Unit 3 The Atmosphere

Unit 3 The Atmosphere - 4 The chlorine monoxide molecule is...

Info iconThis preview shows pages 1–2. Sign up to view the full content.

View Full Document Right Arrow Icon
Unit 3: The Atmosphere 1. Composition of the Atmosphere 1. Uniform Gases 1. Oxygen 21% 2. Nitrogen 78% 3. Argon 1% 2. Variable Gases 1. Water Vapor 3-4% 2. Carbon Dioxide .036% 1. Increase contributing to Global Warming 2. The “Greenhouse Effect” 3. Sources of Particulate Matter 1. Natural Sources 1. Volcanic eruptions 2. Natural Fires 3. Windblown sand/pollen 2. Human Caused 1. Automobiles 2. Factory effluentsS 4. Vertical Structure of the Atmosphere 1. 3.6° Fahrenheit for ever thousand degrees you go up. 1. Only in the Troposphere 2. Layers of Atmosphere 1. Troposphere 1. Most living things live in Troposphere 2. Ozone Layer 1. Located in Stratosphere 2. Chlorofluorocarbons(CFC)- propellant 1. Used in air conditioners of cars. 2. Spray paint propellant 3. Sad story of Ozone 1. UV radiation breaks off a Chlorine atom from a CFC molecule 2. The chlorine atom attacks an ozone molecule, breaking it apart and destroying the ozone 3. The result is an ordinary oxygen and a chlorine monoxide molecule
Background image of page 1

Info iconThis preview has intentionally blurred sections. Sign up to view the full version.

View Full DocumentRight Arrow Icon
Background image of page 2
This is the end of the preview. Sign up to access the rest of the document.

Unformatted text preview: 4. The chlorine monoxide molecule is attacked by a free oxygen atom 3. The Stratosphere 1. Some water in the form of ice crystals 4. Mesosphere 5. Thermosphere 6. Exosphere 7. Other Atmospheric Layers 1. Homosphere 1. Within 50 miles of earth’s surface. 2. Uniformly mixed 2. Heterosphere 1. Layered by molecular weight 2. Greater than 50 Miles from Earth’s surface. 3. Ionosphere 1. Deep layer of electricity charged particles. 5. Elements of Weather 1. Temperature 2. Humidity 3. Cloudiness 4. Precipitation 5. Pressure 6. Winds 7. Storms 8. Atmospheric anomalies 6. Elements of Weather and Climate 1. Temperature 2. Moisture 3. Wind 7. Climate Controls 1. Latitude 1. What Temperatures are going to be like. 2. Distribution of Land and Water 1. Oceans moderate temperatures 3. General Atmospheric Circulation 4. General Circulation of the Oceans 5. Altitude 6. Topographic Barriers 7. Storms 8. Earth’s Rotation...
View Full Document

This note was uploaded on 10/02/2011 for the course GEOG 1114 taught by Professor ? during the Fall '08 term at Oklahoma State.

Page1 / 2

Unit 3 The Atmosphere - 4 The chlorine monoxide molecule is...

This preview shows document pages 1 - 2. Sign up to view the full document.

View Full Document Right Arrow Icon
Ask a homework question - tutors are online