Equilibrium Calculations

Learning Objectives

By the end of this module, you will be able to:

  • Write equations representing changes in concentration and pressure for chemical species in equilibrium systems
  • Use algebra to perform various types of equilibrium calculations

We know that at equilibrium, the value of the reaction quotient of any reaction is equal to its equilibrium constant. Thus, we can use the mathematical expression for Q to determine a number of quantities associated with a reaction at equilibrium or approaching equilibrium. While we have learned to identify in which direction a reaction will shift to reach equilibrium, we want to extend that understanding to quantitative calculations. We do so by evaluating the ways that the concentrations of products and reactants change as a reaction approaches equilibrium, keeping in mind the stoichiometric ratios of the reaction. This algebraic approach to equilibrium calculations will be explored in this section.

Changes in concentrations or pressures of reactants and products occur as a reaction system approaches equilibrium. In this section we will see that we can relate these changes to each other using the coefficients in the balanced chemical equation describing the system. We use the decomposition of ammonia as an example.

On heating, ammonia reversibly decomposes into nitrogen and hydrogen according to this equation:


If a sample of ammonia decomposes in a closed system and the concentration of N2 increases by 0.11 M, the change in the N2 concentration, Δ[N2], the final concentration minus the initial concentration, is 0.11 M. The change is positive because the concentration of N2 increases.

The change in the H2 concentration, Δ[H2], is also positive—the concentration of H2 increases as ammonia decomposes. The chemical equation tells us that the change in the concentration of H2 is three times the change in the concentration of N2, because for each mole of N2 produced, 3 moles of H2 are produced.

Δ[H2]=3×Δ[N2]\Delta\left[{\text{H}}_{2}\right]=3\times \Delta\left[{\text{N}}_{2}\right]

=3×(0.11M)=0.33M=3\times \left(0.11M\right)=0.33M

The change in concentration of NH3, Δ[NH3], is twice that of Δ[N2]; the equation indicates that 2 moles of NH3 must decompose for each mole of N2 formed. However, the change in the NH3 concentration is negative because the concentration of ammonia decreases as it decomposes.

Δ[NH3]=2×Δ[N2]=2×(0.11M)=0.22M\Delta\left[{\text{NH}}_{3}\right]=-2\times \Delta\left[{\text{N}}_{2}\right]=-2\times \left(0.11M\right)=-0.22M

We can relate these relationships directly to the coefficients in the equation

2NH3(g)N2(g)+3H2(g)Δ[NH3]=2×Δ[N2]Δ[N2]=0.11MΔ[H2]=3×Δ[N2]\begin{array}{ccccc}{ }2\text{NH}_3\left(g\right)&\rightleftharpoons&\text{N}_2(g)&+&3\text{H}_2\left(g\right)\\ \Delta\left[\text{NH}_3\right]=-2\times\Delta\left[\text{N}_2\right]&{ }&\Delta\left[\text{N}_2\right]=0.11M&{ }&\Delta\left[\text{H}_2\right]=3\times\Delta\left[\text{N}_2\right]\end{array}

Note that all the changes on one side of the arrows are of the same sign and that all the changes on the other side of the arrows are of the opposite sign.

If we did not know the magnitude of the change in the concentration of N2, we could represent it by the symbol x.


The changes in the other concentrations would then be represented as:

Δ[H2]=3×Δ[N2]=3x\Delta\left[{\text{H}}_{2}\right]=3\times \Delta\left[{\text{N}}_{2}\right]=3x

Δ[NH3]=2×Δ[N2]=2x\Delta\left[{\text{NH}}_{3}\right]=-2\times \Delta\left[{\text{N}}_{2}\right]=-2x

The coefficients in the Δ terms are identical to those in the balanced equation for the reaction.

2NH3(g)N2(g)+3H2(g)2xx3x\begin{array}{ccccc}{ }2\text{NH}_3\left(g\right)&\rightleftharpoons&\text{N}_2(g)&+&3\text{H}_2\left(g\right)\\ -2x&{ }&x&{ }&3x\end{array}

The simplest way for us to find the coefficients for the concentration changes in any reaction is to use the coefficients in the balanced chemical equation. The sign of the coefficient is positive when the concentration increases; it is negative when the concentration decreases.

Example 1: Determining Relative Changes in Concentration

Complete the changes in concentrations for each of the following reactions.

  1. C2H2(g)+2Br2(g)C2H2Br4(g)x\begin{array}{ccccc}{\text{C}}_{2}{\text{H}}_{2}\text{(}g\text{)}&+\qquad & 2{\text{Br}}_{2}\text{(}g\text{)}\qquad & \rightleftharpoons& {\text{C}}_{2}{\text{H}}_{2}{\text{Br}}_{4}\text{(}g\text{)}\qquad \\ x\end{array}
  2. I2(aq)+I(aq)I3(aq)x\begin{array}{ccccc}{\text{I}}_{2}\text{(}aq\text{)}&+\qquad & {\text{I}}^{-}\text{(}aq\text{)}\qquad & \rightleftharpoons\qquad & {\text{I}}_{3}{}^{-}\text{(}aq\text{)}\qquad \\ & & & & x \end{array}
  3. C3H8(g)+5O2(g)3CO2(g)+4H2O(g)x\begin{array}{cccccc}{\text{C}}_{3}{\text{H}}_{8}\text{(}g\text{)}&+\qquad & 5{\text{O}}_{2}\text{(}g\text{)}\qquad & \rightleftharpoons\qquad & 3{\text{CO}}_{2}\text{(}g\text{)}+\qquad & 4{\text{H}}_{2}\text{O}\text{(}g\text{)}\qquad \\ x \end{array}

Check Your Learning

Complete the changes in concentrations for each of the following reactions:

  1. 2SO2(g)+O2(g)2SO3(g)x\begin{array}{ccccc}2{\text{SO}}_{2}\text{(}g\text{)}&+\qquad & {\text{O}}_{2}\text{(}g\text{)}\qquad & \rightleftharpoons\qquad & 2{\text{SO}}_{3}\text{(}g\text{)}\qquad \\ & & x & \qquad \end{array}
  2. C4H8(g)2C2H4(g)2x\begin{array}{ccc}{\text{C}}_{4}{\text{H}}_{8}\text{(}g\text{)}\qquad & \rightleftharpoons\qquad & 2{\text{C}}_{2}{\text{H}}_{4}\text{(}g\text{)}\qquad \\ & & -2x\qquad \end{array}
  3. 4NH3(g)+7H2O(g)4NO2(g)+6H2O(g)\begin{array}{ccccccc}4{\text{NH}}_{3}\text{(}g\text{)}&+\qquad & 7{\text{H}}_{2}\text{O}\text{(}g\text{)}\qquad & \rightleftharpoons\qquad & 4{\text{NO}}_{2}\text{(}g\text{)}&+\qquad & 6{\text{H}}_{2}\text{O}\text{(}g\text{)}\end{array}


  1. A reaction is represented by this equation:
    A(aq)+2B(aq)2C(aq)Kc=1×103\text{A}\left(aq\right)+2\text{B}\left(aq\right)\rightleftharpoons2\text{C}\left(aq\right){K}_{c}=1\times {10}^{3}

    1. Write the mathematical expression for the equilibrium constant.
    2. Using concentrations ≤1 M, make up two sets of concentrations that describe a mixture of A, B, and C at equilibrium.

  2. A reaction is represented by this equation:
    2W(aq)X(aq)+2Y(aq)Kc=5×1042\text{W}\left(aq\right)\rightleftharpoons\text{X}\left(aq\right)+2\text{Y}\left(aq\right){K}_{c}=5\times {10}^{-4}

    1. Write the mathematical expression for the equilibrium constant.
    2. Using concentrations of ≤1 M, make up two sets of concentrations that describe a mixture of W, X, and Y at equilibrium.

Calculations Involving Equilibrium Concentrations

Because the value of the reaction quotient of any reaction at equilibrium is equal to its equilibrium constant, we can use the mathematical expression for Qc (i.e., the law of mass action) to determine a number of quantities associated with a reaction at equilibrium. It may help if we keep in mind that Qc = Kc (at equilibrium) in all of these situations and that there are only three basic types of calculations:

  1. Calculation of an equilibrium constant. If concentrations of reactants and products at equilibrium are known, the value of the equilibrium constant for the reaction can be calculated.
  2. Calculation of missing equilibrium concentrations. If the value of the equilibrium constant and all of the equilibrium concentrations, except one, are known, the remaining concentration can be calculated.
  3. Calculation of equilibrium concentrations from initial concentrations. If the value of the equilibrium constant and a set of concentrations of reactants and products that are not at equilibrium are known, the concentrations at equilibrium can be calculated.

A similar list could be generated using QP, KP, and partial pressure. We will look at solving each of these cases in sequence.

Calculation of an Equilibrium Constant

Since the law of mass action is the only equation we have to describe the relationship between Kc and the concentrations of reactants and products, any problem that requires us to solve for Kc must provide enough information to determine the reactant and product concentrations at equilibrium. Armed with the concentrations, we can solve the equation for Kc, as it will be the only unknown.

Example 2 showed us how to determine the equilibrium constant of a reaction if we know the concentrations of reactants and products at equilibrium. The following example shows how to use the stoichiometry of the reaction and a combination of initial concentrations and equilibrium concentrations to determine an equilibrium constant. This technique, commonly called an ICE chart—for Initial, Change, and Equilibrium—will be helpful in solving many equilibrium problems. A chart is generated beginning with the equilibrium reaction in question. Underneath the reaction the initial concentrations of the reactants and products are listed—these conditions are usually provided in the problem and we consider no shift toward equilibrium to have happened. The next row of data is the change that occurs as the system shifts toward equilibrium—do not forget to consider the reaction stoichiometry as described in a previous section of this chapter. The last row contains the concentrations once equilibrium has been reached.

Example 2: Calculation of an Equilibrium Constant

Iodine molecules react reversibly with iodide ions to produce triiodide ions.


If a solution with the concentrations of I2 and I both equal to 1.000 × 10−3M before reaction gives an equilibrium concentration of I2 of 6.61 × 10−4M, what is the equilibrium constant for the reaction?

Check Your Learning

Ethanol and acetic acid react and form water and ethyl acetate, the solvent responsible for the odor of some nail polish removers.


When 1 mol each of C2H5OH and CH3CO2H are allowed to react in 1 L of the solvent dioxane, equilibrium is established when
mol of each of the reactants remains. Calculate the equilibrium constant for the reaction. (Note: Water is not a solvent in this reaction.)


  1. What is the value of the equilibrium constant at 500 °C for the formation of NH3 according to the following equation?

    An equilibrium mixture of NH3(g), H2(g), and N2(g) at 500 °C was found to contain 1.35 M H2, 1.15 M N2, and 4.12 × 10-1M NH3.
  2. Hydrogen is prepared commercially by the reaction of methane and water vapor at elevated temperatures.


    What is the equilibrium constant for the reaction if a mixture at equilibrium contains gases with the following concentrations: CH4, 0.126 M; H2O, 0.242 M; CO, 0.126 M; H2 1.15 M, at a temperature of 760 °C?
  3. A 0.72-mol sample of PCl5 is put into a 1.00-L vessel and heated. At equilibrium, the vessel contains 0.40 mol of PCl3(g) and 0.40 mol of Cl2(g). Calculate the value of the equilibrium constant for the decomposition of PCl5 to PCl3 and Cl2 at this temperature.
  4. At 1 atm and 25 °C, NO2 with an initial concentration of 1.00 M is 3.3 × 10-3% decomposed into NO and O2. Calculate the value of the equilibrium constant for the reaction

  5. Calculate the value of the equilibrium constant KP for the reaction
    from these equilibrium pressures: NO, 0.050 atm; Cl2, 0.30 atm; NOCl, 1.2 atm.
  6. When heated, iodine vapor dissociates according to this equation: 

    At 1274 K, a sample exhibits a partial pressure of I2 of 0.1122 atm and a partial pressure due to I atoms of 0.1378 atm. Determine the value of the equilibrium constant, KP, for the decomposition at 1274 K.
  7. A sample of ammonium chloride was heated in a closed container: 

    At equilibrium, the pressure of NH3(g) was found to be 1.75 atm. What is the value of the equilibrium constant KP for the decomposition at this temperature?
  8. At a temperature of 60 °C, the vapor pressure of water is 0.196 atm. What is the value of the equilibrium constant KP for the transformation at 60 °C?


Calculation of a Missing Equilibrium Concentration

If we know the equilibrium constant for a reaction and know the concentrations at equilibrium of all reactants and products except one, we can calculate the missing concentration.

Example 3: Calculation of a Missing Equilibrium Concentration

Nitrogen oxides are air pollutants produced by the reaction of nitrogen and oxygen at high temperatures. At 2000 °C, the value of the equilibrium constant for the reaction,
, is 4.1 × 10−4. Find the concentration of NO(g) in an equilibrium mixture with air at 1 atm pressure at this temperature. In air, [N2] = 0.036 mol/L and [O2] 0.0089 mol/L.

Check Your Learning

The equilibrium constant for the reaction of nitrogen and hydrogen to produce ammonia at a certain temperature is 6.00 × 10−2. Calculate the equilibrium concentration of ammonia if the equilibrium concentrations of nitrogen and hydrogen are 4.26 M and 2.09 M, respectively.


  1. Analysis of the gases in a sealed reaction vessel containing NH3, N2, and H2 at equilibrium at 400 °C established the concentration of N2 to be 1.2 M and the concentration of H2 to be 0.24 M.

    N2(g)+3H2(g)2NH3(g)Kc=0.50 at 400C{\text{N}}_{2}\left(g\right)+3{\text{H}}_{2}\left(g\right)\rightleftharpoons2{\text{NH}}_{3}\left(g\right){K}_{c}=0.50\text{ at }400^{\circ}\text{C}

    Calculate the equilibrium molar concentration of NH3.
  2. Carbon reacts with water vapor at elevated temperatures.

    C(s)+H2O(g)CO(g)+H2(g)Kc=0.2 at 1000C\text{C}\left(s\right)+{\text{H}}_{2}\text{O}\left(g\right)\rightleftharpoons\text{CO}\left(g\right)+{\text{H}}_{2}\left(g\right){K}_{c}=0.2\text{ at }1000^{\circ}\text{C}

    What is the concentration of CO in an equilibrium mixture with [H2O] = 0.500 M at 1000 °C?
  3. Cobalt metal can be prepared by reducing cobalt(II) oxide with carbon monoxide.

    CoO(s)+CO(g)Co(s)+CO2(g)Kc=4.90×102 at 550C\text{CoO}\left(s\right)+\text{CO}\left(g\right)\rightleftharpoons\text{Co}\left(s\right)+{\text{CO}}_{2}\left(g\right){K}_{c}=4.90\times {10}^{2}\text{ at }550^{\circ}\text{C}

    What concentration of CO remains in an equilibrium mixture with [CO2] = 0.100 M?
  4. A student solved the following problem and found [N2O4] = 0.16 M at equilibrium. How could this student recognize that the answer was wrong without reworking the problem? The problem was: What is the equilibrium concentration of N2O4 in a mixture formed from a sample of NO2 with a concentration of 0.10 M?

  5. A student solved the following problem and found the equilibrium concentrations to be [SO2] = 0.590 M, [O2] = 0.0450 M, and [SO3] = 0.260 M. How could this student check the work without reworking the problem? The problem was: For the following reaction at 600 °C:


    What are the equilibrium concentrations of all species in a mixture that was prepared with [SO3] = 0.500 M, [SO2] = 0 M, and [O2] = 0.350 M

Calculation of Changes in Concentration

If we know the equilibrium constant for a reaction and a set of concentrations of reactants and products that are not at equilibrium, we can calculate the changes in concentrations as the system comes to equilibrium, as well as the new concentrations at equilibrium. The typical procedure can be summarized in four steps.

  1. Determine the direction the reaction proceeds to come to equilibrium.

    1. Write a balanced chemical equation for the reaction.
    2. If the direction in which the reaction must proceed to reach equilibrium is not obvious, calculate Qc from the initial concentrations and compare to Kc to determine the direction of change.

  2. Determine the relative changes needed to reach equilibrium, then write the equilibrium concentrations in terms of these changes.

    1. Define the changes in the initial concentrations that are needed for the reaction to reach equilibrium. Generally, we represent the smallest change with the symbol x and express the other changes in terms of the smallest change.
    2. Define missing equilibrium concentrations in terms of the initial concentrations and the changes in concentration determined in (a).

  3. Solve for the change and the equilibrium concentrations.

    1. Substitute the equilibrium concentrations into the expression for the equilibrium constant, solve for x, and check any assumptions used to find x.
    2. Calculate the equilibrium concentrations.

  4. Check the arithmetic.

    1. Check the calculated equilibrium concentrations by substituting them into the equilibrium expression and determining whether they give the equilibrium constant.
    2. Sometimes a particular step may differ from problem to problem—it may be more complex in some problems and less complex in others. However, every calculation of equilibrium concentrations from a set of initial concentrations will involve these steps.
    3. In solving equilibrium problems that involve changes in concentration, sometimes it is convenient to set up an ICE table, as described in the previous section.

Example 4: Calculation of Concentration Changes as a Reaction Goes to Equilibrium

Under certain conditions, the equilibrium constant for the decomposition of PCl5(g) into PCl3(g) and Cl2(g) is 0.0211. What are the equilibrium concentrations of PCl5, PCl3, and Cl2 if the initial concentration of PCl5 was 1.00 M?

Check Your Learning

Acetic acid, CH3CO2H, reacts with ethanol, C2H5OH, to form water and ethyl acetate, CH3CO2C2H5.


The equilibrium constant for this reaction with dioxane as a solvent is 4.0. What are the equilibrium concentrations when a mixture that is 0.15 M in CH3CO2H, 0.15 M in C2H5OH, 0.40 M in CH3CO2C2H5, and 0.40 M in H2O are mixed in enough dioxane to make 1.0 L of solution?

Check Your Learning

A 1.00-L flask is filled with 1.00 moles of H2 and 2.00 moles of I2. The value of the equilibrium constant for the reaction of hydrogen and iodine reacting to form hydrogen iodide is 50.5 under the given conditions. What are the equilibrium concentrations of H2, I2, and HI in moles/L?



  1. Complete the changes in concentrations (or pressure, if requested) for each of the following reactions.

    1. 2SO3(g)2SO2(g)+O2(g)  +x  0.125M\begin{array}{llll}2{\text{SO}}_{3}\left(g\right)\qquad & \rightleftharpoons\qquad & 2{\text{SO}}_{2}\left(g\right)+\qquad & {\text{O}}_{2}\left(g\right)\qquad \\ \text{ }\qquad & & \text{ }\qquad & +x\qquad \\ \text{ }\qquad & & \text{ }\qquad & 0.125M\qquad \end{array}
    2. 4NH3(g)+3O2(g)2N2(g)+6H2O(g) 3x   0.24M  \begin{array}{lllll}4{\text{NH}}_{3}\left(g\right)\qquad & +3{\text{O}}_{2}\left(g\right)\qquad & \rightleftharpoons\qquad & 2{\text{N}}_{2}\left(g\right)+\qquad & 6{\text{H}}_{2}\text{O}\left(g\right)\qquad \\ \text{ }\qquad & 3x\qquad & & \text{ }\qquad & \text{ }\qquad \\ \text{ }\qquad & 0.24M\qquad & & \text{ }\qquad & \text{ }\qquad \end{array}
    3. Change in pressure:

      2CH4(g)C2H2(g)+3H2(g) x  25torr \begin{array}{llll}2{\text{CH}}_{4}\left(g\right)\qquad & \rightleftharpoons\qquad & {\text{C}}_{2}{\text{H}}_{2}\left(g\right)+\qquad & 3{\text{H}}_{2}\left(g\right)\qquad \\ \text{ }\qquad & & x\qquad & \text{ }\qquad \\ \text{ }\qquad & & 25\text{torr}\qquad & \text{ }\qquad \end{array}
    4. Change in pressure:

      CH4(g)+H2O(g)CO(g)+3H2(g) x   5atm  \begin{array}{lllll}{\text{CH}}_{4}\left(g\right)+\qquad & {\text{H}}_{2}\text{O}\left(g\right)\qquad & \rightleftharpoons\qquad & \text{CO}\left(g\right)+\qquad & 3{\text{H}}_{2}\left(g\right)\qquad \\ \text{ }\qquad & x\qquad & & \text{ }\qquad & \text{ }\qquad \\ \text{ }\qquad & 5\text{atm}\qquad & & \text{ }\qquad & \text{ }\qquad \end{array}
    5. NH4Cl(s)NH3(g)+HCl(g)x 1.03×104M \begin{array}{llll}{\text{NH}}_{4}\text{Cl}\left(s\right)\qquad & \rightleftharpoons\qquad & {\text{NH}}_{3}\left(g\right)+\qquad & \text{HCl}\left(g\right)\qquad \\ & & x\qquad & \text{ }\qquad \\ & & \qquad 1.03\times {10}^{-4}M\qquad & \text{ }\qquad \end{array}
    6. change in pressure:

      Ni(s)+4CO(g)Ni(CO)4(g)4x 0.40atm \begin{array}{cccc}\text{Ni}\left(s\right)+\qquad & 4\text{CO}\left(g\right)\qquad & \rightleftharpoons\qquad & \text{Ni}{\left(\text{CO}\right)}_{4}\left(g\right)\qquad \\ & 4x\qquad & & \text{ }\qquad \\ & \qquad 0.40\text{atm}\qquad & & \text{ }\qquad \end{array}

  2. Complete the changes in concentrations (or pressure, if requested) for each of the following reactions.

    1. 2H2(g)+O2(g)2H2O(g)  +2x  1.50M\begin{array}{cccc}2{\text{H}}_{2}\left(g\right)+\qquad & {\text{O}}_{2}\left(g\right)\qquad & \rightleftharpoons\qquad & 2{\text{H}}_{2}\text{O}\left(g\right)\qquad \\ \text{ }\qquad & \text{ }\qquad & & +2x\qquad \\ \text{ }\qquad & \text{ }\qquad & & 1.50M\qquad \end{array}
    2. CS2(g)+4H2(g)CH4(g)+2H2S(g)x   0.020M   \begin{array}{ccccc}{\text{CS}}_{2}\left(g\right)+\qquad & 4{\text{H}}_{2}\left(g\right)\qquad & \rightleftharpoons\qquad & {\text{CH}}_{4}\left(g\right)+\qquad & 2{\text{H}}_{2}\text{S}\left(g\right)\qquad \\ x\qquad & \text{ }\qquad & & \text{ }\qquad & \text{ }\qquad \\ 0.020M\qquad & \text{ }\qquad & & \text{ }\qquad & \text{ }\qquad \end{array}
    3. Change in pressure:

      H2(g)+Cl2(g)2HCl(g)x  1.50atm  \begin{array}{cccc}{\text{H}}_{2}\left(g\right)+\qquad & {\text{Cl}}_{2}\left(g\right)\qquad & \rightleftharpoons\qquad & 2\text{HCl}\left(g\right)\qquad \\ x\qquad & \text{ }\qquad & & \text{ }\qquad \\ 1.50\text{atm}\qquad & \text{ }\qquad & & \text{ }\qquad \end{array}
    4. Change in pressure:

      2NH3(g)+2O2(g)N2O(g)+3H2O(g)   x   60.6torr\begin{array}{ccccc}2{\text{NH}}_{3}\left(g\right)\qquad & +2{\text{O}}_{2}\left(g\right)\qquad & \rightleftharpoons\qquad & {\text{N}}_{2}\text{O}\left(g\right)+\qquad & 3{\text{H}}_{2}\text{O}\left(g\right)\qquad \\ \text{ }\qquad & \text{ }\qquad & & \text{ }\qquad & x\qquad \\ \text{ }\qquad & \text{ }\qquad & & \text{ }\qquad & 60.6\text{torr}\qquad \end{array}
    5. NH4HS(s)NH3(g)+H2S(g)x 9.8×106M \begin{array}{cccc}{\text{NH}}_{4}\text{HS}\left(s\right)\qquad & \rightleftharpoons\qquad & {\text{NH}}_{3}\left(g\right)+\qquad & {\text{H}}_{2}\text{S}\left(g\right)\qquad \\ & & x\qquad & \text{ }\qquad \\ & & 9.8\times {10}^{-6}M\qquad & \text{ }\qquad \end{array}
    6. Change in pressure:

      Fe(s)+5CO(g)Fe(CO)4(g) x 0.012atm\begin{array}{cccc}\text{Fe}\left(s\right)+\qquad & 5\text{CO}\left(g\right)\qquad & \rightleftharpoons\qquad & \text{Fe}{\left(\text{CO}\right)}_{4}\left(g\right)\qquad \\ & \text{ }\qquad & & x\qquad \\ & \text{ }\qquad & & 0.012\text{atm}\qquad \end{array}

  3. Why are there no changes specified for Ni in question 11 , part (f)? What property of Ni does change?
  4. Why are there no changes specified for NH4HS in question 12, part (e)? What property of NH4HS does change?


  1. Assume that the change in concentration of N2O4 is small enough to be neglected in the following problem.

    1. Calculate the equilibrium concentration of both species in 1.00 L of a solution prepared from 0.129 mol of N2O4 with chloroform as the solvent.

      N2O4(g)2NO2(g)Kc=1.07×105{\text{N}}_{2}{\text{O}}_{4}\left(g\right)\rightleftharpoons2{\text{NO}}_{2}\left(g\right){K}_{c}=1.07\times {10}^{-5}
      in chloroform
    2. Show that the change is small enough to be neglected.

  2. Assume that the change in concentration of COCl2 is small enough to be neglected in the following problem.

    1. Calculate the equilibrium concentration of all species in an equilibrium mixture that results from the decomposition of COCl2 with an initial concentration of 0.3166 M.

      COCl2(g)CO(g)+Cl2(g)Kc=2.2×1010{\text{COCl}}_{2}\left(g\right)\rightleftharpoons\text{CO}\left(g\right)+{\text{Cl}}_{2}\left(g\right){K}_{c}=2.2\times {10}^{-10}
    2. Show that the change is small enough to be neglected.

  3. Assume that the change in pressure of H2S is small enough to be neglected in the following problem.

    1. Calculate the equilibrium pressures of all species in an equilibrium mixture that results from the decomposition of H2S with an initial pressure of 0.824 atm.

      2H2S(g)2H2(g)+S2(g)KP=2.2×1062{\text{H}}_{2}\text{S}\left(g\right)\rightleftharpoons2{\text{H}}_{2}\left(g\right)+{\text{S}}_{2}\left(g\right){K}_{P}=2.2\times {10}^{-6}
    2. Show that the change is small enough to be neglected.

  4. What are all concentrations after a mixture that contains [H2O] = 1.00 M and [Cl2O] = 1.00 M comes to equilibrium at 25 °C?

  5. What are the concentrations of PCl5, PCl3, and Cl2 in an equilibrium mixture produced by the decomposition of a sample of pure PCl5 with [PCl5] = 2.00 M?


Key Concepts and Summary

The ratios of the rate of change in concentrations of a reaction are equal to the ratios of the coefficients in the balanced chemical equation. The sign of the coefficient of X is positive when the concentration increases and negative when it decreases. We learned to approach three basic types of equilibrium problems. When given the concentrations of the reactants and products at equilibrium, we can solve for the equilibrium constant; when given the equilibrium constant and some of the concentrations involved, we can solve for the missing concentrations; and when given the equilibrium constant and the initial concentrations, we can solve for the concentrations at equilibrium.


  1. Calculate the number of moles of HI that are at equilibrium with 1.25 mol of H2 and 1.25 mol of I2 in a 5.00-L flask at 448 °C.

    H2+I22HIKc=50.2 at 448C{\text{H}}_{2}+{\text{I}}_{2}\rightleftharpoons2\text{HI}{K}_{c}=50.2\text{ at }448^{\circ}\text{C}
  2. What is the pressure of BrCl in an equilibrium mixture of Cl2, Br2, and BrCl if the pressure of Cl2 in the mixture is 0.115 atm and the pressure of Br2 in the mixture is 0.450 atm?

    Cl2(g)+Br2(g)2BrCl(g)KP=4.7×102{\text{Cl}}_{2}\left(g\right)+{\text{Br}}_{2}\left(g\right)\rightleftharpoons2\text{BrCl}\left(g\right){K}_{P}=4.7\times {10}^{-2}
  3. What is the pressure of CO2 in a mixture at equilibrium that contains 0.50 atm H2, 2.0 atm of H2O, and 1.0 atm of CO at 990 °C?

    H2(g)+CO2(g)H2O(g)+CO(g)KP=1.6 at 990C{\text{H}}_{2}\left(g\right)+{\text{CO}}_{2}\left(g\right)\rightleftharpoons{\text{H}}_{2}\text{O}\left(g\right)+\text{CO}\left(g\right){K}_{P}=1.6\text{ at }990^{\circ}\text{C}
  4. Sodium sulfate 10-hydrate, Na2SO4
    10H2O, dehydrates according to the equation

    Na2SO410H2O(s)Na2SO4(s)+10H2O(g)KP=4.08×1025 at 25C{\text{Na}}_{2}{\text{SO}}_{4}\cdot 10{\text{H}}_{2}\text{O}\left(s\right)\rightleftharpoons{\text{Na}}_{2}{\text{SO}}_{4}\left(s\right)+10{\text{H}}_{2}\text{O}\left(g\right){K}_{P}=4.08\times {10}^{-25}\text{ at }25^{\circ}\text{C}

    What is the pressure of water vapor at equilibrium with a mixture of Na2SO4
    10H2O and NaSO4?
  5. Calcium chloride 6-hydrate, CaCl2
    6H2O, dehydrates according to the equation

    CaCl26H2O(s)CaCl2(s)+6H2O(g)KP=5.09×1044 at 25C{\text{CaCl}}_{2}\cdot 6{\text{H}}_{2}\text{O}\left(s\right)\rightleftharpoons{\text{CaCl}}_{2}\left(s\right)+6{\text{H}}_{2}\text{O}\left(g\right){K}_{P}=5.09\times {10}^{-44}\text{ at }25^{\circ}\text{C}

    What is the pressure of water vapor at equilibrium with a mixture of CaCl2
    6H2O and CaCl2?
  6. Calculate the pressures of all species at equilibrium in a mixture of NOCl, NO, and Cl2 produced when a sample of NOCl with a pressure of 0.500 atm comes to equilibrium according to this reaction:

    2NOCl(g)2NO(g)+Cl2(g)KP=4.0×1042\text{NOCl}\left(g\right)\rightleftharpoons 2\text{NO}\left(g\right)+{\text{Cl}}_{2}\left(g\right){K}_{P}=4.0\times {10}^{-4}
  7. Calculate the equilibrium concentrations of NO, O2, and NO2 in a mixture at 250 °C that results from the reaction of 0.20 M NO and 0.10 M O2. (Hint: K is large; assume the reaction goes to completion then comes back to equilibrium.)

    2NO(g)+O2(g)2NO2(g)Kc=2.3×105 at 250C2\text{NO}\left(g\right)+{\text{O}}_{2}\left(g\right)\rightleftharpoons2{\text{NO}}_{2}\left(g\right){K}_{c}=2.3\times {10}^{5}\text{ at }250^{\circ}\text{C}
  8. Calculate the equilibrium concentrations that result when 0.25 M O2 and 1.0 M HCl react and come to equilibrium. (Hint: Kc is large; assume the reaction goes to completion, then comes back to equilibrium.)

    4HCl(g)+O2(g)2Cl2(g)+2H2O(g)Kc=3.1×10134\text{HCl}\left(g\right)+{\text{O}}_{2}\left(g\right)\rightleftharpoons2{\text{Cl}}_{2}\left(g\right)+2{\text{H}}_{2}\text{O}\left(g\right){K}_{c}=3.1\times {10}^{13}
  9. One of the important reactions in the formation of smog is represented by the equation

    O3(g)+NO(g)NO2(g)+O2(g)KP=6.0×1034{\text{O}}_{3}\left(g\right)+\text{NO}\left(g\right)\rightleftharpoons{\text{NO}}_{2}\left(g\right)+{\text{O}}_{2}\left(g\right){K}_{P}=6.0\times {10}^{34}

    What is the pressure of O3 remaining after a mixture of O3 with a pressure of 1.2 × 10-8 atm and NO with a pressure of 1.2 × 10-8 atm comes to equilibrium? (Hint: KP is large; assume the reaction goes to completion then comes back to equilibrium.)
  10. Calculate the pressures of NO, Cl2, and NOCl in an equilibrium mixture produced by the reaction of a starting mixture with 4.0 atm NO and 2.0 atm Cl2. (Hint: KP is small; assume the reverse reaction goes to completion then comes back to equilibrium.)
  11. Calculate the number of grams of HI that are at equilibrium with 1.25 mol of H2 and 63.5 g of iodine at 448 °C.

    H2+I22HIKc=50.2 at 448C{\text{H}}_{2}+{\text{I}}_{2}\rightleftharpoons2\text{HI}{K}_{c}=50.2\text{ at }448^{\circ}\text{C}
  12. Butane exists as two isomers, n-butane and isobutane.

    Three Lewis structures are shown. The first is labeled, “n dash Butane,” and has a C H subscript 3 single bonded to a C H subscript 2 group. This C H subscript 2 group is single bonded to another C H subscript 2 group which is single bonded to a C H subscript 3 group. The second is labeled, “iso dash Butane,” and is composed of a C H group single bonded to three C H subscript 3 groups. The third structure shows a chain of atoms: “C H subscript 3, C H subscript 2, C H subscript 2, C H subscript 3,” a double-headed arrow, then a carbon atom single bonded to three C H subscript 3 groups as well as a hydrogen atom. KP = 2.5 at 25 °CWhat is the pressure of isobutane in a container of the two isomers at equilibrium with a total pressure of 1.22 atm?
  13. What is the minimum mass of CaCO3 required to establish equilibrium at a certain temperature in a 6.50-L container if the equilibrium constant (Kc) is 0.050 for the decomposition reaction of CaCO3 at that temperature?

  14. The equilibrium constant (Kc) for this reaction is 1.60 at 990 °C: 

    Calculate the number of moles of each component in the final equilibrium mixture obtained from adding 1.00 mol of H2, 2.00 mol of CO2, 0.750 mol of H2O, and 1.00 mol of CO to a 5.00-L container at 990 °C.


  1. At 25 °C and at 1 atm, the partial pressures in an equilibrium mixture of N2O4 and NO2 are

    1. Predict how the pressures of NO2 and N2O4 will change if the total pressure increases to 9.0 atm. Will they increase, decrease, or remain the same?
    2. Calculate the partial pressures of NO2 and N2O4 when they are at equilibrium at 9.0 atm and 25 °C.

  2. In a 3.0-L vessel, the following equilibrium partial pressures are measured: N2, 190 torr; H2, 317 torr; NH3, 1.00 × 103 torr: 