS = 723,230 723,220 IV = CV = 0 3.69597 760 100 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 639.11 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 169 TYPE = 0,1 NAME = S169 FLAGS = 0 VIEW = 8 OUT = 299,1 IN = 79,1 POS = 670,235 680,235 IV = CV = 0 65.2249 0 84.271 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 449.412 128.635 3.67335 92.8996 0 18.5151 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 46.3038 LINKS = 0 UNITS = 0 A COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 170 TYPE = 0,1 NAME = S170 FLAGS = 0 VIEW = 4 OUT = 78,1 IN = 92,1 POS = 709,235 721,235 IV = CV = 0 15.8621 0.0128319 800 0 0 0 0 0 0 0 0 0 0 0 0 0 1 0 0 468.101 8.64969 13.9456 88.3224 420.981 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 283.593 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 171 TYPE = 0,2 NAME = S171 FLAGS = 0 VIEW = 8 OUT = 516,1 IN = 132,2 POS = 187,360 187,342 IV = CV = 0 6.48592 760 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.2681 0 0 0 3.39997 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 639.987 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 172 TYPE = 0,1 NAME = S166 FLAGS = 0 VIEW = 8 OUT = 77,1 IN = 78,1 POS = 731,236 748,236 IV = CV = 0 114.015 0.00183338 85.599 0 0 0 0 0 0 0 0 0.00000420621 0.00692026 0 0 0 0.993076 0 0 72.2128 11.4971 / CV = 2.27746 14.0475 59.7067 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 76.766 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 173 TYPE = 0,32 NAME = S173 FLAGS = 0 VIEW = 8 OUT = 112,1 IN = 92,2 POS = 704,230 704,221 IV = CV = 0 267.739 315.556 9.03402 1.56275 0 0 197.131 0 138.904 31.4877 621.881 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 174 TYPE = 0,32 NAME = S174 FLAGS = 0 VIEW = 4 OUT = 90,1 IN = 112,1 POS = 704,211 704,199 IV = CV = 0 277.687 72.3948 8.71041 1.50677 0 0 190.069 0 169.75 30.3597 599.604 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 175 TYPE = 512,32 NAME = S175 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 90,1 POS = 709,194 711,194 711,184 IV = CV = 0 274.878 72.3948 0.0879941 0.0152216 0 0 192.011 0 171.484 30.6699 605.731 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 176 TYPE = 0,1 NAME = S176 FLAGS = 0 VIEW = 4 OUT = 87,1 IN = 91,2 POS = 590,235 600,235 IV = CV = 0 146.677 0 95 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 199.846 50.2426 1.63347 2.3704 9.27273 6.6345 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.3275 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 177 TYPE = 0,1 NAME = S177 FLAGS = 0 VIEW = 4 OUT = 79,2 IN = 90,2 POS = 699,197 668,197 668,230 IV = CV = 0 2.8088 0 72.3948 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 340.169 0 576.356 0 83.4759 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] 0 NUM = 178 TYPE = 0,1 NAME = S178 FLAGS = 0 VIEW = 8 OUT = 134,1 IN = 87,1 POS = 610,235 620,235 IV = CV = 0 72.0051 0 82.2222 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 407.094 102.346 3.32745 4.82858 18.8889 13.5147 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 52.8278 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 179 TYPE = 0,1 NAME = S179 FLAGS = 0 VIEW = 8 OUT = 91,1 IN = 88,1 POS = 571,235 580,235 IV = CV = 0 146.677 0 95 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 199.846 50.2426 1.63347 2.3704 9.27273 6.6345 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.3275 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 180 TYPE = 0,1 NAME = S180 FLAGS = 0 VIEW = 4 OUT = 540,2 IN = 87,2 POS = 605,240 605,251 -1,-1 411,325 396,325 IV = CV = 0 74.672 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 85 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 181 TYPE = 0,1 NAME = S130 FLAGS = 0 VIEW = 8 OUT = 106,1 IN = 105,1 POS = 737,54 762,54 IV = CV = 0 66.4189 0.00184836 80.5169 0 0 0 0 0 0 0 0 0.0000042062 0.00692025 0 0 0 0.993075 0 0 72.8025 11.591 / CV = 2.29605 14.1622 60.1943 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 72.1405 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 182 TYPE = 256,1 NAME = S60~1 FLAGS = 8 VIEW = 8 OUT = 96,1 IN = 0,0 POS = 972,187 963,187 963,194 IV = 0 0.9 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 434 0 0 0 566 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 1000 1355.65 0 0.9 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 434 0 0 0 566 LINKS = 1 1 CTRL 17 0 2 7 3 94 100 0 1 0.2 1 20 0 1 10 0 1 0.008 0 0 0 0 1 0.36 1 0 0 1 0.0002 1 1 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 183 TYPE = 0,1 NAME = S183 FLAGS = 0 VIEW = 4 OUT = 505,1 IN = 504,2 POS = 864,300 864,312 IV = CV = 0 204.117 0.0904414 66.3273 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538194 3.317E-11 0 0.0716802 0 0 / CV = 7.81583 4.25273 0.376227 1.5167 1.07466 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 67.7787 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 184 TYPE = 256,1 NAME = S112~2 FLAGS = 8 VIEW = 8 OUT = 206,2 IN = 0,0 POS = 819,292 819,303 IV = 0 90 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 90 25 0 2250 CV = 0 108.098 0 25 LINKS = 1 1 CTRL 17 0 2 7 12 161 84 0 1 110 1 -0.02 0 1 2 0 1 0.5 0 0 0 0 1 110 1 68 0 1 0.11 1 50 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 185 TYPE = 512,1 NAME = S553~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 100,1 POS = 592,74 598,74 598,85 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 186 TYPE = 1024,1 NAME = S186 FLAGS = 8 VIEW = 8 OUT = 291,3 IN = 0,0 COPY = 7 12 152 4294967295 0 POS = 488,145 505,145 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 190 TYPE = 0,1 NAME = S165 FLAGS = 0 VIEW = 8 OUT = 110,2 IN = 77,1 POS = 758,236 771,236 IV = CV = 0 113.62 0.0000500025 85.599 0 0 0 0 0 0 0 0 0.00000420621 0.00692026 0 0 0 0.993076 0 0 72.2128 11.4971 / CV = 2.27746 14.0475 59.7067 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 76.7125 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 191 TYPE = 0,1 NAME = S191 FLAGS = 0 VIEW = 4 OUT = 95,1 IN = 505,2 POS = 864,322 864,332 IV = CV = 0 43.0691 0.428571 66.3273 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538194 3.317E-11 0 0.0716802 0 0 7.81583 / CV A = 4.25273 0.376227 1.5167 1.07466 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 75.6282 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 192 TYPE = 0,1 NAME = S178~1 FLAGS = 0 VIEW = 8 OUT = 101,1 IN = 225,1 POS = 611,55 621,55 IV = CV = 0 42.2887 0 82.2222 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 407.094 102.346 3.32745 4.82858 18.8889 13.5147 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 52.8278 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 193 TYPE = 0,1 NAME = S138~1 FLAGS = 0 VIEW = 8 OUT = 133,1 IN = 224,2 POS = 567,60 567,77 IV = CV = 0 41.3799 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.416222 0 0 0 0.0193124 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 39.9887 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 194 TYPE = 0,1 NAME = S43~3 FLAGS = 0 VIEW = 8 OUT = 102,1 IN = 104,1 POS = 654,54 666,54 IV = CV = 0 36.4468 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 472.346 118.751 3.8608 69.3601 0 15.6818 0 0 0 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 47.43 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 195 TYPE = 768,1 NAME = S140 FLAGS = 8 VIEW = 8 OUT = 103,2 IN = 0,0 COPY = 7 12 194 4294967295 0 POS = 708,72 708,59 IV = CV = 0 36.4468 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 472.346 118.751 3.8608 69.3601 0 15.6818 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 196 TYPE = 256,32 NAME = S141 FLAGS = 8 VIEW = 4 OUT = 103,3 IN = 0,0 POS = 714,72 714,59 IV = 0 0 148.889 CV = 0 127.494 148.889 0 0 0 0 0 0 0 233.01 766.99 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 200 TYPE = 0,1 NAME = S131 FLAGS = 0 VIEW = 8 OUT = 105,1 IN = 103,1 POS = 717,54 727,54 IV = CV = 0 9.31585 0.0128319 800 0 0 0 0 0 0 0 0 0 0 0 0 0 1 0 0 468.101 8.64969 13.9457 88.3224 420.981 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 283.593 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 201 TYPE = 0,1 NAME = S201 FLAGS = 0 VIEW = 8 OUT = 115,1 IN = 95,1 POS = 859,338 845,338 IV = CV = 0 55.3745 0.333333 66.0614 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538194 3.317E-11 0 0.0716802 0 0 6.07954 / CV = 3.30768 0.292622 1.17965 0.835849 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 73.2664 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 202 TYPE = 512,2 NAME = S132 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 105,2 POS = 732,49 732,38 IV = CV = 0 2.71304 760 100 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 639.11 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 203 TYPE = 0,1 NAME = S124 FLAGS = 0 VIEW = 8 OUT = 110,1 IN = 106,1 POS = 772,54 783,54 -1,-1 776,221 776,231 IV = CV = 0 66.1934 0.00010001 80.5169 0 0 0 0 0 0 0 0 0.0000042062 0.00692025 0 0 0 0.993075 0 0 72.8025 11.591 / CV = 2.29605 14.1622 60.1943 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 72.0912 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 204 TYPE = 0,1 NAME = S94 FLAGS = 0 VIEW = 8 OUT = 510,2 IN = 106,2 POS = 767,59 767,76 766,76 -1,-1 767,247 767,255 758,255 IV = CV = 0 0.225459 0.515152 80.5169 0 0 0 0 0 0 0 0 0.0000042062 0.00692025 0 0 0 0.993075 0 0 72.8025 11.591 / CV = 2.29605 14.1622 60.1943 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 86.6058 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 205 TYPE = 0,1 NAME = S205 FLAGS = 0 VIEW = 8 OUT = 125,1 IN = 123,1 POS = 621,147 631,147 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 206 TYPE = 0,1 NAME = S206 FLAGS = 0 VIEW = 4 OUT = 230,1 IN = 125,1 POS = 641,147 653,147 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 [STREAM] NUM = 210 TYPE = 512,1 NAME = S210 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 511,1 POS = 758,281 770,281 IV = CV = 0 0.0782767 4 64.947 0 0 0 0 0 0 0 0 0.00000420621 0.00692026 0 0 0 0.993075 0 0 14.227 2.26507 0.448685 / CV = 2.76752 11.7629 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 211 TYPE = 512,1 NAME = S211 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 513,1 POS = 753,342 753,354 IV = CV = 0 2.4619 0.0000536515 66.3018 0 0 0 0 0 0 0 0 0.000160904 0.244774 0.0147655 9.426E-11 0 0.740299 0 0 / CV = 7.93608 4.21543 0.377586 1.54016 1.27517 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 212 TYPE = 0,1 NAME = S212 FLAGS = 0 VIEW = 4 OUT = 116,1 IN = 115,1 POS = 835,338 819,338 IV = CV = 0 7.17818 2.57143 65.2386 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538194 3.317E-11 0 0.0716802 0 0 0.780659 / CV = 0.424731 0.0375748 0.151476 0.107329 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 123.89 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 213 TYPE = 0,1 NAME = S213 FLAGS = 0 VIEW = 4 OUT = 120,1 IN = 116,1 POS = 809,337 795,337 IV = CV = 0 0.00645645 1578.08 1232 0 0 0 0 0 0 0 0 0.85 0 0 0.0302708 0 0.119729 0 0 433.962 0 0 0 566.038 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 680898 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 214 TYPE = 0,1 NAME = S214 FLAGS = 0 VIEW = 4 OUT = 496,2 IN = 120,1 POS = 788,332 788,256 816,256 816,241 IV = CV = 0 0.00645636 1578.1 800 0 0 0 0 0 0 0 0 0.85 0 0 0.0302708 0 0.119729 0 0 433.962 0 0 0 566.038 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 442147 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 215 TYPE = 512,1 NAME = S215 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 504,1 POS = 869,295 882,295 IV = CV = 0 5.19298 0.0904414 66.3273 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538194 3.317E-11 0 0.0716802 0 0 / CV = 7.81583 4.25273 0.376227 1.5167 1.07466 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 216 TYPE = 0,1 NAME = S223~2 FLAGS = 0 VIEW = 8 OUT = 135,1 IN = 124,1 POS = 328,726 342,726 IV = CV = 0 169.99 0.107571 70.5538 0 0.0184595 0.81251 0.0325448 0.116707 0.0197781 0 0 0 0 0 0 0 0 0 9.65025 / CV = 9.65023 4.7736 0.451638 1.82716 1.2641 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 71.9436 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 219 TYPE = 256,1 NAME = S219 FLAGS = 8 VIEW = 8 OUT = 113,1 IN = 0,0 POS = 92,81 118,81 IV = 0 25.3796 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 0 0 0 0 0 55.9524 0 0 0 111.905 27 0 1510.71 CV = 0 97.1985 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 27 LINKS = 0 UNITS = 2 1 73 65 -11 0 0 53 65 -12 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 900000/350/24 A ADDIN = [STREAM] NUM = 220 TYPE = 0,1 NAME = S220 FLAGS = 0 VIEW = 4 OUT = 21,2 IN = 545,2 POS = 295,418 295,405 270,405 270,418 IV = CV = 0 193.64 0 68.7811 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8.78957 7.157 3.5384 0.334773 1.35533 0.937004 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 221 TYPE = 512,1 NAME = S64 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 122,1 POS = 567,267 567,276 IV = CV = 0 0.000816426 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 222 TYPE = 256,1 NAME = S222 FLAGS = 8 VIEW = 8 OUT = 119,1 IN = 0,0 POS = 91,164 116,164 IV = 0 33.21 1 20 0 0.268 0.436 0.198 0.066 0.032 CV = 0 0 1 20 0 0.268 0.436 0.198 0.066 0.032 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 27 LINKS = 0 UNITS = 2 1 73 65 -11 0 0 53 65 -12 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0 A ADDIN = [STREAM] NUM = 223 TYPE = 0,1 NAME = S226~2 FLAGS = 0 VIEW = 4 OUT = 136,1 IN = 135,1 POS = 352,725 367,725 IV = CV = 0 170.354 0.105203 70.5538 0 0.00250948 0.825645 0.0330709 0.118594 0.0201801 0 0 0 0 0 0 0 0 0 11.7626 / CV = 9.63477 4.7634 0.450672 1.82325 1.2614 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 71.7898 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 224 TYPE = 0,1 NAME = S224 FLAGS = 0 VIEW = 8 OUT = 235,2 IN = 113,1 POS = 123,86 123,98 182,98 182,102 IV = CV = 0 11.6638 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 27 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 225 TYPE = 0,1 NAME = S225 FLAGS = 0 VIEW = 4 OUT = 131,1 IN = 113,2 POS = 128,81 139,81 IV = CV = 0 85.5347 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 27 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 226 TYPE = 0,1 NAME = S244~2 FLAGS = 0 VIEW = 4 OUT = 442,1 IN = 136,1 POS = 377,726 394,726 -1,-1 147,1517 167,1517 IV = CV = 0 53.7623 0.333333 63.8203 0 0.00250948 0.825645 0.0330709 0.118594 0.0201801 0 0 0 0 0 0 0 0 0 1.03502 / CV = 0.713297 0.343144 0.0324653 0.134826 0.090868 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 / CV = 0 0 71.1685 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 227 TYPE = 0,1 NAME = S227 FLAGS = 0 VIEW = 8 OUT = 482,1 IN = 481,1 POS = 234,1350 243,1350 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 228 TYPE = 0,1 NAME = S228 FLAGS = 512 VIEW = 8 OUT = 481,2 IN = 482,2 POS = 248,1355 248,1364 232,1364 232,1355 IV = 0 1016.47 0 60.5525 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.953329 0.135859 0.0443724 0.0000971791 0.000596625 / IV = 0.000456601 0 0 0 0.431276 0.020914 0.000934623 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 229 TYPE = 0,1 NAME = S229 FLAGS = 0 VIEW = 8 OUT = 492,1 IN = 482,1 POS = 253,1350 265,1350 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 230 TYPE = 256,1 NAME = S230 FLAGS = 8 VIEW = 4 OUT = 95,2 IN = 0,0 POS = 882,336 869,336 IV = 0 15 0 65 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 15 65 0 975 0 0.980555 CV = 0 12.3054 0 65 LINKS = 1 1 CTRL 17 0 2 7 12 201 93 0 1 0.25 1 -290 0 1 10 0 0 0 0 0 0 1 15 1 12 0 1 0.00025 1 15 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 231 TYPE = 256,1 NAME = S231 FLAGS = 8 VIEW = 4 OUT = 115,2 IN = 0,0 POS = 840,352 840,342 IV = 0 0 0 65 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 0 0 0 0.980555 CV = 0 31.1737 0 65 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 1.3*s212:tsuspsol + s212:1 A ADDIN = [STREAM] NUM = 232 TYPE = 0,1 NAME = S232 FLAGS = 0 VIEW = 4 OUT = 503,2 IN = 115,2 POS = 840,332 840,273 859,273 IV = CV = 0 79.3701 0 65.7844 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 4.17094 2.26928 0.200757 0.809316 0.573444 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 233 TYPE = 0,1 NAME = S233 FLAGS = 0 VIEW = 8 OUT = 235,1 IN = 131,1 P AOS = 143,86 143,95 186,95 186,102 IV = CV = 0 2.56604 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 27 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 234 TYPE = 1024,1 NAME = S234 FLAGS = 8 VIEW = 8 OUT = 291,2 IN = 0,0 COPY = 7 12 35 4294967295 0 POS = 488,149 505,149 IV = CV = 0 172.329 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.134 33.9393 1.10342 1.60123 6.27011 4.48144 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 89.6947 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 235 TYPE = 1024,1 NAME = S235 FLAGS = 8 VIEW = 8 OUT = 291,1 IN = 0,0 COPY = 7 12 103 4294967295 0 POS = 486,153 505,153 IV = CV = 0 172.33 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.133 33.9396 1.10344 1.60123 6.27009 4.48192 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 89.6947 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 236 TYPE = 512,1 NAME = S64~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 133,1 POS = 568,87 568,96 IV = CV = 0 0.000479488 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 237 TYPE = 0,1 NAME = S237 FLAGS = 512 VIEW = 8 OUT = 476,2 IN = 480,2 POS = 193,1355 193,1364 176,1364 176,1355 IV = 0 944.425 0 47.8436 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.35803 0.605913 0.462595 0.00101312 0.00621998 0.00476021 / IV = 0 0 0 0.297805 0.218035 0.00974371 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 238 TYPE = 0,1 NAME = S238 FLAGS = 0 VIEW = 8 OUT = 476,1 IN = 475,1 POS = 163,1406 165,1406 165,1335 174,1335 174,1345 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 ADDIN = [STREAM] NUM = 239 TYPE = 0,1 NAME = S239 FLAGS = 512 VIEW = 8 OUT = 129,1 IN = 476,2 POS = 172,1355 172,1398 136,1398 IV = 0 289.683 0 47.8436 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.35803 0.605913 0.462595 0.00101312 0.00621999 0.00476021 / IV = 0 0 0 0.297805 0.218035 0.00974371 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 240 TYPE = 0,1 NAME = S240 FLAGS = 0 VIEW = 4 OUT = 512,2 IN = 505,1 POS = 859,317 758,317 IV = CV = 0 161.048 0.0000150002 66.3273 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538194 3.317E-11 0 0.0716802 0 / CV = 0 7.81583 4.25273 0.376227 1.5167 1.07466 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 241 TYPE = 0,1 NAME = S241 FLAGS = 0 VIEW = 4 OUT = 298,1 IN = 134,1 POS = 630,235 641,235 IV = CV = 0 72.0051 0 82.2222 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 407.094 102.346 3.32745 59.7784 0 13.5147 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 50.9005 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 242 TYPE = 0,1 NAME = S242 FLAGS = 0 VIEW = 4 OUT = 546,2 IN = 136,2 POS = 372,731 372,746 297,746 297,731 IV = CV = 0 224.118 0 68.7811 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8.78956 7.157 3.5384 0.334773 1.35533 0.937004 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 67.7925 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 243 TYPE = 256,1 NAME = S44~2 FLAGS = 8 VIEW = 8 OUT = 140,3 IN = 0,0 POS = 305,994 305,983 IV = 0 0 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 575 425 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 1000 1795.87 1795.87 CV = 0 0 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 575 425 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = s144:tsuspsol* 0.03 A ADDIN = [STREAM] NUM = 244 TYPE = 256,1 NAME = S106~3 FLAGS = 8 VIEW = 8 OUT = 140,2 IN = 0,0 POS = 298,994 298,983 IV = 0 0 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 55 0 2750 CV = 0 0 0 55 LINKS = 1 1 CTRL 17 0 2 7 12 246 93 0 1 0.1 1 -3514 0 0 0 0 0 0 0 0 1 50 1 0 0 1 0.0001 1 1 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 245 TYPE = 0,1 NAME = S245 FLAGS = 0 VIEW = 8 OUT = 145,1 IN = 545,1 POS = 300,423 313,423 IV = CV = 0 164.573 0.111111 70.1345 0 0.0184513 0.812517 0.0325451 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 9.96785 / CV = 7.39707 3.51405 0.34612 1.40199 0.968763 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 71.7863 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 246 TYPE = 0,1 NAME = S223~3 FLAGS = 0 VIEW = 8 OUT = 141,1 IN = 140,1 POS = 306,978 320,978 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 247 TYPE = 0,1 NAME = S247 FLAGS = 0 VIEW = 8 OUT = 471,1 IN = 127,1 POS = 109,1380 114,1380 114,1336 121,1336 121,1345 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 248 TYPE = 0,1 NAME = S248 FLAGS = 0 VIEW = 8 OUT = 127,1 IN = 128,1 POS = 104,1355 104,1377 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 43.4934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 249 TYPE = 0,1 NAME = S249 FLAGS = 0 VIEW = 8 OUT = 128,1 IN = 470,1 POS = 90,1350 99,1350 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 47.0413 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 250 TYPE = 0,1 NAME = S250 FLAGS = 0 VIEW = 4 OUT = 124,1 IN = 546,1 POS = 302,726 318,726 IV = CV = 0 164.574 0.111111 70.1346 0 0.0184595 0.81251 0.0325448 0.116707 0.0197781 0 0 0 0 0 0 0 0 0 9.96783 / CV = 7.39708 3.51405 0.346119 1.40199 0.968776 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 71.7864 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 251 TYPE = 0,1 NAME = S226~3 FLAGS = 0 VIEW = 4 OUT = 142,1 IN = 141,1 POS = 330,977 345,977 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = 0 ADDIN = [STREAM] NUM = 252 TYPE = 0,1 NAME = S252 FLAGS = 0 VIEW = 4 OUT = 545,2 IN = 143,2 POS = 367,428 367,442 295,442 295,428 IV = CV = 0 224.116 0 68.7811 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8.78957 7.157 3.5384 0.334773 1.35533 0.937004 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 253 TYPE = 0,1 NAME = S253 FLAGS = 0 VIEW = 4 OUT = 289,1 IN = 91,1 POS = 585,240 585,249 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 254 TYPE = 0,1 NAME = S254 FLAGS = 0 VIEW = 4 OUT = 74,2 IN = 142,2 POS = 350,973 350,958 285,958 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 255 TYPE = 0,1 NAME = S255 FLAGS = 0 VIEW = 8 OUT = 235,5 IN = 119,1 POS = 121,169 121,145 188,145 188,112 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 256 TYPE = 0,1 NAME = S244~3 FLAGS = 0 VIEW = 4 OUT = 470,1 IN = 142,1 POS = 355,977 371,977 -1,-1 59,1349 80,1349 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 257 TYPE = 0,1 NAME = S257 FLAGS = 0 VIEW = 8 OUT = 137,1 IN = 119,2 POS = 126,164 137,164 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 258 TYPE = 0,1 NAME = S258 FLAGS = 0 VIEW = 8 OUT = 235,4 IN = 137,1 POS = 142,169 142,143 181,143 181,112 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 259 TYPE = 256,1 NAME = S259 FLAGS = 8 VIEW = 4 OUT = 435,2 IN = 0,0 POS = 314,1154 314,1163 IV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 0 0 0 000000000008 CV = 0 15.8781 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 260 TYPE = 0,1 NAME = S690~1 FLAGS = 512 VIEW = 8 OUT = 156,1 IN = 155,1 POS = 745,971 768,971 IV = 0 271.042 0.0160004 50.6531 0 0.337077 0.0398004 0.00179533 0.0073117 0 0 0 0 0 0 0 0 0.00119612 0.612669 / IV = 19.1011 5.35949 0.000187076 0.00117385 0.00738378 1.61311 0 0 0 0 0 0 6.2168 7.87705 3.66722 3.16664 / IV = 1.88757 1.38463 0 0 8.28907 1.03613 108.346 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 261 TYPE = 512,1 NAME = S261 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 362,2 POS = 839,981 855,981 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 262 TYPE = 0,1 NAME = S90 FLAGS = 0 VIEW = 4 OUT = 153,1 IN = 392,1 POS = 582,945 582,956 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 263 TYPE = 0,1 NAME = S114~1 FLAGS = 0 VIEW = 4 0 0 OUT = 150,2 IN = 375,2 POS = 693,940 711,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 264 TYPE = 512,1 NAME = S264 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 322,2 POS = 927,1037 927,1025 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 265 TYPE = 0,1 NAME = S231 FLAGS = 0 VIEW = 4 OUT = 341,1 IN = 155,2 POS = 736,966 736,947 708,947 708,957 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 266 TYPE = 0,1 NAME = S110 FLAGS = 0 VIEW = 8 OUT = 146,1 IN = 151,1 POS = 688,914 688,903 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 267 TYPE = 0,1 NAME = S267 FLAGS = 0 VIEW = 8 OUT = 432,1 IN = 431,1 POS = 316,1193 316,1202 IV = CV = 0 166.355 0.103879 82 0 0.00108677 0.854118 0.0251479 0.119647 0 0 0 0 0 0 0 0 0 0 0.871025 0.520875 / CV = 0.192264 0.00130652 0.00542585 0.00365688 0 0 0 1.05698 0.127349 0 0 0 0 0 0 0 00000000000/ CV = 760 0 0 0 0 0 84.8332 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 268 TYPE = 256,2 NAME = S268 FLAGS = 8 VIEW = 4 OUT = 431,2 IN = 0,0 POS = 302,1189 311,1189 IV = CV = 0 12.5561 3862.89 152.953 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 656.539 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 269 TYPE = 0,1 NAME = S269 FLAGS = 0 VIEW = 8 OUT = 431,1 IN = 435,1 POS = 316,1173 316,1183 IV = CV = 0 153.799 0.112359 36.7848 0 0.00108677 0.854118 0.0251479 0.119647 0 0 0 0 0 0 0 0 0 0 0.942135 0.563399 / CV = 0.207961 0.00141318 0.00586881 0.00395542 0 0 0 1.14327 0.137745 0 0 0 0 0 0 0 00000000000/ CV = 760 0 0 0 0 0 38.1595 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 270 TYPE = 0,1 NAME = S116~1 FLAGS = 0 VIEW = 8 OUT = 211,2 IN = 146,1 POS = 688,893 688,879 689,879 -1,-1 531,565 531,550 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 271 TYPE = 0,1 NAME = S113~1 FLAGS = 0 VIEW = 4 OUT = 150,1 IN = 146,2 POS = 693,898 714,898 714,935 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 272 TYPE = 256,1 NAME = S115~1 FLAGS = 8 VIEW = 4 OUT = 151,2 IN = 0,0 POS = 672,918 683,918 IV = 0 0 0 56 CV = 0 0 0 56 LINKS = 1 1 CTRL 17 0 2 7 12 270 93 0 1 0.5 0 0 0 0 0 0 0 0 0 1 0 1 0 0 1 0.0005 1 1 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 273 TYPE = 0,1 NAME = S91 FLAGS = 0 VIEW = 4 OUT = 152,1 IN = 153,1 POS = 587,961 597,961 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 274 TYPE = 0,1 NAME = S92~3 FLAGS = 0 VIEW = 4 OUT = 153,2 IN = 152,2 0 POS = 600,966 600,975 582,975 582,966 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 275 TYPE = 0,1 NAME = S281~1 FLAGS = 0 VIEW = 4 OUT = 52,3 IN = 165,2 POS = 586,757 571,757 -1,-1 389,703 377,703 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 276 TYPE = 0,1 NAME = S276 FLAGS = 0 VIEW = 4 OUT = 362,1 IN = 156,1 POS = 778,971 835,971 835,976 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 277 TYPE = 256,2 NAME = S277 FLAGS = 8 VIEW = 4 OUT = 426,2 IN = 0,0 POS = 245,1225 256,1225 IV = CV = 0 2.25026 3862.89 152.953 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 278 TYPE = 0,1 NAME = S278 FLAGS = 0 VIEW = 8 OUT = 416,1 IN = 425,1 POS = 261,1173 261,1182 IV = CV = 0 205.761 0.0865602 63.9356 0 0.00176159 0.83068 0.0291164 0.118136 0.0203052 0 0 0 0 0 0 0 0 0 0.964757 / CV = 1.04351 0.736003 0.00500145 0.0207706 0.0139988 0 0 0 1.12317 0.0547717 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 65.708 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 279 TYPE = 256,1 NAME = S279 FLAGS = 8 VIEW = 4 OUT = 425,2 IN = 0,0 POS = 260,1154 260,1163 IV = 0 0 0 25 0 0 0 0 0 000000000000 IV = 0 200 219.008 CV = 0 1.46789 0 25 0 0 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 0 0 0 0 0 0 0 0 0 115 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 / 0 0 0 0 0 0 0 0 0 0 0 0 0 0 115 85 0 [STREAM] NUM = 280 TYPE = 0,1 NAME = S280 FLAGS = 0 VIEW = 4 OUT = 391,1 IN = 160,1 POS = 510,940 520,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 281 TYPE = 0,1 NAME = S281 FLAGS = 0 VIEW = 4 OUT = 161,1 IN = 153,2 POS = 577,964 549,964 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 [STREAM] NUM = 282 TYPE = 0,1 NAME = S282 FLAGS = 0 VIEW = 4 OUT = 62,3 IN = 161,1 POS = 539,965 523,965 -1,-1 391,401 372,401 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = A ADDIN = [STREAM] NUM = 283 TYPE = 0,1 NAME = S283 FLAGS = 0 VIEW = 4 OUT = 74,3 IN = 161,2 POS = 545,972 545,982 -1,-1 295,954 285,954 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 284 TYPE = 0,1 NAME = S10~3 FLAGS = 512 VIEW = 8 OUT = 163,2 IN = 171,1 POS = 730,734 753,734 753,760 IV = 0 382.041 0.00902924 55.401 0 0.132406 0.648242 0.0304036 0.0449326 0.144015 0 0 0 0 0 0 0 0 0 1.43951 / IV = 0.575424 5.262E-09 0.0136081 0.062884 0.045925 0 0 0 0 0 0.0228055 101.419 4.0568 0 6.86755 0 0.268597 / IV = 0 1.94201 0 0.00168466 0 0 0 0 0 0 0 760 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 285 TYPE = 0,1 NAME = S592~1 FLAGS = 0 VIEW = 8 OUT = 163,1 IN = 180,2 POS = 595,805 595,830 749,830 749,770 IV = CV = L AINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 286 TYPE = 0,1 NAME = S231~1 FLAGS = 0 VIEW = 4 OUT = 184,1 IN = 163,2 POS = 745,760 745,741 717,741 717,751 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 287 TYPE = 0,1 NAME = S287 FLAGS = 0 VIEW = 8 OUT = 147,2 IN = 148,2 POS = 176,1173 176,1261 220,1261 IV = CV = 0 91.8938 0 58.02 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.2461 0.577946 0.154565 0.00945317 0.0392582 0.0264591 / CV = 0 0 0 1.68703 0.0389984 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 288 TYPE = 512,1 NAME = S288 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 147,1 POS = 225,1264 225,1274 IV = CV = 0 327.266 0 57.2768 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.00353 0.683186 0.408414 0.00513479 0.0213243 0.0143721 / CV = 0 0 0 1.03073 0.252721 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 289 TYPE = 256,2 NAME = S289 FLAGS = 8 VIEW = 4 OUT = 484,2 IN = 0,0 POS = 311,1371 320,1371 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 290 TYPE = 512,32 NAME = S290 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 114,1 POS = 716,15 738,15 IV = CV = 0 161.436 72.3948 0.087994 0.0152217 0 0 192.011 0 171.485 30.6699 605.731 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 291 TYPE = 0,1 NAME = S291 FLAGS = 0 VIEW = 8 OUT = 102,3 IN = 114,2 POS = 706,15 671,15 671,49 IV = CV = 0 1.64961 0 72.3948 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 340.169 0 576.355 0 83.476 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 292 TYPE = 768,1 NAME = S292 FLAGS = 8 VIEW = 8 OUT = 92,2 IN = 0,0 COPY = 7 12 569 4294967295 0 POS = 701,252 701,240 IV = CV = 0 62.058 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 472.346 118.751 3.8608 69.3601 0 15.6818 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 293 TYPE = 256,32 NAME = S293 FLAGS = 8 VIEW = 4 OUT = 92,3 IN = 0,0 POS = 707,252 707,240 IV = 0 0 148.889 CV = 0 217.085 148.889 0 0 0 0 0 0 0 233.01 766.99 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 294 TYPE = 0,1 NAME = S92~4 FLAGS = 0 VIEW = 4 OUT = 165,2 IN = 166,2 POS = 609,760 609,769 591,769 591,760 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 295 TYPE = 0,1 NAME = S90~1 FLAGS = 0 VIEW = 4 OUT = 165,1 IN = 194,1 POS = 591,739 591,750 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 296 TYPE = 0,1 NAME = S91~1 FLAGS = 0 VIEW = 4 OUT = 166,1 IN = 165,1 POS = 596,755 606,755 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 [STREAM] NUM = 297 TYPE = 256,1 NAME = S297 FLAGS = 8 VIEW = 4 OUT = 411,2 IN = 0,0 POS = 718,1266 718,1279 IV = 0 25 0 50 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 25 CV = 0 23.4344 0 50 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 50 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.00936*s307:totmass A ADDIN = [STREAM] NUM = 298 TYPE = 256,1 NAME = S298 FLAGS = 8 VIEW = 4 OUT = 415,3 IN = 0,0 POS = 732,1288 742,1288 IV = 0 40 0 50 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 40 CV = 0 37.4613 0 50 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.5427*(s663:totmass +s665:totmass ) A ADDIN = [STREAM] NUM = 299 TYPE = 0,1 NAME = S299 FLAGS = 0 VIEW = 4 OUT = 414,1 IN = 413,2 POS = 732,1206 732,1215 IV = CV = 0 803.973 0.0000927251 48.5929 0.54146 0 0 0 0 0 0.443749 0 0 0 0 0 0.0147913 0 0 0.212941 0.0533775 / CV = 0.0190836 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 48.5817 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 300 TYPE = 0,1 NAME = S7~3 FLAGS = 0 VIEW = 8 OUT = 186,1 IN = 166,1 POS = 612,750 612,739 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 301 TYPE = 256,1 NAME = S115~2 FLAGS = 8 VIEW = 8 OUT = 170,2 IN = 0,0 POS = 681,712 692,712 IV = 0 0 0 56 CV = 0 0 0 56 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 0 0 Frm = 0 A ADDIN = [STREAM] NUM = 302 TYPE = 0,1 NAME = S685~1 FLAGS = 0 VIEW = 8 OUT = 170,1 IN = 192,1 POS = 697,729 697,718 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 303 TYPE = 0,1 NAME = S110~1 FLAGS = 0 VIEW = 4 OUT = 172,1 IN = 170,1 POS = 697,708 697,697 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 304 TYPE = 0,1 NAME = S114~2 FLAGS = 0 VIEW = 4 OUT = 171,2 IN = 192,2 POS = 702,734 720,734 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 305 TYPE = 0,1 NAME = S113~2 FLAGS = 0 VIEW = 4 OUT = 171,1 IN = 172,2 POS = 702,692 723,692 723,729 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 306 TYPE = 0,1 NAME = S116~2 FLAGS = 0 VIEW = 4 OUT = 211,1 IN = 172,1 POS = 697,687 697,675 -1,-1 511,545 526,545 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 307 TYPE = 0,1 NAME = S307 FLAGS = 0 VIEW = 4 OUT = 411,1 IN = 393,2 POS = 707,1265 707,1285 713,1285 IV = CV = 0 2501.87 0.00071969 50.0659 0.370088 0 0 0 0 0 0.609593 0 0 0 0 0 0.0203198 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.063 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 308 TYPE = 0,1 NAME = S308 FLAGS = 0 VIEW = 4 OUT = 412,1 IN = 411,1 POS = 718,1289 718,1298 IV = CV = 0 2525.31 0.000713009 50.0653 0.370088 0 0 0 0 0 0.609593 0 0 0 0 0 0.0203198 0 0 0.248384 0.0620995 / CV = 0.02226 0.000151266 0.000628196 0.000423385 0 0 0 0.122375 0.0147441 0 0 0 0 0 00000000000/ CV = 0 0 760 0 0 0 0 0 50.0624 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 309 TYPE = 256,1 NAME = S309 FLAGS = 8 VIEW = 4 OUT = 406,3 IN = 0,0 POS = 703,1278 692,1278 IV = 0 90 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 90 CV = 0 84.4014 0 35 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = .00877*(s680:totmass +s656:totmass ) A ADDIN = [STREAM] NUM = 310 TYPE = 0,1 NAME = S583~1 FLAGS = 0 VIEW = 4 OUT = 173,1 IN = 185,1 POS = 639,734 654,734 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 311 TYPE = 0,1 NAME = S651~1 FLAGS = 0 VIEW = 4 OUT = 191,1 IN = 173,1 POS = 664,734 673,734 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 312 TYPE = 0,1 NAME = S695~1 FLAGS = 0 VIEW = 8 OUT = 174,1 IN = 193,1 POS = 539,734 548,734 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = A ADDIN = 0 0 0 [STREAM] NUM = 313 TYPE = 0,1 NAME = S32~4 FLAGS = 0 VIEW = 8 OUT = 175,1 IN = 174,2 POS = 558,734 567,734 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 314 TYPE = 512,1 NAME = S23~3 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 174,1 POS = 553,739 553,748 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000001/ IV = 0 0 0 0 999 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 315 TYPE = 256,1 NAME = S33~4 FLAGS = 8 VIEW = 8 OUT = 175,2 IN = 0,0 POS = 572,719 572,729 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 1000 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 1 A 1 CTRL 17 0 2 7 3 164 40 0 1 0.05 1 -150 0 1 2 0 1 5 0 0 0 0 1 800 1 0 0 1 0.0005 1 1 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 316 TYPE = 0,1 NAME = S6~3 FLAGS = 0 VIEW = 8 OUT = 194,1 IN = 175,1 POS = 577,734 586,734 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 [STREAM] NUM = 317 TYPE = 0,1 NAME = S317 FLAGS = 0 VIEW = 8 OUT = 351,1 IN = 402,1 POS = 792,1259 802,1259 IV = CV = 0 52.8047 0.470588 50.0659 0.836842 0 0 0 0 0 0.157895 0 0 0 0 0 0.00526315 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 58.2966 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 318 TYPE = 512,2 NAME = S318 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 404,2 POS = 827,1255 827,1246 IV = CV = 0 37.0229 760 100 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 319 TYPE = 0,1 NAME = S319 FLAGS = 0 VIEW = 8 OUT = 350,1 IN = 404,1 POS = 832,1260 841,1260 IV = CV = 0 0.251003 98.9998 95 0.836842 0 0 0 0 0 0.157895 0 0 0 0 0 0.00526315 0 0 37.2304 9.3077 3.33657 0.0226734 / CV = 0.0941606 0.0634614 0 0 0 18.3428 2.21001 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 3382.38 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 320 TYPE = 0,1 NAME = S23~3 FLAGS = 0 VIEW = 8 OUT = 176,1 IN = 190,1 POS = 692,800 668,800 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 321 0 TYPE = 0,1 NAME = S40~2 FLAGS = 0 VIEW = 4 OUT = 183,1 IN = 176,1 POS = 658,800 648,800 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 322 TYPE = 0,1 NAME = S10~3 FLAGS = 0 VIEW = 8 OUT = 180,1 IN = 195,1 POS = 616,800 602,800 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 323 TYPE = 512,1 NAME = S61~2 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 180,1 POS = 597,795 597,780 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] 0 0 0 NUM = 324 TYPE = 0,1 NAME = S21~3 FLAGS = 0 VIEW = 8 OUT = 181,1 IN = 182,1 POS = 716,784 716,795 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 325 TYPE = 0,1 NAME = S12~1 FLAGS = 0 VIEW = 8 OUT = 190,1 IN = 181,1 POS = 711,800 702,800 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 [STREAM] NUM = 326 TYPE = 256,1 NAME = S11~3 FLAGS = 8 VIEW = 8 OUT = 182,4 IN = 0,0 POS = 734,779 721,779 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 1000 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = s330:1 * s330:Glu *0.0005/1000 ADDIN = A [STREAM] NUM = 327 TYPE = 0,1 NAME = S327 FLAGS = 0 VIEW = 8 OUT = 167,1 IN = 168,1 POS = 672,1260 682,1260 IV = CV = 0 10387.1 0.00673847 50.0659 0.428849 0 0 0 0 0 0.156818 0.409104 0 0 0 0 0.00522726 0 0 0.25071 0.0626783 / CV = 0.0224685 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 00000000000/ CV = 0 0 760 0 0 0 0 0 50.1685 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 328 TYPE = 256,1 NAME = S328 FLAGS = 8 VIEW = 4 OUT = 168,2 IN = 0,0 POS = 667,1246 667,1255 IV = 0 16 0 35 CV = 0 14.9948 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 35 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.001436*s329:totmass A ADDIN = [STREAM] NUM = 329 TYPE = 0,1 NAME = S329 FLAGS = 0 VIEW = 8 OUT = 168,1 IN = 169,1 POS = 652,1260 662,1260 IV = CV = 0 10372.1 0.00674822 50.0876 0.428849 0 0 0 0 0 0.156818 0.409104 0 0 0 0 0.00522726 0 0 0.251073 0.0627649 / CV = 0.022501 0.000152904 0.000634997 0.000427968 0 0 0 0.123699 0.0149038 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.1904 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 330 TYPE = 0,1 NAME = S36~4 FLAGS = 512 VIEW = 8 OUT = 182,1 IN = 184,1 POS = 716,761 716,774 IV = 0 688.476 0.00501012 31.7 0 0.132406 0.648242 0.0304036 0.0449326 0.144015 0 0 0 0 0 0 0 0 0 10.3206 / IV = 0.32368 4.205E-09 0.0108851 0.0503007 0.0367352 0 0 0 0 0 0.018242 62.7122 2.89457 0 13.2402 0 1.09164 / IV = 0 1.07764 0 0.139782 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 331 TYPE = 256,1 NAME = S20~3 FLAGS = 8 VIEW = 8 OUT = 182,3 IN = 0,0 POS = 696,782 711,782 IV = 0 0.000001 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = s330:1 * s330:Glu *0.005/1000 A ADDIN = [STREAM] NUM = 332 TYPE = 256,1 NAME = S19~2 FLAGS = 8 VIEW = 8 OUT = 182,2 IN = 0,0 POS = 696,776 711,776 IV = 0 0.000001 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = s330:1*s330:Glu*0.04/1000 A ADDIN = [STREAM] NUM = 333 TYPE = 0,1 NAME = S24~4 FLAGS = 0 VIEW = 8 OUT = 195,1 IN = 183,1 POS = 638,800 626,800 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] 0 NUM = 334 TYPE = 0,1 NAME = S9~4 FLAGS = 0 VIEW = 8 OUT = 185,1 IN = 186,1 POS = 616,734 629,734 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 335 TYPE = 256,1 NAME = S686~1 FLAGS = 8 VIEW = 4 OUT = 191,2 IN = 0,0 POS = 678,718 678,729 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 2 PSpec = 3 Frm = s685:3 PSpec = 1 Frm = s302:1 A ADDIN = [STREAM] NUM = 336 TYPE = 0,1 NAME = S336 FLAGS = 0 VIEW = 8 OUT = 198,1 IN = 137,2 POS = 147,164 156,164 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 0 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 337 TYPE = 0,1 NAME = S337 FLAGS = 0 VIEW = 8 OUT = 382,2 IN = 366,2 POS = 555,1429 686,1429 686,1447 707,1447 IV = CV = 0 64.3157 0.00000213981 48.5928 0.54146 0 0 0 0 0 0.44375 0 0 0 0 0 0.0147913 0 0 0.212941 0.0533775 / CV = 0.0190836 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 48.5801 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 338 TYPE = 0,1 NAME = S338 FLAGS = 0 VIEW = 8 OUT = 382,1 IN = 227,1 POS = 712,1430 712,1440 IV = CV = 0 281.391 0.000260955 48.5928 0.54146 0 0 0 0 0 0.44375 0 0 0 0 0 0.0147912 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 48.5845 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 339 TYPE = 0,1 NAME = S339 FLAGS = 512 VIEW = 8 OUT = 293,2 IN = 382,1 POS = 717,1445 844,1445 844,1409 878,1409 IV = 0 366.299 0.000212812 48.1618 0.548526 0 0 0 0 0 0.435905 0 0 0 0 0.284638 0.0269031 / IV = 0.0113112 0.0000542838 0.00035541 0.000255053 0 0 0 0.0734055 0.0000060092 0 0 0 0 0 0 0 0 / IV = 0 0 0 0 0 0 0 0 0 760 CV = 0 345.706 0.000212804 48.5929 0.54146 0 0 0 0 0 0.44375 0 0 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 48.5837 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 340 TYPE = 0,1 NAME = S653~1 FLAGS = 0 VIEW = 8 OUT = 192,1 IN = 191,1 POS = 683,734 692,734 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 0 0.0155705 0.00799764 0 0 0.0147912 0 00000000 0 [STREAM] NUM = 341 TYPE = 256,1 NAME = S5~4 FLAGS = 8 VIEW = 8 OUT = 194,2 IN = 0,0 POS = 591,717 591,729 IV = 0 0.8 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 CV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = .001399*s316:totmass A ADDIN = [STREAM] NUM = 342 TYPE = 0,1 NAME = S342 FLAGS = 0 VIEW = 4 OUT = 156,2 IN = 163,1 POS = 754,765 766,765 -1,-1 772,957 772,966 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 343 TYPE = 0,1 NAME = S722~2 FLAGS = 0 VIEW = 4 OUT = 162,1 IN = 196,1 POS = 173,838 182,838 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 344 TYPE = 0,1 NAME = S344 FLAGS = 0 VIEW = 4 OUT = 196,1 IN = 61,2 POS = 119,838 163,838 0 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 345 TYPE = 0,1 NAME = S345 FLAGS = 0 VIEW = 4 OUT = 96,2 IN = 200,1 POS = 921,231 921,199 955,199 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 346 TYPE = 0,1 NAME = S66~2 FLAGS = 0 VIEW = 8 OUT = 111,1 IN = 205,1 POS = 946,272 958,272 IV = CV = 0 154.574 0 101.194 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1218 43.0477 3.658 14.7466 10.2381 0 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 91.3402 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 347 TYPE = 512,1 NAME = S347 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 178,2 POS = 889,1464 902,1464 IV = CV = 0 0.889305 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.1401 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22459 0.508994 LINKS = 0 UNITS = 1 53 64 -15 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 348 TYPE = 256,1 NAME = S348 FLAGS = 8 VIEW = 8 OUT = 179,3 IN = 0,0 POS = 570,1481 570,1470 IV = 0 1.86 0.06 30 0 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0.1116 CV = 0 1.86758 0.06 30 0 0 0 0 0 0 0 0 0 0 0 0 1 LINKS = 1 1 CTRL 17 0 2 7 12 347 158 0 1 0.005 1 20 0 1 15 0 1 2 0 0 0 0 1 1.86 1 1.3 0 1 0.000005 1 5 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 349 TYPE = 256,1 NAME = S349 FLAGS = 8 VIEW = 8 OUT = 179,2 IN = 0,0 POS = 570,1449 570,1460 IV = 0 28.11 0.11111 25 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 3.1233 CV = 0 30.2552 0.11111 25 0 0 0 0 0 0 1 LINKS = 1 1 CTRL 17 0 2 7 12 347 156 0 1 0.15 1 15 0 1 12 0 1 1 0 0 0 0 1 30.2 1 25.76 0 1 0.00015 1 5 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 350 TYPE = 0,1 NAME = S350 FLAGS = 0 VIEW = 4 OUT = 541,1 IN = 111,1 POS = 968,272 993,272 IV = CV = 0 154.574 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1218 43.0477 3.658 14.7466 10.2381 0 0 0 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 76.7229 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 351 TYPE = 0,1 NAME = S351 FLAGS = 0 VIEW = 4 OUT = 205,2 IN = 200,2 POS = 921,241 921,272 936,272 IV = CV = 0 153.956 0 101.351 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 76.1275 41.5147 3.67269 14.8058 10.2792 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 352 TYPE = 0,1 NAME = S352 FLAGS = 0 VIEW = 4 OUT = 60,2 IN = 96,1 POS = 965,199 984,199 -1,-1 144,815 119,815 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 353 TYPE = 0,1 NAME = S353 FLAGS = 0 VIEW = 4 OUT = 20,2 IN = 203,2 POS = 1060,276 1060,296 -1,-1 140,250 118,250 IV = CV = 0 71.8712 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1216 43.0474 3.65801 14.7466 10.238 0 0 0 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 76.7229 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 354 TYPE = 0,1 NAME = S354 FLAGS = 0 VIEW = 4 OUT = 510,1 IN = 77,2 POS = 753,241 753,253 IV = CV = 0 0.394742 0.515152 85.599 0 0 0 0 0 0 0 0 0.00000420621 0.00692026 0 0 0 0.993076 0 0 72.2128 11.4971 / CV = 2.27746 14.0475 59.7067 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 92.1448 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 355 TYPE = 0,1 NAME = S63 FLAGS = 0 VIEW = 4 OUT = 240,1 IN = 213,1 POS = 527,482 583,482 IV = CV = 0 28.4597 0 20 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 500 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 356 TYPE = 0,1 NAME = S356 FLAGS = 0 VIEW = 4 OUT = 511,1 IN = 510,1 POS = 753,263 753,276 IV = CV = 0 3.15739 0.10119 64.947 0 0 0 0 0 0 0 0 0.00000420621 0.00692026 0 0 0 0.993075 0 0 14.227 2.26507 0.448685 / CV = 2.76752 11.7629 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 65.9186 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 357 TYPE = 0,1 NAME = S357 FLAGS = 0 VIEW = 8 OUT = 374,1 IN = 197,1 POS = 812,1465 821,1465 IV = CV = 0 0.251003 98.9998 95 0.836842 0 0 0 0 0 0.157895 0 0 0 0 0 0.00526315 0 0 37.2304 9.3077 3.33657 0.0226734 / CV = 0.0941607 0.0634614 0 0 0 18.3428 2.21001 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 3382.38 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 358 TYPE = 0,1 NAME = S358 FLAGS = 0 VIEW = 8 OUT = 373,1 IN = 353,1 POS = 772,1464 782,1464 IV = CV = 0 52.8047 0.470588 50.0659 0.836842 0 0 0 0 0 0.157895 0 0 0 0 0 0.00526315 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 58.2966 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 359 TYPE = 512,1 NAME = S359 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 373,2 POS = 787,1470 787,1481 IV = CV = 0 15.5308 0 50.0659 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25071 0.0626783 0.0224685 0.000152683 0.00063408 / CV = 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 50.0504 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 360 TYPE = 0,1 NAME = S360 FLAGS = 0 VIEW = 4 OUT = 20,1 IN = 214,1 POS = 80,250 108,250 IV = CV = 0 47.9885 0.864463 83.8298 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 4.85176 0 0 0 0.382923 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 108.908 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 361 TYPE = 0,1 NAME = S361 FLAGS = 0 VIEW = 4 OUT = 26,1 IN = 216,1 POS = 90,533 110,533 IV = CV = 0 47.9885 0.864463 83.8297 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 4.85177 0 0 0 0.382924 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 108.908 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 362 TYPE = 256,1 NAME = S362 FLAGS = 8 VIEW = 8 OUT = 530,1 IN = 0,0 POS = 267,1119 281,1119 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 16.1281 16.1281 0 0 0 0 0 1.79468 CV = 0 0.912304 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 263.359 3.81679 732.824 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8.75 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = PSpec Frm = PSpec Frm = PSpec Frm = PSpec Frm = ADDIN = A 4 =1 b534:1*1.17 = 20 69/262*1000 = 21 1/262*1000 = 22 192/262*1000 [STREAM] NUM = 363 TYPE = 0,1 NAME = S139~1 FLAGS = 0 VIEW = 8 OUT = 540,3 IN = 133,2 POS = 562,83 553,83 553,105 -1,-1 372,318 386,318 IV = CV = 0 41.3795 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.416227 0 0 0 0.00772505 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 364 TYPE = 0,1 NAME = S364 FLAGS = 0 VIEW = 4 OUT = 1,1 IN = 221,1 POS = 162,61 162,48 IV = CV = 0 82.9686 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 760 0 0 0 0 0 27 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 365 TYPE = 0,1 NAME = S83 FLAGS = 0 VIEW = 8 OUT = 215,1 IN = 211,1 POS = 536,545 556,545 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 366 TYPE = 0,1 NAME = S56 FLAGS = 0 VIEW = 8 OUT = 212,1 IN = 215,1 POS = 558,539 558,498 562,498 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 367 TYPE = 0,1 NAME = S367 FLAGS = 0 VIEW = 4 OUT = 188,2 IN = 305,1 POS = 589,1479 589,1470 IV = CV = 0 7580.95 0.00503949 50.0029 0.223533 0 0 0 0 0 0.146803 0.624769 0 0 0 0 0.00489344 0 0 0.248165 0.0620637 / CV = 0.0222404 0.000151133 0.000627643 0.000423012 0 0 0 0.122267 0.0147312 0 0 0 0 00000000000/ CV = 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 368 TYPE = 0,1 NAME = S368 FLAGS = 0 VIEW = 8 OUT = 189,1 IN = 188,1 POS = 594,1465 606,1465 IV = CV = 0 10627.1 0.007082 50.0876 0.428849 0 0 0 0 0 0.156818 0.409105 0 0 0 0 0.00522727 0 0 0.251073 0.0627649 / CV = 0.022501 0.000152904 0.000634997 0.000427968 0 0 0 0.123699 0.0149038 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.1963 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 369 TYPE = 0,1 NAME = S369 FLAGS = 0 VIEW = 8 OUT = 306,1 IN = 189,2 POS = 611,1470 611,1479 IV = CV = 0 255.052 0.0206558 50.0876 0.428849 0 0 0 0 0 0.156818 0.409105 0 0 0 0 0.00522727 0 0 0.251073 0.0627649 / CV = 0.022501 0.000152904 0.000634997 0.000427968 0 0 0 0.123699 0.0149038 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.4342 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 370 TYPE = 256,16 NAME = S452~1 FLAGS = 8 VIEW = 8 OUT = 212,2 IN = 0,0 POS = 549,493 562,493 A IV = 0 62 0 20 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2 0 232 766 0 0 / IV = 0 0 1000 CV = 0 62 0 20 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2 0 232 766 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 371 TYPE = 512,64 NAME = S455~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 212,2 POS = 572,494 582,494 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 372 TYPE = 512,16 NAME = S454~1 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 212,3 POS = 567,502 567,512 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 373 TYPE = 512,16 NAME = S453~1 FLAGS = 16 VIEW = 8 0 0 OUT = 0,0 IN = 212,1 POS = 572,500 582,500 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 374 TYPE = 0,1 NAME = S374 FLAGS = 0 VIEW = 4 OUT = 221,2 IN = 222,2 POS = 147,104 164,104 164,71 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 375 TYPE = 0,1 NAME = S375 FLAGS = 0 VIEW = 4 OUT = 235,7 IN = 222,1 POS = 147,107 179,107 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 376 TYPE = 256,1 NAME = S219~1 FLAGS = 8 0 VIEW = 8 OUT = 222,1 IN = 0,0 POS = 120,107 137,107 IV = 0 23.57 1 20 0 0.2795 0.4996 0.0238 0.1763 0.0207 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 23.57 0 0 0 47.14 27 0 636.39 CV = 0 0 1 20 0 0.2795 0.4996 0.0238 0.1763 0.0207 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 27 LINKS = 0 UNITS = 2 1 73 65 -11 0 0 53 65 -12 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0 A ADDIN = [STREAM] NUM = 377 TYPE = 0,1 NAME = S377 FLAGS = 0 VIEW = 4 OUT = 228,2 IN = 356,2 POS = 707,1470 707,1489 722,1489 IV = CV = 0 63.8285 0.00595256 50.0659 0.283548 0 0 0 0 0 0.693341 0 0 0 0 0 0.0231109 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.1547 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 379 TYPE = 256,1 NAME = S379 FLAGS = 8 VIEW = 8 OUT = 199,1 IN = 0,0 POS = 125,134 137,134 IV = 0 9.82 1 20 0 0.268 0.436 0.198 0.066 0.032 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 0 0 0 0 0 0 9.82 0 0 0 19.64 27 0 265.14 0.5 1.19784 CV = 0 0 1 20 0 0.268 0.436 0.198 0.066 0.032 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 27 LINKS = 0 UNITS = 2 1 73 65 -11 0 0 53 65 -12 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0 A ADDIN = [STREAM] NUM = 380 TYPE = 0,1 NAME = S380 FLAGS = 0 VIEW = 8 OUT = 235,3 IN = 199,1 POS = 147,131 163,131 163,111 179,111 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 381 TYPE = 0,1 NAME = S381 FLAGS = 0 VIEW = 8 OUT = 198,2 IN = 199,2 POS = 147,136 161,136 161,159 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 382 TYPE = 0,1 NAME = S179~1 FLAGS = 0 VIEW = 8 OUT = 223,1 IN = 224,1 POS = 572,55 581,55 IV = CV = 0 86.1437 0 95 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 199.846 50.2426 1.63347 2.3704 9.27273 6.6345 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.3275 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 383 TYPE = 0,1 NAME = S176~1 FLAGS = 0 VIEW = 4 OUT = 225,1 IN = 223,2 POS = 591,55 601,55 IV = CV = 0 86.1437 0 95 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 199.846 50.2426 1.63347 2.3704 9.27273 6.6345 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.3275 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 384 TYPE = 0,1 NAME = S180~1 FLAGS = 0 VIEW = 4 OUT = 540,4 IN = 225,2 POS = 606,60 606,69 -1,-1 372,324 386,324 IV = CV = 0 43.855 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV A = 0 0 0 0 0 0 85 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 385 TYPE = 0,1 NAME = S385 FLAGS = 0 VIEW = 4 OUT = 224,1 IN = 226,2 POS = 529,144 529,55 562,55 IV = CV = 0 127.524 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.134 33.9395 1.10343 1.60123 6.2701 4.48168 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 89.6947 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 386 TYPE = 0,1 NAME = S386 FLAGS = 0 VIEW = 8 OUT = 226,1 IN = 291,1 POS = 515,149 525,149 IV = CV = 0 344.658 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.134 33.9395 1.10343 1.60123 6.2701 4.48168 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 89.6947 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 387 TYPE = 0,1 NAME = S387 FLAGS = 0 VIEW = 8 OUT = 21,1 IN = 204,2 POS = 256,423 265,423 IV = CV = 0 999.453 0.0182959 73.1383 0 0.0184513 0.812517 0.0325451 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95267 3.45386 0.372391 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 72.3207 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 388 TYPE = 512,1 NAME = S388 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 204,1 POS = 251,428 251,438 IV = CV = 0 5.02238 0.0182959 73.1383 0 0.0184513 0.812517 0.0325451 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 12.7192 / CV = 7.95267 3.45386 0.372391 1.51005 1.04231 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 390 TYPE = 0,1 NAME = S390 FLAGS = 0 VIEW = 4 OUT = 104,1 IN = 101,1 POS = 631,55 644,55 IV = CV = 0 42.2887 0 82.2222 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 407.094 102.346 3.32745 59.7784 0 13.5147 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 50.9005 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 391 TYPE = 0,1 NAME = S391 FLAGS = 0 VIEW = 4 OUT = 231,1 IN = 230,2 POS = 658,142 658,127 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 392 TYPE = 0,1 NAME = S392 FLAGS = 0 VIEW = 4 OUT = 79,4 IN = 230,1 POS = 662,152 662,230 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 393 TYPE = 512,1 NAME = S393 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 231,2 POS = 663,122 681,122 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 0 0 0 OPT = ADDIN = [STREAM] NUM = 394 TYPE = 0,1 NAME = S394 FLAGS = 0 VIEW = 4 OUT = 102,4 IN = 231,1 POS = 660,117 660,70 668,70 668,59 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 395 TYPE = 0,1 NAME = S343 FLAGS = 0 VIEW = 4 OUT = 177,1 IN = 228,1 POS = 732,1490 754,1490 754,1411 IV = CV = 0 105.338 0.0109249 50.0425 0.652353 0 0 0 0 0 0.336432 0 0 0 0 0 0.0112143 0 0 0.16155 0.0424155 0.014478 / CV = 0.0000983842 0.000408582 0.000275371 0 0 0 0.079593 0.00958966 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 50.2239 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 396 TYPE = 0,1 NAME = S365 FLAGS = 512 VIEW = 8 OUT = 366,2 IN = 227,2 POS = 707,1425 555,1425 IV = 0 557.558 0.00000212527 48.1618 0.548526 0 0 0 0 0 0.435905 0 0 0 0 0 0.0155705 0 0 0.284638 0.0269031 / IV = 0.0113112 0.0000542838 0.00035541 0.000255053 0 0 0 0.0734055 0.00799764 0.0000060092 0 0 0 0 0 0 0 0 / IV = 0 0 0 0 0 0 0 0 0 760 CV = 0 522.583 0.00000213981 48.5928 0.54146 0 0 0 0 0 0.44375 0 0 0 0 0 0.0147912 0 0 0.212941 0.0533775 / CV = 0.0190836 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 48.5801 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 397 TYPE = 0,1 NAME = S397 FLAGS = 0 VIEW = 8 OUT = 233,1 IN = 209,1 POS = 509,1312 520,1312 IV = CV = 0 393.975 0.0869565 62.0361 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.317369 0.130807 0.0482832 / CV = 0.000328105 0.00136259 0.00091835 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 398 TYPE = 0,1 NAME = S398 FLAGS = 0 VIEW = 8 OUT = 384,1 IN = 352,1 POS = 566,1308 566,1200 581,1200 IV = CV = 0 196.988 0.0869565 62.0361 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.317369 0.130807 0.0482832 0.000328105 0.00136259 / CV = 0.00091835 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 399 TYPE = 0,1 NAME = S399 FLAGS = 0 VIEW = 8 OUT = 371,1 IN = 352,2 POS = 562,1318 562,1402 555,1402 IV = CV = 0 196.988 0.0869565 62.0361 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.317369 0.130807 0.0482832 0.000328105 0.00136259 / CV = 0.00091835 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 400 TYPE = 0,1 NAME = S342~1 FLAGS = 0 VIEW = 8 OUT = 286,1 IN = 381,1 POS = 731,1406 717,1406 IV = CV = 0 816.324 0.00196129 48.5928 0.572988 0 0 0 0 0 0.413237 0 0 0 0 0 0.0137745 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 48.6134 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 401 TYPE = 0,1 NAME = S363 FLAGS = 512 VIEW = 8 OUT = 371,2 IN = 286,1 POS = 707,1409 555,1409 IV = 0 13.1002 0.123596 48.1618 0.581477 0 0 0 0 0 0.404089 0 0 0 0 0 0.0144341 0 0 0.284638 0.0269031 0.0113112 / IV = 0.0000542838 0.00035541 0.000255053 0 0 0 0.0734055 0.00799764 0.0000060092 0 000000000000/ IV = 0 0 0 0 760 CV = 0 12.3508 0.123596 48.5928 0.574528 0 0 0 0 0 0.411747 0 0 0 0 0 0.0137248 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.6821 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 402 TYPE = 0,1 NAME = S344~1 FLAGS = 0 VIEW = 8 OUT = 177,2 IN = 301,2 POS = 703,1510 757,1510 757,1411 IV = CV = 0 631.327 0.00071301 50.0653 0.370088 0 0 0 0 0 0.609592 0 0 0 0 0 0.0203198 0 0 0.248384 0.0620995 0.02226 / CV = 0.000151266 0.000628196 0.000423385 0 0 0 0.122375 0.0147441 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 50.0624 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 403 TYPE = 0,1 NAME = S375~1 FLAGS = 0 VIEW = 4 OUT = 302,1 IN = 360,2 POS = 687,1470 687,1490 693,1490 IV = CV = 0 2501.87 0.000719691 50.0659 0.370088 0 0 0 0 0 0.609592 0 0 0 0 0 0.0203198 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.063 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 404 TYPE = 0,1 NAME = S373 FLAGS = 0 VIEW = 8 OUT = 304,1 IN = 364,2 POS = 651,1470 651,1479 IV = CV = 0 7686.44 0.00547846 50.0659 0.185331 0 0 0 0 0 0.130328 0.679995 0 0 0 0 0.00434426 0 0 0.25071 0.0626783 / CV = 0.0224685 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.1464 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 405 TYPE = 0,1 NAME = S366 FLAGS = 512 VIEW = 8 OUT = 187,2 IN = 306,2 POS = 611,1489 611,1504 549,1504 549,1470 IV = 0 2104.33 0.00451281 50 0.191603 0 0 0 0 0 0.141206 0.662144 0 0 0 0 0.00504389 0 0 0.331613 0.0311621 / IV = 0.013178 0.0000632425 0.000414065 0.000297145 0 0 0 0.0855199 0.00931752 0.00000700092 0 0 0 0 0 0 0 / IV = 0 0 0 0 0 0 0 0 0 0 760 CV = 0 2254.61 0.00449673 50 0.191072 0 0 0 0 0 0.14522 0.658866 0 0 0 0 0.00484066 0 0 0.248065 0.0620369 / CV = 0.0222314 0.000151072 0.00062739 0.000422841 0 0 0 0.122217 0.0147252 0 0 0 0 000000000000/ CV = 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 406 TYPE = 0,1 NAME = S334 FLAGS = 0 VIEW = 8 OUT = 219,2 IN = 385,2 POS = 591,1224 722,1224 722,1241 727,1241 IV = CV = 0 64.3154 0.00000213981 48.5929 0.541458 0 0 0 0 0 0.44375 0 0 0 0 0 0.0147913 0 0 0.212941 0.0533775 / CV = 0.0190836 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 48.5801 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 407 TYPE = 0,1 NAME = S407 FLAGS = 0 VIEW = 4 OUT = 295,2 IN = 343,1 POS = 885,1255 885,1216 898,1216 IV = CV = 0 0.0435934 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.14008 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22458 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 408 TYPE = 0,1 NAME = S408 FLAGS = 0 VIEW = 8 OUT = 390,1 IN = 330,1 POS = 611,1260 620,1260 I AV = CV = 0 3046.11 0.0121654 50.2979 0.640521 0 0 0 0 0 0.167143 0.186763 0 0 0 0 0.00557143 0 0 0.258309 0.0644342 / CV = 0.0231495 0.000157311 0.000653299 0.000440304 0 0 0 0.127265 0.0153333 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 50.4961 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 409 TYPE = 256,1 NAME = S409 FLAGS = 8 VIEW = 8 OUT = 330,2 IN = 0,0 POS = 606,1244 606,1255 IV = 0 25.76 0.11111 25 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 2.86219 CV = 0 30.2552 0.11111 25 0 0 0 0 0 0 1 LINKS = 1 1 CTRL 17 0 2 7 12 422 156 0 1 0.15 1 15 0 1 12 0 1 1 0 0 0 0 1 30.2 1 25.76 0 1 0.00015 1 5 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 410 TYPE = 0,1 NAME = S410 FLAGS = 0 VIEW = 4 OUT = 295,1 IN = 310,1 POS = 904,1255 904,1222 IV = CV = 0 0.156936 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.14008 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22458 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 411 TYPE = 0,1 NAME = S300 FLAGS = 0 VIEW = 8 OUT = 219,1 IN = 414,1 POS = 732,1225 732,1235 IV = CV = 0 281.391 0.000260955 48.5929 0.54146 0 0 0 0 0 0.443749 0 0 0 0 0 0.0147913 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 48.5845 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 412 TYPE = 256,1 NAME = S412 FLAGS = 8 VIEW = 4 OUT = 218,2 IN = 0,0 POS = 756,1186 756,1196 IV = 0 85 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 85 CV = 0 79.6589 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 35 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.1079*s413:totmass A ADDIN = [STREAM] NUM = 413 TYPE = 0,1 NAME = S413 FLAGS = 0 A VIEW = 8 OUT = 218,1 IN = 217,1 POS = 770,1201 761,1201 IV = CV = 0 736.665 0.00217348 50.062 0.572988 0 0 0 0 0 0.413238 0 0 0 0 0 0.0137745 0 0 0.235967 0.0590493 0.0211472 / CV = 0.000143704 0.000596793 0.00040222 0 0 0 0.116257 0.0140071 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.0855 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 414 TYPE = 0,1 NAME = S414 FLAGS = 0 VIEW = 8 OUT = 413,1 IN = 218,1 POS = 751,1201 737,1201 IV = CV = 0 816.324 0.00196129 48.5929 0.572988 0 0 0 0 0 0.413238 0 0 0 0 0 0.0137745 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 48.6135 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 415 TYPE = 0,1 NAME = S295 FLAGS = 0 VIEW = 4 OUT = 217,1 IN = 415,1 POS = 752,1285 774,1285 774,1206 IV = CV = 0 105.338 0.0109249 50.0425 0.652352 0 0 0 0 0 0.336433 0 0 0 0 0 0.0112143 0 0 0.16155 0.0424155 0.014478 / CV = 0.0000983842 0.000408581 0.000275371 0 0 0 0.079593 0.00958966 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 50.2239 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 416 TYPE = 0,1 NAME = S416 FLAGS = 512 VIEW = 8 OUT = 292,2 IN = 219,1 POS = 737,1240 849,1240 849,1200 899,1200 IV = 0 366.296 0.000212815 48.1619 0.548524 0 0 0 0 0 0.435906 0 0 0 0 0 0.0155712 0 0 0.284638 0.0269031 / IV = 0.0113112 0.0000542839 0.00035541 0.000255053 0 0 0 0.0734054 0.00799763 0.00000600921 0 0 0 0 0 0 0 / IV = 0 0 0 0 0 0 0 0 0 0 760 CV = 0 345.706 0.000212805 48.5929 0.54146 0 0 0 0 0 0.443749 0 0 0 0 0 0.0147913 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 48.5837 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 417 TYPE = 0,1 NAME = S417 FLAGS = 0 VIEW = 4 OUT = 355,1 IN = 356,1 POS = 712,1465 722,1465 IV = CV = 0 134.939 0.190476 50.0659 0.834079 0 0 0 0 0 0.160569 0 0 0 0 0 0.00535228 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 53.3881 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 418 TYPE = 0,1 NAME = S418 FLAGS = 0 VIEW = 4 OUT = 228,1 IN = 355,1 POS = 727,1470 727,1485 IV = CV = 0 4.04817 0.190476 50.0659 0.834079 0 0 0 0 0 0.160569 0 0 0 0 0 0.00535228 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 53.3881 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 419 TYPE = 0,1 NAME = S419 FLAGS = 0 VIEW = 8 OUT = 354,1 IN = 355,2 POS = 732,1465 742,1465 IV = CV = 0 130.891 0.190476 50.0659 0.834079 0 0 0 0 0 0.160569 0 0 0 0 0 0.00535228 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 53.3881 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 420 TYPE = 0,1 NAME = S301 FLAGS = 0 VIEW = 8 OUT = 217,2 IN = 412,2 P AOS = 723,1305 777,1305 777,1206 IV = CV = 0 631.327 0.000713009 50.0653 0.370088 0 0 0 0 0 0.609593 0 0 0 0 0 0.0203198 0 0 0.248384 0.0620995 / CV = 0.02226 0.000151266 0.000628196 0.000423385 0 0 0 0.122375 0.0147441 0 0 0 0 0 00000000000/ CV = 0 0 760 0 0 0 0 0 50.0624 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 421 TYPE = 0,1 NAME = S406 FLAGS = 0 VIEW = 8 OUT = 310,1 IN = 343,2 POS = 890,1259 899,1259 IV = CV = 0 1.04624 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.14008 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22458 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 422 TYPE = 512,1 NAME = S411 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 310,2 POS = 909,1259 922,1259 IV = CV = 0 0.889305 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.14008 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22458 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 1 53 64 -15 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 423 TYPE = 256,1 NAME = S415 FLAGS = 8 VIEW = 8 OUT = 330,3 IN = 0,0 POS = 606,1276 606,1265 IV = 0 2.25 0.06 30 0 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0.135 CV = 0 1.86758 0.06 30 0 0 0 0 0 0 0 0 0 0 0 0 1 LINKS = 1 1 CTRL 17 0 2 7 12 422 158 0 1 0.005 1 20 0 1 15 0 1 2 0 0 0 0 1 1.86 1 1.3 0 1 0.000005 1 5 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 424 TYPE = 0,1 NAME = S424 FLAGS = 512 VIEW = 8 OUT = 306,2 IN = 303,1 POS = 646,1501 625,1501 625,1482 616,1482 IV = 0 10309.8 0.00451281 50 0.191603 0 0 0 0 0 0.141206 0.662144 0 0 0 0 0.00504389 0 0 0.331613 0.0311621 / IV = 0.013178 0.0000632425 0.000414065 0.000297145 0 0 0 0.0855199 0.00931752 0.00000700092 0 0 0 0 0 0 0 / IV = 0 0 0 0 0 0 0 0 0 0 760 CV = 0 9664.83 0.00449673 50 0.191072 0 0 0 0 0 0.14522 0.658866 0 0 0 0 0.00484066 0 0 0.248065 0.0620369 / CV = 0.0222314 0.000151072 0.00062739 0.000422841 0 0 0 0.122217 0.0147252 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.0634 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 425 TYPE = 0,1 NAME = S425 FLAGS = 0 A VIEW = 8 OUT = 305,1 IN = 306,1 POS = 606,1484 594,1484 IV = CV = 0 7665.27 0.0050344 50.0029 0.223533 0 0 0 0 0 0.146803 0.624769 0 0 0 0 0.00489344 0 0 0.248165 0.0620637 / CV = 0.0222404 0.000151133 0.000627643 0.000423012 0 0 0 0.122267 0.0147312 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 50.0757 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 426 TYPE = 512,1 NAME = S426 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 305,2 POS = 589,1489 589,1500 IV = CV = 0 84.3179 0.00457671 50.0029 0.223533 0 0 0 0 0 0.146803 0.624769 0 0 0 0 0.00489344 0 0 0.248165 0.0620637 / CV = 0.0222404 0.000151133 0.000627643 0.000423012 0 0 0 0.122267 0.0147312 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 50.0677 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 427 TYPE = 0,1 NAME = S427 FLAGS = 512 VIEW = 8 OUT = 304,2 IN = 301,1 POS = 693,1508 662,1508 662,1487 656,1487 IV = 0 2020.2 0.00070491 49.5629 0.376754 0 0 0 0 0 0.601752 0 0 0 0 0 0.0214946 0 0 0.332038 0.0311805 0.0131948 / IV = 0.0000633235 0.000414595 0.000297526 0 0 0 0.0856294 0.00932945 0.00000700989 000000000000/ IV = 0 0 0 0 0 760 CV = 0 1893.98 0.00071301 50.0653 0.370088 0 0 0 0 0 0.609592 0 0 0 0 0 0.0203198 0 0 0.248384 0.0620995 0.02226 / CV = 0.000151266 0.000628196 0.000423385 0 0 0 0.122375 0.0147441 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 50.0624 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 428 TYPE = 256,1 NAME = S428 FLAGS = 8 VIEW = 4 OUT = 304,3 IN = 0,0 POS = 666,1482 656,1482 IV = 0 90 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 90 CV = 0 84.4015 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 35 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.00877*(s404:totmass +s427:totmass ) A ADDIN = [STREAM] NUM = 429 TYPE = 0,1 NAME = S429 FLAGS = 512 VIEW = 8 OUT = 303,1 IN = 304,1 POS = 651,1489 651,1497 IV = 0 10309.8 0.00451281 49.4327 0.191603 0 0 0 0 0 0.141206 0.662144 0 0 0 0 0.00504389 0 0 0.331613 0.0311621 / IV = 0.013178 0.0000632425 0.000414065 0.000297145 0 0 0 0.0855199 0.00931752 0.00000700092 0 0 0 0 0 0 0 / IV = 0 0 0 0 0 0 0 0 0 0 760 CV = 0 9664.83 0.00449673 49.9344 0.191072 0 0 0 0 0 0.14522 0.658866 0 0 0 0 0.00484066 0 0 0.248065 0.0620369 / CV = 0.0222314 0.000151072 0.00062739 0.000422841 0 0 0 0.122217 0.0147252 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 49.9977 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 430 TYPE = 256,1 NAME = S430 FLAGS = 8 VIEW = 4 OUT = 302,2 IN = 0,0 POS = 698,1471 698,1484 IV = 0 25 0 50 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 25 CV = 0 23.4344 0 50 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 50 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.00936*s403:totmass A ADDIN = [STREAM] NUM = 431 TYPE = 0,1 NAME = S431 FLAGS = 0 VIEW = 4 OUT = 301,1 IN = 302,1 POS = 698,1494 698,1503 IV = CV = 0 2525.31 0.00071301 50.0653 0.370088 0 0 0 0 0 0.609592 0 0 0 0 0 0.0203198 0 0 0.248384 0.0620995 0.02226 / CV = 0.000151266 0.000628196 0.000423385 0 0 0 0.122375 0.0147441 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 50.0624 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 432 TYPE = 0,1 NAME = S432 FLAGS = 0 VIEW = 4 OUT = 227,1 IN = 286,2 POS = 712,1411 712,1420 IV = CV = 0 803.973 0.000092725 48.5928 0.54146 0 0 0 0 0 0.44375 0 0 0 0 0 0.0147912 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 48.5817 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 433 TYPE = 256,1 NAME = S433 FLAGS = 8 VIEW = 4 OUT = 228,3 IN = 0,0 POS = 712,1493 722,1493 IV = 0 40 0 50 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 40 CV = 0 37.4613 0 50 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 50 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.5427*(s377:totmass +s418:totmass ) A ADDIN = [STREAM] NUM = 434 TYPE = 0,1 NAME = S331 FLAGS = 0 A VIEW = 4 OUT = 330,1 IN = 386,1 POS = 591,1260 601,1260 IV = CV = 0 3014 0.0111405 50.5736 0.706785 0 0 0 0 0 0.0843184 0.206085 0 0 0 0 0.00281061 0 0 0.261062 0.0670975 / CV = 0.0233962 0.000158987 0.00066026 0.000444996 0 0 0 0.128621 0.0154967 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.7544 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 435 TYPE = 0,1 NAME = S404 FLAGS = 0 VIEW = 8 OUT = 343,1 IN = 346,1 POS = 871,1260 880,1260 IV = CV = 0 1.08984 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.14008 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22458 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 436 TYPE = 0,1 NAME = S402 FLAGS = 0 VIEW = 8 OUT = 346,1 IN = 350,1 POS = 851,1260 861,1260 IV = CV = 0 13.4761 1.94092 52.6575 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 0.693446 0.253943 0.0621462 / CV = 0.000422309 0.00175382 0.00118202 0 0 0 0.341649 0.0411632 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 88.3811 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 439 TYPE = 0,1 NAME = S439 FLAGS = 0 VIEW = 8 OUT = 352,1 IN = 494,1 POS = 550,1312 560,1312 IV = CV = 0 393.975 0.0869565 62.0361 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.317369 0.130807 0.0482832 0.000328105 0.00136259 / CV = 0.00091835 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 440 TYPE = 0,1 NAME = S440 FLAGS = 0 VIEW = 8 OUT = 6,1 IN = 234,1 POS = 112,332 112,340 IV = CV = 0 142.689 0.130739 160 0 0.0187249 0.812528 0.0323228 0.116362 0.0200624 0 0 0 0 0 0 0 0 0 166.278 39.0323 / CV = 17.3464 1.84251 7.55653 5.15664 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 142.651 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 441 TYPE = 0,1 NAME = S441 FLAGS = 0 VIEW = 8 OUT = 236,1 IN = 235,1 POS = 189,107 200,107 IV = CV = 0 14.2299 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 442 TYPE = 0,1 NAME = S442 FLAGS = 0 VIEW = 8 OUT = 237,1 IN = 236,1 POS = 210,107 218,107 IV = CV = 0 14.2299 1 20 0.96 0 0 0 0 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 443 TYPE = 512,2 NAME = S405 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 346,2 POS = 866,1255 866,1246 IV = CV = 0 12.3863 760 100 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 639.11 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 444 TYPE = 0,1 NAME = S444 FLAGS = 0 VIEW = 8 OUT = 238,1 IN = 276,1 POS = 547,443 547,429 593,429 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 63 CV = 0 91.6189 0 144.407 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 144.407 LINKS = 0 UNITS = 1 48 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 445 TYPE = 0,1 NAME = S445 FLAGS = 0 VIEW = 8 OUT = 239,1 IN = 276,2 POS = 552,448 593,448 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 63 CV = 0 150.975 0 144.407 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 144.407 LINKS = 0 UNITS = 1 48 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 446 TYPE = 512,1 NAME = S446 FLAGS = 16 VIEW = 8 OUT = 0,0 A IN = 238,2 POS = 597,434 597,443 IV = CV = 0 61.6188 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 447 TYPE = 0,1 NAME = S447 FLAGS = 0 VIEW = 8 OUT = 265,1 IN = 238,3 POS = 599,424 599,412 645,412 IV = CV = 0 1.83238 0 256.206 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 33081.7 0 0 0 0 0 256.206 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 448 TYPE = 0,2 NAME = S448 FLAGS = 0 VIEW = 8 OUT = 244,1 IN = 238,1 POS = 603,432 691,432 691,441 IV = CV = 0 89.7864 33081.7 398.889 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 3 1 68 -11 0 0 0 3 40 0 0 0 0 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 1 TextTag = 0 52 OPT = ADDIN = [STREAM] NUM = 449 TYPE = 512,1 NAME = S449 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 239,2 POS = 593,452 587,452 587,462 IV = CV = 0 120.975 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 450 TYPE = 0,1 NAME = S450 FLAGS = 0 VIEW = 8 OUT = 265,2 IN = 239,3 POS = 603,448 640,448 640,417 645,417 IV = CV = 0 3.0195 0 314.165 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 78332.1 0 0 0 0 0 314.165 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 451 TYPE = 0,2 NAME = S451 FLAGS = 0 VIEW = 8 OUT = 246,1 IN = 239,1 POS = 603,455 676,455 676,481 719,481 IV = CV = 0 147.955 78332.1 468.333 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 784.925 LINKS = 0 UNITS = 3 A 3 40 0 0 0 0 1 68 -11 0 2 53 0 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 1 TextTag = 0 53 OPT = ADDIN = 0 0 0 0 0 [STREAM] NUM = 452 TYPE = 256,16 NAME = S452 FLAGS = 8 VIEW = 4 OUT = 240,2 IN = 0,0 POS = 570,480 583,480 IV = 0 62 0 20 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2 0 232 766 0 0 / IV = 0 0 1000 CV = 0 102.094 0 20 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2 0 232 766 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 453 TYPE = 512,16 NAME = S453 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 240,1 POS = 593,487 603,487 IV = CV = 0 130.403 760 176.667 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 170.17 / CV = 0.21805 23.6914 599.816 206.105 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 454 TYPE = 512,16 NAME = S454 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 240,3 POS = 588,489 588,499 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 455 TYPE = 512,64 NAME = S455 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 240,2 POS = 593,481 603,481 IV = CV = 0 0.156528 0 176.667 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 456 TYPE = 256,1 NAME = S456 FLAGS = 8 VIEW = 8 OUT = 235,6 IN = 0,0 POS = 188,86 188,102 IV = 0 7 0.923077 25 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 6.46154 0 0 0 13.4615 33.0769 0 231.538 CV = 0 0 0.923077 25 1 LINKS = 1 1 CTRL 17 0 2 7 12 496 1 0 1 193000 1 0.00014 0 1 20 0 0 0 0 0 0 1 7 1 0 0 1 1930 1 1 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 457 TYPE = 0,1 NAME = S457 FLAGS = 0 VIEW = 8 OUT = 241,1 IN = 276,3 POS = 551,453 551,463 619,463 619,486 629,486 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 63 CV = 0 81.5617 0 144.407 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 144.407 LINKS = 0 UNITS = 1 48 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 458 TYPE = 512,1 NAME = S458 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 241,2 POS = 634,491 634,504 IV = CV = 0 31.5617 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 459 TYPE = 0,1 NAME = S459 FLAGS = 0 VIEW = 8 OUT = 265,3 IN = 241,3 POS = 639,482 648,482 648,418 IV = CV = 0 1.63123 0 256.206 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 A00000000000/ CV = 0 0 0 33081.7 0 0 0 0 0 256.206 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 460 TYPE = 0,2 NAME = S460 FLAGS = 0 VIEW = 8 OUT = 244,3 IN = 241,1 POS = 639,487 690,487 690,451 IV = CV = 0 79.9305 33081.7 398.889 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 2 2 53 0 0 0 0 3 40 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 1 TextTag = 0 17 OPT = ADDIN = [STREAM] NUM = 461 TYPE = 256,1 NAME = S461 FLAGS = 8 VIEW = 8 OUT = 243,1 IN = 0,0 POS = 569,518 583,518 IV = 0 10 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 10 40 0 400 CV = 0 15.2996 0 40 LINKS = 1 1 CTRL 17 0 2 7 12 496 1 0 1 193000 1 0.000041 0 1 10 0 1 2 0 0 0 0 1 3 1 0 0 1 193 1 30 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 462 TYPE = 256,16 NAME = S462 FLAGS = 8 VIEW = 4 OUT = 243,2 IN = 0,0 POS = 568,523 583,523 IV = 0 10 0 20 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2 0 232 766 0 0 / IV = 0 0 1000 0 0 0 5.98428 0 59.8428 CV = 0 177.222 0 20 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2 0 232 766 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 463 TYPE = 512,16 NAME = S463 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 243,1 POS = 593,517 605,517 IV = CV = 0 191.504 760 421.165 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 46.168 / CV = 3.06512 23.0034 711.175 216.588 0 0 0 0 0 0 0 136.879 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 464 TYPE = 512,64 NAME = S464 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 243,2 POS = 593,521 605,521 IV = CV = 0 1.02813 0 421.165 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 92.673 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 465 TYPE = 512,16 NAME = S465 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 243,3 POS = 593,524 606,524 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 [STREAM] NUM = 466 TYPE = 0,1 NAME = S466 FLAGS = 512 VIEW = 4 OUT = 242,1 IN = 276,4 POS = 548,453 548,465 616,465 616,519 631,519 IV = 0 2.47449 0 144.417 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 760 0 0 0 0 63 CV = 0 225.239 0 144.407 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 144.407 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 467 TYPE = 0,1 NAME = S467 FLAGS = 0 VIEW = 4 OUT = 265,4 IN = 242,3 POS = 641,516 652,516 652,418 IV = CV = 0 2.80862 0 256.206 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 33081.7 0 0 0 0 0 256.206 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 468 TYPE = 512,1 NAME = S468 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 242,2 POS = 636,525 636,538 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 469 TYPE = 0,2 NAME = S469 FLAGS = 0 VIEW = 8 OUT = 244,2 IN = 242,1 POS = 641,519 693,519 693,451 IV = CV = 0 137.623 33081.7 398.889 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 1 TextTag = 0 15 OPT = ADDIN = [STREAM] NUM = 470 TYPE = 0,2 NAME = S470 FLAGS = 0 VIEW = 8 OUT = 245,1 IN = 244,1 POS = 696,443 712,443 IV = CV = 0 307.339 33081.7 398.888 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 471 TYPE = 0,2 NAME = S471 FLAGS = 0 VIEW = 8 OUT = 247,1 IN = 245,4 POS = 722,445 734,445 IV = CV = 0 286.809 33081.7 398.888 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 472 TYPE = 256,1 NAME = S403 FLAGS = 8 VIEW = 8 OUT = 350,2 IN = 0,0 POS = 846,1246 846,1255 IV = 0 11.387 0.0989 25 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 1.12617 60 CV = 0 13.224 0.0989 25 0 0 0 0 0 0 0 1 LINKS = 1 1 CTRL 17 0 2 7 12 422 157 0 1 0.05 1 15 0 1 15 0 1 1 0 0 0 0 1 13.22 1 11.387 0 1 0.00005 1 10 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 473 TYPE = 0,2 NAME = S473 FLAGS = 0 VIEW = 8 OUT = 254,1 IN = 245,1 POS = 712,447 702,447 702,496 IV = CV = 0 18.4404 33081.7 398.888 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 474 TYPE = 0,2 NAME = S474 FLAGS = 0 VIEW = 8 OUT = 248,1 IN = 246,1 POS = 729,481 748,481 IV = CV = 0 147.955 8517.21 237.092 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 694.639 LINKS = 0 UNITS = 1 1 68 -11 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 475 TYPE = 0,2 NAME = S475 FLAGS = 0 VIEW = 8 OUT = 262,1 IN = 248,1 POS = 750,486 750,533 IV = CV = LINKS = 0 UNITS = 1 2 53 0 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 0 [STREAM] NUM = 476 TYPE = 0,2 NAME = S476 FLAGS = 0 VIEW = 4 OUT = 249,1 IN = 248,2 POS = 758,481 768,481 IV = CV = 0 147.955 8517.21 237.092 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 694.639 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 477 TYPE = 0,2 NAME = S477 FLAGS = 0 VIEW = 8 OUT = 264,5 IN = 249,1 POS = 778,482 797,482 797,577 IV = CV = 0 147.955 3862.89 172.692 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 667.494 LINKS = 0 UNITS = 2 2 53 0 0 0 0 1 68 -11 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 478 TYPE = 0,2 NAME = S478 FLAGS = 0 VIEW = 8 OUT = 251,1 IN = 250,1 POS = 703,525 703,534 IV = CV = 0 18.4404 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.365 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 479 TYPE = 0,2 NAME = S477~1 FLAGS = 0 VIEW = 8 OUT = 259,1 IN = 252,1 POS = 784,445 794,445 IV = CV = 0 106.813 3862.89 184.969 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 674.035 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 480 TYPE = 256,1 NAME = S480 FLAGS = 8 VIEW = 4 OUT = 250,2 IN = 0,0 POS = 711,532 711,520 708,520 IV = 0 0 0 145.556 CV = 0 0 0 145.556 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 481 TYPE = 0,2 NAME = S481 FLAGS = 0 VIEW = 8 OUT = 252,1 IN = 253,2 POS = 765,445 774,445 IV = CV = 0 106.813 8517.21 254.981 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 704.336 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 482 TYPE = 0,2 NAME = S482 FLAGS = 0 VIEW = 8 OUT = 262,3 IN = 253,1 POS = 761,450 761,535 753,535 IV = CV = 0 179.997 8517.21 254.981 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 704.336 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 483 TYPE = 0,2 NAME = S483 FLAGS = 0 VIEW = 8 OUT = 253,1 IN = 247,1 POS = 744,445 755,445 IV = CV = 0 286.809 8517.21 254.981 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 704.336 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 484 TYPE = 0,2 NAME = S484 FLAGS = 0 VIEW = 8 OUT = 257,1 IN = 251,1 POS = 699,544 699,568 IV = CV = 0 0.95 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 765.365 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 485 TYPE = 0,2 NAME = S485 FLAGS = 0 VIEW = 4 OUT = 258,1 IN = 251,2 POS = 702,544 702,565 712,565 IV = CV = 0 0.95 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 765.365 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 486 TYPE = 0,2 NAME = S486 FLAGS = 0 VIEW = 8 OUT = 250,1 IN = 254,1 POS = 702,506 702,515 IV = CV = 0 18.4404 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 2 3 40 0 0 0 0 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 487 TYPE = 512,2 NAME = S487 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 245,2 POS = 722,449 728,449 728,462 IV = CV = 0 1.04495 33081.7 398.888 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 488 TYPE = 512,2 NAME = S488 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 245,3 POS = 720,450 720,461 IV = CV = 0 1.04495 33081.7 398.888 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.366 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 489 TYPE = 0,2 NAME = S489 FLAGS = 0 VIEW = 8 OUT = 256,1 IN = 251,3 POS = 708,538 717,538 IV = CV = 0 2.3 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 765.365 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 490 TYPE = 0,2 NAME = S490 FLAGS = 0 VIEW = 8 OUT = 262,2 IN = 256,1 POS = 727,538 743,538 IV = CV = 0 2.3 8517.21 373.483 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 765.365 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 491 TYPE = 0,2 NAME = S491 FLAGS = 0 VIEW = 4 OUT = 264,3 IN = 257,1 POS = 698,578 698,586 794,586 IV = CV = 0 0.95 3862.89 287.913 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 725.746 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 492 TYPE = 0,2 NAME = S492 FLAGS = 0 VIEW = 4 OUT = 264,2 IN = 258,1 POS = 717,571 717,583 794,583 IV = CV = 0 0.95 3862.89 287.913 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 725.746 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 493 TYPE = 0,2 NAME = S493 FLAGS = 0 VIEW = 8 OUT = 262,4 IN = 263,1 POS = 739,559 748,559 748,543 IV = CV = 0 0.9 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV A = 0 0 0 0 0 0 0 0 0 0 2906960 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 494 TYPE = 0,2 NAME = S494 FLAGS = 0 VIEW = 8 OUT = 264,4 IN = 259,1 POS = 801,450 801,577 IV = CV = 0 9.38765 3862.89 184.969 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 674.035 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 495 TYPE = 0,2 NAME = S495 FLAGS = 0 VIEW = 4 OUT = 260,1 IN = 259,2 POS = 804,445 814,445 IV = CV = 0 97.4249 3862.89 184.969 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 674.035 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 496 TYPE = 0,2 NAME = S496 FLAGS = 0 VIEW = 8 OUT = 261,1 IN = 260,1 POS = 824,445 835,445 IV = CV = 0 87.5434 50.8021 38.4137 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 614.272 LINKS = 0 UNITS = 2 2 53 0 0 0 0 1 68 -11 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 497 TYPE = 0,1 NAME = S497 FLAGS = 0 VIEW = 8 OUT = 278,1 IN = 261,1 POS = 845,445 854,445 IV = CV = 0 87.5434 0 38.4137 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 50.8021 0 0 0 0 0 38.4137 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 498 TYPE = 256,1 NAME = S498 FLAGS = 8 VIEW = 4 OUT = 261,2 IN = 0,0 POS = 838,429 838,440 IV = 0 0 0 15 CV = 0 2911.72 0 15 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 15 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 499 TYPE = 512,1 NAME = S499 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 261,2 POS = 842,440 842,429 IV = CV = 0 2911.72 0 32.3137 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 32.3137 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 500 TYPE = 512,1 NAME = S500 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 260,2 POS = 819,450 819,460 IV = CV = 0 9.88157 0 38.4137 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 501 TYPE = 0,2 NAME = S501 FLAGS = 0 VIEW = 8 OUT = 281,1 IN = 251,5 POS = 707,544 707,553 773,553 IV = CV = 0 12.4404 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 765.365 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 502 TYPE = 0,2 NAME = S502 FLAGS = 0 VIEW = 8 OUT = 263,1 IN = 251,4 POS = 705,544 705,559 729,559 IV = CV = 0 1.8 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 2906960 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 503 TYPE = 0,2 NAME = S503 FLAGS = 0 VIEW = 8 OUT = 264,1 IN = 263,2 POS = 733,565 733,581 794,581 IV = CV = 0 0.9 21445.9 387.23 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 765.365 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 504 TYPE = 0,2 NAME = S504 FLAGS = 0 VIEW = 8 OUT = 267,1 IN = 262,1 POS = 753,538 764,538 IV = CV = 0 184.891 8517.21 256.277 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 764223 LINKS = 0 UNITS = 1 2 53 0 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 505 TYPE = 0,2 NAME = S505 FLAGS = 0 VIEW = 8 OUT = 300,2 IN = 264,1 POS = 799,587 799,601 IV = CV = 0 161.043 3862.89 176.086 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 669.319 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 506 TYPE = 0,1 NAME = S506 FLAGS = 0 VIEW = 8 OUT = 266,1 IN = 265,1 POS = 655,413 664,413 IV = CV = 0 9.29173 0 275.041 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 33081.7 0 0 0 0 0 275.041 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 507 TYPE = 0,2 NAME = S507 FLAGS = 0 VIEW = 8 OUT = 262,5 IN = 266,2 POS = 674,413 745,413 745,533 IV = CV = 0 1.69468 9034.36 188.122 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 664.685 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 508 TYPE = 0,1 NAME = S508 FLAGS = 0 VIEW = 8 OUT = 269,1 IN = 266,1 POS = 671,418 671,598 688,598 IV = CV = 0 7.59705 0 188.122 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 9034.36 0 0 0 0 0 188.122 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 509 TYPE = 0,2 NAME = S509 FLAGS = 0 VIEW = 4 OUT = 264,6 IN = 267,1 POS = 768,543 768,579 794,579 IV = CV = 0 0.9 8517.21 256.277 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV A = 0 0 0 0 0 0 0 0 0 0 705.029 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 510 TYPE = 0,2 NAME = S510 FLAGS = 0 VIEW = 4 OUT = 279,1 IN = 267,2 POS = 774,538 785,538 IV = CV = 0 183.991 8517.21 256.277 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 705.029 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 511 TYPE = 512,1 NAME = S401 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 351,2 POS = 807,1265 807,1276 IV = CV = 0 15.5308 0 50.0659 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25071 0.0626783 0.0224685 0.000152683 0.00063408 / CV = 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 512 TYPE = 0,2 NAME = S512 FLAGS = 0 VIEW = 4 OUT = 271,1 IN = 300,2 POS = 802,601 802,593 810,593 810,582 832,582 IV = CV = 0 125.425 3862.89 176.086 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 669.319 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 513 TYPE = 0,2 NAME = S513 FLAGS = 0 VIEW = 4 OUT = 282,1 IN = 281,1 POS = 783,555 804,555 IV = CV = 0 14.1247 21445.9 241.186 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 677.081 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 514 TYPE = 256,1 NAME = S514 FLAGS = 8 VIEW = 4 OUT = 281,2 IN = 0,0 POS = 779,542 779,551 IV = 0 0 0 25 CV = 0 1.68429 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 515 TYPE = 0,1 NAME = S515 FLAGS = 0 VIEW = 8 OUT = 272,1 IN = 280,1 POS = 814,538 832,538 IV = CV = 0 193.823 0 185.474 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 8517.21 0 0 0 0 0 185.474 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 516 TYPE = 0,1 NAME = S516 FLAGS = 0 VIEW = 8 OUT = 272,2 IN = 282,1 POS = 814,555 835,555 835,542 IV = CV = 0 14.1247 0 231.186 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 21445.9 0 0 0 0 0 231.186 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 517 TYPE = 0,1 NAME = S517 FLAGS = 0 VIEW = 8 OUT = 272,3 IN = 273,1 POS = 840,558 840,542 IV = CV = 0 127.964 0 152.953 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 3862.89 0 0 0 0 0 152.953 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 518 TYPE = 0,2 NAME = S518 FLAGS = 0 VIEW = 4 OUT = 273,1 IN = 271,1 POS = 837,577 837,568 IV = CV = 0 127.964 3862.89 152.953 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 656.539 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 519 TYPE = 0,1 NAME = S519 FLAGS = 0 VIEW = 8 OUT = 270,1 IN = 272,1 POS = 842,537 851,537 IV = CV = 0 335.912 0 175.008 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 3862.89 0 0 0 0 0 175.008 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 520 TYPE = 256,1 NAME = S520 FLAGS = 8 VIEW = 4 OUT = 271,2 IN = 0,0 POS = 854,582 842,582 IV = 0 0 0 25 CV = 0 2.53813 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 521 TYPE = 256,1 NAME = S521 FLAGS = 8 VIEW = 4 OUT = 280,2 IN = 0,0 POS = 808,523 808,533 IV = 0 0 0 25 CV = 0 669.273 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 522 TYPE = 512,1 NAME = S522 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 280,2 POS = 813,533 813,523 IV = CV = 0 669.273 0 165.474 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 165.474 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 523 TYPE = 0,1 NAME = S523 FLAGS = 0 VIEW = 8 OUT = 274,1 IN = 277,1 POS = 834,606 824,606 IV = CV = 0 513.246 0 107.336 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 3309.74 0 0 0 0 0 107.336 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 524 TYPE = 256,1 NAME = S524 FLAGS = 8 VIEW = 8 OUT = 520,1 IN = 0,0 POS = 902,606 888,606 IV = 0 0 0 25 CV = 0 224.156 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 10+s446:1+s449:1+s458:1+s468:1 A ADDIN = [STREAM] NUM = 525 TYPE = 0,1 NAME = S525 FLAGS = 512 VIEW = 8 OUT = 276,1 IN = 284,1 POS = 716,606 544,606 544,453 IV = 0 298.91 0 144.417 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 760 CV = 0 549.394 0 144.407 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 144.407 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 526 TYPE = 0,1 NAME = S526 FLAGS = 0 VIEW = 8 OUT = 277,1 IN = 275,1 POS = 855,606 844,606 IV = CV = 0 513.246 0 107.292 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 107.292 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 527 TYPE = 0,2 NAME = S527 FLAGS = 0 VIEW = 4 OUT = 280,1 IN = 279,1 POS = 795,538 804,538 IV = CV = 0 193.823 8517.21 195.474 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 670.533 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 528 TYPE = 256,1 NAME = S528 FLAGS = 8 VIEW = 4 OUT = 279,2 IN = 0,0 POS = 790,523 790,533 IV = 0 0 0 25 CV = 0 9.8322 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 529 TYPE = 0,1 NAME = S529 FLAGS = 0 VIEW = 8 OUT = 284,2 IN = 269,1 POS = 698,600 716,600 IV = CV = 0 7.0665 0 152.953 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 3862.89 0 0 0 0 0 152.953 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 530 TYPE = 0,2 NAME = S530 FLAGS = 0 VIEW = 8 OUT = 274,2 IN = 269,2 POS = 698,596 816,596 816,601 IV = CV = 0 0.530555 3862.89 152.953 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 656.539 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 531 TYPE = 256,1 NAME = S531 FLAGS = 8 VIEW = 4 OUT = 273,2 IN = 0,0 POS = 853,560 842,560 IV = 0 0 0 25 CV = 0 546.324 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 532 TYPE = 512,1 NAME = S532 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 273,2 POS = 842,565 853,565 IV = CV = 0 546.324 0 142.953 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 142.953 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 533 TYPE = 0,1 NAME = S533 FLAGS = 0 VIEW = 8 OUT = 275,3 IN = 278,1 POS = 863,450 863,601 IV = CV = 0 87.5434 0 38.4394 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 1551.44 0 0 0 0 0 38.4394 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 534 TYPE = 256,1 NAME = S534 FLAGS = 8 VIEW = 4 OUT = 282,2 IN = 0,0 POS = 806,570 806,561 IV = 0 0 0 25 CV = 0 40.3244 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 535 TYPE = 512,1 NAME = S535 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 282,2 POS = 811,561 811,570 IV = CV = 0 40.3244 0 181.186 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 181.186 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 536 TYPE = 0,1 NAME = S536 FLAGS = 0 VIEW = 8 OUT = 275,1 IN = 270,1 POS = 859,542 859,601 IV = CV = 0 201.547 0 175.008 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 3862.89 0 0 0 0 0 175.008 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 537 TYPE = 512,1 NAME = S537 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 270,2 POS = 854,542 854,553 IV = CV = 0 134.365 0 175.008 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 3862.89 0 0 0 0 0 175.008 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 539 TYPE = 0,1 NAME = S539 FLAGS = 0 VIEW = 8 OUT = 284,1 IN = 300,1 POS = 793,606 726,606 IV = CV = 0 549.394 0 144.3 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 144.3 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 540 TYPE = 512,1 NAME = S540 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 284,2 POS = 726,600 737,600 IV = CV = 0 7.0665 0 144.582 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 3862.89 0 0 0 0 0 144.582 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 541 TYPE = 0,1 NAME = S541 FLAGS = 0 VIEW = 8 OUT = 300,1 IN = 274,1 POS = 814,606 803,606 IV = CV = 0 513.777 0 107.903 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 3309.74 0 0 0 0 0 107.903 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 542 TYPE = 0,1 NAME = S400 FLAGS = 0 VIEW = 8 OUT = 404,1 IN = 351,1 POS = 812,1260 822,1260 IV = CV = 0 37.2739 0.666667 50.0659 0.836842 0 0 0 0 0 0.157895 0 0 0 0 0 0.00526315 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 61.7325 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 543 TYPE = 0,1 NAME = S360~1 FLAGS = 0 VIEW = 8 OUT = 197,1 IN = 373,1 POS = 792,1465 802,1465 IV = CV = 0 37.2739 0.666667 50.0659 0.836842 0 0 0 0 0 0.157895 0 0 0 0 0 0.00526315 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 61.7324 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 544 TYPE = 512,2 NAME = S423 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 197,2 POS = 807,1460 807,1451 IV = CV = 0 37.0229 760 100 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 639.11 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 545 TYPE = 0,1 NAME = S421 FLAGS = 0 VIEW = 4 OUT = 353,1 IN = 354,1 POS = 752,1465 762,1465 IV = CV = 0 68.3316 0.364256 50.0659 0.835465 0 0 0 0 0 0.159227 0 0 0 0 0 0.00530757 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 56.4333 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 546 TYPE = 512,1 NAME = S422 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 353,2 POS = 767,1470 767,1482 IV = CV = 0 15.5269 0.00263777 50.0659 0 0 0 0 0 0 0.967679 0 0 0 0 0 0.0322565 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.0966 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 550 TYPE = 512,1 NAME = S420 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 354,2 POS = 747,1470 747,1482 IV = CV = 0 62.5593 0.000661219 50.0659 0 0 0 0 0 0 0.967797 0 0 0 0 0 0.0322599 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 551 TYPE = 0,1 NAME = S376 FLAGS = 0 VIEW = 8 OUT = 356,1 IN = 360,1 POS = 692,1465 702,1465 IV = CV = 0 198.767 0.131222 50.0659 0.826059 0 0 0 0 0 0.16833 0 0 0 0 0 0.00561097 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 52.3498 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 552 TYPE = 0,1 NAME = S552 FLAGS = 0 VIEW = 4 OUT = 290,1 IN = 289,2 POS = 586,259 586,268 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 553 TYPE = 512,1 NAME = S553 0 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 289,1 POS = 591,254 597,254 597,265 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 554 TYPE = 256,1 NAME = S554 FLAGS = 8 VIEW = 4 OUT = 290,2 IN = 0,0 POS = 602,273 591,273 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 258.76 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 258.76 CV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 258.76 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 555 TYPE = 512,1 NAME = S555 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 290,1 POS = 586,278 586,289 550,289 550,257 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 556 TYPE = 0,1 NAME = S556 FLAGS = 0 VIEW = 4 OUT = 88,1 IN = 226,1 POS = 529,154 529,235 561,235 IV = CV = 0 217.135 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.134 33.9395 1.10343 1.60123 6.2701 4.48168 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 89.6947 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 558 TYPE = 0,1 NAME = S558 FLAGS = 0 VIEW = 4 OUT = 384,3 IN = 292,1 POS = 904,1192 904,1183 586,1183 586,1196 IV = CV = 0 91.8124 0.0526085 49.5276 0.793977 0 0 0 0 0 0.151186 0.0497981 0 0 0 0 0.00503952 0 0 0.231199 0.0828831 / CV = 0.0207199 0.000140801 0.000584733 0.000394092 0 0 0 0.113908 0.0137241 0 0 0 0 00000000000/ CV = 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 559 TYPE = 512,1 NAME = S559 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 292,2 POS = 899,1196 886,1196 IV = CV = 0 254.096 0.000212805 48.5929 0.541458 0 0 0 0 0 0.44375 0 0 0 0 0 0.0147913 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 560 TYPE = 0,1 NAME = S560 FLAGS = 0 VIEW = 4 OUT = 371,3 IN = 293,1 POS = 884,1400 884,1382 575,1382 575,1405 555,1405 IV = CV = 0 91.8124 0.0526085 49.5276 0.793977 0 0 0 0 0 0.151186 0.0497981 0 0 0 0 0.00503952 0 0 0.231199 0.0828833 / CV = 0.0207199 0.000140801 0.000584734 0.000394092 0 0 0 0.113908 0.0137241 0 0 0 0 00000000000/ CV = 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 561 TYPE = 256,2 NAME = S561 FLAGS = 8 VIEW = 8 OUT = 299,2 IN = 0,0 POS = 686,221 686,230 IV = CV = 0 1.2916 8517.21 185.474 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 562 TYPE = 512,1 NAME = S562 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 293,2 POS = 878,1404 862,1404 IV = CV = 0 254.097 0.000212804 48.5928 0.54146 0 0 0 0 0 0.44375 0 0 0 0 0 0.0147913 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 563 TYPE = 0,1 NAME = S563 FLAGS = 0 VIEW = 4 OUT = 293,1 IN = 294,1 POS = 884,1424 884,1410 IV = CV = 0 0.20053 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.14016 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22459 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 564 TYPE = 0,1 NAME = S564 FLAGS = 0 VIEW = 4 OUT = 292,1 IN = 295,1 POS = 903,1212 903,1202 IV = CV = 0 0.20053 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.14004 0.768455 0.00522197 / CV = 0.0216864 0.014616 0 0 0 4.22458 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 565 TYPE = 0,32 NAME = S565 FLAGS = 0 VIEW = 8 OUT = 114,1 IN = 296,1 POS = 711,29 711,19 IV = CV = 0 163.086 72.3948 8.71041 1.50677 0 0 190.069 0 169.75 30.3597 599.604 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 566 TYPE = 512,1 NAME = S566 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 296,2 POS = 716,33 719,33 719,23 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 567 TYPE = 0,1 NAME = S567 FLAGS = 0 VIEW = 8 OUT = 103,1 IN = 297,1 POS = 696,54 707,54 IV = CV = 0 39.0653 0 104.444 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 440.685 126.137 3.60202 91.0956 0 18.1556 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 1 53 65 -12 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 0 [STREAM] NUM = 568 TYPE = 256,2 NAME = S568 FLAGS = 8 VIEW = 4 OUT = 297,2 IN = 0,0 POS = 691,38 691,49 IV = CV = 0 0.758574 8517.21 185.474 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 569 TYPE = 0,1 NAME = S569 FLAGS = 0 VIEW = 8 OUT = 79,1 IN = 298,1 POS = 651,235 660,235 IV = CV = 0 62.058 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 472.346 118.751 3.8608 69.3601 0 15.6818 0 0 0 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 47.43 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 570 TYPE = 0,1 NAME = S570 FLAGS = 0 VIEW = 4 OUT = 112,2 IN = 298,2 POS = 649,230 649,216 699,216 IV = CV = 0 9.94722 0 85 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 571 TYPE = 0,1 NAME = S571 FLAGS = 0 VIEW = 8 OUT = 92,1 IN = 299,1 POS = 690,235 699,235 IV = CV = 0 66.5165 0 104.444 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 440.685 126.137 3.60202 91.0957 0 18.1556 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 1 53 65 -12 0 0 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 572 TYPE = 0,1 NAME = S374~1 FLAGS = 0 VIEW = 8 OUT = 360,1 IN = 364,1 POS = 656,1465 682,1465 IV = CV = 0 2700.64 0.0103246 50.0659 0.796615 0 0 0 0 0 0.196824 0 0 0 0 0 0.00656081 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.2313 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 573 TYPE = 0,1 NAME = S372 FLAGS = 0 VIEW = 8 OUT = 364,1 IN = 365,1 POS = 636,1465 646,1465 IV = CV = 0 10387.1 0.00673847 50.0659 0.428849 0 0 0 0 0 0.156818 0.409105 0 0 0 0 0.00522727 0 0 0.25071 0.0626783 / CV = 0.0224685 0.000152683 0.00063408 0.000427351 0 0 0 0.123521 0.0148822 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.1685 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 574 TYPE = 256,1 NAME = S371 FLAGS = 8 VIEW = 4 OUT = 365,2 IN = 0,0 POS = 631,1451 631,1460 IV = 0 16 0 35 CV = 0 14.9948 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 35 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.001436*s575:totmass A ADDIN = [STREAM] NUM = 575 TYPE = 0,1 NAME = S370 FLAGS = 0 VIEW = 8 OUT = 365,1 IN = 189,1 POS = 616,1465 626,1465 IV = CV = 0 10372.1 0.00674822 50.0876 0.428849 0 0 0 0 0 0.156818 0.409105 0 0 0 0 0.00522727 0 0 0.251073 0.0627649 / CV = 0.022501 0.000152904 0.000634997 0.000427968 0 0 0 0.123699 0.0149038 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.1904 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 576 TYPE = 0,1 NAME = S351~1 FLAGS = 0 VIEW = 8 OUT = 188,1 IN = 179,1 POS = 575,1465 584,1465 IV = CV = 0 3046.2 0.0121652 50.2979 0.640517 0 0 0 0 0 0.167143 0.186769 0 0 0 0 0.00557142 0 0 0.258309 0.0644341 / CV = 0.0231495 0.000157311 0.000653299 0.000440303 0 0 0 0.127265 0.0153333 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 50.496 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 580 TYPE = 0,1 NAME = S362~1 FLAGS = 0 VIEW = 8 OUT = 187,1 IN = 372,1 POS = 548,1451 548,1460 IV = CV = 0 759.464 0.0308649 52.2608 0.929828 0 0 0 0 0 0.0579789 0.0102601 0 0 0 0 0.00193262 0 0 0.299645 0.0803678 / CV = 0.026854 0.000182484 0.000757842 0.000510763 0 0 0 0.14763 0.017787 0 0 0 0 0 000000000000/ CV = 0 760 0 0 0 0 0 52.8059 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 581 TYPE = 0,1 NAME = S350 FLAGS = 0 VIEW = 8 OUT = 179,1 IN = 187,1 POS = 555,1465 565,1465 IV = CV = 0 3014.08 0.0111403 50.5736 0.70678 0 0 0 0 0 0.0843191 0.20609 0 0 0 0 0.00281063 0 0 0.261062 0.0670974 / CV = 0.0233962 0.000158987 0.00066026 0.000444995 0 0 0 0.128621 0.0154967 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.7544 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 582 TYPE = 0,1 NAME = S364~1 FLAGS = 0 VIEW = 8 OUT = 366,1 IN = 371,1 POS = 549,1411 549,1421 IV = CV = 0 301.151 0.0779881 57.6951 0.929975 0 0 0 0 0 0.0578549 0.0102415 0 0 0 0 0.00192849 0 0 0.286816 0.112394 / CV = 0.0386824 0.000262863 0.00109165 0.000735742 0 0 0 0.212657 0.0256217 0 0 0 0 000000000000/ CV = 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 583 TYPE = 0,1 NAME = S583 FLAGS = 0 VIEW = 4 OUT = 313,1 IN = 342,1 POS = 630,940 645,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 584 TYPE = 0,1 NAME = S361~1 FLAGS = 0 VIEW = 8 OUT = 372,1 IN = 366,1 POS = 549,1431 549,1441 IV = CV = 0 759.42 0.0309242 52.2608 0.929959 0 0 0 0 0 0.057871 0.010241 0 0 0 0 0.00192903 0 0 0.242236 0.080273 / CV = 0.0268555 0.000182495 0.000757885 0.000510793 0 0 0 0.147639 0.017788 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 52.8089 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 585 TYPE = 256,1 NAME = S356~1 FLAGS = 8 VIEW = 8 OUT = 374,2 IN = 0,0 POS = 826,1451 826,1460 IV = 0 11.387 0.0989 25 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 1.12617 60 CV = 0 13.224 0.0989 25 0 0 0 0 0 0 0 1 LINKS = 1 1 CTRL 17 0 2 7 12 347 157 0 1 0.05 1 15 0 1 15 0 1 1 0 0 0 0 1 13.22 1 14.74 0 1 0.00005 1 10 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 586 TYPE = 0,1 NAME = S354~1 FLAGS = 0 VIEW = 8 OUT = 376,1 IN = 374,1 POS = 831,1465 841,1465 IV = CV = 0 13.4761 1.94092 52.6575 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 0.693446 0.253945 0.0621462 / CV = 0.00042231 0.00175382 0.00118202 0 0 0 0.341649 0.0411632 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 / CV = 0 0 0 88.3811 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 590 TYPE = 512,2 NAME = S355 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 376,2 POS = 846,1460 846,1451 IV = CV = 0 12.3863 760 100 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 639.11 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 591 TYPE = 0,1 NAME = S352~1 FLAGS = 0 VIEW = 8 OUT = 380,1 IN = 376,1 POS = 851,1465 860,1465 IV = C AV = 0 1.08984 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.1401 0.768455 0.00522197 0.0216864 / CV = 0.014616 0 0 0 4.22459 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 592 TYPE = 0,1 NAME = S592 FLAGS = 0 VIEW = 8 OUT = 155,1 IN = 334,2 POS = 586,1011 586,1036 740,1036 740,976 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 593 TYPE = 0,1 NAME = S346 FLAGS = 0 VIEW = 8 OUT = 178,1 IN = 380,2 POS = 870,1464 879,1464 IV = CV = 0 1.04624 24 95 0.795 0 0 0 0 0 0.15 0.05 0 0 0 0 0.00499999 0 0 8.57465 3.1401 0.768455 0.00522197 0.0216864 / CV = 0.014616 0 0 0 4.22459 0.508994 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 891.934 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 594 TYPE = 0,1 NAME = S340 FLAGS = 0 VIEW = 8 OUT = 381,1 IN = 177,1 POS = 750,1406 741,1406 IV = CV = 0 736.665 0.00217348 50.062 0.572988 0 0 0 0 0 0.413237 0 0 0 0 0 0.0137745 0 0 0.235967 0.0590493 0.0211472 / CV = 0.000143704 0.000596793 0.00040222 0 0 0 0.116257 0.0140071 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.0855 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 595 TYPE = 0,1 NAME = S31~4 FLAGS = 0 VIEW = 8 OUT = 311,1 IN = 316,1 POS = 834,1066 834,1075 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 596 TYPE = 0,1 NAME = S1~2 FLAGS = 512 VIEW = 8 OUT = 362,2 IN = 311,1 POS = 829,1080 817,1080 817,981 829,981 IV = 0 197.853 0.021919 100 0 0.337077 0.0398004 0.00179533 0.0073117 0 0 0 0 0 0 0 0 0.00119612 0.612669 / IV = 26.1661 7.34196 0.00025627 0.00160803 0.0101149 2.20976 0 0 0 0 0 0 8.51625 10.7906 5.02364 4.33791 2.58573 / IV = 1.89677 0 0 11.355 1.41938 0.459183 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 600 TYPE = 0,1 NAME = S31~4 FLAGS = 512 VIEW = 8 OUT = 312,1 IN = 315,1 POS = 834,1027 834,1037 IV = 0 244.616 0 88.9925 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.00199384 0.000559885 1.953E-08 1.226E-07 7.712E-07 / IV = 0.00016837 0 0 0 0 0 0 0.000649139 0.000821985 0.000382801 0.000330712 0.000197079 0.000144535 0 0 0.000865899 / IV = 0.000108159 120.051 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 601 TYPE = 0,1 NAME = S11~2 FLAGS = 512 VIEW = 8 OUT = 323,1 IN = 312,1 POS = 839,1042 881,1042 IV = 0 44.8943 0 91.1973 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.00243097 0.000123913 1.429E-11 0.00000279065 0.0000182446 / IV = 0.0000607449 0 0 0 0 0 0.000011014 0.000579496 0.000869051 0.000312516 0.000129134 0.0000769772 0.0000668478 / IV = 0 0.000389234 0.000772811 0.000096572 400 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 602 TYPE = 0,1 NAME = S4~3 FLAGS = 0 VIEW = 8 OUT = 316,2 IN = 312,2 POS = 834,1047 834,1056 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 603 TYPE = 256,1 NAME = S341 FLAGS = 8 VIEW = 4 OUT = 381,2 IN = 0,0 POS = 736,1391 736,1401 IV = 0 85 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 85 CV = 0 79.6589 0 35 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 35 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 0.1079*s594:totmass A ADDIN = [STREAM] NUM = 604 TYPE = 0,1 NAME = S335 FLAGS = 0 VIEW = 8 OUT = 383,1 IN = 385,1 POS = 585,1226 585,1236 IV = CV = 0 759.42 0.0309242 52.2608 0.929959 0 0 0 0 0 0.057871 0.010241 0 0 0 0 0.00192903 0 0 0.242236 0.080273 / CV = 0.0268555 0.000182495 0.000757885 0.000510793 0 0 0 0.147638 0.017788 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 52.8089 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 605 TYPE = 0,1 NAME = S2~1 FLAGS = 512 VIEW = 8 OUT = 315,1 IN = 333,1 POS = 834,1008 834,1017 IV = 0 257.49 0 88.9925 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.00199384 0.000559885 1.953E-08 1.226E-07 7.712E-07 / IV = 0.00016837 0 0 0 0 0 0 6.2168 7.87705 3.66722 3.16664 1.88757 1.38463 0 0 8.28907 1.03613 114.049 0 0 / IV = 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 606 TYPE = 0,1 NAME = S20~2 FLAGS = 0 VIEW = 8 OUT = 316,3 IN = 315,2 POS = 829,1021 822,1021 822,1059 829,1059 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 610 TYPE = 0,1 NAME = S25~3 FLAGS = 0 VIEW = 8 OUT = 316,1 IN = 333,2 POS = 829,1003 820,1003 820,1061 829,1061 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 611 TYPE = 0,1 NAME = S332 FLAGS = 0 VIEW = 8 OUT = 386,1 IN = 383,1 POS = 584,1246 584,1255 IV = CV = 0 759.464 0.0308649 52.2608 0.929828 0 0 0 0 0 0.0579789 0.0102601 0 0 0 0 0.00193262 0 0 0.299645 0.0803678 / CV = 0.026854 0.000182484 0.000757842 0.000510763 0 0 0 0.14763 0.017787 0 0 0 0 0 000000000000/ CV = 0 760 0 0 0 0 0 52.8059 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 612 TYPE = 0,1 NAME = S302 FLAGS = 512 VIEW = 8 OUT = 384,2 IN = 413,1 POS = 727,1201 591,1201 IV = 0 13.1002 0.123596 48.1619 0.581475 0 0 0 0 0 0.40409 0 0 0 0 0 0.0144347 0 0 0.284638 0.0269031 0.0113112 / IV = 0.0000542839 0.00035541 0.000255053 0 0 0 0.0734054 0.00799763 0.00000600921 0 00000000000/ IV = 0 0 0 0 0 760 CV = 0 12.3508 0.123596 48.5929 0.574527 0 0 0 0 0 0.411748 0 0 0 0 0 0.0137249 0 0 0.212941 0.0533775 0.0190836 / CV = 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 613 TYPE = 0,1 NAME = S5~3 FLAGS = 512 VIEW = 8 OUT = 322,1 IN = 323,1 POS = 891,1042 922,1042 IV = 0 51.144 0 91.1973 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.00243091 0.000123917 1.429E-11 0.00000279069 0.0000182438 / IV = 0.0000607449 0 0 0 0 0 0.0000110139 0.000579499 0.000869096 0.000312518 0.000129127 0.000076971 0.0000668446 / IV = 0 0.000389258 0.000772807 0.0000965714 439.47 0 0 0 0 0 0 760 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 614 TYPE = 0,1 NAME = S333 FLAGS = 0 VIEW = 8 OUT = 385,1 IN = 384,1 POS = 585,1206 585,1216 IV = CV = 0 301.151 0.0779881 57.6951 0.929975 0 0 0 0 0 0.0578549 0.0102415 0 0 0 0 0.00192849 0 0 0.286816 0.112394 / CV = 0.0386824 0.000262863 0.00109165 0.000735742 0 0 0 0.212657 0.0256217 0 0 0 0 000000000000/ CV = 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 615 TYPE = 0,1 NAME = S1~2 FLAGS = 512 VIEW = 8 OUT = 324,1 IN = 322,1 POS = 932,1042 962,1042 IV = 0 24.2842 0 91.1973 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.00243091 0.000123917 1.429E-11 0.00000279069 0.0000182438 / IV = 0.0000607449 0 0 0 0 0 0.0000110139 0.000579499 0.000869096 0.000312518 0.000129127 0.000076971 0.0000668446 / IV = 0 0.000389258 0.000772807 0.0000965714 924.999 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 616 TYPE = 0,1 NAME = S2~2 FLAGS = 512 VIEW = 8 OUT = 323,2 IN = 324,2 POS = 967,1047 967,1070 886,1070 886,1047 IV = 0 6.24972 0 91.1973 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.00243091 0.000123917 1.429E-11 0.00000279069 0.0000182438 / IV = 0.0000607449 0 0 0 0 0 0.0000110139 0.000579499 0.000869096 0.000312518 0.000129127 0.000076971 0.0000668446 / IV = 0 0.000389258 0.000772807 0.0000965714 722.999 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 620 TYPE = 0,1 NAME = S3~2 FLAGS = 0 VIEW = 8 OUT = 332,1 IN = 324,1 POS = 972,1042 993,1042 993,1031 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 621 TYPE = 0,1 NAME = S296 FLAGS = 512 VIEW = 8 OUT = 385,2 IN = 414,2 POS = 727,1220 591,1220 IV = 0 557.556 0.00000212529 48.1619 0.548524 0 0 0 0 0 0.435906 0 0 0 0 0 0.0155712 0 0 0.284638 0.0269031 / IV = 0.0113112 0.0000542839 0.00035541 0.000255053 0 0 0 0.0734054 0.00799763 0.00000600921 0 0 0 0 0 0 0 / IV = 0 0 0 0 0 0 0 0 0 0 760 CV = 0 522.582 0.00000213981 48.5929 0.54146 0 0 0 0 0 0.443749 0 0 0 0 0 0.0147913 0 0 0.212941 0.0533775 / CV = 0.0190836 0.000129681 0.000538556 0.00036297 0 0 0 0.104912 0.0126402 0 0 0 0 000000000000/ CV = 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 622 TYPE = 0,1 NAME = S32~3 FLAGS = 0 VIEW = 8 OUT = 326,1 IN = 325,2 POS = 549,940 558,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 623 TYPE = 512,1 NAME = S23~2 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 325,1 P AOS = 544,945 544,954 0 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000001/ IV = 0 0 0 0 999 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 624 TYPE = 256,1 NAME = S33~3 FLAGS = 8 VIEW = 8 OUT = 326,2 IN = 0,0 POS = 563,925 563,935 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 1000 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 1 1 CTRL 17 0 2 7 3 154 40 0 1 0.05 1 -150 0 1 2 0 1 5 0 0 0 0 1 800 1 0 0 1 0.0005 1 1 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 625 TYPE = 0,1 NAME = S6~2 FLAGS = 0 VIEW = 8 OUT = 392,1 IN = 326,1 POS = 568,940 577,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 626 0 TYPE = 0,1 NAME = S316 FLAGS = 0 VIEW = 8 OUT = 386,2 IN = 405,2 POS = 647,1284 647,1299 585,1299 585,1265 IV = 0 2460.94 0.00264576 50 0.325589 0 0 0 0 0 0.2398 0.426039 0 0 0 0 0.00856572 0 0 0.0136794 0.0303591 / IV = 0.0138216 0.000072789 0.000473682 0.000324224 0 0 0 0.0890668 0.00977019 CV = 0 2254.54 0.00449673 50 0.191072 0 0 0 0 0 0.14522 0.658864 0 0 0 0 0.00484066 0 0 0.248065 0.0620369 / CV = 0.0222314 0.000151072 0.00062739 0.000422841 0 0 0 0.122217 0.0147252 0 0 0 0 000000000000/ CV = 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 630 TYPE = 0,1 NAME = S313 FLAGS = 0 VIEW = 4 OUT = 390,2 IN = 159,1 POS = 625,1274 625,1265 IV = CV = 0 7581.02 0.00503949 50.0029 0.223533 0 0 0 0 0 0.146803 0.624767 0 0 0 0 0.00489344 0 0 0.248165 0.0620637 / CV = 0.0222404 0.000151133 0.000627643 0.000423012 0 0 0 0.122267 0.0147312 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 50.0758 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 631 TYPE = 0,1 NAME = S36~3 FLAGS = 512 VIEW = 8 OUT = 336,1 IN = 341,1 POS = 707,967 707,980 IV = 0 688.476 0.00501012 31.7 0 0.132406 0.648242 0.0304036 0.0449326 0.144015 0 0 0 0 0 0 0 0 0 10.3206 / IV = 0.32368 4.205E-09 0.0108851 0.0503007 0.0367352 0 0 0 0 0 0.018242 62.7122 2.89457 0 13.2402 0 1.09164 / IV = 0 1.07764 0 0.139782 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 632 TYPE = 0,1 NAME = S23~2 FLAGS = 0 VIEW = 8 OUT = 331,1 IN = 361,1 POS = 683,1006 659,1006 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 633 TYPE = 0,1 NAME = S40~1 FLAGS = 0 VIEW = 4 OUT = 340,1 IN = 331,1 POS = 649,1006 639,1006 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 634 TYPE = 512,1 NAME = S43~4 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 332,1 POS = 993,1021 993,1010 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 635 TYPE = 0,1 NAME = S95~1 FLAGS = 512 VIEW = 8 OUT = 333,1 IN = 362,1 POS = 834,986 834,998 IV = 0 271.042 0.0160004 88.9925 0 0.337077 0.0398004 0.00179533 0.0073117 0 0 0 0 0 0 0 0 0.00119612 0.612669 / IV = 19.1011 5.35949 0.000187076 0.00117385 0.00738378 1.61311 0 0 0 0 0 0 6.2168 7.87705 3.66722 3.16664 / IV = 1.88757 1.38463 0 0 8.28907 1.03613 108.346 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 636 TYPE = 0,1 NAME = S10~2 FLAGS = 0 VIEW = 8 OUT = 334,1 IN = 403,1 POS = 607,1006 593,1006 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 640 TYPE = 0,1 NAME = S330 FLAGS = 0 VIEW = 8 OUT = 169,1 IN = 390,1 POS = 630,1260 642,1260 IV = CV = 0 10627.1 0.007082 50.0876 0.428849 0 0 0 0 0 0.156818 0.409104 0 0 0 0 0.00522726 0 0 0.251073 0.0627649 / CV = 0.022501 0.000152904 0.000634997 0.000427968 0 0 0 0.123699 0.0149038 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.1963 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 641 TYPE = 512,1 NAME = S61~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 334,1 POS = 588,1001 588,986 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 642 TYPE = 0,1 NAME = S21~2 FLAGS = 0 VIEW = 8 OUT = 335,1 IN = 336,1 POS = 707,990 707,1001 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 0 0 OPT = ADDIN = [STREAM] NUM = 643 TYPE = 0,1 NAME = S12~3 FLAGS = 0 VIEW = 8 OUT = 361,1 IN = 335,1 POS = 702,1006 693,1006 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 644 TYPE = 256,1 NAME = S11~2 FLAGS = 8 VIEW = 8 OUT = 336,4 IN = 0,0 POS = 725,985 712,985 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 0 0 1000 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = s631:1 * s631:Glu *0.0005/1000 A ADDIN = [STREAM] NUM = 645 TYPE = 256,1 NAME = S20~2 FLAGS = 8 VIEW = 8 OUT = 336,3 IN = 0,0 POS = 687,988 702,988 IV = 0 0.000001 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = s631:1 * s631:Glu *0.005/1000 A ADDIN = [STREAM] NUM = 646 TYPE = 256,1 NAME = S19~1 FLAGS = 8 VIEW = 8 OUT = 336,2 IN = 0,0 POS = 687,982 702,982 IV = 0 0.000001 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = s631:1*s631:Glu*0.04/1000 A ADDIN = [STREAM] NUM = 650 TYPE = 0,1 NAME = S24~3 FLAGS = 0 VIEW = 8 OUT = 403,1 IN = 340,1 POS = 629,1006 617,1006 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 651 TYPE = 0,1 NAME = S651 FLAGS = 0 VIEW = 8 OUT = 370,1 IN = 313,1 POS = 655,940 664,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 652 TYPE = 0,1 NAME = S10~2 FLAGS = 512 VIEW = 8 OUT = 155,2 IN = 150,1 POS = 721,940 744,940 744,966 IV = 0 382.041 0.00902924 55.401 0 0.132406 0.648242 0.0304036 0.0449326 0.144015 0 0 0 0 0 0 0 0 0 1.43951 / IV = 0.575424 5.262E-09 0.0136081 0.062884 0.045925 0 0 0 0 0 0.0228055 101.419 4.0568 0 6.86755 0 0.268597 / IV = 0 1.94201 0 0.00168466 0 0 0 0 0 0 0 760 CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 653 TYPE = 0,1 NAME = S653 FLAGS = 0 VIEW = 8 OUT = 375,1 IN = 370,1 POS = 674,940 683,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 654 TYPE = 0,1 NAME = S9~3 FLAGS = 0 VIEW = 8 OUT = 342,1 IN = 344,1 POS = 607,940 620,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 [STREAM] NUM = 655 TYPE = 0,1 NAME = S315 FLAGS = 0 VIEW = 8 OUT = 405,1 IN = 169,2 POS = 647,1265 647,1274 IV = CV = 0 255.051 0.0206559 50.0876 0.428849 0 0 0 0 0 0.156818 0.409104 0 0 0 0 0.00522726 0 0 0.251073 0.0627649 / CV = 0.022501 0.000152904 0.000634997 0.000427968 0 0 0 0.123699 0.0149038 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.4342 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 656 TYPE = 0,1 NAME = S310 FLAGS = 0 VIEW = 8 OUT = 406,1 IN = 167,2 POS = 687,1265 687,1273 IV = CV = 0 7686.44 0.00547847 50.0659 0.185331 0 0 0 0 0 0.130328 0.679993 0 0 0 0 0.00434425 0 0 0.25071 0.0626783 / CV = 0.0224685 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 00000000000/ CV = 0 0 760 0 0 0 0 0 50.1464 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 660 TYPE = 0,1 NAME = S326 FLAGS = 0 VIEW = 8 OUT = 393,1 IN = 167,1 POS = 692,1260 702,1260 IV = CV = 0 2700.64 0.0103247 50.0659 0.796615 0 0 0 0 0 0.196824 0 0 0 0 0 0.00656081 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.2313 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 661 TYPE = 0,1 NAME = S7~2 FLAGS = 0 VIEW = 8 OUT = 344,1 IN = 152,1 POS = 603,956 603,945 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 0 OPT = ADDIN = [STREAM] NUM = 662 TYPE = 0,1 NAME = S325 FLAGS = 0 VIEW = 8 OUT = 394,1 IN = 393,1 POS = 712,1260 722,1260 IV = CV = 0 198.767 0.131222 50.0659 0.826059 0 0 0 0 0 0.16833 0 0 0 0 0 0.00561097 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 52.3498 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 663 TYPE = 0,1 NAME = S306 FLAGS = 0 VIEW = 4 OUT = 415,2 IN = 394,2 POS = 727,1265 727,1284 742,1284 IV = CV = 0 63.8285 0.00595255 50.0659 0.283544 0 0 0 0 0 0.693343 0 0 0 0 0 0.023111 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.1547 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 664 TYPE = 0,1 NAME = S324 FLAGS = 0 VIEW = 4 OUT = 395,1 IN = 394,1 POS = 732,1260 742,1260 IV = CV = 0 134.939 0.190476 50.0659 0.834079 0 0 0 0 0 0.160569 0 0 0 0 0 0.00535228 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 53.3881 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 665 TYPE = 0,1 NAME = S305 FLAGS = 0 VIEW = 4 OUT = 415,1 IN = 395,1 POS = 747,1265 747,1280 IV = CV = 0 4.04817 0.190476 50.0659 0.834079 0 0 0 0 0 0.160569 0 0 0 0 0 0.00535228 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 53.3881 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 666 TYPE = 0,1 NAME = S322 FLAGS = 0 VIEW = 8 OUT = 401,1 IN = 395,2 POS = 752,1260 762,1260 IV = CV = 0 130.891 0.190476 50.0659 0.834079 0 0 0 0 0 0.160569 0 0 0 0 0 0.00535228 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 53.3881 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 670 TYPE = 512,1 NAME = S323 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 401,2 POS = 767,1265 767,1277 IV = CV = 0 62.5592 0.000661232 50.0659 0 0 0 0 0 0 0.967773 0 0 0 0 0 0.0322586 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.062 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 671 TYPE = 0,1 NAME = S320 FLAGS = 0 VIEW = 4 OUT = 402,1 IN = 401,1 POS = 772,1260 782,1260 IV = CV = 0 68.3316 0.364257 50.0659 0.835465 0 0 0 0 0 0.159227 0 0 0 0 0 0.00530756 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 56.4333 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 672 TYPE = 512,1 NAME = S321 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 402,2 POS = 787,1265 787,1277 IV = CV = 0 15.5269 0.00263757 50.0659 0 0 0 0 0 0 0.967756 0 0 0 0 0 0.0322586 0 0 0.25071 0.0626783 0.0224685 / CV = 0.000152683 0.00063408 0.00042735 0 0 0 0.123521 0.0148822 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 50.0966 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 673 TYPE = 0,1 NAME = S303 FLAGS = 0 VIEW = 8 OUT = 405,2 IN = 410,1 POS = 682,1296 661,1296 661,1279 652,1279 IV = CV = 0 9664.82 0.00449673 50 0.191072 0 0 0 0 0 0.14522 0.658864 0 0 0 0 0.00484066 0 0 0.248065 0.0620369 / CV = 0.0222314 0.000151072 0.00062739 0.000422841 0 0 0 0.122217 0.0147252 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 50.0634 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 674 TYPE = 0,1 NAME = S312 FLAGS = 0 VIEW = 8 OUT = 159,1 IN = 405,1 POS = 642,1279 630,1279 IV = CV = 0 7665.33 0.0050344 50.0029 0.223533 0 0 0 0 0 0.146803 0.624767 0 0 0 0 0.00489344 0 0 0.248165 0.0620637 / CV = 0.0222404 0.000151133 0.000627643 0.000423012 0 0 0 0.122267 0.0147312 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 50.0757 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 675 TYPE = 512,1 NAME = S314 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 159,2 POS = 625,1284 625,1294 IV = CV = 0 84.3184 0.00457673 50.0029 0.223533 0 0 0 0 0 0.146803 0.624767 0 0 0 0 0.00489344 0 0 0.248165 0.0620637 / CV = 0.0222404 0.000151133 0.000627643 0.000423012 0 0 0 0.122267 0.0147312 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 50.0677 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 676 TYPE = 0,1 NAME = S676 FLAGS = 0 VIEW = 4 OUT = 132,1 IN = 10,1 POS = 167,365 182,365 IV = CV = 0 178.815 0 122.959 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 131.548 32.7083 1.0634 1.54315 6.16601 4.31889 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1551 0 0 0 0 0 108.785 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 680 TYPE = 0,1 NAME = S304 FLAGS = 512 VIEW = 8 OUT = 406,2 IN = 412,1 POS = 713,1303 698,1303 698,1281 692,1281 IV = 0 2020.2 0.000704916 49.5629 0.376752 0 0 0 0 0 0.601753 0 0 0 0 0 0.0214955 0 0 0.332038 0.0311804 0.0131948 / IV = 0.0000633236 0.000414595 0.000297526 0 0 0 0.0856293 0.00932945 0.00000700989 000000000000/ IV = 0 0 0 0 0 760 CV = 0 1893.98 0.000713009 50.0653 0.370088 0 0 0 0 0 0.609593 0 0 0 0 0 0.0203198 0 0 0.248384 0.0620995 / CV = 0.02226 0.000151266 0.000628196 0.000423385 0 0 0 0.122375 0.0147441 0 0 0 0 0 00000000000/ CV = 0 0 760 0 0 0 0 0 50.0624 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 681 TYPE = 0,1 NAME = S311 FLAGS = 512 VIEW = 8 OUT = 410,1 IN = 406,1 POS = 687,1283 687,1292 IV = 0 10309.8 0.00451282 49.4327 0.191603 0 0 0 0 0 0.141207 0.662139 0 0 0 0 0.00504413 0 0 0.331613 0.031162 / IV = 0.0131779 0.0000632426 0.000414065 0.000297145 0 0 0 0.0855198 0.00931752 0.00000700093 0 0 0 0 0 0 0 / IV = 0 0 0 0 0 0 0 0 0 0 760 CV = 0 9664.82 0.00449673 49.9344 0.191072 0 0 0 0 0 0.14522 0.658864 0 0 0 0 0.00484066 0 0 0.248065 0.0620369 / CV = 0.0222314 0.000151072 0.00062739 0.000422841 0 0 0 0.122217 0.0147252 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 49.9977 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 682 TYPE = 256,1 NAME = S394~1 FLAGS = 8 VIEW = 4 OUT = 207,2 IN = 0,0 POS = 245,1206 256,1206 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 683 TYPE = 0,1 NAME = S391~1 FLAGS = 0 VIEW = 4 OUT = 207,1 IN = 416,1 POS = 261,1192 261,1201 IV = CV = 0 206.651 0.0861872 63.7829 0 0.00176159 0.83068 0.0291164 0.118136 0.0203052 0 0 0 0 0 0 0 0 0 0.9606 / CV = 1.03903 0.732832 0.0049799 0.0206811 0.0139385 0 0 0 1.11833 0.4854 0 0 0 0 0 000000000000/ CV = 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 684 TYPE = 0,1 NAME = S393~1 FLAGS = 0 VIEW = 4 OUT = 426,1 IN = 207,1 POS = 261,1211 261,1220 IV = CV = 0 206.651 0.0861872 63.7829 0 0.00176159 0.83068 0.0291164 0.118136 0.0203052 0 0 0 0 0 0 0 0 0 0.9606 / CV = 1.03903 0.732832 0.0049799 0.0206811 0.0139385 0 0 0 1.11833 0.4854 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 65.5256 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 685 TYPE = 0,1 NAME = S685 FLAGS = 0 VIEW = 8 OUT = 151,1 IN = 375,1 POS = 688,935 688,924 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 686 TYPE = 256,1 NAME = S686 FLAGS = 8 VIEW = 4 OUT = 370,2 IN = 0,0 POS = 669,924 669,935 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 2 PSpec = 3 Frm = s685:3 PSpec = 1 Frm = s685:1 A ADDIN = 0 0 [STREAM] NUM = 690 TYPE = 256,1 NAME = S392~1 FLAGS = 8 VIEW = 4 OUT = 416,2 IN = 0,0 POS = 244,1186 256,1186 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 0 0 0 0 0 0 0 0 0 A0000000000/ IV = 0 100 CV = 0 0.890386 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 691 TYPE = 0,1 NAME = S265 FLAGS = 0 VIEW = 8 OUT = 420,1 IN = 434,1 POS = 356,1168 366,1168 IV = CV = 0 197.978 0.0869565 62.0361 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.317304 0.130807 0.0482831 / CV = 0.000328103 0.00136258 0.000918346 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 692 TYPE = 512,1 NAME = S390~1 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 420,1 POS = 371,1172 371,1185 IV = CV = 0 0.989888 0.0869565 62.0361 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.317304 0.130807 0.0482831 / CV = 0.000328103 0.00136258 0.000918346 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 693 TYPE = 0,1 NAME = S172 FLAGS = 512 VIEW = 8 OUT = 148,2 IN = 423,2 POS = 214,1173 214,1235 180,1235 IV = 0 755.949 0 53.9058 0 0 0 0 0.00624109 0.0408916 0.0293239 / IV = 0 0 0 1.18231 0.0267846 CV = 0 532.229 0 58.02 0 0 0 0 0 0.00945317 0.0392582 0.026459 / CV = 0 0 0 1.68703 0.0389984 0 0 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = 180,1173 0 0 0 0 0 0 0 0 0 0 0 2.17161 0.47191 0.0383627 0 0 0 0 0 0 0 0 0 0 1.2461 0.577946 0.154565 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 [STREAM] NUM = 694 TYPE = 0,1 NAME = S285 FLAGS = 0 VIEW = 8 OUT = 421,1 IN = 148,1 POS = 185,1168 193,1168 IV = CV = 0 494.098 0.036269 58.7166 0 0.00250107 0.825652 0.0330712 0.118595 0.0201802 0 0 0 0 0 0 0 0 0 1.22314 / CV = 0.593118 0.175084 0.0119571 0.0496568 0.0334673 0 0 0 1.50346 0.0347551 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 59.3236 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 695 TYPE = 0,1 NAME = S695 FLAGS = 0 VIEW = 8 OUT = 325,1 IN = 391,1 POS = 530,940 539,940 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 696 TYPE = 0,1 NAME = S275 FLAGS = 0 VIEW = 8 OUT = 147,1 IN = 139,2 POS = 275,1173 275,1260 230,1260 IV = CV = 0 235.373 0 56.9865 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.29925 0.724274 0.507521 0.00344881 0.0143226 0.00965307 / CV = 0 0 0 0.774494 0.336163 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 56.8135 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 700 TYPE = 256,1 NAME = S286 FLAGS = 8 VIEW = 8 OUT = 421,2 IN = 0,0 POS = 190,1187 190,1171 193,1171 IV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 0 0 0 000000000008 CV = 0 32.856 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 701 TYPE = 0,1 NAME = S284 FLAGS = 0 VIEW = 8 OUT = 422,1 IN = 421,1 POS = 198,1173 198,1204 IV = CV = 0 526.996 0.033925 55.6 0 0.00250107 0.825652 0.0330712 0.118595 0.0201802 0 0 0 0 0 0 0 0 0 1.14678 / CV = 0.635988 0.164154 0.0112107 0.0465569 0.0313781 0 0 0 1.90837 0.0325855 0 0 0 000000000000/ CV = 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 702 TYPE = 0,1 NAME = S283~1 FLAGS = 0 VIEW = 8 OUT = 423,1 IN = 422,1 POS = 203,1207 208,1207 208,1154 215,1154 215,1163 IV = CV = 0 527.106 0.0337092 55.6 0 0.00176159 0.830681 0.0291164 0.118136 0.0203052 0 0 0 0 0 0 0 0 0 1.35523 / CV = 0.635855 0.16412 0.0112083 0.0465472 0.0313715 0 0 0 1.90798 0.0325787 0 0 0 0 00000000000/ CV = 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 703 TYPE = 0,1 NAME = S282~1 FLAGS = 512 VIEW = 8 OUT = 423,2 IN = 424,2 POS = 231,1173 231,1182 217,1182 217,1173 IV = 0 1544.64 0 53.9058 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.17161 0.47191 0.0383627 0.00624108 0.0408916 0.0293239 / IV = 0 0 0 1.1823 0.0267846 CV = 0 1097.87 0 58.02 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.2461 0.577946 0.154565 0.00945318 0.0392582 0.026459 / CV = 0 0 0 1.68703 0.0389984 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 57.8774 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 704 TYPE = 0,1 NAME = S281~2 FLAGS = 0 VIEW = 8 OUT = 424,1 IN = 423,1 POS = 219,1167 226,1167 IV = CV = 0 1092.75 0.0162602 56.8457 0 0.00176159 0.830681 0.0291164 0.118136 0.0203052 0 0 0 0 0 0 0 0 0 1.29874 / CV = 0.605879 0.159174 0.0102998 0.0427742 0.0288286 0 0 0 1.7936 0.0359017 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 57.0224 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 705 TYPE = 0,1 NAME = S256 FLAGS = 512 VIEW = 8 OUT = 424,2 IN = 433,2 POS = 329,1173 329,1255 240,1255 240,1153 231,1153 231,1163 IV = 0 297.552 0 57.3899 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.31229 0.276936 0.095216 0.000463381 0.00303607 0.0021772 / IV = 0 0 0 0.545051 0.0679036 CV = 0 209.459 0 70.353 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.703587 0.290049 0.107063 0.000727533 0.00302138 0.00203633 / CV = 0 0 0 0.588577 0.0709141 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 70.2722 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 706 TYPE = 0,1 NAME = S280~1 FLAGS = 0 VIEW = 8 OUT = 425,1 IN = 424,1 POS = 236,1167 256,1167 IV = CV = 0 204.336 0.0869565 64.1722 0 0.00176159 0.830681 0.0291164 0.118136 0.0203052 0 0 0 0 0 0 0 0 0 0.971487 / CV = 0.432215 0.13052 0.00503634 0.0209155 0.0140965 0 0 0 1.131 0.0551538 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 66.0101 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 710 TYPE = 0,1 NAME = S276~1 FLAGS = 0 VIEW = 8 OUT = 430,1 IN = 426,1 POS = 261,1230 261,1239 IV = CV = 0 208.902 0.0852588 70 0 0.00176159 0.83068 0.0291164 0.118136 0.0203052 0 0 0 0 0 0 0 0 0 0.950252 1.02788 / CV = 0.724938 0.00492626 0.0204583 0.0137884 0 0 0 1.10628 0.480171 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 711 TYPE = 0,1 NAME = S274 FLAGS = 0 VIEW = 8 OUT = 139,1 IN A = 430,1 POS = 266,1243 269,1243 269,1153 278,1153 278,1163 IV = CV = 0 209.39 0.0827257 70 0 0.00108677 0.854118 0.0251479 0.119647 0 0 0 0 0 0 0 0 0 0 3.27656 1.03103 0.723246 / CV = 0.00491476 0.0204106 0.0137562 0 0 0 1.1037 0.47905 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 712 TYPE = 0,1 NAME = S273 FLAGS = 512 VIEW = 8 OUT = 139,2 IN = 138,2 POS = 296,1173 296,1182 279,1182 279,1173 IV = 0 1541.48 0 56.864 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.5507 0.671016 0.455963 0.002219 0.0145389 0.010426 / IV = 0 0 0 0.576962 0.325171 CV = 0 1091.28 0 56.9865 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.29925 0.724274 0.507521 0.00344881 0.0143226 0.00965307 / CV = 0 0 0 0.774494 0.336163 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 56.8135 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 713 TYPE = 0,1 NAME = S272 FLAGS = 0 VIEW = 8 OUT = 138,1 IN = 139,1 POS = 282,1168 291,1168 IV = CV = 0 1065.3 0.0162599 59.601 0 0.00108677 0.854118 0.0251479 0.119647 0 0 0 0 0 0 0 0 0 0 2.49134 0.784785 / CV = 0.549923 0.00373695 0.0155192 0.0104596 0 0 0 0.839201 0.364248 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 59.7442 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = 0 [STREAM] NUM = 714 TYPE = 256,1 NAME = S271 FLAGS = 8 VIEW = 4 OUT = 138,2 IN = 0,0 POS = 296,1154 296,1163 IV = 0 234.6 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 0 0 0 0 0 0.997045 CV = 0 163.862 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 1.5*s715:tsuspsol +s715:1 A ADDIN = [STREAM] NUM = 715 TYPE = 0,1 NAME = S270 FLAGS = 0 VIEW = 8 OUT = 435,1 IN = 138,1 POS = 301,1168 310,1168 IV = CV = 0 137.881 0.125619 39.9476 0 0.00108677 0.854118 0.0251479 0.119647 0 0 0 0 0 0 0 0 0 0 1.0509 0.339904 / CV = 0.231969 0.00157632 0.00654634 0.00441206 0 0 0 0.353992 0.153647 0 0 0 0 0 0 000000000000/ CV = 760 0 0 0 0 0 41.6484 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 716 TYPE = 0,1 NAME = S266 FLAGS = 0 VIEW = 8 OUT = 433,1 IN = 432,1 POS = 322,1207 325,1207 325,1154 331,1154 331,1163 IV = CV = 0 166.42 0.103445 82 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 1.26302 0.52067 0.192189 0.001306 / CV = 0.00542372 0.00365544 0 0 0 1.05656 0.127299 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 720 TYPE = 0,1 NAME = S264~1 FLAGS = 512 VIEW = 8 OUT = 433,2 IN = 434,2 POS = 351,1173 351,1182 335,1182 335,1173 IV = 0 1540.13 0 57.3899 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.31229 0.276936 0.095216 0.000463381 0.00303607 0.0021772 / IV = 0 0 0 0.545051 0.0679036 CV = 0 1101.79 0 70.353 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.703587 0.290049 0.107063 0.000727533 0.00302138 0.00203633 / CV = 0 0 0 0.588577 0.0709141 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 70.2722 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 721 TYPE = 0,1 NAME = S263 FLAGS = 0 VIEW = 8 OUT = 434,1 IN A = 433,1 POS = 337,1168 346,1168 IV = CV = 0 1058.75 0.0162602 72.2379 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.791521 0.3263 0.120443 / CV = 0.00081846 0.003399 0.00229083 0 0 0 0.662138 0.0797769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 / CV = 0 0 72.5558 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 722 TYPE = 0,1 NAME = S722 FLAGS = 0 VIEW = 4 OUT = 396,1 IN = 363,1 POS = 220,365 229,365 IV = CV = 0 172.329 0 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 135.134 33.9393 1.10342 1.60123 6.27011 4.48144 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 723 TYPE = 256,1 NAME = S262 FLAGS = 8 VIEW = 4 OUT = 434,2 IN = 0,0 POS = 350,1154 350,1163 IV = 0 339 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 0 0 0 0 0.985695 CV = 0 241.016 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 55 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 2.5*s691:tsuspsol +s691:1 ADDIN = A [STREAM] NUM = 724 TYPE = 256,1 NAME = S394~2 FLAGS = 8 VIEW = 4 OUT = 436,2 IN = 0,0 POS = 237,1556 248,1556 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 725 TYPE = 0,1 NAME = S391~2 FLAGS = 0 VIEW = 4 OUT = 436,1 IN = 440,1 POS = 253,1542 253,1551 IV = CV = 0 206.652 0.0861872 63.7829 0 0.00176751 0.830676 0.0291163 0.118135 0.020305 0 0 0 0 0 0 0 0 0 0.960935 / CV = 1.03904 0.732832 0.00497991 0.0206812 0.0139386 0 0 0 1.11833 0.4854 0 0 0 0 0 00000000000/ CV = 0 0 760 0 0 0 0 0 65.5256 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 726 TYPE = 0,1 NAME = S393~2 FLAGS = 0 VIEW = 4 OUT = 452,1 IN = 436,1 POS = 253,1561 253,1570 IV = CV = 0 206.652 0.0861872 63.7829 0 0.00176751 0.830676 0.0291163 0.118135 0.020305 0 0 0 0 0 0 0 0 0 0.960935 / CV = 1.03904 0.732832 0.00497991 0.0206812 0.0139386 0 0 0 1.11833 0.4854 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 65.5256 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 730 TYPE = 256,1 NAME = S392~2 FLAGS = 8 VIEW = 4 OUT = 440,2 IN = 0,0 POS = 236,1536 248,1536 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 0 0 0 0 0 0 0 0 00000000000/ IV = 0 100 CV = 0 0.890391 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 23.375 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 731 TYPE = 0,1 NAME = S278~1 FLAGS = 0 VIEW = 8 OUT = 440,1 IN = 451,1 POS = 253,1523 253,1532 IV = CV = 0 205.762 0.0865602 63.9356 0 0.00176751 0.830676 0.0291163 0.118135 0.020305 0 0 0 0 0 0 0 0 0 0.965093 / CV = 1.04352 0.736004 0.00500146 0.0207707 0.0139989 0 0 0 1.12317 0.0547718 0 0 0 000000000000/ CV = 0 0 0 760 0 0 0 0 0 65.708 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 732 TYPE = 0,1 NAME = S265~1 FLAGS = 0 VIEW = 8 OUT = 441,1 IN = 462,1 POS = 348,1518 358,1518 IV = CV = 0 197.977 0.0869565 62.0361 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.317434 0.130807 0.0482832 / CV = 0.000328106 0.0013626 0.000918353 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 733 TYPE = 512,1 NAME = S390~2 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 441,1 POS = 363,1522 363,1535 IV = CV = 0 0.989887 0.0869565 62.0361 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.317434 0.130807 0.0482832 / CV = 0.000328106 0.0013626 0.000918353 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 734 TYPE = 0,1 NAME = S172~1 FLAGS = 512 VIEW = 8 OUT = 442,2 IN = 446,2 POS = 206,1523 206,1585 172,1585 IV = 0 755.949 0 53.9058 0 0 0 0 0.00624109 0.0408916 0.0293239 / IV = 0 0 0 1.18231 0.0267846 CV = 0 532.233 0 58.0199 0 0 0 0 0.0094532 0.0392583 0.0264591 / CV = 0 0 0 1.68703 0.0389984 0 0 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = 172,1523 0 0 0 0 0 0 0 0 0 0 0 2.17161 0.47191 0.0383627 0 0 0 0 0 0 0 0 0 0 0 1.24649 0.577947 0.154565 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 [STREAM] NUM = 735 TYPE = 0,1 NAME = S287~1 FLAGS = 0 VIEW = 8 OUT = 443,2 IN = 442,2 POS = 168,1523 168,1611 212,1611 IV = CV = 0 91.8935 0 58.0199 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.24649 0.577947 0.154565 0.00945319 0.0392583 0.0264592 / CV = 0 0 0 1.68703 0.0389984 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 57.8773 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 736 TYPE = 0,1 NAME = S285~1 FLAGS = 0 VIEW = 8 OUT = 444,1 IN = 442,1 POS = 177,1518 185,1518 IV = CV = 0 494.101 0.036269 58.7165 0 0.00250948 0.825645 0.0330709 0.118594 0.0201801 0 0 0 0 0 0 0 0 0 1.22348 / CV = 0.593119 0.175084 0.0119571 0.0496569 0.0334674 0 0 0 1.50347 0.034755 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 59.3235 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = 0 [STREAM] NUM = 740 TYPE = 0,1 NAME = S275~1 FLAGS = 0 VIEW = 8 OUT = 443,1 IN = 454,2 POS = 267,1523 267,1610 222,1610 IV = CV = 0 235.374 0 56.9865 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.29961 0.724276 0.507522 0.00344883 0.0143227 0.00965314 / CV = 0 0 0 0.774497 0.336163 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 56.8135 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 741 TYPE = 512,1 NAME = S288~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 443,1 POS = 217,1614 217,1624 IV = CV = 0 327.268 0 57.2768 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.00391 0.683188 0.408415 0.00513479 0.0213244 0.0143721 / CV = 0 0 0 1.03073 0.252722 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 57.1122 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 742 TYPE = 256,1 NAME = S286~1 FLAGS = 8 VIEW = 8 OUT = 444,2 IN = 0,0 POS = 182,1537 182,1521 185,1521 IV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 0 0 0 000000000008 CV = 0 32.8562 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 7.9584 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 743 TYPE = 0,1 NAME = S284~1 FLAGS = 0 VIEW = 8 OUT = 445,1 IN = 444,1 POS = 190,1523 190,1554 IV = CV = 0 527 0.033925 55.5999 0 0.00250948 0.825645 0.0330709 0.118594 0.0201801 0 0 0 0 0 0 0 0 0 1.14711 0.635989 / CV = 0.164154 0.0112107 0.046557 0.0313781 0 0 0 1.90838 0.0325854 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 56.1163 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 744 TYPE = 0,1 NAME = S283~2 FLAGS = 0 VIEW = 8 OUT = 446,1 IN = 445,1 POS = 195,1557 200,1557 200,1504 207,1504 207,1513 IV = CV = 0 527.11 0.0337091 55.5999 0 0.00176751 0.830676 0.0291163 0.118135 0.020305 0 0 0 0 0 0 0 0 0 1.35564 / CV = 0.635856 0.16412 0.0112083 0.0465473 0.0313716 0 0 0 1.90798 0.0325786 0 0 0 0 00000000000/ CV = 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = 0 [STREAM] NUM = 745 TYPE = 0,1 NAME = S282~2 FLAGS = 512 VIEW = 8 OUT = 446,2 IN = 450,2 POS = 223,1523 223,1532 209,1532 IV = 0 1544.64 0 53.9058 0 0 0 0 0.00624108 0.0408916 0.0293239 / IV = 0 0 0 1.1823 0.0267846 CV = 0 1097.88 0 58.0199 0 0 0 0 0.0094532 0.0392583 0.0264591 / CV = 0 0 0 1.68703 0.0389984 0 0 57.8773 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = 209,1523 0 0 0 0 0 0 0 0 0 0 0 2.17161 0.47191 0.0383627 0 0 0 0 0 0 0 0 0 0 0 1.24649 0.577947 0.154565 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 [STREAM] NUM = 746 TYPE = 0,1 NAME = S281~3 FLAGS = 0 VIEW = 8 OUT = 450,1 IN = 446,1 POS = 211,1517 218,1517 IV = CV = 0 1092.76 0.0162602 56.8456 0 0.00176751 0.830676 0.0291163 0.118135 0.020305 0 0 0 0 0 0 0 0 0 1.29914 / CV = 0.60588 0.159174 0.0102998 0.0427743 0.0288287 0 0 0 1.79361 0.0359017 0 0 0 0 00000000000/ CV = 0 0 0 760 0 0 0 0 0 57.0222 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 750 TYPE = 256,1 NAME = S5~3 FLAGS = 8 VIEW = 8 OUT = 392,2 IN = 0,0 POS = 582,923 582,935 IV = 0 0.8 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 CV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = .001399*s625:totmass A ADDIN = [STREAM] NUM = 751 TYPE = 0,1 NAME = S256~1 FLAGS = 512 VIEW = 8 OUT = 450,2 IN = 461,2 POS = 321,1523 321,1605 232,1605 232,1503 223,1503 223,1513 IV = 0 297.552 0 57.3899 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.31229 0.276936 0.095216 0.000463381 0.00303607 0.0021772 / IV = 0 0 0 0.545051 0.0679036 CV = 0 209.46 0 70.353 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.703876 0.29005 0.107063 0.000727539 0.00302141 0.00203635 / CV = 0 0 0 0.588579 0.0709142 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 70.2722 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 752 TYPE = 0,1 NAME = S280~2 FLAGS = 0 VIEW = 8 A OUT = 451,1 IN = 450,1 POS = 228,1517 248,1517 IV = CV = 0 204.337 0.0869565 64.1722 0 0.00176751 0.830676 0.0291163 0.118135 0.020305 0 0 0 0 0 0 0 0 0 0.971826 / CV = 0.432216 0.13052 0.00503635 0.0209156 0.0140965 0 0 0 1.131 0.0551539 0 0 0 0 000000000000/ CV = 0 0 760 0 0 0 0 0 66.0101 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 753 TYPE = 256,1 NAME = S279~1 FLAGS = 8 VIEW = 4 OUT = 451,2 IN = 0,0 POS = 252,1504 252,1513 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 115 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 200 219.008 CV = 0 1.4679 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 115 85 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 21.75 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 754 TYPE = 256,2 NAME = S277~1 FLAGS = 8 VIEW = 4 OUT = 452,2 IN = 0,0 POS = 237,1575 248,1575 IV = CV = 0 2.25027 3862.89 152.953 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 656.539 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 755 TYPE = 0,1 NAME = S276~2 FLAGS = 0 VIEW = 8 OUT = 453,1 IN = 452,1 POS = 253,1580 253,1589 IV = CV = 0 208.903 0.0852588 70 0 0.00176751 0.830676 0.0291163 0.118135 0.020305 0 0 0 0 0 0 0 0 0 0.950584 1.02788 / CV = 0.724939 0.00492627 0.0204584 0.0137884 0 0 0 1.10628 0.480171 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 71.8919 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 756 TYPE = 0,1 NAME = S274~1 FLAGS = 0 VIEW = 8 OUT = 454,1 IN = 453,1 POS = 258,1593 261,1593 261,1503 270,1503 270,1513 IV = CV = 0 209.392 0.0827255 70 0 0.00109043 0.854115 0.0251478 0.119647 0 0 0 0 0 0 0 0 0 0 3.27708 1.03103 0.723246 / CV = 0.00491477 0.0204106 0.0137562 0 0 0 1.1037 0.47905 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 760 TYPE = 0,1 NAME = S273~1 FLAGS = 512 VIEW = 8 OUT = 454,2 IN = 455,2 POS = 288,1523 288,1532 271,1532 271,1523 IV = 0 1541.48 0 56.864 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.5507 0.671016 0.455963 0.002219 0.0145389 0.010426 / IV = 0 0 0 0.576962 0.325171 CV = 0 1091.29 0 56.9865 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 2.29961 0.724276 0.507522 0.00344883 0.0143227 0.00965313 / CV = 0 0 0 0.774497 0.336163 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 56.8135 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 761 TYPE = 0,1 NAME = S272~1 FLAGS = 0 VIEW = 8 OUT = 455,1 IN = 454,1 POS = 274,1518 283,1518 IV = CV = 0 1065.3 0.0162599 59.6011 0 0.00109043 0.854115 0.0251478 0.119647 0 0 0 0 0 0 0 0 0 0 2.49174 0.784787 / CV = 0.549923 0.00373697 0.0155193 0.0104596 0 0 0 0.839204 0.364248 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 59.7443 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 762 TYPE = 256,1 NAME = S271~1 FLAGS = 8 VIEW = 8 OUT = 455,2 IN = 0,0 POS = 288,1504 288,1513 IV = 0 234.6 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 0 0 0 0 0 0.997045 CV = 0 163.863 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 1.5*s763:tsuspsol +s763:1 A ADDIN = [STREAM] NUM = 763 TYPE = 0,1 NAME = S270~1 FLAGS = 0 VIEW = 8 OUT = 463,1 IN = 455,1 POS = 293,1518 302,1518 IV = CV = 0 137.882 0.125619 39.9477 0 0.00109043 0.854115 0.0251478 0.119647 0 0 0 0 0 0 0 0 0 0 1.05107 0.339905 / CV = 0.231969 0.00157633 0.00654638 0.00441209 0 0 0 0.353994 0.153647 0 0 0 0 0 0 000000000000/ CV = 760 0 0 0 0 0 41.6484 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 764 TYPE = 256,2 NAME = S268~1 FLAGS = 8 VIEW = 4 OUT = 456,2 IN = 0,0 POS = 294,1539 303,1539 IV = CV = 0 12.5561 3862.89 152.953 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 656.539 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 765 TYPE = 0,1 NAME = S269~1 FLAGS = 0 VIEW = 8 OUT = 456,1 IN = 463,1 POS = 308,1523 308,1533 IV = CV = 0 153.8 0.112359 36.7848 0 0.00109043 0.854115 0.0251478 0.119647 0 0 0 0 0 0 0 0 0 0 0.942285 0.563399 / CV = 0.207961 0.00141319 0.00586884 0.00395545 0 0 0 1.14327 0.137745 0 0 0 0 0 0 0 00000000000/ CV = 760 0 0 0 0 0 38.1595 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 766 TYPE = 0,1 NAME = S267~1 FLAGS = 0 VIEW = 8 OUT = 460,1 IN = 456,1 POS = 308,1543 308,1552 IV = CV = 0 166.356 0.103879 82 0 0.00109043 0.854115 0.0251478 0.119647 0 0 0 0 0 0 0 0 0 0 0.871164 0.520875 / CV = 0.192265 0.00130652 0.00542588 0.0036569 0 0 0 1.05698 0.127349 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 / CV = 0 0 0 0 0 84.8332 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 770 TYPE = 0,1 NAME = S266~1 FLAGS = 0 VIEW = 8 OUT = 461,1 A IN = 460,1 POS = 314,1557 317,1557 317,1504 323,1504 323,1513 IV = CV = 0 166.421 0.103445 82 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 1.26353 0.520671 0.192189 0.00130601 / CV = 0.00542375 0.00365546 0 0 0 1.05656 0.127299 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 771 TYPE = 0,1 NAME = S264~2 FLAGS = 512 VIEW = 8 OUT = 461,2 IN = 462,2 POS = 343,1523 343,1532 327,1532 327,1523 IV = 0 1540.13 0 57.3899 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.31229 0.276936 0.095216 0.000463381 0.00303607 0.0021772 / IV = 0 0 0 0.545051 0.0679036 CV = 0 1101.79 0 70.353 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.703876 0.29005 0.107063 0.000727538 0.00302141 0.00203635 / CV = 0 0 0 0.588579 0.0709142 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 70.2722 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 772 TYPE = 0,1 NAME = S263~1 FLAGS = 0 VIEW = 8 OUT = 462,1 IN = 461,1 POS = 329,1518 338,1518 IV = CV = 0 1058.75 0.0162602 72.2379 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.791847 0.326301 0.120444 / CV = 0.000818466 0.00339902 0.00229085 0 0 0 0.662139 0.0797771 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 72.5557 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = 0 [STREAM] NUM = 773 TYPE = 256,1 NAME = S262~1 FLAGS = 8 VIEW = 4 OUT = 462,2 IN = 0,0 POS = 342,1504 342,1513 IV = 0 339 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 0 0 0 0 0.985695 CV = 0 241.016 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 55 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 2.5*s732:tsuspsol +s732:1 A ADDIN = [STREAM] NUM = 774 TYPE = 256,1 NAME = S259~1 FLAGS = 8 VIEW = 4 OUT = 463,2 IN = 0,0 POS = 306,1504 306,1513 IV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 0 0 0 000000000008 CV = 0 15.8781 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 7.9584 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 775 TYPE = 256,1 NAME = S396 FLAGS = 8 VIEW = 8 OUT = 208,2 IN = 0,0 POS = 144,1370 153,1370 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 0 0 0 0 0 0 0 0 00000000000/ IV = 0 100 CV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 776 TYPE = 0,1 NAME = S242~1 FLAGS = 0 VIEW = 8 OUT = 208,1 IN = 473,1 POS = 158,1355 158,1364 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 51.2716 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 780 TYPE = 0,1 NAME = S395 FLAGS = 0 VIEW = 4 OUT = 474,1 IN = 208,1 POS = 158,1374 158,1383 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 781 TYPE = 0,1 NAME = S385~1 FLAGS = 0 VIEW = 8 OUT = 464,1 IN = 466,1 POS = 366,1350 375,1350 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 782 TYPE = 512,1 NAME = S386~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 464,1 POS = 380,1355 380,1365 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 783 TYPE = 0,1 NAME = S261~1 FLAGS = 0 VIEW = 4 OUT = 484,1 IN = 465,1 POS = 325,1355 325,1365 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 784 TYPE = 256,1 NAME = S134 FLAGS = 8 VIEW = 4 OUT = 466,2 IN = 0,0 POS = 360,1336 360,1345 IV = 0 339 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 55 0 18645 0 0.985695 CV = 0 0 0 55 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 55 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 2.5*s781:tsuspsol +s781:1 A ADDIN = [STREAM] NUM = 785 TYPE = 0,1 NAME = S294 FLAGS = 0 VIEW = 8 OUT = 466,1 IN = 98,1 POS = 347,1350 356,1350 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 786 TYPE = 0,1 NAME = S254~1 FLAGS = 512 VIEW = 8 OUT = 470,2 IN = 471,2 POS = 120,1355 120,1391 85,1391 85,1355 IV = 0 597.097 0 55.6046 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.95533 0.380541 0.0269501 0.00645393 0.0396235 0.0303242 / IV = 0 0 0 1.0275 0.0122402 0.0620709 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 790 TYPE = 0,1 NAME = S251 FLAGS = 512 VIEW = 8 OUT = 129,2 IN = 470,2 POS = 81,1355 81,1398 126,1398 IV = 0 341.541 0 55.6046 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.95533 0.380541 0.0269502 0.00645392 0.0396235 0.0303242 / IV = 0 0 0 1.0275 0.0122402 0.0620709 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 791 TYPE = 512,1 NAME = S252~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 129,1 POS = 131,1401 131,1405 109,1405 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 792 TYPE = 256,1 NAME = S250 FLAGS = 8 VIEW = 4 OUT = 128,2 IN = 0,0 POS = 104,1336 104,1345 IV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 0 0 0 000000000008 CV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 793 TYPE = 0,1 NAME = S246 FLAGS = 512 VIEW = 8 OUT = 471,2 IN = 472,2 POS = 139,1355 139,1364 123,1364 123,1355 IV = 0 1007.79 0 55.6046 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.95533 0.380541 0.0269502 0.00645392 0.0396235 0.0303242 / IV = 0 0 0 1.0275 0.0122402 0.0620709 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 794 TYPE = 0,1 NAME = S245 FLAGS = 0 VIEW = 8 OUT = 472,1 IN = 471,1 POS = 125,1349 134,1349 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = 0 [STREAM] NUM = 795 TYPE = 0,1 NAME = S220 FLAGS = 512 VIEW = 8 OUT = 472,2 IN = 481,2 POS = 226,1355 226,1413 147,1413 147,1336 140,1336 140,1345 IV = 0 334.433 0 60.5525 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.953329 0.13586 0.0443725 0.0000971791 0.000596625 / IV = 0.000456601 0 0 0 0.431276 0.020914 0.000934623 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 796 TYPE = 0,1 NAME = S244 FLAGS = 0 VIEW = 8 OUT = 473,1 IN = 472,1 POS = 144,1349 153,1349 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 800 TYPE = 256,1 NAME = S243 FLAGS = 8 VIEW = 4 OUT = 473,2 IN = 0,0 POS = 158,1336 158,1345 IV = 0 0 0 25 0 0 0 0 0 000000000000 IV = 0 200 219.008 CV = 0 0 0 25 0 0 0 0 0 000000000000 CV = 0 0 0 0 0 21.75 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 0 0 0 0 0 0 0 0 0 115 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 / 0 0 0 0 0 0 0 0 0 0 0 115 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 / 0 [STREAM] NUM = 801 TYPE = 256,2 NAME = S241~1 FLAGS = 8 VIEW = 4 OUT = 474,2 IN = 0,0 POS = 142,1388 153,1388 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 802 TYPE = 0,1 NAME = S240~1 FLAGS = 0 VIEW = 8 OUT = 475,1 IN = 474,1 POS = 158,1393 158,1402 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 803 TYPE = 0,1 NAME = S236 FLAGS = 0 VIEW = 8 OUT = 480,1 IN = 476,1 POS = 179,1350 188,1350 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 804 TYPE = 0,1 NAME = S804 FLAGS = 0 VIEW = 4 OUT = 126,1 IN = 541,1 POS = 1003,272 1028,272 IV = CV = 0 143.743 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1218 43.0477 3.658 14.7466 10.2381 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 805 TYPE = 0,1 NAME = S234~1 FLAGS = 0 VIEW = 8 OUT = 483,1 IN = 480,1 POS = 198,1350 207,1350 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD A = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 806 TYPE = 0,1 NAME = S221 FLAGS = 0 VIEW = 4 OUT = 118,1 IN = 483,1 POS = 212,1355 212,1365 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 810 TYPE = 256,2 NAME = S232 FLAGS = 8 VIEW = 4 OUT = 118,2 IN = 0,0 POS = 198,1371 207,1371 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 811 TYPE = 0,1 NAME = S231~2 FLAGS = 0 VIEW = 8 OUT = 117,1 IN = 118,1 POS = 212,1375 212,1384 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = 0 [STREAM] NUM = 812 TYPE = 0,1 NAME = S230 FLAGS = 0 VIEW = 8 OUT = 481,1 IN = 117,1 POS = 217,1389 222,1389 222,1336 229,1336 229,1345 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 813 TYPE = 0,1 NAME = S226 FLAGS = 512 VIEW = 8 OUT = 482,2 IN = 98,2 POS = 340,1355 340,1399 258,1399 258,1336 247,1336 247,1345 IV = 0 357.732 0 49.1195 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.05889 0.00158756 0.00674569 0.0000147736 0.0000907015 / IV = 0.0000694142 0 0 0 0.243281 0.00317944 0.000142085 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 814 TYPE = 256,1 NAME = S223 FLAGS = 8 VIEW = 4 OUT = 483,2 IN = 0,0 POS = 212,1336 212,1345 IV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 0 0 0 000000000008 CV = 0 0 0 8 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 8 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 7.9584 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 815 TYPE = 0,1 NAME = S163 FLAGS = 0 VIEW = 8 OUT = 97,1 IN = 484,1 POS = 325,1375 325,1384 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 816 TYPE = 256,1 NAME = S235~2 FLAGS = 8 VIEW = 4 OUT = 485,2 IN = 0,0 POS = 305,1336 305,1345 IV = 0 234.6 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 0 0 0 0 0 0.997045 CV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 25 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 1 PSpec = 1 Frm = 1.5*s832:tsuspsol +s832:1 ADDIN = A [STREAM] NUM = 820 TYPE = 0,1 NAME = S236~1 FLAGS = 0 VIEW = 8 OUT = 485,1 IN = 486,1 POS = 291,1350 300,1350 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 821 TYPE = 0,1 NAME = S237~1 FLAGS = 512 VIEW = 8 OUT = 486,2 IN = 485,2 POS = 305,1355 305,1364 288,1364 288,1355 IV = 0 944.425 0 47.8436 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1.35803 0.605913 0.462595 0.00101312 0.00621998 0.00476021 / IV = 0 0 0 0.297805 0.218035 0.00974371 CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 822 TYPE = 0,1 NAME = S238~1 FLAGS = 0 VIEW = 8 OUT = 486,1 IN = 490,1 POS = 275,1406 277,1406 277,1335 286,1335 286,1345 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = 0 [STREAM] NUM = 823 TYPE = 0,1 NAME = S240~2 FLAGS = 0 VIEW = 8 OUT = 490,1 IN = 491,1 POS = 270,1393 270,1402 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 824 TYPE = 0,1 NAME = S395~1 FLAGS = 0 VIEW = 4 OUT = 491,1 IN = 493,1 POS = 270,1374 270,1383 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 825 TYPE = 256,2 NAME = S241~2 FLAGS = 8 VIEW = 4 OUT = 491,2 IN = 0,0 POS = 254,1388 265,1388 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 826 TYPE = 256,1 NAME = S243~1 FLAGS = 8 VIEW = 4 OUT = 492,2 IN = 0,0 POS = 270,1336 270,1345 IV = 0 0 0 25 0 0 0 0 0 000000000000 IV = 0 200 219.008 CV = 0 0 0 25 0 0 0 0 0 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 0 0 0 0 0 0 0 0 0 0 115 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 / 0 0 0 0 0 0 0 0 0 0 0 115 85 0 [STREAM] NUM = 830 TYPE = 0,1 NAME = S242~2 FLAGS = 0 VIEW = 8 OUT = 493,1 IN = 492,1 POS = 270,1355 270,1364 IV = CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 13.5463 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = WDTH WDTH = 1 A ADDIN = [STREAM] NUM = 831 TYPE = 256,1 NAME = S396~1 FLAGS = 8 VIEW = 8 OUT = 493,2 IN = 0,0 POS = 256,1370 265,1370 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 0 0 0 0 0 0 0 0 00000000000/ IV = 0 100 CV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 23.375 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 832 TYPE = 0,1 NAME = S832 FLAGS = 0 VIEW = 4 OUT = 465,1 IN = 485,1 POS = 310,1350 320,1350 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 833 TYPE = 0,1 NAME = S833 FLAGS = 0 VIEW = 4 OUT = 480,2 IN = 486,2 POS = 283,1355 283,1396 201,1396 201,1332 193,1332 193,1345 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 834 TYPE = 0,1 NAME = S834 FLAGS = 0 VIEW = 4 OUT = 209,1 IN = 441,2 POS = 368,1518 386,1518 -1,-1 489,1317 499,1317 IV = CV = 0 196.988 0.0869565 62.0361 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.317434 0.130807 0.0482832 / CV = 0.000328106 0.0013626 0.000918353 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 835 TYPE = 0,1 NAME = S835 FLAGS = 0 VIEW = 4 OUT = 209,2 IN = 464,2 POS = 385,1350 395,1350 395,1352 -1,-1 486,1314 499,1314 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 836 TYPE = 0,1 NAME = S836 FLAGS = 0 VIEW = 4 OUT = 209,3 IN = 420,2 POS = 376,1168 390,1168 -1,-1 489,1309 499,1309 IV = CV = 0 196.988 0.0869565 62.0361 0 0 0.856929 0.0236908 0.11938 0 0 0 0 0 0 0 0 0 0 0.317304 0.130807 0.0482831 / CV = 0.000328103 0.00136258 0.000918346 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 / CV = 0 0 0 0 63.892 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 840 TYPE = 256,1 NAME = S840 FLAGS = 8 VIEW = 4 OUT = 160,1 IN = 0,0 POS = 479,936 500,936 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 841 TYPE = 256,1 NAME = S841 FLAGS = 8 VIEW = 4 OUT = 160,2 IN = 0,0 POS = 480,943 500,943 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 842 TYPE = 256,1 NAME = S842 FLAGS = 8 VIEW = 4 0 0 OUT = 193,1 IN = 0,0 POS = 512,733 529,733 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 843 TYPE = 0,1 NAME = S843 FLAGS = 0 VIEW = 4 OUT = 494,1 IN = 233,1 POS = 530,1312 540,1312 IV = CV = 0 393.975 0.0869565 62.0361 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.317369 0.130807 0.0482832 0.000328105 0.00136259 / CV = 0.00091835 0 0 0 0.265437 0.0319809 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 844 TYPE = 256,2 NAME = S844 FLAGS = 8 VIEW = 4 OUT = 495,2 IN = 0,0 POS = 798,221 798,231 IV = CV = 0 2.73732 3862.89 152.953 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 845 TYPE = 0,1 NAME = S845 FLAGS = 0 VIEW = 4 OUT = 496,1 IN = 495,1 POS = 803,236 815,236 IV = CV = 0 182.551 0.0000673856 93.3 0 0 0 0 0 0 0 0 0.00000420621 0.00692026 0 0 0 0.993075 0 0 71.3438 11.3588 / CV = 2.25005 13.8784 58.9882 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 83.7313 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 846 TYPE = 256,1 NAME = S846 FLAGS = 8 VIEW = 4 OUT = 496,3 IN = 0,0 POS = 823,250 823,241 IV = CV = 0 0.00167362 200 20 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 1420 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 850 TYPE = 0,1 NAME = S850 FLAGS = 0 VIEW = 4 OUT = 512,1 IN = 511,2 POS = 753,286 753,312 IV = CV = 0 3.07911 0.00207525 64.947 0 0 0 0 0 0 0 0 0.00000420621 0.00692026 0 0 0 0.993075 0 0 14.227 2.26507 / CV = 0.448685 2.76752 11.7629 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 63.6656 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 851 TYPE = 512,2 NAME = S851 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 496,2 POS = 820,231 820,220 IV = CV = 0 4.78923 760 101.351 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 639.78 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 852 TYPE = 0,1 NAME = S852 FLAGS = 0 VIEW = 4 OUT = 501,1 IN = 496,1 POS = 825,236 836,236 IV = CV = 0 171.117 0.100452 101.351 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538191 0 0 0.0716802 0 0 76.1275 41.5147 / CV = 3.67269 14.8058 10.2792 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 95.2702 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 853 TYPE = 512,1 NAME = S853 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 501,1 POS = 841,231 841,221 IV = CV = 0 0.0572965 1.5 101.351 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538191 0 0 0.0716802 0 0 76.1275 41.5147 / CV = 3.67269 14.8058 10.2792 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 144.916 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 854 TYPE = 0,1 NAME = S854 FLAGS = 0 VIEW = 4 OUT = 502,1 IN = 501,2 POS = 846,236 859,236 IV = CV = 0 171.06 0.0999829 101.351 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538191 0 0 0.0716802 0 0 76.1275 41.5147 / CV = 3.67269 14.8058 10.2792 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 95.2535 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 855 TYPE = 0,1 NAME = S855 FLAGS = 0 VIEW = 4 OUT = 200,1 IN = 502,1 POS = 869,236 916,236 IV = CV = 0 153.956 0 101.351 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 76.1275 41.5147 3.67269 14.8058 10.2792 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 91.7068 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 856 TYPE = 0,1 NAME = S856 FLAGS = 0 VIEW = 4 OUT = 503,1 IN = 502,2 POS = 864,241 864,265 IV = CV = 0 17.103 1 101.351 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538191 0 0 0.0716802 0 0 76.1275 41.5147 3.67269 / CV = 14.8058 10.2792 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 127.18 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 860 TYPE = 0,1 NAME = S860 FLAGS = 0 VIEW = 4 OUT = 513,1 IN = 512,1 POS = 753,322 753,332 IV = CV = 0 164.127 0.0000536515 66.3017 0 0 0 0 0 0 0 0 0.000160904 0.244775 0.0147648 9.099E-12 0 0.740299 0 / CV = 0 7.93611 4.21544 0.377587 1.54016 1.27518 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 / CV = 0 65.6417 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 861 TYPE = 0,1 NAME = S861 FLAGS = 0 VIEW = 4 OUT = 514,1 IN = 513,2 POS = 748,337 733,337 I AV = CV = 0 161.665 0.0000536515 66.3018 0 0 0 0 0 0 0 0 0.000160904 0.244774 0.0147655 9.426E-11 0 0.740299 0 / CV = 0 7.93608 4.21543 0.377586 1.54016 1.27517 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 / CV = 0 65.6417 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 862 TYPE = 0,1 NAME = S862 FLAGS = 0 VIEW = 4 OUT = 78,2 IN = 514,1 POS = 724,332 724,240 IV = CV = 0 101.849 0.0000536515 66.3018 0 0 0 0 0 0 0 0 0.000160904 0.244774 0.0147655 9.426E-11 0 0.740299 0 / CV = 0 7.93608 4.21543 0.377586 1.54016 1.27517 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 / CV = 0 65.6417 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 863 TYPE = 0,1 NAME = S863 FLAGS = 0 VIEW = 4 OUT = 105,2 IN = 514,2 POS = 731,332 731,318 -1,-1 733,76 733,59 IV = CV = 0 59.8161 0.0000536515 66.3018 0 0 0 0 0 0 0 0 0.000160904 0.244774 0.0147655 9.426E-11 0 0.740299 0 / CV = 0 7.93608 4.21543 0.377586 1.54016 1.27517 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 / CV = 0 65.6417 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 864 TYPE = 256,32 NAME = S864 FLAGS = 8 VIEW = 4 OUT = 116,2 IN = 0,0 POS = 818,351 818,342 IV = 0 0 25 CV = 0 27.1302 25 0 0 0 0 0 0 0 233.009 766.991 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 865 TYPE = 256,64 NAME = S865 FLAGS = 8 VIEW = 4 OUT = 116,3 IN = 0,0 POS = 814,354 814,342 IV = CV = 0 1.79913 0 0 0 0 0.8462 0.0038 0.1101 0.0397 0.0002 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 866 TYPE = 256,16 NAME = S866 FLAGS = 8 VIEW = 4 OUT = 116,5 IN = 0,0 POS = 811,358 811,342 IV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 1000 CV = 0 0.0277583 0 98.8853 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD A = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 2 PSpec = 3 Frm = s941:temp PSpec = 1 Frm = s941:1 A ADDIN = [STREAM] NUM = 870 TYPE = 0,32 NAME = S870 FLAGS = 0 VIEW = 4 OUT = 206,1 IN = 116,2 POS = 818,332 818,313 IV = CV = 0 42.5182 149 0 0 0 0 281.417 0 215.662 13.5163 489.405 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 871 TYPE = 0,1 NAME = S871 FLAGS = 0 VIEW = 4 OUT = 506,1 IN = 116,3 POS = 810,332 810,313 IV = CV = 0 0.00645645 285.888 149 0 0 0 0 0 0 0 0 0.000575387 0.873925 0.0538194 3.317E-11 0 0.0716802 0 0 433.962 / CV = 0 0 0 566.038 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 14961.4 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 872 TYPE = 0,1 NAME = S872 FLAGS = 0 VIEW = 4 OUT = 503,3 IN = 206,2 POS = 826,303 826,271 859,271 IV = CV = 0 112.83 0 59.5751 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 59.5751 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 873 TYPE = 512,32 NAME = S873 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 206,1 POS = 822,303 822,285 IV = CV = 0 37.786 59.5751 0 0 0 0 316.66 0 117.435 15.2091 550.696 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 874 TYPE = 512,1 NAME = S874 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 506,2 POS = 802,309 793,309 IV = CV = 0 0.0000645635 285.891 149 0 0 0 0 0 0 0 0 0.000575387 0.873922 0.0538218 3.436E-10 0 0.0716806 0 0 433.962 / CV = 0 0 0 566.038 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 14961.4 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 875 TYPE = 0,1 NAME = S875 FLAGS = 0 VIEW = 4 OUT = 503,4 IN = 506,1 POS = 807,303 807,268 859,268 IV = CV = 0 0.0063918 285.891 149 0 0 0 0 0 0 0 0 0.000575387 0.873922 0.0538218 3.436E10 0 0.0716806 0 0 433.962 / CV = 0 0 0 566.038 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 14961.4 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 876 TYPE = 0,1 NAME = S876 FLAGS = 0 VIEW = 8 OUT = 205,1 IN = 126,3 POS = 1030,276 1030,312 942,312 942,277 IV = CV = 0 0.617945 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 575 425 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 880 TYPE = 0,1 NAME = S880 FLAGS = 0 VIEW = 4 OUT = 203,1 IN = 126,2 POS = 1038,271 IV = CV = 0 143.742 10.238 0 0 0 0 CV = 0 0 0 0 0 L AINKS = 0 UNITS = 0 1058,271 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1216 43.0474 3.65801 14.7466 0000/ 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 76.7229 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 881 TYPE = 0,1 NAME = S881 FLAGS = 0 VIEW = 4 OUT = 130,1 IN = 126,1 POS = 1034,276 1034,322 963,322 IV = CV = 0 0.319654 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 323.944 0 676.056 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 882 TYPE = 512,1 NAME = S882 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 130,2 POS = 953,318 937,318 -1,-1 673,115 673,76 IV = CV = 0 0.118272 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 323.944 0 676.056 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 883 TYPE = 512,1 NAME = S883 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 130,1 POS = 953,325 937,325 -1,-1 667,299 667,259 IV = CV = 0 0.201382 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 323.944 0 676.056 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 884 TYPE = 768,1 NAME = S884 FLAGS = 8 VIEW = 8 OUT = 126,2 IN = 0,0 COPY = 7 12 364 4294967295 0 POS = 1032,256 1032,266 IV = CV = 0 82.9686 1 20 0 0.28 0.45 0.05 0.18 0.04 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 885 TYPE = 0,2 NAME = S885 FLAGS = 0 VIEW = 8 OUT = 521,1 IN = 516,2 POS = 187,332 187,323 -1,-1 886,657 886,638 IV = CV = 0 6.47268 760 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.3423 0 0 0 1.36277 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 639.987 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 886 TYPE = 512,2 NAME = S886 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 516,1 POS = 192,337 208,337 IV = CV = 0 0.0132312 760 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 890 TYPE = 0,2 NAME = S890 FLAGS = 0 VIEW = 8 OUT = 521,2 IN = 515,1 POS = 167,337 176,337 176,328 -1,-1 881,656 881,638 IV = CV = 0 3.50226 1551 122.959 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 35.7967 0 0 0 2.82524 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 647.582 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 891 TYPE = 0,2 NAME = S891 FLAGS = 0 VIEW = 8 OUT = 515,1 IN = 10,2 POS = 162,360 162,342 IV = CV = 0 10.0065 1551 122.959 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 35.7967 0 0 0 2.82524 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 647.582 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 892 TYPE = 0,1 NAME = S892 FLAGS = 0 VIEW = 4 OUT = 275,2 IN = 520,1 POS = 878,606 865,606 IV = CV = 0 224.156 0 73.2963 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 893 TYPE = 0,2 NAME = S893 FLAGS = 0 VIEW = 4 OUT = 520,2 IN = 521,1 POS = 883,628 883,611 IV = CV = 0 19.9499 760 107.18 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.1507 0 0 0 1.87625 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 642.653 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 894 TYPE = 512,2 NAME = S894 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 520,3 POS = 887,611 887,619 902,619 IV = CV = 0 0 760 107.197 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.1507 0 0 0 1.87625 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 895 TYPE = 512,1 NAME = S895 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 520,2 POS = 879,611 879,620 865,620 IV = CV = 0 19.9499 0 99.9998 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.1507 0 0 0 1.87625 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 896 TYPE = 0,2 NAME = S171~1 FLAGS = 0 VIEW = 8 OUT = 522,1 IN = 524,2 POS = 191,663 191,644 IV = CV = 0 6.48596 760 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.2679 0 0 0 3.39996 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 639.987 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 900 TYPE = 512,2 NAME = S886~1 FLAGS = 16 VIEW = 8 OUT = 0,0 IN = 522,1 POS = 196,639 212,639 IV = CV = 0 0.0132312 760 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 00000000000/ CV A = 0 0 0 0 0 0 0 0 0 0 0 0 0 639.987 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 901 TYPE = 0,2 NAME = S891~1 FLAGS = 0 VIEW = 8 OUT = 523,1 IN = 36,2 POS = 164,663 164,645 IV = CV = 0 10.0065 1551 122.959 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 35.7967 0 0 0 2.82524 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 647.582 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 902 TYPE = 0,1 NAME = S676~2 FLAGS = 0 VIEW = 4 OUT = 524,1 IN = 36,1 POS = 169,668 186,668 IV = CV = 0 178.816 0 122.959 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 131.547 32.7082 1.06341 1.54315 6.16598 4.31888 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1551 0 0 0 0 0 108.785 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 903 TYPE = 0,2 NAME = S903 FLAGS = 0 VIEW = 4 OUT = 521,3 IN = 522,2 POS = 191,634 191,625 -1,-1 865,635 878,635 IV = CV = 0 6.47273 760 101.769 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 36.3421 0 0 0 1.36276 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 639.987 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 904 TYPE = 0,2 NAME = S904 FLAGS = 0 VIEW = 4 OUT = 521,4 IN = 523,1 POS = 169,639 182,639 182,621 -1,-1 865,630 878,630 IV = CV = 0 3.50226 1551 122.959 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 35.7967 0 0 0 2.82524 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 647.582 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 905 TYPE = 0,2 NAME = S905 FLAGS = 0 VIEW = 4 OUT = 521,5 IN = 525,2 POS = 76,951 76,942 -1,-1 900,632 888,632 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 906 TYPE = 512,2 NAME = S906 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 525,1 POS = 71,957 56,957 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 910 TYPE = 256,1 NAME = S910 FLAGS = 8 VIEW = 8 OUT = 530,2 IN = 0,0 POS = 286,1103 286,1114 IV = 0 0 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 00000000000/ IV = 0 0 0 0 0 0 0 0 0.997045 CV = 0 0.92275 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 86.7924 0 0 0 113.208 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 3 PSpec = 1 Frm = s362:1/262*0.5*106/0.2 PSpec = 20 Frm = 46/106*200 PSpec = 24 Frm = 60/106*200 A ADDIN = [STREAM] NUM = 911 TYPE = 0,1 NAME = S911 FLAGS = 0 VIEW = 4 OUT = 531,1 IN = 530,1 POS = 291,1119 303,1119 IV = CV = 0 1.83505 0 25 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 174.573 1.89753 364.326 0 56.926 0 0 0 0 0 0 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 912 TYPE = 0,1 NAME = S912 FLAGS = 0 VIEW = 4 OUT = 532,1 IN = 531,1 POS = 313,1119 324,1119 IV = CV = 0 1.83505 0 24.5542 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 174.573 0 364.326 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 41.7438 0 760 0 0 0 0 0 15.287 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 913 TYPE = 0,1 NAME = S913 FLAGS = 0 VIEW = 4 OUT = 533,1 IN = 532,2 POS = 334,1119 348,1119 IV = CV = 0 1.75845 0 24.5542 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 182.178 0 380.197 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 15.5786 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 914 TYPE = 0,1 NAME = S914 FLAGS = 0 VIEW = 4 OUT = 535,1 IN = 533,1 POS = 358,1119 377,1119 377,1103 IV = CV = 0 0.568399 0 24.5542 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 182.178 0 380.197 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 15.5786 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 915 TYPE = 512,1 NAME = S915 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 533,2 POS = 353,1124 353,1134 IV = CV = 0 1.19005 0 24.5542 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 182.178 0 380.197 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 15.5786 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 916 TYPE = 512,1 NAME = S916 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 532,1 POS = 329,1124 329,1135 IV = CV = 0 0.0766022 0 24.5542 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ CV = 0 0 1000 0 760 0 0 0 0 0 8.59397 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 920 TYPE = 0,1 NAME = S920 FLAGS = 0 VIEW = 4 OUT = 79,3 IN = 535,1 POS = 380,1093 380,1076 -1,-1 662,252 662,240 IV = CV = 0 0.358096 0 24.5542 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 182.178 0 380.197 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 15.5786 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 921 TYPE = 0,1 NAME = S921 FLAGS = 0 VIEW = 4 OUT = 102,2 IN = 535,2 POS = 372,1093 372,1075 -1,-1 671,73 671,59 IV = CV = 0 0.21031 0 24.5542 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 182.178 0 380.197 0 0 0 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 15.5786 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 922 TYPE = 0,1 NAME = S922 FLAGS = 512 VIEW = 4 OUT = 536,1 IN = 540,1 POS = 391,326 391,339 IV = 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 000000000000/ IV = 0 0 1 CV = 0 230.363 0 63.1566 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.202069 0 0 0 0.00375034 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 63.1482 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 923 TYPE = 0,1 NAME = S923 FLAGS = 0 VIEW = 4 OUT = 62,2 IN = 536,4 POS = 386,345 371,345 371,399 IV = CV = 0 107.524 0 63.1566 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.202069 0 0 0 0.00375035 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 63.1482 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 924 TYPE = 0,1 NAME = S924 FLAGS = 0 VIEW = 4 OUT = 52,2 IN = 536,2 POS = 391,349 391,361 -1,-1 376,681 376,701 IV = CV = 0 107.525 0 63.1566 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.202069 0 0 0 0.00375035 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 63.1482 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 925 TYPE = 0,1 NAME = S925 FLAGS = 0 VIEW = 4 OUT = 74,4 IN = 536,3 POS = 396,340 410,340 -1,-1 283,934 283,953 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 926 TYPE = 0,1 NAME = S926 FLAGS = 0 VIEW = 4 OUT = 543,1 IN = 541,2 POS = 998,277 998,286 IV = CV = 0 10.8318 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1218 43.0477 3.658 14.7466 10.2381 0 0 0 0 0 0 0 0 / CV = 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 76.7229 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 930 TYPE = 1024,1 NAME = S930 FLAGS = 8 VIEW = 8 OUT = 542,1 IN = 0,0 COPY = 7 12 43 4294967295 0 POS = 978,252 993,252 IV = CV = 0 134.096 0.136364 70.4283 0 0.0184512 0.812517 0.0325451 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 10.2356 / CV = 7.45164 3.50852 0.348698 1.4126 0.975997 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 72.694 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 931 TYPE = 1024,1 NAME = S931 FLAGS = 8 VIEW = 8 OUT = 542,2 IN = 0,0 COPY = 7 12 53 4294967295 0 POS = 979,259 993,259 IV = CV = 0 134.098 0.136364 70.4283 0 0.0184595 0.81251 0.0325448 0.116707 0.0197781 0 0 0 0 0 0 0 0 0 10.2356 / CV = 7.45164 3.50852 0.348699 1.4126 0.976002 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 / CV = 72.694 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 932 TYPE = 512,1 NAME = S932 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 542,1 POS = 1003,255 1019,255 IV = CV = 0 268.194 0.136364 70.4283 0 0.0184554 0.812513 0.0325449 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 10.2356 / CV = 7.45164 3.50852 0.348699 1.4126 0.976 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 0 0 0 0 0 72.694 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 933 TYPE = 768,1 NAME = S933 FLAGS = 8 VIEW = 8 OUT = 541,2 IN = 0,0 COPY = 7 12 932 4294967295 0 POS = 995,262 995,267 IV = CV = 0 268.194 0.136364 70.4283 0 0.0184554 0.812513 0.0325449 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 10.2356 / CV = 7.45164 3.50852 0.348699 1.4126 0.976 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 934 TYPE = 0,1 NAME = S934 FLAGS = 0 VIEW = 4 OUT = 145,2 IN = 543,1 POS = 993,288 975,288 -1,-1 321,437 321,428 IV = CV = 0 5.41589 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1218 43.0477 3.658 14.7466 10.2381 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 935 TYPE = 0,1 NAME = S935 FLAGS = 0 VIEW = 4 OUT = 124,2 IN = 543,2 POS = 993,294 975,294 975,293 -1,-1 326,742 326,731 IV = CV = 0 5.41593 0 85 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 78.1218 43.0477 3.658 14.7466 10.2381 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 936 TYPE = 1024,1 NAME = S936 FLAGS = 8 VIEW = 4 OUT = 544,3 IN = 0,0 COPY = 7 12 221 4294967295 0 POS = 781,349 781,359 IV = CV = 0 0.000816426 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 940 TYPE = 1024,1 NAME = S940 FLAGS = 8 VIEW = 4 OUT = 544,4 IN = 0,0 COPY = 7 12 236 4294967295 0 POS = 787,349 787,359 IV = CV = 0 0.000479488 0 40 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 941 TYPE = 512,1 NAME = S941 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 544,1 POS = 789,364 812,364 IV = CV = 0 0.0277583 0 98.8853 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1000 0 0 0 0 0 0 0 00000000000/ CV = 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 A COMMENT = 0 OD = -1 66 -34 0 0 Stream::TextTags = 0 OPT = ADDIN = 0 [STREAM] NUM = 942 TYPE = 256,1 NAME = S942 FLAGS = 8 VIEW = 4 OUT = 544,5 IN = 0,0 POS = 759,375 784,375 784,369 IV = CV = LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = CP CmpPs Num = 3 PSpec = 3 Frm = s906:temp PSpec = 1 Frm = s906:1 PSpec = 23 Frm = s906:HS A ADDIN = [STREAM] NUM = 943 TYPE = 0,1 NAME = S943 FLAGS = 0 VIEW = 4 OUT = 144,1 IN = 145,1 POS = 323,423 337,423 IV = CV = 0 169.989 0.107571 70.5538 0 0.0184512 0.812517 0.0325451 0.116708 0.0197782 0 0 0 0 0 0 0 0 0 9.65027 / CV = 9.65023 4.7736 0.451638 1.82716 1.2641 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [STREAM] NUM = 944 TYPE = 512,1 NAME = S944 FLAGS = 16 VIEW = 4 OUT = 0,0 IN = 536,1 POS = 396,347 414,347 414,355 IV = CV = 0 15.3146 0 63.1566 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.202069 0 0 0 0.00375035 0 000000000000/ CV = 0 0 0 0 0 0 0 0 0 0 0 760 LINKS = 0 UNITS = 0 COMMENT = 0 OD = -1 66 -34 0 0 0 Stream::TextTags = 0 OPT = ADDIN = [TEXT] NUM = 47 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 768 283 775 286 Dregs TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 24 LEN = 32 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 665 161 687 164 %b232:10 {d=3} fraction to #6 RB TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 1 LEN = 39 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 80 169 106 172 Total Mass = %s222:Totmass {d=0}~ GT/day TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 OPT = [TEXT] NUM = 2 LEN = 39 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 91 132 117 135 Total Mass = %s379:Totmass {d=0}~ GT/day TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 3 LEN = 39 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 85 86 116 89 Total Mass = %s219:Totmass {d=0}~ GT/day TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 4 LEN = 86 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 179 76 206 85 Purchased Bark \nTotal Mass = %s~ 456:Totmass total t/hr\n ~ = %b2:4 T/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 5 LEN = 25 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 241 98 256 104 Bark to Hog \nFuel Boiler TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 6 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 94 129 122 132 Purchased SWD Chips TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 7 LEN = 7 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 145 88 153 91 Rejects TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 8 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 124 89 129 92 Bark TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 9 LEN = 12 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 85 83 104 86 Hardwood RWD TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 10 LEN = 12 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 83 166 101 169 Softwood RWD TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 11 LEN = 8 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 65 114 115 126 Woodyard TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 12 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 122 150 127 153 Bark TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 13 LEN = 7 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 144 151 152 154 Rejects TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 14 LEN = 27 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 190 38 224 41 Clean HW to batch digesters TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 15 LEN = 14 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 190 44 209 47 Clean HW to K2 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 16 LEN = 17 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 154 196 177 199 Clean SW to Batch TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 19 LEN = 2 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 106 226 119 238 K2 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 21 LEN = 15 FONT = Arial SIZE = 9 STYLE = 8208 0 FLAGS = 0 RECT = 124 243 143 246 HW White Liquor TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 22 LEN = 7 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 244 360 257 363 HWD WBL TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 23 LEN = 20 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 210 334 218 343 HWD \nNCGs \nto Kiln TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 27 LEN = 20 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 214 636 222 645 SWD \nNCGs \nto Kiln TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 28 LEN = 7 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 255 663 268 666 HWD WBL TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 29 LEN = 15 FONT = Arial SIZE = 9 STYLE = 8208 0 FLAGS = 0 RECT = 136 524 155 527 HW White Liquor TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 30 LEN = 2 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 109 508 122 520 K1 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 17 LEN = 15 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 94 790 173 802 Batch Digesters TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 20 LEN = 22 FONT = Arial SIZE = 8 STYLE = 8210 0 FLAGS = 64 RECT = 673 64 685 66 %s921:1 {d=2} mt liq/h TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 25 LEN = 39 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 684 121 713 124 %b232:12 {d=3} fraction to power~ boiler TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 42 LEN = 32 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 636 105 658 108 %b232:11 {d=3} fraction to #5 RB TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 26 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 587 65 593 68 Soap TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 31 LEN = 16 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 600 258 618 261 Tall Oil Product TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 32 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 588 279 594 282 Brine TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 33 LEN = 15 FONT = Arial SIZE = 9 STYLE = 8208 0 FLAGS = 0 RECT = 130 810 149 813 SW White Liquor TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 34 LEN = 7 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 198 831 211 834 HWD WBL TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 35 LEN = 11 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 673 72 689 75 Make-up SO4 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 37 LEN = 11 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 725 66 731 71 Weak \nWash TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 38 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 564 278 571 281 NCGs TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 39 LEN = 15 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 461 151 484 154 HWD WBL from K2 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 40 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 586 245 592 248 Soap TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 41 LEN = 18 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 460 143 487 146 HWD WBL from Batch TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 43 LEN = 24 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 590 135 620 138 Lignin Cake Distribution TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 44 LEN = 35 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 534 166 567 169 %b226:3 {d=3} fraction WBL to #6~ RB TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 45 LEN = 21 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 702 93 716 96 %b232:15 {d=0} TPD BL TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 46 LEN = 21 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 689 272 705 275 %b283:10 {d=0} TPD BL TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 48 LEN = 2 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 838 352 843 355 MW TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 49 LEN = 15 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 462 147 485 150 HWD WBL from K1 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 50 LEN = 11 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 649 254 665 257 Make-up SO4 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 51 LEN = 22 FONT = Arial SIZE = 8 STYLE = 8210 0 FLAGS = 64 RECT = 667 246 679 248 %s920:1 {d=2} mt liq/h TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 52 LEN = 22 FONT = Arial SIZE = 7 STYLE = 8210 0 FLAGS = 64 RECT = 964 189 972 191 %s182:1 {d=2} mt liq/h TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 53 LEN = 14 FONT = Arial SIZE = 9 STYLE = 8208 0 FLAGS = 0 RECT = 964 179 974 185 Make-up\nNaCO3 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 54 LEN = 2 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 884 335 889 338 MW TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 56 LEN = 23 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 987 207 1007 213 SWD Green Liq\nTo Batch TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 57 LEN = 47 FONT = Arial SIZE = 7 STYLE = 8210 0 FLAGS = 64 RECT = 987 202 1000 207 %s352:1 {d=1} %u\n%s352:TTA {d=~ 1} g/l NaOH TTA TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 58 LEN = 85 FONT = Arial SIZE = 7 STYLE = 8210 0 FLAGS = 64 RECT = 926 180 935 192 %b94:3 {d=3} HS\n%b94:4 {d=3} CO~ 3\n%b94:5 {d=3} SO4\n%b94:6 {d=3~ } OH\n%b94:7 {d=3} Na TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 59 LEN = 106 FONT = Arial SIZE = 8 STYLE = 8210 0 FLAGS = 64 RECT = 936 180 956 190 %b94:1 {d=1} g/l NaOH TTA\n%b94:~ 8 {d=2} kmol/t liq. TTA\n%b94:11~ {d=3} sulfidity\n%b94:10 {d=3} ~ TTA/t wood TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 55 LEN = 34 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 394 402 419 404 Filtrate from Enzymatic Hydrolys~ is TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 61 LEN = 34 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 390 702 415 704 Filtrate from Enzymatic Hydrolys~ is TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 66 LEN = 34 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 296 953 321 955 Filtrate from Enzymatic Hydrolys~ is TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 67 LEN = 14 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 490 732 511 735 SWD BS from K1 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 68 LEN = 26 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 396 725 416 727 BS to Enzymatic Hydrolysis TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 69 LEN = 122 FONT = Arial SIZE = 12 STYLE = 8210 0 FLAGS = 64 RECT = 1007 1013 1071 1024 %b345:1{d=2} %u mt/hr EtOH\n%b34~ 5:2{d=2} %u Million Gallons per ~ year (MGPY) EtOH\n%b345:3{d=2} %~ u mt Steam/hr Steam Demand TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 70 LEN = 93 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 64 RECT = 943 984 998 993 Reflux: %b321:2\nSteam demand: %~ b321:4 mt/mt-99.5wt% EtOH\nStea~ m demand %b321:5 {d=1} mt/hr TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 71 LEN = 93 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 64 RECT = 879 984 933 993 Reflux: %b320:2\nSteam demand: %~ b320:4 mt/mt-99.5wt% EtOH\nStea~ m demand %b320:5 {d=1} mt/hr TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 72 LEN = 48 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 643 926 662 933 Conversion\n0.87 to Xylose\n0.04~ to Pentose-poly TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 73 LEN = 28 FONT = Arial SIZE = 6 STYLE = 8212 0 FLAGS = 0 RECT = 636 921 661 923 (C5H8O4)n + nH2O = n C5H10O5 TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 74 LEN = 29 FONT = Arial SIZE = 6 STYLE = 8212 0 FLAGS = 0 RECT = 602 921 628 923 (C6H10O5)n + nH2O = n C6H12O6 TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 75 LEN = 18 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 722 781 729 783 %s644:1{d=4} mt/hr TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 76 LEN = 24 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 795 1052 809 1057 Combined\nPrehydolysates TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 77 LEN = 39 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 976 1013 989 1018 %s634:1{d=3} %u\n%s634:Eth{d=0} ~ %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 78 LEN = 10 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 987 1007 1000 1010 30C Liquid TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 79 LEN = 7 FONT = Arial SIZE = 14 STYLE = 8223 0 FLAGS = 0 RECT = 986 999 1001 1003 Storage TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 80 LEN = 56 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 698 759 712 766 %s631:3{d=1}%u\n%s631:1{d=1}%u\n~ %s631:Glu{d=1}%u glucose TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 81 LEN = 20 FONT = Arial SIZE = 10 STYLE = 8223 0 FLAGS = 0 RECT = 631 995 658 998 Pentose fermentation TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 82 LEN = 344 FONT = Arial SIZE = 6 STYLE = 8212 0 FLAGS = 0 RECT = 624 1011 675 1027 [B33]\n3C5H10O5=5C2H5OH+5CO2+Hea~ t Conversion: 0.80\n[B52]\nC5H1~ 0O5--> Xylitol 0.05 (0.05/0.2 = ~ 0.25 frac of the rest)\nC5H10O5-~ -> Z.mobilis 0.04 (0.04/0.2 = 0.~ 2 frac of the rest)\nC5H10O5 -->~ Acetic acid 0.015 (0.015/0.2 = ~ 0.075 frac of the rest)\nC5H10O5~ --> Diss. wood solid 0.01 (0.01/~ 0.2 = 0.05 frac of the rest)\nC~ 5H10O5 --> C5H10O5 0.085 TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 83 LEN = 17 FONT = Arial SIZE = 14 STYLE = 8223 0 FLAGS = 0 RECT = 825 948 855 952 Beer Distillation TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 84 LEN = 9 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 977 1038 990 1041 78C Vapor TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 85 LEN = 9 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 897 1065 910 1068 78C Vapor TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 86 LEN = 15 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 968 1057 987 1060 78C liquid(Ads) TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 87 LEN = 9 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 940 1038 953 1041 78C Vapor TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 88 LEN = 11 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 908 1015 923 1018 100C Liquid TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 89 LEN = 9 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 844 1038 857 1041 94C Vapor TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 OPT = [TEXT] NUM = 90 LEN = 12 FONT = Arial SIZE = 14 STYLE = 8223 0 FLAGS = 0 RECT = 917 999 937 1003 Distillation TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 91 LEN = 11 FONT = Arial SIZE = 14 STYLE = 8223 0 FLAGS = 0 RECT = 955 999 978 1003 Dehydration TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 92 LEN = 39 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 907 1009 924 1014 %s614:1{d=2} %u\n%s614:Eth{d=3} ~ %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 93 LEN = 39 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 978 1044 991 1049 %s620:1{d=0} %u\n%s620:Eth{d=0} ~ %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 94 LEN = 39 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 922 1063 935 1068 %s616:1{d=2} %u\n%s616:Eth{d=0} ~ %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 95 LEN = 39 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 938 1044 951 1049 %s615:1{d=2} %u\n%s615:Eth{d=0} ~ %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 96 LEN = 56 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 808 1071 821 1078 %s596:3{d=1} %u\n%s596:1{d=2} %u~ \n%s596:Eth{d=2} %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 97 LEN = 56 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 842 1044 855 1051 %s601:3{d=1} %u\n%s601:1{d=2} %u~ \n%s601:Eth{d=2} %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 98 LEN = 39 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 902 1044 915 1049 %s613:1{d=2} %u\n%s613:Eth{d=0} ~ %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 99 LEN = 56 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 839 1066 852 1073 %s595:3{d=1} %u\n%s595:1{d=2} %u~ \n%s595:Eth{d=2} %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 100 LEN = 14 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 703 737 706 739 %s652:3{d=1}%u TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 101 LEN = 32 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 841 974 853 979 %s261:3{d=1} %u\n%s261:1{d=0} %u TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 102 LEN = 32 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 836 987 848 992 %s635:3{d=1} %u\n%s635:1{d=2} %u TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 OPT = [TEXT] NUM = 103 LEN = 36 FONT = Arial SIZE = 8 STYLE = 8210 0 FLAGS = 0 RECT = 807 1081 826 1086 Vent of Solids and \nDiss. compo~ unds TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 104 LEN = 34 FONT = Arial SIZE = 10 STYLE = 8226 0 FLAGS = 0 RECT = 663 678 690 684 100% Lignin Removal\nAt 50% Soli~ ds TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 105 LEN = 8 FONT = Arial SIZE = 8 STYLE = 8210 0 FLAGS = 0 RECT = 584 982 593 984 CO2 vent TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 106 LEN = 18 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 709 967 718 972 Controlled\nto 41C TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 107 LEN = 285 FONT = Arial SIZE = 6 STYLE = 8212 0 FLAGS = 0 RECT = 675 1011 729 1025 [B50]\nC6H12O6=2C2H5OH+2CO2+Heat~ Conversion: 0.90\n[B60]\nC6H12~ O6 --> Z.mobilis 0.04 (0.04/0.1 ~ = 0.4 frac of the rest)\nC6H12O6~ --> Acetic acid 0.015 (0.015/0.~ 1 = 0.15 frac of the rest)\nC6H1~ 2O6 --> Diss. wood solid 0.015 (~ 0.015/0.1 = 0.15 frac of the re~ st)\nC6H12O6 --> C6H12O6 0.03 TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 108 LEN = 3 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 680 981 684 983 CSL TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 109 LEN = 10 FONT = Arial SIZE = 8 STYLE = 8212 0 FLAGS = 0 RECT = 714 990 723 992 Z. Mobilis TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 110 LEN = 77 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 591 988 611 995 %s641:1{d=1} mt/hr gas\n%s641:CO~ 2{d=0} %u CO2\n%s641:EV{d=0} %u ~ Ethanol vapor TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 111 LEN = 48 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 618 926 637 933 Conversion\n0.87 to Glucose\n0.0~ 4 to Hexose-poly TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 112 LEN = 3 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 680 987 684 989 DAP TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 113 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8223 0 FLAGS = 0 RECT = 679 995 705 998 Hexose fermentation TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 114 LEN = 36 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 576 917 590 922 Cellulase(solid)\n%s750:1{d=3} m~ t/hr TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 115 LEN = 18 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 691 978 698 980 %s646:1{d=1} mt/hr TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 116 LEN = 18 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 690 989 697 991 %s645:1{d=2} mt/hr TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 117 LEN = 48 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 595 925 614 932 Conversion\n0.87 to Glucose\n0.0~ 4 to Hexose-poly TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 118 LEN = 26 FONT = Arial SIZE = 10 STYLE = 8223 0 FLAGS = 0 RECT = 629 947 662 950 Enzymatic saccharification TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 119 LEN = 34 FONT = Arial SIZE = 10 STYLE = 8226 0 FLAGS = 0 RECT = 654 884 681 890 100% Lignin Removal\nAt 50% Soli~ ds TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 120 LEN = 14 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 694 943 697 945 %s652:3{d=1}%u TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 121 LEN = 56 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 689 965 703 972 %s631:3{d=1}%u\n%s631:1{d=1}%u\n~ %s631:Glu{d=1}%u glucose TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 122 LEN = 18 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 713 987 720 989 %s644:1{d=4} mt/hr TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 123 LEN = 26 FONT = Arial SIZE = 10 STYLE = 8223 0 FLAGS = 0 RECT = 638 741 671 744 Enzymatic saccharification TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 124 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 451 942 478 945 HWD BS from Batches TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 125 LEN = 14 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 456 935 477 938 HWD BS from K2 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 126 LEN = 24 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 541 983 551 987 To BS washer\nBatch Line TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 127 LEN = 21 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 513 963 523 967 To BS washer\nK2 line TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 128 LEN = 26 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 373 975 393 977 BS to Enzymatic Hydrolysis TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 129 LEN = 26 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 391 421 411 423 BS to Enzymatic Hydrolysis TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 130 LEN = 48 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 604 719 623 726 Conversion\n0.87 to Glucose\n0.0~ 4 to Hexose-poly TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 131 LEN = 18 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 699 783 706 785 %s645:1{d=2} mt/hr TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 132 LEN = 18 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 700 772 707 774 %s646:1{d=1} mt/hr TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 133 LEN = 36 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 585 711 599 716 Cellulase(solid)\n%s750:1{d=3} m~ t/hr TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 134 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8223 0 FLAGS = 0 RECT = 688 789 714 792 Hexose fermentation TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 135 LEN = 3 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 689 781 693 783 DAP TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 136 LEN = 48 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 627 720 646 727 Conversion\n0.87 to Glucose\n0.0~ 4 to Hexose-poly TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 137 LEN = 77 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 600 782 620 789 %s641:1{d=1} mt/hr gas\n%s641:CO~ 2{d=0} %u CO2\n%s641:EV{d=0} %u ~ Ethanol vapor TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 138 LEN = 10 FONT = Arial SIZE = 8 STYLE = 8212 0 FLAGS = 0 RECT = 723 784 732 786 Z. Mobilis TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 139 LEN = 3 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 689 775 693 777 CSL TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 140 LEN = 285 FONT = Arial SIZE = 6 STYLE = 8212 0 FLAGS = 0 RECT = 684 805 738 819 [B50]\nC6H12O6=2C2H5OH+2CO2+Heat~ Conversion: 0.90\n[B60]\nC6H12~ O6 --> Z.mobilis 0.04 (0.04/0.1 ~ = 0.4 frac of the rest)\nC6H12O6~ --> Acetic acid 0.015 (0.015/0.~ 1 = 0.15 frac of the rest)\nC6H1~ 2O6 --> Diss. wood solid 0.015 (~ 0.015/0.1 = 0.15 frac of the re~ st)\nC6H12O6 --> C6H12O6 0.03 TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 141 LEN = 18 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 718 761 727 766 Controlled\nto 41C TEXTCOLOR = 255 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 142 LEN = 8 FONT = Arial SIZE = 8 STYLE = 8210 0 FLAGS = 0 RECT = 593 776 602 778 CO2 vent TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 143 LEN = 344 FONT = Arial SIZE = 6 STYLE = 8212 0 FLAGS = 0 RECT = 633 805 684 821 [B33]\n3C5H10O5=5C2H5OH+5CO2+Hea~ t Conversion: 0.80\n[B52]\nC5H1~ 0O5--> Xylitol 0.05 (0.05/0.2 = ~ 0.25 frac of the rest)\nC5H10O5-~ -> Z.mobilis 0.04 (0.04/0.2 = 0.~ 2 frac of the rest)\nC5H10O5 -->~ Acetic acid 0.015 (0.015/0.2 = ~ 0.075 frac of the rest)\nC5H10O5~ --> Diss. wood solid 0.01 (0.01/~ 0.2 = 0.05 frac of the rest)\nC~ 5H10O5 --> C5H10O5 0.085 TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 144 LEN = 20 FONT = Arial SIZE = 10 STYLE = 8223 0 FLAGS = 0 RECT = 640 789 667 792 Pentose fermentation TEXTCOLOR = 0 0 0 BACKCOLOR = 255 128 192 O OPT = [TEXT] NUM = 145 LEN = 29 FONT = Arial SIZE = 6 STYLE = 8212 0 FLAGS = 0 RECT = 611 715 637 717 (C6H10O5)n + nH2O = n C6H12O6 TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 146 LEN = 28 FONT = Arial SIZE = 6 STYLE = 8212 0 FLAGS = 0 RECT = 645 715 670 717 (C5H8O4)n + nH2O = n C5H10O5 TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 147 LEN = 48 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 652 720 671 727 Conversion\n0.87 to Xylose\n0.04~ to Pentose-poly TEXTCOLOR = 0 0 255 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 148 LEN = 21 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 560 755 570 759 To BS washer\nK1 line TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 149 LEN = 8 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 768 954 776 956 SWD Beer TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 150 LEN = 15 FONT = Arial SIZE = 6 STYLE = 8208 0 FLAGS = 0 RECT = 767 764 778 766 To Distillation TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 36 LEN = 308 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 819 395 861 418 60 psig steam demand breakdown\n~ Evaporation = %b255:1 {d=0} t/hr~ \nBoiler Feed Water heat up = %b~ 255:40 {d=0} t/hr\nDistillation ~ = %b255:21 {d=0} t/hr\nBleach pl~ ant = %b255:4 {d=0} t/hr\nMisc P~ M and GL heaters = %b255:5 {d=0}~ t/hr\nPM drying = %b255:22 {d=0~ } t/hr\nSteam Coil Air Heaters =~ %b255:25 {d=0} t/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 60 LEN = 181 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 819 378 860 393 150 psig steam demand breakdown\~ ndigester steam = %b255:39 {d=0}~ t/hr\nBL heater = %b255:38 {d=0~ } t/hr\nPM drying = %b255:20 {d=~ 0} t/hr\nSteam Coil Air Heaters ~ = %b255:25 {d=0} t/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 152 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 656 433 663 436 Steam TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 153 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 656 457 663 460 Steam TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 154 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 656 487 663 490 Steam TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 155 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 656 520 663 523 Steam TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 156 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 637 528 650 531 BFW mkup TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 157 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 588 458 601 461 BFW mkup TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 158 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 598 437 611 440 BFW mkup TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 159 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 639 511 651 514 Blowdown TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 160 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 607 444 619 447 Blowdown TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 161 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 600 420 612 423 Blowdown TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 163 LEN = 11 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 903 608 920 611 BFW make-up TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 164 LEN = 13 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 728 464 736 470 Gland \nleaks TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 165 LEN = 15 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 768 529 787 532 160 psig header TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 166 LEN = 16 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 812 583 821 589 60 psig \nheader TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 167 LEN = 6 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 729 534 737 537 To 150 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 168 LEN = 15 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 710 548 729 551 400 psig header TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 169 LEN = 33 FONT = Arial SIZE = 12 STYLE = 8210 0 FLAGS = 64 RECT = 756 404 796 408 Turbine power: %b255:13 {d=1}M~ W TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 170 LEN = 75 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 773 382 806 388 150 psig demand = %b255:6 {d=0} ~ t/hr\n 60 psig demand = %b255:7~ {d=0} t/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 171 LEN = 21 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 0 RECT = 704 485 710 492 To 400\npsig \nheader TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 172 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 567 514 572 517 Coal TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 173 LEN = 7 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 570 524 579 527 Oxidant TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 174 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 636 472 648 475 Blowdown TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 175 LEN = 21 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 548 479 562 485 Bark from \nWood Yard TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 176 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 635 494 648 497 BFW mkup TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 177 LEN = 12 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 590 491 598 497 Excess\nWood TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 178 LEN = 3 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 604 479 608 482 Ash TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 179 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 604 485 614 488 Flue gas TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 62 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 929 324 936 327 RB #6 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 63 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 929 317 936 320 RB #5 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 64 LEN = 48 FONT = Arial SIZE = 7 STYLE = 8210 0 FLAGS = 64 RECT = 1064 281 1082 286 %s353:1 {d=1} %u\n%s353:TTA {d=~ 1} g/l NaOH TTA TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 65 LEN = 23 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 1064 287 1088 293 HWD White Liquor\nTo K2 TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 151 LEN = 20 FONT = Arial SIZE = 10 STYLE = 8210 0 FLAGS = 0 RECT = 1096 271 1116 277 HWD White Liq\nTo K1 TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 162 LEN = 47 FONT = Arial SIZE = 7 STYLE = 8210 0 FLAGS = 64 RECT = 1096 266 1112 271 %s161:1 {d=1} %u\n%s161:TTA {d=~ 1} g/l NaOH TTA TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 180 LEN = 90 FONT = Arial SIZE = 7 STYLE = 8210 0 FLAGS = 64 RECT = 979 236 988 248 %b202:3 {d=3} HS\n%b202:4 {d=3} ~ CO3\n%b202:5 {d=3} SO4\n%b202:6 ~ {d=3} OH\n%b125:7 {d=3} Na TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 181 LEN = 110 FONT = Arial SIZE = 8 STYLE = 8210 0 FLAGS = 64 RECT = 958 236 978 246 %b202:1 {d=1} g/l NaOH TTA\n%b20~ 2:8 {d=2} kmol/t liq. TTA\n%b202~ :11 {d=3} sulfidity\n%b202:15 {d~ =3} TTA/t wood TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 182 LEN = 31 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 42 818 64 824 Clean SWD chips \nfrom woodyard TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 18 LEN = 56 FONT = Arial SIZE = 8 STYLE = 8208 0 FLAGS = 64 RECT = 792 962 805 969 %s276:3{d=1} %u\n%s276:1{d=2} %u~ \n%s276:Eth{d=2} %u EtOH TEXTCOLOR = 0 128 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 183 LEN = 31 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 39 241 61 247 Clean HWD chips \nfrom woodyard TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 184 LEN = 31 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 39 525 61 531 Clean HWD chips \nfrom woodyard TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 185 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 86 104 114 107 Purchased HWD Chips TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 186 LEN = 39 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 85 107 111 110 Total Mass = %s376:Totmass {d=0}~ GT/day TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 187 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 562 97 569 100 NCGs TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 188 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 589 99 595 102 Brine TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 189 LEN = 16 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 601 78 619 81 Tall Oil Product TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 191 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 608 1270 614 1273 Other TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 192 LEN = 6 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 608 1249 614 1252 Filler TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 193 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 572 1475 578 1478 Other TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 194 LEN = 6 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 572 1452 578 1455 Filler TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 195 LEN = 30 FONT = Agency FB SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 847 1301 872 1304 Total Production = %b86:3 t/yr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 196 LEN = 22 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 892 1466 920 1469 Production=%b86:2 t/yr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 197 LEN = 22 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 912 1265 940 1268 Production=%b86:1 t/yr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 198 LEN = 6 FONT = Arial SIZE = 9 STYLE = 8208 0 FLAGS = 0 RECT = 714 1433 722 1436 Cloudy TEXTCOLOR = 0 0 0 BACKCOLOR = 255 255 255 O OPT = [TEXT] NUM = 199 LEN = 12 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 704 1226 719 1229 Excess Clear TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 200 LEN = 12 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 688 1443 703 1446 Excess Clear TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 201 LEN = 6 FONT = Arial SIZE = 9 STYLE = 8208 0 FLAGS = 0 RECT = 734 1228 742 1231 Cloudy TEXTCOLOR = 0 0 0 BACKCOLOR = 255 255 255 O OPT = [TEXT] NUM = 202 LEN = 3 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 253 1198 258 1201 OFF TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 203 LEN = 3 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 245 1548 250 1551 OFF TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 204 LEN = 8 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 135 1378 147 1381 Oxygen?? TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 205 LEN = 13 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 82 1314 151 1326 D Bleach Line TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 206 LEN = 13 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 169 1474 237 1486 E Bleach Line TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 207 LEN = 13 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 172 1126 239 1138 F Bleach Line TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 208 LEN = 8 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 469 108 515 120 Recovery TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 209 LEN = 15 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 500 406 587 418 Steam and Power TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 210 LEN = 6 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 495 701 536 713 SWD EH TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 211 LEN = 6 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 491 904 533 916 HWD EH TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 212 LEN = 12 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 812 922 865 934 Distillation TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 213 LEN = 14 FONT = Arial SIZE = 36 STYLE = 8210 0 FLAGS = 0 RECT = 620 1339 699 1351 Paper Machines TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 190 LEN = 2 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 815 289 820 292 MW TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 214 LEN = 10 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 883 294 897 297 Mud Losses TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 215 LEN = 21 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 169 338 180 347 Blow\nHeat \nRecovery TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 216 LEN = 18 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 880 659 891 665 Blow heat\nfrom K2 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 217 LEN = 21 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 174 641 185 650 Blow\nHeat \nRecovery TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 218 LEN = 18 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 849 629 860 635 Blow heat\nfrom K1 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 219 LEN = 14 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 45 954 56 960 NCGs to \nKiln TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 220 LEN = 18 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 65 937 87 940 Blow heat recovery TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 221 LEN = 13 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 261 1122 277 1125 Sesquisulfate TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 222 LEN = 6 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 280 1099 290 1102 Na2CO3 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 223 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 378 1072 384 1075 RB#6 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 224 LEN = 4 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 368 1071 374 1074 RB#5 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 225 LEN = 6 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 390 362 400 365 K1 BSW TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 226 LEN = 9 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 412 339 426 342 Batch BSW TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 OPT = [TEXT] NUM = 227 LEN = 18 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 414 320 437 323 From #6 Evap Train TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 228 LEN = 18 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 352 319 375 322 From #5 Evap Train TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 229 LEN = 11 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 961 307 978 310 NaOH Makeup TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 230 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 971 284 978 287 K2 O2 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 231 LEN = 5 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 971 295 978 298 K1 O2 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 232 LEN = 7 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 746 359 757 362 K2 NCGs TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 233 LEN = 7 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 746 366 757 369 K1 NCGs TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 234 LEN = 10 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 743 373 757 376 Batch NCGs TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 235 LEN = 2 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 778 346 781 349 #6 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 OPT = [TEXT] NUM = 236 LEN = 2 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 786 346 789 349 #5 TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 237 LEN = 17 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 374 411 382 414 DF = %b220:6{d=2} TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 238 LEN = 17 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 377 714 385 717 DF = %b526:6{d=2} TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 239 LEN = 20 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 102 433 116 436 yield = %b550:1{d=3} TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 240 LEN = 20 FONT = Arial SIZE = 10 STYLE = 8208 0 O FLAGS = 64 RECT = 108 735 122 738 yield = %b550:2{d=3} TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 241 LEN = 14 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 0 RECT = 411 356 427 359 extra to sewer TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 242 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 763 459 775 462 %b552:1{d=0} klb/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 243 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 751 499 760 502 %b552:2{d=0} klb/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 244 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 803 461 813 464 %b552:3{d=0} klb/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 245 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 785 484 797 487 %b552:4{d=0} klb/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 246 LEN = 19 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 825 452 837 455 %b552:5{d=0} klb/hr TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 247 LEN = 12 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 769 428 770 431 %b553:1{d=0} TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [TEXT] NUM = 248 LEN = 12 FONT = Arial SIZE = 10 STYLE = 8208 0 FLAGS = 64 RECT = 794 429 795 432 %b554:1{d=0} TEXTCOLOR = 0 0 0 BACKCOLOR = 0 0 0 O OPT = [CONDITIONAL COLOR] TYPE = Block NUMBER = 553 REF = B553"Store553":1 OPTR = 0 VAL1 = 1. VAL2 = 0. COLOR = 255 [CONDITIONAL COLOR] TYPE = Block NUMBER = 554 REF = B554"Store554":1 OPTR = 0 VAL1 = 1. VAL2 = 0. C COLOR = 255 [SCRIPT] WINDOW = 28 47 1028 598 0 NAME = Execution FLAGS = 5 COUNT = 33 //Format: instruction optionNum listPosition level fFlags time data1 data2 //2nd Line: text or ref, if applicable COMMENT 01 0 0 0 0 0 Basic execution script COMMENT 02 0 0 0 0 0 Created Monday, September 29, 1997 R REPEATBEG 13 1 0 0 1 0 S SCRIPT 04 1 0 0 7 65543 R REPEATEND 05 0 0 0 0 0 COMMENT 16 0 0 0 0 0 woodyard, pulping, bsw WRITE 17 0 0 0 0 0 S219,s376,s224,s233,s375,s222,s379,s255,s258,s380,s456,s364,s23,s82,s904,s903,s900, s890,s885,s886,s43,s53,s5,s120,s146,s144#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b3:fy61 WRITE 18 0 0 0 0 0 S28,s86,s40,s46,s42,s45,s100,s36,s388,s101,s37,s50,s143,s145,s133,s126,s123,s122,b2 55,s90,s25,s140#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata!b64:fy122 COMMENT 19 0 0 0 0 0 bleach plant and pms WRITE 1 10 0 0 0 0 0 S694,s736,s288,s741,s723,s733,s762,s714,s733,s692,s691,s732,s836,s834,s700,s742,s75 3,s279,s730,s690,s724,s682,s259,s774,s256#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b125:fy183 WRITE 1 11 0 0 0 0 0 s791,s784,s816,s782,s781,s835,s792,s800,s775,s814,s127,s826,s831,s398,s675,s559,s41 2,s328,s309,s297,s298,s409,s423,s472,s422#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b186:fy244 WRITE 1 12 0 0 0 0 0 s399,s426,s562,s603,s574,s428,s430,s433,s349,s348,s585,b255,s347,b410,b303,s412,s32 8,s309,s297,s298,s603,s574,s428,s430,s433#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b247:fy305 COMMENT 1 13 0 0 0 0 0 power and steam WRITE 1 14 0 0 0 0 0 S567,s448,s290,s571,s451,s175,s355,s460,s453,s455,s461,s469,s463,s451,s475,b246,s47 6,s477,b249,s471,s482,b247,s481,s494,b252#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b308:fy366 WRITE 1 15 0 0 0 0 0 s495,s496,b260,s488,s487,s473,b255#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata!b369:fy427 COMMENT 1 16 0 0 0 0 0 evaps and recovery WRITE 1 17 0 0 0 0 0 S556,b226,s138,s180,s385,s193,s185,s165,s383,s384,s241,s390,s569,s194,s168,s202,s18 1,s172,s162,s210,s211,s844,s214,s846,s853#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b430:fy488 WRITE 1 18 0 0 0 0 0 s231,s215,s213,s230,s230,s184,s231,s162,s846,s876,s881,s212,s865#excel:: [C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata!b491:fy549 COMMENT 1 19 0 0 0 0 0 Detailed PFD WRITE 1 20 0 0 0 0 0 S376,s219,s222,s379,s224,s233,s375,s380,s258,s255,s456,s3,s2,s5,s353,s886,s885,s890 ,s35,s23,s26,s934,s28,s40,s388,s36,s923,s250,s125#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b552:fy610 WRITE 1 21 0 0 0 0 0 S161,s900,s903,s904,s103,s82,s80,s935,s100,s105,s924,s86,s46,s101,s226,s352,s906,s1 21,s905,s120,s152,s126,s244,s925,s143,s145,s123,s256#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b613:fy671 WRITE 1 22 0 0 0 0 0 S277,s268,s700,s259,s690,s279,s288,s692,s714,s723,s836,s289,s801,s810,s825,s792,s81 4,s127,s775,s831,s800,s826,s791,s782,s816,s784,s835#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b674:fy732 WRITE 1 23 0 0 0 0 0 S754,s764,s742,s774,s730,s753,s741,s733,s762,s773,s834,s398,s409,s423,s472,s318,s44 3,s422,s670,s672,s511,s675,s559,s328,s309,s297,s298#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b735:fy793 WRITE 1 24 0 0 0 0 0 s412,s399,s349,s348,s585,s544,s590,s347,s550,s546,s359,s426,s562,s574,s428,s430,s43 3,s603,s386,s385,s363,s384,s556,s139,s180#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata! b796:fy854 WRITE 1 25 0 0 0 0 0 s390,s568,s290,s566,s196,s921,s200,s561,s167,s175,s920,s293,s170,s202,s168,s844,s16 2,s210,s211,s851,s853,s214,s856#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata!b857:fy915 WRITE 1 26 0 0 0 0 0 s240,s866,s864,s865,s215,s874,s873,s184,s231,s230,s855,s934,s935,s161,s876,s353,s34 5,s461,s241#excel::[C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata!b918:fy976 COMMENT 1 27 0 0 0 0 0 Steam Balance WRITE 1 28 0 0 0 0 0 s451,s475,s477,s448,s460,s473,s488,s487,s482,s494,s496,b255,s471,s469#excel:: [C:\Documents and Settings\thtreasu\My Documents\Shell models\Base Case\output_report.xlsx]simdata!b979:fy1037 COMMENT 1 29 0 0 0 0 0 Overall PFD WRITE 1 30 0 1 0 0 0 s219,s222,s233,s258,s3,s2,s5,s456,s44,s55,s243,s125,s256,s386,s226,s286,s265,s276,s 634,b345,s270,s306,b210,s171,s194,s569,s156,s350,s352,s353,b202,s182,s161,b94,s451, s448,s460,b255,s376,s379#excel::[c:\Franklin output template.xlsx]WinGEMS dump! b2:fy60 WRITE 1 31 0 1 0 0 0 s375,s380,s392,s393,s394#excel::[c:\Franklin output template.xlsx]WinGEMS dump! b124:fy182 COMMENT 1 32 0 0 0 0 0 Sodium Balance WRITE 1 33 0 1 0 0 0 s353,s352,s44,s35,s125,s386,s152,s243,s256,s270,b210,s261,s264,s634,s553,s555,s156, s350,s182,s212,s183,s175,s28,s40,s388,s143,s145,s123,s661,s161,s55,s226,s86,s46,s10 1,s306,s231,s39,s165#excel::[c:\Franklin output template.xlsx]WinGEMS dump! b b63:fy121 [SCRIPT] WINDOW = 72 91 1072 642 0 NAME = Calculation order FLAGS = 5 COUNT = 423 //Format: instruction optionNum listPosition level fFlags time data1 data2 //2nd Line: text or ref, if applicable B BLOCK 01 0 0 0 542 0 B BLOCK 02 0 0 0 123 0 B BLOCK 03 0 0 0 160 0 B BLOCK 04 0 0 0 60 0 B BLOCK 05 0 0 0 113 0 B BLOCK 06 0 0 0 131 0 B BLOCK 07 0 0 0 222 0 B BLOCK 08 0 0 0 221 0 B BLOCK 09 0 0 0 1 0 B BLOCK 0 10 0 0 0 119 0 B BLOCK 0 11 0 0 0 137 0 B BLOCK 0 12 0 0 0 199 0 B BLOCK 0 13 0 0 0 198 0 B BLOCK 0 14 0 0 0 235 0 B BLOCK 0 15 0 0 0 236 0 B BLOCK 0 16 0 0 0 237 0 B BLOCK 0 17 0 0 0 20 0 BLOCK 0 18 0 0 0 3 0 B BLOCK 0 19 0 0 0 4 0 B BLOCK 0 20 0 0 0 5 0 B BLOCK 0 21 0 0 0 234 0 B BLOCK 0 22 0 0 0 6 0 B BLOCK 0 23 0 0 0 7 0 B BLOCK 0 24 0 0 0 11 0 B BLOCK 0 25 0 0 0 12 0 B BLOCK 0 26 0 0 0 13 0 B BLOCK 0 27 0 0 0 15 0 B BLOCK 0 28 0 0 0 16 0 B BLOCK 0 29 0 0 0 17 0 B BLOCK 0 30 0 0 0 18 0 B BLOCK 0 31 0 0 0 19 0 B BLOCK 0 32 0 0 0 14 0 B BLOCK 0 33 0 0 0 8 0 B BLOCK 0 34 0 0 0 10 0 B BLOCK 0 35 0 0 0 515 0 B BLOCK 0 36 0 0 0 132 0 B BLOCK 0 37 0 0 0 516 0 B BLOCK 0 38 0 0 0 521 0 B BLOCK 0 39 0 0 0 520 0 B BLOCK 0 40 0 0 0 363 0 B BLOCK 0 41 0 0 0 396 0 B BLOCK 0 42 0 0 0 22 0 B BLOCK 0 43 0 0 0 204 0 B BLOCK 0 44 0 0 0 536 0 B BLOCK 0 45 0 0 0 62 0 B BLOCK 0 46 0 0 0 21 0 BLOCK 0 47 0 0 0 26 0 B BLOCK 0 48 0 0 0 30 0 B BLOCK 0 49 0 0 0 31 0 B BLOCK 0 50 0 0 0 32 0 B BLOCK 0 51 0 0 0 53 0 B BLOCK 0 52 0 0 0 33 0 B BLOCK 0 53 0 0 0 121 0 B BLOCK 0 54 0 0 0 34 0 B BLOCK 0 55 0 0 0 40 0 B BLOCK 0 56 0 0 0 41 0 B BLOCK 0 57 0 0 0 42 0 B BLOCK 0 58 0 0 0 44 0 B BLOCK 0 59 0 0 0 45 0 B BLOCK 0 60 0 0 0 46 0 B BLOCK 0 61 0 0 0 50 0 B BLOCK 0 62 0 0 0 51 0 B BLOCK 0 63 0 0 0 43 0 B BLOCK 0 64 0 0 0 35 0 B BLOCK 0 65 0 0 0 36 0 B BLOCK 0 66 0 0 0 55 0 B BLOCK 0 67 0 0 0 56 0 B BLOCK 0 68 0 0 0 24 0 B BLOCK 0 69 0 0 0 54 0 B BLOCK 0 71 0 0 0 25 0 B BLOCK 0 423 0 0 0 546 0 B BLOCK 0 131 0 0 0 124 0 B BLOCK 0 132 0 0 0 135 0 B BLOCK 0 133 0 0 0 136 0 B BLOCK 0 70 0 0 0 52 0 B BLOCK B 0 72 0 0 0 71 0 BLOCK 0 73 0 0 0 66 0 B BLOCK 0 74 0 0 0 70 0 B BLOCK 0 75 0 0 0 72 0 B BLOCK 0 76 0 0 0 525 0 B BLOCK 0 77 0 0 0 63 0 B BLOCK 0 78 0 0 0 65 0 B BLOCK 0 79 0 0 0 82 0 B BLOCK 0 80 0 0 0 81 0 B BLOCK 0 81 0 0 0 80 0 B BLOCK 0 82 0 0 0 76 0 B BLOCK 0 83 0 0 0 75 0 B BLOCK 0 84 0 0 0 84 0 B BLOCK 0 85 0 0 0 73 0 B BLOCK 0 86 0 0 0 74 0 B BLOCK 0 87 0 0 0 83 0 B BLOCK 0 88 0 0 0 64 0 B BLOCK 0 89 0 0 0 291 0 B BLOCK 0 90 0 0 0 226 0 B BLOCK 0 91 0 0 0 88 0 B BLOCK 0 92 0 0 0 122 0 B BLOCK 0 93 0 0 0 91 0 B BLOCK 0 94 0 0 0 289 0 B BLOCK 0 95 0 0 0 290 0 B BLOCK 0 96 0 0 0 87 0 B BLOCK 0 97 0 0 0 104 0 B BLOCK 0 98 0 0 0 535 0 B BLOCK 0 99 0 0 0 102 0 B BLOCK 0 100 0 0 0 297 0 B BLOCK 0 101 0 0 0 103 0 BLOCK 0 102 0 0 0 296 0 B BLOCK 0 103 0 0 0 114 0 B BLOCK 0 104 0 0 0 513 0 B BLOCK 0 105 0 0 0 514 0 B BLOCK 0 106 0 0 0 105 0 B BLOCK 0 107 0 0 0 298 0 B BLOCK 0 108 0 0 0 230 0 B BLOCK 0 109 0 0 0 79 0 B BLOCK 0 110 0 0 0 299 0 B BLOCK 0 111 0 0 0 92 0 B BLOCK 0 112 0 0 0 112 0 B BLOCK 0 113 0 0 0 90 0 B BLOCK 0 114 0 0 0 78 0 B BLOCK 0 115 0 0 0 106 0 B BLOCK 0 116 0 0 0 77 0 B BLOCK 0 117 0 0 0 510 0 B BLOCK 0 118 0 0 0 511 0 B BLOCK 0 119 0 0 0 110 0 B BLOCK 0 120 0 0 0 495 0 B BLOCK 0 121 0 0 0 120 0 B BLOCK 0 122 0 0 0 496 0 B BLOCK 0 123 0 0 0 501 0 B BLOCK 0 124 0 0 0 502 0 B BLOCK 0 125 0 0 0 200 0 B BLOCK 0 126 0 0 0 134 0 B BLOCK 0 127 0 0 0 96 0 B BLOCK 0 128 0 0 0 145 0 B BLOCK 0 129 0 0 0 144 0 B BLOCK 0 130 0 0 0 143 0 B BLOCK B 0 134 0 0 0 140 0 BLOCK 0 135 0 0 0 141 0 B BLOCK 0 136 0 0 0 142 0 B BLOCK 0 137 0 0 0 391 0 B BLOCK 0 138 0 0 0 325 0 B BLOCK 0 139 0 0 0 326 0 B BLOCK 0 140 0 0 0 392 0 B BLOCK 0 141 0 0 0 153 0 B BLOCK 0 142 0 0 0 152 0 B BLOCK 0 143 0 0 0 344 0 B BLOCK 0 144 0 0 0 342 0 B BLOCK 0 145 0 0 0 313 0 B BLOCK 0 146 0 0 0 370 0 B BLOCK 0 147 0 0 0 375 0 B BLOCK 0 148 0 0 0 151 0 B BLOCK 0 149 0 0 0 146 0 B BLOCK 0 150 0 0 0 150 0 B BLOCK 0 151 0 0 0 155 0 B BLOCK 0 152 0 0 0 341 0 B BLOCK 0 153 0 0 0 336 0 B BLOCK 0 154 0 0 0 335 0 B BLOCK 0 155 0 0 0 361 0 B BLOCK 0 156 0 0 0 331 0 B BLOCK 0 157 0 0 0 340 0 B BLOCK 0 158 0 0 0 403 0 B BLOCK 0 159 0 0 0 334 0 B BLOCK 0 160 0 0 0 362 0 B BLOCK 0 161 0 0 0 333 0 B BLOCK 0 162 0 0 0 315 0 B BLOCK 0 163 0 0 0 312 0 BLOCK 0 164 0 0 0 316 0 B BLOCK 0 165 0 0 0 311 0 B BLOCK 0 166 0 0 0 323 0 B BLOCK 0 167 0 0 0 322 0 B BLOCK 0 168 0 0 0 324 0 B BLOCK 0 169 0 0 0 332 0 B BLOCK 0 170 0 0 0 161 0 B BLOCK 0 171 0 0 0 193 0 B BLOCK 0 172 0 0 0 174 0 B BLOCK 0 173 0 0 0 175 0 B BLOCK 0 174 0 0 0 194 0 B BLOCK 0 175 0 0 0 165 0 B BLOCK 0 176 0 0 0 166 0 B BLOCK 0 177 0 0 0 186 0 B BLOCK 0 178 0 0 0 185 0 B BLOCK 0 179 0 0 0 173 0 B BLOCK 0 180 0 0 0 191 0 B BLOCK 0 181 0 0 0 192 0 B BLOCK 0 182 0 0 0 170 0 B BLOCK 0 183 0 0 0 172 0 B BLOCK 0 184 0 0 0 171 0 B BLOCK 0 185 0 0 0 163 0 B BLOCK 0 186 0 0 0 184 0 B BLOCK 0 187 0 0 0 182 0 B BLOCK 0 188 0 0 0 181 0 B BLOCK 0 189 0 0 0 190 0 B BLOCK 0 190 0 0 0 176 0 B BLOCK 0 191 0 0 0 183 0 B BLOCK 0 192 0 0 0 195 0 B BLOCK B 0 193 0 0 0 180 0 BLOCK 0 194 0 0 0 156 0 B BLOCK 0 195 0 0 0 215 0 B BLOCK 0 196 0 0 0 213 0 B BLOCK 0 197 0 0 0 276 0 B BLOCK 0 198 0 0 0 238 0 B BLOCK 0 199 0 0 0 239 0 B BLOCK 0 200 0 0 0 240 0 B BLOCK 0 201 0 0 0 212 0 B BLOCK 0 202 0 0 0 241 0 B BLOCK 0 203 0 0 0 243 0 B BLOCK 0 204 0 0 0 242 0 B BLOCK 0 205 0 0 0 265 0 B BLOCK 0 206 0 0 0 266 0 B BLOCK 0 207 0 0 0 244 0 B BLOCK 0 208 0 0 0 245 0 B BLOCK 0 209 0 0 0 254 0 B BLOCK 0 210 0 0 0 250 0 B BLOCK 0 211 0 0 0 251 0 B BLOCK 0 212 0 0 0 257 0 B BLOCK 0 213 0 0 0 258 0 B BLOCK 0 214 0 0 0 263 0 B BLOCK 0 215 0 0 0 256 0 B BLOCK 0 216 0 0 0 246 0 B BLOCK 0 217 0 0 0 247 0 B BLOCK 0 218 0 0 0 253 0 B BLOCK 0 219 0 0 0 252 0 B BLOCK 0 220 0 0 0 259 0 B BLOCK 0 221 0 0 0 260 0 B BLOCK 0 222 0 0 0 261 0 BLOCK 0 223 0 0 0 278 0 B BLOCK 0 224 0 0 0 248 0 B BLOCK 0 225 0 0 0 249 0 B BLOCK 0 226 0 0 0 262 0 B BLOCK 0 227 0 0 0 267 0 B BLOCK 0 228 0 0 0 279 0 B BLOCK 0 229 0 0 0 280 0 B BLOCK 0 230 0 0 0 281 0 B BLOCK 0 231 0 0 0 282 0 B BLOCK 0 232 0 0 0 264 0 B BLOCK 0 233 0 0 0 271 0 B BLOCK 0 234 0 0 0 273 0 B BLOCK 0 235 0 0 0 272 0 B BLOCK 0 236 0 0 0 270 0 B BLOCK 0 237 0 0 0 275 0 B BLOCK 0 238 0 0 0 277 0 B BLOCK 0 239 0 0 0 274 0 B BLOCK 0 240 0 0 0 300 0 B BLOCK 0 241 0 0 0 269 0 B BLOCK 0 242 0 0 0 284 0 B BLOCK 0 243 0 0 0 211 0 B BLOCK 0 244 0 0 0 196 0 B BLOCK 0 245 0 0 0 162 0 B BLOCK 0 246 0 0 0 126 0 B BLOCK 0 247 0 0 0 205 0 B BLOCK 0 248 0 0 0 203 0 B BLOCK 0 249 0 0 0 214 0 B BLOCK 0 250 0 0 0 216 0 B BLOCK 0 251 0 0 0 224 0 B BLOCK B 0 252 0 0 0 133 0 BLOCK 0 253 0 0 0 223 0 B BLOCK 0 254 0 0 0 100 0 B BLOCK 0 255 0 0 0 93 0 B BLOCK 0 256 0 0 0 225 0 B BLOCK 0 257 0 0 0 101 0 B BLOCK 0 258 0 0 0 125 0 B BLOCK 0 259 0 0 0 231 0 B BLOCK 0 260 0 0 0 61 0 B BLOCK 0 261 0 0 0 209 0 B BLOCK 0 262 0 0 0 233 0 B BLOCK 0 263 0 0 0 494 0 B BLOCK 0 264 0 0 0 352 0 B BLOCK 0 265 0 0 0 384 0 B BLOCK 0 266 0 0 0 385 0 B BLOCK 0 267 0 0 0 383 0 B BLOCK 0 268 0 0 0 386 0 B BLOCK 0 269 0 0 0 330 0 B BLOCK 0 270 0 0 0 390 0 B BLOCK 0 271 0 0 0 169 0 B BLOCK 0 272 0 0 0 168 0 B BLOCK 0 273 0 0 0 167 0 B BLOCK 0 274 0 0 0 393 0 B BLOCK 0 275 0 0 0 394 0 B BLOCK 0 276 0 0 0 395 0 B BLOCK 0 277 0 0 0 415 0 B BLOCK 0 278 0 0 0 401 0 B BLOCK 0 279 0 0 0 402 0 B BLOCK 0 280 0 0 0 351 0 B BLOCK 0 281 0 0 0 404 0 BLOCK 0 282 0 0 0 350 0 B BLOCK 0 283 0 0 0 346 0 B BLOCK 0 284 0 0 0 343 0 B BLOCK 0 285 0 0 0 310 0 B BLOCK 0 286 0 0 0 295 0 B BLOCK 0 287 0 0 0 292 0 B BLOCK 0 288 0 0 0 411 0 B BLOCK 0 289 0 0 0 412 0 B BLOCK 0 290 0 0 0 406 0 B BLOCK 0 291 0 0 0 410 0 B BLOCK 0 292 0 0 0 217 0 B BLOCK 0 293 0 0 0 218 0 B BLOCK 0 294 0 0 0 413 0 B BLOCK 0 295 0 0 0 414 0 B BLOCK 0 296 0 0 0 219 0 B BLOCK 0 297 0 0 0 405 0 B BLOCK 0 298 0 0 0 159 0 B BLOCK 0 299 0 0 0 371 0 B BLOCK 0 300 0 0 0 366 0 B BLOCK 0 301 0 0 0 372 0 B BLOCK 0 302 0 0 0 187 0 B BLOCK 0 303 0 0 0 179 0 B BLOCK 0 304 0 0 0 188 0 B BLOCK 0 305 0 0 0 189 0 B BLOCK 0 306 0 0 0 365 0 B BLOCK 0 307 0 0 0 364 0 B BLOCK 0 308 0 0 0 360 0 B BLOCK 0 309 0 0 0 356 0 B BLOCK 0 310 0 0 0 355 0 B BLOCK B 0 311 0 0 0 228 0 BLOCK 0 312 0 0 0 354 0 B BLOCK 0 313 0 0 0 353 0 B BLOCK 0 314 0 0 0 373 0 B BLOCK 0 315 0 0 0 197 0 B BLOCK 0 316 0 0 0 374 0 B BLOCK 0 317 0 0 0 376 0 B BLOCK 0 318 0 0 0 380 0 B BLOCK 0 319 0 0 0 178 0 B BLOCK 0 320 0 0 0 294 0 B BLOCK 0 321 0 0 0 293 0 B BLOCK 0 322 0 0 0 302 0 B BLOCK 0 323 0 0 0 301 0 B BLOCK 0 324 0 0 0 304 0 B BLOCK 0 325 0 0 0 303 0 B BLOCK 0 326 0 0 0 177 0 B BLOCK 0 327 0 0 0 381 0 B BLOCK 0 328 0 0 0 286 0 B BLOCK 0 329 0 0 0 227 0 B BLOCK 0 330 0 0 0 382 0 B BLOCK 0 331 0 0 0 306 0 B BLOCK 0 332 0 0 0 305 0 B BLOCK 0 333 0 0 0 148 0 B BLOCK 0 334 0 0 0 421 0 B BLOCK 0 335 0 0 0 422 0 B BLOCK 0 336 0 0 0 423 0 B BLOCK 0 337 0 0 0 424 0 B BLOCK 0 338 0 0 0 425 0 B BLOCK 0 339 0 0 0 416 0 B BLOCK 0 340 0 0 0 207 0 BLOCK 0 341 0 0 0 426 0 B BLOCK 0 342 0 0 0 430 0 B BLOCK 0 343 0 0 0 139 0 B BLOCK 0 344 0 0 0 138 0 B BLOCK 0 345 0 0 0 435 0 B BLOCK 0 346 0 0 0 431 0 B BLOCK 0 347 0 0 0 432 0 B BLOCK 0 348 0 0 0 433 0 B BLOCK 0 349 0 0 0 434 0 B BLOCK 0 350 0 0 0 420 0 B BLOCK 0 351 0 0 0 147 0 B BLOCK 0 352 0 0 0 442 0 B BLOCK 0 353 0 0 0 444 0 B BLOCK 0 354 0 0 0 445 0 B BLOCK 0 355 0 0 0 446 0 B BLOCK 0 356 0 0 0 450 0 B BLOCK 0 357 0 0 0 451 0 B BLOCK 0 358 0 0 0 440 0 B BLOCK 0 359 0 0 0 436 0 B BLOCK 0 360 0 0 0 452 0 B BLOCK 0 361 0 0 0 453 0 B BLOCK 0 362 0 0 0 454 0 B BLOCK 0 363 0 0 0 455 0 B BLOCK 0 364 0 0 0 463 0 B BLOCK 0 365 0 0 0 456 0 B BLOCK 0 366 0 0 0 460 0 B BLOCK 0 367 0 0 0 461 0 B BLOCK 0 368 0 0 0 462 0 B BLOCK 0 369 0 0 0 441 0 B BLOCK B 0 370 0 0 0 443 0 BLOCK 0 371 0 0 0 470 0 B BLOCK 0 372 0 0 0 128 0 B BLOCK 0 373 0 0 0 127 0 B BLOCK 0 374 0 0 0 471 0 B BLOCK 0 375 0 0 0 472 0 B BLOCK 0 376 0 0 0 473 0 B BLOCK 0 377 0 0 0 208 0 B BLOCK 0 378 0 0 0 474 0 B BLOCK 0 379 0 0 0 475 0 B BLOCK 0 380 0 0 0 476 0 B BLOCK 0 381 0 0 0 480 0 B BLOCK 0 382 0 0 0 483 0 B BLOCK 0 383 0 0 0 118 0 B BLOCK 0 384 0 0 0 117 0 B BLOCK 0 385 0 0 0 481 0 B BLOCK 0 386 0 0 0 482 0 B BLOCK 0 387 0 0 0 465 0 B BLOCK 0 388 0 0 0 484 0 B BLOCK 0 389 0 0 0 97 0 B BLOCK 0 390 0 0 0 98 0 B BLOCK 0 391 0 0 0 466 0 B BLOCK 0 392 0 0 0 464 0 B BLOCK 0 393 0 0 0 129 0 B BLOCK 0 394 0 0 0 492 0 B BLOCK 0 395 0 0 0 493 0 B BLOCK 0 396 0 0 0 491 0 B BLOCK 0 397 0 0 0 490 0 B BLOCK 0 398 0 0 0 486 0 B BLOCK 0 399 0 0 0 485 0 BLOCK 0 400 0 0 0 206 0 B BLOCK 0 401 0 0 0 506 0 B BLOCK 0 402 0 0 0 503 0 B BLOCK 0 403 0 0 0 504 0 B BLOCK 0 404 0 0 0 505 0 B BLOCK 0 405 0 0 0 95 0 B BLOCK 0 406 0 0 0 512 0 B BLOCK 0 407 0 0 0 115 0 B BLOCK 0 408 0 0 0 116 0 B BLOCK 0 409 0 0 0 130 0 B BLOCK 0 410 0 0 0 111 0 B BLOCK 0 411 0 0 0 523 0 B BLOCK 0 412 0 0 0 524 0 B BLOCK 0 413 0 0 0 522 0 B BLOCK 0 414 0 0 0 530 0 B BLOCK 0 415 0 0 0 531 0 B BLOCK 0 416 0 0 0 532 0 B BLOCK 0 417 0 0 0 533 0 B BLOCK 0 418 0 0 0 540 0 B BLOCK 0 419 0 0 0 541 0 B BLOCK 0 420 0 0 0 543 0 B BLOCK 0 421 0 0 0 544 0 B BLOCK 0 422 0 0 0 545 0 [ [CUSTOM VIEWS COUNT] = 0 [EXECUTION STATE] STATE = 2 MAXITER = 0 2398 MAXERROR = 0 BLOCK = 545 CONVERGED = 1 STACK POS = 0 LOOP DEPTH = 0 STACK0 = 0 0 0 1 297578 1 1 1 7 0 0 0 1 0 0 0 0 1 STACK1 = 1 1 0 2398 297578 1 1 1 7 0 5 3 1 0 0 0 0 0 STACK2 = 101 18321416 18490188 2398 297578 1 1 1 7 1 0 0 1 0 0 0 0 0 B STACK3 = 0 0 0 0 0 0 0 0 7 0 0 0 0 0 0 0 0 0 S STACK4 = 0 0 0 0 0 0 0 0 7 0 0 0 0 0 0 0 0 0 ...
View Full Document

This note was uploaded on 08/22/2011 for the course WPS 417 taught by Professor Kirkman during the Spring '11 term at N.C. State.

Page1 / 548

BCFRANKLIN-KRAFT PAPER MILL V2 - [WINGEMS PROJECT HEADER]...

This preview shows document pages 1 - 3. Sign up to view the full document.

View Full Document Right Arrow Icon
Ask a homework question - tutors are online